summaryrefslogtreecommitdiff
path: root/ldap
Commit message (Expand)AuthorAgeFilesLines
* Turn off the DSO build for netware and revert the previous changes that tried...bnicholes2008-11-251-3/+1
* Fix apu_dso_load() for netware. Make sure that the search for the apr global...bnicholes2008-11-251-1/+1
* Add apr_ldap_stub.c to the netware buildbnicholes2008-11-241-0/+1
* Expose the apr_dso_handle_t when calling apu_dso_load, so that theminfrin2008-09-071-1/+1
* Older OpenLDAP implementations may have ldap_set_rebind_proc() with two args.bojan2008-06-161-1/+18
* * Fix some gcc compiler warnings on Solaris with the Solaris LDAP SDKrpluem2008-06-042-1/+4
* With DSO's 'moving out' the reservation for apr-util is a bitwrowe2008-05-301-8/+8
* Plug in loadable ldap build for win32wrowe2008-05-301-0/+227
* Export the __fns array with an APU_MODULE_DECLARE_DATA,wrowe2008-05-301-1/+1
* Misdeclared loaded ldap functionwrowe2008-05-301-5/+5
* Turn off the APU DSO functionality so that NetWare continues to build as a si...bnicholes2008-05-231-0/+1
* Fix ifdef tests where the flags are booleans.wrowe2008-05-233-4/+4
* Clean all lingering maintainer mode emits, and drop apu_dso_init fromwrowe2008-05-231-1/+0
* Introduce an internal apu_dso API for loading modular components into thewrowe2008-05-222-0/+168
* Add new APU_DECLARE_LDAP macro to wrap the private build of thesewrowe2008-05-213-23/+48
* Add support for OpenLDAP's ability to support a directory ofminfrin2008-05-011-0/+7
* Static global variables are bad on NetWare. Move them into the library applic...bnicholes2008-04-091-4/+59
* LDAP_OPT_REFHOPLIMIT not supported for the Novell LDAP SDKbnicholes2008-04-091-1/+1
* Ensure that the LDAP code can compile cleanly on platforms that dominfrin2008-03-241-3/+5
* Fix the setting of LDAP_OPT_SSL on Win2k, which expects a pointer tominfrin2008-03-231-2/+4
* Add a couple of options to apr_ldap_set_option (APR_LDAP_OPT_REFERALS,bnicholes2008-01-181-0/+36
* Make sure the rebind C source only appears when LDAP is detected.minfrin2007-12-071-0/+3
* Add an LDAP rebind implementation so that authentication can beminfrin2007-12-072-0/+267
* Support Tivoli ITDS LDAP client library, without SSL supporttrawick2007-07-311-4/+3
* Update license headers.jerenkrantz2007-01-153-18/+18
* Correct the use-case checking to determine our ldap[ssl]_[ssl]init()wrowe2005-09-012-1/+5
* We were missing some glue.wrowe2005-06-231-0/+1
* Added the option APR_LDAP_OPT_VERIFY_CERT to the apr_ldap_set_option()bnicholes2005-05-111-0/+42
* * apr-util/ldap/NWGNUmakefilend2005-04-231-260/+260
* NetWare makefile to build apu-ldap as a librarybnicholes2005-04-141-0/+260
* Update copyright year to 2005 and standardize on current copyright owner line.jerenkrantz2005-02-043-3/+6
* Make sure that we return some type of LDAP error if the initialization fails ...bnicholes2005-02-011-2/+8
* Fix a build problem on Solaris v2.9 - Solaris SDK has no LDAP_OPT_SSL.minfrin2005-01-211-2/+5
* The Mozilla SDK has a different vendor string to the Netscape and Solarisminfrin2005-01-211-3/+3
* Solaris v2.9's LDAP is a repackaged Netscape/Mozilla SDK. Detect and handleminfrin2005-01-211-27/+21
* Use the ldapssl_init(host,port,0) function on Novell to init LDAP connections.minfrin2005-01-212-8/+3
* Add another certificate format type for the Novell LDAP SDKbnicholes2005-01-201-0/+12
* Remove an inconsistency in the function defintion that causes the build tominfrin2005-01-201-2/+2
* Remove a stray return statement.minfrin2005-01-201-1/+0
* Correct the return types for the set_option sub functions - they shouldminfrin2005-01-201-2/+2
* Fix build errors for Win32.minfrin2005-01-201-5/+3
* Change the parameter passed to set SSL certificates from a linked listminfrin2005-01-191-28/+31
* Add support for Netscape client certificates.minfrin2005-01-181-1/+15
* * ldap/apr_ldap_option.c: Code style cleanup throughout, no functionaljorton2005-01-131-152/+135
* * ldap/apr_ldap_option.c (option_set_tls, option_set_cert): Fix gccjorton2005-01-131-11/+12
* Remove the call to ldapssl_install_routines for the Novell SDK. Do to the wa...bnicholes2005-01-101-8/+8
* -Since the apr_ldap_opt_tls_cert_t* structure is call be used as a linked lis...bnicholes2005-01-101-2/+11
* LDAP: Move all certificate initialisation, and the creation of SSLminfrin2005-01-082-312/+478
* Fix the eol-style. Remove some stray CRs.minfrin2005-01-061-7/+7
* Add the ability to detect the flavour of the LDAP toolkit within configure,minfrin2005-01-061-201/+183