summaryrefslogtreecommitdiff
path: root/include/apr.hnw
Commit message (Expand)AuthorAgeFilesLines
* Define a printf format and format length for apr_uint64_t.brane2003-03-181-0/+3
* Rebalance our exposed headers such that everything is nested properlywrowe2003-03-051-39/+60
* Several problems here; licenses were missing, and generally consistifywrowe2003-02-161-13/+22
* Moved the APP_DATA structure and other private elements to apr_private.hbnicholes2003-02-071-14/+0
* Removed some unnecessary #defines from apr.hnwbnicholes2003-01-271-16/+0
* Remove the stat info caching for NetWarebnicholes2003-01-141-2/+0
* Catch up on some new apr.h.in flags for consistency.wrowe2003-01-131-1/+8
* Change to the correct 64-bit format string.bnicholes2003-01-021-1/+1
* Update copyright notices to 2003.thommay2003-01-011-1/+1
* Moving the application global data management structure to APR.hnw tobnicholes2002-12-021-3/+18
* Getting ready to build for IPV6 on NetWarebnicholes2002-09-031-0/+4
* Out of time and at the end of my config-foo. This should get us thewrowe2002-08-031-0/+4
* Features, not platforms, correct?wrowe2002-08-021-0/+4
* NetWare has strtoll()bnicholes2002-07-291-0/+1
* Changed APR_HAS_XLATE within apr to an APR_HAVE_ICONV feature test.wrowe2002-07-171-2/+2
* Move UUID. Not the simplest thing in the world. Note that almostwrowe2002-07-171-0/+1
* Allows the internal socket netmask of the accepted socket to initialize itselfbnicholes2002-06-071-0/+8
* Added the IPv6 header for NetWarebnicholes2002-05-311-0/+4
* All of NetWare's locks are globalbnicholes2002-05-021-1/+1
* systems where sigsuspend() is used in lieu of sigwait() needtrawick2002-04-111-0/+1
* Fixed the inlining for NetWarebnicholes2002-03-261-2/+2
* Address several issues. c_is_fnchar must be namespace protected [forwrowe2002-03-221-0/+1
* Back out some over-engineering. We use pid_t throughout - and thiswrowe2002-03-161-1/+1
* Switched to the new winsock header for NetWarebnicholes2002-03-141-1/+1
* Update our copyright for this year.fielding2002-03-131-1/+1
* Per Aaron's consent that there is no more rational way to optimize thiswrowe2002-02-221-0/+2
* Getting ready for some API name changes in the NetWare librariesbnicholes2002-02-081-2/+2
* Sync'ed up the #define's with other platformsbnicholes2002-02-061-5/+18
* Added the implementation of apr_generate_random_bytes()bnicholes2002-01-281-1/+1
* Clean up GNU compiler issues on NetWarebnicholes2001-12-111-1/+5
* Resync'ed and cleanup the NetWare version of APR.hbnicholes2001-11-191-52/+17
* Apr.h for NetWarebnicholes2001-10-161-0/+342