Readline-2.0 import: initial import

64 files changed, 37942 insertions, 0 deletions

diff --git a/COPYING b/COPYING
new file mode 100644
index 0000000..1bb82d1
--- /dev/null
+++ b/COPYING
@@ -0,0 +1,257 @@
+
+		    GNU GENERAL PUBLIC LICENSE
+		     Version 1, February 1989
+
+ Copyright (C) 1989 Free Software Foundation, Inc.
+		    675 Mass Ave, Cambridge, MA 02139, USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+The Free Software Foundation has exempted Bash from the requirement of
+Paragraph 2c of the General Public License.  This is to say, there is
+no requirement for Bash to print a notice when it is started
+interactively in the usual way.	 We made this exception because users
+and standards expect shells not to print such messages.	 This
+exception applies to any program that serves as a shell and that is
+based primarily on Bash as opposed to other GNU software.
+
+			    Preamble
+
+  The license agreements of most software companies try to keep users
+at the mercy of those companies.  By contrast, our General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users.	The
+General Public License applies to the Free Software Foundation's
+software and to any other program whose authors commit to using it.
+You can use it for your programs, too.
+
+  When we speak of free software, we are referring to freedom, not
+price.	Specifically, the General Public License is designed to make
+sure that you have the freedom to give away or sell copies of free
+software, that you receive source code or can get it if you want it,
+that you can change the software or use pieces of it in new free
+programs; and that you know you can do these things.
+
+  To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+  For example, if you distribute copies of a such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have.  You must make sure that they, too, receive or can get the
+source code.  And you must tell them their rights.
+
+  We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+  Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software.  If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.
+
+		    GNU GENERAL PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. This License Agreement applies to any program or other work which
+contains a notice placed by the copyright holder saying it may be
+distributed under the terms of this General Public License.  The
+"Program", below, refers to any such program or work, and a "work based
+on the Program" means either the Program or any work containing the
+Program or a portion of it, either verbatim or with modifications.  Each
+licensee is addressed as "you".
+
+  1. You may copy and distribute verbatim copies of the Program's source
+code as you receive it, in any medium, provided that you conspicuously and
+appropriately publish on each copy an appropriate copyright notice and
+disclaimer of warranty; keep intact all the notices that refer to this
+General Public License and to the absence of any warranty; and give any
+other recipients of the Program a copy of this General Public License
+along with the Program.	 You may charge a fee for the physical act of
+transferring a copy.
+
+  2. You may modify your copy or copies of the Program or any portion of
+it, and copy and distribute such modifications under the terms of Paragraph
+1 above, provided that you also do the following:
+
+    a) cause the modified files to carry prominent notices stating that
+    you changed the files and the date of any change; and
+
+    b) cause the whole of any work that you distribute or publish, that
+    in whole or in part contains the Program or any part thereof, either
+    with or without modifications, to be licensed at no charge to all
+    third parties under the terms of this General Public License (except
+    that you may choose to grant warranty protection to some or all
+    third parties, at your option).
+
+    c) If the modified program normally reads commands interactively when
+    run, you must cause it, when started running for such interactive use
+    in the simplest and most usual way, to print or display an
+    announcement including an appropriate copyright notice and a notice
+    that there is no warranty (or else, saying that you provide a
+    warranty) and that users may redistribute the program under these
+    conditions, and telling the user how to view a copy of this General
+    Public License.
+
+    d) You may charge a fee for the physical act of transferring a
+    copy, and you may at your option offer warranty protection in
+    exchange for a fee.
+
+Mere aggregation of another independent work with the Program (or its
+derivative) on a volume of a storage or distribution medium does not bring
+the other work under the scope of these terms.
+
+  3. You may copy and distribute the Program (or a portion or derivative of
+it, under Paragraph 2) in object code or executable form under the terms of
+Paragraphs 1 and 2 above provided that you also do one of the following:
+
+    a) accompany it with the complete corresponding machine-readable
+    source code, which must be distributed under the terms of
+    Paragraphs 1 and 2 above; or,
+
+    b) accompany it with a written offer, valid for at least three
+    years, to give any third party free (except for a nominal charge
+    for the cost of distribution) a complete machine-readable copy of the
+    corresponding source code, to be distributed under the terms of
+    Paragraphs 1 and 2 above; or,
+
+    c) accompany it with the information you received as to where the
+    corresponding source code may be obtained.	(This alternative is
+    allowed only for noncommercial distribution and only if you
+    received the program in object code or executable form alone.)
+
+Source code for a work means the preferred form of the work for making
+modifications to it.  For an executable file, complete source code means
+all the source code for all modules it contains; but, as a special
+exception, it need not include source code for modules which are standard
+libraries that accompany the operating system on which the executable
+file runs, or for standard header files or definitions files that
+accompany that operating system.
+
+  4. You may not copy, modify, sublicense, distribute or transfer the
+Program except as expressly provided under this General Public License.
+Any attempt otherwise to copy, modify, sublicense, distribute or transfer
+the Program is void, and will automatically terminate your rights to use
+the Program under this License.	 However, parties who have received
+copies, or rights to use copies, from you under this General Public
+License will not have their licenses terminated so long as such parties
+remain in full compliance.
+
+  5. By copying, distributing or modifying the Program (or any work based
+on the Program) you indicate your acceptance of this license to do so,
+and all its terms and conditions.
+
+  6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the original
+licensor to copy, distribute or modify the Program subject to these
+terms and conditions.  You may not impose any further restrictions on the
+recipients' exercise of the rights granted herein.
+
+  7. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time.  Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number.	If the Program
+specifies a version number of the license which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation.  If the Program does not specify a version number of
+the license, you may choose any version ever published by the Free Software
+Foundation.
+
+  8. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission.	For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this.  Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+			    NO WARRANTY
+
+  9. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+  10. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
+
+		     END OF TERMS AND CONDITIONS
+
+	Appendix: How to Apply These Terms to Your New Programs
+
+  If you develop a new program, and you want it to be of the greatest
+possible use to humanity, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these
+terms.
+
+  To do so, attach the following notices to the program.  It is safest to
+attach them to the start of each source file to most effectively convey
+the exclusion of warranty; and each file should have at least the
+"copyright" line and a pointer to where the full notice is found.
+
+    <one line to give the program's name and a brief idea of what it does.>
+    Copyright (C) 19yy	<name of author>
+
+    This program is free software; you can redistribute it and/or modify
+    it under the terms of the GNU General Public License as published by
+    the Free Software Foundation; either version 1, or (at your option)
+    any later version.
+
+    This program is distributed in the hope that it will be useful,
+    but WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+    GNU General Public License for more details.
+
+    You should have received a copy of the GNU General Public License
+    along with this program; if not, write to the Free Software
+    Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+Also add information on how to contact you by electronic and paper mail.
+
+If the program is interactive, make it output a short notice like this
+when it starts in an interactive mode:
+
+    Gnomovision version 69, Copyright (C) 19xx name of author
+    Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
+    This is free software, and you are welcome to redistribute it
+    under certain conditions; type `show c' for details.
+
+The hypothetical commands `show w' and `show c' should show the
+appropriate parts of the General Public License.  Of course, the
+commands you use may be called something other than `show w' and `show
+c'; they could even be mouse-clicks or menu items--whatever suits your
+program.
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the program, if
+necessary.  Here a sample; alter the names:
+
+  Yoyodyne, Inc., hereby disclaims all copyright interest in the
+  program `Gnomovision' (a program to direct compilers to make passes
+  at assemblers) written by James Hacker.
+
+  <signature of Ty Coon>, 1 April 1989
+  Ty Coon, President of Vice
+
+That's all there is to it!
diff --git a/ChangeLog b/ChangeLog
new file mode 100644
index 0000000..1cf0c00
--- /dev/null
+++ b/ChangeLog
@@ -0,0 +1,403 @@
+Tue Mar 23 14:36:51 1993  Brian Fox  (bfox@eos.crseo.ucsb.edu)
+
+	* readline.c (rl_copy): Changed name to rl_copy_text.
+
+Mon Mar 22 19:16:05 1993  Brian Fox  (bfox@eos.crseo.ucsb.edu)
+
+	* dispose_cmd.c, several other files. Declare dispose_xxx () as
+	"void".
+
+	* builtins/hashcom.h: Make declarations of hashed_filenames be
+	"extern" to keep the SGI compiler happy.
+
+	* readline.c (rl_initialize_everything): Assign values to
+	out_stream and in_stream immediately, since
+	output_character_function () can be called before
+	readline_internal () is called.
+
+Tue Dec  8 09:30:56 1992  Brian Fox  (bfox@cubit)
+
+	* readline.c (rl_init_terminal) Set PC from BC, not from *buffer.
+
+Mon Nov 30 09:35:47 1992  Brian Fox  (bfox@cubit)
+
+	* readline.c (invoking_keyseqs_in_map, rl_parse_and_bind) Allow
+	backslash to quote characters, such as backslash, double quote,
+	and space. Backslash quotes all character indiscriminately.
+
+	* funmap.c (vi_keymap) Fix type in "vi-replace" declaration.
+
+Fri Nov 20 10:55:05 1992  Brian Fox  (bfox@cubit)
+
+	* readline.c (init_terminal_io, rl_prep_terminal): FINALLY!
+	Declare and use termcap variable `ospeed' when setting up terminal
+	parameters.
+
+Thu Oct  8 08:53:07 1992  Brian J. Fox  (bfox@helios)
+
+	* Makefile, this directory: Include (as links to the canonical
+	sources), tilde.c, tilde.h, posixstat.h and xmalloc.c.
+
+Tue Sep 29 13:07:21 1992  Brian J. Fox  (bfox@helios)
+
+	* readline.c (init_terminal_io) Don't set arrow keys if the key
+	sequences that represent them are already set.
+
+	* readline.c (rl_function_of_keyseq) New function returns the first
+	function (or macro) found while searching a key sequence.
+
+Mon Sep 28 00:34:04 1992  Brian J. Fox  (bfox@helios)
+
+	* readline.c (LibraryVersion) New static char * contains current
+	version number.  Version is at 2.0.
+
+	* readline.c (rl_complete_internal): Incorporated clean changes
+	from gilmore (gnu@cygnus.com) to support quoted substrings within
+	completion functions.
+
+	* readline.c (many locations) Added support for the _GO32_,
+	whatever that is.  Patches supplied by Cygnus, typed in by hand,
+	with cleanups.
+
+Sun Aug 16 12:46:24 1992  Brian Fox  (bfox@cubit)
+
+	* readline.c (init_terminal_io): Find out the values of the keypad
+	arrows and bind them to appropriate RL functions if present.
+
+Mon Aug 10 18:13:24 1992  Brian Fox  (bfox@cubit)
+
+	* history.c (stifle_history): A negative argument to stifle
+	becomes zero.
+
+Tue Jul 28 09:28:41 1992  Brian Fox  (bfox@cubit)
+
+	* readline.c (rl_variable_bind): New local structure describes
+	booleans by name and address; code in rl_variable_bind () looks at
+	structure to set simple variables.
+
+	* parens.c (rl_insert_close): New variable rl_blink_matching_paren
+	is non-zero if we want to blink the matching open when a close is
+	inserted.  If FD_SET is defined, rl_blink_matching_paren defaults
+	to 1, else 0.  If FD_SET is not defined, and
+	rl_blink_matching_paren is non-zero, the close character(s) are/is
+	simply inserted.
+
+Wed Jul 22 20:03:59 1992  Brian Fox  (bfox@cubit)
+
+	* history.c, readline.c, vi_mode.c: Cause the functions strchr ()
+	and strrchr () to be used instead of index () and rindex ()
+	throughout the source.
+
+Mon Jul 13 11:34:07 1992  Brian Fox  (bfox@cubit)
+
+	* readline.c: (rl_variable_bind) New variable "meta-flag" if "on"
+	means force the use of the 8th bit as Meta bit.  Internal variable
+	is called meta_flag.
+
+Thu Jul  9 10:37:56 1992  Brian Fox  (bfox@cubit)
+
+	* history.c (get_history_event) Change INDEX to LOCAL_INDEX.  If
+	compiling for the shell, allow shell metacharacters to separate
+	history tokens as they would for shell tokens.
+
+Sat Jul  4 19:29:12 1992  Brian Fox  (bfox@cubit)
+
+	* vi_keymap.c: According to Posix, TAB self-inserts instead of
+	doing completion.
+
+	* vi_mode.c: (rl_vi_yank_arg) Enter VI insert mode after yanking
+	an arg from the previous line.
+
+	* search.c: New file takes over vi style searching and implements
+	non-incremental searching the history.
+
+	Makefile: Add search.c and search.o.
+
+	funmap.c: Add names for non-incremental-forward-search-history and
+	non-incremental-reverse-search-history.
+
+	readline.h: Add extern definitions for non-incremental searching.
+
+	vi_mode.c: Remove old search code; add calls to code in search.c.
+
+Fri Jul  3 10:36:33 1992  Brian Fox  (bfox@cubit)
+
+	* readline.c (rl_delete_horizontal_space); New function deletes
+	all whitespace surrounding point.
+
+	funmap.c: Add "delete-horizontal-space".
+	emacs_keymap.c: Put rl_delete_horizontal_space () on M-\.
+
+	* readline.c (rl_set_signals, rl_clear_signals); New function
+	rl_set_sighandler () is either defined in a Posix way (if
+	HAVE_POSIX_SIGNALS is defined) or in a BSD way.  Function is
+	called from rl_set_signals () and rl_clear_signals ().
+
+Fri May  8 12:50:15 1992  Brian Fox  (bfox@cubit)
+
+	* readline.c: (readline_default_bindings) Do comparisons with
+	_POSIX_VDISABLE casted to `unsigned char'.  Change tty characters
+	to be unsigned char.
+
+Thu Apr 30 12:36:35 1992  Brian Fox  (bfox@cubit)
+
+	* readline.c: (rl_getc) Handle "read would block" error on
+	non-blocking IO streams.
+
+	* readline.c: (rl_signal_handler): Unblock only the signal that we
+	have caught, not all signals.
+
+Sun Feb 23 03:33:09 1992  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c: Many functions.  Use only the macros META_CHAR and
+	UNMETA to deal with meta characters.  Prior to this, we used
+	numeric values and tests.
+
+	* readline.c (rl_complete_internal) Report exactly the number of
+	possible completions, not the number + 1.
+
+	* vi_mode.c (rl_do_move) Do not change the cursor position when
+	using `cw' or `cW'.
+
+	* vi_mode.c (rl_vi_complete) Enter insert mode after completing
+	with `*' or `\'.
+
+Fri Feb 21 05:58:18 1992  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c (rl_dispatch) Increment rl_key_sequence_length for
+	meta characters that map onto ESC map.
+
+Mon Feb 10 01:41:35 1992  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* history.c (history_do_write) Build a buffer of all of the lines
+	to write and write them in one fell swoop (lower overhead than
+	calling write () for each line).  Suggested by Peter Ho.
+
+	* readline.c: Include hbullx20 as well as hpux for determining
+	USGr3ness.
+
+	* readline.c (rl_unix_word_rubout) As per the "Now REMEMBER"
+	comment, pass arguments to rl_kill_text () in the correct order to
+	preserve prepending and appending of killed text.
+
+	* readline.c (rl_search_history) malloc (), realloc (), and free
+	() SEARCH_STRING so that there are no static limits on searching.
+
+	* vi_mode.c (rl_vi_subst) Don't forget to end the undo group.
+
+Fri Jan 31 14:51:02 1992  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c (rl_signal_handler): Zero the current history entry's
+	pointer after freeing the undo_list when SIGINT received.
+	Reformat a couple of functions.
+
+Sat Jan 25 13:47:35 1992  Brian Fox  (bfox at bears)
+
+        * readline.c (parser_if): free () TNAME after use.
+
+Tue Jan 21 01:01:35 1992  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c (rl_redisplay) and (rl_character_len): Display
+	Control characters as "^c" and Meta characters as "\234", instead
+	of "C-C" and "M-C".
+
+Sun Dec 29 10:59:00 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c (init_terminal_io) Default to environment variables
+	LINES and COLUMNS before termcap entry values.  If all else fails,
+	then assume 80x24 terminal.
+
+Sat Dec 28 16:33:11 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c: If this machine is USG and it is hpux, then define
+	USGr3.
+
+	* history.c: Cosmetic fixes.
+
+Thu Nov 21 00:10:12 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* vi_mode.c: (rl_do_move) Place cursor at end of line, never at
+	next to last character.
+
+Thu Nov 14 05:08:01 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* history.c (get_history_event) Non-anchored searches can have a
+	return index of greater than zero from get_history_event ().
+
+Fri Nov  1 07:02:13 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c (rl_translate_keyseq) Make C-? translate to RUBOUT
+	unconditionally.
+
+Mon Oct 28 11:34:52 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c; Use Posix directory routines and macros.
+
+	* funmap.c; Add entry for call-last-kbd-macro.
+
+	* readline.c (rl_prep_term); Use system EOF character on POSIX
+	systems also.
+
+Thu Oct  3 16:19:53 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c; Make a distinction between having a TERMIOS tty
+	driver, and having POSIX signal handling.  You might one without
+	the other.  New defines used HAVE_POSIX_SIGNALS, and
+	TERMIOS_TTY_DRIVER.
+
+Tue Jul 30 22:37:26 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c: rl_getc () If a call to read () returns without an
+	error, but with zero characters, the file is empty, so return EOF.
+
+Thu Jul 11 20:58:38 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c: (rl_get_next_history, rl_get_previous_history)
+	Reallocate the buffer space if the line being moved to is longer
+	the the current space allocated.  Amazing that no one has found
+	this bug until now.
+
+Sun Jul  7 02:37:05 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c:(rl_parse_and_bind) Allow leading whitespace.
+	  Make sure TERMIO and TERMIOS systems treat CR and NL
+	  disctinctly.
+	
+Tue Jun 25 04:09:27 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c: Rework parsing conditionals to pay attention to the
+	prior states of the conditional stack.  This makes $if statements
+	work correctly.
+
+Mon Jun 24 20:45:59 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c: support for displaying key binding information
+	includes the functions rl_list_funmap_names (),
+	invoking_keyseqs_in_map (), rl_invoking_keyseqs (),
+	rl_dump_functions (), and rl_function_dumper ().
+
+	funmap.c: support for same includes rl_funmap_names ().
+
+	readline.c, funmap.c: no longer define STATIC_MALLOC.  However,
+	update both version of xrealloc () to handle a null pointer.
+
+Thu Apr 25 12:03:49 1991  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* vi_mode.c (rl_vi_fword, fWord, etc.  All functions use
+	the macro `isident()'.  Fixed movement bug which prevents
+	continious movement through the text.
+
+Fri Jul 27 16:47:01 1990  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c (parser_if) Allow "$if term=foo" construct.
+
+Wed May 23 16:10:33 1990  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c (rl_dispatch) Correctly remember the last command
+	executed.  Fixed typo in username_completion_function ().
+
+Mon Apr  9 19:55:48 1990  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c: username_completion_function (); For text passed in
+	with a leading `~', remember that this could be a filename (after
+	it is completed).
+
+Thu Apr  5 13:44:24 1990  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c: rl_search_history (): Correctly handle case of an
+	unfound search string, but a graceful exit (as with ESC).
+
+	* readline.c: rl_restart_output ();  The Apollo passes the address
+	of the file descriptor to TIOCSTART, not the descriptor itself.
+
+Tue Mar 20 05:38:55 1990  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* readline.c: rl_complete (); second call in a row causes possible
+	completions to be listed.
+
+	* readline.c: rl_redisplay (), added prompt_this_line variable
+	which is the first character character following \n in prompt.
+
+Sun Mar 11 04:32:03 1990  Brian Fox  (bfox at gnuwest.fsf.org)
+
+	* Signals are now supposedly handled inside of SYSV compilation.
+
+Wed Jan 17 19:24:09 1990  Brian Fox  (bfox at sbphy.ucsb.edu)
+
+	* history.c: history_expand (); fixed overwriting memory error,
+	added needed argument to call to get_history_event ().
+
+Thu Jan 11 10:54:04 1990  Brian Fox  (bfox at sbphy.ucsb.edu)
+
+	* readline.c: added mark_modified_lines to control the
+	display of an asterisk on modified history lines.  Also
+	added a user variable called mark-modified-lines to the
+	`set' command.
+
+Thu Jan  4 10:38:05 1990  Brian Fox  (bfox at sbphy.ucsb.edu)
+
+	* readline.c: start_insert ().  Only use IC if we don't have an im
+	capability.
+
+Fri Sep  8 09:00:45 1989  Brian Fox  (bfox at aurel)
+
+	* readline.c: rl_prep_terminal ().  Only turn on 8th bit
+	  as meta-bit iff the terminal is not using parity.
+
+Sun Sep  3 08:57:40 1989  Brian Fox  (bfox at aurel)
+
+	* readline.c: start_insert ().  Uses multiple
+	  insertion call in cases where that makes sense.
+
+	  rl_insert ().  Read type-ahead buffer for additional
+	  keys that are bound to rl_insert, and insert them
+	  all at once.  Make insertion of single keys given
+	  with an argument much more efficient.
+
+Tue Aug  8 18:13:57 1989  Brian Fox  (bfox at aurel)
+
+	* readline.c: Changed handling of EOF.  readline () returns
+	 (char *)EOF or consed string.  The EOF character is read from the
+	 tty, or if the tty doesn't have one, defaults to C-d.
+
+	* readline.c: Added support for event driven programs.
+	  rl_event_hook is the address of a function you want called
+	  while Readline is waiting for input.
+
+	* readline.c: Cleanup time.  Functions without type declarations
+	  do not use return with a value.
+
+	* history.c: history_expand () has new variable which is the
+	  characters to ignore immediately following history_expansion_char.
+
+Sun Jul 16 08:14:00 1989  Brian Fox  (bfox at aurel)
+
+	* rl_prep_terminal ()
+	  BSD version turns off C-s, C-q, C-y, C-v.
+
+	* readline.c -- rl_prep_terminal ()
+	  SYSV version hacks readline_echoing_p.
+	  BSD version turns on passing of the 8th bit for the duration
+	  of reading the line.
+
+Tue Jul 11 06:25:01 1989  Brian Fox  (bfox at aurel)
+
+	* readline.c: new variable rl_tilde_expander.
+	  If non-null, this contains the address of a function to call if
+	  the standard meaning for expanding a tilde fails.  The function is
+	  called with the text sans tilde (as in "foo"), and returns a
+	  malloc()'ed string which is the expansion, or a NULL pointer if
+	  there is no expansion. 
+
+	* readline.h - new file chardefs.h
+	  Separates things that only readline.c needs from the standard
+	  header file publishing interesting things about readline.
+
+	* readline.c:
+	  readline_default_bindings () now looks at terminal chararacters
+	  and binds those as well.
+
+Wed Jun 28 20:20:51 1989  Brian Fox  (bfox at aurel)
+
+	* Made readline and history into independent libraries.
+
diff --git a/INSTALL b/INSTALL
new file mode 100644
index 0000000..8a7d026
--- /dev/null
+++ b/INSTALL
@@ -0,0 +1,146 @@
+   This is a generic INSTALL file for utilities distributions.
+If this package does not come with, e.g., installable documentation or
+data files, please ignore the references to them below.
+
+   The `configure' shell script attempts to guess correct values for
+various system-dependent variables used during compilation, and
+creates the Makefile(s) (one in each subdirectory of the source
+directory).  In some packages it creates a C header file containing
+system-dependent definitions.  It also creates a file `config.status'
+that you can run in the future to recreate the current configuration.
+
+To compile this package:
+
+1.  Configure the package for your system.
+
+   Normally, you just `cd' to the directory containing the package's
+source code and type `./configure'.  If you're using `csh' on an old
+version of System V, you might need to type `sh configure' instead to
+prevent `csh' from trying to execute `configure' itself.
+
+   Running `configure' takes awhile.  While it is running, it
+prints some messages that tell what it is doing.  If you don't want to
+see any messages, run `configure' with its standard output redirected
+to `/dev/null'; for example, `./configure >/dev/null'.
+
+   To compile the package in a different directory from the one
+containing the source code, you must use a version of `make' that
+supports the `VPATH' variable, such as GNU `make'.  `cd' to the
+directory where you want the object files and executables to go and run
+the `configure' script.  `configure' automatically checks for the
+source code in the directory that `configure' is in and in `..'.  If
+for some reason `configure' is not in the source code directory that
+you are configuring, then it will report that it can't find the source
+code.  In that case, run `configure' with the option `--srcdir=DIR',
+where DIR is the directory that contains the source code.
+
+   By default, `make install' will install the package's files in
+`/usr/local/bin', `/usr/local/man', etc.  You can specify an
+installation prefix other than `/usr/local' by giving `configure' the
+option `--prefix=PATH'.  Alternately, you can do so by consistently
+giving a value for the `prefix' variable when you run `make', e.g.,
+     make prefix=/usr/gnu
+     make prefix=/usr/gnu install
+
+   You can specify separate installation prefixes for
+architecture-specific files and architecture-independent files.  If you
+give `configure' the option `--exec-prefix=PATH' or set the `make'
+variable `exec_prefix' to PATH, the package will use PATH as the prefix
+for installing programs and libraries.  Data files and documentation
+will still use the regular prefix.  Normally, all files are installed
+using the same prefix.
+
+   Some packages pay attention to `--with-PACKAGE' options to
+`configure', where PACKAGE is something like `gnu-as' or `x' (for the
+X Window System).  They may also pay attention to `--enable-FEATURE'
+options, where FEATURE indicates an optional part of the package.  The
+README should mention any `--with-' and `--enable-' options that the
+package recognizes.
+
+   `configure' also recognizes the following options:
+
+`--help'
+     Print a summary of the options to `configure', and exit.
+
+`--quiet'
+`--silent'
+     Do not print messages saying which checks are being made.
+
+`--verbose'
+     Print the results of the checks.
+
+`--version'
+     Print the version of Autoconf used to generate the `configure'
+     script, and exit.
+
+`--x-includes=DIR'
+     X include files are in DIR.
+
+`--x-libraries=DIR'
+     X library files are in DIR.
+
+   `configure' also accepts and ignores some other options.
+
+   On systems that require unusual options for compilation or linking
+that the package's `configure' script does not know about, you can give
+`configure' initial values for variables by setting them in the
+environment.  In Bourne-compatible shells, you can do that on the
+command line like this:
+
+     CC='gcc -traditional' LIBS=-lposix ./configure
+
+On systems that have the `env' program, you can do it like this:
+
+     env CC='gcc -traditional' LIBS=-lposix ./configure
+
+   Here are the `make' variables that you might want to override with
+environment variables when running `configure'.
+
+   For these variables, any value given in the environment overrides the
+value that `configure' would choose:
+
+ - Variable: CC
+     C compiler program.  The default is `cc'.
+
+ - Variable: INSTALL
+     Program to use to install files.  The default is `install' if you
+     have it, `cp' otherwise.
+
+   For these variables, any value given in the environment is added to
+the value that `configure' chooses:
+
+ - Variable: DEFS
+     Configuration options, in the form `-Dfoo -Dbar...'.  Do not use
+     this variable in packages that create a configuration header file.
+
+ - Variable: LIBS
+     Libraries to link with, in the form `-lfoo -lbar...'.
+
+   If you need to do unusual things to compile the package, we encourage
+you to figure out how `configure' could check whether to do them, and
+mail diffs or instructions to the address given in the README so we
+can include them in the next release.
+
+2.  Type `make' to compile the package.  If you want, you can override
+the `make' variables CFLAGS and LDFLAGS like this:
+
+	make CFLAGS=-O2 LDFLAGS=-s
+
+3.  If the package comes with self-tests and you want to run them,
+type `make check'.  If you're not sure whether there are any, try it;
+if `make' responds with something like
+	make: *** No way to make target `check'.  Stop.
+then the package does not come with self-tests.
+
+4.  Type `make install' to install programs, data files, and
+documentation.
+
+5.  You can remove the program binaries and object files from the
+source directory by typing `make clean'.  To also remove the
+Makefile(s), the header file containing system-dependent definitions
+(if the package uses one), and `config.status' (all the files that
+`configure' created), type `make distclean'.
+
+   The file `configure.in' is used to create `configure' by a program
+called `autoconf'.  You only need it if you want to regenerate
+`configure' using a newer version of `autoconf'.
diff --git a/MANIFEST b/MANIFEST
new file mode 100644
index 0000000..007a5ca
--- /dev/null
+++ b/MANIFEST
@@ -0,0 +1,52 @@
+doc		d
+examples	d
+COPYING		f
+README		f
+STANDALONE	f
+MANIFEST	f
+INSTALL		f
+acconfig.h	f
+config.h.in	f
+configure	f
+configure.in	f
+Makefile.in	f
+ChangeLog	f
+ansi_stdlib.h	f
+chardefs.h	f
+keymaps.h	f
+memalloc.h	f
+posixstat.h	f
+history.h	f
+rlconf.h	f
+rldefs.h	f
+tilde.h		f
+bind.c		f
+complete.c	f
+display.c	f
+emacs_keymap.c	f
+funmap.c	f
+history.c	f
+isearch.c	f
+keymaps.c	f
+parens.c	f
+readline.c	f
+readline.h	f
+rltty.c		f
+search.c	f
+signals.c	f
+tilde.c		f
+vi_keymap.c	f
+vi_mode.c	f
+xmalloc.c	f
+doc/Makefile	f
+doc/rlman.texinfo	f
+doc/rltech.texinfo	f
+doc/rluser.texinfo	f
+doc/hist.texinfo	f
+doc/hstech.texinfo	f
+doc/hsuser.texinfo	f
+doc/readline.3		f
+examples/Makefile	f
+examples/fileman.c	f
+examples/manexamp.c	f
+examples/Inputrc	f
diff --git a/Makefile b/Makefile
new file mode 100644
index 0000000..afeab8b
--- /dev/null
+++ b/Makefile
@@ -0,0 +1,205 @@
+# Generated automatically from Makefile.in by configure.
+# Master Makefile for the GNU readline library.
+# Copyright (C) 1994 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+srcdir = .
+
+prefix = /usr/local
+exec_prefix = $(prefix)
+bindir = $(exec_prefix)/bin
+libdir = $(exec_prefix)/lib
+mandir = $(prefix)/man/man1
+
+SHELL = /bin/sh
+
+INSTALL = /bin/install -c
+INSTALL_PROGRAM = ${INSTALL}
+INSTALL_DATA = ${INSTALL} -m 644
+
+RANLIB = ranlib
+AR = ar
+RM = rm
+CP = cp
+MV = mv
+
+DEFS = -DHAVE_CONFIG_H
+CFLAGS = -g
+LDFLAGS = -g
+
+# For libraries which include headers from other libraries.
+INCLUDES = -I. -I$(srcdir)
+
+CPPFLAGS = $(DEFS) $(INCLUDES)
+
+PICFLAG=        -pic    # -fpic for some versions of gcc
+SHLIB_OPTS=	-assert pure-text -ldl	# -Bshareable for some versions of gcc
+MAJOR=		2
+MINOR=		.0
+
+.SUFFIXES:	.so
+.c.o:
+	$(CC) -c $(CPPFLAGS) $(CFLAGS) $<
+
+.c.so:
+	-mv $*.o z$*.o
+	$(CC) -c $(PICFLAG) $(CPPFLAGS) $(CFLAGS) $< 
+	mv $*.o $@
+	-mv z$*.o $*.o
+
+# The name of the main library target.
+LIBRARY_NAME = libreadline.a
+SHARED_READLINE = libreadline.so.$(MAJOR)$(MINOR)
+SHARED_HISTORY = libhistory.so.$(MAJOR)$(MINOR)
+SHARED_LIBS = $(SHARED_READLINE) $(SHARED_HISTORY)
+
+# The C code source files for this library.
+CSOURCES = $(srcdir)readline.c $(srcdir)funmap.c $(srcdir)keymaps.c \
+	   $(srcdir)vi_mode.c $(srcdir)parens.c $(srcdir)rltty.c \
+	   $(srcdir)complete.c $(srcdir)bind.c $(srcdir)isearch.c \
+	   $(srcdir)display.c $(srcdir)signals.c $(srcdir)emacs_keymap.c \
+	   $(srcdir)vi_keymap.c $(srcdir)history.c $(srcdir)tilde.c \
+	   $(srcdir)xmalloc.c
+
+# The header files for this library.
+HSOURCES = readline.h rldefs.h chardefs.h keymaps.h history.h \
+	   posixstat.h tilde.h rlconf.h
+
+INSTALLED_HEADERS = readline.h chardefs.h keymaps.h history.h tilde.h
+
+OBJECTS = readline.o vi_mode.o funmap.o keymaps.o parens.o search.o \
+	  rltty.o complete.o bind.o isearch.o display.o signals.o \
+	  history.o tilde.o xmalloc.o
+
+SHARED_OBJ = readline.so vi_mode.so funmap.so keymaps.so parens.so search.so \
+	  rltty.so complete.so bind.so isearch.so display.so signals.so \
+	  history.so tilde.so xmalloc.so
+
+# The texinfo files which document this library.
+DOCSOURCE = doc/rlman.texinfo doc/rltech.texinfo doc/rluser.texinfo
+DOCOBJECT = doc/readline.dvi
+DOCSUPPORT = doc/Makefile
+DOCUMENTATION = $(DOCSOURCE) $(DOCOBJECT) $(DOCSUPPORT)
+
+SUPPORT = Makefile ChangeLog $(DOCSUPPORT) examples/[-a-z.]*
+
+SOURCES  = $(CSOURCES) $(HSOURCES) $(DOCSOURCE)
+
+THINGS_TO_TAR = $(SOURCES) $(SUPPORT)
+
+##########################################################################
+
+all: libreadline.a libhistory.a
+shared: $(SHARED_LIBS)
+
+libreadline.a: $(OBJECTS)
+	$(RM) -f $@
+	$(AR) cq $@ $(OBJECTS)
+	-$(RANLIB) $@
+
+libhistory.a: history.o
+	$(RM) -f $@
+	$(AR) cq $@ history.o
+	-$(RANLIB) $@
+
+$(SHARED_READLINE):	$(SHARED_OBJ)
+	$(RM) -f $@
+	ld ${SHLIB_OPTS} -o $@ $(SHARED_OBJ)
+
+$(SHARED_HISTORY):	history.so
+	$(RM) -f $@
+	ld ${SHLIB_OPTS} -o $@ history.so
+
+documentation: force
+	[ ! -d doc ] && mkdir doc
+	(if [ -d doc ]; then cd doc; $(MAKE) $(MFLAGS); fi)
+
+force:
+
+install: installdirs libreadline.a
+	$(INSTALL_DATA) $(INSTALLED_HEADERS) $(incdir)/readline
+	-$(MV) $(libdir)/libreadline.a $(libdir)/libreadline.old
+	$(INSTALL_DATA) libreadline.a $(libdir)/libreadline.a
+	-$(RANLIB) -t $(libdir)/libreadline.a
+
+installdirs:
+	[ ! -d $(incdir)/readline ] && { \
+	  mkdir $(incdir)/readline && chmod 755 $(incdir)/readline; }
+	[ ! -d $(libdir) ] && mkdir $(libdir)
+
+uninstall:
+	[ -n "$(incdir)" ] && cd $(incdir)/readline && \
+		${RM} -f ${INSTALLED_HEADERS}
+	[ -n "$(libdir)" ] && cd $(libdir) && \
+		${RM} -f libreadline.a libreadline.old $(SHARED_LIBS)
+
+clean::
+	rm -f $(OBJECTS) *.a $(SHARED_OBJ) $(SHARED_LIBS)
+	(if [ -d doc ]; then cd doc; $(MAKE) $(MFLAGS) $@; fi)
+
+readline: readline.h rldefs.h chardefs.h
+readline: $(OBJECTS)
+	$(CC) $(CFLAGS) $(CPPFLAGS) $(READLINE_DEFINES) \
+	  $(LOCAL_INCLUDES) -DTEST -o readline readline.c vi_mode.o funmap.o \
+	  keymaps.o -ltermcap
+
+info:
+install-info:
+dvi:
+check:
+installcheck:
+
+tags:	force
+	etags $(CSOURCES) $(HSOURCES)
+
+TAGS:	force
+	ctags -x $(CSOURCES) $(HSOURCES) > $@
+
+Makefile: config.status $(srcdir)/Makefile.in
+	$(SHELL) config.status
+
+config.status: configure
+	$(SHELL) config.status --recheck
+
+configure: configure.in            ## Comment-me-out in distribution
+	cd $(srcdir); autoconf     ## Comment-me-out in distribution
+config.h.in: configure.in          ## Comment-me-out in distribution
+	cd $(srcdir); autoheader   ## Comment-me-out in distribution
+
+mostlyclean: clean
+
+distclean realclean: clean
+	rm -f Makefile config.status config.h stamp-config
+
+# Tell versions [3.59,3.63) of GNU make not to export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
+
+# Dependencies
+readline.o: readline.c readline.h rldefs.h rlconf.h chardefs.h
+readline.o: keymaps.h history.h
+vi_mode.o:  rldefs.h rlconf.h readline.h history.h
+funmap.o:   funmap.c readline.h rlconf.h
+keymaps.o:  keymaps.c emacs_keymap.c vi_keymap.c keymaps.h chardefs.h rlconf.h
+history.o: history.h memalloc.h
+isearch.o: memalloc.h readline.h history.h
+search.o: memalloc.h readline.h history.h
+display.o: readline.h history.h rldefs.h rlconf.h
+complete.o: readline.h rldefs.h rlconf.h
+rltty.o: rldefs.h rlconf.h readline.h
+bind.o: rldefs.h rlconf.h readline.h history.h
+signals.o: rldefs.h rlconf.h readline.h history.h
+parens.o: readline.h
diff --git a/Makefile.in b/Makefile.in
new file mode 100644
index 0000000..02888bd
--- /dev/null
+++ b/Makefile.in
@@ -0,0 +1,205 @@
+# Master Makefile for the GNU readline library.
+# Copyright (C) 1994 Free Software Foundation, Inc.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+srcdir = @srcdir@
+VPATH = @srcdir@
+
+prefix = /usr/local
+exec_prefix = $(prefix)
+bindir = $(exec_prefix)/bin
+libdir = $(exec_prefix)/lib
+mandir = $(prefix)/man/man1
+
+SHELL = /bin/sh
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+
+RANLIB = @RANLIB@
+AR = ar
+RM = rm
+CP = cp
+MV = mv
+
+DEFS = @DEFS@
+CFLAGS = -g
+LDFLAGS = -g
+
+# For libraries which include headers from other libraries.
+INCLUDES = -I. -I$(srcdir)
+
+CPPFLAGS = $(DEFS) $(INCLUDES)
+
+PICFLAG=        -pic    # -fpic for some versions of gcc
+SHLIB_OPTS=	-assert pure-text -ldl	# -Bshareable for some versions of gcc
+MAJOR=		2
+MINOR=		.0
+
+.SUFFIXES:	.so
+.c.o:
+	$(CC) -c $(CPPFLAGS) $(CFLAGS) $<
+
+.c.so:
+	-mv $*.o z$*.o
+	$(CC) -c $(PICFLAG) $(CPPFLAGS) $(CFLAGS) $< 
+	mv $*.o $@
+	-mv z$*.o $*.o
+
+# The name of the main library target.
+LIBRARY_NAME = libreadline.a
+SHARED_READLINE = libreadline.so.$(MAJOR)$(MINOR)
+SHARED_HISTORY = libhistory.so.$(MAJOR)$(MINOR)
+SHARED_LIBS = $(SHARED_READLINE) $(SHARED_HISTORY)
+
+# The C code source files for this library.
+CSOURCES = $(srcdir)readline.c $(srcdir)funmap.c $(srcdir)keymaps.c \
+	   $(srcdir)vi_mode.c $(srcdir)parens.c $(srcdir)rltty.c \
+	   $(srcdir)complete.c $(srcdir)bind.c $(srcdir)isearch.c \
+	   $(srcdir)display.c $(srcdir)signals.c $(srcdir)emacs_keymap.c \
+	   $(srcdir)vi_keymap.c $(srcdir)history.c $(srcdir)tilde.c \
+	   $(srcdir)xmalloc.c
+
+# The header files for this library.
+HSOURCES = readline.h rldefs.h chardefs.h keymaps.h history.h \
+	   posixstat.h tilde.h rlconf.h
+
+INSTALLED_HEADERS = readline.h chardefs.h keymaps.h history.h tilde.h
+
+OBJECTS = readline.o vi_mode.o funmap.o keymaps.o parens.o search.o \
+	  rltty.o complete.o bind.o isearch.o display.o signals.o \
+	  history.o tilde.o xmalloc.o
+
+SHARED_OBJ = readline.so vi_mode.so funmap.so keymaps.so parens.so search.so \
+	  rltty.so complete.so bind.so isearch.so display.so signals.so \
+	  history.so tilde.so xmalloc.so
+
+# The texinfo files which document this library.
+DOCSOURCE = doc/rlman.texinfo doc/rltech.texinfo doc/rluser.texinfo
+DOCOBJECT = doc/readline.dvi
+DOCSUPPORT = doc/Makefile
+DOCUMENTATION = $(DOCSOURCE) $(DOCOBJECT) $(DOCSUPPORT)
+
+SUPPORT = Makefile ChangeLog $(DOCSUPPORT) examples/[-a-z.]*
+
+SOURCES  = $(CSOURCES) $(HSOURCES) $(DOCSOURCE)
+
+THINGS_TO_TAR = $(SOURCES) $(SUPPORT)
+
+##########################################################################
+
+all: libreadline.a libhistory.a
+shared: $(SHARED_LIBS)
+
+libreadline.a: $(OBJECTS)
+	$(RM) -f $@
+	$(AR) cq $@ $(OBJECTS)
+	-$(RANLIB) $@
+
+libhistory.a: history.o
+	$(RM) -f $@
+	$(AR) cq $@ history.o
+	-$(RANLIB) $@
+
+$(SHARED_READLINE):	$(SHARED_OBJ)
+	$(RM) -f $@
+	ld ${SHLIB_OPTS} -o $@ $(SHARED_OBJ)
+
+$(SHARED_HISTORY):	history.so
+	$(RM) -f $@
+	ld ${SHLIB_OPTS} -o $@ history.so
+
+documentation: force
+	[ ! -d doc ] && mkdir doc
+	(if [ -d doc ]; then cd doc; $(MAKE) $(MFLAGS); fi)
+
+force:
+
+install: installdirs libreadline.a
+	$(INSTALL_DATA) $(INSTALLED_HEADERS) $(incdir)/readline
+	-$(MV) $(libdir)/libreadline.a $(libdir)/libreadline.old
+	$(INSTALL_DATA) libreadline.a $(libdir)/libreadline.a
+	-$(RANLIB) -t $(libdir)/libreadline.a
+
+installdirs:
+	[ ! -d $(incdir)/readline ] && { \
+	  mkdir $(incdir)/readline && chmod 755 $(incdir)/readline; }
+	[ ! -d $(libdir) ] && mkdir $(libdir)
+
+uninstall:
+	[ -n "$(incdir)" ] && cd $(incdir)/readline && \
+		${RM} -f ${INSTALLED_HEADERS}
+	[ -n "$(libdir)" ] && cd $(libdir) && \
+		${RM} -f libreadline.a libreadline.old $(SHARED_LIBS)
+
+clean::
+	rm -f $(OBJECTS) *.a $(SHARED_OBJ) $(SHARED_LIBS)
+	(if [ -d doc ]; then cd doc; $(MAKE) $(MFLAGS) $@; fi)
+
+readline: readline.h rldefs.h chardefs.h
+readline: $(OBJECTS)
+	$(CC) $(CFLAGS) $(CPPFLAGS) $(READLINE_DEFINES) \
+	  $(LOCAL_INCLUDES) -DTEST -o readline readline.c vi_mode.o funmap.o \
+	  keymaps.o -ltermcap
+
+info:
+install-info:
+dvi:
+check:
+installcheck:
+
+tags:	force
+	etags $(CSOURCES) $(HSOURCES)
+
+TAGS:	force
+	ctags -x $(CSOURCES) $(HSOURCES) > $@
+
+Makefile: config.status $(srcdir)/Makefile.in
+	$(SHELL) config.status
+
+config.status: configure
+	$(SHELL) config.status --recheck
+
+configure: configure.in            ## Comment-me-out in distribution
+	cd $(srcdir); autoconf     ## Comment-me-out in distribution
+config.h.in: configure.in          ## Comment-me-out in distribution
+	cd $(srcdir); autoheader   ## Comment-me-out in distribution
+
+mostlyclean: clean
+
+distclean realclean: clean
+	rm -f Makefile config.status config.h stamp-config
+
+# Tell versions [3.59,3.63) of GNU make not to export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
+
+# Dependencies
+readline.o: readline.c readline.h rldefs.h rlconf.h chardefs.h
+readline.o: keymaps.h history.h
+vi_mode.o:  rldefs.h rlconf.h readline.h history.h
+funmap.o:   funmap.c readline.h rlconf.h
+keymaps.o:  keymaps.c emacs_keymap.c vi_keymap.c keymaps.h chardefs.h rlconf.h
+history.o: history.h memalloc.h
+isearch.o: memalloc.h readline.h history.h
+search.o: memalloc.h readline.h history.h
+display.o: readline.h history.h rldefs.h rlconf.h
+complete.o: readline.h rldefs.h rlconf.h
+rltty.o: rldefs.h rlconf.h readline.h
+bind.o: rldefs.h rlconf.h readline.h history.h
+signals.o: rldefs.h rlconf.h readline.h history.h
+parens.o: readline.h
diff --git a/README b/README
new file mode 100644
index 0000000..131471c
--- /dev/null
+++ b/README
@@ -0,0 +1,6 @@
+This is the distribution of the Gnu Readline library.  See the file
+STANDALONE for a description of the #defines that can be passed via
+the makefile to build readline on different systems.
+
+The file rlconf.h contains defines that enable and disable certain
+readline features.
diff --git a/STANDALONE b/STANDALONE
new file mode 100644
index 0000000..c1387f3
--- /dev/null
+++ b/STANDALONE
@@ -0,0 +1,31 @@
+This is a description of C preprocessor defines that readline accepts.
+Most are passed in from the parent `make'; e.g. from the bash source
+directory.
+
+NO_SYS_FILE		<sys/file.h> is not present
+HAVE_UNISTD_H		<unistd.h> exists
+HAVE_STDLIB_H		<stdlib.h> exists
+HAVE_VARARGS_H		<varargs.h> exists and is usable
+HAVE_STRING_H		<string.h> exists
+HAVE_ALLOCA_H		<alloca.h> exists and is needed for alloca()
+HAVE_ALLOCA		alloca(3) or a define for it exists
+PRAGMA_ALLOCA		use of alloca() requires a #pragma, as in AIX 3.x
+VOID_SIGHANDLER		signal handlers are void functions
+HAVE_DIRENT_H		<dirent.h> exists and is usable
+HAVE_SYS_PTEM_H		<sys/ptem.h> exists 
+HAVE_SYS_PTE_H		<sys/pte.h> exists 
+HAVE_SYS_STREAM_H	<sys/stream.h> exists
+
+System-specific options:
+
+GWINSZ_IN_SYS_IOCTL	need to include <sys/ioctl.h> for TIOCGWINSZ
+HAVE_GETPW_DECLS	the getpw* functions are declared in <pwd.h> and cannot
+			be redeclared without compiler errors
+HAVE_STRCASECMP		the strcasecmp and strncasecmp functions are available
+
+USG			Running a variant of System V
+USGr3			Running System V.3
+XENIX_22		Xenix 2.2
+Linux			Linux
+CRAY			running a recent version of Cray UNICOS
+SunOS4			Running SunOS 4.x
diff --git a/acconfig.h b/acconfig.h
new file mode 100644
index 0000000..ebf44e9
--- /dev/null
+++ b/acconfig.h
@@ -0,0 +1,28 @@
+/* acconfig.h
+   This file is in the public domain.
+
+   Descriptive text for the C preprocessor macros that
+   the distributed Autoconf macros can define.
+   No software package will use all of them; autoheader copies the ones
+   your configure.in uses into your configuration header file templates.
+
+   The entries are in sort -df order: alphabetical, case insensitive,
+   ignoring punctuation (such as underscores).  Although this order
+   can split up related entries, it makes it easier to check whether
+   a given entry is in the file.
+
+   Leave the following blank line there!!  Autoheader needs it.  */
+
+
+/* Define if your system defines TIOCGWINSZ in sys/ioctl.h.  */
+#undef GWINSZ_IN_SYS_IOCTL
+
+#undef HAVE_GETPW_DECLS
+
+#undef NO_SYS_FILE
+
+
+/* Leave that blank line there!!  Autoheader needs it.
+   If you're adding to this file, keep in mind:
+   The entries are in sort -df order: alphabetical, case insensitive,
+   ignoring punctuation (such as underscores).  */
diff --git a/ansi_stdlib.h b/ansi_stdlib.h
new file mode 100644
index 0000000..52339da
--- /dev/null
+++ b/ansi_stdlib.h
@@ -0,0 +1,41 @@
+/* ansi_stdlib.h -- An ANSI Standard stdlib.h. */
+/* A minimal stdlib.h containing extern declarations for those functions
+   that bash uses. */
+
+/* Copyright (C) 1993 Free Software Foundation, Inc.
+
+   This file is part of GNU Bash, the Bourne Again SHell.
+
+   Bash is free software; you can redistribute it and/or modify it under
+   the terms of the GNU General Public License as published by the Free
+   Software Foundation; either version 2, or (at your option) any later
+   version.
+
+   Bash is distributed in the hope that it will be useful, but WITHOUT ANY
+   WARRANTY; without even the implied warranty of MERCHANTABILITY or
+   FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+   for more details.
+
+   You should have received a copy of the GNU General Public License along
+   with Bash; see the file COPYING.  If not, write to the Free Software
+   Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#if !defined (_STDLIB_H_)
+#define	_STDLIB_H_ 1
+
+/* String conversion functions. */
+extern int atoi ();
+extern long int atol ();
+
+/* Memory allocation functions. */
+extern char *malloc ();
+extern char *realloc ();
+extern void free ();
+
+/* Other miscellaneous functions. */
+extern void abort ();
+extern void exit ();
+extern char *getenv ();
+extern void qsort ();
+
+#endif /* _STDLIB_H  */
diff --git a/bind.c b/bind.c
new file mode 100644
index 0000000..8821599
--- /dev/null
+++ b/bind.c
@@ -0,0 +1,1487 @@
+/* bind.c -- key binding and startup file support for the readline library. */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#include <stdio.h>
+#include <sys/types.h>
+#include <fcntl.h>
+#if !defined (NO_SYS_FILE)
+#  include <sys/file.h>
+#endif /* !NO_SYS_FILE */
+#include <signal.h>
+
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif /* HAVE_UNISTD_H */
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+#include <errno.h>
+/* Not all systems declare ERRNO in errno.h... and some systems #define it! */
+#if !defined (errno)
+extern int errno;
+#endif /* !errno */
+
+#include "posixstat.h"
+
+/* System-specific feature definitions and include files. */
+#include "rldefs.h"
+
+/* Some standard library routines. */
+#include "readline.h"
+#include "history.h"
+
+#if !defined (strchr) && !defined (__STDC__)
+extern char *strchr (), *strrchr ();
+#endif /* !strchr && !__STDC__ */
+
+extern int _rl_horizontal_scroll_mode;
+extern int _rl_mark_modified_lines;
+extern int _rl_bell_preference;
+extern int _rl_meta_flag;
+extern int _rl_convert_meta_chars_to_ascii;
+extern int _rl_output_meta_chars;
+extern int _rl_complete_show_all;
+#if defined (PAREN_MATCHING)
+extern int rl_blink_matching_paren;
+#endif /* PAREN_MATCHING */
+#if defined (VISIBLE_STATS)
+extern int rl_visible_stats;
+#endif /* VISIBLE_STATS */
+extern int rl_complete_with_tilde_expansion;
+extern int rl_completion_query_items;
+#if defined (VI_MODE)
+extern char *rl_vi_comment_begin;
+#endif
+
+extern int rl_explicit_arg;
+extern int rl_editing_mode;
+extern unsigned short _rl_parsing_conditionalized_out;
+extern Keymap _rl_keymap;
+
+extern char *possible_control_prefixes[], *possible_meta_prefixes[];
+
+extern char **rl_funmap_names ();
+
+/* Forward declarations */
+void rl_set_keymap_from_edit_mode ();
+
+static int glean_key_from_name ();
+
+#if defined (HAVE_STRCASECMP)
+#define stricmp strcasecmp
+#define strnicmp strncasecmp
+#else
+static int stricmp (), strnicmp ();
+#endif
+
+#if defined (STATIC_MALLOC)
+static char *xmalloc (), *xrealloc ();
+#else
+extern char *xmalloc (), *xrealloc ();
+#endif /* STATIC_MALLOC */
+
+/* **************************************************************** */
+/*								    */
+/*			Binding keys				    */
+/*								    */
+/* **************************************************************** */
+
+/* rl_add_defun (char *name, Function *function, int key)
+   Add NAME to the list of named functions.  Make FUNCTION be the function
+   that gets called.  If KEY is not -1, then bind it. */
+rl_add_defun (name, function, key)
+     char *name;
+     Function *function;
+     int key;
+{
+  if (key != -1)
+    rl_bind_key (key, function);
+  rl_add_funmap_entry (name, function);
+  return 0;
+}
+
+/* Bind KEY to FUNCTION.  Returns non-zero if KEY is out of range. */
+int
+rl_bind_key (key, function)
+     int key;
+     Function *function;
+{
+  if (key < 0)
+    return (key);
+
+  if (META_CHAR (key) && _rl_convert_meta_chars_to_ascii)
+    {
+      if (_rl_keymap[ESC].type == ISKMAP)
+	{
+	  Keymap escmap;
+
+	  escmap = FUNCTION_TO_KEYMAP (_rl_keymap, ESC);
+	  key = UNMETA (key);
+	  escmap[key].type = ISFUNC;
+	  escmap[key].function = function;
+	  return (0);
+	}
+      return (key);
+    }
+
+  _rl_keymap[key].type = ISFUNC;
+  _rl_keymap[key].function = function;
+  return (0);
+}
+
+/* Bind KEY to FUNCTION in MAP.  Returns non-zero in case of invalid
+   KEY. */
+int
+rl_bind_key_in_map (key, function, map)
+     int key;
+     Function *function;
+     Keymap map;
+{
+  int result;
+  Keymap oldmap = _rl_keymap;
+
+  _rl_keymap = map;
+  result = rl_bind_key (key, function);
+  _rl_keymap = oldmap;
+  return (result);
+}
+
+/* Make KEY do nothing in the currently selected keymap.
+   Returns non-zero in case of error. */
+int
+rl_unbind_key (key)
+     int key;
+{
+  return (rl_bind_key (key, (Function *)NULL));
+}
+
+/* Make KEY do nothing in MAP.
+   Returns non-zero in case of error. */
+int
+rl_unbind_key_in_map (key, map)
+     int key;
+     Keymap map;
+{
+  return (rl_bind_key_in_map (key, (Function *)NULL, map));
+}
+
+/* Bind the key sequence represented by the string KEYSEQ to
+   FUNCTION.  This makes new keymaps as necessary.  The initial
+   place to do bindings is in MAP. */
+rl_set_key (keyseq, function, map)
+     char *keyseq;
+     Function *function;
+     Keymap map;
+{
+  return (rl_generic_bind (ISFUNC, keyseq, function, map));
+}
+
+/* Bind the key sequence represented by the string KEYSEQ to
+   the string of characters MACRO.  This makes new keymaps as
+   necessary.  The initial place to do bindings is in MAP. */
+rl_macro_bind (keyseq, macro, map)
+     char *keyseq, *macro;
+     Keymap map;
+{
+  char *macro_keys;
+  int macro_keys_len;
+
+  macro_keys = (char *)xmalloc ((2 * strlen (macro)) + 1);
+
+  if (rl_translate_keyseq (macro, macro_keys, &macro_keys_len))
+    {
+      free (macro_keys);
+      return -1;
+    }
+  rl_generic_bind (ISMACR, keyseq, macro_keys, map);
+  return 0;
+}
+
+/* Bind the key sequence represented by the string KEYSEQ to
+   the arbitrary pointer DATA.  TYPE says what kind of data is
+   pointed to by DATA, right now this can be a function (ISFUNC),
+   a macro (ISMACR), or a keymap (ISKMAP).  This makes new keymaps
+   as necessary.  The initial place to do bindings is in MAP. */
+rl_generic_bind (type, keyseq, data, map)
+     int type;
+     char *keyseq, *data;
+     Keymap map;
+{
+  char *keys;
+  int keys_len;
+  register int i;
+
+  /* If no keys to bind to, exit right away. */
+  if (!keyseq || !*keyseq)
+    {
+      if (type == ISMACR)
+	free (data);
+      return -1;
+    }
+
+  keys = xmalloc (1 + (2 * strlen (keyseq)));
+
+  /* Translate the ASCII representation of KEYSEQ into an array of
+     characters.  Stuff the characters into KEYS, and the length of
+     KEYS into KEYS_LEN. */
+  if (rl_translate_keyseq (keyseq, keys, &keys_len))
+    {
+      free (keys);
+      return -1;
+    }
+
+  /* Bind keys, making new keymaps as necessary. */
+  for (i = 0; i < keys_len; i++)
+    {
+      int ic = (int) ((unsigned char)keys[i]);
+
+      if (_rl_convert_meta_chars_to_ascii && META_CHAR (ic))
+	{
+	  ic = UNMETA (ic);
+	  if (map[ESC].type == ISKMAP)
+	    map = FUNCTION_TO_KEYMAP (map, ESC);
+	}
+
+      if ((i + 1) < keys_len)
+	{
+	  if (map[ic].type != ISKMAP)
+	    {
+	      if (map[ic].type == ISMACR)
+		free ((char *)map[ic].function);
+
+	      map[ic].type = ISKMAP;
+	      map[ic].function = KEYMAP_TO_FUNCTION (rl_make_bare_keymap());
+	    }
+	  map = FUNCTION_TO_KEYMAP (map, ic);
+	}
+      else
+	{
+	  if (map[ic].type == ISMACR)
+	    free ((char *)map[ic].function);
+
+	  map[ic].function = KEYMAP_TO_FUNCTION (data);
+	  map[ic].type = type;
+	}
+    }
+  free (keys);
+  return 0;
+}
+
+/* Translate the ASCII representation of SEQ, stuffing the values into ARRAY,
+   an array of characters.  LEN gets the final length of ARRAY.  Return
+   non-zero if there was an error parsing SEQ. */
+rl_translate_keyseq (seq, array, len)
+     char *seq, *array;
+     int *len;
+{
+  register int i, c, l = 0;
+
+  for (i = 0; c = seq[i]; i++)
+    {
+      if (c == '\\')
+	{
+	  c = seq[++i];
+
+	  if (!c)
+	    break;
+
+	  if (((c == 'C' || c == 'M') &&  seq[i + 1] == '-') ||
+	      (c == 'e'))
+	    {
+	      /* Handle special case of backwards define. */
+	      if (strncmp (&seq[i], "C-\\M-", 5) == 0)
+		{
+		  array[l++] = ESC;
+		  i += 5;
+		  array[l++] = CTRL (to_upper (seq[i]));
+		  if (!seq[i])
+		    i--;
+		  continue;
+		}
+
+	      switch (c)
+		{
+		case 'M':
+		  i++;
+		  array[l++] = ESC;
+		  break;
+
+		case 'C':
+		  i += 2;
+		  /* Special hack for C-?... */
+		  if (seq[i] == '?')
+		    array[l++] = RUBOUT;
+		  else
+		    array[l++] = CTRL (to_upper (seq[i]));
+		  break;
+
+		case 'e':
+		  array[l++] = ESC;
+		}
+
+	      continue;
+	    }
+	}
+      array[l++] = c;
+    }
+
+  *len = l;
+  array[l] = '\0';
+  return (0);
+}
+
+/* Return a pointer to the function that STRING represents.
+   If STRING doesn't have a matching function, then a NULL pointer
+   is returned. */
+Function *
+rl_named_function (string)
+     char *string;
+{
+  register int i;
+
+  rl_initialize_funmap ();
+
+  for (i = 0; funmap[i]; i++)
+    if (stricmp (funmap[i]->name, string) == 0)
+      return (funmap[i]->function);
+  return ((Function *)NULL);
+}
+
+/* Return the function (or macro) definition which would be invoked via
+   KEYSEQ if executed in MAP.  If MAP is NULL, then the current keymap is
+   used.  TYPE, if non-NULL, is a pointer to an int which will receive the
+   type of the object pointed to.  One of ISFUNC (function), ISKMAP (keymap),
+   or ISMACR (macro). */
+Function *
+rl_function_of_keyseq (keyseq, map, type)
+     char *keyseq;
+     Keymap map;
+     int *type;
+{
+  register int i;
+
+  if (!map)
+    map = _rl_keymap;
+
+  for (i = 0; keyseq && keyseq[i]; i++)
+    {
+      int ic = keyseq[i];
+
+      if (META_CHAR (ic) && _rl_convert_meta_chars_to_ascii)
+	{
+	  if (map[ESC].type != ISKMAP)
+	    {
+	      if (type)
+		*type = map[ESC].type;
+
+	      return (map[ESC].function);
+	    }
+	  else
+	    {
+	      map = FUNCTION_TO_KEYMAP (map, ESC);
+	      ic = UNMETA (ic);
+	    }
+	}
+
+      if (map[ic].type == ISKMAP)
+	{
+	  /* If this is the last key in the key sequence, return the
+	     map. */
+	  if (!keyseq[i + 1])
+	    {
+	      if (type)
+		*type = ISKMAP;
+
+	      return (map[ic].function);
+	    }
+	  else
+	    map = FUNCTION_TO_KEYMAP (map, ic);
+	}
+      else
+	{
+	  if (type)
+	    *type = map[ic].type;
+
+	  return (map[ic].function);
+	}
+    }
+  return ((Function *) NULL);
+}
+
+/* The last key bindings file read. */
+static char *last_readline_init_file = (char *)NULL;
+
+/* Re-read the current keybindings file. */
+rl_re_read_init_file (count, ignore)
+     int count, ignore;
+{
+  int r;
+  r = rl_read_init_file ((char *)NULL);
+  rl_set_keymap_from_edit_mode ();
+  return r;
+}
+
+/* Do key bindings from a file.  If FILENAME is NULL it defaults
+   to the first non-null filename from this list:
+     1. the filename used for the previous call
+     2. the value of the shell variable `INPUTRC'
+     3. ~/.inputrc
+   If the file existed and could be opened and read, 0 is returned,
+   otherwise errno is returned. */
+int
+rl_read_init_file (filename)
+     char *filename;
+{
+  register int i;
+  char *buffer, *openname, *line, *end;
+  struct stat finfo;
+  int file;
+
+  /* Default the filename. */
+  if (!filename)
+    {
+      filename = last_readline_init_file;
+      if (!filename)
+        filename = getenv ("INPUTRC");
+      if (!filename)
+	filename = DEFAULT_INPUTRC;
+    }
+
+  if (!*filename)
+    filename = DEFAULT_INPUTRC;
+
+  openname = tilde_expand (filename);
+
+  if ((stat (openname, &finfo) < 0) ||
+      (file = open (openname, O_RDONLY, 0666)) < 0)
+    {
+      free (openname);
+      return (errno);
+    }
+  else
+    free (openname);
+
+  if (filename != last_readline_init_file)
+    {
+      if (last_readline_init_file)
+	free (last_readline_init_file);
+
+      last_readline_init_file = savestring (filename);
+    }
+
+  /* Read the file into BUFFER. */
+  buffer = (char *)xmalloc ((int)finfo.st_size + 1);
+  i = read (file, buffer, finfo.st_size);
+  close (file);
+
+  if (i != finfo.st_size)
+    return (errno);
+
+  /* Loop over the lines in the file.  Lines that start with `#' are
+     comments; all other lines are commands for readline initialization. */
+  line = buffer;
+  end = buffer + finfo.st_size;
+  while (line < end)
+    {
+      /* Find the end of this line. */
+      for (i = 0; line + i != end && line[i] != '\n'; i++);
+
+      /* Mark end of line. */
+      line[i] = '\0';
+
+      /* Skip leading whitespace. */
+      while (*line && whitespace (*line))
+        {
+	  line++;
+	  i--;
+        }
+
+      /* If the line is not a comment, then parse it. */
+      if (*line && *line != '#')
+	rl_parse_and_bind (line);
+
+      /* Move to the next line. */
+      line += i + 1;
+    }
+  free (buffer);
+  return (0);
+}
+
+/* **************************************************************** */
+/*								    */
+/*			Parser Directives       		    */
+/*								    */
+/* **************************************************************** */
+
+/* Conditionals. */
+
+/* Calling programs set this to have their argv[0]. */
+char *rl_readline_name = "other";
+
+/* Stack of previous values of parsing_conditionalized_out. */
+static unsigned char *if_stack = (unsigned char *)NULL;
+static int if_stack_depth = 0;
+static int if_stack_size = 0;
+
+/* Push _rl_parsing_conditionalized_out, and set parser state based
+   on ARGS. */
+static int
+parser_if (args)
+     char *args;
+{
+  register int i;
+
+  /* Push parser state. */
+  if (if_stack_depth + 1 >= if_stack_size)
+    {
+      if (!if_stack)
+	if_stack = (unsigned char *)xmalloc (if_stack_size = 20);
+      else
+	if_stack = (unsigned char *)xrealloc (if_stack, if_stack_size += 20);
+    }
+  if_stack[if_stack_depth++] = _rl_parsing_conditionalized_out;
+
+  /* If parsing is turned off, then nothing can turn it back on except
+     for finding the matching endif.  In that case, return right now. */
+  if (_rl_parsing_conditionalized_out)
+    return 0;
+
+  /* Isolate first argument. */
+  for (i = 0; args[i] && !whitespace (args[i]); i++);
+
+  if (args[i])
+    args[i++] = '\0';
+
+  /* Handle "if term=foo" and "if mode=emacs" constructs.  If this
+     isn't term=foo, or mode=emacs, then check to see if the first
+     word in ARGS is the same as the value stored in rl_readline_name. */
+  if (rl_terminal_name && strnicmp (args, "term=", 5) == 0)
+    {
+      char *tem, *tname;
+
+      /* Terminals like "aaa-60" are equivalent to "aaa". */
+      tname = savestring (rl_terminal_name);
+      tem = strchr (tname, '-');
+      if (tem)
+	*tem = '\0';
+
+      /* Test the `long' and `short' forms of the terminal name so that
+	 if someone has a `sun-cmd' and does not want to have bindings
+	 that will be executed if the terminal is a `sun', they can put
+	 `$if term=sun-cmd' into their .inputrc. */
+      if ((stricmp (args + 5, tname) == 0) ||
+	  (stricmp (args + 5, rl_terminal_name) == 0))
+	_rl_parsing_conditionalized_out = 0;
+      else
+	_rl_parsing_conditionalized_out = 1;
+
+      free (tname);
+    }
+#if defined (VI_MODE)
+  else if (strnicmp (args, "mode=", 5) == 0)
+    {
+      int mode;
+
+      if (stricmp (args + 5, "emacs") == 0)
+	mode = emacs_mode;
+      else if (stricmp (args + 5, "vi") == 0)
+	mode = vi_mode;
+      else
+	mode = no_mode;
+
+      if (mode == rl_editing_mode)
+	_rl_parsing_conditionalized_out = 0;
+      else
+	_rl_parsing_conditionalized_out = 1;
+    }
+#endif /* VI_MODE */
+  /* Check to see if the first word in ARGS is the same as the
+     value stored in rl_readline_name. */
+  else if (stricmp (args, rl_readline_name) == 0)
+    _rl_parsing_conditionalized_out = 0;
+  else
+    _rl_parsing_conditionalized_out = 1;
+  return 0;
+}
+
+/* Invert the current parser state if there is anything on the stack. */
+static int
+parser_else (args)
+     char *args;
+{
+  register int i;
+
+  if (!if_stack_depth)
+    {
+      /* Error message? */
+      return 0;
+    }
+
+  /* Check the previous (n - 1) levels of the stack to make sure that
+     we haven't previously turned off parsing. */
+  for (i = 0; i < if_stack_depth - 1; i++)
+    if (if_stack[i] == 1)
+      return 0;
+
+  /* Invert the state of parsing if at top level. */
+  _rl_parsing_conditionalized_out = !_rl_parsing_conditionalized_out;
+  return 0;
+}
+
+/* Terminate a conditional, popping the value of
+   _rl_parsing_conditionalized_out from the stack. */
+static int
+parser_endif (args)
+     char *args;
+{
+  if (if_stack_depth)
+    _rl_parsing_conditionalized_out = if_stack[--if_stack_depth];
+  else
+    {
+      /* *** What, no error message? *** */
+    }
+  return 0;
+}
+
+/* Associate textual names with actual functions. */
+static struct {
+  char *name;
+  Function *function;
+} parser_directives [] = {
+  { "if", parser_if },
+  { "endif", parser_endif },
+  { "else", parser_else },
+  { (char *)0x0, (Function *)0x0 }
+};
+
+/* Handle a parser directive.  STATEMENT is the line of the directive
+   without any leading `$'. */
+static int
+handle_parser_directive (statement)
+     char *statement;
+{
+  register int i;
+  char *directive, *args;
+
+  /* Isolate the actual directive. */
+
+  /* Skip whitespace. */
+  for (i = 0; whitespace (statement[i]); i++);
+
+  directive = &statement[i];
+
+  for (; statement[i] && !whitespace (statement[i]); i++);
+
+  if (statement[i])
+    statement[i++] = '\0';
+
+  for (; statement[i] && whitespace (statement[i]); i++);
+
+  args = &statement[i];
+
+  /* Lookup the command, and act on it. */
+  for (i = 0; parser_directives[i].name; i++)
+    if (stricmp (directive, parser_directives[i].name) == 0)
+      {
+	(*parser_directives[i].function) (args);
+	return (0);
+      }
+
+  /* *** Should an error message be output? */
+  return (1);
+}
+
+static int substring_member_of_array ();
+
+/* Read the binding command from STRING and perform it.
