summaryrefslogtreecommitdiff
path: root/include/apr.hnw
Commit message (Expand)AuthorAgeFilesLines
* Add APR_DSOPATH to allow us to inspect the current working dso path varwrowe2008-05-211-0/+2
* Leverage the new apr_uintptr_t type for our ULONG_PTR members.wrowe2008-05-021-0/+6
* Perhaps smaller than long, perhaps larger than long,wrowe2007-10-241-0/+2
* Define apr_ino_t in such a way that it doesn't change definitionwrowe2007-10-241-0/+1
* Backport revision 560480 from the eventset branch:davi2007-08-061-0/+11
* Introduce macro definitions of the min/max characteristics of the apr integerdavi2007-07-091-3/+57
* Fix the typo.jorton2006-08-031-1/+1
* Update license header.jorton2006-08-031-6/+6
* Add APR_HAVE_IOVEC to the NetWare apr.h headerbnicholes2006-07-121-0/+1
* Remove an unnecessary #definebnicholes2006-05-091-1/+0
* Update remaining 2004 copyright notices.jorton2005-06-141-1/+2
* Allow Apache on NetWare to build using either the standard socket libraries o...bnicholes2005-04-141-4/+25
* Added apr_procattr_user_set and apr_procattr_group_set to allow setting uid/g...mturk2005-01-161-0/+2
* WIN64: update pools code for 64 bit compilesake2004-10-071-1/+0
* clarify APR_DWORD_MAXake2004-10-011-1/+1
* replaced define for DWORD_MAX with APR_DWORD_MAXclar2004-09-281-1/+1
* added define for DWORD_MAXclar2004-09-241-0/+1
* Move APR_INT64_STRFN to apr_private.h and remove redundantjorton2004-06-041-4/+0
* Increase the default for FD_SETSIZE on Netwarebnicholes2004-03-161-0/+2
* Relicense.jorton2004-02-281-49/+10
* Clean up some 32 bit/64 bit type incompatibilities that cause problems when l...bnicholes2003-12-151-1/+5
* large file support is causing problems with acrobat reader and PDF files. Tu...bnicholes2003-12-131-1/+5
* Use the correct literal typing for NetWarebnicholes2003-11-251-6/+0
* Puzzle for the day, how does sha2.c compile already on Win32 or Netware.wrowe2003-11-171-0/+4
* With the exception of some intersting(1) output from testall random2,wrowe2003-11-161-1/+3
* Enable large file support for NetWarebnicholes2003-10-171-2/+2
* Implement apr_socket_atmark, similar to socket_atmark except 1) it'swrowe2003-10-141-0/+1
* * configure.in, include/apr.h.in, include/apr.hw, include/apr.hnw:jorton2003-10-011-3/+0
* * configure.in, build/apr_network.m4: Remove APR_INADDR_NONEjorton2003-10-011-5/+0
* implement APR_UINT64_T_HEX_FMTtrawick2003-04-151-0/+2
* Fix for multiple fixes to __attribute__ which conflicts for 3rd partywrowe2003-03-231-0/+2
* Define a printf format and format length for apr_uint64_t.brane2003-03-181-0/+3
* Rebalance our exposed headers such that everything is nested properlywrowe2003-03-051-39/+60
* Several problems here; licenses were missing, and generally consistifywrowe2003-02-161-13/+22
* Moved the APP_DATA structure and other private elements to apr_private.hbnicholes2003-02-071-14/+0
* Removed some unnecessary #defines from apr.hnwbnicholes2003-01-271-16/+0
* Remove the stat info caching for NetWarebnicholes2003-01-141-2/+0
* Catch up on some new apr.h.in flags for consistency.wrowe2003-01-131-1/+8
* Change to the correct 64-bit format string.bnicholes2003-01-021-1/+1
* Update copyright notices to 2003.thommay2003-01-011-1/+1
* Moving the application global data management structure to APR.hnw tobnicholes2002-12-021-3/+18
* Getting ready to build for IPV6 on NetWarebnicholes2002-09-031-0/+4
* Out of time and at the end of my config-foo. This should get us thewrowe2002-08-031-0/+4
* Features, not platforms, correct?wrowe2002-08-021-0/+4
* NetWare has strtoll()bnicholes2002-07-291-0/+1
* Changed APR_HAS_XLATE within apr to an APR_HAVE_ICONV feature test.wrowe2002-07-171-2/+2
* Move UUID. Not the simplest thing in the world. Note that almostwrowe2002-07-171-0/+1
* Allows the internal socket netmask of the accepted socket to initialize itselfbnicholes2002-06-071-0/+8
* Added the IPv6 header for NetWarebnicholes2002-05-311-0/+4
* All of NetWare's locks are globalbnicholes2002-05-021-1/+1