summaryrefslogtreecommitdiff
Commit message (Expand)AuthorAgeFilesLines
* Update READMEDHCP-971122Ted Lemon1997-11-221-38/+49
* Add a caveat that this doesn't include everythingTed Lemon1997-11-221-0/+6
* Update release notes (lose obsolete cruft about old lease database formats)Ted Lemon1997-11-221-189/+42
* new catted man pageTed Lemon1997-11-221-42/+42
* Document -q. Fix typos/pastos. Reword some bad stuff. Fix SEE ALSOTed Lemon1997-11-221-4/+15
* Daemonize by default. Fix a couple of uninitialized automatic variables. ...Ted Lemon1997-11-221-17/+59
* Name server definitionsTed Lemon1997-11-221-0/+237
* Override default value for _PATH_DHCRELAY_PIDTed Lemon1997-11-229-2/+27
* Set a default value for _PATH_DHCRELAY_PIDTed Lemon1997-11-221-0/+4
* Fix typo in comment.Ted Lemon1997-11-221-2/+2
* new catted man pageTed Lemon1997-11-221-6/+6
* new catted man pagesTed Lemon1997-11-222-782/+320
* Add dhcpd.leases man page. Globalize sed scripts on man pages.Ted Lemon1997-11-221-5/+13
* new catted man pagesTed Lemon1997-11-221-12/+540
* Fix errors mentioned by cgd. s/dhcp(5)/dhcp-options(5)/ Fix SEE ALSO.Ted Lemon1997-11-221-18/+21
* Move BUGS up. Add FILES section documenting location of script files in dis...Ted Lemon1997-11-221-3/+10
* globalize sed commands on man pagesTed Lemon1997-11-221-6/+6
* catted man page for nroff-less systemsTed Lemon1997-11-222-0/+594
* catted man pages, for machines that don't have troff/nroffTed Lemon1997-11-222-0/+330
* DHCP lease database descriptionTed Lemon1997-11-221-0/+82
* Build and install dhclient.leases man pageTed Lemon1997-11-221-2/+18
* DHCP Client lease database descriptionTed Lemon1997-11-221-0/+62
* Don't echo ifconfig parameters - that was for debugging.Ted Lemon1997-11-223-3/+0
* DHCP client configuration scriptTed Lemon1997-11-221-0/+184
* Write an actual manual pageTed Lemon1997-11-221-4/+481
* Add prototype for broadcast_addr()Ted Lemon1997-11-221-0/+1
* Add broadcast_addr function which produces the broadcast address of a subnet ...Ted Lemon1997-11-221-0/+24
* Move dhcp option documentation to dhcp-options(5)Ted Lemon1997-11-221-409/+15
* Build and install dhcp-options.5Ted Lemon1997-11-211-6/+14
* Documentation for DHCP option declaration syntaxTed Lemon1997-11-211-0/+451
* bsd/os client script (pretty much identical to NetBSD)Ted Lemon1997-11-201-0/+175
* Check if variables have value before doing set $variableTed Lemon1997-11-202-88/+116
* Don't need to compute network number or broadcast address anymoreTed Lemon1997-11-201-10/+0
* Compute network number and (if not offered by server) broadcast address for l...Ted Lemon1997-11-201-1/+41
* Fix up referencesTed Lemon1997-10-291-2/+1
* fix up nameTed Lemon1997-10-292-2/+2
* Support hostname keywordTed Lemon1997-10-291-1/+3
* Fix up handling of hostnameTed Lemon1997-10-271-2/+7
* Fix up handling of hostnameTed Lemon1997-10-271-2/+2
* Fix spellingTed Lemon1997-10-271-2/+2
* Don't ping static leases - there's no persistent structure for them!NetBSD_1_3_AlphaTed Lemon1997-10-201-2/+2
* Add notice of 2.0.31 release of LinuxTed Lemon1997-10-201-0/+7
* systat -> sysconfTed Lemon1997-10-207-76/+76
* systat -> sysconfTed Lemon1997-10-203-20/+20
* System Configuration notification protocolTed Lemon1997-10-201-0/+52
* Use local quiet flag and also set global quiet_interface_discovery flag with ...Ted Lemon1997-10-201-4/+5
* Add quiet_interface_discovery variableTed Lemon1997-10-201-0/+1
* Define quiet_interface_discovery. Don't consider EAGAIN or EINTR to be fata...Ted Lemon1997-10-201-3/+8
* Don't print startup banner if quiet_interface_discovery is setTed Lemon1997-10-205-59/+69
* Document -q flagTed Lemon1997-10-201-0/+9
View Lorry Controller Status