+   A key binding command looks like: Keyname: function-name\0,
+   a variable binding command looks like: set variable value.
+   A new-style keybinding looks like "\C-x\C-x": exchange-point-and-mark. */
+rl_parse_and_bind (string)
+     char *string;
+{
+  char *funname, *kname;
+  register int c, i;
+  int key, equivalency;
+
+  while (string && whitespace (*string))
+    string++;
+
+  if (!string || !*string || *string == '#')
+    return 0;
+
+  /* If this is a parser directive, act on it. */
+  if (*string == '$')
+    {
+      handle_parser_directive (&string[1]);
+      return 0;
+    }
+
+  /* If we aren't supposed to be parsing right now, then we're done. */
+  if (_rl_parsing_conditionalized_out)
+    return 0;
+
+  i = 0;
+  /* If this keyname is a complex key expression surrounded by quotes,
+     advance to after the matching close quote.  This code allows the
+     backslash to quote characters in the key expression. */
+  if (*string == '"')
+    {
+      int passc = 0;
+
+      for (i = 1; c = string[i]; i++)
+	{
+	  if (passc)
+	    {
+	      passc = 0;
+	      continue;
+	    }
+
+	  if (c == '\\')
+	    {
+	      passc++;
+	      continue;
+	    }
+
+	  if (c == '"')
+	    break;
+	}
+    }
+
+  /* Advance to the colon (:) or whitespace which separates the two objects. */
+  for (; (c = string[i]) && c != ':' && c != ' ' && c != '\t'; i++ );
+
+  equivalency = (c == ':' && string[i + 1] == '=');
+
+  /* Mark the end of the command (or keyname). */
+  if (string[i])
+    string[i++] = '\0';
+
+  /* If doing assignment, skip the '=' sign as well. */
+  if (equivalency)
+    string[i++] = '\0';
+
+  /* If this is a command to set a variable, then do that. */
+  if (stricmp (string, "set") == 0)
+    {
+      char *var = string + i;
+      char *value;
+
+      /* Make VAR point to start of variable name. */
+      while (*var && whitespace (*var)) var++;
+
+      /* Make value point to start of value string. */
+      value = var;
+      while (*value && !whitespace (*value)) value++;
+      if (*value)
+	*value++ = '\0';
+      while (*value && whitespace (*value)) value++;
+
+      rl_variable_bind (var, value);
+      return 0;
+    }
+
+  /* Skip any whitespace between keyname and funname. */
+  for (; string[i] && whitespace (string[i]); i++);
+  funname = &string[i];
+
+  /* Now isolate funname.
+     For straight function names just look for whitespace, since
+     that will signify the end of the string.  But this could be a
+     macro definition.  In that case, the string is quoted, so skip
+     to the matching delimiter.  We allow the backslash to quote the
+     delimiter characters in the macro body. */
+  /* This code exists to allow whitespace in macro expansions, which
+     would otherwise be gobbled up by the next `for' loop.*/
+  /* XXX - it may be desirable to allow backslash quoting only if " is
+     the quoted string delimiter, like the shell. */
+  if (*funname == '\'' || *funname == '"')
+    {
+      int delimiter = string[i++];
+      int passc = 0;
+
+      for (; c = string[i]; i++)
+	{
+	  if (passc)
+	    {
+	      passc = 0;
+	      continue;
+	    }
+
+	  if (c == '\\')
+	    {
+	      passc = 1;
+	      continue;
+	    }
+
+	  if (c == delimiter)
+	    break;
+	}
+      if (c)
+	i++;
+    }
+
+  /* Advance to the end of the string.  */
+  for (; string[i] && !whitespace (string[i]); i++);
+
+  /* No extra whitespace at the end of the string. */
+  string[i] = '\0';
+
+  /* Handle equivalency bindings here.  Make the left-hand side be exactly
+     whatever the right-hand evaluates to, including keymaps. */
+  if (equivalency)
+    {
+      return 0;
+    }
+
+  /* If this is a new-style key-binding, then do the binding with
+     rl_set_key ().  Otherwise, let the older code deal with it. */
+  if (*string == '"')
+    {
+      char *seq = xmalloc (1 + strlen (string));
+      register int j, k = 0;
+      int passc = 0;
+
+      for (j = 1; string[j]; j++)
+	{
+	  /* Allow backslash to quote characters, but leave them in place.
+	     This allows a string to end with a backslash quoting another
+	     backslash, or with a backslash quoting a double quote.  The
+	     backslashes are left in place for rl_translate_keyseq (). */
+	  if (passc || (string[j] == '\\'))
+	    {
+	      seq[k++] = string[j];
+	      passc = !passc;
+	      continue;
+	    }
+
+	  if (string[j] == '"')
+	    break;
+
+	  seq[k++] = string[j];
+	}
+      seq[k] = '\0';
+
+      /* Binding macro? */
+      if (*funname == '\'' || *funname == '"')
+	{
+	  j = strlen (funname);
+
+	  /* Remove the delimiting quotes from each end of FUNNAME. */
+	  if (j && funname[j - 1] == *funname)
+	    funname[j - 1] = '\0';
+
+	  rl_macro_bind (seq, &funname[1], _rl_keymap);
+	}
+      else
+	rl_set_key (seq, rl_named_function (funname), _rl_keymap);
+
+      free (seq);
+      return 0;
+    }
+
+  /* Get the actual character we want to deal with. */
+  kname = strrchr (string, '-');
+  if (!kname)
+    kname = string;
+  else
+    kname++;
+
+  key = glean_key_from_name (kname);
+
+  /* Add in control and meta bits. */
+  if (substring_member_of_array (string, possible_control_prefixes))
+    key = CTRL (to_upper (key));
+
+  if (substring_member_of_array (string, possible_meta_prefixes))
+    key = META (key);
+
+  /* Temporary.  Handle old-style keyname with macro-binding. */
+  if (*funname == '\'' || *funname == '"')
+    {
+      char seq[2];
+      int fl = strlen (funname);
+
+      seq[0] = key; seq[1] = '\0';
+      if (fl && funname[fl - 1] == *funname)
+	funname[fl - 1] = '\0';
+
+      rl_macro_bind (seq, &funname[1], _rl_keymap);
+    }
+#if defined (PREFIX_META_HACK)
+  /* Ugly, but working hack to keep prefix-meta around. */
+  else if (stricmp (funname, "prefix-meta") == 0)
+    {
+      char seq[2];
+
+      seq[0] = key;
+      seq[1] = '\0';
+      rl_generic_bind (ISKMAP, seq, (char *)emacs_meta_keymap, _rl_keymap);
+    }
+#endif /* PREFIX_META_HACK */
+  else
+    rl_bind_key (key, rl_named_function (funname));
+  return 0;
+}
+
+/* Simple structure for boolean readline variables (i.e., those that can
+   have one of two values; either "On" or 1 for truth, or "Off" or 0 for
+   false. */
+
+static struct {
+  char *name;
+  int *value;
+} boolean_varlist [] = {
+  { "horizontal-scroll-mode",	&_rl_horizontal_scroll_mode },
+  { "mark-modified-lines",	&_rl_mark_modified_lines },
+  { "meta-flag",		&_rl_meta_flag },
+#if defined (PAREN_MATCHING)
+  { "blink-matching-paren",	&rl_blink_matching_paren },
+#endif
+  { "convert-meta",		&_rl_convert_meta_chars_to_ascii },
+  { "show-all-if-ambiguous",	&_rl_complete_show_all },
+  { "output-meta",		&_rl_output_meta_chars },
+#if defined (VISIBLE_STATS)
+  { "visible-stats",		&rl_visible_stats },
+#endif /* VISIBLE_STATS */
+  { "expand-tilde",		&rl_complete_with_tilde_expansion },
+  { (char *)NULL, (int *)NULL }
+};
+
+rl_variable_bind (name, value)
+     char *name, *value;
+{
+  register int i;
+
+  /* Check for simple variables first. */
+  for (i = 0; boolean_varlist[i].name; i++)
+    {
+      if (stricmp (name, boolean_varlist[i].name) == 0)
+	{
+	  /* A variable is TRUE if the "value" is "on", "1" or "". */
+	  if ((!*value) ||
+	      (stricmp (value, "On") == 0) ||
+	      (value[0] == '1' && value[1] == '\0'))
+	    *boolean_varlist[i].value = 1;
+	  else
+	    *boolean_varlist[i].value = 0;
+	  return 0;
+	}
+    }
+
+  /* Not a boolean variable, so check for specials. */
+
+  /* Editing mode change? */
+  if (stricmp (name, "editing-mode") == 0)
+    {
+      if (strnicmp (value, "vi", 2) == 0)
+	{
+#if defined (VI_MODE)
+	  _rl_keymap = vi_insertion_keymap;
+	  rl_editing_mode = vi_mode;
+#endif /* VI_MODE */
+	}
+      else if (strnicmp (value, "emacs", 5) == 0)
+	{
+	  _rl_keymap = emacs_standard_keymap;
+	  rl_editing_mode = emacs_mode;
+	}
+    }
+
+  /* Comment string change? */
+  else if (stricmp (name, "comment-begin") == 0)
+    {
+#if defined (VI_MODE)
+      if (*value)
+	{
+	  if (rl_vi_comment_begin)
+	    free (rl_vi_comment_begin);
+
+	  rl_vi_comment_begin = savestring (value);
+	}
+#endif /* VI_MODE */
+    }
+  else if (stricmp (name, "completion-query-items") == 0)
+    {
+      int nval = 100;
+      if (*value)
+	{
+	  nval = atoi (value);
+	  if (nval < 0)
+	    nval = 0;
+	}
+      rl_completion_query_items = nval;
+    }
+  else if (stricmp (name, "keymap") == 0)
+    {
+      Keymap kmap;
+      kmap = rl_get_keymap_by_name (value);
+      if (kmap)
+        rl_set_keymap (kmap);
+    }
+  else if (stricmp (name, "bell-style") == 0)
+    {
+      if (!*value)
+        _rl_bell_preference = AUDIBLE_BELL;
+      else
+        {
+          if (stricmp (value, "none") == 0 || stricmp (value, "off") == 0)
+            _rl_bell_preference = NO_BELL;
+          else if (stricmp (value, "audible") == 0 || stricmp (value, "on") == 0)
+            _rl_bell_preference = AUDIBLE_BELL;
+          else if (stricmp (value, "visible") == 0)
+            _rl_bell_preference = VISIBLE_BELL;
+        }
+    }
+  else if (stricmp (name, "prefer-visible-bell") == 0)
+    {
+      /* Backwards compatibility. */
+      if (*value && (stricmp (value, "on") == 0 ||
+		     (*value == '1' && !value[1])))
+        _rl_bell_preference = VISIBLE_BELL;
+      else
+        _rl_bell_preference = AUDIBLE_BELL;
+    }
+
+  return 0;
+}
+
+/* Return the character which matches NAME.
+   For example, `Space' returns ' '. */
+
+typedef struct {
+  char *name;
+  int value;
+} assoc_list;
+
+static assoc_list name_key_alist[] = {
+  { "DEL", 0x7f },
+  { "ESC", '\033' },
+  { "Escape", '\033' },
+  { "LFD", '\n' },
+  { "Newline", '\n' },
+  { "RET", '\r' },
+  { "Return", '\r' },
+  { "Rubout", 0x7f },
+  { "SPC", ' ' },
+  { "Space", ' ' },
+  { "Tab", 0x09 },
+  { (char *)0x0, 0 }
+};
+
+static int
+glean_key_from_name (name)
+     char *name;
+{
+  register int i;
+
+  for (i = 0; name_key_alist[i].name; i++)
+    if (stricmp (name, name_key_alist[i].name) == 0)
+      return (name_key_alist[i].value);
+
+  return (*(unsigned char *)name);	/* XXX was return (*name) */
+}
+
+/* Auxiliary functions to manage keymaps. */
+static struct {
+  char *name;
+  Keymap map;
+} keymap_names[] = {
+  { "emacs", emacs_standard_keymap },
+  { "emacs-standard", emacs_standard_keymap },
+  { "emacs-meta", emacs_meta_keymap },
+  { "emacs-ctlx", emacs_ctlx_keymap },
+#if defined (VI_MODE)
+  { "vi", vi_movement_keymap },
+  { "vi-move", vi_movement_keymap },
+  { "vi-command", vi_movement_keymap },
+  { "vi-insert", vi_insertion_keymap },
+#endif /* VI_MODE */
+  { (char *)0x0, (Keymap)0x0 }
+};
+
+Keymap
+rl_get_keymap_by_name (name)
+     char *name;
+{
+  register int i;
+
+  for (i = 0; keymap_names[i].name; i++)
+    if (strcmp (name, keymap_names[i].name) == 0)
+      return (keymap_names[i].map);
+  return ((Keymap) NULL);
+}
+
+void
+rl_set_keymap (map)
+     Keymap map;
+{
+  if (map)
+    _rl_keymap = map;
+}
+
+Keymap
+rl_get_keymap ()
+{
+  return (_rl_keymap);
+}
+
+void
+rl_set_keymap_from_edit_mode ()
+{
+  if (rl_editing_mode == emacs_mode)
+    _rl_keymap = emacs_standard_keymap;
+#if defined (VI_MODE)
+  else if (rl_editing_mode == vi_mode)
+    _rl_keymap = vi_insertion_keymap;
+#endif /* VI_MODE */
+}
+
+/* **************************************************************** */
+/*								    */
+/*		  Key Binding and Function Information		    */
+/*								    */
+/* **************************************************************** */
+
+/* Each of the following functions produces information about the
+   state of keybindings and functions known to Readline.  The info
+   is always printed to rl_outstream, and in such a way that it can
+   be read back in (i.e., passed to rl_parse_and_bind (). */
+
+/* Print the names of functions known to Readline. */
+void
+rl_list_funmap_names (count, ignore)
+     int count, ignore;
+{
+  register int i;
+  char **funmap_names;
+
+  funmap_names = rl_funmap_names ();
+
+  if (!funmap_names)
+    return;
+
+  for (i = 0; funmap_names[i]; i++)
+    fprintf (rl_outstream, "%s\n", funmap_names[i]);
+
+  free (funmap_names);
+}
+
+/* Return a NULL terminated array of strings which represent the key
+   sequences that are used to invoke FUNCTION in MAP. */
+char **
+rl_invoking_keyseqs_in_map (function, map)
+     Function *function;
+     Keymap map;
+{
+  register int key;
+  char **result;
+  int result_index, result_size;
+
+  result = (char **)NULL;
+  result_index = result_size = 0;
+
+  for (key = 0; key < 128; key++)
+    {
+      switch (map[key].type)
+	{
+	case ISMACR:
+	  /* Macros match, if, and only if, the pointers are identical.
+	     Thus, they are treated exactly like functions in here. */
+	case ISFUNC:
+	  /* If the function in the keymap is the one we are looking for,
+	     then add the current KEY to the list of invoking keys. */
+	  if (map[key].function == function)
+	    {
+	      char *keyname = (char *)xmalloc (5);
+
+	      if (CTRL_CHAR (key))
+		sprintf (keyname, "\\C-%c", to_lower (UNCTRL (key)));
+	      else if (key == RUBOUT)
+		sprintf (keyname, "\\C-?");
+	      else if (key == '\\' || key == '"')
+		{
+		  keyname[0] = '\\';
+		  keyname[1] = (char) key;
+		  keyname[2] = '\0';
+		}
+	      else
+		{
+		  keyname[0] = (char) key;
+		  keyname[1] = '\0';
+		}
+
+	      if (result_index + 2 > result_size)
+		result = (char **) xrealloc
+		  (result, (result_size += 10) * sizeof (char *));
+
+	      result[result_index++] = keyname;
+	      result[result_index] = (char *)NULL;
+	    }
+	  break;
+
+	case ISKMAP:
+	  {
+	    char **seqs = (char **)NULL;
+
+	    /* Find the list of keyseqs in this map which have FUNCTION as
+	       their target.  Add the key sequences found to RESULT. */
+	    if (map[key].function)
+	      seqs =
+	        rl_invoking_keyseqs_in_map (function, FUNCTION_TO_KEYMAP (map, key));
+
+	    if (seqs)
+	      {
+		register int i;
+
+		for (i = 0; seqs[i]; i++)
+		  {
+		    char *keyname = (char *)xmalloc (6 + strlen (seqs[i]));
+
+		    if (key == ESC)
+		      sprintf (keyname, "\\e");
+		    else if (CTRL_CHAR (key))
+		      sprintf (keyname, "\\C-%c", to_lower (UNCTRL (key)));
+		    else if (key == RUBOUT)
+		      sprintf (keyname, "\\C-?");
+		    else if (key == '\\' || key == '"')
+		      {
+			keyname[0] = '\\';
+			keyname[1] = (char) key;
+			keyname[2] = '\0';
+		      }
+		    else
+		      {
+			keyname[0] = (char) key;
+			keyname[1] = '\0';
+		      }
+
+		    strcat (keyname, seqs[i]);
+		    free (seqs[i]);
+
+		    if (result_index + 2 > result_size)
+		      result = (char **) xrealloc
+			(result, (result_size += 10) * sizeof (char *));
+
+		    result[result_index++] = keyname;
+		    result[result_index] = (char *)NULL;
+		  }
+
+		free (seqs);
+	      }
+	  }
+	  break;
+	}
+    }
+  return (result);
+}
+
+/* Return a NULL terminated array of strings which represent the key
+   sequences that can be used to invoke FUNCTION using the current keymap. */
+char **
+rl_invoking_keyseqs (function)
+     Function *function;
+{
+  return (rl_invoking_keyseqs_in_map (function, _rl_keymap));
+}
+
+/* Print all of the current functions and their bindings to
+   rl_outstream.  If an explicit argument is given, then print
+   the output in such a way that it can be read back in. */
+int
+rl_dump_functions (count, key)
+     int count, key;
+{
+  rl_function_dumper (rl_explicit_arg);
+  rl_on_new_line ();
+  return (0);
+}
+
+/* Print all of the functions and their bindings to rl_outstream.  If
+   PRINT_READABLY is non-zero, then print the output in such a way
+   that it can be read back in. */
+void
+rl_function_dumper (print_readably)
+     int print_readably;
+{
+  register int i;
+  char **names;
+  char *name;
+
+  names = rl_funmap_names ();
+
+  fprintf (rl_outstream, "\n");
+
+  for (i = 0; name = names[i]; i++)
+    {
+      Function *function;
+      char **invokers;
+
+      function = rl_named_function (name);
+      invokers = rl_invoking_keyseqs_in_map (function, _rl_keymap);
+
+      if (print_readably)
+	{
+	  if (!invokers)
+	    fprintf (rl_outstream, "# %s (not bound)\n", name);
+	  else
+	    {
+	      register int j;
+
+	      for (j = 0; invokers[j]; j++)
+		{
+		  fprintf (rl_outstream, "\"%s\": %s\n",
+			   invokers[j], name);
+		  free (invokers[j]);
+		}
+
+	      free (invokers);
+	    }
+	}
+      else
+	{
+	  if (!invokers)
+	    fprintf (rl_outstream, "%s is not bound to any keys\n",
+		     name);
+	  else
+	    {
+	      register int j;
+
+	      fprintf (rl_outstream, "%s can be found on ", name);
+
+	      for (j = 0; invokers[j] && j < 5; j++)
+		{
+		  fprintf (rl_outstream, "\"%s\"%s", invokers[j],
+			   invokers[j + 1] ? ", " : ".\n");
+		}
+
+	      if (j == 5 && invokers[j])
+		fprintf (rl_outstream, "...\n");
+
+	      for (j = 0; invokers[j]; j++)
+		free (invokers[j]);
+
+	      free (invokers);
+	    }
+	}
+    }
+}
+
+/* Bind key sequence KEYSEQ to DEFAULT_FUNC if KEYSEQ is unbound. */
+void
+_rl_bind_if_unbound (keyseq, default_func)
+     char *keyseq;
+     Function *default_func;
+{
+  Function *func;
+
+  if (keyseq)
+    {
+      func = rl_function_of_keyseq (keyseq, _rl_keymap, (int *)NULL);
+      if (!func || func == rl_do_lowercase_version)
+	rl_set_key (keyseq, default_func, _rl_keymap);
+    }
+}
+
+/* **************************************************************** */
+/*								    */
+/*			String Utility Functions		    */
+/*								    */
+/* **************************************************************** */
+
+static char *strindex ();
+
+/* Return non-zero if any members of ARRAY are a substring in STRING. */
+static int
+substring_member_of_array (string, array)
+     char *string, **array;
+{
+  while (*array)
+    {
+      if (strindex (string, *array))
+	return (1);
+      array++;
+    }
+  return (0);
+}
+
+#if !defined (HAVE_STRCASECMP)
+/* Whoops, Unix doesn't have strnicmp. */
+
+/* Compare at most COUNT characters from string1 to string2.  Case
+   doesn't matter. */
+static int
+strnicmp (string1, string2, count)
+     char *string1, *string2;
+     int count;
+{
+  register char ch1, ch2;
+
+  while (count)
+    {
+      ch1 = *string1++;
+      ch2 = *string2++;
+      if (to_upper(ch1) == to_upper(ch2))
+	count--;
+      else
+        break;
+    }
+  return (count);
+}
+
+/* strcmp (), but caseless. */
+static int
+stricmp (string1, string2)
+     char *string1, *string2;
+{
+  register char ch1, ch2;
+
+  while (*string1 && *string2)
+    {
+      ch1 = *string1++;
+      ch2 = *string2++;
+      if (to_upper(ch1) != to_upper(ch2))
+	return (1);
+    }
+  return (*string1 - *string2);
+}
+#endif /* !HAVE_STRCASECMP */
+
+/* Determine if s2 occurs in s1.  If so, return a pointer to the
+   match in s1.  The compare is case insensitive. */
+static char *
+strindex (s1, s2)
+     register char *s1, *s2;
+{
+  register int i, l = strlen (s2);
+  register int len = strlen (s1);
+
+  for (i = 0; (len - i) >= l; i++)
+    if (strnicmp (s1 + i, s2, l) == 0)
+      return (s1 + i);
+  return ((char *)NULL);
+}
diff --git a/chardefs.h b/chardefs.h
new file mode 100644
index 0000000..8c92811
--- /dev/null
+++ b/chardefs.h
@@ -0,0 +1,122 @@
+/* chardefs.h -- Character definitions for readline. */
+
+/* Copyright (C) 1994 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#ifndef _CHARDEFS_H
+#define _CHARDEFS_H
+
+#include <ctype.h>
+
+#if defined (HAVE_STRING_H)
+#  include <string.h>
+#else
+#  include <strings.h>
+#endif /* HAVE_STRING_H */
+
+#ifndef whitespace
+#define whitespace(c) (((c) == ' ') || ((c) == '\t'))
+#endif
+
+#ifdef CTRL
+#undef CTRL
+#endif
+
+/* Some character stuff. */
+#define control_character_threshold 0x020   /* Smaller than this is control. */
+#define control_character_mask 0x1f	    /* 0x20 - 1 */
+#define meta_character_threshold 0x07f	    /* Larger than this is Meta. */
+#define control_character_bit 0x40	    /* 0x000000, must be off. */
+#define meta_character_bit 0x080	    /* x0000000, must be on. */
+#define largest_char 255		    /* Largest character value. */
+
+#define CTRL_CHAR(c) ((c) < control_character_threshold)
+#define META_CHAR(c) ((c) > meta_character_threshold && (c) <= largest_char)
+
+#define CTRL(c) ((c) & control_character_mask)
+#define META(c) ((c) | meta_character_bit)
+
+#define UNMETA(c) ((c) & (~meta_character_bit))
+#define UNCTRL(c) to_upper(((c)|control_character_bit))
+
+/* Old versions
+#define lowercase_p(c) (((c) > ('a' - 1) && (c) < ('z' + 1)))
+#define uppercase_p(c) (((c) > ('A' - 1) && (c) < ('Z' + 1)))
+#define digit_p(c)  ((c) >= '0' && (c) <= '9')
+*/
+
+#define lowercase_p(c) (islower(c))
+#define uppercase_p(c) (isupper(c))
+#define digit_p(x)  (isdigit (x))
+
+#define pure_alphabetic(c) (lowercase_p(c) || uppercase_p(c))
+
+/* Old versions
+#  define to_upper(c) (lowercase_p(c) ? ((c) - 32) : (c))
+#  define to_lower(c) (uppercase_p(c) ? ((c) + 32) : (c))
+*/
+
+#ifndef to_upper
+#  define to_upper(c) (islower(c) ? toupper(c) : (c))
+#  define to_lower(c) (isupper(c) ? tolower(c) : (c))
+#endif
+
+#ifndef digit_value
+#define digit_value(x) ((x) - '0')
+#endif
+
+#ifndef NEWLINE
+#define NEWLINE '\n'
+#endif
+
+#ifndef RETURN
+#define RETURN CTRL('M')
+#endif
+
+#ifndef RUBOUT
+#define RUBOUT 0x7f
+#endif
+
+#ifndef TAB
+#define TAB '\t'
+#endif
+
+#ifdef ABORT_CHAR
+#undef ABORT_CHAR
+#endif
+#define ABORT_CHAR CTRL('G')
+
+#ifdef PAGE
+#undef PAGE
+#endif
+#define PAGE CTRL('L')
+
+#ifdef SPACE
+#undef SPACE
+#endif
+#define SPACE ' '	/* XXX - was 0x20 */
+
+#ifdef ESC
+#undef ESC
+#endif
+
+#define ESC CTRL('[')
+
+#endif  /* _CHARDEFS_H */
diff --git a/complete.c b/complete.c
new file mode 100644
index 0000000..2180132
--- /dev/null
+++ b/complete.c
@@ -0,0 +1,1417 @@
+/* complete.c -- filename completion for readline. */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#include <stdio.h>
+#include <sys/types.h>
+#include <fcntl.h>
+#if !defined (NO_SYS_FILE)
+#  include <sys/file.h>
+#endif /* !NO_SYS_FILE */
+
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif /* HAVE_UNISTD_H */
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+#include <errno.h>
+/* Not all systems declare ERRNO in errno.h... and some systems #define it! */
+#if !defined (errno)
+extern int errno;
+#endif /* !errno */
+
+#include <pwd.h>
+#if defined (USG) && !defined (HAVE_GETPW_DECLS)
+extern struct passwd *getpwent ();
+#endif /* USG && !HAVE_GETPW_DECLS */
+
+/* ISC systems don't define getpwent() if _POSIX_SOURCE is defined. */
+#if defined (isc386) && defined (_POSIX_SOURCE)
+#  if defined (__STDC__)
+extern struct passwd *getpwent (void);
+#  else
+extern struct passwd *getpwent ();
+#  endif /* !__STDC__ */
+#endif /* isc386 && _POSIX_SOURCE */
+
+#include "posixstat.h"
+
+/* System-specific feature definitions and include files. */
+#include "rldefs.h"
+
+/* Some standard library routines. */
+#include "readline.h"
+
+/* Possible values for do_replace in rl_complete_internal. */
+#define NO_MATCH	0
+#define SINGLE_MATCH	1
+#define MULT_MATCH	2
+
+#if !defined (strchr) && !defined (__STDC__)
+extern char *strchr (), *strrchr ();
+#endif /* !strchr && !__STDC__ */
+
+extern char *tilde_expand ();
+extern char *rl_copy_text ();
+
+extern Function *rl_last_func;
+extern int rl_editing_mode;
+extern int screenwidth;
+
+/* Forward declarations for functions defined and used in this file. */
+char *filename_completion_function ();
+char **completion_matches ();
+
+static int compare_strings ();
+static char *rl_strpbrk ();
+
+#if defined (STATIC_MALLOC)
+static char *xmalloc (), *xrealloc ();
+#else
+extern char *xmalloc (), *xrealloc ();
+#endif /* STATIC_MALLOC */
+
+/* If non-zero, then this is the address of a function to call when
+   completing on a directory name.  The function is called with
+   the address of a string (the current directory name) as an arg. */
+Function *rl_directory_completion_hook = (Function *)NULL;
+
+/* Non-zero means readline completion functions perform tilde expansion. */
+int rl_complete_with_tilde_expansion = 0;
+
+/* If non-zero, non-unique completions always show the list of matches. */
+int _rl_complete_show_all = 0;
+
+#if defined (VISIBLE_STATS)
+#  if !defined (X_OK)
+#    define X_OK 1
+#  endif
+
+static int stat_char ();
+
+/* Non-zero means add an additional character to each filename displayed
+   during listing completion iff rl_filename_completion_desired which helps
+   to indicate the type of file being listed. */
+int rl_visible_stats = 0;
+#endif /* VISIBLE_STATS */
+
+/* **************************************************************** */
+/*								    */
+/*	Completion matching, from readline's point of view.	    */
+/*								    */
+/* **************************************************************** */
+
+/* Pointer to the generator function for completion_matches ().
+   NULL means to use filename_entry_function (), the default filename
+   completer. */
+Function *rl_completion_entry_function = (Function *)NULL;
+
+/* Pointer to alternative function to create matches.
+   Function is called with TEXT, START, and END.
+   START and END are indices in RL_LINE_BUFFER saying what the boundaries
+   of TEXT are.
+   If this function exists and returns NULL then call the value of
+   rl_completion_entry_function to try to match, otherwise use the
+   array of strings returned. */
+CPPFunction *rl_attempted_completion_function = (CPPFunction *)NULL;
+
+/* Non-zero means to suppress normal filename completion after the
+   user-specified completion function has been called. */
+int rl_attempted_completion_over = 0;
+
+/* Local variable states what happened during the last completion attempt. */
+static int completion_changed_buffer = 0;
+
+/* Complete the word at or before point.  You have supplied the function
+   that does the initial simple matching selection algorithm (see
+   completion_matches ()).  The default is to do filename completion. */
+
+rl_complete (ignore, invoking_key)
+     int ignore, invoking_key;
+{
+  if (rl_last_func == rl_complete && !completion_changed_buffer)
+    return (rl_complete_internal ('?'));
+  else if (_rl_complete_show_all)
+    return (rl_complete_internal ('!'));
+  else
+    return (rl_complete_internal (TAB));
+}
+
+/* List the possible completions.  See description of rl_complete (). */
+rl_possible_completions (ignore, invoking_key)
+     int ignore, invoking_key;
+{
+  return (rl_complete_internal ('?'));
+}
+
+rl_insert_completions (ignore, invoking_key)
+     int ignore, invoking_key;
+{
+  return (rl_complete_internal ('*'));
+}
+
+/* The user must press "y" or "n". Non-zero return means "y" pressed. */
+get_y_or_n ()
+{
+  int c;
+
+  for (;;)
+    {
+      c = rl_read_key ();
+      if (c == 'y' || c == 'Y' || c == ' ')
+	return (1);
+      if (c == 'n' || c == 'N' || c == RUBOUT)
+	return (0);
+      if (c == ABORT_CHAR)
+	rl_abort ();
+      ding ();
+    }
+}
+
+/* Up to this many items will be displayed in response to a
+   possible-completions call.  After that, we ask the user if
+   she is sure she wants to see them all. */
+int rl_completion_query_items = 100;
+
+/* The basic list of characters that signal a break between words for the
+   completer routine.  The contents of this variable is what breaks words
+   in the shell, i.e. " \t\n\"\\'`@$><=" */
+char *rl_basic_word_break_characters = " \t\n\"\\'`@$><=;|&{(";
+
+/* The list of characters that signal a break between words for
+   rl_complete_internal.  The default list is the contents of
+   rl_basic_word_break_characters.  */
+char *rl_completer_word_break_characters = (char *)NULL;
+
+/* List of characters which can be used to quote a substring of the line.
+   Completion occurs on the entire substring, and within the substring
+   rl_completer_word_break_characters are treated as any other character,
+   unless they also appear within this list. */
+char *rl_completer_quote_characters = (char *)NULL;
+
+/* List of characters that are word break characters, but should be left
+   in TEXT when it is passed to the completion function.  The shell uses
+   this to help determine what kind of completing to do. */
+char *rl_special_prefixes = (char *)NULL;
+
+/* If non-zero, then disallow duplicates in the matches. */
+int rl_ignore_completion_duplicates = 1;
+
+/* Non-zero means that the results of the matches are to be treated
+   as filenames.  This is ALWAYS zero on entry, and can only be changed
+   within a completion entry finder function. */
+int rl_filename_completion_desired = 0;
+
+/* Non-zero means that the results of the matches are to be quoted using
+   double quotes (or an application-specific quoting mechanism) if the
+   filename contains any characters in rl_word_break_chars.  This is
+   ALWAYS non-zero on entry, and can only be changed within a completion
+   entry finder function. */
+int rl_filename_quoting_desired = 1;
+
+/* This function, if defined, is called by the completer when real
+   filename completion is done, after all the matching names have been
+   generated. It is passed a (char**) known as matches in the code below.
+   It consists of a NULL-terminated array of pointers to potential
+   matching strings.  The 1st element (matches[0]) is the maximal
+   substring that is common to all matches. This function can re-arrange
+   the list of matches as required, but all elements of the array must be
+   free()'d if they are deleted. The main intent of this function is
+   to implement FIGNORE a la SunOS csh. */
+Function *rl_ignore_some_completions_function = (Function *)NULL;
+
+#if defined (SHELL)
+/* A function to strip quotes that are not protected by backquotes.  It
+   allows single quotes to appear within double quotes, and vice versa.
+   It should be smarter.  It's fairly shell-specific, hence the SHELL
+   definition wrapper. */
+static char *
+_delete_quotes (text)
+     char *text;
+{
+  char *ret, *p, *r;
+  int l, quoted;
+
+  l = strlen (text);
+  ret = xmalloc (l + 1);
+  for (quoted = 0, p = text, r = ret; p && *p; p++)
+    {
+      /* Allow backslash-quoted characters to pass through unscathed. */
+      if (*p == '\\')
+        continue;
+      /* Close quote. */
+      if (quoted && *p == quoted)
+	{
+	  quoted = 0;
+	  continue;
+	}
+      /* Open quote. */
+      if (quoted == 0 && (*p == '\'' || *p == '"'))
+	{
+	  quoted = *p;
+	  continue;
+	}
+      *r++ = *p;
+    }
+  *r = '\0';
+  return ret;
+}
+#endif /* SHELL */
+
+/* Return the portion of PATHNAME that should be output when listing
+   possible completions.  If we are hacking filename completion, we
+   are only interested in the basename, the portion following the
+   final slash.  Otherwise, we return what we were passed. */
+static char *
+printable_part (pathname)
+      char *pathname;
+{
+  char *temp = (char *)NULL;
+
+  if (rl_filename_completion_desired)
+    temp = strrchr (pathname, '/');
+
+  if (!temp)
+    return (pathname);
+  else
+    return (++temp);
+}
+
+/* Output TO_PRINT to rl_outstream.  If VISIBLE_STATS is defined and we
+   are using it, check for and output a single character for `special'
+   filenames.  Return 1 if we printed an extension character, 0 if not. */
+static int
+print_filename (to_print, full_pathname)
+     char *to_print, *full_pathname;
+{
+#if !defined (VISIBLE_STATS)
+  fputs (to_print, rl_outstream);
+  return 0;
+#else  
+  char *s, c, *new_full_pathname;
+  int extension_char = 0, slen, tlen;
+
+  fputs (to_print, rl_outstream);
+  if (rl_filename_completion_desired && rl_visible_stats)
+    {
+      /* If to_print != full_pathname, to_print is the basename of the
+	 path passed.  In this case, we try to expand the directory
+	 name before checking for the stat character. */
+      if (to_print != full_pathname)
+	{
+	  /* Terminate the directory name. */
+	  c = to_print[-1];
+	  to_print[-1] = '\0';
+
+	  s = tilde_expand (full_pathname);
+	  if (rl_directory_completion_hook)
+	    (*rl_directory_completion_hook) (&s);
+
+	  slen = strlen (s);
+	  tlen = strlen (to_print);
+	  new_full_pathname = xmalloc (slen + tlen + 2);
+	  strcpy (new_full_pathname, s);
+	  new_full_pathname[slen] = '/';
+	  strcpy (new_full_pathname + slen + 1, to_print);
+
+	  extension_char = stat_char (new_full_pathname);
+
+	  free (new_full_pathname);
+	  to_print[-1] = c;
+	}
+      else
+	{
+	  s = tilde_expand (full_pathname);
+	  extension_char = stat_char (s);
+	}
+
+      free (s);
+      if (extension_char)
+	putc (extension_char, rl_outstream);
+      return (extension_char != 0);
+    }
+  else
+    return 0;
+#endif /* VISIBLE_STATS */
+}
+
+/* Complete the word at or before point.
+   WHAT_TO_DO says what to do with the completion.
+   `?' means list the possible completions.
+   TAB means do standard completion.
+   `*' means insert all of the possible completions.
+   `!' means to do standard completion, and list all possible completions if
+   there is more than one. */
+rl_complete_internal (what_to_do)
+     int what_to_do;
+{
+  char **matches;
+  Function *our_func;
+  int start, scan, end, delimiter = 0, pass_next;
+  char *text, *saved_line_buffer;
+  char *replacement;
+  char quote_char = '\0';
+  int found_quote = 0;
+
+  if (rl_line_buffer)
+    saved_line_buffer = savestring (rl_line_buffer);
+  else
+    saved_line_buffer = (char *)NULL;
+
+  if (rl_completion_entry_function)
+    our_func = rl_completion_entry_function;
+  else
+    our_func = (Function *)filename_completion_function;
+
+  /* Only the completion entry function can change these. */
+  rl_filename_completion_desired = 0;
+  rl_filename_quoting_desired = 1;
+
+  /* We now look backwards for the start of a filename/variable word. */
+  end = rl_point;
+
+  if (rl_point)
+    {
+      if (rl_completer_quote_characters)
+	{
+	  /* We have a list of characters which can be used in pairs to
+	     quote substrings for the completer.  Try to find the start
+	     of an unclosed quoted substring. */
+	  /* FOUND_QUOTE is set so we know what kind of quotes we found. */
+	  for (scan = pass_next = 0; scan < end; scan++)
+	    {
+	      if (pass_next)
+		{
+		  pass_next = 0;
+		  continue;
+		}
+
+	      if (rl_line_buffer[scan] == '\\')
+		{
+		  pass_next = 1;
+		  found_quote |= 4;
+		  continue;
+		}
+
+	      if (quote_char != '\0')
+		{
+		  /* Ignore everything until the matching close quote char. */
+		  if (rl_line_buffer[scan] == quote_char)
+		    {
+		      /* Found matching close.  Abandon this substring. */
+		      quote_char = '\0';
+		      rl_point = end;
+		    }
+		}
+	      else if (strchr (rl_completer_quote_characters, rl_line_buffer[scan]))
+		{
+		  /* Found start of a quoted substring. */
+		  quote_char = rl_line_buffer[scan];
+		  rl_point = scan + 1;
+		  /* Shell-like quoting conventions. */
+		  if (quote_char == '\'')
+		    found_quote |= 1;
+		  else if (quote_char == '"')
+		    found_quote |= 2;
+		}
+	    }
+	}
+
+      if (rl_point == end)
+	{
+	  int quoted = 0;
+	  /* We didn't find an unclosed quoted substring upon which to do
+	     completion, so use the word break characters to find the
+	     substring on which to complete. */
+	  while (--rl_point)
+	    {
+	      scan = rl_line_buffer[rl_point];
+
+	      if (strchr (rl_completer_word_break_characters, scan) == 0)
+		continue;
+
+#if defined (SHELL)
+	      /* Don't let word break characters in quoted substrings break
+		 words for the completer. */
+	      if (found_quote && char_is_quoted (rl_line_buffer, rl_point))
+		continue;
+#endif /* SHELL */
+
+	      /* Convoluted code, but it avoids an n^2 algorithm with calls
+	      	 to char_is_quoted. */
+	      break;
+	    }
+	}
+
+      /* If we are at an unquoted word break, then advance past it. */
+      scan = rl_line_buffer[rl_point];
+#if defined (SHELL)
+      if ((found_quote == 0 || char_is_quoted (rl_line_buffer, rl_point) == 0) &&
+          strchr (rl_completer_word_break_characters, scan))
+#else
+      if (strchr (rl_completer_word_break_characters, scan))
+#endif
+	{
+	  /* If the character that caused the word break was a quoting
+	     character, then remember it as the delimiter. */
+	  if (strchr ("\"'", scan) && (end - rl_point) > 1)
+	    delimiter = scan;
+
+	  /* If the character isn't needed to determine something special
+	     about what kind of completion to perform, then advance past it. */
+	  if (!rl_special_prefixes || strchr (rl_special_prefixes, scan) == 0)
+	    rl_point++;
+	}
+    }
+
+  /* At this point, we know we have an open quote if quote_char != '\0'. */
+  start = rl_point;
+  rl_point = end;
+  text = rl_copy_text (start, end);
+
+  /* If the user wants to TRY to complete, but then wants to give
+     up and use the default completion function, they set the
+     variable rl_attempted_completion_function. */
+  if (rl_attempted_completion_function)
+    {
+      matches = (*rl_attempted_completion_function) (text, start, end);
+
+      if (matches || rl_attempted_completion_over)
+	{
+	  rl_attempted_completion_over = 0;
+	  our_func = (Function *)NULL;
+	  goto after_usual_completion;
+	}
+    }
+
+#if defined (SHELL)
+  /* Beware -- we're stripping the quotes here.  Do this only if we know
+     we are doing filename completion. */
+  if (found_quote && our_func == (Function *)filename_completion_function)
+    {
+      /* delete single and double quotes */
+      replacement = _delete_quotes (text);
+      free (text);
+      text = replacement;
+      replacement = (char *)0;
+    }
+#endif /* SHELL */
+
+  matches = completion_matches (text, our_func);
+
+ after_usual_completion:
+  free (text);
+
+  if (!matches)
+    ding ();
+  else
+    {
+      register int i;
+      int should_quote;
+
+      /* It seems to me that in all the cases we handle we would like
+	 to ignore duplicate possiblilities.  Scan for the text to
+	 insert being identical to the other completions. */
+      if (rl_ignore_completion_duplicates)
+	{
+	  char *lowest_common;
+	  int j, newlen = 0;
+	  char dead_slot;
+	  char **temp_array;
+
+	  /* Sort the items. */
+	  /* It is safe to sort this array, because the lowest common
+	     denominator found in matches[0] will remain in place. */
+	  for (i = 0; matches[i]; i++);
+	  qsort (matches, i, sizeof (char *), compare_strings);
+
+	  /* Remember the lowest common denominator for it may be unique. */
+	  lowest_common = savestring (matches[0]);
+
+	  for (i = 0; matches[i + 1]; i++)
+	    {
+	      if (strcmp (matches[i], matches[i + 1]) == 0)
+		{
+		  free (matches[i]);
+		  matches[i] = (char *)&dead_slot;
+		}
+	      else
+		newlen++;
+	    }
+
+	  /* We have marked all the dead slots with (char *)&dead_slot.
+	     Copy all the non-dead entries into a new array. */
+	  temp_array = (char **)xmalloc ((3 + newlen) * sizeof (char *));
+	  for (i = j = 1; matches[i]; i++)
+	    {
+	      if (matches[i] != (char *)&dead_slot)
+		temp_array[j++] = matches[i];
+	    }
+	  temp_array[j] = (char *)NULL;
+
+	  if (matches[0] != (char *)&dead_slot)
+	    free (matches[0]);
+	  free (matches);
+
+	  matches = temp_array;
+
+	  /* Place the lowest common denominator back in [0]. */
+	  matches[0] = lowest_common;
+
+	  /* If there is one string left, and it is identical to the
+	     lowest common denominator, then the LCD is the string to
+	     insert. */
+	  if (j == 2 && strcmp (matches[0], matches[1]) == 0)
+	    {
+	      free (matches[1]);
+	      matches[1] = (char *)NULL;
+	    }
+	}
+
+      switch (what_to_do)
+	{
+	case TAB:
+	case '!':
+	  /* If we are matching filenames, then here is our chance to
+	     do clever processing by re-examining the list.  Call the
+	     ignore function with the array as a parameter.  It can
+	     munge the array, deleting matches as it desires. */
+	  if (rl_ignore_some_completions_function &&
+	      our_func == (Function *)filename_completion_function)
+	    (void)(*rl_ignore_some_completions_function)(matches);
+
+	  /* If we are doing completion on quoted substrings, and any matches
+	     contain any of the completer_word_break_characters, then auto-
+	     matically prepend the substring with a quote character (just pick
+	     the first one from the list of such) if it does not already begin
+	     with a quote string.  FIXME: Need to remove any such automatically
+	     inserted quote character when it no longer is necessary, such as
+	     if we change the string we are completing on and the new set of
+	     matches don't require a quoted substring. */
+	  replacement = matches[0];
+
+	  should_quote = matches[0] && rl_completer_quote_characters &&
+			 rl_filename_completion_desired &&
+			 rl_filename_quoting_desired;
+
+	  if (should_quote)
+#if defined (SHELL)
+	    should_quote = should_quote && (!quote_char || quote_char == '"');
+#else
+	    should_quote = should_quote && !quote_char;
+#endif
+
+	  if (should_quote)
+	    {
+	      int do_replace;
+
+	      do_replace = NO_MATCH;
+
+	      /* If there is a single match, see if we need to quote it.
+		 This also checks whether the common prefix of several
+		 matches needs to be quoted.  If the common prefix should
+		 not be checked, add !matches[1] to the if clause. */
+	      should_quote = rl_strpbrk (matches[0], rl_completer_word_break_characters) != 0;
+#if defined (SHELL)
+	      should_quote = should_quote || rl_strpbrk (matches[0], "#$`") != 0;
+#endif
+
+	      if (should_quote)
+		do_replace = matches[1] ? MULT_MATCH : SINGLE_MATCH;
+
+	      if (do_replace != NO_MATCH)
+		{
+#if defined (SHELL)
+		  /* Quote the replacement, since we found an
+		     embedded word break character in a potential
+		     match. */
+		  char *rtext, *mtext;
+		  int rlen;
+		  extern char *double_quote ();	/* in builtins/common.c */
+
+		  /* If DO_REPLACE == MULT_MATCH, it means that there is
+		     more than one match.  In this case, we do not add
+		     the closing quote or attempt to perform tilde
+		     expansion.  If DO_REPLACE == SINGLE_MATCH, we try
+		     to perform tilde expansion, because double quotes
+		     inhibit tilde expansion by the shell. */
+
+		  mtext = matches[0];
+		  if (mtext[0] == '~' && do_replace == SINGLE_MATCH)
+		    mtext = tilde_expand (matches[0]);
+		  rtext = double_quote (mtext);
+		  if (mtext != matches[0])
+		    free (mtext);
+
+		  rlen = strlen (rtext);
+		  replacement = xmalloc (rlen + 1);
+		  /* If we're completing on a quoted string where the user
+		     has already supplied the opening quote, we don't want
+		     the quote in the replacement text, and we reset
+		     QUOTE_CHAR to 0 to avoid an extra closing quote. */
+		  if (quote_char == '"')
+		    {
+		      strcpy (replacement, rtext + 1);
+		      rlen--;
+		      quote_char = 0;
+		    }
+		  else
+		    strcpy (replacement, rtext);
+		  if (do_replace == MULT_MATCH)
+		    replacement[rlen - 1] = '\0';
+		  free (rtext);
+#else /* !SHELL */
+		  /* Found an embedded word break character in a potential
+		     match, so we need to prepend a quote character if we
+		     are replacing the completion string. */
+		  replacement = xmalloc (strlen (matches[0]) + 2);
+		  quote_char = *rl_completer_quote_characters;
+		  *replacement = quote_char;
+		  strcpy (replacement + 1, matches[0]);
+#endif /* SHELL */
+		}
+	    }
+
+	  if (replacement)
+	    {
+	      rl_begin_undo_group ();
+	      rl_delete_text (start, rl_point);
+	      rl_point = start;
+	      rl_insert_text (replacement);
+	      rl_end_undo_group ();
+	      if (replacement != matches[0])
+		free (replacement);
+	    }
+
+	  /* If there are more matches, ring the bell to indicate.
+	     If this was the only match, and we are hacking files,
+	     check the file to see if it was a directory.  If so,
+	     add a '/' to the name.  If not, and we are at the end
+	     of the line, then add a space. */
+	  if (matches[1])
+	    {
+	      if (what_to_do == '!')
+		goto display_matches;		/* XXX */
+	      else if (rl_editing_mode != vi_mode)
+		ding ();	/* There are other matches remaining. */
+	    }
+	  else
+	    {
+	      char temp_string[4];
+	      int temp_string_index = 0;
+
+	      if (quote_char)
+		temp_string[temp_string_index++] = quote_char;
+
+	      temp_string[temp_string_index++] = delimiter ? delimiter : ' ';
+	      temp_string[temp_string_index++] = '\0';
+
+	      if (rl_filename_completion_desired)
+		{
+		  struct stat finfo;
+		  char *filename = tilde_expand (matches[0]);
+
+		  if ((stat (filename, &finfo) == 0) && S_ISDIR (finfo.st_mode))
+		    {
+		      if (rl_line_buffer[rl_point] != '/')
+			rl_insert_text ("/");
+		    }
+		  else
+		    {
+		      if (rl_point == rl_end)
+			rl_insert_text (temp_string);
+		    }
+		  free (filename);
+		}
+	      else
+		{
+		  if (rl_point == rl_end)
+		    rl_insert_text (temp_string);
+		}
+	    }
+	  break;
+
+	case '*':
+	  {
+	    int i = 1;
+
+	    rl_begin_undo_group ();
+	    rl_delete_text (start, rl_point);
+	    rl_point = start;
+	    if (matches[1])
+	      {
+		while (matches[i])
+		  {
+		    rl_insert_text (matches[i++]);
+		    rl_insert_text (" ");
+		  }
+	      }
+	    else
+	      {
+		rl_insert_text (matches[0]);
+		rl_insert_text (" ");
+	      }
+	    rl_end_undo_group ();
+	  }
+	  break;
+
+	case '?':
+	  {
+	    int len, count, limit, max;
+	    int j, k, l;
+
+	    /* Handle simple case first.  What if there is only one answer? */
+	    if (!matches[1])
+	      {
+		char *temp;
+
+		temp = printable_part (matches[0]);
+		crlf ();
+		print_filename (temp, matches[0]);
+		crlf ();
+		goto restart;
+	      }
+
+	    /* There is more than one answer.  Find out how many there are,
+	       and find out what the maximum printed length of a single entry
+	       is. */
+	  display_matches:
+	    for (max = 0, i = 1; matches[i]; i++)
+	      {
+		char *temp;
+		int name_length;
+
+		temp = printable_part (matches[i]);
+		name_length = strlen (temp);
+
+		if (name_length > max)
+		  max = name_length;
+	      }
+
+	    len = i - 1;
+
+	    /* If there are many items, then ask the user if she
+	       really wants to see them all. */
+	    if (len >= rl_completion_query_items)
+	      {
+		crlf ();
+		fprintf (rl_outstream,
+			 "There are %d possibilities.  Do you really", len);
+		crlf ();
+		fprintf (rl_outstream, "wish to see them all? (y or n)");
+		fflush (rl_outstream);
+		if (!get_y_or_n ())
+		  {
+		    crlf ();
+		    goto restart;
+		  }
+	      }
+
+	    /* How many items of MAX length can we fit in the screen window? */
+	    max += 2;
+	    limit = screenwidth / max;
+	    if (limit != 1 && (limit * max == screenwidth))
+	      limit--;
+
+	    /* Avoid a possible floating exception.  If max > screenwidth,
+	       limit will be 0 and a divide-by-zero fault will result. */
+	    if (limit == 0)
+	      limit = 1;
+
+	    /* How many iterations of the printing loop? */
+	    count = (len + (limit - 1)) / limit;
+
+	    /* Watch out for special case.  If LEN is less than LIMIT, then
+	       just do the inner printing loop. */
+	    if (len < limit)
+	      count = 1;
+
+	    /* Sort the items if they are not already sorted. */
+	    if (!rl_ignore_completion_duplicates)
+	      qsort (matches, len, sizeof (char *), compare_strings);
+
+	    /* Print the sorted items, up-and-down alphabetically, like
+	       ls might. */
+	    crlf ();
+
+	    for (i = 1; i < count + 1; i++)
+	      {
+		for (j = 0, l = i; j < limit; j++)
+		  {
+		    if (l > len || !matches[l])
+		      break;
+		    else
+		      {
+			char *temp;
+			int printed_length;
+
+			temp = printable_part (matches[l]);
+			printed_length = strlen (temp);
+			printed_length += print_filename (temp, matches[l]);
+
+			if (j + 1 < limit)
+			  {
+			    for (k = 0; k < max - printed_length; k++)
+			      putc (' ', rl_outstream);
+			  }
+		      }
+		    l += count;
+		  }
+		crlf ();
+	      }
+	  restart:
+
+	    rl_on_new_line ();
+	  }
+	  break;
+
+	default:
+	  fprintf (stderr, "\r\nreadline: bad value for what_to_do in rl_complete\n");
+	  abort ();
+	}
+
+      for (i = 0; matches[i]; i++)
+	free (matches[i]);
+      free (matches);
+    }
+
+  /* Check to see if the line has changed through all of this manipulation. */
+  if (saved_line_buffer)
+    {
+      if (strcmp (rl_line_buffer, saved_line_buffer) != 0)
+	completion_changed_buffer = 1;
+      else
+	completion_changed_buffer = 0;
+
+      free (saved_line_buffer);
+    }
+  return 0;
+}
+
+#if defined (VISIBLE_STATS)
+/* Return the character which best describes FILENAME.
+     `@' for symbolic links
+     `/' for directories
+     `*' for executables
+     `=' for sockets */
+static int
+stat_char (filename)
+     char *filename;
+{
+  struct stat finfo;
+  int character, r;
+
+#if defined (S_ISLNK)
+  r = lstat (filename, &finfo);
+#else
+  r = stat (filename, &finfo);
+#endif
+
+  if (r == -1)
+    return (0);
+
+  character = 0;
+  if (S_ISDIR (finfo.st_mode))
+    character = '/';
+#if defined (S_ISLNK)
+  else if (S_ISLNK (finfo.st_mode))
+    character = '@';
+#endif /* S_ISLNK */
+#if defined (S_ISSOCK)
+  else if (S_ISSOCK (finfo.st_mode))
+    character = '=';
+#endif /* S_ISSOCK */
+  else if (S_ISREG (finfo.st_mode))
+    {
+      if (access (filename, X_OK) == 0)
+	character = '*';
+    }
+  return (character);
+}
+#endif /* VISIBLE_STATS */
+
+/* Stupid comparison routine for qsort () ing strings. */
+static int
+compare_strings (s1, s2)
+  char **s1, **s2;
+{
+  int result;
+
+  result = **s1 - **s2;
+  if (result == 0)
+    result = strcmp (*s1, *s2);
+
+  return result;
+}
+
+/* A completion function for usernames.
+   TEXT contains a partial username preceded by a random
+   character (usually `~').  */
+char *
+username_completion_function (text, state)
+     int state;
+     char *text;
+{
+#if defined (__GO32__)
+  return (char *)NULL;
+#else /* !__GO32__ */
+  static char *username = (char *)NULL;
+  static struct passwd *entry;
+  static int namelen, first_char, first_char_loc;
+
+  if (!state)
+    {
+      if (username)
+	free (username);
+
+      first_char = *text;
+
+      if (first_char == '~')
+	first_char_loc = 1;
+      else
+	first_char_loc = 0;
+
+      username = savestring (&text[first_char_loc]);
+      namelen = strlen (username);
+      setpwent ();
+    }
+
+  while (entry = getpwent ())
+    {
+      if ((username[0] == entry->pw_name[0]) &&
+	  (strncmp (username, entry->pw_name, namelen) == 0))
+	break;
+    }
+
+  if (!entry)
+    {
+      endpwent ();
+      return ((char *)NULL);
+    }
+  else
+    {
+      char *value = xmalloc (2 + strlen (entry->pw_name));
+
+      *value = *text;
+
+      strcpy (value + first_char_loc, entry->pw_name);
+
+      if (first_char == '~')
+	rl_filename_completion_desired = 1;
+
+      return (value);
+    }
+#endif /* !__GO32__ */
+}
+
+/* **************************************************************** */
+/*								    */
+/*			     Completion				    */
+/*								    */
+/* **************************************************************** */
+
+/* Non-zero means that case is not significant in completion. */
+int completion_case_fold = 0;
+
+/* Return an array of (char *) which is a list of completions for TEXT.
+   If there are no completions, return a NULL pointer.
+   The first entry in the returned array is the substitution for TEXT.
+   The remaining entries are the possible completions.
+   The array is terminated with a NULL pointer.
+
+   ENTRY_FUNCTION is a function of two args, and returns a (char *).
+     The first argument is TEXT.
+     The second is a state argument; it should be zero on the first call, and
+     non-zero on subsequent calls.  It returns a NULL pointer to the caller
+     when there are no more matches.
+ */
+char **
+completion_matches (text, entry_function)
+     char *text;
+     CPFunction *entry_function;
+{
+  /* Number of slots in match_list. */
+  int match_list_size;
+
+  /* The list of matches. */
+  char **match_list =
+    (char **)xmalloc (((match_list_size = 10) + 1) * sizeof (char *));
+
+  /* Number of matches actually found. */
+  int matches = 0;
+
+  /* Temporary string binder. */
+  char *string;
+
+  match_list[1] = (char *)NULL;
+
+  while (string = (*entry_function) (text, matches))
+    {
+      if (matches + 1 == match_list_size)
+	match_list = (char **)xrealloc
+	  (match_list, ((match_list_size += 10) + 1) * sizeof (char *));
+
+      match_list[++matches] = string;
+      match_list[matches + 1] = (char *)NULL;
+    }
+
+  /* If there were any matches, then look through them finding out the
+     lowest common denominator.  That then becomes match_list[0]. */
+  if (matches)
+    {
+      register int i = 1;
+      int low = 100000;		/* Count of max-matched characters. */
+
+      /* If only one match, just use that. */
+      if (matches == 1)
+	{
+	  match_list[0] = match_list[1];
+	  match_list[1] = (char *)NULL;
+	}
+      else
+	{
+	  /* Otherwise, compare each member of the list with
+	     the next, finding out where they stop matching. */
+
+	  while (i < matches)
+	    {
+	      register int c1, c2, si;
+
+	      if (completion_case_fold)
+		{
+		  for (si = 0;
+		       (c1 = to_lower(match_list[i][si])) &&
+		       (c2 = to_lower(match_list[i + 1][si]));
+		       si++)
+		    if (c1 != c2) break;
+		}
+	      else
+		{
+		  for (si = 0;
+		       (c1 = match_list[i][si]) &&
+		       (c2 = match_list[i + 1][si]);
+		       si++)
+		    if (c1 != c2) break;
+		}
+
+	      if (low > si) low = si;
+	      i++;
+	    }
+	  match_list[0] = xmalloc (low + 1);
+	  strncpy (match_list[0], match_list[1], low);
+	  match_list[0][low] = '\0';
+	}
+    }
+  else				/* There were no matches. */
+    {
+      free (match_list);
+      match_list = (char **)NULL;
+    }
+  return (match_list);
+}
+
+/* Okay, now we write the entry_function for filename completion.  In the
+   general case.  Note that completion in the shell is a little different
+   because of all the pathnames that must be followed when looking up the
+   completion for a command. */
+char *
+filename_completion_function (text, state)
+     int state;
+     char *text;
+{
+  static DIR *directory;
+  static char *filename = (char *)NULL;
+  static char *dirname = (char *)NULL;
+  static char *users_dirname = (char *)NULL;
+  static int filename_len;
+
+  struct dirent *entry = (struct dirent *)NULL;
+
+  /* If we don't have any state, then do some initialization. */
+  if (!state)
+    {
+      char *temp;
+
+      if (dirname) free (dirname);
+      if (filename) free (filename);
+      if (users_dirname) free (users_dirname);
+
+      filename = savestring (text);
+      if (!*text) text = ".";
+      dirname = savestring (text);
+
+      temp = strrchr (dirname, '/');
+
+      if (temp)
+	{
+	  strcpy (filename, ++temp);
+	  *temp = '\0';
+	}
+      else
+	strcpy (dirname, ".");
+
+      /* We aren't done yet.  We also support the "~user" syntax. */
+
+      /* Save the version of the directory that the user typed. */
+      users_dirname = savestring (dirname);
+      {
+	char *temp_dirname;
+	int replace_dirname;
+
+	temp_dirname = tilde_expand (dirname);
+	free (dirname);
+	dirname = temp_dirname;
+
+	replace_dirname = 0;
+	if (rl_directory_completion_hook)
+	  replace_dirname = (*rl_directory_completion_hook) (&dirname);
+	if (replace_dirname)
+	  {
+	    free (users_dirname);
+	    users_dirname = savestring (dirname);
+	  }
+      }
+      directory = opendir (dirname);
+      filename_len = strlen (filename);
+
+      rl_filename_completion_desired = 1;
+    }
+
+  /* At this point we should entertain the possibility of hacking wildcarded
+     filenames, like /usr/man/man<WILD>/te<TAB>.  If the directory name
+     contains globbing characters, then build an array of directories, and
+     then map over that list while completing. */
+  /* *** UNIMPLEMENTED *** */
+
+  /* Now that we have some state, we can read the directory. */
+
+  while (directory && (entry = readdir (directory)))
+    {
+      /* Special case for no filename.
+	 All entries except "." and ".." match. */
+      if (!filename_len)
+	{
+	  if ((strcmp (entry->d_name, ".") != 0) &&
+	      (strcmp (entry->d_name, "..") != 0))
+	    break;
+	}
+      else
+	{
+	  /* Otherwise, if these match up to the length of filename, then
+	     it is a match. */
+	    if ((entry->d_name[0] == filename[0]) &&
+		(((int)D_NAMLEN (entry)) >= filename_len) &&
+		(strncmp (filename, entry->d_name, filename_len) == 0))
+	      break;
+	}
+    }
+
+  if (!entry)
+    {
+      if (directory)
+	{
+	  closedir (directory);
+	  directory = (DIR *)NULL;
+	}
+      if (dirname)
+	{
+	  free (dirname);
+	  dirname = (char *)NULL;
+	}
+      if (filename)
+	{
+	  free (filename);
+	  filename = (char *)NULL;
+	}
+      if (users_dirname)
+	{
+	  free (users_dirname);
+	  users_dirname = (char *)NULL;
+	}
+
+      return (char *)NULL;
+    }
+  else
+    {
+      char *temp;
+
+      /* dirname && (strcmp (dirname, ".") != 0) */
+      if (dirname && (dirname[0] != '.' || dirname[1]))
+	{
+	  if (rl_complete_with_tilde_expansion && *users_dirname == '~')
+	    {
+	      int dirlen = strlen (dirname);
+	      temp = xmalloc (2 + dirlen + D_NAMLEN (entry));
+	      strcpy (temp, dirname);
+	      /* Canonicalization cuts off any final slash present.  We need
+		 to add it back. */
+	      if (dirname[dirlen - 1] != '/')
+	        {
+	          temp[dirlen] = '/';
+	          temp[dirlen + 1] = '\0';
+	        }
+	    }
+	  else
+	    {
+	      temp = xmalloc (1 + strlen (users_dirname) + D_NAMLEN (entry));
+	      strcpy (temp, users_dirname);
+	    }
+
+	  strcat (temp, entry->d_name);
+	}
+      else
+	temp = (savestring (entry->d_name));
+
+      return (temp);
+    }
+}
+
+/* A function for simple tilde expansion. */
+int
+rl_tilde_expand (ignore, key)
+     int ignore, key;
+{
+  register int start, end;
+  char *homedir;
+
+  end = rl_point;
+  start = end - 1;
+
+  if (rl_point == rl_end && rl_line_buffer[rl_point] == '~')
+    {
+      homedir = tilde_expand ("~");
+      goto insert;
+    }
+  else if (rl_line_buffer[start] != '~')
+    {
+      for (; !whitespace (rl_line_buffer[start]) && start >= 0; start--);
+      start++;
+    }
+
+  end = start;
+  do
+    {
+      end++;
+    }
+  while (!whitespace (rl_line_buffer[end]) && end < rl_end);
+
+  if (whitespace (rl_line_buffer[end]) || end >= rl_end)
+    end--;
+
+  /* If the first character of the current word is a tilde, perform
+     tilde expansion and insert the result.  If not a tilde, do
+     nothing. */
+  if (rl_line_buffer[start] == '~')
+    {
+      char *temp;
+      int len;
+
+      len = end - start + 1;
+      temp = xmalloc (len + 1);
+      strncpy (temp, rl_line_buffer + start, len);
+      temp[len] = '\0';
+      homedir = tilde_expand (temp);
+      free (temp);
+
+    insert:
+      rl_begin_undo_group ();
+      rl_delete_text (start, end + 1);
+      rl_point = start;
+      rl_insert_text (homedir);
+      rl_end_undo_group ();
+    }
+
+  return (0);
+}
+
+/* Find the first occurrence in STRING1 of any character from STRING2.
+   Return a pointer to the character in STRING1. */
+static char *
+rl_strpbrk (string1, string2)
+     char *string1, *string2;
+{
+  register char *scan;
+
+  for (; *string1; string1++)
+    {
+      for (scan = string2; *scan; scan++)
+	{
+	  if (*string1 == *scan)
+	    {
+	      return (string1);
+	    }
+	}
+    }
+  return ((char *)NULL);
+}
+
+#if defined (STATIC_MALLOC)
+
+/* **************************************************************** */
+/*								    */
+/*			xmalloc and xrealloc ()		     	    */
+/*								    */
+/* **************************************************************** */
+
+static void memory_error_and_abort ();
+
+static char *
+xmalloc (bytes)
+     int bytes;
+{
+  char *temp = (char *)malloc (bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+  return (temp);
+}
+
+static char *
+xrealloc (pointer, bytes)
+     char *pointer;
+     int bytes;
+{
+  char *temp;
+
+  if (!pointer)
+    temp = (char *)malloc (bytes);
+  else
+    temp = (char *)realloc (pointer, bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+
+  return (temp);
+}
+
+static void
+memory_error_and_abort ()
+{
+  fprintf (stderr, "readline: Out of virtual memory!\n");
+  abort ();
+}
+#endif /* STATIC_MALLOC */
diff --git a/config.h b/config.h
new file mode 100644
index 0000000..045ea22
--- /dev/null
+++ b/config.h
@@ -0,0 +1,71 @@
+/* config.h.  Generated automatically by configure.  */
+/* config.h.in.  Generated automatically from configure.in by autoheader.  */
+
+#ifndef _RL_CONFIG_H
+#define _RL_CONFIG_H
+
+/* Define if using alloca.c.  */
+/* #undef C_ALLOCA */
+
+/* Define to one of _getb67, GETB67, getb67 for Cray-2 and Cray-YMP systems.
+   This function is required for alloca.c support on those systems.  */
+/* #undef CRAY_STACKSEG_END */
+
+/* Define if you have alloca.h and it should be used (not Ultrix).  */
+#define HAVE_ALLOCA_H 1
+
+/* If using the C implementation of alloca, define if you know the
+   direction of stack growth for your system; otherwise it will be
+   automatically deduced at run-time.
+	STACK_DIRECTION > 0 => grows toward higher addresses
+	STACK_DIRECTION < 0 => grows toward lower addresses
+	STACK_DIRECTION = 0 => direction of growth unknown
+ */
+/* #undef STACK_DIRECTION */
+
+/* Define if you do not have strings.h, index, bzero, etc..  */
+/* #undef USG */
+
+/* Define if your system defines TIOCGWINSZ in sys/ioctl.h.  */
+#define GWINSZ_IN_SYS_IOCTL 1
+
+/* #undef HAVE_GETPW_DECLS */
+#define NO_SYS_FILE 1
+
+/* Define if you have strcasecmp.  */
+#define HAVE_STRCASECMP 1
+
+/* Define if you have the <alloca.h> header file.  */
+#define HAVE_ALLOCA_H 1
+
+/* Define if you have the <dirent.h> header file.  */
+/* #undef HAVE_DIRENT_H */
+
+/* Define if you have the <stdlib.h> header file.  */
+/* #undef HAVE_STDLIB_H */
+
+/* Define if you have the <string.h> header file.  */
+/* #undef HAVE_STRING_H */
+
+/* Define if you have the <sys/pte.h> header file.  */
+/* #undef HAVE_SYS_PTE_H */
+
+/* Define if you have the <sys/ptem.h> header file.  */
+/* #undef HAVE_SYS_PTEM_H */
+
+/* Define if you have the <sys/stream.h> header file.  */
+/* #undef HAVE_SYS_STREAM_H */
+
+/* Define if you have the <termcap.h> header file.  */
+/* #undef HAVE_TERMCAP_H */
+
+/* Define if you have the <termio.h> header file.  */
+/* #undef HAVE_TERMIO_H */
+
+/* Define if you have the <unistd.h> header file.  */
+/* #undef HAVE_UNISTD_H */
+
+/* Define if you have the <varargs.h> header file.  */
+/* #undef HAVE_VARARGS_H */
+
+#endif
diff --git a/config.h.in b/config.h.in
new file mode 100644
index 0000000..7d7525d
--- /dev/null
+++ b/config.h.in
@@ -0,0 +1,70 @@
+/* config.h.in.  Generated automatically from configure.in by autoheader.  */
+
+#ifndef _RL_CONFIG_H
+#define _RL_CONFIG_H
+
+/* Define if using alloca.c.  */
+#undef C_ALLOCA
+
+/* Define to one of _getb67, GETB67, getb67 for Cray-2 and Cray-YMP systems.
