summaryrefslogtreecommitdiff
path: root/ldap
Commit message (Expand)AuthorAgeFilesLines
* Correct the use-case checking to determine our ldap[ssl]_[ssl]init()wrowe2005-09-012-1/+5
* We were missing some glue.wrowe2005-06-231-0/+1
* Added the option APR_LDAP_OPT_VERIFY_CERT to the apr_ldap_set_option()bnicholes2005-05-111-0/+42
* * apr-util/ldap/NWGNUmakefilend2005-04-231-260/+260
* NetWare makefile to build apu-ldap as a librarybnicholes2005-04-141-0/+260
* Update copyright year to 2005 and standardize on current copyright owner line.jerenkrantz2005-02-043-3/+6
* Make sure that we return some type of LDAP error if the initialization fails ...bnicholes2005-02-011-2/+8
* Fix a build problem on Solaris v2.9 - Solaris SDK has no LDAP_OPT_SSL.minfrin2005-01-211-2/+5
* The Mozilla SDK has a different vendor string to the Netscape and Solarisminfrin2005-01-211-3/+3
* Solaris v2.9's LDAP is a repackaged Netscape/Mozilla SDK. Detect and handleminfrin2005-01-211-27/+21
* Use the ldapssl_init(host,port,0) function on Novell to init LDAP connections.minfrin2005-01-212-8/+3
* Add another certificate format type for the Novell LDAP SDKbnicholes2005-01-201-0/+12
* Remove an inconsistency in the function defintion that causes the build tominfrin2005-01-201-2/+2
* Remove a stray return statement.minfrin2005-01-201-1/+0
* Correct the return types for the set_option sub functions - they shouldminfrin2005-01-201-2/+2
* Fix build errors for Win32.minfrin2005-01-201-5/+3
* Change the parameter passed to set SSL certificates from a linked listminfrin2005-01-191-28/+31
* Add support for Netscape client certificates.minfrin2005-01-181-1/+15
* * ldap/apr_ldap_option.c: Code style cleanup throughout, no functionaljorton2005-01-131-152/+135
* * ldap/apr_ldap_option.c (option_set_tls, option_set_cert): Fix gccjorton2005-01-131-11/+12
* Remove the call to ldapssl_install_routines for the Novell SDK. Do to the wa...bnicholes2005-01-101-8/+8
* -Since the apr_ldap_opt_tls_cert_t* structure is call be used as a linked lis...bnicholes2005-01-101-2/+11
* LDAP: Move all certificate initialisation, and the creation of SSLminfrin2005-01-082-312/+478
* Fix the eol-style. Remove some stray CRs.minfrin2005-01-061-7/+7
* Add the ability to detect the flavour of the LDAP toolkit within configure,minfrin2005-01-061-201/+183
* Attempt to keep up with non-uniform #includes. Make consistent to thewrowe2005-01-051-6/+7
* Quit using unique #include conventions. Also solve misc Win32 (possiblywrowe2005-01-052-9/+9
* Implement the startTLS functionality for Novell LDAP SDKbnicholes2005-01-051-1/+16
* The Microsoft version of the ldap_start_tls_s() function has 5 parametersminfrin2005-01-051-1/+1
* Teach apr_ldap_init() how to handle STARTTLS in addition to the existingminfrin2005-01-052-8/+155
* Rework the LDAP toolkit detection to be more accurate than "OpenLDAPminfrin2004-12-201-113/+201
* Added the apr_ldap_ssl_add_cert() API to allow multiple certificates to be st...bnicholes2004-12-151-1/+44
* Remove .cvsignore files.jorton2004-11-181-3/+0
* Fix a parsing problem with the LDAP URL where it was truncating the host port...bnicholes2004-10-251-4/+3
* Fix compiler warnings:jorton2004-08-262-1/+4
* fix typo in log messagetrawick2004-08-231-1/+1
* Fix a segfault on NetWare and give a better reason why SSL support didn't ini...bnicholes2004-08-231-0/+5
* Win32 LDAP SDK fixesbnicholes2004-08-092-1/+6
* Add the apr_ldap_info() prototype and reverse the parameter order to match th...bnicholes2004-08-051-3/+2
* Fix a compile problem - ldap_url_parse_ext should be apr_ldap_url_parse_ext().minfrin2004-08-031-1/+1
* Make the order of the arguments consistent with idea of the pool beingminfrin2004-08-031-4/+4
* Overhaul support for LDAP URL parsing. Instead of using incompatibleminfrin2004-08-031-207/+168
* Begone foul fooness. We now only support LDAP v3.0 SDKs, so apr_ldap_compatminfrin2004-08-031-48/+0
* Remove support for LDAP v2.0 SDK toolkits. This will be addedminfrin2004-08-031-24/+4
* Add a note to indicate deprecated code in APR v1.0. This code will be fixedminfrin2004-08-022-0/+14
* Add an apr_ldap_err_t structure to handle the return of LDAPminfrin2004-08-011-37/+54
* Clean up for the Novell and Netscape SDKsbnicholes2004-07-301-6/+6
* Add APR functions to do the job of ldap_init(), hiding toolkitminfrin2004-07-301-0/+254
* Relicense APR under Apache License, Version 2.0.jerenkrantz2004-02-132-98/+20
* First whack at switching to a single top-level make. This adds a dependencygstein2004-02-051-8/+0