+   This function is required for alloca.c support on those systems.  */
+#undef CRAY_STACKSEG_END
+
+/* Define if you have alloca.h and it should be used (not Ultrix).  */
+#undef HAVE_ALLOCA_H
+
+/* If using the C implementation of alloca, define if you know the
+   direction of stack growth for your system; otherwise it will be
+   automatically deduced at run-time.
+	STACK_DIRECTION > 0 => grows toward higher addresses
+	STACK_DIRECTION < 0 => grows toward lower addresses
+	STACK_DIRECTION = 0 => direction of growth unknown
+ */
+#undef STACK_DIRECTION
+
+/* Define if you do not have strings.h, index, bzero, etc..  */
+#undef USG
+
+/* Define if your system defines TIOCGWINSZ in sys/ioctl.h.  */
+#undef GWINSZ_IN_SYS_IOCTL
+
+#undef HAVE_GETPW_DECLS
+#undef NO_SYS_FILE
+
+/* Define if you have strcasecmp.  */
+#undef HAVE_STRCASECMP
+
+/* Define if you have the <alloca.h> header file.  */
+#undef HAVE_ALLOCA_H
+
+/* Define if you have the <dirent.h> header file.  */
+#undef HAVE_DIRENT_H
+
+/* Define if you have the <stdlib.h> header file.  */
+#undef HAVE_STDLIB_H
+
+/* Define if you have the <string.h> header file.  */
+#undef HAVE_STRING_H
+
+/* Define if you have the <sys/pte.h> header file.  */
+#undef HAVE_SYS_PTE_H
+
+/* Define if you have the <sys/ptem.h> header file.  */
+#undef HAVE_SYS_PTEM_H
+
+/* Define if you have the <sys/stream.h> header file.  */
+#undef HAVE_SYS_STREAM_H
+
+/* Define if you have the <termcap.h> header file.  */
+#undef HAVE_TERMCAP_H
+
+/* Define if you have the <termio.h> header file.  */
+#undef HAVE_TERMIO_H
+
+/* Define if you have the <unistd.h> header file.  */
+#undef HAVE_UNISTD_H
+
+/* Define if you have the <varargs.h> header file.  */
+#undef HAVE_VARARGS_H
+
+#endif
diff --git a/config.status b/config.status
new file mode 100755
index 0000000..b6bc9ee
--- /dev/null
+++ b/config.status
@@ -0,0 +1,190 @@
+#!/bin/sh
+# Generated automatically by configure.
+# Run this file to recreate the current configuration.
+# This directory was configured as follows,
+# on host odin:
+#
+# ./configure  --with-gcc
+
+ac_cs_usage="Usage: config.status [--recheck] [--version] [--help]"
+for ac_option
+do
+  case "$ac_option" in
+  -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r)
+    echo running ${CONFIG_SHELL-/bin/sh} ./configure  --with-gcc --no-create
+    exec ${CONFIG_SHELL-/bin/sh} ./configure  --with-gcc --no-create ;;
+  -version | --version | --versio | --versi | --vers | --ver | --ve | --v)
+    echo "config.status generated by autoconf version 1.11"
+    exit 0 ;;
+  -help | --help | --hel | --he | --h)
+    echo "$ac_cs_usage"; exit 0 ;;
+  *) echo "$ac_cs_usage"; exit 1 ;;
+  esac
+done
+
+trap 'rm -fr Makefile config.h conftest*; exit 1' 1 2 15
+CC='gcc'
+CFLAGS='-g -O'
+LDFLAGS=''
+CPP='/lib/cpp'
+INSTALL='/bin/install -c'
+INSTALL_PROGRAM='${INSTALL}'
+INSTALL_DATA='${INSTALL} -m 644'
+RANLIB='ranlib'
+ALLOCA=''
+LIBS=''
+srcdir='.'
+top_srcdir=''
+prefix='/usr/local'
+exec_prefix='${prefix}'
+ac_prsub=''
+ac_vpsub='/^[ 	]*VPATH[ 	]*=[^:]*$/d'
+extrasub=''
+
+ac_given_srcdir=$srcdir
+
+CONFIG_FILES=${CONFIG_FILES-"Makefile"}
+for ac_file in .. ${CONFIG_FILES}; do if test "x$ac_file" != x..; then
+  # Remove last slash and all that follows it.  Not all systems have dirname.
+  ac_dir=`echo $ac_file|sed 's%/[^/][^/]*$%%'`
+  if test "$ac_dir" != "$ac_file" && test "$ac_dir" != .; then
+    # The file is in a subdirectory.
+    test ! -d "$ac_dir" && mkdir "$ac_dir"
+    ac_dir_suffix="/$ac_dir"
+  else
+    ac_dir_suffix=
+  fi
+
+  # A "../" for each directory in $ac_dir_suffix.
+  ac_dots=`echo $ac_dir_suffix|sed 's%/[^/]*%../%g'`
+  case "$ac_given_srcdir" in
+  .)  srcdir=.
+      if test -z "$ac_dir_suffix"; then top_srcdir=.
+      else top_srcdir=`echo $ac_dots|sed 's%/$%%'`; fi ;;
+  /*) srcdir="$ac_given_srcdir$ac_dir_suffix"; top_srcdir="$ac_given_srcdir" ;;
+  *) # Relative path.
+    srcdir="$ac_dots$ac_given_srcdir$ac_dir_suffix"
+    top_srcdir="$ac_dots$ac_given_srcdir" ;;
+  esac
+
+  echo creating "$ac_file"
+  rm -f "$ac_file"
+  comment_str="Generated automatically from `echo $ac_file|sed 's|.*/||'`.in by configure."
+  case "$ac_file" in
+    *.c | *.h | *.C | *.cc | *.m )  echo "/* $comment_str */" > "$ac_file" ;;
+    * )          echo "# $comment_str"     > "$ac_file" ;;
+  esac
+  sed -e "
+$ac_prsub
+$ac_vpsub
+$extrasub
+s%@CC@%$CC%g
+s%@CFLAGS@%$CFLAGS%g
+s%@LDFLAGS@%$LDFLAGS%g
+s%@CPP@%$CPP%g
+s%@INSTALL@%$INSTALL%g
+s%@INSTALL_PROGRAM@%$INSTALL_PROGRAM%g
+s%@INSTALL_DATA@%$INSTALL_DATA%g
+s%@RANLIB@%$RANLIB%g
+s%@ALLOCA@%$ALLOCA%g
+s%@LIBS@%$LIBS%g
+s%@srcdir@%$srcdir%g
+s%@top_srcdir@%$top_srcdir%g
+s%@prefix@%$prefix%g
+s%@exec_prefix@%$exec_prefix%g
+s%@DEFS@%-DHAVE_CONFIG_H%" $ac_given_srcdir/${ac_file}.in >> $ac_file
+fi; done
+
+# These sed commands are put into ac_sed_defs when defining a macro.
+# They are broken into pieces to make the sed script easier to manage.
+# They are passed to sed as "A NAME B NAME C VALUE D", where NAME
+# is the cpp macro being defined and VALUE is the value it is being given.
+# Each defining turns into a single global substitution command.
+# Hopefully no one uses "!" as a variable value.
+# Other candidates for the sed separators, like , and @, do get used.
+#
+# ac_d sets the value in "#define NAME VALUE" lines.
+ac_dA='s!^\([ 	]*\)#\([ 	]*define[ 	][ 	]*\)'
+ac_dB='\([ 	][ 	]*\)[^ 	]*!\1#\2'
+ac_dC='\3'
+ac_dD='!g'
+# ac_u turns "#undef NAME" with trailing blanks into "#define NAME VALUE".
+ac_uA='s!^\([ 	]*\)#\([ 	]*\)undef\([ 	][ 	]*\)'
+ac_uB='\([ 	]\)!\1#\2define\3'
+ac_uC=' '
+ac_uD='\4!g'
+# ac_e turns "#undef NAME" without trailing blanks into "#define NAME VALUE".
+ac_eA='s!^\([ 	]*\)#\([ 	]*\)undef\([ 	][ 	]*\)'
+ac_eB='$!\1#\2define\3'
+ac_eC=' '
+ac_eD='!g'
+rm -f conftest.sed
+cat >> conftest.sed <<CONFEOF
+${ac_dA}HAVE_STRCASECMP${ac_dB}HAVE_STRCASECMP${ac_dC}1${ac_dD}
+${ac_uA}HAVE_STRCASECMP${ac_uB}HAVE_STRCASECMP${ac_uC}1${ac_uD}
+${ac_eA}HAVE_STRCASECMP${ac_eB}HAVE_STRCASECMP${ac_eC}1${ac_eD}
+${ac_dA}NO_SYS_FILE${ac_dB}NO_SYS_FILE${ac_dC}1${ac_dD}
+${ac_uA}NO_SYS_FILE${ac_uB}NO_SYS_FILE${ac_uC}1${ac_uD}
+${ac_eA}NO_SYS_FILE${ac_eB}NO_SYS_FILE${ac_eC}1${ac_eD}
+${ac_dA}GWINSZ_IN_SYS_IOCTL${ac_dB}GWINSZ_IN_SYS_IOCTL${ac_dC}1${ac_dD}
+${ac_uA}GWINSZ_IN_SYS_IOCTL${ac_uB}GWINSZ_IN_SYS_IOCTL${ac_uC}1${ac_uD}
+${ac_eA}GWINSZ_IN_SYS_IOCTL${ac_eB}GWINSZ_IN_SYS_IOCTL${ac_eC}1${ac_eD}
+CONFEOF
+cat >> conftest.sed <<CONFEOF
+${ac_dA}HAVE_ALLOCA_H${ac_dB}HAVE_ALLOCA_H${ac_dC}1${ac_dD}
+${ac_uA}HAVE_ALLOCA_H${ac_uB}HAVE_ALLOCA_H${ac_uC}1${ac_uD}
+${ac_eA}HAVE_ALLOCA_H${ac_eB}HAVE_ALLOCA_H${ac_eC}1${ac_eD}
+${ac_dA}HAVE_ALLOCA${ac_dB}HAVE_ALLOCA${ac_dC}1${ac_dD}
+${ac_uA}HAVE_ALLOCA${ac_uB}HAVE_ALLOCA${ac_uC}1${ac_uD}
+${ac_eA}HAVE_ALLOCA${ac_eB}HAVE_ALLOCA${ac_eC}1${ac_eD}
+
+CONFEOF
+# This sed command replaces #undef's with comments.  This is necessary, for
+# example, in the case of _POSIX_SOURCE, which is predefined and required
+# on some systems where configure will not decide to define it in
+# config.h.
+cat >> conftest.sed <<\CONFEOF
+s,^[ 	]*#[ 	]*undef[ 	][ 	]*[a-zA-Z_][a-zA-Z_0-9]*,/* & */,
+CONFEOF
+rm -f conftest.h
+# Break up the sed commands because old seds have small limits.
+ac_max_sed_lines=20
+
+CONFIG_HEADERS=${CONFIG_HEADERS-"config.h"}
+for ac_file in .. ${CONFIG_HEADERS}; do if test "x$ac_file" != x..; then
+  echo creating $ac_file
+
+  cp $ac_given_srcdir/$ac_file.in conftest.h1
+  cp conftest.sed conftest.stm
+  while :
+  do
+    ac_lines=`grep -c . conftest.stm`
+    if test -z "$ac_lines" || test "$ac_lines" -eq 0; then break; fi
+    rm -f conftest.s1 conftest.s2 conftest.h2
+    sed ${ac_max_sed_lines}q conftest.stm > conftest.s1 # Like head -20.
+    sed 1,${ac_max_sed_lines}d conftest.stm > conftest.s2 # Like tail +21.
+    sed -f conftest.s1 < conftest.h1 > conftest.h2
+    rm -f conftest.s1 conftest.h1 conftest.stm
+    mv conftest.h2 conftest.h1
+    mv conftest.s2 conftest.stm
+  done
+  rm -f conftest.stm conftest.h
+  echo "/* $ac_file.  Generated automatically by configure.  */" > conftest.h
+  cat conftest.h1 >> conftest.h
+  rm -f conftest.h1
+  if cmp -s $ac_file conftest.h 2>/dev/null; then
+    # The file exists and we would not be changing it.
+    echo "$ac_file is unchanged"
+    rm -f conftest.h
+  else
+    rm -f $ac_file
+    mv conftest.h $ac_file
+  fi
+fi; done
+rm -f conftest.sed
+
+
+
+# Makefile uses this timestamp file to record whether config.h is up to date.
+touch stamp-config
+exit 0
diff --git a/configure b/configure
new file mode 100755
index 0000000..c1b0a63
--- /dev/null
+++ b/configure
@@ -0,0 +1,1240 @@
+#!/bin/sh
+# Guess values for system-dependent variables and create Makefiles.
+# Generated automatically using autoconf version 1.11 
+# Copyright (C) 1991, 1992, 1993, 1994 Free Software Foundation, Inc.
+
+# This configure script is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as published
+# by the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This script is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General
+# Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
+
+# Save the original args to write them into config.status later.
+configure_args="$*"
+
+# Only options that might do something get documented.
+ac_usage="Usage: configure [options] [host]
+Options: [defaults in brackets after descriptions]
+--build=BUILD		configure for building on BUILD [BUILD=HOST]
+--disable-FEATURE	do not include FEATURE (same as --enable-FEATURE=no)
+--enable-FEATURE[=ARG]	include FEATURE [ARG=yes]
+--exec-prefix=PREFIX	install host dependent files in PREFIX [/usr/local]
+--help			print this message
+--host=HOST		configure for HOST [guessed]
+--prefix=PREFIX		install host independent files in PREFIX [/usr/local]
+--quiet, --silent	do not print \`checking for...' messages
+--srcdir=DIR		find the sources in DIR [configure dir or ..]
+--target=TARGET		configure for TARGET [TARGET=HOST]
+--verbose		print results of checks
+--version		print the version of autoconf that created configure
+--with-PACKAGE[=ARG]	use PACKAGE [ARG=yes]
+--without-PACKAGE	do not use PACKAGE (same as --with-PACKAGE=no)
+--x-includes=DIR	X include files are in DIR
+--x-libraries=DIR	X library files are in DIR"
+
+# Initialize some variables set by options.
+# The variables have the same names as the options, with
+# dashes changed to underlines.
+build=NONE
+exec_prefix=
+host=NONE
+no_create=
+nonopt=NONE
+norecursion=
+prefix=
+program_prefix=
+program_suffix=
+program_transform_name=
+silent=
+srcdir=
+target=NONE
+verbose=
+x_includes=
+x_libraries=
+
+ac_prev=
+for ac_option
+do
+
+  # If the previous option needs an argument, assign it.
+  if test -n "$ac_prev"; then
+    eval "$ac_prev=\$ac_option"
+    ac_prev=
+    continue
+  fi
+
+  # Accept (but ignore some of) the important Cygnus configure
+  # options, so we can diagnose typos.
+
+  case "$ac_option" in
+  -*=*) ac_optarg=`echo "$ac_option" | sed 's/[-_a-zA-Z0-9]*=//'` ;;
+  *) ac_optarg= ;;
+  esac
+
+  case "$ac_option" in
+
+  -build | --build | --buil | --bui | --bu | --b)
+    ac_prev=build ;;
+  -build=* | --build=* | --buil=* | --bui=* | --bu=* | --b=*)
+    build="$ac_optarg" ;;
+
+  -disable-* | --disable-*)
+    ac_feature=`echo $ac_option|sed -e 's/-*disable-//'`
+    # Reject names that aren't valid shell variable names.
+    if test -n "`echo $ac_feature| sed 's/[-a-zA-Z0-9_]//g'`"; then
+      echo "configure: $ac_feature: invalid feature name" >&2; exit 1
+    fi
+    ac_feature=`echo $ac_feature| sed 's/-/_/g'`
+    eval "enable_${ac_feature}=no" ;;
+
+  -enable-* | --enable-*)
+    ac_feature=`echo $ac_option|sed -e 's/-*enable-//' -e 's/=.*//'`
+    # Reject names that aren't valid shell variable names.
+    if test -n "`echo $ac_feature| sed 's/[-_a-zA-Z0-9]//g'`"; then
+      echo "configure: $ac_feature: invalid feature name" >&2; exit 1
+    fi
+    ac_feature=`echo $ac_feature| sed 's/-/_/g'`
+    case "$ac_option" in
+      *=*) ;;
+      *) ac_optarg=yes ;;
+    esac
+    eval "enable_${ac_feature}='$ac_optarg'" ;;
+
+  # For backward compatibility, recognize -exec-prefix and --exec_prefix.
+  -exec-prefix | --exec_prefix | --exec-prefix | --exec-prefi \
+  | --exec-pref | --exec-pre | --exec-pr | --exec-p | --exec- \
+  | --exec | --exe | --ex)
+    ac_prev=exec_prefix ;;
+  -exec-prefix=* | --exec_prefix=* | --exec-prefix=* | --exec-prefi=* \
+  | --exec-pref=* | --exec-pre=* | --exec-pr=* | --exec-p=* | --exec-=* \
+  | --exec=* | --exe=* | --ex=*)
+    exec_prefix="$ac_optarg" ;;
+
+  -gas | --gas | --ga | --g)
+    with_gas=yes ;; # Obsolete; use --with-gas.
+
+  -help | --help | --hel | --he)
+    cat << EOF
+$ac_usage
+EOF
+    exit 0 ;;
+
+  -host | --host | --hos | --ho)
+    ac_prev=host ;;
+  -host=* | --host=* | --hos=* | --ho=*)
+    host="$ac_optarg" ;;
+
+  -nfp | --nfp | --nf)
+    with_fp=no ;; # Obsolete; use --without-fp.
+
+  -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+  | --no-cr | --no-c)
+    no_create=yes ;;
+
+  -norecursion | --norecursion | --norecursio | --norecursi \
+  | --norecurs | --norecur | --norecu | --norec | --nore | --nor)
+    norecursion=yes ;;
+
+  -prefix | --prefix | --prefi | --pref | --pre | --pr | --p)
+    ac_prev=prefix ;;
+  -prefix=* | --prefix=* | --prefi=* | --pref=* | --pre=* | --pr=* | --p=*)
+    prefix="$ac_optarg" ;;
+
+  -program-prefix | --program-prefix | --program-prefi | --program-pref \
+  | --program-pre | --program-pr | --program-p)
+    ac_prev=program_prefix ;;
+  -program-prefix=* | --program-prefix=* | --program-prefi=* \
+  | --program-pref=* | --program-pre=* | --program-pr=* | --program-p=*)
+    program_prefix="$ac_optarg" ;;
+
+  -program-suffix | --program-suffix | --program-suffi | --program-suff \
+  | --program-suf | --program-su | --program-s)
+    ac_prev=program_suffix ;;
+  -program-suffix=* | --program-suffix=* | --program-suffi=* \
+  | --program-suff=* | --program-suf=* | --program-su=* | --program-s=*)
+    program_suffix="$ac_optarg" ;;
+
+  -program-transform-name | --program-transform-name \
+  | --program-transform-nam | --program-transform-na \
+  | --program-transform-n | --program-transform- \
+  | --program-transform | --program-transfor \
+  | --program-transfo | --program-transf \
+  | --program-trans | --program-tran \
+  | --progr-tra | --program-tr | --program-t)
+    ac_prev=program_transform_name ;;
+  -program-transform-name=* | --program-transform-name=* \
+  | --program-transform-nam=* | --program-transform-na=* \
+  | --program-transform-n=* | --program-transform-=* \
+  | --program-transform=* | --program-transfor=* \
+  | --program-transfo=* | --program-transf=* \
+  | --program-trans=* | --program-tran=* \
+  | --progr-tra=* | --program-tr=* | --program-t=*)
+    program_transform_name="$ac_optarg" ;;
+
+  -q | -quiet | --quiet | --quie | --qui | --qu | --q \
+  | -silent | --silent | --silen | --sile | --sil)
+    silent=yes ;;
+
+  -srcdir | --srcdir | --srcdi | --srcd | --src | --sr)
+    ac_prev=srcdir ;;
+  -srcdir=* | --srcdir=* | --srcdi=* | --srcd=* | --src=* | --sr=*)
+    srcdir="$ac_optarg" ;;
+
+  -target | --target | --targe | --targ | --tar | --ta | --t)
+    ac_prev=target ;;
+  -target=* | --target=* | --targe=* | --targ=* | --tar=* | --ta=* | --t=*)
+    target="$ac_optarg" ;;
+
+  -v | -verbose | --verbose | --verbos | --verbo | --verb)
+    verbose=yes ;;
+
+  -version | --version | --versio | --versi | --vers)
+    echo "configure generated by autoconf version 1.11"
+    exit 0 ;;
+
+  -with-* | --with-*)
+    ac_package=`echo $ac_option|sed -e 's/-*with-//' -e 's/=.*//'`
+    # Reject names that aren't valid shell variable names.
+    if test -n "`echo $ac_package| sed 's/[-_a-zA-Z0-9]//g'`"; then
+      echo "configure: $ac_package: invalid package name" >&2; exit 1
+    fi
+    ac_package=`echo $ac_package| sed 's/-/_/g'`
+    case "$ac_option" in
+      *=*) ;;
+      *) ac_optarg=yes ;;
+    esac
+    eval "with_${ac_package}='$ac_optarg'" ;;
+
+  -without-* | --without-*)
+    ac_package=`echo $ac_option|sed -e 's/-*without-//'`
+    # Reject names that aren't valid shell variable names.
+    if test -n "`echo $ac_package| sed 's/[-a-zA-Z0-9_]//g'`"; then
+      echo "configure: $ac_package: invalid package name" >&2; exit 1
+    fi
+    ac_package=`echo $ac_package| sed 's/-/_/g'`
+    eval "with_${ac_package}=no" ;;
+
+  --x) with_x=yes ;; # Obsolete; use --with-x.
+
+  -x-includes | --x-includes | --x-include | --x-includ | --x-inclu \
+  | --x-incl | --x-inc | --x-in | --x-i)
+    ac_prev=x_includes ;;
+  -x-includes=* | --x-includes=* | --x-include=* | --x-includ=* | --x-inclu=* \
+  | --x-incl=* | --x-inc=* | --x-in=* | --x-i=*)
+    x_includes="$ac_optarg" ;;
+
+  -x-libraries | --x-libraries | --x-librarie | --x-librari \
+  | --x-librar | --x-libra | --x-libr | --x-lib | --x-li | --x-l)
+    ac_prev=x_libraries ;;
+  -x-libraries=* | --x-libraries=* | --x-librarie=* | --x-librari=* \
+  | --x-librar=* | --x-libra=* | --x-libr=* | --x-lib=* | --x-li=* | --x-l=*)
+    x_libraries="$ac_optarg" ;;
+
+  -*) echo "configure: $ac_option: invalid option; use --help to show usage" >&2; exit 1
+    ;;
+
+  *) 
+    if test -n "`echo $ac_option| sed 's/[-a-z0-9.]//g'`"; then
+      echo "configure: warning: $ac_option: invalid host type" >&2
+    fi
+    if test "x$nonopt" != xNONE; then
+      echo "configure: can only configure for one host and one target at a time" >&2; exit 1
+    fi
+    nonopt="$ac_option"
+    ;;
+
+  esac
+done
+
+if test -n "$ac_prev"; then
+  echo "configure: missing argument to --`echo $ac_prev | sed 's/_/-/g'`" >&2; exit 1
+fi
+
+trap 'rm -fr conftest* confdefs* core $ac_clean_files; exit 1' 1 2 15
+trap 'rm -fr confdefs* $ac_clean_files' 0
+
+# Save the original args if we used an alternate arg parser.
+ac_configure_temp="${configure_args-$*}"
+# Strip out --no-create and --norecursion so they don't pile up.
+configure_args=
+for ac_arg in $ac_configure_temp; do
+  case "$ac_arg" in
+  -no-create | --no-create | --no-creat | --no-crea | --no-cre \
+  | --no-cr | --no-c) ;;
+  -norecursion | --norecursion | --norecursio | --norecursi \
+  | --norecurs | --norecur | --norecu | --norec | --nore | --nor) ;;
+  *) configure_args="$configure_args $ac_arg" ;;
+  esac
+done
+
+# NLS nuisances.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+if test "${LC_ALL+set}" = 'set'; then LC_ALL=C; export LC_ALL; fi
+if test "${LANG+set}"   = 'set'; then LANG=C;   export LANG;   fi
+
+# confdefs.h avoids OS command line length limits that DEFS can exceed.
+rm -rf conftest* confdefs.h
+# AIX cpp loses on an empty file, so make sure it contains at least a newline.
+echo > confdefs.h
+
+# A filename unique to this package, relative to the directory that
+# configure is in, which we can look for to find out if srcdir is correct.
+ac_unique_file=readline.h
+
+# Find the source files, if location was not specified.
+if test -z "$srcdir"; then
+  ac_srcdir_defaulted=yes
+  # Try the directory containing this script, then `..'.
+  ac_prog=$0
+  ac_confdir=`echo $ac_prog|sed 's%/[^/][^/]*$%%'`
+  test "x$ac_confdir" = "x$ac_prog" && ac_confdir=.
+  srcdir=$ac_confdir
+  if test ! -r $srcdir/$ac_unique_file; then
+    srcdir=..
+  fi
+fi
+if test ! -r $srcdir/$ac_unique_file; then
+  if test x$ac_srcdir_defaulted = xyes; then
+    echo "configure: can not find sources in ${ac_confdir} or .." >&2; exit 1
+  else
+    echo "configure: can not find sources in ${srcdir}" >&2; exit 1
+  fi
+fi
+ac_ext=c
+# CFLAGS is not in ac_cpp because -g, -O, etc. are not valid cpp options.
+ac_cpp='${CPP}'
+ac_compile='${CC-cc} $CFLAGS $LDFLAGS conftest.${ac_ext} -o conftest $LIBS >/dev/null 2>&1'
+
+
+
+#!/bin/sh
+# From configure.in Configure for Readline 2.0
+
+
+# We want these before the checks, so the checks can modify their values.
+test -z "$CFLAGS" && CFLAGS=-g auto_cflags=1
+
+if test -z "$CC"; then
+  # Extract the first word of `gcc', so it can be a program name with args.
+  set ac_dummy gcc; ac_word=$2
+  test -n "$silent" || echo "checking for $ac_word"
+  IFS="${IFS= 	}"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+  for ac_dir in $PATH; do
+    test -z "$ac_dir" && ac_dir=.
+    if test -f $ac_dir/$ac_word; then
+      CC="gcc"
+      break
+    fi
+  done
+  IFS="$ac_save_ifs"
+fi
+test -z "$CC" && CC="cc"
+test -n "$CC" && test -n "$verbose" && echo "	setting CC to $CC"
+
+# Find out if we are using GNU C, under whatever name.
+cat > conftest.c <<EOF
+#ifdef __GNUC__
+  yes
+#endif
+EOF
+${CC-cc} -E conftest.c > conftest.out 2>&1
+if egrep yes conftest.out >/dev/null 2>&1; then
+  GCC=1 # For later tests.
+fi
+rm -f conftest*
+
+
+# If we're using gcc and the user hasn't specified CFLAGS, add -O to CFLAGS.
+test -n "$GCC" && test -n "$auto_cflags" && CFLAGS="$CFLAGS -O"
+
+
+test -n "$silent" || echo "checking how to run the C preprocessor"
+if test -z "$CPP"; then
+  # This must be in double quotes, not single quotes, because CPP may get
+  # substituted into the Makefile and ``${CC-cc}'' will simply confuse
+  # make.  It must be expanded now.
+  CPP="${CC-cc} -E"
+  cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <stdio.h>
+Syntax Error
+EOF
+# Some shells (Coherent) do redirections in the wrong order, so need
+# the parens.
+ac_err=`eval "($ac_cpp conftest.${ac_ext} >/dev/null) 2>&1"`
+if test -z "$ac_err"; then
+  :
+else
+  rm -rf conftest*
+  CPP="${CC-cc} -E -traditional-cpp"
+  cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <stdio.h>
+Syntax Error
+EOF
+# Some shells (Coherent) do redirections in the wrong order, so need
+# the parens.
+ac_err=`eval "($ac_cpp conftest.${ac_ext} >/dev/null) 2>&1"`
+if test -z "$ac_err"; then
+  :
+else
+  rm -rf conftest*
+  CPP=/lib/cpp
+fi
+rm -f conftest*
+fi
+rm -f conftest*
+fi
+test -n "$verbose" && echo "	setting CPP to $CPP"
+
+if test -n "$GCC"; then
+  test -n "$silent" || echo "checking whether -traditional is needed"
+  ac_pattern="Autoconf.*'x'"
+  ac_prog='#include <sgtty.h>
+Autoconf TIOCGETP'
+  cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+$ac_prog
+EOF
+eval "$ac_cpp conftest.${ac_ext} > conftest.out 2>&1"
+if egrep "$ac_pattern" conftest.out >/dev/null 2>&1; then
+  rm -rf conftest*
+  ac_need_trad=1
+
+fi
+rm -f conftest*
+
+
+  if test -z "$ac_need_trad"; then
+    ac_prog='#include <termio.h>
+Autoconf TCGETA'
+    cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+$ac_prog
+EOF
+eval "$ac_cpp conftest.${ac_ext} > conftest.out 2>&1"
+if egrep "$ac_pattern" conftest.out >/dev/null 2>&1; then
+  rm -rf conftest*
+  ac_need_trad=1
+
+fi
+rm -f conftest*
+
+  fi
+  test -n "$ac_need_trad" && CC="$CC -traditional"
+fi
+
+# Make sure to not get the incompatible SysV /etc/install and
+# /usr/sbin/install, which might be in PATH before a BSD-like install,
+# or the SunOS /usr/etc/install directory, or the AIX /bin/install,
+# or the AFS install, which mishandles nonexistent args, or
+# /usr/ucb/install on SVR4, which tries to use the nonexistent group
+# `staff', or /sbin/install on IRIX which has incompatible command-line
+# syntax.  Sigh.
+#
+#     On most BSDish systems install is in /usr/bin, not /usr/ucb
+#     anyway.
+# This turns out not to be true, so the mere pathname isn't an indication
+# of whether the program works.  What we really need is a set of tests for
+# the install program to see if it actually works in all the required ways.
+#
+# Avoid using ./install, which might have been erroneously created
+# by make from ./install.sh.
+if test -z "${INSTALL}"; then
+  test -n "$silent" || echo "checking for a BSD compatible install"
+  IFS="${IFS= 	}"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+  for ac_dir in $PATH; do
+    case "$ac_dir" in
+    ''|.|/etc|/sbin|/usr/sbin|/usr/etc|/usr/afsws/bin|/usr/ucb) ;;
+    *)
+      # OSF1 and SCO ODT 3.0 have their own names for install.
+      for ac_prog in installbsd scoinst install; do
+        if test -f $ac_dir/$ac_prog; then
+	  if test $ac_prog = install &&
+            grep dspmsg $ac_dir/$ac_prog >/dev/null 2>&1; then
+	    # AIX install.  It has an incompatible calling convention.
+	    # OSF/1 installbsd also uses dspmsg, but is usable.
+	    :
+	  else
+	    INSTALL="$ac_dir/$ac_prog -c"
+	    break 2
+	  fi
+	fi
+      done
+      ;;
+    esac
+  done
+  IFS="$ac_save_ifs"
+fi
+
+if test -z "$INSTALL"; then
+  # As a last resort, use the slow shell script.
+  for ac_dir in ${srcdir} ${srcdir}/.. ${srcdir}/../..; do
+    if test -f $ac_dir/install.sh; then
+      INSTALL="$ac_dir/install.sh -c"; break
+    fi
+  done
+fi
+if test -z "$INSTALL"; then
+  echo "configure: can not find install.sh in ${srcdir} or ${srcdir}/.. or ${srcdir}/../.." >&2; exit 1
+fi
+test -n "$verbose" && echo "	setting INSTALL to $INSTALL"
+
+# Use test -z because SunOS4 sh mishandles ${INSTALL_PROGRAM-'${INSTALL}'}.
+# It thinks the first close brace ends the variable substitution.
+test -z "$INSTALL_PROGRAM" && INSTALL_PROGRAM='${INSTALL}'
+test -n "$verbose" && echo "	setting INSTALL_PROGRAM to $INSTALL_PROGRAM"
+
+test -z "$INSTALL_DATA" && INSTALL_DATA='${INSTALL} -m 644'
+test -n "$verbose" && echo "	setting INSTALL_DATA to $INSTALL_DATA"
+
+if test -z "$RANLIB"; then
+  # Extract the first word of `ranlib', so it can be a program name with args.
+  set ac_dummy ranlib; ac_word=$2
+  test -n "$silent" || echo "checking for $ac_word"
+  IFS="${IFS= 	}"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+  for ac_dir in $PATH; do
+    test -z "$ac_dir" && ac_dir=.
+    if test -f $ac_dir/$ac_word; then
+      RANLIB="ranlib"
+      break
+    fi
+  done
+  IFS="$ac_save_ifs"
+fi
+test -z "$RANLIB" && RANLIB=":"
+test -n "$RANLIB" && test -n "$verbose" && echo "	setting RANLIB to $RANLIB"
+
+
+test -n "$silent" || echo "checking for BSD string and memory functions"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <strings.h>
+int main() { return 0; }
+int t() { rindex(0, 0); bzero(0, 0);; return 0; }
+EOF
+if eval $ac_compile; then
+  :
+else
+  rm -rf conftest*
+  
+{
+test -n "$verbose" && \
+echo "	defining USG"
+echo "#define" USG "1" >> confdefs.h
+DEFS="$DEFS -DUSG=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}USG\${ac_dB}USG\${ac_dC}1\${ac_dD}
+\${ac_uA}USG\${ac_uB}USG\${ac_uC}1\${ac_uD}
+\${ac_eA}USG\${ac_eB}USG\${ac_eC}1\${ac_eD}
+"
+}
+
+fi
+rm -f conftest*
+
+
+for ac_func in strcasecmp sighold
+do
+ac_tr_func=HAVE_`echo $ac_func | tr '[a-z]' '[A-Z]'`
+test -n "$silent" || echo "checking for ${ac_func}"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <ctype.h>
+int main() { return 0; }
+int t() { 
+/* The GNU C library defines this for functions which it implements
+    to always fail with ENOSYS.  Some functions are actually named
+    something starting with __ and the normal name is an alias.  */
+#if defined (__stub_${ac_func}) || defined (__stub___${ac_func})
+choke me
+#else
+/* Override any gcc2 internal prototype to avoid an error.  */
+extern char ${ac_func}(); ${ac_func}();
+#endif
+; return 0; }
+EOF
+if eval $ac_compile; then
+  rm -rf conftest*
+  {
+test -n "$verbose" && \
+echo "	defining ${ac_tr_func}"
+echo "#define" ${ac_tr_func} "1" >> confdefs.h
+DEFS="$DEFS -D${ac_tr_func}=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}${ac_tr_func}\${ac_dB}${ac_tr_func}\${ac_dC}1\${ac_dD}
+\${ac_uA}${ac_tr_func}\${ac_uB}${ac_tr_func}\${ac_uC}1\${ac_uD}
+\${ac_eA}${ac_tr_func}\${ac_eB}${ac_tr_func}\${ac_eC}1\${ac_eD}
+"
+}
+
+
+fi
+rm -f conftest*
+done
+
+
+for ac_hdr in unistd.h stdlib.h varargs.h string.h alloca.h \
+		dirent.h sys/ptem.h sys/pte.h sys/stream.h termcap.h \
+		termio.h
+do
+ac_tr_hdr=HAVE_`echo $ac_hdr | tr '[a-z]./' '[A-Z]__'`
+test -n "$silent" || echo "checking for ${ac_hdr}"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <${ac_hdr}>
+EOF
+# Some shells (Coherent) do redirections in the wrong order, so need
+# the parens.
+ac_err=`eval "($ac_cpp conftest.${ac_ext} >/dev/null) 2>&1"`
+if test -z "$ac_err"; then
+  rm -rf conftest*
+  
+{
+test -n "$verbose" && \
+echo "	defining ${ac_tr_hdr}"
+echo "#define" ${ac_tr_hdr} "1" >> confdefs.h
+DEFS="$DEFS -D${ac_tr_hdr}=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}${ac_tr_hdr}\${ac_dB}${ac_tr_hdr}\${ac_dC}1\${ac_dD}
+\${ac_uA}${ac_tr_hdr}\${ac_uB}${ac_tr_hdr}\${ac_uC}1\${ac_uD}
+\${ac_eA}${ac_tr_hdr}\${ac_eB}${ac_tr_hdr}\${ac_eC}1\${ac_eD}
+"
+}
+
+
+fi
+rm -f conftest*
+done
+
+
+test -n "$silent" || echo "checking for sys/file.h"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <sys/file.h>
+EOF
+# Some shells (Coherent) do redirections in the wrong order, so need
+# the parens.
+ac_err=`eval "($ac_cpp conftest.${ac_ext} >/dev/null) 2>&1"`
+if test -z "$ac_err"; then
+  :
+else
+  rm -rf conftest*
+  
+{
+test -n "$verbose" && \
+echo "	defining NO_SYS_FILE"
+echo "#define" NO_SYS_FILE "1" >> confdefs.h
+DEFS="$DEFS -DNO_SYS_FILE=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}NO_SYS_FILE\${ac_dB}NO_SYS_FILE\${ac_dC}1\${ac_dD}
+\${ac_uA}NO_SYS_FILE\${ac_uB}NO_SYS_FILE\${ac_uC}1\${ac_uD}
+\${ac_eA}NO_SYS_FILE\${ac_eB}NO_SYS_FILE\${ac_eC}1\${ac_eD}
+"
+}
+
+fi
+rm -f conftest*
+
+
+if test -z "$have_tiocgwinsz"; then
+test -n "$silent" || echo "checking for TIOCGWINSZ in sys/ioctl.h"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <sys/types.h>
+#include <sys/ioctl.h>
+int main() { return 0; }
+int t() { int x = TIOCGWINSZ;; return 0; }
+EOF
+if eval $ac_compile; then
+  rm -rf conftest*
+  
+{
+test -n "$verbose" && \
+echo "	defining GWINSZ_IN_SYS_IOCTL"
+echo "#define" GWINSZ_IN_SYS_IOCTL "1" >> confdefs.h
+DEFS="$DEFS -DGWINSZ_IN_SYS_IOCTL=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}GWINSZ_IN_SYS_IOCTL\${ac_dB}GWINSZ_IN_SYS_IOCTL\${ac_dC}1\${ac_dD}
+\${ac_uA}GWINSZ_IN_SYS_IOCTL\${ac_uB}GWINSZ_IN_SYS_IOCTL\${ac_uC}1\${ac_uD}
+\${ac_eA}GWINSZ_IN_SYS_IOCTL\${ac_eB}GWINSZ_IN_SYS_IOCTL\${ac_eC}1\${ac_eD}
+"
+}
+
+
+fi
+rm -f conftest*
+
+fi
+
+test -n "$silent" || echo "checking for programs able to redeclare getpw functions"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <sys/types.h>
+#include <pwd.h>
+extern struct passwd *getpwuid();
+int main() { return 0; }
+int t() { struct passwd *z; z = getpwuid(0);; return 0; }
+EOF
+if eval $ac_compile; then
+  :
+else
+  rm -rf conftest*
+  
+{
+test -n "$verbose" && \
+echo "	defining HAVE_GETPW_DECLS"
+echo "#define" HAVE_GETPW_DECLS "1" >> confdefs.h
+DEFS="$DEFS -DHAVE_GETPW_DECLS=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}HAVE_GETPW_DECLS\${ac_dB}HAVE_GETPW_DECLS\${ac_dC}1\${ac_dD}
+\${ac_uA}HAVE_GETPW_DECLS\${ac_uB}HAVE_GETPW_DECLS\${ac_uC}1\${ac_uD}
+\${ac_eA}HAVE_GETPW_DECLS\${ac_eB}HAVE_GETPW_DECLS\${ac_eC}1\${ac_eD}
+"
+}
+
+fi
+rm -f conftest*
+
+
+# The Ultrix 4.2 mips builtin alloca declared by alloca.h only works
+# for constant arguments.  Useless!
+test -n "$silent" || echo "checking for working alloca.h"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <alloca.h>
+int main() { return 0; }
+int t() { char *p = alloca(2 * sizeof(int));; return 0; }
+EOF
+if eval $ac_compile; then
+  rm -rf conftest*
+  
+{
+test -n "$verbose" && \
+echo "	defining HAVE_ALLOCA_H"
+echo "#define" HAVE_ALLOCA_H "1" >> confdefs.h
+DEFS="$DEFS -DHAVE_ALLOCA_H=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}HAVE_ALLOCA_H\${ac_dB}HAVE_ALLOCA_H\${ac_dC}1\${ac_dD}
+\${ac_uA}HAVE_ALLOCA_H\${ac_uB}HAVE_ALLOCA_H\${ac_uC}1\${ac_uD}
+\${ac_eA}HAVE_ALLOCA_H\${ac_eB}HAVE_ALLOCA_H\${ac_eC}1\${ac_eD}
+"
+}
+
+
+fi
+rm -f conftest*
+
+ac_decl="#ifdef __GNUC__
+#define alloca __builtin_alloca
+#else
+#if HAVE_ALLOCA_H
+#include <alloca.h>
+#else
+#ifdef _AIX
+ #pragma alloca
+#else
+char *alloca ();
+#endif
+#endif
+#endif
+"
+test -n "$silent" || echo "checking for alloca"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+$ac_decl
+int main() { return 0; }
+int t() { char *p = (char *) alloca(1);; return 0; }
+EOF
+if eval $ac_compile; then
+  rm -rf conftest*
+  
+{
+test -n "$verbose" && \
+echo "	defining HAVE_ALLOCA"
+echo "#define" HAVE_ALLOCA "1" >> confdefs.h
+DEFS="$DEFS -DHAVE_ALLOCA=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}HAVE_ALLOCA\${ac_dB}HAVE_ALLOCA\${ac_dC}1\${ac_dD}
+\${ac_uA}HAVE_ALLOCA\${ac_uB}HAVE_ALLOCA\${ac_uC}1\${ac_uD}
+\${ac_eA}HAVE_ALLOCA\${ac_eB}HAVE_ALLOCA\${ac_eC}1\${ac_eD}
+"
+}
+
+
+else
+  rm -rf conftest*
+  ac_alloca_missing=1
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+
+#if defined(CRAY) && ! defined(CRAY2)
+winnitude
+#else
+lossage
+#endif
+
+EOF
+eval "$ac_cpp conftest.${ac_ext} > conftest.out 2>&1"
+if egrep "winnitude" conftest.out >/dev/null 2>&1; then
+  rm -rf conftest*
+  test -n "$silent" || echo "checking for _getb67"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <ctype.h>
+int main() { return 0; }
+int t() { 
+/* The GNU C library defines this for functions which it implements
+    to always fail with ENOSYS.  Some functions are actually named
+    something starting with __ and the normal name is an alias.  */
+#if defined (__stub__getb67) || defined (__stub____getb67)
+choke me
+#else
+/* Override any gcc2 internal prototype to avoid an error.  */
+extern char _getb67(); _getb67();
+#endif
+; return 0; }
+EOF
+if eval $ac_compile; then
+  rm -rf conftest*
+  {
+test -n "$verbose" && \
+echo "	defining" CRAY_STACKSEG_END to be "_getb67"
+echo "#define" CRAY_STACKSEG_END "_getb67" >> confdefs.h
+DEFS="$DEFS -DCRAY_STACKSEG_END=_getb67"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}CRAY_STACKSEG_END\${ac_dB}CRAY_STACKSEG_END\${ac_dC}_getb67\${ac_dD}
+\${ac_uA}CRAY_STACKSEG_END\${ac_uB}CRAY_STACKSEG_END\${ac_uC}_getb67\${ac_uD}
+\${ac_eA}CRAY_STACKSEG_END\${ac_eB}CRAY_STACKSEG_END\${ac_eC}_getb67\${ac_eD}
+"
+}
+
+
+else
+  rm -rf conftest*
+  test -n "$silent" || echo "checking for GETB67"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <ctype.h>
+int main() { return 0; }
+int t() { 
+/* The GNU C library defines this for functions which it implements
+    to always fail with ENOSYS.  Some functions are actually named
+    something starting with __ and the normal name is an alias.  */
+#if defined (__stub_GETB67) || defined (__stub___GETB67)
+choke me
+#else
+/* Override any gcc2 internal prototype to avoid an error.  */
+extern char GETB67(); GETB67();
+#endif
+; return 0; }
+EOF
+if eval $ac_compile; then
+  rm -rf conftest*
+  {
+test -n "$verbose" && \
+echo "	defining" CRAY_STACKSEG_END to be "GETB67"
+echo "#define" CRAY_STACKSEG_END "GETB67" >> confdefs.h
+DEFS="$DEFS -DCRAY_STACKSEG_END=GETB67"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}CRAY_STACKSEG_END\${ac_dB}CRAY_STACKSEG_END\${ac_dC}GETB67\${ac_dD}
+\${ac_uA}CRAY_STACKSEG_END\${ac_uB}CRAY_STACKSEG_END\${ac_uC}GETB67\${ac_uD}
+\${ac_eA}CRAY_STACKSEG_END\${ac_eB}CRAY_STACKSEG_END\${ac_eC}GETB67\${ac_eD}
+"
+}
+
+
+else
+  rm -rf conftest*
+  test -n "$silent" || echo "checking for getb67"
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+#include <ctype.h>
+int main() { return 0; }
+int t() { 
+/* The GNU C library defines this for functions which it implements
+    to always fail with ENOSYS.  Some functions are actually named
+    something starting with __ and the normal name is an alias.  */
+#if defined (__stub_getb67) || defined (__stub___getb67)
+choke me
+#else
+/* Override any gcc2 internal prototype to avoid an error.  */
+extern char getb67(); getb67();
+#endif
+; return 0; }
+EOF
+if eval $ac_compile; then
+  rm -rf conftest*
+  {
+test -n "$verbose" && \
+echo "	defining" CRAY_STACKSEG_END to be "getb67"
+echo "#define" CRAY_STACKSEG_END "getb67" >> confdefs.h
+DEFS="$DEFS -DCRAY_STACKSEG_END=getb67"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}CRAY_STACKSEG_END\${ac_dB}CRAY_STACKSEG_END\${ac_dC}getb67\${ac_dD}
+\${ac_uA}CRAY_STACKSEG_END\${ac_uB}CRAY_STACKSEG_END\${ac_uC}getb67\${ac_uD}
+\${ac_eA}CRAY_STACKSEG_END\${ac_eB}CRAY_STACKSEG_END\${ac_eC}getb67\${ac_eD}
+"
+}
+
+
+fi
+rm -f conftest*
+
+fi
+rm -f conftest*
+
+fi
+rm -f conftest*
+
+
+fi
+rm -f conftest*
+
+
+fi
+rm -f conftest*
+
+if test -n "$ac_alloca_missing"; then
+  # The SVR3 libPW and SVR4 libucb both contain incompatible functions
+  # that cause trouble.  Some versions do not even contain alloca or
+  # contain a buggy version.  If you still want to use their alloca,
+  # use ar to extract alloca.o from them instead of compiling alloca.c.
+  ALLOCA=alloca.o
+  
+{
+test -n "$verbose" && \
+echo "	defining C_ALLOCA"
+echo "#define" C_ALLOCA "1" >> confdefs.h
+DEFS="$DEFS -DC_ALLOCA=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}C_ALLOCA\${ac_dB}C_ALLOCA\${ac_dC}1\${ac_dD}
+\${ac_uA}C_ALLOCA\${ac_uB}C_ALLOCA\${ac_uC}1\${ac_uD}
+\${ac_eA}C_ALLOCA\${ac_eB}C_ALLOCA\${ac_eC}1\${ac_eD}
+"
+}
+
+
+  test -n "$silent" || echo "checking stack direction for C alloca"
+  test -n "$silent" || echo "checking whether cross-compiling"
+# If we cannot run a trivial program, we must be cross compiling.
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+main(){exit(0);}
+EOF
+eval $ac_compile
+if test -s conftest && (./conftest; exit) 2>/dev/null; then
+  :
+else
+  cross_compiling=1
+fi
+rm -fr conftest*
+
+if test -n "$cross_compiling"
+then
+  
+{
+test -n "$verbose" && \
+echo "	defining" STACK_DIRECTION to be "0"
+echo "#define" STACK_DIRECTION "0" >> confdefs.h
+DEFS="$DEFS -DSTACK_DIRECTION=0"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}STACK_DIRECTION\${ac_dB}STACK_DIRECTION\${ac_dC}0\${ac_dD}
+\${ac_uA}STACK_DIRECTION\${ac_uB}STACK_DIRECTION\${ac_uC}0\${ac_uD}
+\${ac_eA}STACK_DIRECTION\${ac_eB}STACK_DIRECTION\${ac_eC}0\${ac_eD}
+"
+}
+
+else
+cat > conftest.${ac_ext} <<EOF
+#include "confdefs.h"
+find_stack_direction ()
+{
+  static char *addr = 0;
+  auto char dummy;
+  if (addr == 0)
+    {
+      addr = &dummy;
+      return find_stack_direction ();
+    }
+  else
+    return (&dummy > addr) ? 1 : -1;
+}
+main ()
+{
+  exit (find_stack_direction() < 0);
+}
+EOF
+eval $ac_compile
+if test -s conftest && (./conftest; exit) 2>/dev/null; then
+  
+{
+test -n "$verbose" && \
+echo "	defining" STACK_DIRECTION to be "1"
+echo "#define" STACK_DIRECTION "1" >> confdefs.h
+DEFS="$DEFS -DSTACK_DIRECTION=1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}STACK_DIRECTION\${ac_dB}STACK_DIRECTION\${ac_dC}1\${ac_dD}
+\${ac_uA}STACK_DIRECTION\${ac_uB}STACK_DIRECTION\${ac_uC}1\${ac_uD}
+\${ac_eA}STACK_DIRECTION\${ac_eB}STACK_DIRECTION\${ac_eC}1\${ac_eD}
+"
+}
+
+
+else
+  
+{
+test -n "$verbose" && \
+echo "	defining" STACK_DIRECTION to be "-1"
+echo "#define" STACK_DIRECTION "-1" >> confdefs.h
+DEFS="$DEFS -DSTACK_DIRECTION=-1"
+ac_sed_defs="${ac_sed_defs}\${ac_dA}STACK_DIRECTION\${ac_dB}STACK_DIRECTION\${ac_dC}-1\${ac_dD}
+\${ac_uA}STACK_DIRECTION\${ac_uB}STACK_DIRECTION\${ac_uC}-1\${ac_uD}
+\${ac_eA}STACK_DIRECTION\${ac_eB}STACK_DIRECTION\${ac_eC}-1\${ac_eD}
+"
+}
+
+fi
+fi
+rm -fr conftest*
+fi
+
+
+
+# The preferred way to propogate these variables is regular @ substitutions.
+if test -n "$prefix"; then
+  ac_prsub="s%^prefix\\([ 	]*\\)=\\([ 	]*\\).*$%prefix\\1=\\2$prefix%"
+else
+  prefix=/usr/local
+fi
+if test -n "$exec_prefix"; then
+  ac_prsub="$ac_prsub
+s%^exec_prefix\\([ 	]*\\)=\\([ 	]*\\).*$%exec_prefix\\1=\\2$exec_prefix%"
+else
+  exec_prefix='${prefix}' # Let make expand it.
+fi
+
+# Any assignment to VPATH causes Sun make to only execute
+# the first set of double-colon rules, so remove it if not needed.
+# If there is a colon in the path, we need to keep it.
+if test "x$srcdir" = x.; then
+  ac_vpsub='/^[ 	]*VPATH[ 	]*=[^:]*$/d'
+fi
+
+# Quote sed substitution magic chars in DEFS.
+cat >conftest.def <<EOF
+$DEFS
+EOF
+ac_escape_ampersand_and_backslash='s%[&\\]%\\&%g'
+DEFS=`sed "$ac_escape_ampersand_and_backslash" <conftest.def`
+rm -f conftest.def
+# Substitute for predefined variables.
+
+trap 'rm -f config.status; exit 1' 1 2 15
+echo creating config.status
+rm -f config.status
+cat > config.status <<EOF
+#!/bin/sh
+# Generated automatically by configure.
+# Run this file to recreate the current configuration.
+# This directory was configured as follows,
+# on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+#
+# $0 $configure_args
+
+ac_cs_usage="Usage: config.status [--recheck] [--version] [--help]"
+for ac_option
+do
+  case "\$ac_option" in
+  -recheck | --recheck | --rechec | --reche | --rech | --rec | --re | --r)
+    echo running \${CONFIG_SHELL-/bin/sh} $0 $configure_args --no-create
+    exec \${CONFIG_SHELL-/bin/sh} $0 $configure_args --no-create ;;
+  -version | --version | --versio | --versi | --vers | --ver | --ve | --v)
+    echo "config.status generated by autoconf version 1.11"
+    exit 0 ;;
+  -help | --help | --hel | --he | --h)
+    echo "\$ac_cs_usage"; exit 0 ;;
+  *) echo "\$ac_cs_usage"; exit 1 ;;
+  esac
+done
+
+trap 'rm -fr Makefile config.h conftest*; exit 1' 1 2 15
+CC='$CC'
+CFLAGS='$CFLAGS'
+LDFLAGS='$LDFLAGS'
+CPP='$CPP'
+INSTALL='$INSTALL'
+INSTALL_PROGRAM='$INSTALL_PROGRAM'
+INSTALL_DATA='$INSTALL_DATA'
+RANLIB='$RANLIB'
+ALLOCA='$ALLOCA'
+LIBS='$LIBS'
+srcdir='$srcdir'
+top_srcdir='$top_srcdir'
+prefix='$prefix'
+exec_prefix='$exec_prefix'
+ac_prsub='$ac_prsub'
+ac_vpsub='$ac_vpsub'
+extrasub='$extrasub'
+EOF
+cat >> config.status <<\EOF
+
+ac_given_srcdir=$srcdir
+
+CONFIG_FILES=${CONFIG_FILES-"Makefile"}
+for ac_file in .. ${CONFIG_FILES}; do if test "x$ac_file" != x..; then
+  # Remove last slash and all that follows it.  Not all systems have dirname.
+  ac_dir=`echo $ac_file|sed 's%/[^/][^/]*$%%'`
+  if test "$ac_dir" != "$ac_file" && test "$ac_dir" != .; then
+    # The file is in a subdirectory.
+    test ! -d "$ac_dir" && mkdir "$ac_dir"
+    ac_dir_suffix="/$ac_dir"
+  else
+    ac_dir_suffix=
+  fi
+
+  # A "../" for each directory in $ac_dir_suffix.
+  ac_dots=`echo $ac_dir_suffix|sed 's%/[^/]*%../%g'`
+  case "$ac_given_srcdir" in
+  .)  srcdir=.
+      if test -z "$ac_dir_suffix"; then top_srcdir=.
+      else top_srcdir=`echo $ac_dots|sed 's%/$%%'`; fi ;;
+  /*) srcdir="$ac_given_srcdir$ac_dir_suffix"; top_srcdir="$ac_given_srcdir" ;;
+  *) # Relative path.
+    srcdir="$ac_dots$ac_given_srcdir$ac_dir_suffix"
+    top_srcdir="$ac_dots$ac_given_srcdir" ;;
+  esac
+
+  echo creating "$ac_file"
+  rm -f "$ac_file"
+  comment_str="Generated automatically from `echo $ac_file|sed 's|.*/||'`.in by configure."
+  case "$ac_file" in
+    *.c | *.h | *.C | *.cc | *.m )  echo "/* $comment_str */" > "$ac_file" ;;
+    * )          echo "# $comment_str"     > "$ac_file" ;;
+  esac
+  sed -e "
+$ac_prsub
+$ac_vpsub
+$extrasub
+s%@CC@%$CC%g
+s%@CFLAGS@%$CFLAGS%g
+s%@LDFLAGS@%$LDFLAGS%g
+s%@CPP@%$CPP%g
+s%@INSTALL@%$INSTALL%g
+s%@INSTALL_PROGRAM@%$INSTALL_PROGRAM%g
+s%@INSTALL_DATA@%$INSTALL_DATA%g
+s%@RANLIB@%$RANLIB%g
+s%@ALLOCA@%$ALLOCA%g
+s%@LIBS@%$LIBS%g
+s%@srcdir@%$srcdir%g
+s%@top_srcdir@%$top_srcdir%g
+s%@prefix@%$prefix%g
+s%@exec_prefix@%$exec_prefix%g
+s%@DEFS@%-DHAVE_CONFIG_H%" $ac_given_srcdir/${ac_file}.in >> $ac_file
+fi; done
+
+# These sed commands are put into ac_sed_defs when defining a macro.
+# They are broken into pieces to make the sed script easier to manage.
+# They are passed to sed as "A NAME B NAME C VALUE D", where NAME
+# is the cpp macro being defined and VALUE is the value it is being given.
+# Each defining turns into a single global substitution command.
+# Hopefully no one uses "!" as a variable value.
+# Other candidates for the sed separators, like , and @, do get used.
+#
+# ac_d sets the value in "#define NAME VALUE" lines.
+ac_dA='s!^\([ 	]*\)#\([ 	]*define[ 	][ 	]*\)'
+ac_dB='\([ 	][ 	]*\)[^ 	]*!\1#\2'
+ac_dC='\3'
+ac_dD='!g'
+# ac_u turns "#undef NAME" with trailing blanks into "#define NAME VALUE".
+ac_uA='s!^\([ 	]*\)#\([ 	]*\)undef\([ 	][ 	]*\)'
+ac_uB='\([ 	]\)!\1#\2define\3'
+ac_uC=' '
+ac_uD='\4!g'
+# ac_e turns "#undef NAME" without trailing blanks into "#define NAME VALUE".
+ac_eA='s!^\([ 	]*\)#\([ 	]*\)undef\([ 	][ 	]*\)'
+ac_eB='$!\1#\2define\3'
+ac_eC=' '
+ac_eD='!g'
+rm -f conftest.sed
+EOF
+# Turn off quoting long enough to insert the sed commands.
+rm -f conftest.sh
+cat > conftest.sh <<EOF
+$ac_sed_defs
+EOF
+
+# Break up $ac_sed_defs (now in conftest.sh) because some shells have a limit
+# on the size of here documents.
+
+# Maximum number of lines to put in a single here document.
+ac_max_sh_lines=9
+
+while :
+do
+  # wc gives bogus results for an empty file on some AIX systems.
+  ac_lines=`grep -c . conftest.sh`
+  if test -z "$ac_lines" || test "$ac_lines" -eq 0; then break; fi
+  rm -f conftest.s1 conftest.s2
+  sed ${ac_max_sh_lines}q conftest.sh > conftest.s1 # Like head -9.
+  sed 1,${ac_max_sh_lines}d conftest.sh > conftest.s2 # Like tail +10.
+  # Write a limited-size here document to append to conftest.sed.
+  echo 'cat >> conftest.sed <<CONFEOF' >> config.status
+  cat conftest.s1 >> config.status
+  echo 'CONFEOF' >> config.status
+  rm -f conftest.s1 conftest.sh
+  mv conftest.s2 conftest.sh
+done
+rm -f conftest.sh
+
+# Now back to your regularly scheduled config.status.
+cat >> config.status <<\EOF
+# This sed command replaces #undef's with comments.  This is necessary, for
+# example, in the case of _POSIX_SOURCE, which is predefined and required
+# on some systems where configure will not decide to define it in
+# config.h.
+cat >> conftest.sed <<\CONFEOF
+s,^[ 	]*#[ 	]*undef[ 	][ 	]*[a-zA-Z_][a-zA-Z_0-9]*,/* & */,
+CONFEOF
+rm -f conftest.h
+# Break up the sed commands because old seds have small limits.
+ac_max_sed_lines=20
+
+CONFIG_HEADERS=${CONFIG_HEADERS-"config.h"}
+for ac_file in .. ${CONFIG_HEADERS}; do if test "x$ac_file" != x..; then
+  echo creating $ac_file
+
+  cp $ac_given_srcdir/$ac_file.in conftest.h1
+  cp conftest.sed conftest.stm
+  while :
+  do
+    ac_lines=`grep -c . conftest.stm`
+    if test -z "$ac_lines" || test "$ac_lines" -eq 0; then break; fi
+    rm -f conftest.s1 conftest.s2 conftest.h2
+    sed ${ac_max_sed_lines}q conftest.stm > conftest.s1 # Like head -20.
+    sed 1,${ac_max_sed_lines}d conftest.stm > conftest.s2 # Like tail +21.
+    sed -f conftest.s1 < conftest.h1 > conftest.h2
+    rm -f conftest.s1 conftest.h1 conftest.stm
+    mv conftest.h2 conftest.h1
+    mv conftest.s2 conftest.stm
+  done
+  rm -f conftest.stm conftest.h
+  echo "/* $ac_file.  Generated automatically by configure.  */" > conftest.h
+  cat conftest.h1 >> conftest.h
+  rm -f conftest.h1
+  if cmp -s $ac_file conftest.h 2>/dev/null; then
+    # The file exists and we would not be changing it.
+    echo "$ac_file is unchanged"
+    rm -f conftest.h
+  else
+    rm -f $ac_file
+    mv conftest.h $ac_file
+  fi
+fi; done
+rm -f conftest.sed
+
+
+
+# Makefile uses this timestamp file to record whether config.h is up to date.
+touch stamp-config
+exit 0
+EOF
+chmod +x config.status
+# Some shells look in PATH for config.status without the "./".
+test -n "$no_create" || ${CONFIG_SHELL-/bin/sh} ./config.status
+
diff --git a/configure.in b/configure.in
new file mode 100644
index 0000000..febcbab
--- /dev/null
+++ b/configure.in
@@ -0,0 +1,48 @@
+dnl Process this file with autoconf to produce a configure script.
+AC_INIT(readline.h)
+AC_CONFIG_HEADER(config.h)
+AC_REVISION(Configure for Readline 2.0)
+
+# We want these before the checks, so the checks can modify their values.
+test -z "$CFLAGS" && CFLAGS=-g auto_cflags=1
+
+AC_PROG_CC
+
+# If we're using gcc and the user hasn't specified CFLAGS, add -O to CFLAGS.
+test -n "$GCC" && test -n "$auto_cflags" && CFLAGS="$CFLAGS -O"
+
+AC_SUBST(CFLAGS)dnl
+AC_SUBST(LDFLAGS)dnl
+
+AC_GCC_TRADITIONAL
+AC_PROG_INSTALL
+AC_PROG_RANLIB
+
+AC_USG
+
+AC_HAVE_FUNCS(strcasecmp sighold)
+
+AC_HAVE_HEADERS(unistd.h stdlib.h varargs.h string.h alloca.h \
+		dirent.h sys/ptem.h sys/pte.h sys/stream.h termcap.h \
+		termio.h)
+
+AC_HEADER_CHECK(sys/file.h, ,AC_DEFINE(NO_SYS_FILE))
+
+if test -z "$have_tiocgwinsz"; then
+AC_COMPILE_CHECK(TIOCGWINSZ in sys/ioctl.h,
+[#include <sys/types.h>
+#include <sys/ioctl.h>], [int x = TIOCGWINSZ;],
+AC_DEFINE(GWINSZ_IN_SYS_IOCTL))
+fi
+
+AC_COMPILE_CHECK(programs able to redeclare getpw functions,
+[#include <sys/types.h>
+#include <pwd.h>
+extern struct passwd *getpwuid();], [struct passwd *z; z = getpwuid(0);], ,
+AC_DEFINE(HAVE_GETPW_DECLS))
+
+AC_ALLOCA
+
+AC_OUTPUT(Makefile, [
+# Makefile uses this timestamp file to record whether config.h is up to date.
+touch stamp-config])
diff --git a/display.c b/display.c
new file mode 100644
index 0000000..8204570
--- /dev/null
+++ b/display.c
@@ -0,0 +1,1219 @@
+/* display.c -- readline redisplay facility. */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#include <stdio.h>
+#include <sys/types.h>
+
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif /* HAVE_UNISTD_H */
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+#include "posixstat.h"
+
+/* System-specific feature definitions and include files. */
+#include "rldefs.h"
+
+/* Some standard library routines. */
+#include "readline.h"
+#include "history.h"
+
+#if !defined (strchr) && !defined (__STDC__)
+extern char *strchr (), *strrchr ();
+#endif /* !strchr && !__STDC__ */
+
+/* Global and pseudo-global variables and functions
+   imported from readline.c. */
+extern char *rl_prompt;
+extern int readline_echoing_p;
+extern char *term_clreol, *term_im, *term_ic,  *term_ei, *term_DC;
+/* Termcap variables. */
+extern char *term_up, *term_dc, *term_cr, *term_IC;
+extern int screenheight, screenwidth, screenchars;
+extern int terminal_can_insert, term_xn;
+
+extern void _rl_output_some_chars ();
+extern int _rl_output_character_function ();
+
+extern int _rl_output_meta_chars;
+extern int _rl_horizontal_scroll_mode;
+extern int _rl_mark_modified_lines;
+extern int _rl_prefer_visible_bell;
+
+/* Pseudo-global functions (local to the readline library) exported
+   by this file. */
+void _rl_move_cursor_relative (), _rl_output_some_chars ();
+void _rl_move_vert ();
+
+static void update_line (), clear_to_eol (), space_to_eol ();
+static void delete_chars (), insert_some_chars ();
+
+extern char *xmalloc (), *xrealloc ();
+
+/* Heuristic used to decide whether it is faster to move from CUR to NEW
+   by backing up or outputting a carriage return and moving forward. */
+#define CR_FASTER(new, cur) (((new) + 1) < ((cur) - (new)))
+
+/* **************************************************************** */
+/*								    */
+/*			Display stuff				    */
+/*								    */
+/* **************************************************************** */
+
+/* This is the stuff that is hard for me.  I never seem to write good
+   display routines in C.  Let's see how I do this time. */
+
+/* (PWP) Well... Good for a simple line updater, but totally ignores
+   the problems of input lines longer than the screen width.
+
+   update_line and the code that calls it makes a multiple line,
+   automatically wrapping line update.  Careful attention needs
+   to be paid to the vertical position variables. */
+
+/* Keep two buffers; one which reflects the current contents of the
+   screen, and the other to draw what we think the new contents should
+   be.  Then compare the buffers, and make whatever changes to the
+   screen itself that we should.  Finally, make the buffer that we
+   just drew into be the one which reflects the current contents of the
+   screen, and place the cursor where it belongs.
+
+   Commands that want to can fix the display themselves, and then let
+   this function know that the display has been fixed by setting the
+   RL_DISPLAY_FIXED variable.  This is good for efficiency. */
+
+/* Global variables declared here. */
+/* What YOU turn on when you have handled all redisplay yourself. */
+int rl_display_fixed = 0;
+
+/* The stuff that gets printed out before the actual text of the line.
+   This is usually pointing to rl_prompt. */
+char *rl_display_prompt = (char *)NULL;
+
+/* Pseudo-global variables declared here. */
+/* The visible cursor position.  If you print some text, adjust this. */
+int _rl_last_c_pos = 0;
+int _rl_last_v_pos = 0;
+
+/* Number of lines currently on screen minus 1. */
+int _rl_vis_botlin = 0;
+
+/* Variables used only in this file. */
+/* The last left edge of text that was displayed.  This is used when
+   doing horizontal scrolling.  It shifts in thirds of a screenwidth. */
+static int last_lmargin = 0;
+
+/* The line display buffers.  One is the line currently displayed on
+   the screen.  The other is the line about to be displayed. */
+static char *visible_line = (char *)NULL;
+static char *invisible_line = (char *)NULL;
+
+/* A buffer for `modeline' messages. */
+static char msg_buf[128];
+
+/* Non-zero forces the redisplay even if we thought it was unnecessary. */
+static int forced_display = 0;
+
+/* Default and initial buffer size.  Can grow. */
+static int line_size = 1024;
+
+static char *last_prompt_string = (char *)NULL;
+static char *local_prompt, *local_prompt_prefix;
+static int visible_length, prefix_length;
+
+/* The number of invisible characters in the line currently being
+   displayed on the screen. */
+static int visible_wrap_offset = 0;
+
+/* The length (buffer offset) of the first line of the last (possibly
+   multi-line) buffer displayed on the screen. */
+static int visible_first_line_len = 0;
+
+/* Expand the prompt string S and return the number of visible
+   characters in *LP, if LP is not null.  This is currently more-or-less
+   a placeholder for expansion. */
+
+/* Current implementation:
+	\001 (^A) start non-visible characters
+	\002 (^B) end non-visible characters
+   all characters except \001 and \002 (following a \001) are copied to
+   the returned string; all characters except those between \001 and
+   \002 are assumed to be `visible'. */	
+
+static char *
+expand_prompt (pmt, lp)
+     char *pmt;
+     int *lp;
+{
+  char *r, *ret, *p;
+  int l, rl, ignoring;
+
+  /* Short-circuit if we can. */
+  if (strchr (pmt, RL_PROMPT_START_IGNORE) == 0)
+    {
+      r = savestring (pmt);
+      if (lp)
+	*lp = strlen (r);
+      return r;
+    }
+
+  l = strlen (pmt);
+  r = ret = xmalloc (l + 1);
+  
+  for (rl = ignoring = 0, p = pmt; p && *p; p++)
+    {
+      /* This code strips the invisible character string markers
+	 RL_PROMPT_START_IGNORE and RL_PROMPT_END_IGNORE */
+      if (*p == RL_PROMPT_START_IGNORE)
+	{
+	  ignoring++;
+	  continue;
+	}
+      else if (ignoring && *p == RL_PROMPT_END_IGNORE)
+	{
+	  ignoring = 0;
+	  continue;
+	}
+      else
+	{
+	  *r++ = *p;
+	  if (!ignoring)
+	    rl++;
+	}
+    }
+
+  *r = '\0';
+  if (lp)
+    *lp = rl;
+  return ret;
+}
+
+/*
+ * Expand the prompt string into the various display components, if
+ * necessary.
+ *
+ * local_prompt = expanded last line of string in rl_display_prompt
+ *		  (portion after the final newline)
+ * local_prompt_prefix = portion before last newline of rl_display_prompt,
+ *			 expanded via expand_prompt
+ * visible_length = number of visible characters in local_prompt
+ * prefix_length = number of visible characters in local_prompt_prefix
+ *
+ * This function is called once per call to readline().  It may also be
+ * called arbitrarily to expand the primary prompt.
+ *
+ * The return value is the number of visible characters on the last line
+ * of the (possibly multi-line) prompt.
+ */
+int
+rl_expand_prompt (prompt)
+     char *prompt;
+{
+  char *p, *t;
+  int c;
+
+  /* Clear out any saved values. */
+  if (local_prompt)
+    free (local_prompt);
+  if (local_prompt_prefix)
+    free (local_prompt_prefix);
+  local_prompt = local_prompt_prefix = (char *)0;
+
+  p = strrchr (prompt, '\n');
+  if (!p)
+    {
+      /* The prompt is only one line. */
+      local_prompt = expand_prompt (prompt, &visible_length);
+      local_prompt_prefix = (char *)0;
+      return (visible_length);
+    }
+  else
+    {
+      /* The prompt spans multiple lines. */
+      t = ++p;
+      local_prompt = expand_prompt (p, &visible_length);
+      c = *t; *t = '\0';
+      /* The portion of the prompt string up to and including the
+	 final newline is now null-terminated. */
+      local_prompt_prefix = expand_prompt (prompt, &prefix_length);
+      *t = c;
+      return (prefix_length);
+    }
+}
+
+/* Basic redisplay algorithm. */
+void
+rl_redisplay ()
+{
+  register int in, out, c, linenum;
+  register char *line = invisible_line;
+  int c_pos = 0, inv_botlin = 0, wrap_offset, wrap_column;
+  char *prompt_this_line;
+
+  if (!readline_echoing_p)
+    return;
+
+  if (!rl_display_prompt)
+    rl_display_prompt = "";
+
+  if (!invisible_line)
+    {
+      visible_line = xmalloc (line_size);
+      invisible_line = xmalloc (line_size);
+      line = invisible_line;
+      for (in = 0; in < line_size; in++)
+	{
+	  visible_line[in] = 0;
+	  invisible_line[in] = 1;
+	}
+      rl_on_new_line ();
+    }
+
+  /* Draw the line into the buffer. */
+  c_pos = -1;
+
+  /* Mark the line as modified or not.  We only do this for history
+     lines. */
+  out = 0;
+  if (_rl_mark_modified_lines && current_history () && rl_undo_list)
+    {
+      line[out++] = '*';
+      line[out] = '\0';
+    }
+
+  /* If someone thought that the redisplay was handled, but the currently
+     visible line has a different modification state than the one about
+     to become visible, then correct the caller's misconception. */
+  if (visible_line[0] != invisible_line[0])
+    rl_display_fixed = 0;
+
+  /* If the prompt to be displayed is the `primary' readline prompt (the
+     one passed to readline()), use the values we have already expanded.
+     If not, use what's already in rl_display_prompt.  WRAP_OFFSET is the
+     number of non-visible characters in the prompt string. */
+  if (rl_display_prompt == rl_prompt)
+    {
+      int local_len = local_prompt ? strlen (local_prompt) : 0;
+      if (local_prompt_prefix && forced_display)
+	_rl_output_some_chars (local_prompt_prefix, strlen (local_prompt_prefix));
+
+      if (local_len > 0)
+	strncpy (line + out, local_prompt, local_len);
+      out += local_len;
+      line[out] = '\0';
+      wrap_offset = local_len - visible_length;
+    }
+  else
+    {
+      int pmtlen;
+      prompt_this_line = strrchr (rl_display_prompt, '\n');
+      if (!prompt_this_line)
+	prompt_this_line = rl_display_prompt;
+      else
+	{
+	  prompt_this_line++;
+	  if (forced_display)
+	    _rl_output_some_chars (rl_display_prompt, prompt_this_line - rl_display_prompt);
+	}
+
+      pmtlen = strlen (prompt_this_line);
+      strncpy (line + out,  prompt_this_line, pmtlen);
+      out += pmtlen;
+      line[out] = '\0';
+      wrap_offset = 0;
+    }
+
+  for (in = 0; in < rl_end; in++)
+    {
+      c = (unsigned char)rl_line_buffer[in];
+
+      if (out + 8 >= line_size)		/* XXX - 8 for \t */
+	{
+	  line_size *= 2;
+	  visible_line = xrealloc (visible_line, line_size);
+	  invisible_line = xrealloc (invisible_line, line_size);
+	  line = invisible_line;
+	}
+
+      if (in == rl_point)
+	c_pos = out;
+
+      if (META_CHAR (c))
+	{
+	  if (_rl_output_meta_chars == 0)
+	    {
+	      sprintf (line + out, "\\%o", c);
+	      out += 4;
+	    }
+	  else
+	    line[out++] = c;	  
+	}
+#if defined (DISPLAY_TABS)
+      else if (c == '\t')
+	{
+	  register int newout = (out | (int)7) + 1;
+	  while (out < newout)
+	    line[out++] = ' ';
+	}
+#endif
+      else if (c < ' ')
+	{
+	  line[out++] = '^';
+	  line[out++] = UNCTRL (c);	/* XXX was c ^ 0x40 */
+	}
+      else if (c == 127)
+	{
+	  line[out++] = '^';
+	  line[out++] = '?';
+	}
+      else
+	line[out++] = c;
+    }
+  line[out] = '\0';
+  if (c_pos < 0)
+    c_pos = out;
+
+  /* C_POS == position in buffer where cursor should be placed. */
+
+  /* PWP: now is when things get a bit hairy.  The visible and invisible
+     line buffers are really multiple lines, which would wrap every
+     (screenwidth - 1) characters.  Go through each in turn, finding
+     the changed region and updating it.  The line order is top to bottom. */
+
+  /* If we can move the cursor up and down, then use multiple lines,
+     otherwise, let long lines display in a single terminal line, and
+     horizontally scroll it. */
+
+  if (!_rl_horizontal_scroll_mode && term_up && *term_up)
+    {
+      int total_screen_chars = screenchars;
+      int nleft, cursor_linenum, pos, changed_screen_line;
+
+      if (!rl_display_fixed || forced_display)
+	{
+	  forced_display = 0;
+
+	  /* If we have more than a screenful of material to display, then
+	     only display a screenful.  We should display the last screen,
+	     not the first.  I'll fix this in a minute. */
+	  if (out >= total_screen_chars)
+	    out = total_screen_chars - 1;
+
+	  /* Number of screen lines to display.  The first line wraps at
+	     (screenwidth + wrap_offset) chars, the rest of the lines have
+	     screenwidth chars. */
+	  nleft = out - wrap_offset + term_xn - 1;
+	  inv_botlin = (nleft > 0) ? nleft / screenwidth : 0;
+
+	  /* The first line is at character position 0 in the buffer.  The
+	     second and subsequent lines start at N * screenwidth, offset by
+	     OFFSET.  OFFSET is wrap_offset for the invisible line and
+	     visible_wrap_offset for the line currently displayed. */
+
+#define W_OFFSET(line, offset) ((line) == 0 ? offset : 0)
+#define L_OFFSET(n, offset) ((n) > 0 ? ((n) * screenwidth) + (offset) : 0)
+#define VIS_CHARS(line) &visible_line[L_OFFSET((line), visible_wrap_offset)]
+#define VIS_LINE(line) ((line) > _rl_vis_botlin) ? "" : VIS_CHARS(line)
+#define INV_LINE(line) &invisible_line[L_OFFSET((line), wrap_offset)]
+
+	  /* For each line in the buffer, do the updating display. */
+	  for (linenum = 0; linenum <= inv_botlin; linenum++)
+	    {
+	      update_line (VIS_LINE(linenum), INV_LINE(linenum), linenum,
+			   screenwidth + W_OFFSET(linenum, visible_wrap_offset),
+			   screenwidth + W_OFFSET(linenum, wrap_offset),
+			   inv_botlin);
+
+	      /* If this is the line with the prompt, we might need to
+		 compensate for invisible characters in the new line. Do
+		 this only if there is not more than one new line (which
+		 implies that we completely overwrite the old visible line)
+		 and the new line is shorter than the old. */
+	      if (linenum == 0 &&
+		  inv_botlin == 0 &&
+		  (wrap_offset > visible_wrap_offset) &&
+		  (_rl_last_c_pos < visible_first_line_len))
+		{
+		  nleft = screenwidth + wrap_offset - _rl_last_c_pos;
+		  clear_to_eol (nleft);
+		}
+
+	      /* Since the new first line is now visible, save its length. */
+	      if (linenum == 0)
+		visible_first_line_len = (inv_botlin > 0) ? screenwidth : out - wrap_offset;
+	    }
+
+	  /* We may have deleted some lines.  If so, clear the left over
+	     blank ones at the bottom out. */
+	  if (_rl_vis_botlin > inv_botlin)
+	    {
+	      char *tt;
+	      for (; linenum <= _rl_vis_botlin; linenum++)
+		{
+		  tt = VIS_CHARS (linenum);
+		  _rl_move_vert (linenum);
+		  _rl_move_cursor_relative (0, tt);
+		  clear_to_eol
+		    ((linenum == _rl_vis_botlin) ? strlen (tt) : screenwidth);
+		}
+	    }
+	  _rl_vis_botlin = inv_botlin;
+
+	  /* Move the cursor where it should be. */
+	  /* Which line? */
+	  nleft = c_pos - wrap_offset - term_xn + 1;
+	  cursor_linenum = (nleft > 0) ? nleft / screenwidth : 0;
+
+	  /* CHANGED_SCREEN_LINE is set to 1 if we have moved to a
+	     different screen line during this redisplay. */
+	  changed_screen_line = _rl_last_v_pos != cursor_linenum;
+	  if (changed_screen_line)
+	    {
+	      _rl_move_vert (cursor_linenum);
+	      /* If we moved up to the line with the prompt using term_up,
+	         the physical cursor position on the screen stays the same,
+	         but the buffer position needs to be adjusted to account
+	         for invisible characters. */
+	      if (cursor_linenum == 0 && wrap_offset)
+	        _rl_last_c_pos += wrap_offset;
+	    }
+
+	  /* We have to reprint the prompt if it contains invisible
+	     characters, since it's not generally OK to just reprint
+	     the characters from the current cursor position. */
+	  nleft = visible_length + wrap_offset;
+	  if (cursor_linenum == 0 && wrap_offset > 0 && _rl_last_c_pos > 0 &&
+	      _rl_last_c_pos <= nleft && local_prompt)
+	    {
+	      if (term_cr)
+		tputs (term_cr, 1, _rl_output_character_function);
+	      _rl_output_some_chars (local_prompt, nleft);
+	      _rl_last_c_pos = nleft;
+	    }
+
+	  /* Where on that line?  And where does that line start
+	     in the buffer? */
+	  pos = L_OFFSET(cursor_linenum, wrap_offset);
+	  /* nleft == number of characters in the line buffer between the
+	     start of the line and the cursor position. */
+	  nleft = c_pos - pos;
+
+	  /* Since backspace() doesn't know about invisible characters in the
+	     prompt, and there's no good way to tell it, we compensate for
+	     those characters here and call backspace() directly. */
+	  if (wrap_offset && cursor_linenum == 0 && nleft < _rl_last_c_pos)
+	    {
+	      backspace (_rl_last_c_pos - nleft);
+	      _rl_last_c_pos = nleft;
+	    }
+
+	  if (nleft != _rl_last_c_pos)
+	    _rl_move_cursor_relative (nleft, &invisible_line[pos]);
+	}
+    }
+  else				/* Do horizontal scrolling. */
+    {
+#define M_OFFSET(margin, offset) ((margin) == 0 ? offset : 0)
+      int lmargin, ndisp, nleft, phys_c_pos, t;
+
+      /* Always at top line. */
+      _rl_last_v_pos = 0;
+
+      /* Compute where in the buffer the displayed line should start.  This
+	 will be LMARGIN. */
+
+      /* The number of characters that will be displayed before the cursor. */
+      ndisp = c_pos - wrap_offset;
+      nleft  = visible_length + wrap_offset;
+      /* Where the new cursor position will be on the screen.  This can be
+         longer than SCREENWIDTH; if it is, lmargin will be adjusted. */
+      phys_c_pos = c_pos - (last_lmargin ? last_lmargin : wrap_offset);
+      t = screenwidth / 3;
+
+      /* If the number of characters had already exceeded the screenwidth,
+         last_lmargin will be > 0. */
+
+      /* If the number of characters to be displayed is more than the screen
+         width, compute the starting offset so that the cursor is about
+         two-thirds of the way across the screen. */
+      if (phys_c_pos > screenwidth - 2)
+	{
+	  lmargin = c_pos - (2 * t);
+	  if (lmargin < 0)
+	    lmargin = 0;
+	  /* If the left margin would be in the middle of a prompt with
+	     invisible characters, don't display the prompt at all. */
+	  if (wrap_offset && lmargin > 0 && lmargin < nleft)
+	    lmargin = nleft;
+	}
+      else if (ndisp < screenwidth - 2)		/* XXX - was -1 */
+        lmargin = 0;
+      else if (phys_c_pos < 1)
+	{
+	  /* If we are moving back towards the beginning of the line and
+	     the last margin is no longer correct, compute a new one. */
+	  lmargin = ((c_pos - 1) / t) * t;	/* XXX */
+	  if (wrap_offset && lmargin > 0 && lmargin < nleft)
+	    lmargin = nleft;
+	}
+      else
+        lmargin = last_lmargin;
+
+      /* If the first character on the screen isn't the first character
+	 in the display line, indicate this with a special character. */
+      if (lmargin > 0)
+	line[lmargin] = '<';
+
+      /* If SCREENWIDTH characters starting at LMARGIN do not encompass
+         the whole line, indicate that with a special characters at the
+         right edge of the screen.  If LMARGIN is 0, we need to take the
+         wrap offset into account. */
+      t = lmargin + M_OFFSET (lmargin, wrap_offset) + screenwidth;
+      if (t < out)
+        line[t - 1] = '>';
+
+      if (!rl_display_fixed || forced_display || lmargin != last_lmargin)
+	{
+	  forced_display = 0;
+	  update_line (&visible_line[last_lmargin],
+		       &invisible_line[lmargin],
+		       0,
+		       screenwidth + visible_wrap_offset,
+		       screenwidth + (lmargin ? 0 : wrap_offset),
+		       0);
+
+	  /* If the visible new line is shorter than the old, but the number
+	     of invisible characters is greater, and we are at the end of
+	     the new line, we need to clear to eol. */
+	  t = _rl_last_c_pos - M_OFFSET (lmargin, wrap_offset);
+	  if ((M_OFFSET (lmargin, wrap_offset) > visible_wrap_offset) &&
+	      (_rl_last_c_pos == out) &&
+	      t < visible_first_line_len)
+	    {
+	      nleft = screenwidth - t;
+	      clear_to_eol (nleft);
+	    }
+	  visible_first_line_len = out - lmargin - M_OFFSET (lmargin, wrap_offset);
+	  if (visible_first_line_len > screenwidth)
+	    visible_first_line_len = screenwidth;
+
+	  _rl_move_cursor_relative (c_pos - lmargin, &invisible_line[lmargin]);
+	  last_lmargin = lmargin;
+	}
+    }
+  fflush (rl_outstream);
+
+  /* Swap visible and non-visible lines. */
+  {
+    char *temp = visible_line;
+    visible_line = invisible_line;
+    invisible_line = temp;
+    rl_display_fixed = 0;
+    /* If we are displaying on a single line, and last_lmargin is > 0, we
+       are not displaying any invisible characters, so set visible_wrap_offset
+       to 0. */
+    if (_rl_horizontal_scroll_mode && last_lmargin)
+      visible_wrap_offset = 0;
+    else
+      visible_wrap_offset = wrap_offset;
+  }
+}
+
+/* PWP: update_line() is based on finding the middle difference of each
+   line on the screen; vis:
+
+			     /old first difference
+	/beginning of line   |	      /old last same       /old EOL
+	v		     v	      v		    v
+old:	eddie> Oh, my little gruntle-buggy is to me, as lurgid as
+new:	eddie> Oh, my little buggy says to me, as lurgid as
+	^		     ^	^			   ^
+	\beginning of line   |	\new last same	   \new end of line
+			     \new first difference
+
+   All are character pointers for the sake of speed.  Special cases for
+   no differences, as well as for end of line additions must be handeled.
+
+   Could be made even smarter, but this works well enough */
+static void
+update_line (old, new, current_line, omax, nmax, inv_botlin)
+     register char *old, *new;
+     int current_line, omax, nmax;
+{
+  register char *ofd, *ols, *oe, *nfd, *nls, *ne;
+  int temp, lendiff, wsatend, od, nd;
+
+  /* If we're at the right edge of a terminal that supports xn, we're
+     ready to wrap around, so do so.  This fixes problems with knowing
+     the exact cursor position and cut-and-paste with certain terminal
+     emulators.  In this calculation, TEMP is the physical screen
+     position of the cursor. */
+  temp = _rl_last_c_pos - W_OFFSET(_rl_last_v_pos, visible_wrap_offset);
+  if (temp == screenwidth && term_xn && !_rl_horizontal_scroll_mode
+      && _rl_last_v_pos == current_line - 1)
+    {
+      if (new[0])
+	putc (new[0], rl_outstream);
+      else
+	putc (' ', rl_outstream);
+      _rl_last_c_pos = 1;		/* XXX */
+      _rl_last_v_pos++;
+      if (old[0])
+        old[0] = new[0];
+    }
+      
+  /* Find first difference. */
+  for (ofd = old, nfd = new;
+       (ofd - old < omax) && *ofd && (*ofd == *nfd);
+       ofd++, nfd++)
+    ;
+
+  /* Move to the end of the screen line.  ND and OD are used to keep track
+     of the distance between ne and new and oe and old, respectively, to
+     move a subtraction out of each loop. */
+  for (od = ofd - old, oe = ofd; od < omax && *oe; oe++, od++);
+  for (nd = nfd - new, ne = nfd; nd < nmax && *ne; ne++, nd++);
+
+  /* If no difference, continue to next line. */
+  if (ofd == oe && nfd == ne)
+    return;
+
+  wsatend = 1;			/* flag for trailing whitespace */
+  ols = oe - 1;			/* find last same */
+  nls = ne - 1;
+  while ((ols > ofd) && (nls > nfd) && (*ols == *nls))
+    {
+      if (*ols != ' ')
+	wsatend = 0;
+      ols--;
+      nls--;
+    }
+
+  if (wsatend)
+    {
+      ols = oe;
+      nls = ne;
+    }
+  else if (*ols != *nls)
+    {
+      if (*ols)			/* don't step past the NUL */
+	ols++;
+      if (*nls)
+	nls++;
+    }
+
+  _rl_move_vert (current_line);
+
+  /* If this is the first line and there are invisible characters in the
+     prompt string, and the prompt string has not changed, then redraw
+     the entire prompt string.  We can only do this reliably if the
+     terminal supports a `cr' capability.
+
+     This is more than just an efficiency hack -- there is a problem with
+     redrawing portions of the prompt string if they contain terminal
+     escape sequences (like drawing the `unbold' sequence without a
+     corresponding `bold') that manifests itself on certain terminals. */
+
+  lendiff = strlen (local_prompt);
+  if (current_line == 0 && !_rl_horizontal_scroll_mode &&
+      lendiff > visible_length &&
+      _rl_last_c_pos > 0 && (ofd - old) >= lendiff && term_cr)
+    {
+      tputs (term_cr, 1, _rl_output_character_function);
+      _rl_output_some_chars (local_prompt, lendiff);
+      _rl_last_c_pos = lendiff;
+    }
+
+  _rl_move_cursor_relative (ofd - old, old);
+
+  /* if (len (new) > len (old)) */
+  lendiff = (nls - nfd) - (ols - ofd);
+
+  /* Insert (diff (len (old), len (new)) ch. */
+  temp = ne - nfd;
+  if (lendiff > 0)
+    {
+      /* Non-zero if we're increasing the number of lines. */
+      int gl = current_line >= _rl_vis_botlin && inv_botlin > _rl_vis_botlin;
+      /* Sometimes it is cheaper to print the characters rather than
+	 use the terminal's capabilities.  If we're growing the number
+	 of lines, make sure we actually cause the new line to wrap
+	 around on auto-wrapping terminals. */
+      if (terminal_can_insert && ((2 * temp) >= lendiff || term_IC) && (!term_xn || !gl))
+	{
+	  /* If lendiff > visible_length and _rl_last_c_pos == 0 and
+	     _rl_horizontal_scroll_mode == 1, inserting the characters with
+	     term_IC or term_ic will screw up the screen because of the
+	     invisible characters.  We need to just draw them. */
+	  if (*ols && (!_rl_horizontal_scroll_mode || _rl_last_c_pos > 0 ||
+			lendiff <= visible_length))
+	    {
+	      insert_some_chars (nfd, lendiff);
+	      _rl_last_c_pos += lendiff;
+	    }
+	  else
+	    {
+	      /* At the end of a line the characters do not have to
+		 be "inserted".  They can just be placed on the screen. */
+	      _rl_output_some_chars (nfd, lendiff);
+	      _rl_last_c_pos += lendiff;
+	    }
+	  /* Copy (new) chars to screen from first diff to last match. */
+	  temp = nls - nfd;
+	  if ((temp - lendiff) > 0)
+	    {
+	      _rl_output_some_chars (nfd + lendiff, temp - lendiff);
+	      _rl_last_c_pos += temp - lendiff;
+	    }
+	}
+      else
+	{
+	  /* cannot insert chars, write to EOL */
+	  _rl_output_some_chars (nfd, temp);
+	  _rl_last_c_pos += temp;
+	}
+    }
+  else				/* Delete characters from line. */
+    {
+      /* If possible and inexpensive to use terminal deletion, then do so. */
+      if (term_dc && (2 * temp) >= -lendiff)
+	{
+	  /* If all we're doing is erasing the invisible characters in the
+	     prompt string, don't bother.  It screws up the assumptions
+	     about what's on the screen. */
+	  if (_rl_horizontal_scroll_mode && _rl_last_c_pos == 0 &&
+	      -lendiff == visible_wrap_offset)
+	    lendiff = 0;
+
+	  if (lendiff)
+	    delete_chars (-lendiff); /* delete (diff) characters */
+
+	  /* Copy (new) chars to screen from first diff to last match */
+	  temp = nls - nfd;
+	  if (temp > 0)
+	    {
+	      _rl_output_some_chars (nfd, temp);
+	      _rl_last_c_pos += temp;
+	    }
+	}
+      /* Otherwise, print over the existing material. */
+      else
+	{
+	  if (temp > 0)
+	    {
+	      _rl_output_some_chars (nfd, temp);
+	      _rl_last_c_pos += temp;
+	    }
+	  lendiff = (oe - old) - (ne - new);
+	  if (term_xn && current_line < inv_botlin)
+	    space_to_eol (lendiff);
+	  else
+	    clear_to_eol (lendiff);
+	}
+    }
+}
+
+/* Tell the update routines that we have moved onto a new (empty) line. */
+rl_on_new_line ()
+{
+  if (visible_line)
+    visible_line[0] = '\0';
+
+  _rl_last_c_pos = _rl_last_v_pos = 0;
+  _rl_vis_botlin = last_lmargin = 0;
+  return 0;
+}
+
+/* Actually update the display, period. */
+rl_forced_update_display ()
+{
+  if (visible_line)
+    {
+      register char *temp = visible_line;
+
+      while (*temp) *temp++ = '\0';
+    }
+  rl_on_new_line ();
+  forced_display++;
+  rl_redisplay ();
+  return 0;
+}
+
+/* Move the cursor from _rl_last_c_pos to NEW, which are buffer indices.
+   DATA is the contents of the screen line of interest; i.e., where
+   the movement is being done. */
+void
+_rl_move_cursor_relative (new, data)
+     int new;
+     char *data;
+{
+  register int i;
+
+  /* If we don't have to do anything, then return. */
+  if (_rl_last_c_pos == new) return;
+
+  /* It may be faster to output a CR, and then move forwards instead
+     of moving backwards. */
+  /* i == current physical cursor position. */
+  i = _rl_last_c_pos - W_OFFSET(_rl_last_v_pos, visible_wrap_offset);
+  if (CR_FASTER (new, _rl_last_c_pos) || (term_xn && i == screenwidth))
+    {
+#if defined (__MSDOS__)
+      putc ('\r', rl_outstream);
+#else
+      tputs (term_cr, 1, _rl_output_character_function);
+#endif /* !__MSDOS__ */
+      _rl_last_c_pos = 0;
+    }
+
+  if (_rl_last_c_pos < new)
+    {
+      /* Move the cursor forward.  We do it by printing the command
+	 to move the cursor forward if there is one, else print that
+	 portion of the output buffer again.  Which is cheaper? */
+
+      /* The above comment is left here for posterity.  It is faster
+	 to print one character (non-control) than to print a control
+	 sequence telling the terminal to move forward one character.
+	 That kind of control is for people who don't know what the
+	 data is underneath the cursor. */
+#if defined (HACK_TERMCAP_MOTION)
+      extern char *term_forward_char;
+
+      if (term_forward_char)
+	for (i = _rl_last_c_pos; i < new; i++)
+	  tputs (term_forward_char, 1, _rl_output_character_function);
+      else
+	for (i = _rl_last_c_pos; i < new; i++)
+	  putc (data[i], rl_outstream);
+#else
+      for (i = _rl_last_c_pos; i < new; i++)
+	putc (data[i], rl_outstream);
+#endif /* HACK_TERMCAP_MOTION */
+    }
+  else if (_rl_last_c_pos != new)
+    backspace (_rl_last_c_pos - new);
+  _rl_last_c_pos = new;
+}
+
+/* PWP: move the cursor up or down. */
+void
+_rl_move_vert (to)
+     int to;
+{
+  register int delta, i;
+
+  if (_rl_last_v_pos == to || to > screenheight)
+    return;
+
+#if defined (__GO32__)
+  {
+    int row, col;
+
+    ScreenGetCursor (&row, &col);
+    ScreenSetCursor ((row + to - _rl_last_v_pos), col);
+  }
+#else /* !__GO32__ */
+
+  if ((delta = to - _rl_last_v_pos) > 0)
+    {
+      for (i = 0; i < delta; i++)
+	putc ('\n', rl_outstream);
+      tputs (term_cr, 1, _rl_output_character_function);
+      _rl_last_c_pos = 0;
+    }
+  else
+    {			/* delta < 0 */
+      if (term_up && *term_up)
+	for (i = 0; i < -delta; i++)
+	  tputs (term_up, 1, _rl_output_character_function);
+    }
+#endif /* !__GO32__ */
+  _rl_last_v_pos = to;		/* Now TO is here */
+}
+
+/* Physically print C on rl_outstream.  This is for functions which know
+   how to optimize the display.  Return the number of characters output. */
+rl_show_char (c)
+     int c;
+{
+  int n = 1;
+  if (META_CHAR (c) && (_rl_output_meta_chars == 0))
+    {
+      fprintf (rl_outstream, "M-");
+      n += 2;
+      c = UNMETA (c);
+    }
+
+#if defined (DISPLAY_TABS)
+  if (c < 32 && c != '\t')
+#else
+  if (c < 32)
+#endif /* !DISPLAY_TABS */
+    {
+      fprintf (rl_outstream, "C-");
+      n += 2;
+      c += 64;
+    }
+
+  putc (c, rl_outstream);
+  fflush (rl_outstream);
+  return n;
+}
+
+int
+rl_character_len (c, pos)
+     register int c, pos;
+{
+  unsigned char uc;
+
+  uc = (unsigned char)c;
+
+  if (META_CHAR (uc))
+    return ((_rl_output_meta_chars == 0) ? 4 : 1);
+
+  if (uc == '\t')
+    {
+#if defined (DISPLAY_TABS)
+      return (((pos | 7) + 1) - pos);
+#else
+      return (2);
+#endif /* !DISPLAY_TABS */
+    }
+
+  return ((isprint (uc)) ? 1 : 2);
+}
+
+/* How to print things in the "echo-area".  The prompt is treated as a
+   mini-modeline. */
+
+#if defined (HAVE_VARARGS_H)
+rl_message (va_alist)
+     va_dcl
+{
+  char *format;
+  va_list args;
+
+  va_start (args);
+  format = va_arg (args, char *);
+  vsprintf (msg_buf, format, args);
+  va_end (args);
+
+  rl_display_prompt = msg_buf;
+  rl_redisplay ();
+  return 0;
+}
+#else /* !HAVE_VARARGS_H */
+rl_message (format, arg1, arg2)
+     char *format;
+{
+  sprintf (msg_buf, format, arg1, arg2);
+  rl_display_prompt = msg_buf;
+  rl_redisplay ();
+  return 0;
+}
+#endif /* !HAVE_VARARGS_H */
+
+/* How to clear things from the "echo-area". */
+rl_clear_message ()
+{
+  rl_display_prompt = rl_prompt;
+  rl_redisplay ();
+  return 0;
+}
+
+rl_reset_line_state ()
+{
+  rl_on_new_line ();
+
+  rl_display_prompt = rl_prompt ? rl_prompt : "";
+  forced_display = 1;
+  return 0;
+}
+
+/* Quick redisplay hack when erasing characters at the end of the line. */
+void
+_rl_erase_at_end_of_line (l)
+     int l;
+{
+  register int i;
+
+  backspace (l);
+  for (i = 0; i < l; i++)
+    putc (' ', rl_outstream);
+  backspace (l);
+  for (i = 0; i < l; i++)
+    visible_line[--_rl_last_c_pos] = '\0';
+  rl_display_fixed++;
+}
+
+/* Clear to the end of the line.  COUNT is the minimum
+   number of character spaces to clear, */
+static void
+clear_to_eol (count)
+     int count;
+{
+#if !defined (__GO32__)
+  if (term_clreol)
+    {
+      tputs (term_clreol, 1, _rl_output_character_function);
+    }
+  else
+#endif /* !__GO32__ */
+    space_to_eol (count);
+}
+
+/* Clear to the end of the line using spaces.  COUNT is the minimum
+   number of character spaces to clear, */
+static void
+space_to_eol (count)
+     int count;
+{
+  register int i;
+
+  for (i = 0; i < count; i++)
+   putc (' ', rl_outstream);
+
+  _rl_last_c_pos += count;
+}
+
+/* Insert COUNT characters from STRING to the output stream. */
+static void
+insert_some_chars (string, count)
+     char *string;
+     int count;
+{
+#if defined (__GO32__)
+  int row, col, width;
+  char *row_start;
+
+  ScreenGetCursor (&row, &col);
+  width = ScreenCols ();
+  row_start = ScreenPrimary + (row * width);
+
+  memcpy (row_start + col + count, row_start + col, width - col - count);
+
+  /* Place the text on the screen. */
+  _rl_output_some_chars (string, count);
+#else /* !_GO32 */
+
+  /* If IC is defined, then we do not have to "enter" insert mode. */
+  if (term_IC)
+    {
+      char *tgoto (), *buffer;
+      buffer = tgoto (term_IC, 0, count);
+      tputs (buffer, 1, _rl_output_character_function);
+      _rl_output_some_chars (string, count);
+    }
+  else
+    {
+      register int i;
+
+      /* If we have to turn on insert-mode, then do so. */
+      if (term_im && *term_im)
+	tputs (term_im, 1, _rl_output_character_function);
+
+      /* If there is a special command for inserting characters, then
+	 use that first to open up the space. */
+      if (term_ic && *term_ic)
+	{
+	  for (i = count; i--; )
+	    tputs (term_ic, 1, _rl_output_character_function);
+	}
+
+      /* Print the text. */
+      _rl_output_some_chars (string, count);
+
+      /* If there is a string to turn off insert mode, we had best use
+	 it now. */
+      if (term_ei && *term_ei)
+	tputs (term_ei, 1, _rl_output_character_function);
+    }
+#endif /* !__GO32__ */
+}
+
+/* Delete COUNT characters from the display line. */
+static void
+delete_chars (count)
+     int count;
+{
+#if defined (__GO32__)
+  int row, col, width;
+  char *row_start;
+
+  ScreenGetCursor (&row, &col);
+  width = ScreenCols ();
+  row_start = ScreenPrimary + (row * width);
+
+  memcpy (row_start + col, row_start + col + count, width - col - count);
+  memset (row_start + width - count, 0, count * 2);
+#else /* !_GO32 */
+
+  if (count > screenwidth)	/* XXX */
+    return;
+
+  if (term_DC && *term_DC)
+    {
+      char *tgoto (), *buffer;
+      buffer = tgoto (term_DC, count, count);
+      tputs (buffer, count, _rl_output_character_function);
+    }
+  else
+    {
+      if (term_dc && *term_dc)
+	while (count--)
+	  tputs (term_dc, 1, _rl_output_character_function);
+    }
+#endif /* !__GO32__ */
+}
+
+void
+_rl_update_final ()
+{
+  int full_lines;
+
+  full_lines = 0;
+  if (_rl_vis_botlin && visible_line[screenwidth * _rl_vis_botlin] == 0)
+    {
+      _rl_vis_botlin--;
+      full_lines = 1;
+    }
+  _rl_move_vert (_rl_vis_botlin);
+  if (full_lines && term_xn)
+    {
+      /* Remove final line-wrap flag in xterm. */
+      char *last_line;
+      last_line = &visible_line[screenwidth * _rl_vis_botlin];
+      _rl_move_cursor_relative (screenwidth - 1, last_line);
+      clear_to_eol (0);
+      putc (last_line[screenwidth - 1], rl_outstream);
+    }
+  _rl_vis_botlin = 0;
+  crlf ();
+  fflush (rl_outstream);
+  rl_display_fixed++;
+}
diff --git a/doc/Makefile b/doc/Makefile
new file mode 100644
index 0000000..ad5ef70
--- /dev/null
+++ b/doc/Makefile
@@ -0,0 +1,56 @@
+# This makefile for History library documentation is in -*- text -*- mode.
+# Emacs likes it that way.
+
+DOC_SUPPORT = ../../doc-support/
+TEXINDEX    = $(DOC_SUPPORT)/texindex
+
+TEX    = tex
+
+DVIOBJ = readline.dvi history.dvi
+INFOBJ = readline.info history.info
+PSOBJ = readline.ps history.ps
+
+all: info dvi
+
+readline.dvi: rlman.texinfo rluser.texinfo rltech.texinfo
+	$(TEX) rlman.texinfo
+	$(TEXINDEX) rlman.??
+	$(TEX) rlman.texinfo
+	mv rlman.dvi readline.dvi
+
+readline.info: rlman.texinfo rluser.texinfo rltech.texinfo
+	makeinfo rlman.texinfo
+
+history.dvi: hist.texinfo hsuser.texinfo hstech.texinfo
+	$(TEX) hist.texinfo
+	$(TEXINDEX) hist.??
+	$(TEX) hist.texinfo
+	mv hist.dvi history.dvi
+
+history.info: hist.texinfo hsuser.texinfo hstech.texinfo
+	makeinfo hist.texinfo
+
+readline.ps:	readline.dvi
+	dvips -D 300 -o $@ readline.dvi
+
+history.ps:	history.dvi
+	dvips -D 300 -o $@ history.dvi
+
+info:	$(INFOOBJ)
+dvi:	$(DVIOBJ)
+ps:	$(PSOBJ)
+
+
+$(TEXINDEX):
+	(cd $(DOC_SUPPORT); $(MAKE) $(MFLAGS) CFLAGS='$(CFLAGS)' texindex)
+
+clean:
+	rm -f *.aux *.cp *.fn *.ky *.log *.pg *.toc *.tp *.vr *.cps *.pgs \
+	      *.fns *.kys *.tps *.vrs *.o core
+
+squeaky-clean:
+	rm -f *.aux *.cp *.fn *.ky *.log *.pg *.toc *.tp *.vr *.cps *.pgs \
+	      *.dvi *.info *.info-* *.fns *.kys *.tps *.vrs *.o core
+
+distclean: clean
+realclean: clean
diff --git a/doc/hist.texinfo b/doc/hist.texinfo
new file mode 100644
index 0000000..cc80efa
--- /dev/null
+++ b/doc/hist.texinfo
@@ -0,0 +1,113 @@
+\input texinfo    @c -*-texinfo-*-
+@c %**start of header (This is for running Texinfo on a region.)
+@setfilename history.info
+@settitle GNU History Library
+@c %**end of header (This is for running Texinfo on a region.)
+
+@setchapternewpage odd
+
+@ignore
+last change: Wed Jul 20 09:57:17 EDT 1994
+@end ignore
+
+@set EDITION 2.0
+@set VERSION 2.0
+@set UPDATED 20 July 1994
+@set UPDATE-MONTH July 1994
+
+@ifinfo
+This document describes the GNU History library, a programming tool that
+provides a consistent user interface for recalling lines of previously
+typed input.
+
+Copyright (C) 1988, 1991 Free Software Foundation, Inc.
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+pare preserved on all copies.
+
+@ignore
+Permission is granted to process this file through TeX and print the
+results, provided the printed document carries copying permission
+notice identical to this one except for the removal of this paragraph
+(this paragraph not being relevant to the printed manual).
+@end ignore
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided that the entire
+resulting derived work is distributed under the terms of a permission
+notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions,
+except that this permission notice may be stated in a translation approved
+by the Foundation.
+@end ifinfo
+
+@titlepage
+@sp 10
+@title GNU History Library
+@subtitle Edition @value{EDITION}, for @code{History Library} Version @value{VERSION}.
+@subtitle @value{UPDATE-MONTH}
+@author Brian Fox, Free Software Foundation
+@author Chet Ramey, Case Western Reserve University
+
+@page
+This document describes the GNU History library, a programming tool that
+provides a consistent user interface for recalling lines of previously
+typed input.
+
+Published by the Free Software Foundation @*
+675 Massachusetts Avenue, @*
+Cambridge, MA 02139 USA
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+are preserved on all copies.
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided that the entire
+resulting derived work is distributed under the terms of a permission
+notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions,
+except that this permission notice may be stated in a translation approved
+by the Foundation.
+
+@vskip 0pt plus 1filll
+Copyright @copyright{} 1989, 1991 Free Software Foundation, Inc.
+@end titlepage
+
+@ifinfo
+@node Top
+@top GNU History Library
+
+This document describes the GNU History library, a programming tool that
+provides a consistent user interface for recalling lines of previously
+typed input.
+
+@menu
+* Using History Interactively::	  GNU History User's Manual.
+* Programming with GNU History::  GNU History Programmer's Manual.
+* Concept Index::		  Index of concepts described in this manual.
+* Function and Variable Index::	  Index of externally visible functions
+				  and variables.
+@end menu
+@end ifinfo
+
+@syncodeindex fn vr
+
+@include hsuser.texinfo
+@include hstech.texinfo
+
+@node Concept Index
+@appendix Concept Index
+@printindex cp
+
+@node Function and Variable Index
+@appendix Function and Variable Index
+@printindex vr
+
+@contents
+@bye
diff --git a/doc/history.dvi b/doc/history.dvi
new file mode 100644
index 0000000..60d7376
--- /dev/null
+++ b/doc/history.dvi
diff --git a/doc/history.info b/doc/history.info
new file mode 100644
index 0000000..6df0bd9
--- /dev/null
+++ b/doc/history.info
@@ -0,0 +1,744 @@
+This is Info file history.info, produced by Makeinfo-1.55 from the
+input file hist.texinfo.
+
+   This document describes the GNU History library, a programming tool
+that provides a consistent user interface for recalling lines of
+previously typed input.
+
+   Copyright (C) 1988, 1991 Free Software Foundation, Inc.
+
+   Permission is granted to make and distribute verbatim copies of this
+manual provided the copyright notice and this permission notice pare
+preserved on all copies.
+
+   Permission is granted to copy and distribute modified versions of
+this manual under the conditions for verbatim copying, provided that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+   Permission is granted to copy and distribute translations of this
+manual into another language, under the above conditions for modified
+versions, except that this permission notice may be stated in a
+translation approved by the Foundation.
+
+
+File: history.info,  Node: Top,  Next: Using History Interactively,  Prev: (DIR),  Up: (DIR)
+
+GNU History Library
+*******************
+
+   This document describes the GNU History library, a programming tool
+that provides a consistent user interface for recalling lines of
+previously typed input.
+
+* Menu:
+
+* Using History Interactively::	  GNU History User's Manual.
+* Programming with GNU History::  GNU History Programmer's Manual.
+* Concept Index::		  Index of concepts described in this manual.
+* Function and Variable Index::	  Index of externally visible functions
+				  and variables.
+
+
+File: history.info,  Node: Using History Interactively,  Next: Programming with GNU History,  Prev: Top,  Up: Top
+
+Using History Interactively
+***************************
+
+   This chapter describes how to use the GNU History Library
+interactively, from a user's standpoint.  It should be considered a
+user's guide.  For information on using the GNU History Library in your
+own programs, *note Programming with GNU History::..
+
+* Menu:
+
+* History Interaction::		What it feels like using History as a user.
+
+
+File: history.info,  Node: History Interaction,  Up: Using History Interactively
+
+History Interaction
+===================
+
+   The History library provides a history expansion feature that is
+similar to the history expansion provided by `csh'.  The following text
+describes the syntax used to manipulate the history information.
+
+   History expansion takes place in two parts.  The first is to
+determine which line from the previous history should be used during
+substitution.  The second is to select portions of that line for
+inclusion into the current one.  The line selected from the previous
+history is called the "event", and the portions of that line that are
+acted upon are called "words".  The line is broken into words in the
+same fashion that Bash does, so that several English (or Unix) words
+surrounded by quotes are considered as one word.
+
+* Menu:
+
+* Event Designators::	How to specify which history line to use.
+* Word Designators::	Specifying which words are of interest.
+* Modifiers::		Modifying the results of substitution.
+
+
+File: history.info,  Node: Event Designators,  Next: Word Designators,  Up: History Interaction
+
+Event Designators
+-----------------
+
+   An event designator is a reference to a command line entry in the
+history list.
+
+`!'
+     Start a history substitution, except when followed by a space, tab,
+     the end of the line, = or (.
+
+`!!'
+     Refer to the previous command.  This is a synonym for `!-1'.
+
+`!n'
+     Refer to command line N.
+
+`!-n'
+     Refer to the command N lines back.
+
+`!string'
+     Refer to the most recent command starting with STRING.
+
+`!?string'[`?']
+     Refer to the most recent command containing STRING.
+
+`!#'
+     The entire command line typed so far.
+
+`^string1^string2^'
+     Quick Substitution.  Repeat the last command, replacing STRING1
+     with STRING2.  Equivalent to `!!:s/string1/string2/'.
+
+
+File: history.info,  Node: Word Designators,  Next: Modifiers,  Prev: Event Designators,  Up: History Interaction
+
+Word Designators
+----------------
+
+   A : separates the event specification from the word designator.  It
+can be omitted if the word designator begins with a ^, $, * or %.
+Words are numbered from the beginning of the line, with the first word
+being denoted by a 0 (zero).
+
+`0 (zero)'
+     The `0'th word.  For many applications, this is the command word.
+
+`n'
+     The Nth word.
+
+`^'
+     The first argument;  that is, word 1.
+
+`$'
+     The last argument.
+
+`%'
+     The word matched by the most recent `?string?' search.
+
+`x-y'
+     A range of words; `-Y' abbreviates `0-Y'.
+
+`*'
+     All of the words, except the `0'th.  This is a synonym for `1-$'.
+     It is not an error to use * if there is just one word in the event;
+     the empty string is returned in that case.
+
+`x*'
+     Abbreviates `x-$'
+
+`x-'
+     Abbreviates `x-$' like `x*', but omits the last word.
+
+
+File: history.info,  Node: Modifiers,  Prev: Word Designators,  Up: History Interaction
+
+Modifiers
+---------
+
+   After the optional word designator, you can add a sequence of one or
+more of the following modifiers, each preceded by a :.
+
+`h'
+     Remove a trailing pathname component, leaving only the head.
+
+`r'
+     Remove a trailing suffix of the form `.'SUFFIX, leaving the
+     basename.
+
+`e'
+     Remove all but the trailing suffix.
+
+`t'
+     Remove all leading  pathname  components, leaving the tail.
+
+`p'
+     Print the new command but do not execute it.
+
+`s/old/new/'
+     Substitute NEW for the first occurrence of OLD in the event line.
+     Any delimiter may be used in place of /.  The delimiter may be
+     quoted in OLD and NEW with a single backslash.  If & appears in
+     NEW, it is replaced by OLD.  A single backslash will quote the &.
+     The final delimiter is optional if it is the last character on the
+     input line.
+
+`&'
+     Repeat the previous substitution.
+
+`g'
+     Cause changes to be applied over the entire event line.  Used in
+     conjunction with `s', as in `gs/old/new/', or with `&'.
+
+
+File: history.info,  Node: Programming with GNU History,  Next: Concept Index,  Prev: Using History Interactively,  Up: Top
+
+Programming with GNU History
+****************************
+
+   This chapter describes how to interface programs that you write with
+the GNU History Library.  It should be considered a technical guide.
+For information on the interactive use of GNU History, *note Using
+History Interactively::..
+
+* Menu:
+
+* Introduction to History::	What is the GNU History library for?
+* History Storage::		How information is stored.
+* History Functions::		Functions that you can use.
+* History Variables::		Variables that control behaviour.
+* History Programming Example::	Example of using the GNU History Library.
+
+
+File: history.info,  Node: Introduction to History,  Next: History Storage,  Up: Programming with GNU History
+
+Introduction to History
+=======================
+
+   Many programs read input from the user a line at a time.  The GNU
+History library is able to keep track of those lines, associate
+arbitrary data with each line, and utilize information from previous
+lines in composing new ones.
+
+   The programmer using the History library has available functions for
+remembering lines on a history list, associating arbitrary data with a
+line, removing lines from the list, searching through the list for a
+line containing an arbitrary text string, and referencing any line in
+the list directly.  In addition, a history "expansion" function is
+available which provides for a consistent user interface across
+different programs.
+
+   The user using programs written with the History library has the
+benefit of a consistent user interface with a set of well-known
+commands for manipulating the text of previous lines and using that text
+in new commands.  The basic history manipulation commands are similar to
+the history substitution provided by `csh'.
+
+   If the programmer desires, he can use the Readline library, which
+includes some history manipulation by default, and has the added
+advantage of command line editing.
+
+
+File: history.info,  Node: History Storage,  Next: History Functions,  Prev: Introduction to History,  Up: Programming with GNU History
+
+History Storage
+===============
+
+   The history list is an array of history entries.  A history entry is
+declared as follows:
+
+     typedef struct _hist_entry {
+       char *line;
+       char *data;
+     } HIST_ENTRY;
+
+   The history list itself might therefore be declared as
+
+     HIST_ENTRY **the_history_list;
+
+   The state of the History library is encapsulated into a single
+structure:
+
+     /* A structure used to pass the current state of the history stuff around. */
+     typedef struct _hist_state {
+       HIST_ENTRY **entries;         /* Pointer to the entries themselves. */
+       int offset;                   /* The location pointer within this array. */
+       int length;                   /* Number of elements within this array. */
+       int size;                     /* Number of slots allocated to this array. */
+       int flags;
+     } HISTORY_STATE;
+
+   If the flags member includes `HS_STIFLED', the history has been
+stifled.
+
+
+File: history.info,  Node: History Functions,  Next: History Variables,  Prev: History Storage,  Up: Programming with GNU History
+
+History Functions
+=================
+
+   This section describes the calling sequence for the various functions
+present in GNU History.
+
+* Menu:
+
+* Initializing History and State Management::	Functions to call when you
+						want to use history in a
+						program.
+* History List Management::		Functions used to manage the list
+					of history entries.
+* Information About the History List::	Functions returning information about
+					the history list.
+* Moving Around the History List::	Functions used to change the position
+					in the history list.
+* Searching the History List::		Functions to search the history list
+					for entries containing a string.
+* Managing the History File::		Functions that read and write a file
+					containing the history list.
+* History Expansion::			Functions to perform csh-like history
+					expansion.
+
+
+File: history.info,  Node: Initializing History and State Management,  Next: History List Management,  Up: History Functions
+
+Initializing History and State Management
+-----------------------------------------
+
+   This section describes functions used to initialize and manage the
+state of the History library when you want to use the history functions
+in your program.
+
+ - Function: void using_history ()
+     Begin a session in which the history functions might be used.  This
+     initializes the interactive variables.
+
+ - Function: HISTORY_STATE * history_get_history_state ()
+     Return a structure describing the current state of the input
+     history.
+
+ - Function: void history_set_history_state (HISTORY_STATE *state)
+     Set the state of the history list according to STATE.
+
+
+File: history.info,  Node: History List Management,  Next: Information About the History List,  Prev: Initializing History and State Management,  Up: History Functions
+
+History List Management
+-----------------------
+
+   These functions manage individual entries on the history list, or set
+parameters managing the list itself.
+
+ - Function: void add_history (char *string)
+     Place STRING at the end of the history list.  The associated data
+     field (if any) is set to `NULL'.
+
+ - Function: HIST_ENTRY * remove_history (int which)
+     Remove history entry at offset WHICH from the history.  The
+     removed element is returned so you can free the line, data, and
+     containing structure.
+
+ - Function: HIST_ENTRY * replace_history_entry (int which, char *line,
+          char *data)
+     Make the history entry at offset WHICH have LINE and DATA.  This
+     returns the old entry so you can dispose of the data.  In the case
+     of an invalid WHICH, a `NULL' pointer is returned.
+
+ - Function: void stifle_history (int max)
+     Stifle the history list, remembering only the last MAX entries.
+
+ - Function: int unstifle_history ()
+     Stop stifling the history.  This returns the previous amount the
+     history was stifled.  The value is positive if the history was
+     stifled, negative if it wasn't.
+
+ - Function: int history_is_stifled ()
+     Returns non-zero if the history is stifled, zero if it is not.
+
+
+File: history.info,  Node: Information About the History List,  Next: Moving Around the History List,  Prev: History List Management,  Up: History Functions
+
+Information About the History List
+----------------------------------
+
+   These functions return information about the entire history list or
+individual list entries.
+
+ - Function: HIST_ENTRY ** history_list ()
+     Return a `NULL' terminated array of `HIST_ENTRY' which is the
+     current input history.  Element 0 of this list is the beginning of
+     time.  If there is no history, return `NULL'.
+
+ - Function: int where_history ()
+     Returns the offset of the current history element.
+
+ - Function: HIST_ENTRY * current_history ()
+     Return the history entry at the current position, as determined by
+     `where_history ()'.  If there is no entry there, return a `NULL'
+     pointer.
+
+ - Function: HIST_ENTRY * history_get (int offset)
+     Return the history entry at position OFFSET, starting from
+     `history_base'.  If there is no entry there, or if OFFSET is
+     greater than the history length, return a `NULL' pointer.
+
+ - Function: int history_total_bytes ()
+     Return the number of bytes that the primary history entries are
+     using.  This function returns the sum of the lengths of all the
+     lines in the history.
+
+
+File: history.info,  Node: Moving Around the History List,  Next: Searching the History List,  Prev: Information About the History List,  Up: History Functions
+
+Moving Around the History List
+------------------------------
+
+   These functions allow the current index into the history list to be
+set or changed.
+
+ - Function: int history_set_pos (int pos)
+     Set the position in the history list to POS, an absolute index
+     into the list.
+
+ - Function: HIST_ENTRY * previous_history ()
+     Back up the current history offset to the previous history entry,
+     and return a pointer to that entry.  If there is no previous
+     entry, return a `NULL' pointer.
+
+ - Function: HIST_ENTRY * next_history ()
+     Move the current history offset forward to the next history entry,
+     and return the a pointer to that entry.  If there is no next
+     entry, return a `NULL' pointer.
+
+
+File: history.info,  Node: Searching the History List,  Next: Managing the History File,  Prev: Moving Around the History List,  Up: History Functions
+
+Searching the History List
+--------------------------
+
+   These functions allow searching of the history list for entries
+containing a specific string.  Searching may be performed both forward
+and backward from the current history position.  The search may be
+"anchored", meaning that the string must match at the beginning of the
+history entry.
+
+ - Function: int history_search (char *string, int direction)
+     Search the history for STRING, starting at the current history
+     offset.  If DIRECTION < 0, then the search is through previous
+     entries, else through subsequent.  If STRING is found, then the
+     current history index is set to that history entry, and the value
+     returned is the offset in the line of the entry where STRING was
+     found.  Otherwise, nothing is changed, and a -1 is returned.
+
+ - Function: int history_search_prefix (char *string, int direction)
+     Search the history for STRING, starting at the current history
+     offset.  The search is anchored: matching lines must begin with
+     STRING.  If DIRECTION < 0, then the search is through previous
+     entries, else through subsequent.  If STRING is found, then the
+     current history index is set to that entry, and the return value
+     is 0.  Otherwise, nothing is changed, and a -1 is returned.
+
+ - Function: int history_search_pos (char *string, int direction, int
+          pos)
+     Search for STRING in the history list, starting at POS, an
+     absolute index into the list.  If DIRECTION is negative, the search
+     proceeds backward from POS, otherwise forward.  Returns the
+     absolute index of the history element where STRING was found, or
+     -1 otherwise.
+
+
+File: history.info,  Node: Managing the History File,  Next: History Expansion,  Prev: Searching the History List,  Up: History Functions
+
+Managing the History File
+-------------------------
+
+   The History library can read the history from and write it to a file.
+This section documents the functions for managing a history file.
+
+ - Function: int read_history (char *filename)
+     Add the contents of FILENAME to the history list, a line at a
+     time.  If FILENAME is `NULL', then read from `~/.history'.
+     Returns 0 if successful, or errno if not.
+
+ - Function: int read_history_range (char *filename, int from, int to)
+     Read a range of lines from FILENAME, adding them to the history
+     list.  Start reading at line FROM and end at TO.  If FROM is zero,
+     start at the beginning.  If TO is less than FROM, then read until
+     the end of the file.  If FILENAME is `NULL', then read from
+     `~/.history'.  Returns 0 if successful, or `errno' if not.
+
+ - Function: int write_history (char *filename)
+     Write the current history to FILENAME, overwriting FILENAME if
+     necessary.  If FILENAME is `NULL', then write the history list to
+     `~/.history'.  Values returned are as in `read_history ()'.
+
+ - Function: int append_history (int nelements, char *filename)
+     Append the last NELEMENTS of the history list to FILENAME.
+
+ - Function: int history_truncate_file (char *filename, int nlines)
+     Truncate the history file FILENAME, leaving only the last NLINES
+     lines.
+
+
+File: history.info,  Node: History Expansion,  Prev: Managing the History File,  Up: History Functions
+
+History Expansion
+-----------------
+
+   These functions implement `csh'-like history expansion.
+
+ - Function: int history_expand (char *string, char **output)
+     Expand STRING, placing the result into OUTPUT, a pointer to a
+     string (*note History Interaction::.).  Returns:
+    `0'
+          If no expansions took place (or, if the only change in the
+          text was the de-slashifying of the history expansion
+          character);
+
+    `1'
+          if expansions did take place;
+
+    `-1'
+          if there was an error in expansion;
+
+    `2'
+          if the returned line should only be displayed, but not
+          executed, as with the `:p' modifier (*note Modifiers::.).
+
+     If an error ocurred in expansion, then OUTPUT contains a
+     descriptive error message.
+
+ - Function: char * history_arg_extract (int first, int last, char
+          *string)
+     Extract a string segment consisting of the FIRST through LAST
+     arguments present in STRING.  Arguments are broken up as in Bash.
+
+ - Function: char * get_history_event (char *string, int *cindex, int
+          qchar)
+     Returns the text of the history event beginning at STRING +
+     *CINDEX.  *CINDEX is modified to point to after the event
+     specifier.  At function entry, CINDEX points to the index into
+     STRING where the history event specification begins.  QCHAR is a
+     character that is allowed to end the event specification in
+     addition to the "normal" terminating characters.
+
+ - Function: char ** history_tokenize (char *string)
+     Return an array of tokens parsed out of STRING, much as the shell
+     might.  The tokens are split on white space and on the characters
+     `()<>;&|$', and shell quoting conventions are obeyed.
+
+
+File: history.info,  Node: History Variables,  Next: History Programming Example,  Prev: History Functions,  Up: Programming with GNU History
+
+History Variables
+=================
+
+   This section describes the externally visible variables exported by
+the GNU History Library.
+
+ - Variable: int history_base
+     The logical offset of the first entry in the history list.
+
+ - Variable: int history_length
+     The number of entries currently stored in the history list.
+
+ - Variable: int max_input_history
+     The maximum number of history entries.  This must be changed using
+     `stifle_history ()'.
+
+ - Variable: char history_expansion_char
+     The character that starts a history event.  The default is `!'.
+
+ - Variable: char history_subst_char
+     The character that invokes word substitution if found at the start
+     of a line.  The default is `^'.
+
+ - Variable: char history_comment_char
+     During tokenization, if this character is seen as the first
+     character of a word, then it and all subsequent characters up to a
+     newline are ignored, suppressing history expansion for the
+     remainder of the line.  This is disabled by default.
+
+ - Variable: char * history_no_expand_chars
+     The list of characters which inhibit history expansion if found
+     immediately following HISTORY_EXPANSION_CHAR.  The default is
+     whitespace and `='.
+
+
+File: history.info,  Node: History Programming Example,  Prev: History Variables,  Up: Programming with GNU History
+
+History Programming Example
+===========================
+
+   The following program demonstrates simple use of the GNU History
+Library.
+
+     main ()
+     {
+       char line[1024], *t;
+       int len, done = 0;
+     
+       line[0] = 0;
+     
+       using_history ();
+       while (!done)
+         {
+           printf ("history$ ");
+           fflush (stdout);
+           t = fgets (line, sizeof (line) - 1, stdin);
+           if (t && *t)
+             {
+               len = strlen (t);
+               if (t[len - 1] == '\n')
+                 t[len - 1] = '\0';
+             }
+     
+           if (!t)
+             strcpy (line, "quit");
+     
+           if (line[0])
+             {
+               char *expansion;
+               int result;
+     
+               result = history_expand (line, &expansion);
+               if (result)
+                 fprintf (stderr, "%s\n", expansion);
+     
+               if (result < 0 || result == 2)
+                 {
+                   free (expansion);
+                   continue;
+                 }
+     
+               add_history (expansion);
+               strncpy (line, expansion, sizeof (line) - 1);
+               free (expansion);
+             }
+     
+           if (strcmp (line, "quit") == 0)
+             done = 1;
+           else if (strcmp (line, "save") == 0)
+             write_history ("history_file");
+           else if (strcmp (line, "read") == 0)
+             read_history ("history_file");
+           else if (strcmp (line, "list") == 0)
+             {
+               register HIST_ENTRY **the_list;
+               register int i;
+     
+               the_list = history_list ();
+               if (the_list)
+                 for (i = 0; the_list[i]; i++)
+                   printf ("%d: %s\n", i + history_base, the_list[i]->line);
+             }
+           else if (strncmp (line, "delete", 6) == 0)
+             {
+               int which;
+               if ((sscanf (line + 6, "%d", &which)) == 1)
+                 {
+                   HIST_ENTRY *entry = remove_history (which);
+                   if (!entry)
+                     fprintf (stderr, "No such entry %d\n", which);
+                   else
+                     {
+                       free (entry->line);
+                       free (entry);
+                     }
+                 }
+               else
+                 {
+                   fprintf (stderr, "non-numeric arg given to `delete'\n");
+                 }
+             }
+         }
+     }
+
+
+File: history.info,  Node: Concept Index,  Next: Function and Variable Index,  Prev: Programming with GNU History,  Up: Top
+
+Concept Index
+*************
+
+* Menu:
+
+* anchored search:                      Searching the History List.
+* event designators:                    Event Designators.
+* expansion:                            History Interaction.
+* history events:                       Event Designators.
+* History Searching:                    Searching the History List.
+
+
+File: history.info,  Node: Function and Variable Index,  Prev: Concept Index,  Up: Top
+
+Function and Variable Index
+***************************
+
+* Menu:
+
+* add_history:                          History List Management.
+* append_history:                       Managing the History File.
+* current_history:                      Information About the History List.
+* get_history_event:                    History Expansion.
+* history_arg_extract:                  History Expansion.
+* history_base:                         History Variables.
+* history_comment_char:                 History Variables.
+* history_expand:                       History Expansion.
+* history_expansion_char:               History Variables.
+* history_get:                          Information About the History List.
+* history_get_history_state:            Initializing History and State Management.
+* history_is_stifled:                   History List Management.
+* history_length:                       History Variables.
+* history_list:                         Information About the History List.
+* history_no_expand_chars:              History Variables.
+* history_search:                       Searching the History List.
+* history_search_pos:                   Searching the History List.
+* history_search_prefix:                Searching the History List.
+* history_set_history_state:            Initializing History and State Management.
+* history_set_pos:                      Moving Around the History List.
+* history_subst_char:                   History Variables.
+* history_tokenize:                     History Expansion.
+* history_total_bytes:                  Information About the History List.
+* history_truncate_file:                Managing the History File.
+* max_input_history:                    History Variables.
+* next_history:                         Moving Around the History List.
+* previous_history:                     Moving Around the History List.
+* read_history:                         Managing the History File.
+* read_history_range:                   Managing the History File.
+* remove_history:                       History List Management.
+* replace_history_entry:                History List Management.
+* stifle_history:                       History List Management.
+* unstifle_history:                     History List Management.
+* using_history:                        Initializing History and State Management.
+* where_history:                        Information About the History List.
+* write_history:                        Managing the History File.
+
+
+
+Tag Table:
+Node: Top975
+Node: Using History Interactively1569
+Node: History Interaction2077
+Node: Event Designators3122
+Node: Word Designators3952
+Node: Modifiers4936
+Node: Programming with GNU History6065
+Node: Introduction to History6791
+Node: History Storage8112
+Node: History Functions9205
+Node: Initializing History and State Management10176
+Node: History List Management10968
+Node: Information About the History List12396
+Node: Moving Around the History List13702
+Node: Searching the History List14587
+Node: Managing the History File16419
+Node: History Expansion17925
+Node: History Variables19769
+Node: History Programming Example21138
+Node: Concept Index23742
+Node: Function and Variable Index24223
+
+End Tag Table
diff --git a/doc/history.ps b/doc/history.ps
new file mode 100644
index 0000000..839598f
--- /dev/null
+++ b/doc/history.ps
@@ -0,0 +1,2037 @@
+%!PS-Adobe-2.0
+%%Creator: dvipsk 5.490s Copyright 1986, 1992 Radical Eye Software
+%%Title: history.dvi
+%%Pages: 22 1
+%%BoundingBox: 0 0 612 792
+%%EndComments
+%DVIPSCommandLine: dvips -D 300 -o history.ps history.dvi
+%%BeginProcSet: tex.pro
+%!
+/TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N /X{S N}
+B /TR{translate}N /isls false N /vsize 11 72 mul N /@rigin{isls{[0 -1 1 0 0 0]
+concat}if 72 Resolution div 72 VResolution div neg scale isls{Resolution hsize
+-72 div mul 0 TR}if Resolution VResolution vsize -72 div 1 add mul TR matrix
+currentmatrix dup dup 4 get round 4 exch put dup dup 5 get round 5 exch put
+setmatrix}N /@landscape{/isls true N}B /@manualfeed{statusdict /manualfeed
+true put}B /@copies{/#copies X}B /FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N
+/IE 0 N /ctr 0 N /df-tail{/nn 8 dict N nn begin /FontType 3 N /FontMatrix
+fntrx N /FontBBox FBB N string /base X array /BitMaps X /BuildChar{
+CharBuilder}N /Encoding IE N end dup{/foo setfont}2 array copy cvx N load 0 nn
+put /ctr 0 N[}B /df{/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0
+0 sf neg 0 0]N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data
+dup length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{128
+ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub get 127
+sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data dup type
+/stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N /rc 0 N /gp 0 N
+/cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup /base get 2 index get
+S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx 0 ch-xoff ch-yoff ch-height
+sub ch-xoff ch-width add ch-yoff setcachedevice ch-width ch-height true[1 0 0
+-1 -.1 ch-xoff sub ch-yoff .1 add]{ch-image}imagemask restore}B /D{/cc X dup
+type /stringtype ne{]}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1
+ne{dup dup length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}
+B /I{cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin
+0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul add
+.99 lt{/FV}{/RV}ifelse load def pop}N /eop{SI restore showpage userdict
+/eop-hook known{eop-hook}if}N /@start{userdict /start-hook known{start-hook}
+if /VResolution X /Resolution X 1000 div /DVImag X /IE 256 array N 0 1 255{IE
+S 1 string dup 0 3 index put cvn put}for 65781.76 div /vsize X 65781.76 div
+/hsize X}N /p{show}N /RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley
+0 N /v{/ruley X /rulex X V}B /V{}B /RV statusdict begin /product where{pop
+product dup length 7 ge{0 7 getinterval dup(Display)eq exch 0 4 getinterval
+(NeXT)eq or}{pop false}ifelse}{false}ifelse end{{gsave TR -.1 -.1 TR 1 1 scale
+rulex ruley false RMat{BDot}imagemask grestore}}{{gsave TR -.1 -.1 TR rulex
+ruley scale 1 1 false RMat{BDot}imagemask grestore}}ifelse B /FV{gsave
+transform round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg
+rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail{dup
+/delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M}B /d{-3 M}
+B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{4 M}B /w{0
+rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{p 1 w}B /r{p 2 w}
+B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p a}B /bos{/SS save N}B
+/eos{SS restore}B end
+%%EndProcSet
+TeXDict begin 40258431 52099146 1000 300 300 @start /Fa 1 59
+df<70F8F8F87005057C840D>58 D E /Fb 1 59 df<78FCFCFCFC7806067B8510>58
+D E /Fc 24 123 df<1FC0007FF000707800201800001C00001C0007FC001FFC003C1C00701C00
+E01C00E01C00E01C00707C003FFF800F8F8011107E8F14>97 D<FC0000FC00001C00001C00001C
+00001C00001C00001CF8001DFE001F07001E03001C03801C01C01C01C01C01C01C01C01C01C01C
+01C01C03801E03001F0E001DFC000CF8001217809614>I<03F80FFC1C1C380870006000E000E0
+00E000E00060007000380E1C1E0FFC03F00F107E8F14>I<007E00007E00000E00000E00000E00
+000E00000E0007CE000FFE001C3E00301E00700E00E00E00E00E00E00E00E00E00E00E00E00E00
+700E00301E00383E001FEFC007CFC012177F9614>I<07E00FF01C38301C700CE00EE00EFFFEFF
+FEE00060007000380E1C1E0FFC03F00F107E8F14>I<007C00FE01CE03840380038003807FFEFF
+FE0380038003800380038003800380038003800380038003807FFC7FFC0F177F9614>I<07CF00
+1FFF80383B80301800701C00701C00701C003018003838003FF00037C0007000007000003FF800
+1FFC003FFE00700F00E00380E00380E00380E003807007003C1E001FFC0007F00011197F8F14>
+I<FC0000FC00001C00001C00001C00001C00001C00001C78001DFE001F86001E07001C07001C07
+001C07001C07001C07001C07001C07001C07001C07001C0700FF8FE0FF8FE01317809614>I<03
+0007800780030000000000000000007F807F800380038003800380038003800380038003800380
+03800380FFFCFFFC0E187D9714>I<FC0000FC00001C00001C00001C00001C00001C00001DFF80
+1DFF801C3C001C78001CF0001DE0001FC0001FC0001FE0001EF0001C70001C38001C38001C1C00
+FE3F80FE3F8011177F9614>107 D<FF80FF800380038003800380038003800380038003800380
+038003800380038003800380038003800380FFFEFFFE0F177E9614>I<FB8E00FFDF003CF3803C
+F38038E38038E38038E38038E38038E38038E38038E38038E38038E38038E380FEFBE0FE79E013
+10808F14>I<FC7800FDFE001F86001E07001C07001C07001C07001C07001C07001C07001C0700
+1C07001C07001C0700FF8FE0FF8FE01310808F14>I<07C01FF03C78701C701CE00EE00EE00EE0
+0EE00EE00E701C783C3C781FF007C00F107E8F14>I<FCF800FDFE001F07001E03001C03801C01
+C01C01C01C01C01C01C01C01C01C01C01C03801E03001F0E001DFC001CF8001C00001C00001C00
+001C00001C00001C0000FF8000FF80001218808F14>I<FE1F00FE7F800EE3800F81000F00000F
+00000E00000E00000E00000E00000E00000E00000E00000E0000FFF000FFF00011107F8F14>
+114 D<0FD83FF86038C038C038F0007F803FF007F8001C6006E006F006F81CFFF8CFE00F107E8F
+14>I<030007000700070007007FFCFFFC07000700070007000700070007000700070E070E070E
+070C03FC00F00F157F9414>I<FC3F00FC3F001C07001C07001C07001C07001C07001C07001C07
+001C07001C07001C07001C07001C1F000FFFE003E7E01310808F14>I<FE3F80FE3F801C1C001C
+1C001C1C001C1C000E38000E38000E380006300007700007700007700003E00003E00003E00011
+107F8F14>I<FF7F80FF7F80380E00380E00380E00380E0039CE0039CE0019CC001B6C001B6C00
+1A6C001A6C001E7C000E78000E780011107F8F14>I<7E3F007E3F001E38000E780007700007E0
+0003E00001C00003C00003E0000770000E78000E38001C1C00FE3F80FE3F8011107F8F14>I<FE
+3F80FE3F801C1C001C1C001C1C000E1C000E38000E380007380007300007300003700003700001
+E00001E00001E00001C00001C00001C0000380007380007700007E00003C000011187F8F14>I<
+3FFF7FFF700E701C7038007000E001C0038007000E001C0738077007FFFFFFFF10107F8F14>I
+E /Fd 1 59 df<60F0F06004047D830B>58 D E /Fe 25 122 df<078018603030303060186018
+E01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01C6018601870383030186007800E187E
+9713>48 D<03000700FF0007000700070007000700070007000700070007000700070007000700
+070007000700070007000700FFF00C187D9713>I<0F80106020304038803CC01CE01C401C003C
+003800380070006000C001800100020004040804100430083FF87FF8FFF80E187E9713>I<01E0
+06100C1818383038300070006000E000E7C0E860F030F018E018E01CE01CE01C601C601C701830
+183030186007C00E187E9713>54 D<40007FFE7FFC7FFC40088010801080200040004000800180
+01800100030003000300030007000700070007000700070002000F197E9813>I<078018603030
+201860186018601870103C303E600F8007C019F030F86038401CC00CC00CC00CC00C6008201018
+600FC00E187E9713>I<07801860303070306018E018E018E01CE01CE01C601C603C303C185C0F
+9C001C00180018003870307060604021801F000E187E9713>I<FFE7FF0E00700E00700E00700E
+00700E00700E00700E00700E00700E00700E00700E00700FFFF00E00700E00700E00700E00700E
+00700E00700E00700E00700E00700E00700E00700E0070FFE7FF181A7E991D>72
+D<0FC21836200E6006C006C002C002C002E00070007E003FE01FF807FC003E000E000700038003
+80038003C002C006E004D81887E0101A7E9915>83 D<3F8070C070E020700070007007F01C7030
+707070E070E071E071E0F171FB1E3C10107E8F13>97 D<07F80C1C381C30087000E000E000E000
+E000E000E0007000300438080C1807E00E107F8F11>99 D<007E00000E00000E00000E00000E00
+000E00000E00000E00000E00000E0003CE000C3E00380E00300E00700E00E00E00E00E00E00E00
+E00E00E00E00E00E00600E00700E00381E001C2E0007CFC0121A7F9915>I<07C01C3030187018
+600CE00CFFFCE000E000E000E0006000300438080C1807E00E107F8F11>I<0FCE187330307038
+703870387038303018602FC02000600070003FF03FFC1FFE600FC003C003C003C0036006381C07
+E010187F8F13>103 D<FC00001C00001C00001C00001C00001C00001C00001C00001C00001C00
+001CF8001D0C001E0E001E0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E
+001C0E001C0E00FF9FC0121A7F9915>I<18003C003C001800000000000000000000000000FC00
+1C001C001C001C001C001C001C001C001C001C001C001C001C001C00FF80091A80990A>I<FCF8
+001D0C001E0E001E0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E
+001C0E00FF9FC012107F8F15>110 D<07E01C38300C700E6006E007E007E007E007E007E00760
+06700E381C1C3807E010107F8F13>I<FCF8001F0E001E07001C03801C03801C01C01C01C01C01
+C01C01C01C01C01C01C01C03801C03001E07001F0C001CF0001C00001C00001C00001C00001C00
+001C0000FF800012177F8F15>I<FCE01D701E701E201C001C001C001C001C001C001C001C001C
+001C001C00FFC00C107F8F0F>114 D<1F2060E04020C020C020F0007F003FC01FE000F0807080
+30C030C020F0408F800C107F8F0F>I<0400040004000C000C001C003C00FFC01C001C001C001C
+001C001C001C001C001C201C201C201C201C200E4003800B177F960F>I<FF1F803C06001C0400
+1C04001E0C000E08000E080007100007100007900003A00003A00001C00001C00001C000008000
+11107F8F14>118 D<FF3F803C1C001C18000E100007200007600003C00001C00001E00003E000
+027000043800083800181C00381E00FC3FC012107F8F14>120 D<FF1F803C06001C04001C0400
+1E0C000E08000E080007100007100007900003A00003A00001C00001C00001C000008000008000
+010000010000E10000E20000E4000078000011177F8F14>I E /Ff 2 42
+df<007000E001C00380078007000E001E001E003C003C003C0078007800780078007000F000F0
+00F000F000F000F000F000F000F000F000F000F000700078007800780078003C003C003C001E00
+1E000E0007000780038001C000E000700C2E7EA112>40 D<E000700038001C001E000E00070007
+80078003C003C003C001E001E001E001E000E000F000F000F000F000F000F000F000F000F000F0
+00F000F000E001E001E001E001E003C003C003C00780078007000E001E001C0038007000E0000C
+2E7DA112>I E /Fg 25 123 df<0007F800007FFC0001FC0E0003F01F0007E03F000FC03F000F
+C03F000FC03F000FC01E000FC00C000FC000000FC000000FC0FF80FFFFFF80FFFFFF800FC01F80
+0FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F
+800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F807FF8FFF07FF8FFF01C23
+7FA220>12 D<000FFF80007FFF8001FC1F8003F03F8007E03F800FC03F800FC01F800FC01F800F
+C01F800FC01F800FC01F800FC01F800FC01F80FFFFFF80FFFFFF800FC01F800FC01F800FC01F80
+0FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F
+800FC01F800FC01F800FC01F800FC01F800FC01F807FF8FFF07FF8FFF01C237FA220>I<07FE00
+001FFF80003F07E0003F03F0003F01F0003F01F8001E01F8000001F8000001F800003FF80003FD
+F8001F81F8003E01F8007C01F800F801F800F801F800F801F800F801F8007C02F8007E0CF8001F
+F87F8007E03F8019167E951C>97 D<FF800000FF8000001F8000001F8000001F8000001F800000
+1F8000001F8000001F8000001F8000001F8000001F8000001F8000001F87F0001FBFFC001FF03E
+001FC01F001F800F801F800FC01F8007C01F8007E01F8007E01F8007E01F8007E01F8007E01F80
+07E01F8007E01F8007C01F8007C01F800FC01F800F801FC01F001E707E001C3FFC00180FE0001B
+237EA220>I<00FF8007FFE00F83F01F03F03E03F07E03F07C01E07C0000FC0000FC0000FC0000
+FC0000FC0000FC00007C00007E00007E00003F00301F00600FC0E007FF8000FE0014167E9519>
+I<0001FF000001FF0000003F0000003F0000003F0000003F0000003F0000003F0000003F000000
+3F0000003F0000003F0000003F0000FE3F0007FFBF000FC1FF001F007F003E003F007E003F007C
+003F007C003F00FC003F00FC003F00FC003F00FC003F00FC003F00FC003F00FC003F007C003F00
+7E003F003E003F001F007F000F81FF0007FF3FE001FC3FE01B237EA220>I<00FE0007FF800F83
+C01F01E03E00F07E00F07C00F87C0078FC0078FFFFF8FFFFF8FC0000FC0000FC00007C00007C00
+003E00183E00181F00300F80E003FFC000FF0015167E951A>I<00FE0F8003FF9FC00F83E3C01F
+01F3C01E00F0003E00F8003E00F8003E00F8003E00F8003E00F8001E00F0001F01F0000F83E000
+0BFF800008FE000018000000180000001C0000001FFFE0001FFFFC000FFFFF0007FFFF001FFFFF
+807C001FC078000FC0F80007C0F80007C0F80007C07C000F803E001F001F807E000FFFFC0001FF
+E0001A217F951D>103 D<FF800000FF8000001F8000001F8000001F8000001F8000001F800000
+1F8000001F8000001F8000001F8000001F8000001F8000001F83F0001F8FFC001F987E001FA03E
+001FC03F001FC03F001F803F001F803F001F803F001F803F001F803F001F803F001F803F001F80
+3F001F803F001F803F001F803F001F803F001F803F001F803F00FFF1FFE0FFF1FFE01B237DA220
+>I<1E003F007F807F807F807F803F001E00000000000000000000000000FF80FF801F801F801F
+801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80FFF0FFF00C247EA3
+0F>I<FF800000FF8000001F8000001F8000001F8000001F8000001F8000001F8000001F800000
+1F8000001F8000001F8000001F8000001F80FF801F80FF801F803C001F8030001F80E0001F81C0
+001F8300001F8600001F9E00001FBE00001FFF00001FDF80001F8FC0001F07C0001F07E0001F03
+F0001F01F8001F00F8001F00FC001F007E00FFE1FFC0FFE1FFC01A237EA21E>107
+D<FF80FF801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80
+1F801F801F801F801F801F801F801F801F801F801F801F801F801F80FFF0FFF00C237EA20F>I<
+FF03F803F800FF0FFE0FFE001F183F183F001F201F201F001F401FC01F801F401FC01F801F801F
+801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80
+1F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F
+801F80FFF0FFF0FFF0FFF0FFF0FFF02C167D9531>I<FF03F000FF0FFC001F187E001F203E001F
+403F001F403F001F803F001F803F001F803F001F803F001F803F001F803F001F803F001F803F00
+1F803F001F803F001F803F001F803F001F803F001F803F00FFF1FFE0FFF1FFE01B167D9520>I<
+00FF0007FFE00F81F01F00F83E007C7C003E7C003E7C003EFC003FFC003FFC003FFC003FFC003F
+FC003FFC003F7C003E7E007E3E007C1F00F80F81F007FFE000FF0018167E951D>I<FF87F000FF
+BFFC001FF07E001FC01F001F800F801F800FC01F800FC01F8007E01F8007E01F8007E01F8007E0
+1F8007E01F8007E01F8007E01F8007C01F800FC01F800FC01F801F801FC01F001FF07E001FBFFC
+001F8FE0001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F800000FFF0
+0000FFF000001B207E9520>I<FF0F80FF1FE01F33F01F63F01F43F01F43F01FC1E01F80001F80
+001F80001F80001F80001F80001F80001F80001F80001F80001F80001F80001F8000FFF800FFF8
+0014167E9518>114 D<07F9801FFF80380780700380F00180F00180F80000FF0000FFF8007FFE
+003FFF001FFF8007FF80003FC0C007C0C003C0E003C0E003C0F00380FC0F00EFFE00C3F8001216
+7E9517>I<00C00000C00000C00000C00001C00001C00003C00007C0000FC0001FC000FFFF00FF
+FF000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC1800F
+C1800FC1800FC1800FC18007C18007E30003FE0000FC0011207F9F16>I<FF81FF00FF81FF001F
+803F001F803F001F803F001F803F001F803F001F803F001F803F001F803F001F803F001F803F00
+1F803F001F803F001F803F001F803F001F803F001F807F001F80FF000FC1BF0007FF3FE001FC3F
+E01B167D9520>I<FFF01FE0FFF01FE00FC007000FC006000FE00E0007E00C0007F01C0003F018
+0003F8180001F8300001F8300000FC600000FC6000007EC000007EC000007FC000003F8000003F
+8000001F0000001F0000000E0000000E00001B167F951E>I<FFF3FF87FCFFF3FF87FC1F807C00
+E00FC07C00C00FC07E00C00FE03E01C007E03F018007E07F018003F07F030003F0CF830001F8CF
+860001F8CFC60001FD87C60000FD87CC0000FF03EC00007F03F800007F03F800007E01F800003E
+01F000003C00F000001C00E000001800600026167F9529>I<FFF0FFC0FFF0FFC00FC01C0007E0
+380007F0700003F0E00001F8C00000FD8000007F0000007F0000003F0000001F8000003FC00000
+37E0000067F00000C3F00001C1F8000380FC000700FE000E007E00FFC1FFE0FFC1FFE01B167F95
+1E>I<FFF01FE0FFF01FE00FC007000FC006000FE00E0007E00C0007F01C0003F0180003F81800
+01F8300001F8300000FC600000FC6000007EC000007EC000007FC000003F8000003F8000001F00
+00001F0000000E0000000E0000000C0000000C00000018000078180000FC380000FC300000FC60
+000069E000007F8000001F0000001B207F951E>I<7FFFE07FFFE0780FC0701FC0601F80E03F00
+C07F00C07E00C0FC0001FC0001F80003F00007F03007E0300FC0301FC0701F80703F00607F00E0
+7E03E0FFFFE0FFFFE014167E9519>I E /Fh 22 119 df<00E00000E00000E00000E00040E040
+F0E1E0F8E3E07EEFC01FFF0007FC0003F80007FC001FFF007EEFC0F8E3E0F0E1E040E04000E000
+00E00000E00000E00013157D991A>42 D<003800007C00007C00006C0000EE0000EE0000EE0000
+EE0000C60001C70001C70001C70001C7000383800383800383800383800783C00701C007FFC007
+FFC007FFC00E00E00E00E00E00E00E00E01C00707F83FCFF83FE7F83FC171E7F9D1A>65
+D<7FFFFCFFFFFC7FFFFC0E001C0E001C0E001C0E001C0E001C0E00000E00000E07000E07000E07
+000FFF000FFF000FFF000E07000E07000E07000E00000E00000E00000E000E0E000E0E000E0E00
+0E0E000E7FFFFEFFFFFE7FFFFE171E7F9D1A>69 D<FF8FF8FF8FF8FF8FF81C01C01C01C01C01C0
+1C01C01C01C01C01C01C01C01C01C01C01C01C01C01FFFC01FFFC01FFFC01C01C01C01C01C01C0
+1C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C0FF8FF8FF8FF8FF8FF8151E7E9D1A>
+72 D<FFFF80FFFF80FFFF8001C00001C00001C00001C00001C00001C00001C00001C00001C000
+01C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C000
+01C00001C000FFFF80FFFF80FFFF80111E7C9D1A>I<FE0FF8FF0FF8FF0FF81D81C01D81C01D81
+C01D81C01DC1C01CC1C01CC1C01CE1C01CE1C01C61C01C61C01C71C01C71C01C31C01C31C01C39
+C01C39C01C19C01C19C01C1DC01C0DC01C0DC01C0DC01C0DC0FF87C0FF87C0FF83C0151E7E9D1A
+>78 D<0FFE003FFF807FFFC07C07C07001C0F001E0E000E0E000E0E000E0E000E0E000E0E000E0
+E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0F001E0F001E0
+7001C07C07C07FFFC03FFF800FFE00131E7D9D1A>I<FFF000FFFC00FFFF001C0F801C07801C03
+C01C01C01C01C01C01C01C01C01C03C01C07801C0F801FFF001FFC001FFE001C0F001C07001C03
+801C03801C03801C03801C03801C03841C038E1C038E1C038EFF81FCFF81FCFF8070171E7E9D1A
+>82 D<03F1C00FFDC03FFFC07C0FC07003C0E003C0E001C0E001C0E001C0E00000700000780000
+3F00001FF00007FE0000FF00000F800003C00001C00000E00000E06000E0E000E0E000E0E001C0
+F001C0FC0780FFFF80EFFE00E3F800131E7D9D1A>I<7FFFFEFFFFFEFFFFFEE0380EE0380EE038
+0EE0380EE0380E0038000038000038000038000038000038000038000038000038000038000038
+0000380000380000380000380000380000380000380000380003FF8007FFC003FF80171E7F9D1A
+>I<FF01FEFF83FEFF01FE1E00F00E00E00E00E00701C00701C003838003838003C78001C70001
+C70000EE0000EE00007C00007C0000380000380000380000380000380000380000380000380000
+380000380001FF0001FF0001FF00171E7F9D1A>89 D<7FFFC0FFFFE0FFFFE07FFFC013047D7E1A
+>95 D<1FF0003FFC007FFE00780F00300700000380000380007F8007FF801FFF803F8380780380
+700380E00380E00380E00380700780780F803FFFFC1FFDFC07F0FC16157D941A>97
+D<00FF8003FFC00FFFE01F01E03C00C0780000700000700000E00000E00000E00000E00000E000
+007000007000007800703C00701F01F00FFFE003FFC000FE0014157D941A>99
+D<001FC0001FC0001FC00001C00001C00001C00001C00001C00001C001F1C007FDC00FFFC01E0F
+C03C07C07803C07001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C07003C07003C03807
+C03E0FC01FFFFC07FDFC01F1FC161E7E9D1A>I<FE0000FE0000FE00000E00000E00000E00000E
+00000E00000E00000E3E000EFF800FFFC00FC1C00F80E00F00E00E00E00E00E00E00E00E00E00E
+00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E0FFE3FEFFE3FEFFE3FE171E7F9D1A>
+104 D<01C00003E00003E00003E00001C0000000000000000000000000000000007FE000FFE000
+7FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000
+00E00000E00000E000FFFFC0FFFFC0FFFFC0121F7C9E1A>I<FE3E00FEFF80FFFFC00FC1C00F80
+E00F00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00
+E0FFE3FEFFE3FEFFE3FE17157F941A>110 D<01F00007FC001FFF003E0F803C07807803C07001
+C0E000E0E000E0E000E0E000E0E000E0E000E0F001E07001C07803C03C07803E0F801FFF0007FC
+0001F00013157D941A>I<FF83F0FF8FF8FFBFFC03FC3C03F01803E00003C00003C00003800003
+8000038000038000038000038000038000038000038000038000FFFF00FFFF80FFFF0016157E94
+1A>114 D<00C00001C00001C00001C00001C00001C00001C0007FFFE0FFFFE0FFFFE001C00001
+C00001C00001C00001C00001C00001C00001C00001C00001C00001C07001C07001C07001C07000
+E0E000FFE0007FC0001F00141C7F9B1A>116 D<7FC7FCFFC7FE7FC7FC0E00E00E00E00F01E007
+01C00701C00783C003838003838003838001C70001C70001C70000EE0000EE0000EE00007C0000
+7C0000380017157F941A>118 D E /Fi 41 123 df<0003FC00003FFE00007E070001F80F8003
+F01F8003E01F8007E01F8007E01F8007E01F8007E0060007E0000007E0000007E0000007E0FFC0
+FFFFFFC0FFFFFFC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00F
+C007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC007E0
+0FC007E00FC007E00FC07FFC7FFC7FFC7FFC1E267FA522>12 D<3C7EFFFFFFFF7E3C08087C8711
+>46 D<001C00003C0000FC00FFFC00FFFC0000FC0000FC0000FC0000FC0000FC0000FC0000FC00
+00FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC00
+00FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC007FFFFC7FFFFC16237CA21F>49
+D<01FF0007FFC01E07F03803F86001FC7C00FEFE00FEFE00FFFE007FFE007F7C007F3800FF0000
+FF0000FE0000FE0001FC0001F80003F00007E0000780000F00001E00003C0000700000E00301C0
+030380070700060600060FFFFE1FFFFE3FFFFE7FFFFCFFFFFCFFFFFC18237DA21F>I<01FF0007
+FFE01E03F03801F83C01FC7E00FE7E00FE7E00FE3E00FE1C01FE0001FC0001FC0003F80007F000
+0FC001FF0001FF000007E00001F00001F80000FC0000FE0000FF0000FF1000FF7C00FFFE00FFFE
+00FFFE00FEFE00FE7C01FC7001F83E07F00FFFC001FF0018237DA21F>I<000038000000780000
+0078000000F8000001F8000003F8000007F8000006F800000CF800001CF8000038F8000030F800
+0060F80000E0F80001C0F8000180F8000300F8000700F8000E00F8001C00F8001800F8003000F8
+007000F800E000F800FFFFFFC0FFFFFFC00001F8000001F8000001F8000001F8000001F8000001
+F8000001F800007FFFC0007FFFC01A237EA21F>I<18000C1F007C1FFFF81FFFF01FFFE01FFFC0
+1FFF801FFE0018000018000018000018000018000018FF001BFFE01F01F01C00F80800FC00007E
+00007E00007E00007F00007F78007FFC007FFC007FFC007FFC007EF8007E6000FC7000FC3801F8
+1E07E007FFC001FE0018237DA21F>I<001FC0007FF001F83803E00C07803E0F807E1F007E3F00
+7E3F007E7E003C7E00007E00007E0000FE3FC0FE7FF0FE80F8FF80FCFF007CFF007EFE007EFE00
+7FFE007FFE007FFE007F7E007F7E007F7E007F7E007F3E007E3F007E1F007C0F80F807C1F003FF
+C0007F0018237DA21F>I<300000003C0000003FFFFFC03FFFFFC03FFFFF807FFFFF007FFFFE00
+7FFFFC006000180060001800E0003000C0006000C000C000000180000001800000030000000700
+0000060000000E0000001E0000001E0000001E0000003C0000003C0000007C0000007C0000007C
+0000007C000000FC000000FC000000FC000000FC000000FC000000FC000000FC00000078000000
+3000001A257DA41F>I<00001C00000000001C00000000003E00000000003E00000000003E0000
+0000007F00000000007F0000000000FF8000000000FF8000000000FF80000000019FC000000001
+9FC0000000031FE0000000030FE0000000030FE00000000607F00000000607F00000000C07F800
+00000C03F80000001C03FC0000001801FC0000001801FC0000003001FE0000003000FE0000007F
+FFFF0000007FFFFF00000060007F000000C0007F800000C0003F800001C0003FC0000180001FC0
+000180001FC0000300000FE0000300000FE0000780000FF000FFF801FFFF80FFF801FFFF802925
+7EA42E>65 D<FFFFFFE00000FFFFFFFC000003F800FF000003F8001FC00003F80007E00003F800
+03F00003F80001F80003F80001FC0003F80000FC0003F80000FE0003F80000FE0003F800007F00
+03F800007F0003F800007F0003F800007F8003F800007F8003F800007F8003F800007F8003F800
+007F8003F800007F8003F800007F8003F800007F8003F800007F8003F800007F8003F800007F00
+03F800007F0003F800007F0003F80000FE0003F80000FE0003F80001FC0003F80001F80003F800
+03F00003F80007E00003F8001FC00003F800FF8000FFFFFFFE0000FFFFFFE0000029257EA42F>
+68 D<FFFFFFFF00FFFFFFFF0003F8007F0003F8000F8003F800078003F800038003F800038003
+F800018003F800018003F800018003F80000C003F80600C003F80600C003F806000003F8060000
+03F80E000003F81E000003FFFE000003FFFE000003F81E000003F80E000003F806000003F80600
+0003F806006003F806006003F800006003F80000C003F80000C003F80000C003F80000C003F800
+01C003F80003C003F80003C003F8000F8003F8003F80FFFFFFFF80FFFFFFFF8023257EA428>I<
+FFFFFFFE00FFFFFFFE0003F800FE0003F8001F0003F8000F0003F800070003F800070003F80003
+0003F800030003F800030003F800018003F806018003F806018003F806000003F806000003F80E
+000003F81E000003FFFE000003FFFE000003F81E000003F80E000003F806000003F806000003F8
+06000003F806000003F800000003F800000003F800000003F800000003F800000003F800000003
+F800000003F800000003F800000003F8000000FFFFF00000FFFFF0000021257EA427>I<FFFFE0
+FFFFE0FFFFE0FFFFE003F80003F80003F80003F80003F80003F80003F80003F80003F80003F800
+03F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F800
+03F80003F80003F80003F80003F80003F80003F80003FFFFFFF80003FFFFFFF80003F80003F800
+03F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F800
+03F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F800
+03F80003F80003F80003F800FFFFE0FFFFE0FFFFE0FFFFE02B257EA430>72
+D<FFFFE0FFFFE003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F8
+0003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F8
+0003F80003F80003F80003F80003F80003F80003F80003F80003F800FFFFE0FFFFE013257EA417
+>I<FFFFF000FFFFF00003F8000003F8000003F8000003F8000003F8000003F8000003F8000003
+F8000003F8000003F8000003F8000003F8000003F8000003F8000003F8000003F8000003F80000
+03F8000003F8000003F8000003F8000003F8000603F8000603F8000603F8000C03F8000C03F800
+0C03F8001C03F8001C03F8003C03F8007C03F800F803F803F8FFFFFFF8FFFFFFF81F257EA425>
+76 D<FFF8000000FFF8FFFC000001FFF803FC000001FE00037E0000037E00037E0000037E0003
+7E0000037E00033F0000067E00033F0000067E00031F80000C7E00031F80000C7E00030FC00018
+7E00030FC000187E000307E000307E000307E000307E000307E000307E000303F000607E000303
+F000607E000301F800C07E000301F800C07E000300FC01807E000300FC01807E0003007E03007E
+0003007E03007E0003007E03007E0003003F06007E0003003F06007E0003001F8C007E0003001F
+8C007E0003000FD8007E0003000FD8007E00030007F0007E00030007F0007E00030007F0007E00
+030003E0007E00078003E0007E00FFFC01C01FFFF8FFFC01C01FFFF835257EA43A>I<00FF0080
+07FFE3800F80F7801E001F803C000F807800078078000380F8000380F8000180F8000180FC0001
+80FC000000FF0000007FE000007FFF00003FFFE0003FFFF8001FFFFE0007FFFF0003FFFF80007F
+FF800003FFC000003FC000000FE0000007E0000007E0C00003E0C00003E0C00003E0C00003C0E0
+0003C0F00007C0F8000780FC000F00FFC03E00E3FFF800803FE0001B257DA422>83
+D<FFFF83FFFE01FFF0FFFF83FFFE01FFF007F0001FC0000F0007F0001FC000060003F8000FE000
+0C0003F8000FE0000C0003FC000FF0001C0001FC0007F000180001FC0007F000180000FE000FF8
+00300000FE000FF800300000FE000FFC003000007F0019FC006000007F0019FC006000007F8039
+FE00E000003F8030FE00C000003F8030FE00C000001FC0607F018000001FC0607F018000001FE0
+607F818000000FE0C03F830000000FE0C03F830000000FF1C03FC700000007F1801FC600000007
+F1801FC600000003FB000FEC00000003FB000FEC00000003FF000FFC00000001FE0007F8000000
+01FE0007F800000001FE0007F800000000FC0003F000000000FC0003F000000000780001E00000
+0000780001E000000000780001E000000000300000C000003C257FA43F>87
+D<07FF00001FFFC0003E03E0003F01F0003F01F8003F00FC001E00FC000000FC000000FC000000
+FC00003FFC0003FCFC000FC0FC003F00FC007E00FC007E00FC00FC00FC00FC00FC00FC00FC00FC
+017C007E017C003F067C001FFC3FE007F01FE01B187E971E>97 D<FFC00000FFC000000FC00000
+0FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC000
+000FC000000FC3F8000FCFFE000FF81F800FE00FC00FC007E00FC007E00FC003F00FC003F00FC0
+03F80FC003F80FC003F80FC003F80FC003F80FC003F80FC003F80FC003F80FC003F00FC003F00F
+C007E00FC007C00FE00FC00F383F000E1FFE000C07F0001D267EA522>I<007FE003FFF807C07C
+1F80FC1F00FC3F00FC7E00787E0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000
+7E00007F00003F000C1F800C1FC01807E07003FFE0007F0016187E971B>I<0001FF800001FF80
+00001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F
+8000001F8000001F80007F1F8003FFDF8007E0FF801F803F803F001F803F001F807E001F807E00
+1F80FE001F80FE001F80FE001F80FE001F80FE001F80FE001F80FE001F80FE001F807E001F807E
+001F803F001F803F003F801F807F800FC0FF8003FF9FF800FE1FF81D267EA522>I<007F0003FF
+C007C1F00F80F81F00F83F007C7E007C7E007EFE007EFE007EFFFFFEFFFFFEFE0000FE0000FE00
+007E00007E00007E00063F00061F000C0F801807E07003FFE0007F8017187E971C>I<000FC000
+7FF000F8F001F1F803F1F803E1F807E0F007E00007E00007E00007E00007E00007E00007E000FF
+FF00FFFF0007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007
+E00007E00007E00007E00007E00007E00007E00007E00007E0007FFF007FFF0015267EA513>I<
+01FF07C007FFDFE00F83F1E01F01F1E03E00F8007E00FC007E00FC007E00FC007E00FC007E00FC
+007E00FC003E00F8001F01F0000F83E0000FFFC00011FF00003000000030000000380000003C00
+00003FFFE0001FFFFC001FFFFE000FFFFF001FFFFF803C003F8078000FC0F80007C0F80007C0F8
+0007C0F80007C07C000F803E001F001F807E0007FFF80000FFC0001B247E971F>I<FFC00000FF
+C000000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC00000
+0FC000000FC000000FC000000FC1F8000FC7FE000FCC3F000FD01F000FF01F800FE01F800FE01F
+800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC0
+1F800FC01F800FC01F800FC01F800FC01F800FC01F80FFFCFFF8FFFCFFF81D267DA522>I<0F00
+1F803FC03FC03FC03FC01F800F000000000000000000000000000000FFC0FFC00FC00FC00FC00F
+C00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0FFF8FFF80D27
+7EA611>I<FFC0FFC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0
+0FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0FF
+FCFFFC0E267EA511>108 D<FF81FC01FC00FF87FF07FF000F8C1F8C1F800F980F980F800FB00F
+F00FC00FA00FE00FC00FA00FE00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0
+0FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00F
+C00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0FFFCFFFCFFFCFFFCFFFCFFFC
+2E187D9733>I<FF81F800FF87FE000F8C3F000F901F000FB01F800FA01F800FA01F800FC01F80
+0FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F
+800FC01F800FC01F800FC01F800FC01F80FFFCFFF8FFFCFFF81D187D9722>I<007F800003FFF0
+0007C0F8001F807E003F003F003F003F007E001F807E001F80FE001FC0FE001FC0FE001FC0FE00
+1FC0FE001FC0FE001FC0FE001FC0FE001FC07E001F807E001F803F003F003F003F001F807E000F
+C0FC0003FFF000007F80001A187E971F>I<FFC3F800FFCFFE000FF83F800FE00FC00FC00FE00F
+C007E00FC007F00FC003F00FC003F80FC003F80FC003F80FC003F80FC003F80FC003F80FC003F8
+0FC003F80FC007F00FC007F00FC007E00FC00FC00FE01FC00FF83F000FDFFE000FC7F0000FC000
+000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC00000FFFC0000FFFC
+00001D237E9722>I<FF87C0FF8FF00F98F80FB1F80FA1F80FA1F80FE0F00FC0000FC0000FC000
+0FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC000FFFE00
+FFFE0015187E9719>114 D<07F9801FFF803C0F80700380F00180F00180F00180FC0000FF8000
+7FFC007FFE003FFF800FFFC003FFC0001FE00003E0C001E0C001E0E001E0E001C0F003C0FC0780
+EFFF00C3FC0013187E9718>I<00600000600000600000600000E00000E00001E00001E00003E0
+0007E0001FE000FFFFC0FFFFC007E00007E00007E00007E00007E00007E00007E00007E00007E0
+0007E00007E00007E00007E06007E06007E06007E06007E06007E06003E0C003F0C001FF80007E
+0013237FA218>I<FFC1FF80FFC1FF800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F
+800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC0
+1F800FC03F800FC03F8007C07F8007E0DF8003FF9FF800FE1FF81D187D9722>I<FFF80FF8FFF8
+0FF80FC003C00FE0018007E0030007E0030003F0060003F0060003F80E0001F80C0001FC1C0000
+FC180000FE1800007E3000007E3000003F6000003F6000001FC000001FC000001FC000000F8000
+000F800000070000000700001D187F9720>I<FFF83FF0FFF83FF00FC00F0007E00C0003F01C00
+03F8380001FC700000FCE000007EC000003F8000003F8000001F8000000FC000001FE000001FF0
+000033F8000071F80000E0FC0001C07E0003807F0003003F000F001F80FFC07FF8FFC07FF81D18
+7F9720>120 D<FFF80FF8FFF80FF80FC003C00FE0018007E0030007E0030003F0060003F00600
+03F80E0001F80C0001FC1C0000FC180000FE1800007E3000007E3000003F6000003F6000001FC0
+00001FC000001FC000000F8000000F800000070000000700000006000000060000000C0000300C
+0000781C0000FC180000FC380000FC70000078E000007FC000001F0000001D237F9720>I<3FFF
+F83FFFF83E03F03807F0300FE0700FC0701F80603F80603F00607E0000FE0000FC0001F80003F8
+1803F01807E0180FE0180FC0381F80303F80707F00707E01F0FFFFF0FFFFF015187E971B>I
+E /Fj 29 122 df<0003F07C001E0DC600380F0F00701E0F00E01E0E00E00C0001C01C0001C01C
+0001C01C0001C01C0001C01C00038038007FFFFFC0038038000380380003803800038038000700
+700007007000070070000700700007007000070070000E00E0000E00E0000E00E0000E00E0000E
+00E0000E00E0001C01C0001E01E000FF8FFE0020207E9F1B>11 D<0003E0001C1800381800703C
+00E03C00E03801C00001C00001C00001C00001C0000380007FFFF0038070038070038070038070
+0700E00700E00700E00700E00700E00700E00E01C00E01C00E01C00E01C00E01C00E01C01C0380
+1E03C0FF0FF816207E9F19>I<0003F03F00001E09E08000380F80C000701F01E000E03E01E000
+E01E01C001C01C000001C01C000001C01C000001C01C000001C01C000003803800007FFFFFFF80
+038038038003803803800380380380038038038007007007000700700700070070070007007007
+00070070070007007007000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E0
+0E001C01C01C001E01E01E00FF8FF8FFC023207E9F26>14 D<0020000060000060000060000060
+007061C03843800E4E0007580001E00001E00006B8001C9C00708700E083800180000180000180
+0001800001000012147AA117>42 D<FFC0FFC00A027D8A0F>45 D<000C001C00FC0F3800380038
+00380038003800700070007000700070007000E000E000E000E000E000E001C001C001C001C001
+C001C0038003C0FFFE0F1E7C9D17>49 D<003F8000C1E00100F00200780400780400780F007C0F
+807C0F807C0F00780600780000F80000F00001E00001C0000380000700000E00001C0000380000
+600000C0000180000300200600200800401000403FFFC07FFF80FFFF80161E7E9D17>I<07F800
+0C0C001E06001E07001C070000070000070000070000FF0007C7001E07003C0E00780E00F00E10
+F00E10F00E10F01E10F02E20784F401F878014147D9317>97 D<01FC07060E0F1C0F380E780070
+00F000F000F000F000E000E000E000E000F0027004300818300FC010147C9314>99
+D<0000700003F00000F00000700000700000E00000E00000E00000E00000E00000E00001C000F9
+C00305C00E03C01C03C03801C0780380700380F00380F00380F00380F00380E00700E00700E007
+00E00700E00700700F00301E00186F000F8FE014207C9F19>I<00F800070E000E07001C070038
+0380780380700380F00380F00380FFFF80F00000E00000E00000E00000E00000F0010070020030
+04001C180007E00011147D9314>I<0007800018C00031E00061E000E1C000C00001C00001C000
+01C00001C00001C0000380007FF800038000038000038000038000070000070000070000070000
+0700000700000E00000E00000E00000E00000E00000E00001C00001E0000FFE00013207E9F0E>
+I<00000E003E1100E1A301C1C20381E00780E00701E00F01E00F01E00F01E00703C00703800787
+0004FC000800000800001800001C00000FFF000FFFC007FFE01800F0300030600030C00030C000
+30C000306000603000C01C070007FC00181F809417>I<00E00007E00001E00000E00000E00001
+C00001C00001C00001C00001C00001C000038000038F800390E003A0E003C0600380600780E007
+00E00700E00700E00700E00700E00E01C00E01C00E01C00E01C00E01C00E01C01C03801E03C0FF
+CFF815207E9F19>I<01C003E003E003C0018000000000000000000000000003801F8007800380
+03800700070007000700070007000E000E000E000E000E000E001C001E00FF800B1F7F9E0C>I<
+00E007E001E000E000E001C001C001C001C001C001C00380038003800380038003800700070007
+000700070007000E000E000E000E000E000E001C001E00FFC00B207F9F0C>108
+D<0387C07C001F9861860007A072070003C0340300038038030007807807000700700700070070
+07000700700700070070070007007007000E00E00E000E00E00E000E00E00E000E00E00E000E00
+E00E000E00E00E001C01C01C001E01E01E00FFCFFCFFC022147E9326>I<038F801F90E007A0E0
+03C0600380600780E00700E00700E00700E00700E00700E00E01C00E01C00E01C00E01C00E01C0
+0E01C01C03801E03C0FFCFF815147E9319>I<00FC000387000E01801C00C03800E03800E07000
+F0F000F0F000F0F000F0F000F0E001E0E001E0E001C0E003C0F00380700700380E001C1C0007E0
+0014147D9317>I<00E3E007EC3800F01C00E01E00E00E01C00E01C00F01C00F01C00F01C00F01
+C00F03801E03801E03801C03803C0380380380700740E00721C0071F000700000700000700000E
+00000E00000E00000E00001E0000FFC000181D809319>I<00F040038CC00E04C01C03C03C03C0
+780380780380F00380F00380F00380F00380E00700E00700E00700F00700F00F00700F00301E00
+186E000F8E00000E00000E00000E00001C00001C00001C00001C00003C0001FF80121D7C9318>
+I<038E001FB38007C78003C7800383000780000700000700000700000700000700000E00000E00
+000E00000E00000E00000E00001C00001E0000FFE00011147E9312>I<01F2060E080618061802
+380438001E001FE00FF003F8003C401C400C400C600C6018E010D0608FC00F147E9312>I<0080
+010001000100030007000F001E00FFF80E000E000E000E001C001C001C001C001C001C00380038
+203820382038203840384018800F000D1C7C9B12>I<1C0380FC1F803C07801C03801C03803807
+00380700380700380700380700380700700E00700E00700E00700E00701E00701E00703C00305E
+001F9FC012147B9319>I<FF83F81E00E01C00C01C00800E00800E01000E02000E02000F040007
+040007080007080007100003900003A00003E00003C00003800001800001000015147C9318>I<
+FF9FE1FC3E0780701C0300601C0300401C0380401C0380800E0780800E0581000E0981000E09C2
+000E11C2000731C4000721C4000760C8000740C8000780F0000780F0000300E000030060000200
+40001E147C9321>I<1FF0FF03C07801C06001C04000E08000E180007300007600003C00003C00
+001C00002E00004E000087000107000203800603800C01C03E03E0FF07FC18147F9318>I<0FF8
+3F8001E00E0001C00C0001C0080000E0180000E0100000E0200000E0200000F040000070400000
+708000007080000071000000390000003A0000003E0000003C0000003800000018000000100000
+0010000000200000002000000040000070C00000F0800000F1000000E20000007C000000191D80
+9318>I E /Fk 36 122 df<0001C0000003C000000FC000007FC0001FFFC000FFFFC000FFBFC0
+00E03FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003F
+C000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC00000
+3FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000
+003FC000003FC000003FC000003FC000003FC000003FC000003FC0007FFFFFE07FFFFFE07FFFFF
+E01B2E7AAD28>49 D<003FE00001FFFE0007FFFF800F80FFC01E003FE038001FF07C000FF87E00
+07FCFF0007FCFF8007FEFF8007FEFF8003FEFF8003FE7F0003FE3E0007FE000007FE000007FC00
+0007FC00000FF800000FF800000FF000001FE000001FC000003F8000007F0000007E000000F800
+0001F0000003E0000007C000000F0000001E000E003C000E0038000E0070001E00E0001C01C000
+1C0300003C07FFFFFC0FFFFFFC1FFFFFFC3FFFFFFC7FFFFFF8FFFFFFF8FFFFFFF8FFFFFFF81F2E
+7CAD28>I<0000007800000000000078000000000000FC000000000000FC000000000000FC0000
+00000001FE000000000001FE000000000003FF000000000003FF000000000007FF800000000007
+FF800000000007FF80000000000FFFC0000000000E7FC0000000001E7FE0000000001C3FE00000
+00001C3FE000000000383FF000000000381FF000000000781FF800000000700FF800000000700F
+F800000000E00FFC00000000E007FC00000001E007FE00000001C003FE00000001C003FE000000
+038003FF000000038001FF000000078001FF800000070000FF800000070000FF8000000FFFFFFF
+C000000FFFFFFFC000001FFFFFFFE000001C00003FE000003C00003FF000003800001FF0000038
+00001FF000007000001FF800007000000FF80000F000000FFC0000E0000007FC0000E0000007FC
+0001C0000007FE0003E0000003FE00FFFF8001FFFFFCFFFF8001FFFFFCFFFF8001FFFFFC36317D
+B03D>65 D<FFFFFFFFE00000FFFFFFFFFE0000FFFFFFFFFF800000FF0000FFC00000FF00003FF0
+0000FF00001FF80000FF00000FF80000FF000007FC0000FF000007FC0000FF000007FE0000FF00
+0003FE0000FF000003FE0000FF000003FE0000FF000003FE0000FF000007FE0000FF000007FE00
+00FF000007FC0000FF000007FC0000FF00000FF80000FF00001FF00000FF00003FE00000FF0000
+FF800000FF000FFF000000FFFFFFFE000000FFFFFFFFC00000FF00001FF00000FF000007F80000
+FF000003FE0000FF000003FE0000FF000001FF0000FF000001FF8000FF000000FF8000FF000000
+FFC000FF000000FFC000FF000000FFC000FF000000FFC000FF000000FFC000FF000000FFC000FF
+000000FFC000FF000000FF8000FF000001FF8000FF000001FF0000FF000003FF0000FF000007FE
+0000FF00000FFC0000FF00007FF800FFFFFFFFFFE000FFFFFFFFFF8000FFFFFFFFFC000032317E
+B039>I<000003FF80018000003FFFF003800001FFFFFC07800007FF003F0F80001FF800079F80
+003FC00001FF8000FF800000FF8001FE0000007F8003FC0000003F8007FC0000001F8007F80000
+000F800FF00000000F801FF000000007801FF000000007803FE000000007803FE000000003807F
+E000000003807FE000000003807FC000000000007FC00000000000FFC00000000000FFC0000000
+0000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC0
+0000000000FFC000000000007FC000000000007FC000000000007FE000000000007FE000000003
+803FE000000003803FE000000003801FF000000003801FF000000007800FF0000000070007F800
+0000070007FC0000000E0003FC0000001E0001FE0000001C0000FF8000007800003FC00000F000
+001FF80003E0000007FF003F80000001FFFFFE000000003FFFF80000000003FF80000031317CB0
+3A>I<FFFFFFFFFFE0FFFFFFFFFFE0FFFFFFFFFFE000FF80007FE000FF80000FF000FF800003F0
+00FF800001F000FF800001F000FF800000F000FF800000F000FF8000007000FF8000007000FF80
+00007000FF8000003800FF8000003800FF8007003800FF8007003800FF8007000000FF80070000
+00FF8007000000FF800F000000FF801F000000FF803F000000FFFFFF000000FFFFFF000000FFFF
+FF000000FF803F000000FF801F000000FF800F000000FF8007000000FF8007000000FF80070000
+00FF8007000000FF8007000000FF8000000000FF8000000000FF8000000000FF8000000000FF80
+00000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF80000000
+00FF80000000FFFFFFE00000FFFFFFE00000FFFFFFE000002D317EB033>70
+D<000003FF00030000007FFFF007000001FFFFFC0F000007FF007E1F00001FF0000FBF00007FC0
+0003FF0000FF800001FF0001FE0000007F0003FC0000007F0007FC0000003F000FF80000001F00
+0FF00000001F001FF00000000F001FF00000000F003FE000000007003FE000000007007FE00000
+0007007FE000000007007FC00000000000FFC00000000000FFC00000000000FFC00000000000FF
+C00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC0000000
+0000FFC00000000000FFC00007FFFFFC7FC00007FFFFFC7FE00007FFFFFC7FE0000001FF003FE0
+000001FF003FE0000001FF001FF0000001FF001FF0000001FF000FF0000001FF000FF8000001FF
+0007FC000001FF0003FC000001FF0001FE000001FF0000FF800001FF00007FC00003FF00001FF8
+00077F000007FF003E3F000001FFFFFC1F0000007FFFF00F00000003FF80030036317CB03F>I<
+FFFFFF807FFFFFC0FFFFFF807FFFFFC0FFFFFF807FFFFFC000FF8000007FC00000FF8000007FC0
+0000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007F
+C00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF800000
+7FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000
+007FC00000FF8000007FC00000FF8000007FC00000FFFFFFFFFFC00000FFFFFFFFFFC00000FFFF
+FFFFFFC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF
+8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000
+FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC000
+00FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC00000FF8000007FC0
+0000FF8000007FC00000FF8000007FC000FFFFFF807FFFFFC0FFFFFF807FFFFFC0FFFFFF807FFF
+FFC03A317EB03F>I<FFFFFF80FFFFFF80FFFFFF8000FF800000FF800000FF800000FF800000FF
+800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000
+FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF8000
+00FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF80
+0000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF8000FFFF
+FF80FFFFFF80FFFFFF8019317EB01E>I<FFFF800001FFFFC0FFFFC00001FFFFC0FFFFE00001FF
+FFC000FFF0000003E00000FFF8000001C00000EFFC000001C00000E7FC000001C00000E7FE0000
+01C00000E3FF000001C00000E1FF800001C00000E0FFC00001C00000E07FE00001C00000E03FE0
+0001C00000E03FF00001C00000E01FF80001C00000E00FFC0001C00000E007FE0001C00000E003
+FE0001C00000E001FF0001C00000E001FF8001C00000E000FFC001C00000E0007FE001C00000E0
+003FF001C00000E0001FF001C00000E0001FF801C00000E0000FFC01C00000E00007FE01C00000
+E00003FF01C00000E00001FF81C00000E00000FF81C00000E00000FFC1C00000E000007FE1C000
+00E000003FF1C00000E000001FF9C00000E000000FFDC00000E0000007FDC00000E0000007FFC0
+0000E0000003FFC00000E0000001FFC00000E0000000FFC00000E00000007FC00000E00000003F
+C00000E00000003FC00000E00000001FC00000E00000000FC00001F000000007C000FFFFE00000
+03C000FFFFE0000001C000FFFFE0000001C0003A317EB03F>78 D<FFFFFFFFE000FFFFFFFFFE00
+FFFFFFFFFF8000FF8000FFE000FF80003FF000FF80000FF800FF800007FC00FF800007FC00FF80
+0003FE00FF800003FE00FF800003FF00FF800003FF00FF800003FF00FF800003FF00FF800003FF
+00FF800003FF00FF800003FF00FF800003FE00FF800003FE00FF800007FC00FF800007F800FF80
+000FF800FF80003FE000FF8000FFC000FFFFFFFF0000FFFFFFF80000FF8000000000FF80000000
+00FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF80
+00000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF80000000
+00FF8000000000FF8000000000FF8000000000FF8000000000FF80000000FFFFFF800000FFFFFF
+800000FFFFFF80000030317EB037>80 D<7FFFFFFFFFFF007FFFFFFFFFFF007FFFFFFFFFFF007F
+C00FF801FF007E000FF8003F007C000FF8001F0078000FF8000F0078000FF8000F0070000FF800
+0700F0000FF8000780F0000FF8000780F0000FF8000780E0000FF8000380E0000FF8000380E000
+0FF8000380E0000FF8000380E0000FF800038000000FF800000000000FF800000000000FF80000
+0000000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000F
+F800000000000FF800000000000FF800000000000FF800000000000FF800000000000FF8000000
+00000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000FF8
+00000000000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000
+000FF800000000000FF800000000000FF8000000007FFFFFFF0000007FFFFFFF0000007FFFFFFF
+000031307DAF38>84 D<FFFFFF8003FFFF80FFFFFF8003FFFF80FFFFFF8003FFFF8000FF800000
+07C00000FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF8000
+0003800000FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF80
+000003800000FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF
+80000003800000FF80000003800000FF80000003800000FF80000003800000FF80000003800000
+FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF800000038000
+00FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF8000000380
+0000FF80000003800000FF80000003800000FF800000038000007F800000038000007F80000007
+0000007FC00000070000003FC000000E0000003FC000000E0000001FE000001C0000000FF00000
+3800000007F800007000000003FC0001E000000000FF801FC0000000003FFFFF80000000000FFF
+FE000000000000FFE000000039317EB03E>I<FFFFFC0000FFFFFFFFFC0000FFFFFFFFFC0000FF
+FF03FF00000003C001FF000000038001FF800000078000FF800000070000FFC000000700007FC0
+00000E00007FC000000E00007FE000001E00003FE000001C00003FF000003C00001FF000003800
+001FF800003800000FF800007000000FFC000070000007FC0000E0000007FC0000E0000007FE00
+01E0000003FE0001C0000003FF0003C0000001FF000380000001FF800380000000FF8007000000
+00FFC00700000000FFC00F000000007FC00E000000007FE01E000000003FE01C000000003FF03C
+000000001FF038000000001FF838000000000FF870000000000FF870000000000FFCF000000000
+07FCE00000000007FFE00000000003FFC00000000003FFC00000000001FF800000000001FF8000
+00000000FF000000000000FF000000000000FF0000000000007E0000000000007E000000000000
+3C0000000000003C00000038317EB03D>I<00FFF0000003FFFE00000F803F80000FC00FE0001F
+E007F0001FE007F0001FE003F8000FC003FC00078003FC00000003FC00000003FC00000003FC00
+000003FC000000FFFC00001FFFFC0000FFE3FC0003FC03FC000FF003FC001FC003FC003FC003FC
+007F8003FC007F8003FC00FF0003FC00FF0003FC00FF0003FC00FF0007FC00FF0007FC007F800D
+FC003FC019FE001FE070FFF007FFE07FF000FF803FF024207E9F27>97 D<01F8000000FFF80000
+00FFF8000000FFF80000000FF800000007F800000007F800000007F800000007F800000007F800
+000007F800000007F800000007F800000007F800000007F800000007F800000007F800000007F8
+00000007F83FE00007F8FFFC0007FBE07F0007FF001F8007FE000FC007FC000FE007F80007F007
+F80007F807F80007F807F80003FC07F80003FC07F80003FC07F80003FE07F80003FE07F80003FE
+07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FC07F80003FC07F80003
+FC07F80007F807F80007F807F80007F007FC000FE007FE000FC007E7003F8007C3C0FE000780FF
+F80007003FC00027327EB12D>I<000FFF00007FFFC001FC01F003F003F007E007F80FE007F81F
+C007F83FC003F03FC001E07F8000007F8000007F800000FF800000FF800000FF800000FF800000
+FF800000FF800000FF800000FF8000007F8000007F8000007F8000003FC0001C3FC0001C1FC000
+380FE0003807E0007003F001E001FC07C0007FFF00000FF8001E207D9F24>I<0000000FC00000
+07FFC0000007FFC0000007FFC00000007FC00000003FC00000003FC00000003FC00000003FC000
+00003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC0
+0000003FC00007F83FC0003FFF3FC000FE07BFC003F801FFC007E0007FC00FE0007FC01FC0003F
+C03FC0003FC03FC0003FC07F80003FC07F80003FC07F80003FC0FF80003FC0FF80003FC0FF8000
+3FC0FF80003FC0FF80003FC0FF80003FC0FF80003FC0FF80003FC07F80003FC07F80003FC07F80
+003FC03FC0003FC03FC0003FC01FC0003FC00FE0007FC007E000FFC003F003FFE001FC0F3FFE00
+7FFE3FFE000FF03FFE27327DB12D>I<000FFC00007FFF8001FC0FC003F003E007E001F00FE001
+F81FC000FC3FC000FE3FC000FE7F80007E7F80007F7F80007FFF80007FFF80007FFFFFFFFFFFFF
+FFFFFF800000FF800000FF800000FF8000007F8000007F8000007F8000003FC000071FC000071F
+C0000E0FE0000E07F0001C03F8007800FE03E0003FFFC00007FE0020207E9F25>I<0001FE0000
+0FFF80001FC3C0007F07E000FE0FF001FE0FF001FC0FF003FC0FF003FC07E003FC018003FC0000
+03FC000003FC000003FC000003FC000003FC000003FC000003FC0000FFFFFC00FFFFFC00FFFFFC
+0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC
+000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003
+FC000003FC000003FC000003FC000003FC000003FC000003FC00007FFFF0007FFFF0007FFFF000
+1C327EB119>I<001FF007C000FFFE3FE001F83F79F007E00FC3F00FE00FE1F00FC007E0E01FC0
+07F0001FC007F0003FC007F8003FC007F8003FC007F8003FC007F8003FC007F8001FC007F0001F
+C007F0000FC007E0000FE00FE00007E00FC00003F83F000006FFFE00000E1FF000000E00000000
+1E000000001E000000001F000000001F800000001FFFFF80000FFFFFF0000FFFFFFC0007FFFFFE
+0003FFFFFF0003FFFFFF800FFFFFFFC01F00007FC07E00001FE07C00000FE0FC000007E0FC0000
+07E0FC000007E0FC000007E07E00000FC03E00000F803F00001F800FC0007E0007F803FC0001FF
+FFF000001FFF0000242F7E9F28>I<01F8000000FFF8000000FFF8000000FFF80000000FF80000
+0007F800000007F800000007F800000007F800000007F800000007F800000007F800000007F800
+000007F800000007F800000007F800000007F800000007F800000007F807F80007F83FFE0007F8
+783F0007F8C03F8007F9801FC007FB001FC007FE001FE007FC001FE007FC001FE007FC001FE007
+F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE0
+07F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001F
+E007F8001FE007F8001FE007F8001FE0FFFFC3FFFFFFFFC3FFFFFFFFC3FFFF28327DB12D>I<03
+C00007E0000FF0001FF8001FF8001FF8001FF8000FF00007E00003C00000000000000000000000
+000000000000000000000000000000000001F800FFF800FFF800FFF8000FF80007F80007F80007
+F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007
+F80007F80007F80007F80007F80007F80007F80007F80007F800FFFF80FFFF80FFFF8011337DB2
+17>I<01F800FFF800FFF800FFF8000FF80007F80007F80007F80007F80007F80007F80007F800
+07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800
+07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800
+07F80007F80007F80007F80007F80007F80007F80007F80007F800FFFFC0FFFFC0FFFFC012327D
+B117>108 D<03F007F8001FE000FFF03FFE00FFF800FFF0783F01E0FC00FFF0C03F8300FE000F
+F1801FC6007F0007F3001FCC007F0007F6001FF8007F8007FC001FF0007F8007FC001FF0007F80
+07FC001FF0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F
+8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE000
+7F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0
+007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001F
+E0007F80FFFFC3FFFF0FFFFCFFFFC3FFFF0FFFFCFFFFC3FFFF0FFFFC3E207D9F43>I<03F007F8
+00FFF03FFE00FFF0783F00FFF0C03F800FF1801FC007F3001FC007F6001FE007FC001FE007FC00
+1FE007FC001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8
+001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007
+F8001FE007F8001FE007F8001FE007F8001FE007F8001FE0FFFFC3FFFFFFFFC3FFFFFFFFC3FFFF
+28207D9F2D>I<0007FC0000007FFFC00001FC07F00003F001F80007E000FC000FC0007E001FC0
+007F003FC0007F803F80003F807F80003FC07F80003FC07F80003FC0FF80003FE0FF80003FE0FF
+80003FE0FF80003FE0FF80003FE0FF80003FE0FF80003FE0FF80003FE07F80003FC07F80003FC0
+7F80003FC03FC0007F803FC0007F801FC0007F000FE000FE0007E000FC0003F803F80001FE0FF0
+00007FFFC0000007FC000023207E9F28>I<01F83FE000FFF8FFFC00FFFBE07F00FFFF003F8007
+FE001FC007FC000FE007F8000FF007F80007F807F80007F807F80007FC07F80003FC07F80003FC
+07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003
+FE07F80003FC07F80007FC07F80007FC07F80007F807F80007F807F8000FF007FC000FE007FE00
+1FC007FF003F8007FBC0FE0007F8FFF80007F83FC00007F800000007F800000007F800000007F8
+00000007F800000007F800000007F800000007F800000007F800000007F800000007F8000000FF
+FFC00000FFFFC00000FFFFC00000272E7E9F2D>I<03F03F00FFF07FC0FFF1C3E0FFF187E00FF3
+0FF007F60FF007F60FF007FC07E007FC03C007FC000007FC000007F8000007F8000007F8000007
+F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F80000
+07F8000007F8000007F8000007F8000007F80000FFFFE000FFFFE000FFFFE0001C207E9F21>
+114 D<01FF860007FFFE001F00FE003C003E0078001E0078000E00F8000E00F8000E00F8000E00
+FC000000FF800000FFFC00007FFFC0007FFFF0003FFFF8001FFFFC0007FFFE0001FFFF00003FFF
+000000FF8000003F8060001F80E0000F80E0000F80F0000F80F0000F00F8000F00FC001E00FE00
+1C00FF807800F3FFF000C07F800019207D9F20>I<001C0000001C0000001C0000001C0000001C
+0000003C0000003C0000003C0000007C0000007C000000FC000001FC000003FC000007FC00001F
+FFFE00FFFFFE00FFFFFE0003FC000003FC000003FC000003FC000003FC000003FC000003FC0000
+03FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC03
+8003FC038003FC038003FC038003FC038003FC038003FC038001FC038001FC070000FE0700007F
+0E00003FFC000007F000192E7FAD1F>I<01F80007E0FFF803FFE0FFF803FFE0FFF803FFE00FF8
+003FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007
+F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE0
+07F8001FE007F8001FE007F8001FE007F8001FE007F8003FE007F8003FE003F8007FE003F8007F
+E001FC00DFF000FE039FFF007FFF1FFF000FFC1FFF28207D9F2D>I<FFFF801FFCFFFF801FFCFF
+FF801FFC0FF80003C007F800038007FC00078003FC00070003FE000F0001FE000E0001FF000E00
+00FF001C0000FF001C00007F803800007F803800007FC07800003FC07000003FE0F000001FE0E0
+00001FF1E000000FF1C000000FF9C0000007FB80000007FB80000003FF00000003FF00000003FF
+00000001FE00000001FE00000000FC00000000FC00000000780000000078000026207E9F2B>I<
+FFFF1FFFE07FF8FFFF1FFFE07FF8FFFF1FFFE07FF80FF000FE0007800FF800FE00078007F800FE
+00070007F8007F00070003FC007F000E0003FC00FF800E0003FE00FF801E0001FE00FF801C0001
+FE01DFC01C0001FF01DFC03C0000FF03DFE0380000FF838FE07800007F838FE07000007F8707F0
+7000007FC707F0F000003FCF07F8E000003FCE03F8E000001FEE03F9C000001FFC01FDC000001F
+FC01FFC000000FFC01FF8000000FF800FF80000007F800FF00000007F0007F00000007F0007F00
+000003F0007E00000003E0003E00000001E0003C00000001C0001C000035207E9F3A>I<7FFF80
+7FFC7FFF807FFC7FFF807FFC03FE000F0001FE001E0000FF003C0000FF807800007FC07800003F
+E0F000001FE1E000000FF3C000000FFF80000007FF00000003FE00000001FE00000000FF000000
+00FF80000000FFC0000001FFC0000003DFE00000078FF00000078FF800000F07FC00001E03FC00
+003C01FE00007800FF0000F000FF8000E0007FC001E0003FC0FFFC01FFFFFFFC01FFFFFFFC01FF
+FF28207F9F2B>I<FFFF801FFCFFFF801FFCFFFF801FFC0FF80003C007F800038007FC00078003
+FC00070003FE000F0001FE000E0001FF000E0000FF001C0000FF001C00007F803800007F803800
+007FC07800003FC07000003FE0F000001FE0E000001FF1E000000FF1C000000FF9C0000007FB80
+000007FB80000003FF00000003FF00000003FF00000001FE00000001FE00000000FC00000000FC
+000000007800000000780000000070000000007000000000F000000000E000000001E000007C01
+C00000FE03C00000FE03800000FE07800000FE0F000000FC1E000000787C0000003FF00000000F
+C0000000262E7E9F2B>I E /Fl 1 14 df<0001FE00000007FF8000001E01E000007800780000
+E0001C000180000600030000030006000001800C000000C00C000000C018000000603000000030
+30000000303000000030600000001860000000186000000018C00000000CC00000000CC0000000
+0CC00000000CC00000000CC00000000CC00000000CC00000000CC00000000C6000000018600000
+0018600000001830000000303000000030300000003018000000600C000000C00C000000C00600
+0001800300000300018000060000E0001C000078007800001E01E0000007FF80000001FE000026
+2B7DA02D>13 D E /Fm 46 122 df<3C007F00FF80FF80FFC0FFC0FFC07FC03EC000C000C00180
+018001800300030006000E001C00380030000A157B8813>44 D<1C007F007F00FF80FF80FF807F
+007F001C0009097B8813>46 D<000E00001E00007E0007FE00FFFE00FFFE00F8FE0000FE0000FE
+0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE
+0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE
+0000FE007FFFFE7FFFFE7FFFFE17277BA622>49 D<00FF800007FFF0000FFFFC001E03FE003800
+FF807C003F80FE003FC0FF001FC0FF001FE0FF000FE0FF000FE07E000FE03C001FE000001FE000
+001FC000001FC000003F8000003F0000007E000000FC000000F8000001F0000003E00000078000
+000F0000001E0000003C00E0007000E000E000E001C001C0038001C0060001C00FFFFFC01FFFFF
+C03FFFFFC07FFFFFC0FFFFFF80FFFFFF80FFFFFF801B277DA622>I<007F800003FFF00007FFFC
+000F80FE001F007F003F807F003F803F803F803F803F803F801F803F801F003F8000007F000000
+7F0000007E000000FC000001F8000007F00000FFC00000FFC0000001F80000007E0000003F0000
+003F8000001FC000001FC000001FE000001FE03C001FE07E001FE0FF001FE0FF001FE0FF001FC0
+FF003FC0FE003F807C007F003F00FE001FFFFC0007FFF00000FF80001B277DA622>I<00000E00
+00001E0000003E0000007E000000FE000000FE000001FE000003FE0000077E00000E7E00000E7E
+00001C7E0000387E0000707E0000E07E0000E07E0001C07E0003807E0007007E000E007E000E00
+7E001C007E0038007E0070007E00E0007E00FFFFFFF8FFFFFFF8FFFFFFF80000FE000000FE0000
+00FE000000FE000000FE000000FE000000FE000000FE00007FFFF8007FFFF8007FFFF81D277EA6
+22>I<180003001F801F001FFFFE001FFFFC001FFFF8001FFFF0001FFFC0001FFF00001C000000
+1C0000001C0000001C0000001C0000001C0000001C0000001C7FC0001DFFF8001F80FC001E003F
+0008003F0000001F8000001FC000001FC000001FE000001FE018001FE07C001FE0FE001FE0FE00
+1FE0FE001FE0FE001FC0FC001FC078003F8078003F803C007F001F01FE000FFFFC0003FFF00000
+FF80001B277DA622>I<380000003E0000003FFFFFF03FFFFFF03FFFFFF07FFFFFE07FFFFFC07F
+FFFF807FFFFF0070000E0070000E0070001C00E0003800E0007000E000E0000001E0000001C000
+000380000007800000070000000F0000001F0000001E0000003E0000003E0000007E0000007C00
+00007C000000FC000000FC000000FC000000FC000001FC000001FC000001FC000001FC000001FC
+000001FC000001FC000000F80000007000001C297CA822>55 D<00000780000000000780000000
+000FC0000000000FC0000000000FC0000000001FE0000000001FE0000000003FF0000000003FF0
+000000003FF00000000077F80000000077F800000000F7FC00000000E3FC00000000E3FC000000
+01C1FE00000001C1FE00000003C1FF0000000380FF0000000380FF00000007007F80000007007F
+8000000F007FC000000E003FC000000E003FC000001C001FE000001C001FE000003FFFFFF00000
+3FFFFFF000003FFFFFF00000700007F80000700007F80000F00007FC0000E00003FC0000E00003
+FC0001C00001FE0001C00001FE0003C00001FF00FFFE003FFFFCFFFE003FFFFCFFFE003FFFFC2E
+297EA833>65 D<FFFFFFF800FFFFFFFF00FFFFFFFFC003F8001FE003F8000FF003F80007F803F8
+0003F803F80003FC03F80003FC03F80001FC03F80001FC03F80001FC03F80003FC03F80003F803
+F80003F803F80007F003F8000FF003F8001FC003F800FF8003FFFFFE0003FFFFFFC003F8000FF0
+03F80003F803F80001FC03F80001FE03F80000FE03F80000FE03F80000FF03F80000FF03F80000
+FF03F80000FF03F80000FF03F80000FF03F80000FE03F80001FE03F80003FC03F80007FC03F800
+1FF8FFFFFFFFE0FFFFFFFFC0FFFFFFFE0028297DA830>I<00007FE0030007FFFC07001FFFFF0F
+007FF00F9F00FF0001FF01FC0000FF03F800007F07F000003F0FE000001F1FC000001F1FC00000
+0F3F8000000F3F800000077F800000077F800000077F00000000FF00000000FF00000000FF0000
+0000FF00000000FF00000000FF00000000FF00000000FF00000000FF000000007F000000007F80
+0000007F800000073F800000073F800000071FC00000071FC000000E0FE000000E07F000001C03
+F800003C01FC00007800FF0001F0007FF007C0001FFFFF800007FFFE0000007FF00028297CA831
+>I<FFFFFFFFE0FFFFFFFFE0FFFFFFFFE003FC001FE003FC0007F003FC0001F003FC0001F003FC
+0000F003FC00007003FC00007003FC00007003FC01C07803FC01C03803FC01C03803FC01C03803
+FC03C00003FC03C00003FC0FC00003FFFFC00003FFFFC00003FFFFC00003FC0FC00003FC03C000
+03FC03C00003FC01C00E03FC01C00E03FC01C00E03FC01C01C03FC00001C03FC00001C03FC0000
+1C03FC00003C03FC00003803FC00007803FC0000F803FC0001F803FC0003F803FC001FF8FFFFFF
+FFF0FFFFFFFFF0FFFFFFFFF027297EA82C>69 D<FFFFFFFFC0FFFFFFFFC0FFFFFFFFC003FC003F
+C003FC000FE003FC0003E003FC0001E003FC0001E003FC0000E003FC0000E003FC0000E003FC00
+00F003FC01C07003FC01C07003FC01C07003FC01C00003FC03C00003FC03C00003FC0FC00003FF
+FFC00003FFFFC00003FFFFC00003FC0FC00003FC03C00003FC03C00003FC01C00003FC01C00003
+FC01C00003FC01C00003FC00000003FC00000003FC00000003FC00000003FC00000003FC000000
+03FC00000003FC00000003FC000000FFFFFC0000FFFFFC0000FFFFFC000024297EA82A>I<0000
+7FE003000007FFFC0700001FFFFF0F00007FF00F9F0000FF0001FF0001FC0000FF0003F800007F
+0007F000003F000FE000001F001FC000001F001FC000000F003F8000000F003F80000007007F80
+000007007F80000007007F0000000000FF0000000000FF0000000000FF0000000000FF00000000
+00FF0000000000FF0000000000FF0000000000FF0000000000FF0000FFFFF87F0000FFFFF87F80
+00FFFFF87F800000FF003F800000FF003F800000FF001FC00000FF001FC00000FF000FE00000FF
+0007F00000FF0003F80000FF0001FC0000FF0000FF0001FF00007FF007FF00001FFFFF9F000007
+FFFE0F0000007FF003002D297CA835>I<FFFFF00FFFFFFFFFF00FFFFFFFFFF00FFFFF03FC0000
+3FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003
+FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC0000
+3FC003FC00003FC003FFFFFFFFC003FFFFFFFFC003FFFFFFFFC003FC00003FC003FC00003FC003
+FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC0000
+3FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003
+FC00003FC003FC00003FC0FFFFF00FFFFFFFFFF00FFFFFFFFFF00FFFFF30297EA835>I<FFFFFC
+FFFFFCFFFFFC01FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE00
+01FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE00
+01FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE00FFFFFCFFFFFC
+FFFFFC16297FA819>I<FFFE0000003FFF80FFFE0000003FFF80FFFF0000007FFF8003FF000000
+7FE00003FF0000007FE00003BF800000EFE00003BF800000EFE000039FC00001CFE000039FC000
+01CFE000038FE000038FE000038FE000038FE000038FE000038FE0000387F000070FE0000387F0
+00070FE0000383F8000E0FE0000383F8000E0FE0000381FC001C0FE0000381FC001C0FE0000381
+FC001C0FE0000380FE00380FE0000380FE00380FE00003807F00700FE00003807F00700FE00003
+803F80E00FE00003803F80E00FE00003803F80E00FE00003801FC1C00FE00003801FC1C00FE000
+03800FE3800FE00003800FE3800FE000038007F7000FE000038007F7000FE000038007F7000FE0
+00038003FE000FE000038003FE000FE000038001FC000FE000038001FC000FE000038000F8000F
+E000FFFE00F803FFFF80FFFE00F803FFFF80FFFE007003FFFF8039297DA840>77
+D<FFFC00007FFFFFFE00007FFFFFFF00007FFF03FF800001C003FFC00001C003BFE00001C0039F
+E00001C0039FF00001C0038FF80001C00387FC0001C00383FE0001C00381FF0001C00380FF8001
+C003807F8001C003807FC001C003803FE001C003801FF001C003800FF801C0038007FC01C00380
+03FC01C0038003FE01C0038001FF01C0038000FF81C00380007FC1C00380003FE1C00380001FF1
+C00380000FF1C00380000FF9C003800007FDC003800003FFC003800001FFC003800000FFC00380
+00007FC0038000007FC0038000003FC0038000001FC0038000000FC00380000007C0FFFE000003
+C0FFFE000001C0FFFE000001C030297EA835>I<FFFFFFF800FFFFFFFF00FFFFFFFFC003FC003F
+E003FC0007F003FC0003F803FC0003FC03FC0001FC03FC0001FE03FC0001FE03FC0001FE03FC00
+01FE03FC0001FE03FC0001FE03FC0001FE03FC0001FC03FC0003FC03FC0003F803FC0007F003FC
+003FE003FFFFFF8003FFFFFE0003FC00000003FC00000003FC00000003FC00000003FC00000003
+FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC000000
+03FC00000003FC00000003FC000000FFFFF00000FFFFF00000FFFFF0000027297EA82E>80
+D<FFFFFFE00000FFFFFFFE0000FFFFFFFF800003FC003FE00003FC000FF00003FC0007F80003FC
+0003FC0003FC0001FC0003FC0001FE0003FC0001FE0003FC0001FE0003FC0001FE0003FC0001FE
+0003FC0001FE0003FC0001FC0003FC0003F80003FC0007F80003FC000FE00003FC003FC00003FF
+FFFE000003FFFFFE000003FC00FF800003FC003FC00003FC001FE00003FC000FF00003FC0007F8
+0003FC0007F80003FC0007F80003FC0007F80003FC0007F80003FC0007F80003FC0007F80003FC
+0007F80003FC0007F80003FC0007F80E03FC0007F80E03FC0003F80E03FC0001FC1CFFFFF000FE
+1CFFFFF0007FF8FFFFF0000FE02F297EA832>82 D<00FF00C003FFE1C00FFFF9C01F80FFC03F00
+3FC03E000FC07C0007C07C0007C0FC0003C0FC0003C0FC0001C0FE0001C0FE0001C0FF000000FF
+C000007FFC00007FFFE0003FFFF8001FFFFE001FFFFF0007FFFF8003FFFFC000FFFFC0000FFFE0
+00007FE000001FF000000FF0000007F0E00003F0E00003F0E00003F0E00003F0F00003E0F00003
+E0F80007E0FC0007C0FF000F80FFE01F80E3FFFF00E1FFFC00C01FF0001C297CA825>I<FFFFF0
+00FFFEFFFFF000FFFEFFFFF000FFFE03FC0000038003FC0000038003FC0000038003FC00000380
+03FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC00
+00038003FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC00000380
+03FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC00
+00038003FC0000038003FC0000038003FC0000038003FC0000038001FC0000070001FE00000700
+00FE00000E00007F00000E00003F00003C00001FC0007800000FF003F0000007FFFFE0000000FF
+FF800000001FFC00002F297EA834>85 D<FFFFF0007FFFFFFFF0007FFFFFFFF0007FFF03FE0000
+01C001FE0000038001FE0000038000FF0000070000FF0000070000FF80000F00007F80000E0000
+7FC0000E00003FC0001C00003FE0001C00001FE0003800001FE0003800001FF0007800000FF000
+7000000FF800F0000007F800E0000007FC00E0000003FC01C0000003FC01C0000003FE03C00000
+01FE0380000001FF0780000000FF0700000000FF87000000007F8E000000007F8E000000007FDE
+000000003FDC000000003FFC000000001FF8000000001FF8000000000FF0000000000FF0000000
+000FF00000000007E00000000007E00000000003C00000000003C0000030297FA833>I<FFFFE0
+FFFFE01FFFC0FFFFE0FFFFE01FFFC0FFFFE0FFFFE01FFFC003FC0003FC0000700003FC0003FC00
+00700003FE0003FE0000F00001FE0001FE0000E00001FE0001FE0000E00001FF0001FF0001E000
+00FF0001FF0001C00000FF0001FF0001C000007F8003FF80038000007F8003FF80038000007FC0
+07FFC0078000003FC0073FC0070000003FC0073FC0070000003FE00F3FE00F0000001FE00E1FE0
+0E0000001FE00E1FE00E0000000FF01C0FF01C0000000FF01C0FF01C0000000FF01C0FF81C0000
+0007F83807F83800000007F83807F83800000007FC7807FC7800000003FC7003FC7000000003FC
+7003FC7000000003FEF003FEF000000001FEE001FEE000000001FEE001FEE000000000FFC000FF
+C000000000FFC000FFC000000000FFC000FFC0000000007F80007F80000000007F80007F800000
+00007F80007F80000000003F00003F00000000003F00003F00000000003F00003F00000000001E
+00001E00000000001E00001E00000042297FA845>I<03FF80000FFFF0001F01FC003F80FE003F
+807F003F803F003F803F801F003F8000003F8000003F8000003F8000003F80003FFF8001FC3F80
+0FE03F801F803F803F003F807E003F80FC003F80FC003F80FC003F80FC003F80FC005F807E00DF
+803F839FFC1FFE0FFC03F803FC1E1B7E9A21>97 D<FFE00000FFE00000FFE000000FE000000FE0
+00000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000F
+E000000FE1FE000FE7FF800FFE07E00FF803F00FF001F80FE000FC0FE000FC0FE0007E0FE0007E
+0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007E0FE000
+7E0FE0007E0FE000FC0FE000FC0FF001F80FF803F00F9C0FE00F0FFF800E01FC00202A7EA925>
+I<003FF00001FFFC0003F03E000FC07F001F807F003F007F003F007F007F003E007E0000007E00
+0000FE000000FE000000FE000000FE000000FE000000FE000000FE0000007E0000007E0000007F
+0000003F0003803F8003801F8007000FE00E0003F83C0001FFF800003FC000191B7E9A1E>I<00
+007FF000007FF000007FF0000007F0000007F0000007F0000007F0000007F0000007F0000007F0
+000007F0000007F0000007F0000007F0000007F0003F87F001FFF7F007F03FF00FC00FF01F8007
+F03F0007F03F0007F07E0007F07E0007F07E0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE00
+07F0FE0007F0FE0007F0FE0007F07E0007F07E0007F03F0007F03F0007F01F800FF00FC01FF007
+E07FFF01FFE7FF007F87FF202A7EA925>I<003FC00001FFF00003E07C000F803E001F801F001F
+001F003F000F807E000F807E000FC07E000FC0FE0007C0FE0007C0FFFFFFC0FFFFFFC0FE000000
+FE000000FE0000007E0000007E0000007F0000003F0001C01F0001C00F80038007C0070003F01E
+0000FFFC00003FE0001A1B7E9A1F>I<0007F8003FFC007E3E01FC7F03F87F03F07F07F07F07F0
+3E07F00007F00007F00007F00007F00007F00007F000FFFFC0FFFFC0FFFFC007F00007F00007F0
+0007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F0
+0007F00007F00007F00007F00007F0007FFF807FFF807FFF80182A7EA915>I<007F80F001FFE3
+F807C0FE1C0F807C7C1F003E7C1F003E103F003F003F003F003F003F003F003F003F003F003F00
+3F001F003E001F003E000F807C0007C0F80005FFE0000C7F8000180000001C0000001C0000001E
+0000001FFFF8001FFFFF000FFFFFC007FFFFE003FFFFF00FFFFFF03E0007F07C0001F8F80000F8
+F80000F8F80000F8F80000F87C0001F07C0001F03F0007E00FC01F8007FFFF00007FF0001E287E
+9A22>I<FFE00000FFE00000FFE000000FE000000FE000000FE000000FE000000FE000000FE000
+000FE000000FE000000FE000000FE000000FE000000FE000000FE07E000FE1FF800FE30FC00FE4
+0FE00FE807E00FF807F00FF007F00FF007F00FE007F00FE007F00FE007F00FE007F00FE007F00F
+E007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F0
+0FE007F0FFFE3FFFFFFE3FFFFFFE3FFF202A7DA925>I<07000F801FC03FE03FE03FE01FC00F80
+07000000000000000000000000000000FFE0FFE0FFE00FE00FE00FE00FE00FE00FE00FE00FE00F
+E00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0FFFEFFFEFFFE0F2B7EAA12>I<FF
+E0FFE0FFE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0
+0FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0FF
+FEFFFEFFFE0F2A7EA912>108 D<FFC07F001FC000FFC1FFC07FF000FFC307E0C1F8000FC407F1
+01FC000FC803F200FC000FD803FE00FE000FD003FC00FE000FD003FC00FE000FE003F800FE000F
+E003F800FE000FE003F800FE000FE003F800FE000FE003F800FE000FE003F800FE000FE003F800
+FE000FE003F800FE000FE003F800FE000FE003F800FE000FE003F800FE000FE003F800FE000FE0
+03F800FE000FE003F800FE000FE003F800FE000FE003F800FE00FFFE3FFF8FFFE0FFFE3FFF8FFF
+E0FFFE3FFF8FFFE0331B7D9A38>I<FFC07E00FFC1FF80FFC30FC00FC40FE00FC807E00FD807F0
+0FD007F00FD007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007
+F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F0FFFE3FFFFFFE
+3FFFFFFE3FFF201B7D9A25>I<003FE00001FFFC0003F07E000FC01F801F800FC03F0007E03F00
+07E07E0003F07E0003F07E0003F0FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE
+0003F8FE0003F87E0003F07E0003F03F0007E03F0007E01F800FC00FC01F8007F07F0001FFFC00
+003FE0001D1B7E9A22>I<FFE1FE00FFE7FF80FFFE0FE00FF803F00FF001F80FE001FC0FE000FC
+0FE000FE0FE000FE0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE000
+7F0FE0007E0FE000FE0FE000FE0FE000FC0FE001FC0FF001F80FF803F00FFC0FE00FEFFF800FE1
+FC000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE00000FF
+FE0000FFFE0000FFFE000020277E9A25>I<FFC3E0FFC7F8FFCC7C0FD8FE0FD0FE0FD0FE0FF0FE
+0FE07C0FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE000
+0FE0000FE0000FE0000FE000FFFF00FFFF00FFFF00171B7E9A1B>114 D<03FE300FFFF03E03F0
+7800F07000F0F00070F00070F80070FE0000FFE0007FFF007FFFC03FFFE01FFFF007FFF800FFF8
+0007FC0000FCE0007CE0003CF0003CF00038F80038FC0070FF01E0E7FFC0C1FF00161B7E9A1B>
+I<00700000700000700000700000F00000F00000F00001F00003F00003F00007F0001FFFE0FFFF
+E0FFFFE007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F0
+0007F00007F07007F07007F07007F07007F07007F07007F07003F0E001F8C000FFC0003F001426
+7FA51A>I<FFE07FF0FFE07FF0FFE07FF00FE007F00FE007F00FE007F00FE007F00FE007F00FE0
+07F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00F
+E007F00FE007F00FE007F00FE00FF00FE00FF007E017F003F067FF01FFC7FF007F87FF201B7D9A
+25>I<FFFE07FFFFFE07FFFFFE07FF07F000E007F000E007F801E003F801C003F801C001FC0380
+01FC038001FE078000FE070000FF0F00007F0E00007F0E00003F9C00003F9C00003FFC00001FF8
+00001FF800000FF000000FF000000FF0000007E0000007E0000003C0000003C000201B7F9A23>
+I<FFFC7FFC1FFCFFFC7FFC1FFCFFFC7FFC1FFC0FE00FE001C007F007E0038007F007E0038007F8
+07F0078003F807F0070003F807F8070001FC0FF80E0001FC0FF80E0001FE1FFC1E0000FE1CFC1C
+0000FE1CFE1C0000FF387E3C00007F387E3800007F787F3800003FF03F7000003FF03F7000003F
+E01FF000001FE01FE000001FE01FE000000FC00FC000000FC00FC000000FC00FC0000007800780
+000007800780002E1B7F9A31>I<FFFC1FFEFFFC1FFEFFFC1FFE07F0078003F8070001FC0F0001
+FE1E0000FE3C00007F7800003FF800003FF000001FE000000FE0000007F0000007F800000FF800
+001FFC00003DFE000038FF0000787F0000F03F8001E03FC003C01FE003800FE0FFF03FFFFFF03F
+FFFFF03FFF201B7F9A23>I<FFFE07FFFFFE07FFFFFE07FF07F000E007F000E007F801E003F801
+C003F801C001FC038001FC038001FE078000FE070000FF0F00007F0E00007F0E00003F9C00003F
+9C00003FFC00001FF800001FF800000FF000000FF0000007F0000007E0000007E0000003C00000
+03C000000380000003800000078000380700007C070000FE0E0000FE0E0000FE1C0000FE380000
+7C7000003FE000000F80000020277F9A23>I E /Fn 75 127 df<70F8F8F8F8F8F8F8F8F8F8F8
+F8F8F8F8F870000000000070F8F8F870051C779B18>33 D<4010E038F078E038E038E038E038E0
+38E038E038E038E038E03860300D0E7B9C18>I<030600078F00078F00078F00078F00078F0007
+8F007FFFC0FFFFE0FFFFE07FFFC00F1E000F1E000F1E000F1E000F1E000F1E007FFFC0FFFFE0FF
+FFE07FFFC01E3C001E3C001E3C001E3C001E3C001E3C000C1800131C7E9B18>I<00C00001C000
+01C00001C00003F0000FFC003FFE007DCF0071C700E1C380E1C780E1C780E1C780F1C00079C000
+3DC0001FE0000FF80003FC0001DE0001CF0001C70061C380F1C380F1C380E1C380E1C70071C700
+79DE003FFE001FF80007E00001C00001C00001C00000C00011247D9F18>I<3803007C07807C07
+80EE0F80EE0F00EE0F00EE1F00EE1E00EE1E00EE3E007C3C007C3C00387C0000780000780000F8
+0000F00001F00001E00001E00003E00003C00003C00007C0000783800787C00F87C00F0EE00F0E
+E01F0EE01E0EE01E0EE03E0EE03C07C03C07C018038013247E9F18>I<01C00007E0000FF0000E
+70001C38001C38001C38001C38001C73F01C73F01CE3F00FE3800FC7000F87000F07001F0E003F
+0E007B8E0073DC00E1DC00E0F800E0F800E07070E0787070FC707FFFE03FCFE00F03C0141C7F9B
+18>I<387C7C7E3E0E0E0E1C1C38F8F0C0070E789B18>I<007000F001E003C007800F001E001C00
+380038007000700070007000E000E000E000E000E000E000E000E0007000700070007000380038
+001C001E000F00078003C001F000F000700C24799F18>I<6000F00078003C001E000F00078003
+8001C001C000E000E000E000E00070007000700070007000700070007000E000E000E000E001C0
+01C0038007800F001E003C007800F00060000C247C9F18>I<01C00001C00001C00001C000C1C1
+80F1C780F9CF807FFF001FFC0007F00007F0001FFC007FFF00F9CF80F1C780C1C18001C00001C0
+0001C00001C00011147D9718>I<00600000F00000F00000F00000F00000F00000F00000F0007F
+FFC0FFFFE0FFFFE07FFFC000F00000F00000F00000F00000F00000F00000F00000600013147E97
+18>I<1C3E7E7F3F1F070E1E7CF860080C788518>I<7FFF00FFFF80FFFF807FFF0011047D8F18>
+I<3078FCFC78300606778518>I<000300000780000780000F80000F00001F00001E00001E0000
+3E00003C00007C0000780000780000F80000F00001F00001E00003E00003C00003C00007C00007
+80000F80000F00000F00001F00001E00003E00003C00003C00007C0000780000F80000F00000F0
+000060000011247D9F18>I<01F00007FC000FFE001F1F001C07003803807803C07001C07001C0
+E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0F001E07001C07001C07803C0
+3803801C07001F1F000FFE0007FC0001F000131C7E9B18>I<01800380038007800F803F80FF80
+FB80438003800380038003800380038003800380038003800380038003800380038003807FFCFF
+FE7FFC0F1C7B9B18>I<03F0000FFE003FFF007C0F807003C0E001C0F000E0F000E06000E00000
+E00000E00001C00001C00003C0000780000F00001E00003C0000780000F00001E00007C0000F80
+001E00E03C00E07FFFE0FFFFE07FFFE0131C7E9B18>I<001F00003F0000770000770000E70001
+E70001C7000387000787000707000E07001E07003C0700380700780700F00700FFFFF8FFFFF8FF
+FFF8000700000700000700000700000700000700007FF000FFF8007FF0151C7F9B18>52
+D<007E0001FF0007FF800F83C01E03C01C03C0380180380000700000700000E1F800E7FE00FFFF
+00FE0780F803C0F001C0F000E0E000E0F000E07000E07000E07000E03801C03C03C01E07800FFF
+0007FE0001F800131C7E9B18>54 D<3078FCFC783000000000000000003078FCFC783006147793
+18>58 D<183C7E7E3C180000000000000000183C7E7E3E1E0E1C3C78F060071A789318>I<0003
+00000780001F80003F00007E0001FC0003F00007E0001FC0003F00007E0000FC0000FC00007E00
+003F00001FC00007E00003F00001FC00007E00003F00001F8000078000030011187D9918>I<7F
+FFC0FFFFE0FFFFE0FFFFE0000000000000000000000000FFFFE0FFFFE0FFFFE07FFFC0130C7E93
+18>I<600000F00000FC00007E00003F00001FC00007E00003F00001FC00007E00003F00001F80
+001F80003F00007E0001FC0003F00007E0001FC0003F00007E0000FC0000F0000060000011187D
+9918>I<0FF0003FFC007FFF00700F00F00380F00380600780000F00003E00007C0001F00001E0
+0003C00003C00003C00003C00003C00003800000000000000000000000000000000003800007C0
+0007C00007C000038000111C7D9B18>I<00700000F80000F80000D80000D80001DC0001DC0001
+DC00018C00038E00038E00038E00038E000306000707000707000707000707000FFF800FFF800F
+FF800E03800E03801C01C01C01C07F07F0FF8FF87F07F0151C7F9B18>65
+D<7FF800FFFE007FFF001C0F801C03C01C03C01C01E01C00E01C00E01C00F01C00701C00701C00
+701C00701C00701C00701C00701C00701C00F01C00E01C00E01C01E01C01C01C03C01C0F807FFF
+00FFFE007FF800141C7F9B18>68 D<FFFFF0FFFFF0FFFFF01C00701C00701C00701C00701C0000
+1C00001C0E001C0E001C0E001FFE001FFE001FFE001C0E001C0E001C0E001C00001C00001C0038
+1C00381C00381C00381C0038FFFFF8FFFFF8FFFFF8151C7F9B18>I<FFFFE0FFFFE0FFFFE01C00
+E01C00E01C00E01C00E01C00001C00001C1C001C1C001C1C001FFC001FFC001FFC001C1C001C1C
+001C1C001C00001C00001C00001C00001C00001C00001C0000FFC000FFC000FFC000131C7E9B18
+>I<7F07F0FF8FF87F07F01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01F
+FFC01FFFC01FFFC01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C07F
+07F0FF8FF87F07F0151C7F9B18>72 D<7FFF00FFFF807FFF0001C00001C00001C00001C00001C0
+0001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0
+0001C00001C00001C00001C0007FFF00FFFF807FFF00111C7D9B18>I<7FE000FFE0007FE0000E
+00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E
+00000E00000E00000E00000E00700E00700E00700E00700E00707FFFF0FFFFF07FFFF0141C7F9B
+18>76 D<7E07F0FF0FF87F07F01D81C01D81C01D81C01DC1C01CC1C01CC1C01CE1C01CE1C01CE1
+C01C61C01C71C01C71C01C31C01C39C01C39C01C39C01C19C01C19C01C1DC01C0DC01C0DC01C0D
+C07F07C0FF87C07F03C0151C7F9B18>78 D<0FF8003FFE007FFF00780F00700700F00780E00380
+E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380
+E00380E00380F00780700700780F007FFF003FFE000FF800111C7D9B18>I<FFFE00FFFF80FFFF
+C01C03C01C01E01C00E01C00701C00701C00701C00701C00701C00E01C01E01C03C01FFFC01FFF
+801FFE001C00001C00001C00001C00001C00001C00001C00001C0000FF8000FF8000FF8000141C
+7F9B18>I<7FF800FFFE007FFF001C0F801C03801C03C01C01C01C01C01C01C01C03C01C03801C
+0F801FFF001FFE001FFE001C0F001C07001C03801C03801C03801C03801C03801C039C1C039C1C
+039C7F01F8FF81F87F00F0161C7F9B18>82 D<03F3801FFF803FFF807C0F80700780E00380E003
+80E00380E000007000007800003F00001FF00007FE0000FF00000F800003C00001C00000E00000
+E06000E0E000E0E001E0F001C0F80780FFFF80FFFE00E7F800131C7E9B18>I<7FFFF8FFFFF8FF
+FFF8E07038E07038E07038E0703800700000700000700000700000700000700000700000700000
+700000700000700000700000700000700000700000700000700000700007FF0007FF0007FF0015
+1C7F9B18>I<FF83FEFF83FEFF83FE1C00701C00701C00701C00701C00701C00701C00701C0070
+1C00701C00701C00701C00701C00701C00701C00701C00701C00701C00701C00700E00E00F01E0
+0783C003FF8001FF00007C00171C809B18>I<FF07F8FF07F8FF07F81C01C01E03C00E03800F07
+80070700070700038E00038E0001DC0001DC0001DC0000F80000F8000070000070000070000070
+0000700000700000700000700000700001FC0003FE0001FC00151C7F9B18>89
+D<FFF8FFF8FFF8E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000
+E000E000E000E000E000E000E000E000E000E000E000E000E000E000FFF8FFF8FFF80D24779F18
+>91 D<600000F00000F00000F800007800007C00003C00003C00003E00001E00001F00000F0000
+0F00000F800007800007C00003C00003C00003E00001E00001F00000F00000F800007800007800
+007C00003C00003E00001E00001E00001F00000F00000F8000078000078000030011247D9F18>
+I<FFF8FFF8FFF80038003800380038003800380038003800380038003800380038003800380038
+00380038003800380038003800380038003800380038003800380038FFF8FFF8FFF80D247F9F18
+>I<018007C01FF07EFCF83EE00E0F067C9B18>I<7FFF00FFFF80FFFF807FFF0011047D7F18>I<
+061E3E387070E0E0E0F8FC7C7C38070E789E18>I<1FE0003FF8007FFC00781E00300E00000700
+00070000FF0007FF001FFF007F0700780700E00700E00700E00700F00F00781F003FFFF01FFBF0
+07E1F014147D9318>I<7E0000FE00007E00000E00000E00000E00000E00000E00000E3E000EFF
+800FFFC00FC1E00F80E00F00700E00700E00380E00380E00380E00380E00380E00380F00700F00
+700F80E00FC1E00FFFC00EFF80063E00151C809B18>I<01FE0007FF001FFF803E078038030070
+0000700000E00000E00000E00000E00000E00000E000007000007001C03801C03E03C01FFF8007
+FF0001FC0012147D9318>I<001F80003F80001F8000038000038000038000038000038003E380
+0FFB801FFF803C1F80380F80700780700380E00380E00380E00380E00380E00380E00380700780
+700780380F803C1F801FFFF00FFBF803E3F0151C7E9B18>I<01F00007FC001FFE003E0F003807
+80700380700380E001C0E001C0FFFFC0FFFFC0FFFFC0E000007000007001C03801C03E03C01FFF
+8007FF0001FC0012147D9318>I<001F80007FC000FFE000E1E001C0C001C00001C00001C0007F
+FFC0FFFFC0FFFFC001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001
+C00001C00001C00001C0007FFF007FFF007FFF00131C7F9B18>I<01E1F007FFF80FFFF81E1E30
+1C0E003807003807003807003807003807001C0E001E1E001FFC001FF80039E0003800001C0000
+1FFE001FFFC03FFFE07801F0700070E00038E00038E00038E000387800F07E03F01FFFC00FFF80
+01FC00151F7F9318>I<7E0000FE00007E00000E00000E00000E00000E00000E00000E3E000EFF
+800FFFC00FC1C00F80E00F00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00
+E00E00E00E00E07FC3FCFFE7FE7FC3FC171C809B18>I<03800007C00007C00007C00003800000
+00000000000000000000007FC000FFC0007FC00001C00001C00001C00001C00001C00001C00001
+C00001C00001C00001C00001C00001C00001C00001C000FFFF00FFFF80FFFF00111D7C9C18>I<
+7FE000FFE0007FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000
+00E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0007FFFC0
+FFFFE07FFFC0131C7E9B18>108 D<7CE0E000FFFBF8007FFFF8001F1F1C001E1E1C001E1E1C00
+1C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C
+001C1C1C007F1F1F00FFBFBF807F1F1F001914819318>I<7E3E00FEFF807FFFC00FC1C00F80E0
+0F00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E07FC3FC
+FFE7FE7FC3FC1714809318>I<01F0000FFE001FFF003E0F803803807001C07001C0E000E0E000
+E0E000E0E000E0E000E0F001E07001C07803C03C07803E0F801FFF000FFE0001F00013147E9318
+>I<7E3E00FEFF807FFFC00FC1E00F80E00F00700E00700E00380E00380E00380E00380E00380E
+00380F00700F00700F80E00FC1E00FFFC00EFF800E3E000E00000E00000E00000E00000E00000E
+00000E00007FC000FFE0007FC000151E809318>I<01E38007FB801FFF803E1F80380F80700780
+700780E00380E00380E00380E00380E00380E00380700780700780380F803C1F801FFF800FFB80
+03E380000380000380000380000380000380000380000380003FF8003FF8003FF8151E7E9318>
+I<7F87E0FF9FF07FBFF803F87803F03003E00003C00003C0000380000380000380000380000380
+000380000380000380000380007FFE00FFFF007FFE0015147F9318>I<07F7003FFF007FFF0078
+0F00E00700E00700E007007C00007FE0001FFC0003FE00001F00600780E00380E00380F00380F8
+0F00FFFF00FFFC00E7F00011147D9318>I<0180000380000380000380000380007FFFC0FFFFC0
+FFFFC00380000380000380000380000380000380000380000380000380000380400380E00380E0
+0380E001C1C001FFC000FF80003E0013197F9818>I<7E07E0FE0FE07E07E00E00E00E00E00E00
+E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E01E00F03E007FFFC03FF
+FE01FCFC1714809318>I<7F8FF0FF8FF87F8FF01E03C00E03800E03800E038007070007070007
+0700038E00038E00038E00038E0001DC0001DC0001DC0000F80000F80000700015147F9318>I<
+FF8FF8FF8FF8FF8FF83800E03800E03800E01C01C01C01C01C71C01CF9C01CF9C01CD9C01CD9C0
+0DDD800DDD800DDD800D8D800F8F800F8F8007070015147F9318>I<7F8FF07F9FF07F8FF00707
+00078E00039E0001DC0001F80000F80000700000F00000F80001DC00039E00038E000707000F07
+807F8FF0FF8FF87F8FF015147F9318>I<7F8FF0FF8FF87F8FF00E01C00E03800E038007038007
+0700070700038700038600038E0001CE0001CE0000CC0000CC0000DC0000780000780000780000
+700000700000700000F00000E00079E0007BC0007F80003F00001E0000151E7F9318>I<3FFFF0
+7FFFF07FFFF07001E07003C0700780000F00001E00003C0000F80001F00003C0000780000F0070
+1E00703C0070780070FFFFF0FFFFF0FFFFF014147F9318>I<0007E0001FE0007FE000780000E0
+0000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00001E0007FC000FF80
+00FF80007FC00001E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0
+0000E000007800007FE0001FE00007E013247E9F18>I<60F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0
+F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0600424769F18>I<7C0000FF0000FFC00003C000
+00E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000F000007FC0
+003FE0003FE0007FC000F00000E00000E00000E00000E00000E00000E00000E00000E00000E000
+00E00000E00003C000FFC000FF00007C000013247E9F18>I<060C1F1E3FBEFBF8F1F060C00F06
+7C9B18>I E /Fo 75 123 df<001F83E000F06E3001C078780380F8780300F030070070000700
+70000700700007007000070070000700700007007000FFFFFF8007007000070070000700700007
+007000070070000700700007007000070070000700700007007000070070000700700007007000
+07007000070070000700700007007000070070007FE3FF001D20809F1B>11
+D<003F0000E0C001C0C00381E00701E00701E0070000070000070000070000070000070000FFFF
+E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700
+E00700E00700E00700E00700E00700E07FC3FE1720809F19>I<003FE000E0E001C1E00381E007
+00E00700E00700E00700E00700E00700E00700E00700E0FFFFE00700E00700E00700E00700E007
+00E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E007
+00E07FE7FE1720809F19>I<001F81F80000F04F040001C07C06000380F80F000300F00F000700
+F00F00070070000007007000000700700000070070000007007000000700700000FFFFFFFF0007
+007007000700700700070070070007007007000700700700070070070007007007000700700700
+070070070007007007000700700700070070070007007007000700700700070070070007007007
+00070070070007007007007FE3FE3FF02420809F26>I<7038F87CFC7EFC7E743A040204020402
+0804080410081008201040200F0E7E9F17>34 D<70F8FCFC74040404080810102040060E7C9F0D
+>39 D<0020004000800100020006000C000C00180018003000300030007000600060006000E000
+E000E000E000E000E000E000E000E000E000E000E0006000600060007000300030003000180018
+000C000C000600020001000080004000200B2E7DA112>I<800040002000100008000C00060006
+000300030001800180018001C000C000C000C000E000E000E000E000E000E000E000E000E000E0
+00E000E000C000C000C001C001800180018003000300060006000C00080010002000400080000B
+2E7DA112>I<70F8FCFC74040404080810102040060E7C840D>44 D<FFC0FFC00A027F8A0F>I<70
+F8F8F87005057C840D>I<03F0000E1C001C0E00180600380700700380700380700380700380F0
+03C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C070
+03807003807003807807803807001806001C0E000E1C0003F000121F7E9D17>48
+D<018003800F80F380038003800380038003800380038003800380038003800380038003800380
+03800380038003800380038003800380038007C0FFFE0F1E7C9D17>I<03F0000C1C00100E0020
+0700400780800780F007C0F803C0F803C0F803C02007C00007C0000780000780000F00000E0000
+1C0000380000700000600000C0000180000300000600400C00401800401000803FFF807FFF80FF
+FF80121E7E9D17>I<03F0000C1C00100E00200F00780F80780780780780380F80000F80000F00
+000F00000E00001C0000380003F000003C00000E00000F000007800007800007C02007C0F807C0
+F807C0F807C0F00780400780400F00200E001C3C0003F000121F7E9D17>I<000600000600000E
+00000E00001E00002E00002E00004E00008E00008E00010E00020E00020E00040E00080E00080E
+00100E00200E00200E00400E00C00E00FFFFF0000E00000E00000E00000E00000E00000E00000E
+0000FFE0141E7F9D17>I<1803001FFE001FFC001FF8001FE00010000010000010000010000010
+000010000011F000161C00180E001007001007800003800003800003C00003C00003C07003C0F0
+03C0F003C0E00380400380400700200600100E000C380003E000121F7E9D17>I<007C00018200
+0701000E03800C07801C0780380300380000780000700000700000F1F000F21C00F40600F80700
+F80380F80380F003C0F003C0F003C0F003C0F003C07003C07003C0700380380380380700180700
+0C0E00061C0001F000121F7E9D17>I<4000007FFFC07FFF807FFF804001008002008002008004
+0000080000080000100000200000200000400000400000C00000C00001C0000180000380000380
+00038000038000078000078000078000078000078000078000078000030000121F7D9D17>I<03
+F0000C0C001006003003002001806001806001806001807001807803003E03003F06001FC8000F
+F00003F80007FC000C7E00103F00300F806003804001C0C001C0C000C0C000C0C000C0C0008060
+01802001001002000C0C0003F000121F7E9D17>I<03F0000E18001C0C00380600380700700700
+700380F00380F00380F003C0F003C0F003C0F003C0F003C07007C07007C03807C0180BC00E13C0
+03E3C0000380000380000380000700300700780600780E00700C002018001070000FC000121F7E
+9D17>I<70F8F8F8700000000000000000000070F8F8F87005147C930D>I<70F8F8F87000000000
+00000000000070F0F8F878080808101010202040051D7C930D>I<000100000003800000038000
+000380000007C0000007C0000007C0000009E0000009E0000009E0000010F0000010F0000010F0
+0000207800002078000020780000403C0000403C0000403C0000801E0000801E0000FFFE000100
+0F0001000F0001000F00020007800200078002000780040003C00E0003C01F0007E0FFC03FFE1F
+207F9F22>65 D<FFFFE0000F80380007801E0007801F0007800F0007800F8007800F8007800F80
+07800F8007800F8007800F0007801F0007801E0007803C0007FFF00007803C0007801E0007800F
+0007800F8007800780078007C0078007C0078007C0078007C0078007C00780078007800F800780
+0F0007801F000F803C00FFFFF0001A1F7E9E20>I<000FC040007030C001C009C0038005C00700
+03C00E0001C01E0000C01C0000C03C0000C07C0000407C00004078000040F8000000F8000000F8
+000000F8000000F8000000F8000000F8000000F8000000F8000000780000007C0000407C000040
+3C0000401C0000401E0000800E000080070001000380020001C0040000703800000FC0001A217D
+9F21>I<FFFFE0000F803C0007801E000780070007800380078003C0078001E0078001E0078001
+F0078000F0078000F0078000F8078000F8078000F8078000F8078000F8078000F8078000F80780
+00F8078000F8078000F0078000F0078000F0078001E0078001E0078003C0078003800780070007
+800E000F803C00FFFFE0001D1F7E9E23>I<FFFFFF000F800F0007800300078003000780010007
+800180078000800780008007800080078080800780800007808000078080000781800007FF8000
+078180000780800007808000078080000780800007800020078000200780002007800040078000
+4007800040078000C0078000C0078001800F800F80FFFFFF801B1F7E9E1F>I<FFFFFF000F800F
+000780030007800300078001000780018007800080078000800780008007800080078080000780
+800007808000078080000781800007FF8000078180000780800007808000078080000780800007
+800000078000000780000007800000078000000780000007800000078000000FC00000FFFE0000
+191F7E9E1E>I<000FE0200078186000E004E0038002E0070001E00F0000E01E0000601E000060
+3C0000603C0000207C00002078000020F8000000F8000000F8000000F8000000F8000000F80000
+00F8000000F8007FFCF80003E0780001E07C0001E03C0001E03C0001E01E0001E01E0001E00F00
+01E0070001E0038002E000E0046000781820000FE0001E217D9F24>I<FFF8FFF80F800F800780
+0F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007
+800F0007800F0007FFFF0007800F0007800F0007800F0007800F0007800F0007800F0007800F00
+07800F0007800F0007800F0007800F0007800F0007800F0007800F000F800F80FFF8FFF81D1F7E
+9E22>I<FFFC0FC007800780078007800780078007800780078007800780078007800780078007
+80078007800780078007800780078007800780078007800FC0FFFC0E1F7F9E10>I<0FFFC0007C
+00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C
+00003C00003C00003C00003C00003C00003C00003C00003C00203C00F83C00F83C00F83C00F038
+0040780040700030E0000F800012207E9E17>I<FFFE000FC00007800007800007800007800007
+800007800007800007800007800007800007800007800007800007800007800007800007800007
+800007800207800207800207800207800607800407800407800C07801C0F807CFFFFFC171F7E9E
+1C>76 D<FF80001FF80F80001F800780001F0005C0002F0005C0002F0005C0002F0004E0004F00
+04E0004F000470008F000470008F000470008F000438010F000438010F000438010F00041C020F
+00041C020F00041C020F00040E040F00040E040F00040E040F000407080F000407080F00040708
+0F000403900F000403900F000401E00F000401E00F000401E00F000E00C00F001F00C01F80FFE0
+C1FFF8251F7E9E2A>I<FF803FF807C007C007C0038005E0010005E0010004F001000478010004
+780100043C0100043C0100041E0100040F0100040F010004078100040781000403C1000401E100
+0401E1000400F1000400F1000400790004003D0004003D0004001F0004001F0004000F00040007
+00040007000E0003001F000300FFE001001D1F7E9E22>I<001F800000F0F00001C0380007801E
+000F000F000E0007001E0007803C0003C03C0003C07C0003E0780001E0780001E0F80001F0F800
+01F0F80001F0F80001F0F80001F0F80001F0F80001F0F80001F0F80001F0780001E07C0003E07C
+0003E03C0003C03C0003C01E0007800E0007000F000F0007801E0001C0380000F0F000001F8000
+1C217D9F23>I<FFFFE0000F80780007801C0007801E0007800F0007800F8007800F8007800F80
+07800F8007800F8007800F8007800F0007801E0007801C000780780007FFE00007800000078000
+000780000007800000078000000780000007800000078000000780000007800000078000000780
+0000078000000FC00000FFFC0000191F7E9E1F>I<001F800000F0F00001C0380007801E000F00
+0F000E0007001E0007803C0003C03C0003C07C0003E07C0003E0780001E0F80001F0F80001F0F8
+0001F0F80001F0F80001F0F80001F0F80001F0F80001F0F80001F0780001E0780001E07C0003E0
+3C0003C03C0F03C01E1087800E2047000F204F0007A03E0001E0380000F0F010001FB010000030
+10000038300000387000003FF000001FE000001FE000000FC0000007801C297D9F23>I<FFFF80
+000F80F0000780780007803C0007801E0007801E0007801F0007801F0007801F0007801F000780
+1E0007801E0007803C00078078000780F00007FF80000781C0000780E0000780F0000780700007
+807800078078000780780007807C0007807C0007807C0007807C0407807E0407803E040FC01E08
+FFFC0F10000003E01E207E9E21>I<07E0800C1980100780300380600180600180E00180E00080
+E00080E00080F00000F000007800007F00003FF0001FFC000FFE0003FF00001F800007800003C0
+0003C00001C08001C08001C08001C08001C0C00180C00380E00300F00600CE0C0081F80012217D
+9F19>I<7FFFFFE0780F01E0600F0060400F0020400F0020C00F0030800F0010800F0010800F00
+10800F0010000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F
+0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F000000
+0F0000001F800007FFFE001C1F7E9E21>I<FFFC3FF80FC007C007800380078001000780010007
+800100078001000780010007800100078001000780010007800100078001000780010007800100
+078001000780010007800100078001000780010007800100078001000780010007800100038002
+000380020001C0020001C0040000E008000070180000382000000FC0001D207E9E22>I<FFF003
+FE1F8000F80F0000600F800060078000400780004003C0008003C0008003C0008001E0010001E0
+010001F0010000F0020000F0020000F806000078040000780400003C0800003C0800003C080000
+1E1000001E1000001F3000000F2000000F20000007C0000007C0000007C0000003800000038000
+00038000000100001F207F9E22>I<FFF07FF81FF01F800FC007C00F00078003800F0007800100
+0F0007C00100078007C00200078007C00200078007C0020003C009E0040003C009E0040003C009
+E0040003E010F00C0001E010F0080001E010F0080001F02078080000F02078100000F020781000
+00F0403C10000078403C20000078403C20000078C03E2000003C801E4000003C801E4000003C80
+1E4000001F000F8000001F000F8000001F000F8000001E00078000000E00070000000E00070000
+000C000300000004000200002C207F9E2F>I<FEFEC0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0
+C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0FEFE072D7CA10D>91
+D<080410082010201040204020804080408040B85CFC7EFC7E7C3E381C0F0E7B9F17>I<FEFE06
+060606060606060606060606060606060606060606060606060606060606060606060606060606
+06FEFE072D7FA10D>I<081020204040808080B8FCFC7C38060E7D9F0D>96
+D<1FE000303000781800781C00300E00000E00000E00000E0000FE00078E001E0E00380E00780E
+00F00E10F00E10F00E10F01E10781E103867200F83C014147E9317>I<0E0000FE00000E00000E
+00000E00000E00000E00000E00000E00000E00000E00000E00000E3E000EC3800F01C00F00E00E
+00E00E00700E00700E00780E00780E00780E00780E00780E00780E00700E00700E00E00F00E00D
+01C00CC300083E0015207F9F19>I<03F80E0C1C1E381E380C70007000F000F000F000F000F000
+F00070007000380138011C020E0C03F010147E9314>I<000380003F8000038000038000038000
+038000038000038000038000038000038000038003E380061B801C078038038038038070038070
+0380F00380F00380F00380F00380F00380F003807003807003803803803807801C07800E1B8003
+E3F815207E9F19>I<03F0000E1C001C0E00380700380700700700700380F00380F00380FFFF80
+F00000F00000F000007000007000003800801800800C010007060001F80011147F9314>I<007C
+00C6018F038F07060700070007000700070007000700FFF0070007000700070007000700070007
+0007000700070007000700070007000700070007007FF01020809F0E>I<0000E003E3300E3C30
+1C1C30380E00780F00780F00780F00780F00780F00380E001C1C001E380033E000200000200000
+3000003000003FFE001FFF800FFFC03001E0600070C00030C00030C00030C000306000603000C0
+1C038003FC00141F7F9417>I<0E0000FE00000E00000E00000E00000E00000E00000E00000E00
+000E00000E00000E00000E3E000E43000E81800F01C00F01C00E01C00E01C00E01C00E01C00E01
+C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0FFE7FC16207F9F19>I<1C
+003E003E003E001C000000000000000000000000000E007E000E000E000E000E000E000E000E00
+0E000E000E000E000E000E000E000E000E000E00FFC00A1F809E0C>I<00E001F001F001F000E0
+000000000000000000000000007007F000F0007000700070007000700070007000700070007000
+7000700070007000700070007000700070007000706070F060F0C061803F000C28829E0E>I<0E
+0000FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0FF00E
+03C00E03000E02000E04000E08000E10000E30000E70000EF8000F38000E1C000E1E000E0E000E
+07000E07800E03800E03C00E03E0FFCFF815207F9F18>I<0E00FE000E000E000E000E000E000E
+000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E00
+0E000E000E000E00FFE00B20809F0C>I<0E1F01F000FE618618000E81C81C000F00F00E000F00
+F00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E
+00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E00FFE7FE7FE0
+23147F9326>I<0E3E00FE43000E81800F01C00F01C00E01C00E01C00E01C00E01C00E01C00E01
+C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0FFE7FC16147F9319>I<01F80007
+0E001C03803801C03801C07000E07000E0F000F0F000F0F000F0F000F0F000F0F000F07000E070
+00E03801C03801C01C0380070E0001F80014147F9317>I<0E3E00FEC3800F01C00F00E00E00E0
+0E00F00E00700E00780E00780E00780E00780E00780E00780E00700E00F00E00E00F01E00F01C0
+0EC3000E3E000E00000E00000E00000E00000E00000E00000E00000E0000FFE000151D7F9319>
+I<03E0800619801C05803C0780380380780380700380F00380F00380F00380F00380F00380F003
+807003807803803803803807801C0B800E138003E3800003800003800003800003800003800003
+80000380000380003FF8151D7E9318>I<0E78FE8C0F1E0F1E0F0C0E000E000E000E000E000E00
+0E000E000E000E000E000E000E000E00FFE00F147F9312>I<1F9030704030C010C010C010E000
+78007F803FE00FF00070803880188018C018C018E030D0608F800D147E9312>I<020002000200
+060006000E000E003E00FFF80E000E000E000E000E000E000E000E000E000E000E000E080E080E
+080E080E080610031001E00D1C7F9B12>I<0E01C0FE1FC00E01C00E01C00E01C00E01C00E01C0
+0E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E03C00603C0030DC001F1FC
+16147F9319>I<FF83F81E01E01C00C00E00800E00800E00800701000701000382000382000382
+0001C40001C40001EC0000E80000E80000700000700000700000200015147F9318>I<FF9FE1FC
+3C0780701C0300601C0380200E0380400E0380400E03C0400707C0800704C0800704E080038861
+000388710003C8730001D0320001D03A0000F03C0000E01C0000E01C0000601800004008001E14
+7F9321>I<7FC3FC0F01E00701C007018003810001C20000E40000EC00007800003800003C0000
+7C00004E000087000107000303800201C00601E01E01E0FF07FE1714809318>I<FF83F81E01E0
+1C00C00E00800E00800E008007010007010003820003820003820001C40001C40001EC0000E800
+00E800007000007000007000002000002000004000004000004000F08000F08000F10000620000
+3C0000151D7F9318>I<3FFF380E200E201C40384078407000E001E001C00380078007010E011E
+011C0338027006700EFFFE10147F9314>I E /Fp 13 122 df<0000001FFC0000C000000003FF
+FFC001C00000001FFFFFF003C00000007FFFFFFC07C0000001FFFC00FE0FC0000007FFC0001F9F
+C000000FFE000007FFC000003FF8000003FFC000007FF0000000FFC00000FFE00000007FC00001
+FFC00000007FC00001FF800000003FC00003FF000000001FC00007FE000000001FC0000FFE0000
+00000FC0000FFC000000000FC0001FFC0000000007C0001FFC0000000007C0003FF80000000007
+C0003FF80000000003C0003FF80000000003C0007FF80000000003C0007FF80000000003C0007F
+F0000000000000007FF000000000000000FFF000000000000000FFF000000000000000FFF00000
+0000000000FFF000000000000000FFF000000000000000FFF000000000000000FFF00000000000
+0000FFF000000000000000FFF000000000000000FFF000000000000000FFF000001FFFFFFF807F
+F000001FFFFFFF807FF000001FFFFFFF807FF800001FFFFFFF807FF800000001FFC0003FF80000
+0001FFC0003FF800000001FFC0003FF800000001FFC0001FFC00000001FFC0001FFC00000001FF
+C0000FFE00000001FFC0000FFE00000001FFC00007FF00000001FFC00003FF00000001FFC00001
+FF80000001FFC00001FFC0000001FFC00000FFE0000001FFC000007FF0000003FFC000003FFC00
+0003FFC000000FFF000007FFC0000007FFC0001FBFC0000001FFFC00FF1FC00000007FFFFFFE0F
+C00000001FFFFFF803C000000003FFFFE000C0000000001FFE00000000413D7BBB4C>71
+D<FFFFFFF803FFFFFFE0FFFFFFF803FFFFFFE0FFFFFFF803FFFFFFE0FFFFFFF803FFFFFFE0007F
+F0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF00000
+01FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC0
+00007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007F
+F0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF00000
+01FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC0
+00007FFFFFFFFFFFC000007FFFFFFFFFFFC000007FFFFFFFFFFFC000007FFFFFFFFFFFC000007F
+F0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF00000
+01FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC0
+00007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007F
+F0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF00000
+01FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000007FF0000001FFC0
+00007FF0000001FFC000007FF0000001FFC000007FF0000001FFC000FFFFFFF803FFFFFFE0FFFF
+FFF803FFFFFFE0FFFFFFF803FFFFFFE0FFFFFFF803FFFFFFE0433B7CBA4C>I<FFFFFFFE000000
+FFFFFFFE000000FFFFFFFE000000FFFFFFFE000000007FF000000000007FF000000000007FF000
+000000007FF000000000007FF000000000007FF000000000007FF000000000007FF00000000000
+7FF000000000007FF000000000007FF000000000007FF000000000007FF000000000007FF00000
+0000007FF000000000007FF000000000007FF000000000007FF000000000007FF000000000007F
+F000000000007FF000000000007FF000000000007FF000000000007FF000000000007FF0000000
+00007FF000000000007FF000000000007FF000000000007FF000000000007FF000000000007FF0
+00000000007FF000000780007FF000000780007FF000000780007FF000000780007FF000000780
+007FF000000F80007FF000000F00007FF000000F00007FF000000F00007FF000001F00007FF000
+001F00007FF000001F00007FF000003F00007FF000003F00007FF000007F00007FF00000FF0000
+7FF00001FF00007FF00003FF00007FF0000FFE00007FF0007FFE00FFFFFFFFFFFE00FFFFFFFFFF
+FE00FFFFFFFFFFFE00FFFFFFFFFFFE00313B7CBA3A>76 D<FFFFF0000007FFFFE0FFFFF8000007
+FFFFE0FFFFFC000007FFFFE0FFFFFE000007FFFFE0007FFE00000007E000007FFF00000003C000
+007FFF80000003C000007BFFC0000003C000007BFFE0000003C0000079FFE0000003C0000078FF
+F0000003C00000787FF8000003C00000783FFC000003C00000783FFE000003C00000781FFE0000
+03C00000780FFF000003C000007807FF800003C000007803FFC00003C000007803FFE00003C000
+007801FFE00003C000007800FFF00003C0000078007FF80003C0000078003FFC0003C000007800
+3FFE0003C0000078001FFF0003C0000078000FFF0003C00000780007FF8003C00000780003FFC0
+03C00000780003FFE003C00000780001FFF003C00000780000FFF003C000007800007FF803C000
+007800003FFC03C000007800003FFE03C000007800001FFF03C000007800000FFF03C000007800
+0007FF83C0000078000003FFC3C0000078000003FFE3C0000078000001FFF3C0000078000000FF
+F3C00000780000007FFBC00000780000003FFFC00000780000003FFFC00000780000001FFFC000
+00780000000FFFC000007800000007FFC000007800000003FFC000007800000003FFC000007800
+000001FFC000007800000000FFC0000078000000007FC0000078000000003FC000007800000000
+3FC00000FC000000001FC000FFFFFC0000000FC000FFFFFC00000007C000FFFFFC00000003C000
+FFFFFC00000003C000433B7CBA4C>78 D<FFFFFFF8001FFFFF80FFFFFFF8001FFFFF80FFFFFFF8
+001FFFFF80FFFFFFF8001FFFFF80007FF00000001F8000007FF00000000F0000007FF00000000F
+0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F000000
+7FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF000
+00000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F
+0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F000000
+7FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF000
+00000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F
+0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F000000
+7FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF000
+00000F0000007FF00000000F0000007FF00000000F0000003FF00000001E0000003FF00000001E
+0000003FF80000001E0000001FF80000003C0000001FF80000003C0000000FFC00000078000000
+07FC000000F800000007FE000001F000000003FF000003F000000001FF800007E000000000FFE0
+001FC0000000003FFC01FF80000000001FFFFFFE000000000007FFFFF8000000000000FFFFE000
+00000000000FFE00000000413C7CBA4A>85 D<003FFE00000001FFFFE0000007FFFFF800000FE0
+07FC00000FF001FE00001FF800FF00001FF8007F80001FF8007FC0001FF8003FC0000FF0003FE0
+0007E0003FE00003C0003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000
+FFFFE000001FFFFFE000007FF83FE00003FF803FE00007FC003FE0000FF0003FE0001FE0003FE0
+003FE0003FE0007FC0003FE0007FC0003FE000FF80003FE000FF80003FE000FF80003FE000FF80
+003FE000FF80007FE0007FC0007FE0007FC000DFE0003FE0039FF0001FF80F0FFFE007FFFE0FFF
+E001FFF807FFE0003FE000FFE02B267DA52F>97 D<00FE00000000FFFE00000000FFFE00000000
+FFFE00000000FFFE0000000007FE0000000003FE0000000003FE0000000003FE0000000003FE00
+00000003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE00000000
+03FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE01
+FF000003FE1FFFF00003FE7FFFFC0003FEFC03FE0003FFF000FF0003FFC0003F8003FF00001FC0
+03FE00001FE003FE00000FF003FE00000FF803FE00000FF803FE000007FC03FE000007FC03FE00
+0007FC03FE000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007FE
+03FE000007FE03FE000007FE03FE000007FE03FE000007FC03FE000007FC03FE000007FC03FE00
+000FFC03FE00000FF803FE00000FF003FE00001FF003FF00001FE003FF80003FC003FFC0007F80
+03F9E000FF0003F0FC07FE0003F07FFFF80003E01FFFE00003C003FE00002F3C7DBB36>I<01E0
+0007F8000FFC000FFC001FFE001FFE001FFE001FFE000FFC000FFC0007F80001E0000000000000
+0000000000000000000000000000000000000000000000000000000000FE00FFFE00FFFE00FFFE
+00FFFE0007FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE
+0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE
+0003FE0003FE0003FE0003FE00FFFFF0FFFFF0FFFFF0FFFFF0143D7DBC1A>105
+D<0001FFC00000000FFFF80000007FFFFF000000FF80FF800003FE003FE00007F8000FF0000FF0
+0007F8000FF00007F8001FE00003FC003FE00003FE003FE00003FE007FC00001FF007FC00001FF
+007FC00001FF007FC00001FF00FFC00001FF80FFC00001FF80FFC00001FF80FFC00001FF80FFC0
+0001FF80FFC00001FF80FFC00001FF80FFC00001FF80FFC00001FF807FC00001FF007FC00001FF
+007FC00001FF003FE00003FE003FE00003FE001FE00003FC001FF00007FC000FF00007F80007F8
+000FF00003FE003FE00000FF80FF8000007FFFFF0000000FFFF800000001FFC0000029267DA530
+>111 D<01FC03F000FFFC0FFC00FFFC1FFF00FFFC3C3F80FFFC707F8007FCE0FFC003FCC0FFC0
+03FD80FFC003FD80FFC003FF807F8003FF003F0003FF001E0003FF00000003FE00000003FE0000
+0003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00
+000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE
+00000003FE00000003FE00000003FE000000FFFFFC0000FFFFFC0000FFFFFC0000FFFFFC000022
+267DA528>114 D<003FF07003FFFEF007FFFFF01FC01FF03F0003F03E0001F07C0001F07C0000
+F0FC0000F0FC0000F0FE0000F0FF000000FFC00000FFFC00007FFFF0003FFFFE003FFFFF801FFF
+FFC00FFFFFE003FFFFF000FFFFF8001FFFFC00007FFC000007FE700001FEF00000FEF000007EF8
+00007EF800007EFC00007EFC00007CFE0000FCFF0000F8FF8001F0FFF00FE0F9FFFFC0F07FFF00
+C01FF8001F267DA526>I<000F0000000F0000000F0000000F0000000F0000001F0000001F0000
+001F0000001F0000003F0000003F0000007F0000007F000000FF000001FF000003FF000007FF00
+001FFFFFF0FFFFFFF0FFFFFFF0FFFFFFF001FF000001FF000001FF000001FF000001FF000001FF
+000001FF000001FF000001FF000001FF000001FF000001FF000001FF000001FF000001FF000001
+FF000001FF000001FF000001FF000001FF003C01FF003C01FF003C01FF003C01FF003C01FF003C
+01FF003C01FF003C00FF007800FF8078007F80F0003FC1E0001FFFC0000FFF800001FE001E377E
+B626>I<FFFFF001FFFCFFFFF001FFFCFFFFF001FFFCFFFFF001FFFC03FE00001F8003FF00001F
+0001FF00001E0001FF80003E0000FF80003C0000FF80003C00007FC0007800007FC0007800007F
+E000F800003FE000F000003FF001F000001FF001E000001FF803E000000FF803C000000FFC03C0
+000007FC0780000007FC0780000007FE0F80000003FE0F00000003FF1F00000001FF1E00000001
+FFBE00000000FFBC00000000FFFC000000007FF8000000007FF8000000007FF8000000003FF000
+0000003FF0000000001FE0000000001FE0000000000FC0000000000FC000000000078000000000
+0780000000000F80000000000F00000000001F00000000001E00000008003E0000007F003C0000
+007F007C000000FF8078000000FF80F8000000FF80F0000000FF81E00000007F07C00000007C1F
+800000003FFF000000001FFE0000000007F0000000002E377EA533>121
+D E end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 300dpi
+TeXDict begin
+
+%%EndSetup
+%%Page: 1 1
+0 bop 0 1152 a Fp(GNU)33 b(History)f(Library)p 0 1201 1950
+17 v 1035 1250 a Fo(Edition)16 b(2.0,)e(for)h Fn(History)f(Library)g
+Fo(V)l(ersion)i(2.0.)1759 1304 y(July)g(1994)0 2443 y Fm(Brian)23
+b(F)-6 b(o)n(x,)23 b(F)-6 b(ree)23 b(Soft)n(w)n(are)f(F)-6
+b(oundation)0 2509 y(Chet)22 b(Ramey)-6 b(,)23 b(Case)e(W)-6
+b(estern)23 b(Reserv)n(e)f(Univ)n(ersit)n(y)p 0 2545 1950 9
+v eop
+%%Page: 2 2
+1 bop 0 295 a Fo(This)16 b(do)q(cumen)o(t)g(describ)q(es)h(the)f(GNU)f
+(History)g(library)l(,)h(a)g(programming)e(to)q(ol)i(that)f(pro)o(vides)h(a)f
+(consisten)o(t)0 358 y(user)g(in)o(terface)h(for)e(recalling)j(lines)g(of)e
+(previously)h(t)o(yp)q(ed)g(input.)0 495 y(Published)h(b)o(y)f(the)f(F)l(ree)
+g(Soft)o(w)o(are)f(F)l(oundation)0 557 y(675)g(Massac)o(h)o(usetts)g(Av)o(en)
+o(ue,)0 619 y(Cam)o(bridge,)h(MA)g(02139)f(USA)0 756 y(P)o(ermission)f(is)g
+(gran)o(ted)f(to)f(mak)o(e)h(and)h(distribute)h(v)o(erbatim)e(copies)h(of)f
+(this)h(man)o(ual)g(pro)o(vided)g(the)f(cop)o(yrigh)o(t)0 818
+y(notice)k(and)f(this)h(p)q(ermission)h(notice)e(are)g(preserv)o(ed)h(on)f
+(all)h(copies.)0 955 y(P)o(ermission)f(is)f(gran)o(ted)f(to)h(cop)o(y)g(and)g
+(distribute)h(mo)q(di\014ed)h(v)o(ersions)e(of)f(this)i(man)o(ual)f(under)h
+(the)f(conditions)0 1018 y(for)e(v)o(erbatim)g(cop)o(ying,)h(pro)o(vided)h
+(that)d(the)i(en)o(tire)g(resulting)h(deriv)o(ed)f(w)o(ork)f(is)h
+(distributed)h(under)f(the)g(terms)0 1080 y(of)i(a)g(p)q(ermission)h(notice)g
+(iden)o(tical)h(to)e(this)g(one.)0 1217 y(P)o(ermission)20
+b(is)g(gran)o(ted)f(to)g(cop)o(y)h(and)f(distribute)i(translations)f(of)f
+(this)h(man)o(ual)f(in)o(to)h(another)f(language,)0 1279 y(under)c(the)f(ab)q
+(o)o(v)o(e)g(conditions)h(for)e(mo)q(di\014ed)j(v)o(ersions,)e(except)g(that)
+g(this)g(p)q(ermission)i(notice)e(ma)o(y)g(b)q(e)h(stated)0
+1341 y(in)h(a)f(translation)g(appro)o(v)o(ed)g(b)o(y)g(the)g(F)l(oundation.)0
+2636 y(Cop)o(yrigh)o(t)226 2635 y(c)214 2636 y Fl(\015)g Fo(1989,)f(1991)g(F)
+l(ree)h(Soft)o(w)o(are)f(F)l(oundation,)h(Inc.)p eop
+%%Page: 1 3
+2 bop 0 -83 a Fo(Chapter)15 b(1:)k(Using)d(History)f(In)o(teractiv)o(ely)1157
+b(1)0 158 y Fk(1)41 b(Using)14 b(History)h(In)n(teractiv)n(ely)62
+330 y Fo(This)i(c)o(hapter)e(describ)q(es)j(ho)o(w)d(to)h(use)g(the)g(GNU)g
+(History)f(Library)i(in)o(teractiv)o(ely)l(,)g(from)e(a)g(user's)h(stand-)0
+392 y(p)q(oin)o(t.)23 b(It)16 b(should)h(b)q(e)f(considered)i(a)d(user's)h
+(guide.)23 b(F)l(or)15 b(information)h(on)g(using)h(the)f(GNU)g(History)f
+(Library)0 454 y(in)h(y)o(our)f(o)o(wn)f(programs,)g(see)i(Chapter)e(2)h
+([Programming)f(with)i(GNU)f(History],)f(page)h(5.)0 663 y
+Fm(1.1)33 b(History)15 b(In)n(teraction)62 800 y Fo(The)j(History)g(library)g
+(pro)o(vides)h(a)e(history)h(expansion)h(feature)e(that)g(is)i(similar)g(to)e
+(the)h(history)f(expan-)0 862 y(sion)k(pro)o(vided)h(b)o(y)f
+Fn(csh)p Fo(.)36 b(The)22 b(follo)o(wing)f(text)g(describ)q(es)h(the)f(syn)o
+(tax)f(used)i(to)e(manipulate)i(the)f(history)0 924 y(information.)62
+1061 y(History)11 b(expansion)i(tak)o(es)d(place)i(in)h(t)o(w)o(o)d(parts.)18
+b(The)11 b(\014rst)g(is)h(to)f(determine)h(whic)o(h)g(line)h(from)e(the)g
+(previous)0 1124 y(history)h(should)h(b)q(e)f(used)h(during)f(substitution.)
+20 b(The)12 b(second)g(is)h(to)e(select)h(p)q(ortions)g(of)g(that)f(line)i
+(for)f(inclusion)0 1186 y(in)o(to)f(the)h(curren)o(t)f(one.)18
+b(The)12 b(line)h(selected)f(from)f(the)g(previous)h(history)g(is)f(called)i
+(the)e Fj(ev)o(en)o(t)p Fo(,)h(and)f(the)h(p)q(ortions)0 1248
+y(of)h(that)g(line)i(that)e(are)g(acted)g(up)q(on)h(are)g(called)h
+Fj(w)o(ords)p Fo(.)j(The)c(line)h(is)f(brok)o(en)f(in)o(to)h(w)o(ords)f(in)h
+(the)f(same)h(fashion)0 1310 y(that)j(Bash)h(do)q(es,)h(so)e(that)g(sev)o
+(eral)h(English)i(\(or)d(Unix\))h(w)o(ords)f(surrounded)i(b)o(y)f(quotes)f
+(are)h(considered)h(as)0 1373 y(one)c(w)o(ord.)0 1565 y Fi(1.1.1)30
+b(Ev)n(en)n(t)16 b(Designators)62 1702 y Fo(An)g(ev)o(en)o(t)f(designator)g
+(is)g(a)g(reference)h(to)f(a)g(command)g(line)i(en)o(try)d(in)i(the)g
+(history)f(list.)0 1847 y Fn(!)216 b Fo(Start)14 b(a)g(history)h
+(substitution,)g(except)h(when)f(follo)o(w)o(ed)g(b)o(y)g(a)f(space,)h(tab,)f
+(the)h(end)g(of)g(the)g(line,)240 1909 y Fn(=)g Fo(or)g Fn(\()p
+Fo(.)0 1989 y Fn(!!)192 b Fo(Refer)16 b(to)e(the)i(previous)f(command.)20
+b(This)c(is)g(a)f(synon)o(ym)g(for)f Fn(!-1)p Fo(.)0 2068 y
+Fn(!n)192 b Fo(Refer)16 b(to)e(command)h(line)i Fj(n)p Fo(.)0
+2148 y Fn(!-n)168 b Fo(Refer)16 b(to)e(the)i(command)f Fj(n)g
+Fo(lines)i(bac)o(k.)0 2227 y Fn(!string)72 b Fo(Refer)16 b(to)e(the)i(most)e
+(recen)o(t)h(command)g(starting)g(with)g Fj(string)p Fo(.)0
+2298 y Fn(!?string)p Fo([)p Fn(?)p Fo(])240 2360 y(Refer)h(to)e(the)i(most)e
+(recen)o(t)h(command)g(con)o(taining)h Fj(string)p Fo(.)0 2440
+y Fn(!#)192 b Fo(The)15 b(en)o(tire)h(command)f(line)i(t)o(yp)q(ed)f(so)e
+(far.)0 2510 y Fn(^string1^string2^)240 2573 y Fo(Quic)o(k)j(Substitution.)22
+b(Rep)q(eat)16 b(the)g(last)f(command,)h(replacing)h Fj(string1)h
+Fo(with)e Fj(string2)p Fo(.)21 b(Equiv-)240 2635 y(alen)o(t)15
+b(to)g Fn(!!:s/string1/string2/)p Fo(.)p eop
+%%Page: 2 4
+3 bop 0 -83 a Fo(2)1497 b(GNU)15 b(History)g(Library)0 158
+y Fi(1.1.2)30 b(W)-5 b(ord)15 b(Designators)62 295 y Fo(A)i
+Fn(:)g Fo(separates)f(the)h(ev)o(en)o(t)f(sp)q(eci\014cation)j(from)d(the)g
+(w)o(ord)g(designator.)25 b(It)17 b(can)g(b)q(e)g(omitted)g(if)g(the)g(w)o
+(ord)0 358 y(designator)d(b)q(egins)h(with)f(a)f Fn(^)p Fo(,)h
+Fn($)p Fo(,)f Fn(*)h Fo(or)f Fn(\045)p Fo(.)20 b(W)l(ords)13
+b(are)h(n)o(um)o(b)q(ered)g(from)f(the)h(b)q(eginning)i(of)d(the)h(line,)i
+(with)e(the)0 420 y(\014rst)h(w)o(ord)f(b)q(eing)j(denoted)f(b)o(y)f(a)g(0)f
+(\(zero\).)0 569 y Fn(0)h(\(zero\))57 b Fo(The)15 b Fn(0)p
+Fo(th)g(w)o(ord.)20 b(F)l(or)14 b(man)o(y)h(applications,)h(this)g(is)g(the)f
+(command)g(w)o(ord.)0 656 y Fn(n)216 b Fo(The)15 b Fj(n)p Fo(th)h(w)o(ord.)0
+744 y Fn(^)216 b Fo(The)15 b(\014rst)g(argumen)o(t;)f(that)h(is,)g(w)o(ord)g
+(1.)0 831 y Fn($)216 b Fo(The)15 b(last)h(argumen)o(t.)0 918
+y Fn(\045)216 b Fo(The)15 b(w)o(ord)g(matc)o(hed)g(b)o(y)g(the)g(most)g
+(recen)o(t)g Fn(?string?)f Fo(searc)o(h.)0 1005 y Fn(x-y)168
+b Fo(A)15 b(range)g(of)g(w)o(ords;)f Fn(-)p Fj(y)19 b Fo(abbreviates)c
+Fn(0-)p Fj(y)t Fo(.)0 1092 y Fn(*)216 b Fo(All)17 b(of)f(the)g(w)o(ords,)f
+(except)i(the)f Fn(0)p Fo(th.)22 b(This)17 b(is)f(a)g(synon)o(ym)g(for)f
+Fn(1-$)p Fo(.)22 b(It)17 b(is)f(not)g(an)g(error)f(to)h(use)240
+1155 y Fn(*)f Fo(if)h(there)f(is)h(just)f(one)g(w)o(ord)f(in)i(the)g(ev)o(en)
+o(t;)e(the)i(empt)o(y)e(string)i(is)f(returned)h(in)g(that)e(case.)0
+1242 y Fn(x*)192 b Fo(Abbreviates)16 b Fn(x-$)0 1329 y(x-)192
+b Fo(Abbreviates)16 b Fn(x-$)f Fo(lik)o(e)h Fn(x*)p Fo(,)e(but)i(omits)f(the)
+g(last)g(w)o(ord.)0 1537 y Fi(1.1.3)30 b(Mo)r(di\014ers)62
+1674 y Fo(After)20 b(the)f(optional)i(w)o(ord)e(designator,)h(y)o(ou)f(can)h
+(add)g(a)g(sequence)h(of)e(one)h(or)f(more)g(of)g(the)h(follo)o(wing)0
+1736 y(mo)q(di\014ers,)c(eac)o(h)f(preceded)i(b)o(y)e(a)g Fn(:)p
+Fo(.)0 1885 y Fn(h)216 b Fo(Remo)o(v)o(e)15 b(a)g(trailing)h(pathname)f(comp)
+q(onen)o(t,)g(lea)o(ving)h(only)g(the)f(head.)0 1973 y Fn(r)216
+b Fo(Remo)o(v)o(e)15 b(a)g(trailing)h(su\016x)f(of)g(the)g(form)g(`)p
+Fn(.)p Fo(')p Fj(su\016x)p Fo(,)f(lea)o(ving)i(the)f(basename.)0
+2060 y Fn(e)216 b Fo(Remo)o(v)o(e)15 b(all)h(but)g(the)f(trailing)h(su\016x.)
+0 2147 y Fn(t)216 b Fo(Remo)o(v)o(e)15 b(all)h(leading)h(pathname)e(comp)q
+(onen)o(ts,)g(lea)o(ving)h(the)f(tail.)0 2234 y Fn(p)216 b
+Fo(Prin)o(t)15 b(the)g(new)h(command)f(but)g(do)g(not)g(execute)h(it.)0
+2309 y Fn(s/old/new/)240 2371 y Fo(Substitute)g Fj(new)k Fo(for)15
+b(the)h(\014rst)f(o)q(ccurrence)h(of)g Fj(old)h Fo(in)g(the)e(ev)o(en)o(t)h
+(line.)22 b(An)o(y)16 b(delimiter)h(ma)o(y)e(b)q(e)240 2433
+y(used)e(in)f(place)h(of)f Fn(/)p Fo(.)19 b(The)12 b(delimiter)i(ma)o(y)d(b)q
+(e)i(quoted)f(in)h Fj(old)h Fo(and)e Fj(new)17 b Fo(with)12
+b(a)g(single)h(bac)o(kslash.)240 2496 y(If)g Fn(&)h Fo(app)q(ears)f(in)h
+Fj(new)p Fo(,)f(it)h(is)g(replaced)g(b)o(y)f Fj(old)p Fo(.)20
+b(A)13 b(single)i(bac)o(kslash)e(will)i(quote)e(the)h Fn(&)p
+Fo(.)19 b(The)13 b(\014nal)240 2558 y(delimiter)k(is)f(optional)g(if)f(it)h
+(is)f(the)h(last)f(c)o(haracter)f(on)h(the)h(input)g(line.)0
+2645 y Fn(&)216 b Fo(Rep)q(eat)16 b(the)f(previous)h(substitution.)p
+eop
+%%Page: 3 5
+4 bop 0 -83 a Fo(Chapter)15 b(1:)k(Using)d(History)f(In)o(teractiv)o(ely)1157
+b(3)0 158 y Fn(g)216 b Fo(Cause)15 b(c)o(hanges)g(to)f(b)q(e)i(applied)h(o)o
+(v)o(er)d(the)h(en)o(tire)g(ev)o(en)o(t)g(line.)21 b(Used)16
+b(in)g(conjunction)g(with)f Fn(s)p Fo(,)f(as)240 221 y(in)i
+Fn(gs/old/new/)p Fo(,)d(or)i(with)h Fn(&)p Fo(.)p eop
+%%Page: 4 6
+5 bop 0 -83 a Fo(4)1497 b(GNU)15 b(History)g(Library)p eop
+%%Page: 5 7
+6 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1039
+b(5)0 158 y Fk(2)41 b(Programming)16 b(with)f(GNU)h(History)62
+347 y Fo(This)e(c)o(hapter)f(describ)q(es)i(ho)o(w)d(to)h(in)o(terface)g
+(programs)f(that)h(y)o(ou)g(write)g(with)g(the)h(GNU)f(History)g(Library)l(.)
+0 409 y(It)j(should)g(b)q(e)g(considered)h(a)f(tec)o(hnical)h(guide.)22
+b(F)l(or)15 b(information)h(on)f(the)h(in)o(teractiv)o(e)g(use)g(of)f(GNU)g
+(History)l(,)0 471 y(see)g(Chapter)g(1)g([Using)h(History)f(In)o(teractiv)o
+(ely],)g(page)g(1.)0 698 y Fm(2.1)33 b(In)n(tro)r(duction)17
+b(to)e(History)62 835 y Fo(Man)o(y)j(programs)g(read)h(input)h(from)e(the)g
+(user)h(a)g(line)h(at)f(a)f(time.)31 b(The)19 b(GNU)g(History)f(library)i(is)
+f(able)0 897 y(to)e(k)o(eep)g(trac)o(k)f(of)h(those)g(lines,)i(asso)q(ciate)e
+(arbitrary)g(data)g(with)g(eac)o(h)g(line,)j(and)d(utilize)i(information)f
+(from)0 960 y(previous)e(lines)h(in)f(comp)q(osing)f(new)h(ones.)62
+1097 y(The)i(programmer)f(using)h(the)g(History)g(library)g(has)g(a)o(v)m
+(ailable)h(functions)g(for)e(remem)o(b)q(ering)h(lines)i(on)d(a)0
+1159 y(history)f(list,)g(asso)q(ciating)g(arbitrary)g(data)f(with)h(a)f
+(line,)j(remo)o(ving)d(lines)j(from)d(the)h(list,)g(searc)o(hing)g(through)0
+1221 y(the)h(list)h(for)e(a)h(line)h(con)o(taining)g(an)f(arbitrary)f(text)h
+(string,)g(and)g(referencing)h(an)o(y)f(line)h(in)g(the)f(list)h(directly)l
+(.)0 1284 y(In)d(addition,)h(a)e(history)h Fj(expansion)h Fo(function)g(is)f
+(a)o(v)m(ailable)h(whic)o(h)g(pro)o(vides)f(for)f(a)h(consisten)o(t)g(user)g
+(in)o(terface)0 1346 y(across)f(di\013eren)o(t)i(programs.)62
+1483 y(The)i(user)g(using)g(programs)f(written)g(with)h(the)g(History)f
+(library)i(has)e(the)h(b)q(ene\014t)h(of)e(a)g(consisten)o(t)h(user)0
+1545 y(in)o(terface)d(with)g(a)f(set)h(of)f(w)o(ell-kno)o(wn)h(commands)g
+(for)f(manipulating)i(the)f(text)f(of)g(previous)h(lines)h(and)f(using)0
+1608 y(that)g(text)g(in)i(new)e(commands.)22 b(The)15 b(basic)i(history)e
+(manipulation)j(commands)d(are)g(similar)i(to)e(the)h(history)0
+1670 y(substitution)g(pro)o(vided)g(b)o(y)f Fn(csh)p Fo(.)62
+1807 y(If)g(the)g(programmer)e(desires,)i(he)g(can)g(use)g(the)f(Readline)j
+(library)l(,)e(whic)o(h)h(includes)g(some)f(history)f(manip-)0
+1870 y(ulation)i(b)o(y)f(default,)h(and)f(has)g(the)g(added)h(adv)m(an)o
+(tage)f(of)g(command)g(line)h(editing.)0 2096 y Fm(2.2)33 b(History)15
+b(Storage)62 2234 y Fo(The)h(history)f(list)h(is)g(an)f(arra)o(y)f(of)g
+(history)i(en)o(tries.)k(A)15 b(history)g(en)o(try)g(is)h(declared)g(as)f
+(follo)o(ws:)120 2358 y Fn(typedef)23 b(struct)g(_hist_entry)f({)168
+2408 y(char)h(*line;)168 2458 y(char)g(*data;)120 2508 y(})h(HIST_ENTRY;)62
+2645 y Fo(The)16 b(history)f(list)h(itself)g(migh)o(t)f(therefore)g(b)q(e)h
+(declared)g(as)p eop
+%%Page: 6 8
+7 bop 0 -83 a Fo(6)1497 b(GNU)15 b(History)g(Library)120 158
+y Fn(HIST_ENTRY)22 b(**the_history_list;)62 302 y Fo(The)16
+b(state)e(of)h(the)g(History)g(library)h(is)g(encapsulated)g(in)o(to)f(a)g
+(single)i(structure:)120 434 y Fn(/*)24 b(A)f(structure)g(used)g(to)h(pass)f
+(the)h(current)f(state)g(of)g(the)h(history)f(stuff)g(around.)g(*/)120
+484 y(typedef)g(struct)g(_hist_state)f({)168 534 y(HIST_ENTRY)g(**entries;)
+214 b(/*)23 b(Pointer)g(to)h(the)f(entries)g(themselves.)f(*/)168
+584 y(int)h(offset;)453 b(/*)23 b(The)h(location)e(pointer)h(within)g(this)h
+(array.)f(*/)168 633 y(int)g(length;)453 b(/*)23 b(Number)g(of)h(elements)f
+(within)g(this)g(array.)g(*/)168 683 y(int)g(size;)501 b(/*)23
+b(Number)g(of)h(slots)f(allocated)g(to)g(this)h(array.)f(*/)168
+733 y(int)g(flags;)120 783 y(})h(HISTORY_STATE;)62 927 y Fo(If)16
+b(the)f(\015ags)g(mem)o(b)q(er)g(includes)j Fn(HS_STIFLED)p
+Fo(,)13 b(the)i(history)h(has)f(b)q(een)h(sti\015ed.)0 1215
+y Fm(2.3)33 b(History)15 b(F)-6 b(unctions)62 1359 y Fo(This)16
+b(section)g(describ)q(es)h(the)e(calling)i(sequence)f(for)f(the)g(v)m(arious)
+h(functions)g(presen)o(t)f(in)h(GNU)f(History)l(.)0 1631 y
+Fi(2.3.1)30 b(Initializing)15 b(History)g(and)g(State)g(Managemen)n(t)62
+1775 y Fo(This)j(section)g(describ)q(es)h(functions)f(used)g(to)e(initialize)
+21 b(and)c(manage)g(the)g(state)g(of)g(the)g(History)g(library)0
+1837 y(when)f(y)o(ou)f(w)o(an)o(t)f(to)g(use)i(the)f(history)g(functions)h
+(in)g(y)o(our)f(program.)1725 2021 y(F)l(unction)-1899 b Fh(void)20
+b Fg(using)p 258 2021 18 3 v 20 w(history)j Ff(\(\))120 2083
+y Fo(Begin)g(a)f(session)g(in)h(whic)o(h)g(the)f(history)g(functions)g(migh)o
+(t)g(b)q(e)h(used.)40 b(This)23 b(initializes)i(the)120 2145
+y(in)o(teractiv)o(e)16 b(v)m(ariables.)1725 2328 y(F)l(unction)-1899
+b Fh(HISTORY_STATE)21 b(*)e Fg(history)p 582 2328 V 21 w(get)p
+680 2328 V 21 w(history)p 876 2328 V 21 w(state)j Ff(\(\))120
+2391 y Fo(Return)16 b(a)f(structure)g(describing)i(the)e(curren)o(t)g(state)f
+(of)h(the)g(input)i(history)l(.)1725 2574 y(F)l(unction)-1899
+b Fh(void)20 b Fg(history)p 302 2574 V 20 w(set)p 393 2574
+V 21 w(history)p 589 2574 V 21 w(state)j Ff(\()p Fn(HISTORY_STATE)13
+b(*state)p Ff(\))120 2636 y Fo(Set)i(the)h(state)e(of)h(the)g(history)g(list)
+h(according)g(to)e Fj(state)p Fo(.)p eop
+%%Page: 7 9
+8 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1039
+b(7)0 158 y Fi(2.3.2)30 b(History)15 b(List)g(Managemen)n(t)62
+295 y Fo(These)i(functions)h(manage)e(individual)k(en)o(tries)d(on)f(the)h
+(history)g(list,)g(or)f(set)h(parameters)e(managing)i(the)0
+358 y(list)f(itself.)1725 520 y(F)l(unction)-1899 b Fh(void)20
+b Fg(add)p 219 520 18 3 v 20 w(history)j Ff(\()p Fn(char)14
+b(*string)p Ff(\))120 582 y Fo(Place)j Fj(string)k Fo(at)16
+b(the)g(end)i(of)e(the)g(history)h(list.)25 b(The)17 b(asso)q(ciated)g(data)f
+(\014eld)h(\(if)g(an)o(y\))f(is)h(set)g(to)120 644 y Fn(NULL)p
+Fo(.)1725 806 y(F)l(unction)-1899 b Fh(HIST_ENTRY)21 b(*)e
+Fg(remo)n(v)n(e)p 509 806 V 20 w(history)k Ff(\()p Fn(int)14
+b(which)p Ff(\))120 868 y Fo(Remo)o(v)o(e)d(history)g(en)o(try)g(at)g
+(o\013set)f Fj(whic)o(h)i Fo(from)f(the)g(history)l(.)19 b(The)11
+b(remo)o(v)o(ed)g(elemen)o(t)h(is)g(returned)120 930 y(so)j(y)o(ou)g(can)g
+(free)g(the)h(line,)g(data,)e(and)i(con)o(taining)g(structure.)1725
+1092 y(F)l(unction)-1899 b Fh(HIST_ENTRY)21 b(*)e Fg(replace)p
+505 1092 V 22 w(history)p 702 1092 V 20 w(en)n(try)24 b Ff(\()p
+Fn(int)14 b(which,)g(char)h(*line,)f(char)208 1155 y(*data)p
+Ff(\))120 1217 y Fo(Mak)o(e)d(the)i(history)f(en)o(try)g(at)f(o\013set)h
+Fj(whic)o(h)h Fo(ha)o(v)o(e)e Fj(line)17 b Fo(and)12 b Fj(data)p
+Fo(.)19 b(This)12 b(returns)g(the)h(old)g(en)o(try)e(so)120
+1279 y(y)o(ou)i(can)g(disp)q(ose)h(of)e(the)h(data.)19 b(In)13
+b(the)g(case)g(of)f(an)h(in)o(v)m(alid)i Fj(whic)o(h)p Fo(,)f(a)f
+Fn(NULL)f Fo(p)q(oin)o(ter)i(is)f(returned.)1725 1441 y(F)l(unction)-1899
+b Fh(void)20 b Fg(sti\015e)p 245 1441 V 21 w(history)j Ff(\()p
+Fn(int)14 b(max)p Ff(\))120 1503 y Fo(Sti\015e)i(the)f(history)h(list,)f
+(remem)o(b)q(ering)h(only)g(the)f(last)g Fj(max)j Fo(en)o(tries.)1725
+1665 y(F)l(unction)-1899 b Fh(int)20 b Fg(unsti\015e)p 283
+1665 V 21 w(history)i Ff(\(\))120 1728 y Fo(Stop)13 b(sti\015ing)h(the)f
+(history)l(.)19 b(This)14 b(returns)f(the)g(previous)h(amoun)o(t)e(the)h
+(history)g(w)o(as)g(sti\015ed.)20 b(The)120 1790 y(v)m(alue)c(is)g(p)q
+(ositiv)o(e)g(if)g(the)f(history)g(w)o(as)g(sti\015ed,)h(negativ)o(e)f(if)g
+(it)h(w)o(asn't.)1725 1952 y(F)l(unction)-1899 b Fh(int)20
+b Fg(history)p 276 1952 V 20 w(is)p 334 1952 V 21 w(sti\015ed)k
+Ff(\(\))120 2014 y Fo(Returns)16 b(non-zero)f(if)h(the)f(history)g(is)h
+(sti\015ed,)g(zero)f(if)g(it)h(is)g(not.)0 2222 y Fi(2.3.3)30
+b(Information)14 b(Ab)r(out)h(the)g(History)g(List)62 2359
+y Fo(These)h(functions)g(return)f(information)g(ab)q(out)g(the)h(en)o(tire)f
+(history)g(list)h(or)f(individual)j(list)f(en)o(tries.)1725
+2521 y(F)l(unction)-1899 b Fh(HIST_ENTRY)21 b(**)e Fg(history)p
+530 2521 V 21 w(list)24 b Ff(\(\))120 2583 y Fo(Return)e(a)e
+Fn(NULL)h Fo(terminated)g(arra)o(y)f(of)g Fn(HIST_ENTRY)g Fo(whic)o(h)i(is)f
+(the)g(curren)o(t)g(input)h(history)l(.)120 2645 y(Elemen)o(t)16
+b(0)f(of)f(this)i(list)g(is)g(the)f(b)q(eginning)i(of)e(time.)20
+b(If)c(there)f(is)h(no)f(history)l(,)g(return)g Fn(NULL)p Fo(.)p
+eop
+%%Page: 8 10
+9 bop 0 -83 a Fo(8)1497 b(GNU)15 b(History)g(Library)1725 158
+y(F)l(unction)-1899 b Fh(int)20 b Fg(where)p 250 158 18 3 v
+20 w(history)j Ff(\(\))120 221 y Fo(Returns)16 b(the)f(o\013set)f(of)h(the)g
+(curren)o(t)g(history)g(elemen)o(t.)1725 378 y(F)l(unction)-1899
+b Fh(HIST_ENTRY)21 b(*)e Fg(curren)n(t)p 512 378 V 21 w(history)k
+Ff(\(\))120 440 y Fo(Return)14 b(the)g(history)g(en)o(try)f(at)h(the)g
+(curren)o(t)f(p)q(osition,)i(as)e(determined)j(b)o(y)d Fn(where_history)h
+(\(\))p Fo(.)120 502 y(If)h(there)h(is)f(no)h(en)o(try)e(there,)h(return)g(a)
+g Fn(NULL)g Fo(p)q(oin)o(ter.)1725 660 y(F)l(unction)-1899
+b Fh(HIST_ENTRY)21 b(*)e Fg(history)p 504 660 V 21 w(get)j
+Ff(\()p Fn(int)15 b(offset)p Ff(\))120 722 y Fo(Return)g(the)g(history)f(en)o
+(try)g(at)g(p)q(osition)i Fj(o\013set)p Fo(,)d(starting)h(from)g
+Fn(history_base)p Fo(.)k(If)c(there)h(is)g(no)120 784 y(en)o(try)g(there,)g
+(or)f(if)i Fj(o\013set)f Fo(is)h(greater)e(than)h(the)h(history)f(length,)g
+(return)g(a)g Fn(NULL)g Fo(p)q(oin)o(ter.)1725 942 y(F)l(unction)-1899
+b Fh(int)20 b Fg(history)p 276 942 V 20 w(total)p 412 942 V
+22 w(b)n(ytes)j Ff(\(\))120 1004 y Fo(Return)17 b(the)f(n)o(um)o(b)q(er)g(of)
+g(b)o(ytes)g(that)f(the)h(primary)g(history)g(en)o(tries)h(are)e(using.)23
+b(This)17 b(function)120 1066 y(returns)e(the)g(sum)h(of)e(the)i(lengths)f
+(of)g(all)h(the)g(lines)g(in)g(the)g(history)l(.)0 1265 y Fi(2.3.4)30
+b(Mo)n(ving)15 b(Around)h(the)f(History)g(List)62 1402 y Fo(These)h
+(functions)g(allo)o(w)f(the)g(curren)o(t)h(index)g(in)o(to)f(the)h(history)f
+(list)h(to)e(b)q(e)i(set)f(or)g(c)o(hanged.)1725 1559 y(F)l(unction)-1899
+b Fh(int)20 b Fg(history)p 276 1559 V 20 w(set)p 367 1559 V
+21 w(p)r(os)h Ff(\()p Fn(int)15 b(pos)p Ff(\))120 1621 y Fo(Set)g(the)h(p)q
+(osition)g(in)g(the)f(history)g(list)h(to)f Fj(p)q(os)p Fo(,)g(an)g(absolute)
+g(index)i(in)o(to)e(the)g(list.)1725 1779 y(F)l(unction)-1899
+b Fh(HIST_ENTRY)21 b(*)e Fg(previous)p 540 1779 V 20 w(history)k
+Ff(\(\))120 1841 y Fo(Bac)o(k)16 b(up)h(the)g(curren)o(t)f(history)h
+(o\013set)e(to)h(the)h(previous)g(history)g(en)o(try)l(,)f(and)h(return)f(a)g
+(p)q(oin)o(ter)120 1903 y(to)f(that)f(en)o(try)l(.)20 b(If)15
+b(there)g(is)h(no)f(previous)h(en)o(try)l(,)f(return)g(a)g
+Fn(NULL)g Fo(p)q(oin)o(ter.)1725 2061 y(F)l(unction)-1899 b
+Fh(HIST_ENTRY)21 b(*)e Fg(next)p 439 2061 V 21 w(history)k
+Ff(\(\))120 2123 y Fo(Mo)o(v)o(e)c(the)h(curren)o(t)g(history)f(o\013set)g
+(forw)o(ard)g(to)g(the)h(next)g(history)g(en)o(try)l(,)g(and)g(return)g(the)g
+(a)120 2185 y(p)q(oin)o(ter)c(to)e(that)h(en)o(try)l(.)k(If)d(there)f(is)h
+(no)f(next)g(en)o(try)l(,)g(return)g(a)g Fn(NULL)g Fo(p)q(oin)o(ter.)0
+2384 y Fi(2.3.5)30 b(Searc)n(hing)15 b(the)h(History)f(List)62
+2521 y Fo(These)e(functions)g(allo)o(w)f(searc)o(hing)h(of)f(the)g(history)g
+(list)h(for)f(en)o(tries)h(con)o(taining)g(a)f(sp)q(eci\014c)i(string.)19
+b(Searc)o(h-)0 2583 y(ing)e(ma)o(y)g(b)q(e)g(p)q(erformed)g(b)q(oth)g(forw)o
+(ard)f(and)h(bac)o(kw)o(ard)f(from)g(the)h(curren)o(t)f(history)h(p)q
+(osition.)26 b(The)17 b(searc)o(h)0 2645 y(ma)o(y)d(b)q(e)i
+Fj(anc)o(hored)p Fo(,)f(meaning)h(that)f(the)g(string)g(m)o(ust)g(matc)o(h)f
+(at)h(the)g(b)q(eginning)i(of)e(the)h(history)f(en)o(try)l(.)p
+eop
+%%Page: 9 11
+10 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1039
+b(9)1725 158 y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p
+276 158 18 3 v 20 w(searc)n(h)j Ff(\()p Fn(char)14 b(*string,)g(int)h
+(direction)p Ff(\))120 221 y Fo(Searc)o(h)k(the)g(history)g(for)f
+Fj(string)p Fo(,)i(starting)e(at)g(the)h(curren)o(t)g(history)g(o\013set.)30
+b(If)19 b Fj(direction)h Fn(<)f Fo(0,)120 283 y(then)14 b(the)f(searc)o(h)g
+(is)h(through)e(previous)i(en)o(tries,)g(else)g(through)f(subsequen)o(t.)20
+b(If)13 b Fj(string)k Fo(is)d(found,)120 345 y(then)f(the)g(curren)o(t)g
+(history)g(index)i(is)e(set)g(to)f(that)h(history)g(en)o(try)l(,)f(and)i(the)
+f(v)m(alue)h(returned)f(is)h(the)120 407 y(o\013set)h(in)i(the)f(line)i(of)d
+(the)h(en)o(try)g(where)g Fj(string)k Fo(w)o(as)c(found.)22
+b(Otherwise,)17 b(nothing)f(is)h(c)o(hanged,)120 470 y(and)e(a)g(-1)g(is)h
+(returned.)1725 659 y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p
+276 659 V 20 w(searc)n(h)p 452 659 V 21 w(pre\014x)i Ff(\()p
+Fn(char)15 b(*string,)f(int)g(direction)p Ff(\))120 721 y Fo(Searc)o(h)22
+b(the)h(history)f(for)f Fj(string)p Fo(,)j(starting)e(at)f(the)i(curren)o(t)f
+(history)g(o\013set.)40 b(The)22 b(searc)o(h)g(is)120 783 y(anc)o(hored:)i
+(matc)o(hing)18 b(lines)h(m)o(ust)d(b)q(egin)j(with)f Fj(string)p
+Fo(.)26 b(If)17 b Fj(direction)i Fn(<)e Fo(0,)g(then)h(the)f(searc)o(h)g(is)
+120 845 y(through)e(previous)h(en)o(tries,)f(else)i(through)d(subsequen)o(t.)
+21 b(If)16 b Fj(string)j Fo(is)d(found,)f(then)h(the)f(curren)o(t)120
+908 y(history)20 b(index)i(is)e(set)g(to)g(that)f(en)o(try)l(,)i(and)f(the)g
+(return)h(v)m(alue)g(is)g(0.)34 b(Otherwise,)22 b(nothing)e(is)120
+970 y(c)o(hanged,)15 b(and)h(a)e(-1)h(is)h(returned.)1725 1159
+y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p 276 1159 V 20
+w(searc)n(h)p 452 1159 V 21 w(p)r(os)h Ff(\()p Fn(char)15 b(*string,)f(int)g
+(direction,)g(int)h(pos)p Ff(\))120 1221 y Fo(Searc)o(h)d(for)f
+Fj(string)k Fo(in)d(the)g(history)f(list,)i(starting)e(at)g
+Fj(p)q(os)p Fo(,)h(an)f(absolute)h(index)h(in)o(to)e(the)h(list.)19
+b(If)12 b Fj(di-)120 1283 y(rection)g Fo(is)h(negativ)o(e,)f(the)g(searc)o(h)
+g(pro)q(ceeds)h(bac)o(kw)o(ard)e(from)g Fj(p)q(os)p Fo(,)i(otherwise)f(forw)o
+(ard.)17 b(Returns)120 1345 y(the)e(absolute)h(index)g(of)f(the)g(history)h
+(elemen)o(t)f(where)h Fj(string)j Fo(w)o(as)14 b(found,)h(or)g(-1)g
+(otherwise.)0 1634 y Fi(2.3.6)30 b(Managing)14 b(the)i(History)f(File)62
+1780 y Fo(The)f(History)g(library)h(can)f(read)g(the)g(history)g(from)f(and)i
+(write)f(it)g(to)f(a)h(\014le.)20 b(This)15 b(section)g(do)q(cumen)o(ts)f
+(the)0 1842 y(functions)i(for)f(managing)g(a)f(history)i(\014le.)1725
+2031 y(F)l(unction)-1899 b Fh(int)20 b Fg(read)p 211 2031 V
+20 w(history)i Ff(\()p Fn(char)15 b(*filename)p Ff(\))120 2093
+y Fo(Add)i(the)f(con)o(ten)o(ts)g(of)g Fj(\014lename)k Fo(to)c(the)h(history)
+f(list,)h(a)f(line)i(at)e(a)g(time.)24 b(If)17 b Fj(\014lename)j
+Fo(is)d Fn(NULL)p Fo(,)120 2155 y(then)f(read)f(from)f(`)p
+Fn(~/.history)p Fo('.)k(Returns)e(0)e(if)i(successful,)g(or)f(errno)g(if)h
+(not.)1725 2344 y(F)l(unction)-1899 b Fh(int)20 b Fg(read)p
+211 2344 V 20 w(history)p 406 2344 V 20 w(range)i Ff(\()p Fn(char)15
+b(*filename,)e(int)i(from,)g(int)f(to)p Ff(\))120 2407 y Fo(Read)j(a)e(range)
+h(of)f(lines)j(from)d Fj(\014lename)p Fo(,)i(adding)f(them)g(to)f(the)h
+(history)g(list.)23 b(Start)15 b(reading)i(at)120 2469 y(line)f
+Fj(from)f Fo(and)g(end)g(at)f Fj(to)p Fo(.)19 b(If)d Fj(from)e
+Fo(is)h(zero,)f(start)g(at)g(the)h(b)q(eginning.)22 b(If)15
+b Fj(to)i Fo(is)e(less)g(than)g Fj(from)p Fo(,)120 2531 y(then)i(read)g(un)o
+(til)h(the)f(end)g(of)g(the)g(\014le.)25 b(If)17 b Fj(\014lename)k
+Fo(is)c Fn(NULL)p Fo(,)f(then)i(read)e(from)g(`)p Fn(~/.history)p
+Fo('.)120 2593 y(Returns)g(0)f(if)g(successful,)h(or)f Fn(errno)g
+Fo(if)g(not.)p eop
+%%Page: 10 12
+11 bop 0 -83 a Fo(10)1474 b(GNU)15 b(History)g(Library)1725
+158 y(F)l(unction)-1899 b Fh(int)20 b Fg(write)p 229 158 18
+3 v 22 w(history)i Ff(\()p Fn(char)15 b(*filename)p Ff(\))120
+221 y Fo(W)l(rite)20 b(the)g(curren)o(t)f(history)h(to)f Fj(\014lename)p
+Fo(,)i(o)o(v)o(erwriting)f Fj(\014lename)j Fo(if)d(necessary)l(.)34
+b(If)20 b Fj(\014lename)120 283 y Fo(is)d Fn(NULL)p Fo(,)g(then)g(write)g
+(the)g(history)g(list)h(to)e(`)p Fn(~/.history)p Fo('.)23 b(V)l(alues)18
+b(returned)g(are)e(as)h(in)h Fn(read_)120 345 y(history)c(\(\))p
+Fo(.)1725 504 y(F)l(unction)-1899 b Fh(int)20 b Fg(app)r(end)p
+285 504 V 19 w(history)j Ff(\()p Fn(int)14 b(nelements,)g(char)h(*filename)p
+Ff(\))120 566 y Fo(App)q(end)i(the)e(last)g Fj(nelemen)o(ts)j
+Fo(of)d(the)g(history)g(list)h(to)f Fj(\014lename)p Fo(.)1725
+724 y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p 276 724
+V 20 w(truncate)p 507 724 V 21 w(\014le)k Ff(\()p Fn(char)14
+b(*filename,)g(int)h(nlines)p Ff(\))120 787 y Fo(T)l(runcate)g(the)h(history)
+f(\014le)h Fj(\014lename)p Fo(,)g(lea)o(ving)g(only)g(the)f(last)g
+Fj(nlines)k Fo(lines.)0 988 y Fi(2.3.7)30 b(History)15 b(Expansion)62
+1125 y Fo(These)h(functions)g(implemen)o(t)g Fn(csh)p Fo(-lik)o(e)g(history)g
+(expansion.)1725 1283 y(F)l(unction)-1899 b Fh(int)20 b Fg(history)p
+276 1283 V 20 w(expand)j Ff(\()p Fn(char)14 b(*string,)g(char)h(**output)p
+Ff(\))120 1345 y Fo(Expand)20 b Fj(string)p Fo(,)f(placing)i(the)e(result)h
+(in)o(to)f Fj(output)p Fo(,)h(a)f(p)q(oin)o(ter)h(to)e(a)h(string)h(\(see)f
+(Section)h(1.1)120 1408 y([History)15 b(In)o(teraction],)f(page)h(1\).)20
+b(Returns:)120 1555 y Fn(0)216 b Fo(If)21 b(no)g(expansions)h(to)q(ok)e
+(place)h(\(or,)g(if)h(the)f(only)g(c)o(hange)g(in)h(the)f(text)f(w)o(as)g
+(the)360 1618 y(de-slashifying)d(of)e(the)g(history)h(expansion)g(c)o
+(haracter\);)120 1701 y Fn(1)216 b Fo(if)16 b(expansions)g(did)g(tak)o(e)e
+(place;)120 1785 y Fn(-1)192 b Fo(if)16 b(there)f(w)o(as)f(an)h(error)g(in)h
+(expansion;)120 1869 y Fn(2)216 b Fo(if)14 b(the)f(returned)h(line)h(should)f
+(only)g(b)q(e)f(displa)o(y)o(ed,)i(but)e(not)g(executed,)h(as)f(with)h(the)
+360 1931 y Fn(:p)h Fo(mo)q(di\014er)h(\(see)f(Section)h(1.1.3)e([Mo)q
+(di\014ers],)h(page)g(2\).)120 2079 y(If)g(an)h(error)e(o)q(curred)i(in)g
+(expansion,)f(then)h Fj(output)g Fo(con)o(tains)f(a)g(descriptiv)o(e)i(error)
+d(message.)1725 2238 y(F)l(unction)-1899 b Fh(char)20 b(*)f
+Fg(history)p 347 2238 V 21 w(arg)p 449 2238 V 19 w(extract)24
+b Ff(\()p Fn(int)14 b(first,)h(int)g(last,)f(char)h(*string)p
+Ff(\))120 2300 y Fo(Extract)10 b(a)h(string)g(segmen)o(t)g(consisting)h(of)f
+(the)g Fj(\014rst)h Fo(through)f Fj(last)h Fo(argumen)o(ts)e(presen)o(t)h(in)
+h Fj(string)p Fo(.)120 2362 y(Argumen)o(ts)j(are)g(brok)o(en)g(up)g(as)g(in)h
+(Bash.)1725 2521 y(F)l(unction)-1899 b Fh(char)20 b(*)f Fg(get)p
+249 2521 V 21 w(history)p 445 2521 V 20 w(ev)n(en)n(t)25 b
+Ff(\()p Fn(char)14 b(*string,)g(int)h(*cindex,)f(int)h(qchar)p
+Ff(\))120 2583 y Fo(Returns)e(the)f(text)f(of)h(the)g(history)g(ev)o(en)o(t)f
+(b)q(eginning)k(at)c Fj(string)16 b Fn(+)c Fj(*cindex)p Fo(.)20
+b Fj(*cindex)c Fo(is)d(mo)q(di\014ed)120 2645 y(to)h(p)q(oin)o(t)h(to)f
+(after)h(the)f(ev)o(en)o(t)h(sp)q(eci\014er.)21 b(A)o(t)15
+b(function)g(en)o(try)l(,)f Fj(cindex)20 b Fo(p)q(oin)o(ts)15
+b(to)f(the)h(index)h(in)o(to)p eop
+%%Page: 11 13
+12 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1017
+b(11)120 158 y Fj(string)17 b Fo(where)d(the)f(history)h(ev)o(en)o(t)f(sp)q
+(eci\014cation)i(b)q(egins.)20 b Fj(qc)o(har)d Fo(is)c(a)g(c)o(haracter)g
+(that)g(is)h(allo)o(w)o(ed)120 221 y(to)h(end)g(the)h(ev)o(en)o(t)f(sp)q
+(eci\014cation)i(in)f(addition)g(to)f(the)g(\\normal")g(terminating)g(c)o
+(haracters.)1725 394 y(F)l(unction)-1899 b Fh(char)20 b(**)f
+Fg(history)p 373 394 18 3 v 21 w(tok)n(enize)25 b Ff(\()p Fn(char)14
+b(*string)p Ff(\))120 456 y Fo(Return)k(an)f(arra)o(y)f(of)h(tok)o(ens)f
+(parsed)i(out)e(of)h Fj(string)p Fo(,)g(m)o(uc)o(h)h(as)e(the)i(shell)g(migh)
+o(t.)26 b(The)17 b(tok)o(ens)120 519 y(are)c(split)h(on)f(white)g(space)h
+(and)f(on)g(the)g(c)o(haracters)f Fn(\(\)<>;&|$)p Fo(,)g(and)h(shell)i
+(quoting)e(con)o(v)o(en)o(tions)120 581 y(are)i(ob)q(ey)o(ed.)0
+840 y Fm(2.4)33 b(History)15 b(V)-6 b(ariables)62 981 y Fo(This)16
+b(section)g(describ)q(es)h(the)e(externally)h(visible)i(v)m(ariables)e(exp)q
+(orted)g(b)o(y)f(the)g(GNU)g(History)g(Library)l(.)1736 1155
+y(V)l(ariable)-1899 b Fh(int)20 b Fg(history)p 276 1155 V 20
+w(base)120 1217 y Fo(The)15 b(logical)i(o\013set)d(of)h(the)g(\014rst)g(en)o
+(try)g(in)h(the)f(history)g(list.)1736 1390 y(V)l(ariable)-1899
+b Fh(int)20 b Fg(history)p 276 1390 V 20 w(length)120 1453
+y Fo(The)15 b(n)o(um)o(b)q(er)h(of)f(en)o(tries)g(curren)o(tly)h(stored)f(in)
+h(the)f(history)g(list.)1736 1626 y(V)l(ariable)-1899 b Fh(int)20
+b Fg(max)p 208 1626 V 19 w(input)p 360 1626 V 21 w(history)120
+1689 y Fo(The)12 b(maxim)o(um)g(n)o(um)o(b)q(er)g(of)f(history)h(en)o(tries.)
+19 b(This)12 b(m)o(ust)f(b)q(e)h(c)o(hanged)g(using)h Fn(stifle_history)120
+1751 y(\(\))p Fo(.)1736 1924 y(V)l(ariable)-1899 b Fh(char)20
+b Fg(history)p 302 1924 V 20 w(expansion)p 569 1924 V 21 w(c)n(har)120
+1987 y Fo(The)15 b(c)o(haracter)g(that)f(starts)g(a)h(history)g(ev)o(en)o(t.)
+20 b(The)15 b(default)h(is)g(`)p Fn(!)p Fo('.)1736 2160 y(V)l(ariable)-1899
+b Fh(char)20 b Fg(history)p 302 2160 V 20 w(subst)p 454 2160
+V 20 w(c)n(har)120 2222 y Fo(The)13 b(c)o(haracter)e(that)h(in)o(v)o(ok)o(es)
+g(w)o(ord)g(substitution)h(if)g(found)g(at)e(the)i(start)e(of)h(a)g(line.)21
+b(The)12 b(default)120 2285 y(is)k(`)p Fn(^)p Fo('.)1736 2458
+y(V)l(ariable)-1899 b Fh(char)20 b Fg(history)p 302 2458 V
+20 w(commen)n(t)p 552 2458 V 19 w(c)n(har)120 2521 y Fo(During)12
+b(tok)o(enization,)h(if)f(this)h(c)o(haracter)e(is)i(seen)f(as)g(the)g
+(\014rst)f(c)o(haracter)g(of)h(a)g(w)o(ord,)f(then)i(it)f(and)120
+2583 y(all)19 b(subsequen)o(t)g(c)o(haracters)e(up)h(to)g(a)f(newline)j(are)e
+(ignored,)h(suppressing)g(history)f(expansion)120 2645 y(for)d(the)g
+(remainder)h(of)f(the)g(line.)21 b(This)16 b(is)g(disabled)h(b)o(y)e
+(default.)p eop
+%%Page: 12 14
+13 bop 0 -83 a Fo(12)1474 b(GNU)15 b(History)g(Library)1736
+158 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(history)p 347
+158 18 3 v 21 w(no)p 429 158 V 20 w(expand)p 629 158 V 20 w(c)n(hars)120
+221 y Fo(The)f(list)g(of)g(c)o(haracters)e(whic)o(h)j(inhibit)h(history)d
+(expansion)i(if)f(found)g(immediately)h(follo)o(wing)120 283
+y Fj(history)p 261 283 14 2 v 16 w(expansion)p 472 283 V 18
+w(c)o(har)p Fo(.)g(The)d(default)f(is)h(whitespace)g(and)g(`)p
+Fn(=)p Fo('.)0 575 y Fm(2.5)33 b(History)15 b(Programming)h(Example)62
+720 y Fo(The)g(follo)o(wing)g(program)e(demonstrates)g(simple)j(use)e(of)g
+(the)g(GNU)g(History)g(Library)l(.)120 852 y Fn(main)23 b(\(\))120
+902 y({)168 951 y(char)g(line[1024],)f(*t;)168 1001 y(int)h(len,)g(done)h(=)g
+(0;)168 1101 y(line[0])f(=)g(0;)168 1201 y(using_history)f(\(\);)168
+1250 y(while)h(\(!done\))215 1300 y({)263 1350 y(printf)g(\("history$)g("\);)
+263 1400 y(fflush)g(\(stdout\);)263 1450 y(t)h(=)g(fgets)f(\(line,)g(sizeof)g
+(\(line\))g(-)h(1,)f(stdin\);)263 1499 y(if)h(\(t)f(&&)h(*t\))311
+1549 y({)359 1599 y(len)f(=)h(strlen)f(\(t\);)359 1649 y(if)g(\(t[len)g(-)h
+(1])g(==)f('\\n'\))406 1699 y(t[len)h(-)f(1])h(=)g('\\0';)311
+1748 y(})263 1848 y(if)g(\(!t\))311 1898 y(strcpy)f(\(line,)g("quit"\);)263
+1998 y(if)h(\(line[0]\))311 2047 y({)359 2097 y(char)f(*expansion;)359
+2147 y(int)g(result;)359 2247 y(result)g(=)g(history_expand)f(\(line,)h
+(&expansion\);)359 2296 y(if)g(\(result\))406 2346 y(fprintf)g(\(stderr,)g
+("\045s\\n",)g(expansion\);)359 2446 y(if)g(\(result)g(<)h(0)g(||)f(result)g
+(==)h(2\))406 2496 y({)454 2545 y(free)f(\(expansion\);)454
+2595 y(continue;)406 2645 y(})p eop
+%%Page: 13 15
+14 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(History)1017
+b(13)359 208 y Fn(add_history)22 b(\(expansion\);)359 258 y(strncpy)h
+(\(line,)g(expansion,)f(sizeof)h(\(line\))g(-)h(1\);)359 308
+y(free)f(\(expansion\);)311 358 y(})263 457 y(if)h(\(strcmp)f(\(line,)g
+("quit"\))g(==)g(0\))311 507 y(done)g(=)h(1;)263 557 y(else)f(if)h(\(strcmp)f
+(\(line,)g("save"\))g(==)h(0\))311 607 y(write_history)e(\("history_file"\);)
+263 656 y(else)h(if)h(\(strcmp)f(\(line,)g("read"\))g(==)h(0\))311
+706 y(read_history)e(\("history_file"\);)263 756 y(else)h(if)h(\(strcmp)f
+(\(line,)g("list"\))g(==)h(0\))311 806 y({)359 856 y(register)e(HIST_ENTRY)h
+(**the_list;)359 906 y(register)f(int)i(i;)359 1005 y(the_list)e(=)i
+(history_list)e(\(\);)359 1055 y(if)h(\(the_list\))406 1105
+y(for)h(\(i)f(=)h(0;)g(the_list[i];)e(i++\))454 1155 y(printf)h(\("\045d:)g
+(\045s\\n",)g(i)h(+)g(history_base,)e(the_list[i]->line\);)311
+1204 y(})263 1254 y(else)h(if)h(\(strncmp)f(\(line,)g("delete",)g(6\))g(==)h
+(0\))311 1304 y({)359 1354 y(int)f(which;)359 1404 y(if)g(\(\(sscanf)g
+(\(line)g(+)h(6,)f("\045d",)h(&which\)\))e(==)i(1\))406 1453
+y({)454 1503 y(HIST_ENTRY)f(*entry)g(=)g(remove_history)f(\(which\);)454
+1553 y(if)i(\(!entry\))502 1603 y(fprintf)f(\(stderr,)f("No)i(such)f(entry)g
+(\045d\\n",)g(which\);)454 1653 y(else)502 1703 y({)550 1752
+y(free)g(\(entry->line\);)550 1802 y(free)g(\(entry\);)502
+1852 y(})406 1902 y(})359 1952 y(else)406 2001 y({)454 2051
+y(fprintf)g(\(stderr,)g("non-numeric)f(arg)h(given)h(to)f(`delete'\\n"\);)406
+2101 y(})311 2151 y(})215 2201 y(})120 2250 y(})p eop
+%%Page: 14 16
+15 bop 0 -83 a Fo(14)1474 b(GNU)15 b(History)g(Library)p eop
+%%Page: 15 17
+16 bop 0 -83 a Fo(App)q(endix)17 b(A:)e(Concept)g(Index)1346
+b(15)0 158 y Fk(App)r(endix)13 b(A)41 b(Concept)15 b(Index)0
+405 y Fm(A)0 471 y Fe(anc)o(hored)f(searc)o(h)5 b Fd(:)i(:)f(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b Fe(8)0
+579 y Fm(E)0 646 y Fe(ev)o(en)o(t)13 b(designators)g Fd(:)6
+b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23
+b Fe(1)1015 405 y(expansion)5 b Fd(:)k(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b Fe(1)1015
+521 y Fm(H)1015 587 y Fe(history)d(ev)o(en)o(ts)5 b Fd(:)i(:)f(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b
+Fe(1)1015 646 y(History)c(Searc)o(hing)7 b Fd(:)h(:)e(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(8)p eop
+%%Page: 16 18
+17 bop 0 -83 a Fo(16)1474 b(GNU)15 b(History)g(Library)p eop
+%%Page: 17 19
+18 bop 0 -83 a Fo(App)q(endix)17 b(B:)e(F)l(unction)h(and)g(V)l(ariable)g
+(Index)1069 b(17)0 158 y Fk(App)r(endix)13 b(B)41 b(F)-7 b(unction)15
+b(and)g(V)-7 b(ariable)14 b(Index)0 405 y Fm(A)0 471 y Fc(add)p
+62 471 12 2 v 13 w(history)8 b Fd(:)s(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b Fe(7)0 529 y Fc(append)p
+122 529 V 12 w(history)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)24 b Fe(10)0 654 y Fm(C)0 720 y Fc(current)p
+142 720 V 11 w(history)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)24 b Fe(8)0 845 y Fm(G)0 911 y Fc(get)p 62 911
+V 13 w(history)p 215 911 V 11 w(event)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)23 b Fe(10)0 1036 y Fm(H)0 1102 y Fc(history)p
+142 1102 V 11 w(arg)p 213 1102 V 13 w(extract)8 b Fd(:)t(:)e(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)21 b Fe(10)0 1160 y Fc(history)p 142 1160
+V 11 w(base)e Fd(:)6 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)20 b Fe(11)0 1218 y Fc(history)p 142 1218 V 11 w(comment)p
+293 1218 V 12 w(char)g Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)21
+b Fe(11)0 1276 y Fc(history)p 142 1276 V 11 w(expand)10 b Fd(:)c(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)24 b Fe(10)0
+1335 y Fc(history)p 142 1335 V 11 w(expansion)p 333 1335 V
+11 w(char)17 b Fd(:)7 b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(11)0
+1393 y Fc(history)p 142 1393 V 11 w(get)8 b Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)h(:)
+f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20 b Fe(8)0
+1451 y Fc(history)p 142 1451 V 11 w(get)p 213 1451 V 13 w(history)p
+366 1451 V 12 w(state)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(6)0
+1509 y Fc(history)p 142 1509 V 11 w(is)p 193 1509 V 14 w(stifled)7
+b Fd(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23 b
+Fe(7)0 1567 y Fc(history)p 142 1567 V 11 w(length)16 b Fd(:)6
+b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18
+b Fe(11)0 1625 y Fc(history)p 142 1625 V 11 w(list)7 b Fd(:)t(:)g(:)f(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)19
+b Fe(7)0 1683 y Fc(history)p 142 1683 V 11 w(no)p 193 1683
+V 14 w(expand)p 327 1683 V 12 w(chars)f Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)20
+b Fe(12)0 1741 y Fc(history)p 142 1741 V 11 w(search)t Fd(:)t(:)6
+b(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17
+b Fe(9)0 1800 y Fc(history)p 142 1800 V 11 w(search)p 273 1800
+V 12 w(pos)9 b Fd(:)d(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23
+b Fe(9)0 1858 y Fc(history)p 142 1858 V 11 w(search)p 273 1858
+V 12 w(prefix)6 b Fd(:)t(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19
+b Fe(9)0 1916 y Fc(history)p 142 1916 V 11 w(set)p 213 1916
+V 13 w(history)p 366 1916 V 12 w(state)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17
+b Fe(6)0 1974 y Fc(history)p 142 1974 V 11 w(set)p 213 1974
+V 13 w(pos)5 b Fd(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)18 b Fe(8)0 2032 y Fc(history)p 142 2032 V 11 w(subst)p
+253 2032 V 13 w(char)k Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)24
+b Fe(11)1015 405 y Fc(history)p 1157 405 V 12 w(tokenize)9
+b Fd(:)s(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)22
+b Fe(11)1015 463 y Fc(history)p 1157 463 V 12 w(total)p 1269
+463 V 12 w(bytes)9 b Fd(:)t(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22
+b Fe(8)1015 521 y Fc(history)p 1157 521 V 12 w(truncate)p 1329
+521 V 11 w(file)5 b Fd(:)g(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)
+f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19
+b Fe(10)1015 629 y Fm(M)1015 695 y Fc(max)p 1077 695 V 13 w(input)p
+1190 695 V 13 w(history)14 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)17 b Fe(11)1015 803 y Fm(N)1015 870 y Fc(next)p 1097
+870 V 13 w(history)7 b Fd(:)s(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(8)1015 978 y Fm(P)1015 1044
+y Fc(previous)p 1177 1044 V 12 w(history)7 b Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)23 b Fe(8)1015 1152 y Fm(R)1015
+1218 y Fc(read)p 1097 1218 V 13 w(history)7 b Fd(:)s(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(9)1015
+1276 y Fc(read)p 1097 1276 V 13 w(history)p 1250 1276 V 11
+w(range)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23
+b Fe(9)1015 1335 y Fc(remove)p 1137 1335 V 12 w(history)t Fd(:)t(:)6
+b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)17
+b Fe(7)1015 1393 y Fc(replace)p 1157 1393 V 12 w(history)p
+1309 1393 V 11 w(entry)6 b Fd(:)f(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)19
+b Fe(7)1015 1501 y Fm(S)1015 1567 y Fc(stifle)p 1137 1567 V
+12 w(history)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)g(:)g(:)17 b Fe(7)1015 1675 y Fm(U)1015 1741 y Fc(unstifle)p
+1177 1741 V 12 w(history)7 b Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)23 b Fe(7)1015 1800 y Fc(using)p 1117 1800 V
+13 w(history)5 b Fd(:)s(:)h(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)18 b Fe(6)1015 1907 y Fm(W)1015 1974 y Fc(where)p
+1117 1974 V 13 w(history)5 b Fd(:)s(:)h(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)18 b Fe(8)1015 2032 y Fc(write)p
+1117 2032 V 13 w(history)5 b Fd(:)s(:)h(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)18 b Fe(9)p eop
+%%Page: 18 20
+19 bop 0 -83 a Fo(18)1474 b(GNU)15 b(History)g(Library)p eop
+%%Page: -1 21
+20 bop 1937 -83 a Fo(i)0 158 y Fk(T)-7 b(able)15 b(of)g(Con)n(ten)n(ts)0
+333 y Fm(1)67 b(Using)22 b(History)h(In)n(teractiv)n(ely)9
+b Fb(:)k(:)d(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)31 b Fm(1)149 411 y Fo(1.1)45
+b(History)15 b(In)o(teraction)9 b Fa(:)f(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)23
+b Fo(1)299 473 y(1.1.1)44 b(Ev)o(en)o(t)14 b(Designators)6
+b Fa(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)20 b Fo(1)299 535 y(1.1.2)44 b(W)l(ord)15 b(Designators)9
+b Fa(:)d(:)h(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)23 b Fo(2)299 597 y(1.1.3)44 b(Mo)q(di\014ers)14
+b Fa(:)8 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)
+g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)28 b Fo(2)0 722
+y Fm(2)67 b(Programming)23 b(with)g(GNU)f(History)13 b Fb(:)e(:)f(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)36 b
+Fm(5)149 800 y Fo(2.1)45 b(In)o(tro)q(duction)16 b(to)f(History)6
+b Fa(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)g(:)20 b Fo(5)149 862 y(2.2)45 b(History)15
+b(Storage)d Fa(:)7 b(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)27
+b Fo(5)149 924 y(2.3)45 b(History)15 b(F)l(unctions)c Fa(:)d(:)f(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)25 b Fo(6)299 986 y(2.3.1)44 b(Initializing)18
+b(History)d(and)h(State)e(Managemen)o(t)f Fa(:)7 b(:)g(:)g(:)h(:)f(:)g(:)g(:)
+g(:)h(:)f(:)g(:)g(:)g(:)h(:)27 b Fo(6)299 1049 y(2.3.2)44 b(History)15
+b(List)h(Managemen)o(t)c Fa(:)7 b(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)28 b Fo(7)299 1111 y(2.3.3)44 b(Information)15 b(Ab)q(out)g(the)h(History)
+f(List)5 b Fa(:)i(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)19 b Fo(7)299 1173 y(2.3.4)44 b(Mo)o(ving)15
+b(Around)g(the)g(History)g(List)6 b Fa(:)i(:)f(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)
+g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)20
+b Fo(8)299 1236 y(2.3.5)44 b(Searc)o(hing)16 b(the)f(History)g(List)7
+b Fa(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)21 b
+Fo(8)299 1298 y(2.3.6)44 b(Managing)15 b(the)g(History)g(File)5
+b Fa(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)19 b
+Fo(9)299 1360 y(2.3.7)44 b(History)15 b(Expansion)d Fa(:)7
+b(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)26
+b Fo(10)149 1422 y(2.4)45 b(History)15 b(V)l(ariables)5 b Fa(:)k(:)e(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)g(:)20 b Fo(11)149 1485 y(2.5)45 b(History)15
+b(Programming)f(Example)8 b Fa(:)g(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)
+g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)23 b Fo(12)0 1609 y Fm(App)r(endix)h(A)67 b(Concept)22
+b(Index)15 b Fb(:)c(:)f(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)37 b Fm(15)0 1749
+y(App)r(endix)24 b(B)67 b(F)-6 b(unction)25 b(and)e(V)-6 b(ariable)24
+b(Index)8 b Fb(:)j(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)31
+b Fm(17)p eop
+%%Page: -2 22
+21 bop 0 -83 a Fo(ii)1496 b(GNU)15 b(History)g(Library)p eop
+%%Trailer
+end
+userdict /end-hook known{end-hook}if
+%%EOF
diff --git a/doc/hstech.texinfo b/doc/hstech.texinfo
new file mode 100644
index 0000000..5f0f600
--- /dev/null
+++ b/doc/hstech.texinfo
@@ -0,0 +1,489 @@
+@ignore
+This file documents the user interface to the GNU History library.
+
+Copyright (C) 1988, 1991 Free Software Foundation, Inc.
+Authored by Brian Fox and Chet Ramey.
+
+Permission is granted to make and distribute verbatim copies of this manual
+provided the copyright notice and this permission notice are preserved on
+all copies.
+
+Permission is granted to process this file through Tex and print the
+results, provided the printed document carries copying permission notice
+identical to this one except for the removal of this paragraph (this
+paragraph not being relevant to the printed manual).
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided also that the
+GNU Copyright statement is available to the distributee, and provided that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions.
+@end ignore
+
+@node Programming with GNU History
+@chapter Programming with GNU History
+
+This chapter describes how to interface programs that you write
+with the GNU History Library.
+It should be considered a technical guide.
+For information on the interactive use of GNU History, @pxref{Using
+History Interactively}.
+
+@menu
+* Introduction to History::	What is the GNU History library for?
+* History Storage::		How information is stored.
+* History Functions::		Functions that you can use.
+* History Variables::		Variables that control behaviour.
+* History Programming Example::	Example of using the GNU History Library.
+@end menu
+
+@node Introduction to History
+@section Introduction to History
+
+Many programs read input from the user a line at a time.  The GNU History
+library is able to keep track of those lines, associate arbitrary data with
+each line, and utilize information from previous lines in composing new
+ones.
+
+The programmer using the History library has available functions
+for remembering lines on a history list, associating arbitrary data
+with a line, removing lines from the list, searching through the list
+for a line containing an arbitrary text string, and referencing any line
+in the list directly.  In addition, a history @dfn{expansion} function
+is available which provides for a consistent user interface across
+different programs.
+
+The user using programs written with the History library has the
+benefit of a consistent user interface with a set of well-known
+commands for manipulating the text of previous lines and using that text
+in new commands.  The basic history manipulation commands are similar to
+the history substitution provided by @code{csh}.
+
+If the programmer desires, he can use the Readline library, which
+includes some history manipulation by default, and has the added
+advantage of command line editing.
+
+@node History Storage
+@section History Storage
+
+The history list is an array of history entries.  A history entry is
+declared as follows:
+
+@example
+typedef struct _hist_entry @{
+  char *line;
+  char *data;
+@} HIST_ENTRY;
+@end example
+
+The history list itself might therefore be declared as
+
+@example
+HIST_ENTRY **the_history_list;
+@end example
+
+The state of the History library is encapsulated into a single structure:
+
+@example
+/* A structure used to pass the current state of the history stuff around. */
+typedef struct _hist_state @{
+  HIST_ENTRY **entries;         /* Pointer to the entries themselves. */
+  int offset;                   /* The location pointer within this array. */
+  int length;                   /* Number of elements within this array. */
+  int size;                     /* Number of slots allocated to this array. */
+  int flags;
+@} HISTORY_STATE;
+@end example
+
+If the flags member includes @code{HS_STIFLED}, the history has been
+stifled.
+
+@node History Functions
+@section History Functions
+
+This section describes the calling sequence for the various functions
+present in GNU History.
+
+@menu
+* Initializing History and State Management::	Functions to call when you
+						want to use history in a
+						program.
+* History List Management::		Functions used to manage the list
+					of history entries.
+* Information About the History List::	Functions returning information about
+					the history list.
+* Moving Around the History List::	Functions used to change the position
+					in the history list.
+* Searching the History List::		Functions to search the history list
+					for entries containing a string.
+* Managing the History File::		Functions that read and write a file
+					containing the history list.
+* History Expansion::			Functions to perform csh-like history
+					expansion.
+@end menu
+
+@node Initializing History and State Management
+@subsection Initializing History and State Management
+
+This section describes functions used to initialize and manage
+the state of the History library when you want to use the history
+functions in your program.
+
+@deftypefun void using_history ()
+Begin a session in which the history functions might be used.  This
+initializes the interactive variables.
+@end deftypefun
+
+@deftypefun {HISTORY_STATE *} history_get_history_state ()
+Return a structure describing the current state of the input history.
+@end deftypefun
+
+@deftypefun void history_set_history_state (HISTORY_STATE *state)
+Set the state of the history list according to @var{state}.
+@end deftypefun
+
+@node History List Management
+@subsection History List Management
+
+These functions manage individual entries on the history list, or set
+parameters managing the list itself.
+
+@deftypefun void add_history (char *string)
+Place @var{string} at the end of the history list.  The associated data
+field (if any) is set to @code{NULL}.
+@end deftypefun
+
+@deftypefun {HIST_ENTRY *} remove_history (int which)
+Remove history entry at offset @var{which} from the history.  The
+removed element is returned so you can free the line, data,
+and containing structure.
+@end deftypefun
+
+@deftypefun {HIST_ENTRY *} replace_history_entry (int which, char *line, char *data)
+Make the history entry at offset @var{which} have @var{line} and @var{data}.
+This returns the old entry so you can dispose of the data.  In the case
+of an invalid @var{which}, a @code{NULL} pointer is returned.
+@end deftypefun
+
+@deftypefun void stifle_history (int max)
+Stifle the history list, remembering only the last @var{max} entries.
+@end deftypefun
+
+@deftypefun int unstifle_history ()
+Stop stifling the history.  This returns the previous amount the
+history was stifled.  The value is positive if the history was
+stifled, negative if it wasn't.
+@end deftypefun
+
+@deftypefun int history_is_stifled ()
+Returns non-zero if the history is stifled, zero if it is not.
+@end deftypefun
+
+@node Information About the History List
+@subsection Information About the History List
+
+These functions return information about the entire history list or
+individual list entries.
+
+@deftypefun {HIST_ENTRY **} history_list ()
+Return a @code{NULL} terminated array of @code{HIST_ENTRY} which is the
+current input history.  Element 0 of this list is the beginning of time.
+If there is no history, return @code{NULL}.
+@end deftypefun
+
+@deftypefun int where_history ()
+Returns the offset of the current history element.
+@end deftypefun
+
+@deftypefun {HIST_ENTRY *} current_history ()
+Return the history entry at the current position, as determined by
+@code{where_history ()}.  If there is no entry there, return a @code{NULL}
+pointer.
+@end deftypefun
+
+@deftypefun {HIST_ENTRY *} history_get (int offset)
+Return the history entry at position @var{offset}, starting from
+@code{history_base}.  If there is no entry there, or if @var{offset}
+is greater than the history length, return a @code{NULL} pointer.
+@end deftypefun
+
+@deftypefun int history_total_bytes ()
+Return the number of bytes that the primary history entries are using.
+This function returns the sum of the lengths of all the lines in the
+history.
+@end deftypefun
+
+@node Moving Around the History List
+@subsection Moving Around the History List
+
+These functions allow the current index into the history list to be
+set or changed.
+
+@deftypefun int history_set_pos (int pos)
+Set the position in the history list to @var{pos}, an absolute index
+into the list.
+@end deftypefun
+
+@deftypefun {HIST_ENTRY *} previous_history ()
+Back up the current history offset to the previous history entry, and
+return a pointer to that entry.  If there is no previous entry, return
+a @code{NULL} pointer.
+@end deftypefun
+
+@deftypefun {HIST_ENTRY *} next_history ()
+Move the current history offset forward to the next history entry, and
+return the a pointer to that entry.  If there is no next entry, return
+a @code{NULL} pointer.
+@end deftypefun
+
+@node Searching the History List
+@subsection Searching the History List
+@cindex History Searching
+
+These functions allow searching of the history list for entries containing
+a specific string.  Searching may be performed both forward and backward
+from the current history position.  The search may be @dfn{anchored},
+meaning that the string must match at the beginning of the history entry.
+@cindex anchored search
+
+@deftypefun int history_search (char *string, int direction)
+Search the history for @var{string}, starting at the current history
+offset.  If @var{direction} < 0, then the search is through previous entries,
+else through subsequent.  If @var{string} is found, then
+the current history index is set to that history entry, and the value
+returned is the offset in the line of the entry where
+@var{string} was found.  Otherwise, nothing is changed, and a -1 is
+returned.
+@end deftypefun
+
+@deftypefun int history_search_prefix (char *string, int direction)
+Search the history for @var{string}, starting at the current history
+offset.  The search is anchored: matching lines must begin with
+@var{string}.  If @var{direction} < 0, then the search is through previous
+entries, else through subsequent.  If @var{string} is found, then the
+current history index is set to that entry, and the return value is 0. 
+Otherwise, nothing is changed, and a -1 is returned. 
+@end deftypefun
+
+@deftypefun int history_search_pos (char *string, int direction, int pos)
+Search for @var{string} in the history list, starting at @var{pos}, an
+absolute index into the list.  If @var{direction} is negative, the search
+proceeds backward from @var{pos}, otherwise forward.  Returns the absolute
+index of the history element where @var{string} was found, or -1 otherwise.
+@end deftypefun
+
+@node Managing the History File
+@subsection Managing the History File
+
+The History library can read the history from and write it to a file.
+This section documents the functions for managing a history file.
+
+@deftypefun int read_history (char *filename)
+Add the contents of @var{filename} to the history list, a line at a
+time.  If @var{filename} is @code{NULL}, then read from
+@file{~/.history}.  Returns 0 if successful, or errno if not.
+@end deftypefun
+
+@deftypefun int read_history_range (char *filename, int from, int to)
+Read a range of lines from @var{filename}, adding them to the history list.
+Start reading at line @var{from} and end at @var{to}.  If
+@var{from} is zero, start at the beginning.  If @var{to} is less than
+@var{from}, then read until the end of the file.  If @var{filename} is
+@code{NULL}, then read from @file{~/.history}.  Returns 0 if successful,
+or @code{errno} if not.
+@end deftypefun
+
+@deftypefun int write_history (char *filename)
+Write the current history to @var{filename}, overwriting @var{filename}
+if necessary.  If @var{filename} is
+@code{NULL}, then write the history list to @file{~/.history}.  Values
+returned are as in @code{read_history ()}.
+@end deftypefun
+
+@deftypefun int append_history (int nelements, char *filename)
+Append the last @var{nelements} of the history list to @var{filename}.
+@end deftypefun
+
+@deftypefun int history_truncate_file (char *filename, int nlines)
+Truncate the history file @var{filename}, leaving only the last
+@var{nlines} lines.
+@end deftypefun
+
+@node History Expansion
+@subsection History Expansion
+
+These functions implement @code{csh}-like history expansion.
+
+@deftypefun int history_expand (char *string, char **output)
+Expand @var{string}, placing the result into @var{output}, a pointer
+to a string (@pxref{History Interaction}).  Returns:
+@table @code
+@item 0
+If no expansions took place (or, if the only change in
+the text was the de-slashifying of the history expansion
+character);
+@item 1
+if expansions did take place;
+@item -1
+if there was an error in expansion;
+@item 2
+if the returned line should only be displayed, but not executed,
+as with the @code{:p} modifier (@pxref{Modifiers}).
+@end table
+
+If an error ocurred in expansion, then @var{output} contains a descriptive
+error message.
+@end deftypefun
+
+@deftypefun {char *} history_arg_extract (int first, int last, char *string)
+Extract a string segment consisting of the @var{first} through @var{last}
+arguments present in @var{string}.  Arguments are broken up as in Bash.
+@end deftypefun
+
+@deftypefun {char *} get_history_event (char *string, int *cindex, int qchar)
+Returns the text of the history event beginning at @var{string} +
+@var{*cindex}.  @var{*cindex} is modified to point to after the event
+specifier.  At function entry, @var{cindex} points to the index into
+@var{string} where the history event specification begins.  @var{qchar}
+is a character that is allowed to end the event specification in addition
+to the ``normal'' terminating characters.
+@end deftypefun
+
+@deftypefun {char **} history_tokenize (char *string)
+Return an array of tokens parsed out of @var{string}, much as the
+shell might.  The tokens are split on white space and on the
+characters @code{()<>;&|$}, and shell quoting conventions are
+obeyed.
+@end deftypefun
+
+@node History Variables
+@section History Variables
+
+This section describes the externally visible variables exported by
+the GNU History Library.
+
+@deftypevar int history_base
+The logical offset of the first entry in the history list.
+@end deftypevar
+
+@deftypevar int history_length
+The number of entries currently stored in the history list.
+@end deftypevar
+
+@deftypevar int max_input_history
+The maximum number of history entries.  This must be changed using
+@code{stifle_history ()}.
+@end deftypevar
+
+@deftypevar char history_expansion_char
+The character that starts a history event.  The default is @samp{!}.
+@end deftypevar
+
+@deftypevar char history_subst_char
+The character that invokes word substitution if found at the start of
+a line.  The default is @samp{^}.
+@end deftypevar
+
+@deftypevar char history_comment_char
+During tokenization, if this character is seen as the first character
+of a word, then it and all subsequent characters up to a newline are
+ignored, suppressing history expansion for the remainder of the line.
+This is disabled by default.
+@end deftypevar
+
+@deftypevar {char *} history_no_expand_chars
+The list of characters which inhibit history expansion if found immediately
+following @var{history_expansion_char}.  The default is whitespace and
+@samp{=}.
+@end deftypevar
+
+@node History Programming Example
+@section History Programming Example
+
+The following program demonstrates simple use of the GNU History Library.
+
+@smallexample
+main ()
+@{
+  char line[1024], *t;
+  int len, done = 0;
+
+  line[0] = 0;
+
+  using_history ();
+  while (!done)
+    @{
+      printf ("history$ ");
+      fflush (stdout);
+      t = fgets (line, sizeof (line) - 1, stdin);
+      if (t && *t)
+        @{
+          len = strlen (t);
+          if (t[len - 1] == '\n')
+            t[len - 1] = '\0';
+        @}
+
+      if (!t)
+        strcpy (line, "quit");
+
+      if (line[0])
+        @{
+          char *expansion;
+          int result;
+
+          result = history_expand (line, &expansion);
+          if (result)
+            fprintf (stderr, "%s\n", expansion);
+
+          if (result < 0 || result == 2)
+            @{
+              free (expansion);
+              continue;
+            @}
+
+          add_history (expansion);
+          strncpy (line, expansion, sizeof (line) - 1);
+          free (expansion);
+        @}
+
+      if (strcmp (line, "quit") == 0)
+        done = 1;
+      else if (strcmp (line, "save") == 0)
+        write_history ("history_file");
+      else if (strcmp (line, "read") == 0)
+        read_history ("history_file");
+      else if (strcmp (line, "list") == 0)
+        @{
+          register HIST_ENTRY **the_list;
+          register int i;
+
+          the_list = history_list ();
+          if (the_list)
+            for (i = 0; the_list[i]; i++)
+              printf ("%d: %s\n", i + history_base, the_list[i]->line);
+        @}
+      else if (strncmp (line, "delete", 6) == 0)
+        @{
+          int which;
+          if ((sscanf (line + 6, "%d", &which)) == 1)
+            @{
+              HIST_ENTRY *entry = remove_history (which);
+              if (!entry)
+                fprintf (stderr, "No such entry %d\n", which);
+              else
+                @{
+                  free (entry->line);
+                  free (entry);
+                @}
+            @}
+          else
+            @{
+              fprintf (stderr, "non-numeric arg given to `delete'\n");
+            @}
+        @}
+    @}
+@}
+@end smallexample
diff --git a/doc/hsuser.texinfo b/doc/hsuser.texinfo
new file mode 100644
index 0000000..51327a3
--- /dev/null
+++ b/doc/hsuser.texinfo
@@ -0,0 +1,198 @@
+@ignore
+This file documents the user interface to the GNU History library.
+
+Copyright (C) 1988, 1991 Free Software Foundation, Inc.
+Authored by Brian Fox and Chet Ramey.
+
+Permission is granted to make and distribute verbatim copies of this manual
+provided the copyright notice and this permission notice are preserved on
+all copies.
+
+Permission is granted to process this file through Tex and print the
+results, provided the printed document carries copying permission notice
+identical to this one except for the removal of this paragraph (this
+paragraph not being relevant to the printed manual).
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided also that the
+GNU Copyright statement is available to the distributee, and provided that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions.
+@end ignore
+
+@node Using History Interactively
+@chapter Using History Interactively
+
+@ifset BashFeatures
+This chapter describes how to use the GNU History Library interactively,
+from a user's standpoint.  It should be considered a user's guide.  For
+information on using the GNU History Library in your own programs,
+see the GNU Readline Library Manual.
+@end ifset
+@ifclear BashFeatures
+This chapter describes how to use the GNU History Library interactively,
+from a user's standpoint.  It should be considered a user's guide.  For
+information on using the GNU History Library in your own programs,
+@pxref{Programming with GNU History}.
+@end ifclear
+
+@menu
+* History Interaction::		What it feels like using History as a user.
+@end menu
+
+@node History Interaction
+@section History Interaction
+@cindex expansion
+
+The History library provides a history expansion feature that is similar
+to the history expansion provided by @code{csh}.  The following text
+describes the syntax used to manipulate the history information.
+
+History expansion takes place in two parts.  The first is to determine
+which line from the previous history should be used during substitution.
+The second is to select portions of that line for inclusion into the
+current one.  The line selected from the previous history is called the
+@dfn{event}, and the portions of that line that are acted upon are
+called @dfn{words}.  The line is broken into words in the same fashion
+that Bash does, so that several English (or Unix) words
+surrounded by quotes are considered as one word.
+
+@menu
+* Event Designators::	How to specify which history line to use.
+* Word Designators::	Specifying which words are of interest.
+* Modifiers::		Modifying the results of substitution.
+@end menu
+
+@node Event Designators
+@subsection Event Designators
+@cindex event designators
+
+An event designator is a reference to a command line entry in the
+history list.
+@cindex history events
+
+@table @asis
+
+@item @code{!}
+Start a history substitution, except when followed by a space, tab,
+the end of the line, @key{=} or @key{(}.
+
+@item @code{!!}
+Refer to the previous command.  This is a synonym for @code{!-1}.
+
+@item @code{!n}
+Refer to command line @var{n}.
+
+@item @code{!-n}
+Refer to the command @var{n} lines back.
+
+@item @code{!string}
+Refer to the most recent command starting with @var{string}.
+
+@item @code{!?string}[@code{?}]
+Refer to the most recent command containing @var{string}.
+
+@item @code{!#}
+The entire command line typed so far.
+
+@item @code{^string1^string2^}
+Quick Substitution.  Repeat the last command, replacing @var{string1}
+with @var{string2}.  Equivalent to
+@code{!!:s/string1/string2/}.
+
+@end table
+
+@node Word Designators
+@subsection Word Designators
+
+A @key{:} separates the event specification from the word designator.  It
+can be omitted if the word designator begins with a @key{^}, @key{$},
+@key{*} or @key{%}.  Words are numbered from the beginning of the line,
+with the first word being denoted by a 0 (zero).
+
+@table @code
+
+@item 0 (zero)
+The @code{0}th word.  For many applications, this is the command word.
+
+@item n
+The @var{n}th word.
+
+@item ^
+The first argument;  that is, word 1.
+
+@item $
+The last argument.
+
+@item %
+The word matched by the most recent @code{?string?} search.
+
+@item x-y
+A range of words; @code{-@var{y}} abbreviates @code{0-@var{y}}.
+
+@item *
+All of the words, except the @code{0}th.  This is a synonym for @code{1-$}.
+It is not an error to use @key{*} if there is just one word in the event;
+the empty string is returned in that case.
+
+@item x*
+Abbreviates @code{x-$}
+
+@item x-
+Abbreviates @code{x-$} like @code{x*}, but omits the last word.
+
+@end table
+
+@node Modifiers
+@subsection Modifiers
+
+After the optional word designator, you can add a sequence of one or more
+of the following modifiers, each preceded by a @key{:}.
+
+@table @code
+
+@item h
+Remove a trailing pathname component, leaving only the head.
+
+@item r
+Remove a trailing suffix of the form @samp{.}@var{suffix}, leaving the basename.
+
+@item e
+Remove all but the trailing suffix.
+
+@item t
+Remove all leading  pathname  components, leaving the tail.
+
+@item p
+Print the new command but do not execute it.
+
+@ifset BashFeatures
+@item q
+Quote the substituted words, escaping further substitutions.
+
+@item x
+Quote the substituted words as with @code{q},         
+but break into words at spaces, tabs, and newlines.
+@end ifset
+
+@item s/old/new/
+Substitute @var{new} for the first occurrence of @var{old} in the
+event line.  Any delimiter may be used in place of @key{/}.
+The delimiter may be quoted in @var{old} and @var{new}
+with a single backslash.  If @key{&} appears in @var{new},
+it is replaced by @var{old}.  A single backslash will quote
+the @key{&}.  The final delimiter is optional if it is the last
+character on the input line.
+
+@item &
+Repeat the previous substitution.
+
+@item g
+Cause changes to be applied over the entire event line.  Used in
+conjunction with @code{s}, as in @code{gs/old/new/}, or with
+@code{&}.
+
+@end table
diff --git a/doc/readline.3 b/doc/readline.3
new file mode 100644
index 0000000..e3da7cc
--- /dev/null
+++ b/doc/readline.3
@@ -0,0 +1,1210 @@
+.\"
+.\" MAN PAGE COMMENTS to
+.\"
+.\"	Chet Ramey
+.\"	Information Network Services
+.\"	Case Western Reserve University
+.\"	chet@ins.CWRU.Edu
+.\"
+.\"	Last Change: Mon Jun 13 20:06:14 EDT 1994
+.\"
+.TH READLINE 3 "1994 June 13" GNU
+.\"
+.\" File Name macro.  This used to be `.PN', for Path Name,
+.\" but Sun doesn't seem to like that very much.
+.\"
+.de FN
+\fI\|\\$1\|\fP
+..
+.SH NAME
+readline \- get a line from a user with editing
+.SH SYNOPSIS
+.LP
+.nf
+.ft B
+#include <readline.h>
+#include <history.h>
+.ft
+.fi
+.LP
+.nf
+.ft B
+typedef int Function ();
+.LP
+.nf
+.ft B
+char *readline (prompt)
+char *prompt;
+.ft
+.fi
+.LP
+.nf
+.ft B
+int rl_add_defun (name, function, key)
+char *name;
+Function *function;
+int key;
+.ft
+.fi
+.LP
+.nf
+.ft B
+int rl_bind_key (key, function)
+int key;
+Function *function;
+.ft
+.fi
+.LP
+.nf
+.ft B
+int rl_unbind_key (key)
+int key;
+.ft
+.fi
+.LP
+.nf
+.ft B
+int rl_bind_key_in_map (key, function, keymap)
+int key;
+Function *function;
+Keymap keymap;
+.ft
+.fi
+.LP
+.nf
+.ft B
+int rl_unbind_key_in_map (key, keymap)
+int key;
+Keymap keymap;
+.ft
+.fi
+.ft B
+int rl_macro_bind (keyseq, macro, keymap)
+char *keyseq, *macro;
+Keymap keymap;
+.ft
+.fi
+.LP
+.nf
+.ft B
+int rl_variable_bind (variable, value)
+char *variable, *value;
+.ft
+.fi
+.LP
+.nf
+.LP
+.nf
+.ft B
+int rl_parse_and_bind (line)
+char *line;
+.ft
+.fi
+.LP
+.nf
+.ft B
+int rl_translate_keyseq (keyseq, array, len)
+char *keyseq, *array;
+int *len;
+.ft
+.fi
+.LP
+.nf
+.ft B
+Function *rl_named_function (command)
+char *command;
+.ft
+.fi
+.LP
+.nf
+.ft B
+Function *rl_function_of_keyseq (keyseq, keymap, type)
+char *keyseq;
+Keymap keymap;
+int *type;
+.ft
+.fi
+.LP
+.nf
+.ft B
+char **rl_invoking_keyseqs (function)
+Function *function;
+.ft
+.fi
+.LP
+.nf
+.ft B
+char **rl_invoking_keyseqs_in_map (function, keymap)
+Function *function;
+Keymap keymap;
+.ft
+.fi
+.LP
+.nf
+.ft B
+void rl_function_dumper (readable)
+int readable;
+.ft
+.fi
+.LP
+.nf
+.ft B
+char **rl_funmap_names ()
+.ft
+.fi
+.SH COPYRIGHT
+.if n Readline is Copyright (C) 1989, 1991 by the Free Software Foundation, Inc.
+.if t Readline is Copyright \(co 1989, 1991 by the Free Software Foundation, Inc.
+.SH DESCRIPTION
+.LP
+.B readline
+will read a line from the terminal
+and return it, using
+.B prompt
+as a prompt.  If 
+.B prompt
+is null, no prompt is issued.  The line returned is allocated with
+.IR malloc (3),
+so the caller must free it when finished.  The line returned
+has the final newline removed, so only the text of the line
+remains.
+.LP
+.B readline
+offers editing capabilities while the user is entering the
+line.
+By default, the line editing commands
+are similar to those of emacs.
+A vi\-style line editing interface is also available.
+.LP
+In the following descriptions,
+.B keymap
+can be one of \fIemacs_keymap, emacs_meta_keymap, emacs_ctlx_keymap,
+vi_insertion_keymap, or vi_movement_keymap\fP.
+.LP
+.B rl_add_defun
+makes
+.B name
+appear as a bindable readline command, and makes
+.B function
+be the function called when that command is invoked.  If
+.B key
+is not \-1, it is bound to
+.B function
+in the current keymap.
+.LP
+.B rl_bind_key
+causes
+.B key
+to invoke
+.BR function .
+The binding is made in the current keymap.
+.LP
+.B rl_unbind_key
+removes the binding for
+.B key
+in the current keymap.
+.LP
+.B rl_bind_key_in_map
+makes the
+.B key
+entry in
+.B keymap
+invoke
+.BR function .
+.LP
+.B rl_unbind_key_in_map
+removes the binding for
+.B key
+in keymap
+.BR keymap .
+.LP
+.B rl_macro_bind
+makes
+.B keyseq
+insert the string
+.BR macro .
+The binding is performed in
+.BR keymap .
+.LP
+.B rl_variable_bind
+sets the value of the readline variable
+.B variable
+to
+.BR value .
+.LP
+.B rl_parse_and_bind
+takes as an argument a line of the same form as the readline startup
+file (see
+.SM
+.B INITIALIZATION FILE
+below) and executes the commands therein.
+.LP
+.B rl_translate_keyseq
+converts
+.B keyseq
+into a new string, storing the result in
+.BR array .
+This translates control and meta prefixes and the readline
+character escape sequences (see
+.SM
+.B Key Bindings
+below).  The length of the translated sequence is returned in
+.BR *len .
+.LP
+.B rl_named_function
+returns the function that is executed when the readline
+command
+.B command
+is invoked.
+.LP
+.B rl_function_of_keyseq
+returns the function that is executed when
+.B keyseq
+is read and
+.B keymap
+is the current keymap.
+.B type
+is set to indicate whether the return value corresponds to a
+function, macro, or auxiliary keymap.
+.LP
+.B rl_invoking_keyseqs
+returns all of the key sequences in the current keymap that
+invoke
+.BR function .
+.LP
+.B rl_invoking_keyseqs_in_map
+returns all of the key sequences in
+.B keymap
+that invoke
+.BR function .
+.LP
+.B rl_function_dumper
+prints all of the readline functions and their bindings to the
+readline output stream.  If
+.B readable
+is non\-zero, the output is formattted so that it can be read
+back in to restore the bindings.
+.LP
+.B rl_funmap_names
+returns an array of all known readline bindable function names.
+The array is sorted.
+.SH RETURN VALUE
+.LP
+.B readline
+returns the text of the line read.  A blank line
+returns the empty string.  If
+.B EOF
+is encountered while reading a line, and the line is empty,
+.B NULL
+is returned.  If an
+.B EOF
+is read with a non\-empty line, it is
+treated as a newline.
+.LP
+Unless otherwise stated,
+the other functions return 0 on success and non\-zero on failure.
+.SH NOTATION
+.LP
+An emacs\-style notation is used to denote
+keystrokes.  Control keys are denoted by C\-\fIkey\fR, e.g., C\-n
+means Control\-N.  Similarly, 
+.I meta
+keys are denoted by M\-\fIkey\fR, so M\-x means Meta\-X.  (On keyboards
+without a 
+.I meta
+key, M\-\fIx\fP means ESC \fIx\fP, i.e., press the Escape key
+then the
+.I x
+key.  This makes ESC the \fImeta prefix\fP.
+The combination M\-C\-\fIx\fP means ESC\-Control\-\fIx\fP,
+or press the Escape key
+then hold the Control key while pressing the
+.I x
+key.)
+.PP
+Readline commands may be given numeric
+.IR arguments ,
+which normally act as a repeat count.  Sometimes, however, it is the
+sign of the argument that is significant.  Passing a negative argument
+to a command that acts in the forward direction (e.g., \fBkill\-line\fP)
+causes that command to act in a backward direction.  Commands whose
+behavior with arguments deviates from this are noted.
+.PP
+When a command is described as \fIkilling\fP text, the text
+deleted is saved for possible future retrieval
+(\fIyanking\fP).  The killed text is saved in a
+\fIkill\-ring\fP.  Consecutive kills cause the text to be
+accumulated into one unit, which can be yanked all at once. 
+Commands which do not kill text separate the chunks of text
+on the kill\-ring.
+.SH INITIALIZATION FILE
+.LP
+Readline is customized by putting commands in an initialization
+file.  The name of this file is taken from the value of the
+.B INPUTRC
+variable.  If that variable is unset, the default is
+.IR ~/.inputrc .
+When a program which uses the readline library starts up, the
+init file is read, and the key bindings and variables are set.
+There are only a few basic constructs allowed in the
+readline init file.  Blank lines are ignored.
+Lines beginning with a \fB#\fP are comments.
+Lines beginning with a \fB$\fP indicate conditional
+constructs.  Other lines
+denote key bindings and variable settings.
+Each program using this library may add its own commands
+and bindings.
+.PP
+For example, placing
+.RS
+.PP
+M\-Control\-u: universal\-argument
+.RE
+or
+.RS
+C\-Meta\-u: universal\-argument
+.RE
+into the 
+.FN ~/.inputrc
+would make M\-C\-u execute the readline command
+.IR universal\-argument .
+.PP
+The following symbolic character names are recognized while
+processing key bindings:
+.IR RUBOUT ,
+.IR DEL ,
+.IR ESC ,
+.IR LFD ,
+.IR NEWLINE ,
+.IR RET ,
+.IR RETURN ,
+.IR SPC ,
+.IR SPACE ,
+and
+.IR TAB .
+In addition to command names, readline allows keys to be bound
+to a string that is inserted when the key is pressed (a \fImacro\fP).
+.PP
+.SS Key Bindings
+.PP
+The syntax for controlling key bindings in the
+.I ~/.inputrc
+file is simple.  All that is required is the name of the
+command or the text of a macro and a key sequence to which
+it should be bound. The name may be specified in one of two ways:
+as a symbolic key name, possibly with \fIMeta\-\fP or \fIControl\-\fP
+prefixes, or as a key sequence.
+When using the form \fBkeyname\fP:\fIfunction-name\fP or \fImacro\fP,
+.I keyname
+is the name of a key spelled out in English.  For example:
+.sp
+.RS
+Control\-u: universal\-argument
+.br
+Meta\-Rubout: backward\-kill\-word
+.br
+Control\-o: ">&output"
+.RE
+.LP
+In the above example,
+.I C\-u
+is bound to the function
+.BR universal\-argument ,
+.I M-DEL
+is bound to the function
+.BR backward\-kill\-word ,
+and
+.I C\-o
+is bound to run the macro
+expressed on the right hand side (that is, to insert the text
+.I >&output
+into the line).
+.PP
+In the second form, \fB"keyseq"\fP:\fIfunction\-name\fP or \fImacro\fP,
+.B keyseq
+differs from
+.B keyname
+above in that strings denoting
+an entire key sequence may be specified by placing the sequence
+within double quotes.  Some GNU Emacs style key escapes can be
+used, as in the following example.
+.sp
+.RS
+"\eC\-u": universal\-argument
+.br
+"\eC\-x\eC\-r": re\-read\-init\-file
+.br
+"\ee[11~": "Function Key 1"
+.RE
+.PP
+In this example,
+.I C-u
+is again bound to the function
+.BR universal\-argument .
+.I "C-x C-r"
+is bound to the function
+.BR re\-read\-init\-file ,
+and 
+.I "ESC [ 1 1 ~"
+is bound to insert the text
+.BR "Function Key 1" .
+The full set of escape sequences is
+.RS
+.TP
+.B \eC-
+control prefix
+.TP
+.B \eM-
+meta prefix
+.TP
+.B \ee
+an escape character
+.TP
+.B \e\e
+backslash
+.TP
+.B \e"
+literal "
+.TP
+.B \e'
+literal '
+.RE
+.PP
+When entering the text of a macro, single or double quotes should
+be used to indicate a macro definition.  Unquoted text
+is assumed to be a function name.  Backslash
+will quote any character in the macro text, including " and '.
+.PP
+.B Bash
+allows the current readline key bindings to be displayed or modified
+with the
+.B bind
+builtin command.  The editing mode may be switched during interactive
+use by using the
+.B \-o
+option to the
+.B set
+builtin command.  Other programs using this library provide
+similar mechanisms.  The
+.I inputrc
+file may be edited and re\-read if a program does not provide
+any other means to incorporate new bindings.
+.SS Variables
+.PP
+Readline has variables that can be used to further customize its
+behavior.  A variable may be set in the
+.I inputrc
+file with a statement of the form
+.RS
+.PP
+\fBset\fP \fIvariable\-name\fP \fIvalue\fP
+.RE
+.PP
+Except where noted, readline variables can take the values
+.B On
+or
+.BR Off .
+The variables and their default values are:
+.PP
+.PD 0
+.TP
+.B horizontal\-scroll\-mode (Off)
+When set to \fBOn\fP, makes readline use a single line for display,
+scrolling the input horizontally on a single screen line when it
+becomes longer than the screen width rather than wrapping to a new line.
+.TP
+.B editing\-mode (emacs)
+Controls whether readline begins with a set of key bindings similar
+to \fIemacs\fP or \fIvi\fP.
+.B editing\-mode
+can be set to either
+.B emacs
+or
+.BR vi .
+.TP
+.B mark\-modified\-lines (Off)
+If set to \fBOn\fP, history lines that have been modified are displayed
+with a preceding asterisk (\fB*\fP).
+.TP
+.B bell\-style (audible)
+Controls what happens when readline wants to ring the terminal bell.
+If set to \fBnone\fP, readline never rings the bell.  If set to
+\fBvisible\fP, readline uses a visible bell if one is available.
+If set to \fBaudible\fP, readline attempts to ring the terminal's bell.
+.TP
+.B comment\-begin (``#'')
+The string that is inserted in \fBvi\fP mode when the
+.B vi\-comment
+command is executed.
+.TP
+.B meta\-flag (Off)
+If set to \fBOn\fP, readline will enable eight-bit input (that is,
+it will not strip the high bit from the characters it reads),
+regardless of what the terminal claims it can support.
+.TP
+.B convert\-meta (On)
+If set to \fBOn\fP, readline will convert characters with the
+eighth bit set to an ASCII key sequence
+by stripping the eighth bit and prepending an
+escape character (in effect, using escape as the \fImeta prefix\fP).
+.TP
+.B output\-meta (Off)
+If set to \fBOn\fP, readline will display characters with the
+eighth bit set directly rather than as a meta-prefixed escape
+sequence.
+.TP
+.B completion\-query\-items (100)
+This determines when the user is queried about viewing
+the number of possible completions
+generated by the \fBpossible\-completions\fP command.
+It may be set to any integer value greater than or equal to
+zero.  If the number of possible completions is greater than
+or equal to the value of this variable, the user is asked whether
+or not he wishes to view them; otherwise they are simply listed
+on the terminal.
+.TP
+.B keymap (emacs)
+Set the current readline keymap.  The set of legal keymap names is
+\fIemacs, emacs-standard, emacs-meta, emacs-ctlx, vi, vi-move,
+vi-command\fP, and
+.IR vi-insert .
+\fIvi\fP is equivalent to \fIvi-command\fP; \fIemacs\fP is
+equivalent to \fIemacs-standard\fP.  The default value is
+.IR emacs ;
+the value of
+.B editing\-mode
+also affects the default keymap.
+.TP
+.B show\-all\-if\-ambiguous (Off)
+This alters the default behavior of the completion functions.  If
+set to
+.BR on ,
+words which have more than one possible completion cause the
+matches to be listed immediately instead of ringing the bell.
+.TP
+.B expand\-tilde (Off)
+If set to \fBon\fP, tilde expansion is performed when readline
+attempts word completion.
+.PD
+.SS Conditional Constructs
+.PP
+Readline implements a facility similar in spirit to the conditional
+compilation features of the C preprocessor which allows key
+bindings and variable settings to be performed as the result
+of tests.  There are three parser directives used.
+.IP \fB$if\fP
+The 
+.B $if
+construct allows bindings to be made based on the
+editing mode, the terminal being used, or the application using
+readline.  The text of the test extends to the end of the line;
+no characters are required to isolate it.
+.RS
+.IP \fBmode\fP
+The \fBmode=\fP form of the \fB$if\fP directive is used to test
+whether readline is in emacs or vi mode.
+This may be used in conjunction
+with the \fBset keymap\fP command, for instance, to set bindings in
+the \fIemacs-standard\fP and \fIemacs-ctlx\fP keymaps only if
+readline is starting out in emacs mode.
+.IP \fBterm\fP
+The \fBterm=\fP form may be used to include terminal-specific
+key bindings, perhaps to bind the key sequences output by the
+terminal's function keys.  The word on the right side of the
+.B =
+is tested against the full name of the terminal and the portion
+of the terminal name before the first \fB\-\fP.  This allows
+.I sun
+to match both
+.I sun
+and
+.IR sun\-cmd ,
+for instance.
+.IP \fBapplication\fP
+The \fBapplication\fP construct is used to include
+application\-specific settings.  Each program using the readline
+library sets the \fIapplication name\fP, and an initialization
+file can test for a particular value.
+This could be used to bind key sequences to functions useful for
+a specific program.  For instance, the following command adds a
+key sequence that quotes the current or previous word in Bash:
+.RS
+.nf
+\fB$if\fP bash
+# Quote the current or previous word
+"\eC-xq": "\eeb\e"\eef\e""
+\fB$endif\fP
+.fi
+.RE
+.RE
+.IP \fB$endif\fP
+This command, as you saw in the previous example, terminates an
+\fB$if\fP command.
+.IP \fB$else\fP
+Commands in this branch of the \fB$if\fP directive are executed if
+the test fails.
+.SH EDITING COMMANDS
+.PP
+The following is a list of the names of the commands and the default
+key sequences to which they are bound.
+.SS Commands for Moving
+.PP
+.PD 0
+.TP
+.B beginning\-of\-line (C\-a)
+Move to the start of the current line.
+.TP
+.B end\-of\-line (C\-e)
+Move to the end of the line.
+.TP
+.B forward\-char (C\-f)
+Move forward a character.
+.TP
+.B backward\-char (C\-b)
+Move back a character.
+.TP
+.B forward\-word (M\-f)
+Move forward to the end of the next word.  Words are composed of
+alphanumeric characters (letters and digits).
+.TP
+.B backward\-word (M\-b)
+Move back to the start of this, or the previous, word.  Words are
+composed of alphanumeric characters (letters and digits).
+.TP
+.B clear\-screen (C\-l)
+Clear the screen leaving the current line at the top of the screen.
+With an argument, refresh the current line without clearing the
+screen.
+.TP
+.B redraw\-current\-line
+Refresh the current line.  By default, this is unbound.
+.PD
+.SS Commands for Manipulating the History
+.PP
+.PD 0
+.TP
+.B accept\-line (Newline, Return)
+Accept the line regardless of where the cursor is.  If this line is
+non\-empty, add it to the history list. If the line is a modified
+history line, then restore the history line to its original state.
+.TP
+.B previous\-history (C\-p)
+Fetch the previous command from the history list, moving back in
+the list.
+.TP
+.B next\-history (C\-n)
+Fetch the next command from the history list, moving forward in the
+list.
+.TP
+.B beginning\-of\-history (M\-<)
+Move to the first line in the history.
+.TP
+.B end\-of\-history (M\->)
+Move to the end of the input history, i.e., the line currently being
+entered.
+.TP
+.B reverse\-search\-history (C\-r)
+Search backward starting at the current line and moving `up' through
+the history as necessary.  This is an incremental search.
+.TP
+.B forward\-search\-history (C\-s)
+Search forward starting at the current line and moving `down' through
+the history as necessary.  This is an incremental search.
+.TP
+.B non\-incremental\-reverse\-search\-history (M\-p)
+Search backward through the history starting at the current line
+using a non\-incremental search for a string supplied by the user.
+.TP
+.B non\-incremental\-forward\-search\-history (M\-n)
+Search forward through the history using a non\-incremental search
+for a string supplied by the user.
+.TP
+.B history\-search\-forward
+Search forward through the history for the string of characters
+between the start of the current line and the current point.  This
+is a non-incremental search.  By default, this command is unbound.
+.TP
+.B history\-search\-backward
+Search backward through the history for the string of characters
+between the start of the current line and the current point.  This
+is a non-incremental search.  By default, this command is unbound.
+.TP
+.B yank\-nth\-arg (M\-C\-y)
+Insert the first argument to the previous command (usually
+the second word on the previous line) at point (the current
+cursor position).  With an argument
+.IR n ,
+insert the \fIn\fPth word from the previous command (the words
+in the previous command begin with word 0).  A negative argument
+inserts the \fIn\fPth word from the end of the previous command.
+.PD
+.SS Commands for Changing Text
+.PP
+.PD 0
+.TP
+.B delete\-char (C\-d)
+Delete the character under the cursor.  If point is at the
+beginning of the line, there are no characters in the line, and
+the last character typed was not
+.BR C\-d ,
+then return
+.SM
+.BR EOF .
+.TP
+.B backward\-delete\-char (Rubout)
+Delete the character behind the cursor.  When given a numeric argument,
+save the deleted text on the kill\-ring.
+.TP
+.B quoted\-insert (C\-q, C\-v)
+Add the next character that you type to the line verbatim.  This is
+how to insert characters like \fBC\-q\fP, for example.
+.TP
+.B tab\-insert (M-TAB)
+Insert a tab character.
+.TP
+.B self\-insert (a,\ b,\ A,\ 1,\ !,\ ...)
+Insert the character typed.
+.TP
+.B transpose\-chars (C\-t)
+Drag the character before point forward over the character at point.
+Point moves forward as well.  If point is at the end of the line, then
+transpose the two characters before point.  Negative arguments don't work.
+.TP
+.B transpose\-words (M\-t)
+Drag the word behind the cursor past the word in front of the cursor
+moving the cursor over that word as well.
+.TP
+.B upcase\-word (M\-u)
+Uppercase the current (or following) word.  With a negative argument,
+do the previous word, but do not move point.
+.TP
+.B downcase\-word (M\-l)
+Lowercase the current (or following) word.  With a negative argument,
+do the previous word, but do not move point.
+.TP
+.B capitalize\-word (M\-c)
+Capitalize the current (or following) word.  With a negative argument,
+do the previous word, but do not move point.
+.PD
+.SS Killing and Yanking
+.PP
+.PD 0
+.TP
+.B kill\-line (C\-k)
+Kill the text from the current cursor position to the end of the line.
+.TP
+.B backward\-kill\-line (C\-x Rubout)
+Kill backward to the beginning of the line.
+.TP
+.B unix\-line\-discard (C\-u)
+Kill backward from point to the beginning of the line.
+.\" There is no real difference between this and backward-kill-line
+.TP
+.B kill\-whole\-line
+Kill all characters on the current line, no matter where the
+cursor is.  By default, this is unbound.
+.TP
+.B kill\-word  (M\-d)
+Kill from the cursor to the end of the current word, or if between
+words, to the end of the next word.  Word boundaries are the same as
+those used by \fBforward\-word\fP.
+.TP
+.B backward\-kill\-word (M\-Rubout)
+Kill the word behind the cursor.  Word boundaries are the same as
+those used by \fBbackward\-word\fP.
+.TP
+.B unix\-word\-rubout (C\-w)
+Kill the word behind the cursor, using white space as a word boundary.
+The word boundaries are different from
+.BR backward\-kill\-word .
+.TP
+.B delete\-horizontal\-space
+Delete all spaces and tabs around point.  By default, this is unbound.
+.TP
+.B yank (C\-y)
+Yank the top of the kill ring into the buffer at the cursor.
+.TP
+.B yank\-pop (M\-y)
+Rotate the kill\-ring, and yank the new top.  Only works following
+.B yank
+or
+.BR yank\-pop .
+.PD
+.SS Numeric Arguments
+.PP
+.PD 0
+.TP
+.B digit\-argument (M\-0, M\-1, ..., M\-\-)
+Add this digit to the argument already accumulating, or start a new
+argument.  M\-\- starts a negative argument.
+.TP
+.B universal\-argument
+Each time this is executed, the argument count is multiplied by four.
+The argument count is initially one, so executing this function the
+first time makes the argument count four.  By default, this is not
+bound to a key.
+.PD
+.SS Completing
+.PP
+.PD 0
+.TP
+.B complete (TAB)
+Attempt to perform completion on the text before point.
+The actual completion performed is application-specific.
+.BR Bash ,
+for instance, attempts completion treating the text as a variable
+(if the text begins with \fB$\fP), username (if the text begins with
+\fB~\fP), hostname (if the text begins with \fB@\fP), or
+command (including aliases and functions) in turn.  If none
+of these produces a match, filename completion is attempted.
+.BR Gdb ,
+on the other hand,
+allows completion of program functions and variables, and
+only attempts filename completion under certain circumstances.
+.TP
+.B possible\-completions (M-?)
+List the possible completions of the text before point.
+.TP
+.B insert\-completions
+Insert all completions of the text before point
+that would have been generated by
+\fBpossible\-completions\fP.  By default, this
+is not bound to a key.
+.PD
+.SS Keyboard Macros
+.PP
+.PD 0
+.TP
+.B start\-kbd\-macro (C-x (\^)
+Begin saving the characters typed into the current keyboard macro.
+.TP
+.B end\-kbd\-macro (C-x )\^)
+Stop saving the characters typed into the current keyboard macro
+and save the definition.
+.TP
+.B call\-last\-kbd\-macro (C-x e)
+Re-execute the last keyboard macro defined, by making the characters
+in the macro appear as if typed at the keyboard.
+.PD
+.SS Miscellaneous
+.PP
+.PD 0
+.TP
+.B re-read-init-file (C\-x C\-r)
+Read in the contents of your init file, and incorporate
+any bindings or variable assignments found there.
+.TP
+.B abort (C\-g)
+Abort the current editing command and
+ring the terminal's bell (subject to the setting of
+.BR bell\-style ).
+.TP
+.B do\-uppercase\-version (M\-a, M\-b, ...)
+Run the command that is bound to the corresponding uppercase
+character.
+.TP
+.B prefix\-meta (ESC)
+Metafy the next character typed.
+.SM
+.B ESC
+.B f
+is equivalent to
+.BR Meta\-f .
+.TP
+.B undo (C\-_, C\-x C\-u)
+Incremental undo, separately remembered for each line.
+.TP
+.B revert\-line (M\-r)
+Undo all changes made to this line.  This is like typing the
+.B undo
+command enough times to return the line to its initial state.
+.TP
+.B tilde\-expand (M\-~)
+Perform tilde expansion on the current word.
+.TP
+.B dump\-functions
+Print all of the functions and their key bindings to the
+readline output stream.  If a numeric argument is supplied,
+the output is formatted in such a way that it can be made part
+of an \fIinputrc\fP file.
+.TP
+.B emacs\-editing\-mode (C\-e)
+When in
+.B vi
+editing mode, this causes a switch to
+.B emacs
+editing mode.
+.TP
+.B vi\-editing\-mode (M\-C\-j)
+When in
+.B emacs
+editing mode, this causes a switch to
+.B vi
+editing mode.
+.PD
+.SH DEFAULT KEY BINDINGS
+.LP
+The following is a list of the default emacs and vi bindings.
+Characters with the 8th bit set are written as M-<character>, and
+are referred to as
+.I metafied
+characters.
+The printable ASCII characters not mentioned in the list of emacs
+standard bindings are bound to the
+.I self\-insert
+function, which just inserts the given character into the input line.
+In vi insertion mode, all characters not specifically mentioned are
+bound to
+.IR self\-insert .
+Characters assigned to signal generation by
+.IR stty (1)
+or the terminal driver, such as C-Z or C-C,
+retain that function.
+Upper and lower case
+.I metafied
+characters are bound to the same function in the emacs mode
+meta keymap.
+The remaining characters are unbound, which causes readline
+to ring the bell (subject to the setting of the
+.B bell\-style
+variable).
+.SS Emacs Mode
+.RS +.6i
+.nf
+.ta 2.5i
+.sp
+Emacs Standard bindings
+.sp
+"C-A"	->  beginning-of-line
+"C-B"	->  backward-char
+"C-D"	->  delete-char
+"C-E"	->  end-of-line
+"C-F"	->  forward-char
+"C-G"	->  abort
+"C-H"	->  backward-delete-char
+"C-I"	->  complete
+"C-J"	->  accept-line
+"C-K"	->  kill-line
+"C-L"	->  clear-screen
+"C-M"	->  accept-line
+"C-N"	->  next-history
+"C-P"	->  previous-history
+"C-Q"	->  quoted-insert
+"C-R"	->  reverse-search-history
+"C-S"	->  forward-search-history
+"C-T"	->  transpose-chars
+"C-U"	->  unix-line-discard
+"C-V"	->  quoted-insert
+"C-W"	->  unix-word-rubout
+"C-Y"	->  yank
+"C-_"	->  undo
+"\^ " to "/"	->  self-insert
+"0"  to "9"	->  self-insert
+":"  to "~"	->  self-insert
+"C-?"	->  backward-delete-char
+.PP
+Emacs Meta bindings
+.sp
+"M-C-H"	->  backward-kill-word
+"M-C-I"	->  tab-insert
+"M-C-J"	->  vi-editing-mode
+"M-C-M"	->  vi-editing-mode
+"M-C-R"	->  revert-line
+"M-C-Y"	->  yank-nth-arg
+"M-C-["	->  complete
+"M-&"	->  tilde-expand
+"M--"	->  digit-argument
+"M-0"	->  digit-argument
+"M-1"	->  digit-argument
+"M-2"	->  digit-argument
+"M-3"	->  digit-argument
+"M-4"	->  digit-argument
+"M-5"	->  digit-argument
+"M-6"	->  digit-argument
+"M-7"	->  digit-argument
+"M-8"	->  digit-argument
+"M-9"	->  digit-argument
+"M-<"	->  beginning-of-history
+"M->"	->  end-of-history
+"M-?"	->  possible-completions
+"M-B"	->  backward-word
+"M-C"	->  capitalize-word
+"M-D"	->  kill-word
+"M-F"	->  forward-word
+"M-L"	->  downcase-word
+"M-N"	->  non-incremental-forward-search-history
+"M-O"	->  arrow-key-prefix
+"M-P"	->  non-incremental-reverse-search-history
+"M-R"	->  revert-line
+"M-T"	->  transpose-words
+"M-U"	->  upcase-word
+"M-Y"	->  yank-pop
+"M-C-Y"	->  yank-nth-arg
+"M-C-?"	->  backward-delete-word
+.PP
+Emacs Control-X bindings
+.sp
+"C-XC-G"	->  abort
+"C-XC-R"	->  re-read-init-file
+"C-XC-U"	->  undo
+"C-X("	->  start-kbd-macro
+"C-X)"	->  end-kbd-macro
+"C-Xe"	->  call-last-kbd-macro
+"C-XC-?"	->  backward-kill-line
+.sp
+.RE
+.SS VI Mode bindings
+.RS +.6i
+.nf
+.ta 2.5i
+.sp
+.PP
+VI Insert Mode functions
+.sp
+"C-D"	->  vi-eof-maybe
+"C-H"	->  backward-delete-char
+"C-I"	->  complete
+"C-J"	->  accept-line
+"C-K"	->  kill-line
+"C-L"	->  clear-screen
+"C-M"	->  accept-line
+"C-N"	->  next-history
+"C-P"	->  previous-history
+"C-Q"	->  quoted-insert
+"C-R"	->  reverse-search-history
+"C-S"	->  forward-search-history
+"C-T"	->  transpose-chars
+"C-U"	->  unix-line-discard
+"C-V"	->  quoted-insert
+"C-W"	->  unix-word-rubout
+"C-Y"	->  yank
+"C-["	->  vi-movement-mode
+"\^ " to "~"	->  self-insert
+"C-?"	->  backward-delete-char
+.PP
+VI Command Mode functions
+.sp
+"C-D"	->  vi-eof-maybe
+"C-E"	->  emacs-editing-mode
+"C-G"	->  abort
+"C-H"	->  backward-char
+"C-J"	->  accept-line
+"C-K"	->  kill-line
+"C-L"	->  clear-screen
+"C-M"	->  accept-line
+"C-N"	->  next-history
+"C-P"	->  previous-history
+"C-Q"	->  quoted-insert
+"C-R"	->  reverse-search-history
+"C-S"	->  forward-search-history
+"C-T"	->  transpose-chars
+"C-U"	->  unix-line-discard
+"C-V"	->  quoted-insert
+"C-W"	->  unix-word-rubout
+"C-Y"	->  yank
+"C-["	->  abort
+"\^ "	->  forward-char
+"#"	->  vi-comment
+"$"	->  end-of-line
+"%"	->  vi-match
+"&"	->  vi-tilde-expand
+"*"	->  vi-complete
+"+"	->  down-history
+","	->  vi-char-search
+"-"	->  previous-history
+"."	->  vi-redo
+"/"	->  vi-search
+"0"	->  beginning-of-line
+"1" to "9"	->  vi-arg-digit
+";"	->  vi-char-search
+"="	->  vi-complete
+"?"	->  vi-search
+"@"	->  is undefined
+"A"	->  vi-append-eol
+"B"	->  vi-prev-word
+"C"	->  vi-change-to
+"D"	->  vi-delete-to
+"E"	->  vi-end-word
+"F"	->  vi-char-search
+"I"	->  vi-insert-beg
+"N"	->  vi-search-again
+"P"	->  vi-put
+"R"	->  vi-replace
+"S"	->  vi-subst
+"T"	->  vi-char-search
+"U"	->  revert-line
+"W"	->  vi-next-word
+"X"	->  backward-delete-char
+"Y"	->  vi-yank-to
+"\e"	->  vi-complete
+"^"	->  vi-first-print
+"_"	->  vi-yank-arg
+"a"	->  vi-append-mode
+"b"	->  vi-prev-word
+"c"	->  vi-change-to
+"d"	->  vi-delete-to
+"e"	->  vi-end-word
+"f"	->  vi-char-search
+"h"	->  backward-char
+"i"	->  vi-insertion-mode
+"j"	->  next-history
+"k"	->  prev-history
+"l"	->  forward-char
+"n"	->  vi-search-again
+"r"	->  vi-change-char
+"s"	->  vi-subst
+"t"	->  vi-char-search
+"u"	->  undo
+"w"	->  vi-next-word
+"x"	->  vi-delete
+"y"	->  vi-yank-to
+"|"	->  vi-column
+"~"	->  vi-change-case
+.RE
+.SH "SEE ALSO"
+.PD 0
+.TP
+\fIThe Gnu Readline Library\fP, Brian Fox
+.TP
+\fIThe Gnu History Library\fP, Brian Fox
+.TP
+\fIbash\fP(1)
+.PD
+.SH FILES
+.PD 0
+.TP
+.FN ~/.inputrc
+Individual \fBreadline\fP initialization file
+.PD
+.SH AUTHORS
+.RS
+Brian Fox, Free Software Foundation (primary author)
+.br
+bfox@ai.MIT.Edu
+.PP
+Chet Ramey, Case Western Reserve University
+.br
+chet@ins.CWRU.Edu
+.SH BUG REPORTS
+If you find a bug in
+.B readline,
+you should report it.  But first, you should
+make sure that it really is a bug, and that it appears in the latest
+version of the
+.B readline
+library that you have.
+.PP
+Once you have determined that a bug actually exists, mail a
+bug report to \fIbash\-maintainers\fP@\fIprep.ai.MIT.Edu\fP.
+If you have a fix, you are welcome to mail that
+as well!  Suggestions and `philosophical' bug reports may be mailed
+to \fPbug-bash\fP@\fIprep.ai.MIT.Edu\fP or posted to the Usenet
+newsgroup
+.BR gnu.bash.bug .
+.PP
+Comments and bug reports concerning
+this manual page should be directed to
+.IR chet@ins.CWRU.Edu .
+.SH BUGS
+.PP
+It's too big and too slow.
diff --git a/doc/readline.dvi b/doc/readline.dvi
new file mode 100644
index 0000000..a967128
--- /dev/null
+++ b/doc/readline.dvi
diff --git a/doc/readline.info b/doc/readline.info
new file mode 100644
index 0000000..f4882e9
--- /dev/null
+++ b/doc/readline.info
@@ -0,0 +1,74 @@
+This is Info file readline.info, produced by Makeinfo-1.55 from the
+input file rlman.texinfo.
+
+   This document describes the GNU Readline Library, a utility which
+aids in the consistency of user interface across discrete programs that
+need to provide a command line interface.
+
+   Copyright (C) 1988, 1991 Free Software Foundation, Inc.
+
+   Permission is granted to make and distribute verbatim copies of this
+manual provided the copyright notice and this permission notice pare
+preserved on all copies.
+
+   Permission is granted to copy and distribute modified versions of
+this manual under the conditions for verbatim copying, provided that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+   Permission is granted to copy and distribute translations of this
+manual into another language, under the above conditions for modified
+versions, except that this permission notice may be stated in a
+translation approved by the Foundation.
+
+
+Indirect:
+readline.info-1: 1000
+readline.info-2: 50467
+
+Tag Table:
+(Indirect)
+Node: Top1000
+Node: Command Line Editing1613
+Node: Introduction and Notation2264
+Node: Readline Interaction3284
+Node: Readline Bare Essentials4423
+Node: Readline Movement Commands5953
+Node: Readline Killing Commands6844
+Node: Readline Arguments8547
+Node: Readline Init File9498
+Node: Readline Init Syntax10502
+Node: Conditional Init Constructs17435
+Node: Bindable Readline Commands19681
+Node: Commands For Moving20351
+Node: Commands For History21199
+Node: Commands For Text23783
+Node: Commands For Killing25522
+Node: Numeric Arguments26971
+Node: Commands For Completion27598
+Node: Keyboard Macros28525
+Node: Miscellaneous Commands29084
+Node: Readline vi Mode30372
+Node: Programming with GNU Readline32122
+Node: Basic Behavior32919
+Node: Custom Functions36232
+Node: The Function Type36845
+Node: Function Writing37690
+Node: Readline Convenience Functions40453
+Node: Function Naming41118
+Node: Keymaps42345
+Node: Binding Keys43856
+Node: Associating Function Names and Bindings45650
+Node: Allowing Undoing46812
+Node: Redisplay49397
+Node: Modifying Text50467
+Node: Utility Functions51378
+Node: Custom Completers54444
+Node: How Completing Works55165
+Node: Completion Functions58156
+Node: Completion Variables61171
+Node: A Short Completion Example64996
+Node: Concept Index77230
+Node: Function and Variable Index77717
+
+End Tag Table
diff --git a/doc/readline.info-1 b/doc/readline.info-1
new file mode 100644
index 0000000..78bbd05
--- /dev/null
+++ b/doc/readline.info-1
@@ -0,0 +1,1322 @@
+This is Info file readline.info, produced by Makeinfo-1.55 from the
+input file rlman.texinfo.
+
+   This document describes the GNU Readline Library, a utility which
+aids in the consistency of user interface across discrete programs that
+need to provide a command line interface.
+
+   Copyright (C) 1988, 1991 Free Software Foundation, Inc.
+
+   Permission is granted to make and distribute verbatim copies of this
+manual provided the copyright notice and this permission notice pare
+preserved on all copies.
+
+   Permission is granted to copy and distribute modified versions of
+this manual under the conditions for verbatim copying, provided that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+   Permission is granted to copy and distribute translations of this
+manual into another language, under the above conditions for modified
+versions, except that this permission notice may be stated in a
+translation approved by the Foundation.
+
+
+File: readline.info,  Node: Top,  Next: Command Line Editing,  Prev: (DIR),  Up: (DIR)
+
+GNU Readline Library
+********************
+
+   This document describes the GNU Readline Library, a utility which
+aids in the consistency of user interface across discrete programs that
+need to provide a command line interface.
+
+* Menu:
+
+* Command Line Editing::	   GNU Readline User's Manual.
+* Programming with GNU Readline::  GNU Readline Programmer's Manual.
+* Concept Index::		   Index of concepts described in this manual.
+* Function and Variable Index::	   Index of externally visible functions
+				   and variables.
+
+
+File: readline.info,  Node: Command Line Editing,  Next: Programming with GNU Readline,  Prev: Top,  Up: Top
+
+Command Line Editing
+********************
+
+   This chapter describes the basic features of the GNU command line
+editing interface.
+
+* Menu:
+
+* Introduction and Notation::	Notation used in this text.
+* Readline Interaction::	The minimum set of commands for editing a line.
+* Readline Init File::		Customizing Readline from a user's view.
+* Bindable Readline Commands::	A description of most of the Readline commands
+				available for binding
+* Readline vi Mode::		A short description of how to make Readline
+				behave like the vi editor.
+
+
+File: readline.info,  Node: Introduction and Notation,  Next: Readline Interaction,  Up: Command Line Editing
+
+Introduction to Line Editing
+============================
+
+   The following paragraphs describe the notation used to represent
+keystrokes.
+
+   The text C-k is read as `Control-K' and describes the character
+produced when the Control key is depressed and the k key is struck.
+
+   The text M-k is read as `Meta-K' and describes the character
+produced when the meta key (if you have one) is depressed, and the k
+key is struck.  If you do not have a meta key, the identical keystroke
+can be generated by typing ESC first, and then typing k.  Either
+process is known as "metafying" the k key.
+
+   The text M-C-k is read as `Meta-Control-k' and describes the
+character produced by "metafying" C-k.
+
+   In addition, several keys have their own names.  Specifically, DEL,
+ESC, LFD, SPC, RET, and TAB all stand for themselves when seen in this
+text, or in an init file (*note Readline Init File::., for more info).
+
+
+File: readline.info,  Node: Readline Interaction,  Next: Readline Init File,  Prev: Introduction and Notation,  Up: Command Line Editing
+
+Readline Interaction
+====================
+
+   Often during an interactive session you type in a long line of text,
+only to notice that the first word on the line is misspelled.  The
+Readline library gives you a set of commands for manipulating the text
+as you type it in, allowing you to just fix your typo, and not forcing
+you to retype the majority of the line.  Using these editing commands,
+you move the cursor to the place that needs correction, and delete or
+insert the text of the corrections.  Then, when you are satisfied with
+the line, you simply press RETURN.  You do not have to be at the end of
+the line to press RETURN; the entire line is accepted regardless of the
+location of the cursor within the line.
+
+* Menu:
+
+* Readline Bare Essentials::	The least you need to know about Readline.
+* Readline Movement Commands::	Moving about the input line.
+* Readline Killing Commands::	How to delete text, and how to get it back!
+* Readline Arguments::		Giving numeric arguments to commands.
+
+
+File: readline.info,  Node: Readline Bare Essentials,  Next: Readline Movement Commands,  Up: Readline Interaction
+
+Readline Bare Essentials
+------------------------
+
+   In order to enter characters into the line, simply type them.  The
+typed character appears where the cursor was, and then the cursor moves
+one space to the right.  If you mistype a character, you can use your
+erase character to back up and delete the mistyped character.
+
+   Sometimes you may miss typing a character that you wanted to type,
+and not notice your error until you have typed several other
+characters.  In that case, you can type C-b to move the cursor to the
+left, and then correct your mistake.  Afterwards, you can move the
+cursor to the right with C-f.
+
+   When you add text in the middle of a line, you will notice that
+characters to the right of the cursor are `pushed over' to make room
+for the text that you have inserted.  Likewise, when you delete text
+behind the cursor, characters to the right of the cursor are `pulled
+back' to fill in the blank space created by the removal of the text.  A
+list of the basic bare essentials for editing the text of an input line
+follows.
+
+C-b
+     Move back one character.
+
+C-f
+     Move forward one character.
+
+DEL
+     Delete the character to the left of the cursor.
+
+C-d
+     Delete the character underneath the cursor.
+
+Printing characters
+     Insert the character into the line at the cursor.
+
+C-_
+     Undo the last thing that you did.  You can undo all the way back
+     to an empty line.
+
+
+File: readline.info,  Node: Readline Movement Commands,  Next: Readline Killing Commands,  Prev: Readline Bare Essentials,  Up: Readline Interaction
+
+Readline Movement Commands
+--------------------------
+
+   The above table describes the most basic possible keystrokes that
+you need in order to do editing of the input line.  For your
+convenience, many other commands have been added in addition to C-b,
+C-f, C-d, and DEL.  Here are some commands for moving more rapidly
+about the line.
+
+C-a
+     Move to the start of the line.
+
+C-e
+     Move to the end of the line.
+
+M-f
+     Move forward a word.
+
+M-b
+     Move backward a word.
+
+C-l
+     Clear the screen, reprinting the current line at the top.
+
+   Notice how C-f moves forward a character, while M-f moves forward a
+word.  It is a loose convention that control keystrokes operate on
+characters while meta keystrokes operate on words.
+
+
+File: readline.info,  Node: Readline Killing Commands,  Next: Readline Arguments,  Prev: Readline Movement Commands,  Up: Readline Interaction
+
+Readline Killing Commands
+-------------------------
+
+   "Killing" text means to delete the text from the line, but to save
+it away for later use, usually by "yanking" (re-inserting) it back into
+the line.  If the description for a command says that it `kills' text,
+then you can be sure that you can get the text back in a different (or
+the same) place later.
+
+   When you use a kill command, the text is saved in a "kill-ring".
+Any number of consecutive kills save all of the killed text together, so
+that when you yank it back, you get it all.  The kill ring is not line
+specific; the text that you killed on a previously typed line is
+available to be yanked back later, when you are typing another line.
+
+   Here is the list of commands for killing text.
+
+C-k
+     Kill the text from the current cursor position to the end of the
+     line.
+
+M-d
+     Kill from the cursor to the end of the current word, or if between
+     words, to the end of the next word.
+
+M-DEL
+     Kill from the cursor the start of the previous word, or if between
+     words, to the start of the previous word.
+
+C-w
+     Kill from the cursor to the previous whitespace.  This is
+     different than M-DEL because the word boundaries differ.
+
+   And, here is how to "yank" the text back into the line.  Yanking
+means to copy the most-recently-killed text from the kill buffer.
+
+C-y
+     Yank the most recently killed text back into the buffer at the
+     cursor.
+
+M-y
+     Rotate the kill-ring, and yank the new top.  You can only do this
+     if the prior command is C-y or M-y.
+
+
+File: readline.info,  Node: Readline Arguments,  Prev: Readline Killing Commands,  Up: Readline Interaction
+
+Readline Arguments
+------------------
+
+   You can pass numeric arguments to Readline commands.  Sometimes the
+argument acts as a repeat count, other times it is the sign of the
+argument that is significant.  If you pass a negative argument to a
+command which normally acts in a forward direction, that command will
+act in a backward direction.  For example, to kill text back to the
+start of the line, you might type M- C-k.
+
+   The general way to pass numeric arguments to a command is to type
+meta digits before the command.  If the first `digit' you type is a
+minus sign (-), then the sign of the argument will be negative.  Once
+you have typed one meta digit to get the argument started, you can type
+the remainder of the digits, and then the command.  For example, to give
+the C-d command an argument of 10, you could type M-1 0 C-d.
+
+
+File: readline.info,  Node: Readline Init File,  Next: Bindable Readline Commands,  Prev: Readline Interaction,  Up: Command Line Editing
+
+Readline Init File
+==================
+
+   Although the Readline library comes with a set of Emacs-like
+keybindings installed by default, it is possible that you would like to
+use a different set of keybindings.  You can customize programs that
+use Readline by putting commands in an "init" file in your home
+directory.  The name of this file is taken from the value of the
+environment variable `INPUTRC'.  If that variable is unset, the default
+is `~/.inputrc'.
+
+   When a program which uses the Readline library starts up, the init
+file is read, and the key bindings are set.
+
+   In addition, the `C-x C-r' command re-reads this init file, thus
+incorporating any changes that you might have made to it.
+
+* Menu:
+
+* Readline Init Syntax::	Syntax for the commands in the inputrc file.
+* Conditional Init Constructs::	Conditional key bindings in the inputrc file.
+
+
+File: readline.info,  Node: Readline Init Syntax,  Next: Conditional Init Constructs,  Up: Readline Init File
+
+Readline Init Syntax
+--------------------
+
+   There are only a few basic constructs allowed in the Readline init
+file.  Blank lines are ignored.  Lines beginning with a # are comments.
+Lines beginning with a $ indicate conditional constructs (*note
+Conditional Init Constructs::.).  Other lines denote variable settings
+and key bindings.
+
+Variable Settings
+     You can change the state of a few variables in Readline by using
+     the `set' command within the init file.  Here is how you would
+     specify that you wish to use `vi' line editing commands:
+
+          set editing-mode vi
+
+     Right now, there are only a few variables which can be set; so
+     few, in fact, that we just list them here:
+
+    `editing-mode'
+          The `editing-mode' variable controls which editing mode you
+          are using.  By default, Readline starts up in Emacs editing
+          mode, where the keystrokes are most similar to Emacs.  This
+          variable can be set to either `emacs' or `vi'.
+
+    `horizontal-scroll-mode'
+          This variable can be set to either `On' or `Off'.  Setting it
+          to `On' means that the text of the lines that you edit will
+          scroll horizontally on a single screen line when they are
+          longer than the width of the screen, instead of wrapping onto
+          a new screen line.  By default, this variable is set to `Off'.
+
+    `mark-modified-lines'
+          This variable, when set to `On', says to display an asterisk
+          (`*') at the start of history lines which have been modified.
+          This variable is `off' by default.
+
+    `bell-style'
+          Controls what happens when Readline wants to ring the
+          terminal bell.  If set to `none', Readline never rings the
+          bell.  If set to `visible', Readline uses a visible bell if
+          one is available.  If set to `audible' (the default),
+          Readline attempts to ring the terminal's bell.
+
+    `comment-begin'
+          The string to insert at the beginning of the line when the
+          `vi-comment' command is executed.  The default value is `"#"'.
+
+    `meta-flag'
+          If set to `on', Readline will enable eight-bit input (it will
+          not strip the eighth bit from the characters it reads),
+          regardless of what the terminal claims it can support.  The
+          default value is `off'.
+
+    `convert-meta'
+          If set to `on', Readline will convert characters with the
+          eigth bit set to an ASCII key sequence by stripping the eigth
+          bit and prepending an ESC character, converting them to a
+          meta-prefixed key sequence.  The default value is `on'.
+
+    `output-meta'
+          If set to `on', Readline will display characters with the
+          eighth bit set directly rather than as a meta-prefixed escape
+          sequence.  The default is `off'.
+
+    `completion-query-items'
+          The number of possible completions that determines when the
+          user is asked whether he wants to see the list of
+          possibilities.  If the number of possible completions is
+          greater than this value, Readline will ask the user whether
+          or not he wishes to view them; otherwise, they are simply
+          listed.  The default limit is `100'.
+
+    `keymap'
+          Sets Readline's idea of the current keymap for key binding
+          commands.  Acceptable `keymap' names are `emacs',
+          `emacs-standard', `emacs-meta', `emacs-ctlx', `vi', `vi-move',
+          `vi-command', and `vi-insert'.  `vi' is equivalent to
+          `vi-command'; `emacs' is equivalent to `emacs-standard'.  The
+          default value is `emacs'.  The value of the `editing-mode'
+          variable also affects the default keymap.
+
+    `show-all-if-ambiguous'
+          This alters the default behavior of the completion functions.
+          If set to `on', words which have more than one possible
+          completion cause the matches to be listed immediately instead
+          of ringing the bell.  The default value is `off'.
+
+    `expand-tilde'
+          If set to `on', tilde expansion is performed when Readline
+          attempts word completion.  The default is `off'.
+
+Key Bindings
+     The syntax for controlling key bindings in the init file is
+     simple.  First you have to know the name of the command that you
+     want to change.  The following pages contain tables of the command
+     name, the default keybinding, and a short description of what the
+     command does.
+
+     Once you know the name of the command, simply place the name of
+     the key you wish to bind the command to, a colon, and then the
+     name of the command on a line in the init file.  The name of the
+     key can be expressed in different ways, depending on which is most
+     comfortable for you.
+
+    KEYNAME: FUNCTION-NAME or MACRO
+          KEYNAME is the name of a key spelled out in English.  For
+          example:
+               Control-u: universal-argument
+               Meta-Rubout: backward-kill-word
+               Control-o: ">&output"
+
+          In the above example, `C-u' is bound to the function
+          `universal-argument', and `C-o' is bound to run the macro
+          expressed on the right hand side (that is, to insert the text
+          `>&output' into the line).
+
+    "KEYSEQ": FUNCTION-NAME or MACRO
+          KEYSEQ differs from KEYNAME above in that strings denoting an
+          entire key sequence can be specified, by placing the key
+          sequence in double quotes.  Some GNU Emacs style key escapes
+          can be used, as in the following example, but the special
+          character names are not recognized.
+
+               "\C-u": universal-argument
+               "\C-x\C-r": re-read-init-file
+               "\e[11~": "Function Key 1"
+
+          In the above example, `C-u' is bound to the function
+          `universal-argument' (just as it was in the first example),
+          `C-x C-r' is bound to the function `re-read-init-file', and
+          `ESC [ 1 1 ~' is bound to insert the text `Function Key 1'.
+          The following escape sequences are available when specifying
+          key sequences:
+
+         ``\C-''
+               control prefix
+
+         ``\M-''
+               meta prefix
+
+         ``\e''
+               an escape character
+
+         ``\\''
+               backslash
+
+         ``\"''
+               "
+
+         ``\'''
+               '
+
+          When entering the text of a macro, single or double quotes
+          should be used to indicate a macro definition.  Unquoted text
+          is assumed to be a function name.  Backslash will quote any
+          character in the macro text, including " and '.  For example,
+          the following binding will make `C-x \' insert a single \
+          into the line:
+               "\C-x\\": "\\"
+
+
+File: readline.info,  Node: Conditional Init Constructs,  Prev: Readline Init Syntax,  Up: Readline Init File
+
+Conditional Init Constructs
+---------------------------
+
+   Readline implements a facility similar in spirit to the conditional
+compilation features of the C preprocessor which allows key bindings
+and variable settings to be performed as the result of tests.  There
+are three parser directives used.
+
+`$if'
+     The `$if' construct allows bindings to be made based on the
+     editing mode, the terminal being used, or the application using
+     Readline.  The text of the test extends to the end of the line; no
+     characters are required to isolate it.
+
+    `mode'
+          The `mode=' form of the `$if' directive is used to test
+          whether Readline is in `emacs' or `vi' mode.  This may be
+          used in conjunction with the `set keymap' command, for
+          instance, to set bindings in the `emacs-standard' and
+          `emacs-ctlx' keymaps only if Readline is starting out in
+          `emacs' mode.
+
+    `term'
+          The `term=' form may be used to include terminal-specific key
+          bindings, perhaps to bind the key sequences output by the
+          terminal's function keys.  The word on the right side of the
+          `=' is tested against the full name of the terminal and the
+          portion of the terminal name before the first `-'.  This
+          allows SUN to match both SUN and SUN-CMD, for instance.
+
+    `application'
+          The APPLICATION construct is used to include
+          application-specific settings.  Each program using the
+          Readline library sets the APPLICATION NAME, and you can test
+          for it.  This could be used to bind key sequences to
+          functions useful for a specific program.  For instance, the
+          following command adds a key sequence that quotes the current
+          or previous word in Bash:
+               $if bash
+               # Quote the current or previous word
+               "\C-xq": "\eb\"\ef\""
+               $endif
+
+`$endif'
+     This command, as you saw in the previous example, terminates an
+     `$if' command.
+
+`$else'
+     Commands in this branch of the `$if' directive are executed if the
+     test fails.
+
+
+File: readline.info,  Node: Bindable Readline Commands,  Next: Readline vi Mode,  Prev: Readline Init File,  Up: Command Line Editing
+
+Bindable Readline Commands
+==========================
+
+* Menu:
+
+* Commands For Moving::		Moving about the line.
+* Commands For History::	Getting at previous lines.
+* Commands For Text::		Commands for changing text.
+* Commands For Killing::	Commands for killing and yanking.
+* Numeric Arguments::		Specifying numeric arguments, repeat counts.
+* Commands For Completion::	Getting Readline to do the typing for you.
+* Keyboard Macros::		Saving and re-executing typed characters
+* Miscellaneous Commands::	Other miscellaneous commands.
+
+
+File: readline.info,  Node: Commands For Moving,  Next: Commands For History,  Up: Bindable Readline Commands
+
+Commands For Moving
+-------------------
+
+`beginning-of-line (C-a)'
+     Move to the start of the current line.
+
+`end-of-line (C-e)'
+     Move to the end of the line.
+
+`forward-char (C-f)'
+     Move forward a character.
+
+`backward-char (C-b)'
+     Move back a character.
+
+`forward-word (M-f)'
+     Move forward to the end of the next word.  Words are composed of
+     letters and digits.
+
+`backward-word (M-b)'
+     Move back to the start of this, or the previous, word.  Words are
+     composed of letters and digits.
+
+`clear-screen (C-l)'
+     Clear the screen and redraw the current line, leaving the current
+     line at the top of the screen.
+
+`redraw-current-line ()'
+     Refresh the current line.  By default, this is unbound.
+
+
+File: readline.info,  Node: Commands For History,  Next: Commands For Text,  Prev: Commands For Moving,  Up: Bindable Readline Commands
+
+Commands For Manipulating The History
+-------------------------------------
+
+`accept-line (Newline, Return)'
+     Accept the line regardless of where the cursor is.  If this line is
+     non-empty, add it to the history list.  If this line was a history
+     line, then restore the history line to its original state.
+
+`previous-history (C-p)'
+     Move `up' through the history list.
+
+`next-history (C-n)'
+     Move `down' through the history list.
+
+`beginning-of-history (M-<)'
+     Move to the first line in the history.
+
+`end-of-history (M->)'
+     Move to the end of the input history, i.e., the line you are
+     entering.
+
+`reverse-search-history (C-r)'
+     Search backward starting at the current line and moving `up'
+     through the history as necessary.  This is an incremental search.
+
+`forward-search-history (C-s)'
+     Search forward starting at the current line and moving `down'
+     through the the history as necessary.  This is an incremental
+     search.
+
+`non-incremental-reverse-search-history (M-p)'
+     Search backward starting at the current line and moving `up'
+     through the history as necessary using a non-incremental search
+     for a string supplied by the user.
+
+`non-incremental-forward-search-history (M-n)'
+     Search forward starting at the current line and moving `down'
+     through the the history as necessary using a non-incremental search
+     for a string supplied by the user.
+
+`history-search-forward ()'
+     Search forward through the history for the string of characters
+     between the start of the current line and the current point.  This
+     is a non-incremental search.  By default, this command is unbound.
+
+`history-search-backward ()'
+     Search backward through the history for the string of characters
+     between the start of the current line and the current point.  This
+     is a non-incremental search.  By default, this command is unbound.
+
+`yank-nth-arg (M-C-y)'
+     Insert the first argument to the previous command (usually the
+     second word on the previous line).  With an argument N, insert the
+     Nth word from the previous command (the words in the previous
+     command begin with word 0).  A negative argument inserts the Nth
+     word from the end of the previous command.
+
+`yank-last-arg (M-., M-_)'
+     Insert last argument to the previous command (the last word on the
+     previous line).  With an argument, behave exactly like
+     `yank-nth-arg'.
+
+
+File: readline.info,  Node: Commands For Text,  Next: Commands For Killing,  Prev: Commands For History,  Up: Bindable Readline Commands
+
+Commands For Changing Text
+--------------------------
+
+`delete-char (C-d)'
+     Delete the character under the cursor.  If the cursor is at the
+     beginning of the line, there are no characters in the line, and
+     the last character typed was not C-d, then return EOF.
+
+`backward-delete-char (Rubout)'
+     Delete the character behind the cursor.  A numeric arg says to kill
+     the characters instead of deleting them.
+
+`quoted-insert (C-q, C-v)'
+     Add the next character that you type to the line verbatim.  This is
+     how to insert key sequences like C-q, for example.
+
+`tab-insert (M-TAB)'
+     Insert a tab character.
+
+`self-insert (a, b, A, 1, !, ...)'
+     Insert yourself.
+
+`transpose-chars (C-t)'
+     Drag the character before the cursor forward over the character at
+     the cursor, moving the cursor forward as well.  If the insertion
+     point is at the end of the line, then this transposes the last two
+     characters of the line.  Negative argumentss don't work.
+
+`transpose-words (M-t)'
+     Drag the word behind the cursor past the word in front of the
+     cursor moving the cursor over that word as well.
+
+`upcase-word (M-u)'
+     Uppercase the current (or following) word.  With a negative
+     argument, do the previous word, but do not move the cursor.
+
+`downcase-word (M-l)'
+     Lowercase the current (or following) word.  With a negative
+     argument, do the previous word, but do not move the cursor.
+
+`capitalize-word (M-c)'
+     Capitalize the current (or following) word.  With a negative
+     argument, do the previous word, but do not move the cursor.
+
+
+File: readline.info,  Node: Commands For Killing,  Next: Numeric Arguments,  Prev: Commands For Text,  Up: Bindable Readline Commands
+
+Killing And Yanking
+-------------------
+
+`kill-line (C-k)'
+     Kill the text from the current cursor position to the end of the
+     line.
+
+`backward-kill-line (C-x Rubout)'
+     Kill backward to the beginning of the line.
+
+`unix-line-discard (C-u)'
+     Kill backward from the cursor to the beginning of the current line.
+     Save the killed text on the kill-ring.
+
+`kill-whole-line ()'
+     Kill all characters on the current line, no matter where the
+     cursor is.  By default, this is unbound.
+
+`kill-word (M-d)'
+     Kill from the cursor to the end of the current word, or if between
+     words, to the end of the next word.  Word boundaries are the same
+     as `forward-word'.
+
+`backward-kill-word (M-DEL)'
+     Kill the word behind the cursor.  Word boundaries are the same as
+     `backward-word'.
+
+`unix-word-rubout (C-w)'
+     Kill the word behind the cursor, using white space as a word
+     boundary.  The killed text is saved on the kill-ring.
+
+`delete-horizontal-space ()'
+     Delete all spaces and tabs around point.  By default, this is
+     unbound.
+
+`yank (C-y)'
+     Yank the top of the kill ring into the buffer at the current
+     cursor position.
+
+`yank-pop (M-y)'
+     Rotate the kill-ring, and yank the new top.  You can only do this
+     if the prior command is yank or yank-pop.
+
+
+File: readline.info,  Node: Numeric Arguments,  Next: Commands For Completion,  Prev: Commands For Killing,  Up: Bindable Readline Commands
+
+Specifying Numeric Arguments
+----------------------------
+
+`digit-argument (M-0, M-1, ... M--)'
+     Add this digit to the argument already accumulating, or start a new
+     argument.  M- starts a negative argument.
+
+`universal-argument ()'
+     Each time this is executed, the argument count is multiplied by
+     four.  The argument count is initially one, so executing this
+     function the first time makes the argument count four.  By
+     default, this is not bound to a key.
+
+
+File: readline.info,  Node: Commands For Completion,  Next: Keyboard Macros,  Prev: Numeric Arguments,  Up: Bindable Readline Commands
+
+Letting Readline Type For You
+-----------------------------
+
+`complete (TAB)'
+     Attempt to do completion on the text before the cursor.  This is
+     application-specific.  Generally, if you are typing a filename
+     argument, you can do filename completion; if you are typing a
+     command, you can do command completion, if you are typing in a
+     symbol to GDB, you can do symbol name completion, if you are
+     typing in a variable to Bash, you can do variable name completion,
+     and so on.
+
+`possible-completions (M-?)'
+     List the possible completions of the text before the cursor.
+
+`insert-completions ()'
+     Insert all completions of the text before point that would have
+     been generated by `possible-completions'.  By default, this is not
+     bound to a key.
+
+
+File: readline.info,  Node: Keyboard Macros,  Next: Miscellaneous Commands,  Prev: Commands For Completion,  Up: Bindable Readline Commands
+
+Keyboard Macros
+---------------
+
+`start-kbd-macro (C-x ()'
+     Begin saving the characters typed into the current keyboard macro.
+
+`end-kbd-macro (C-x ))'
+     Stop saving the characters typed into the current keyboard macro
+     and save the definition.
+
+`call-last-kbd-macro (C-x e)'
+     Re-execute the last keyboard macro defined, by making the
+     characters in the macro appear as if typed at the keyboard.
+
+
+File: readline.info,  Node: Miscellaneous Commands,  Prev: Keyboard Macros,  Up: Bindable Readline Commands
+
+Some Miscellaneous Commands
+---------------------------
+
+`re-read-init-file (C-x C-r)'
+     Read in the contents of your init file, and incorporate any
+     bindings or variable assignments found there.
+
+`abort (C-g)'
+     Abort the current editing command and ring the terminal's bell
+     (subject to the setting of `bell-style').
+
+`do-uppercase-version (M-a, M-b, ...)'
+     Run the command that is bound to the corresoponding uppercase
+     character.
+
+`prefix-meta (ESC)'
+     Make the next character that you type be metafied.  This is for
+     people without a meta key.  Typing `ESC f' is equivalent to typing
+     `M-f'.
+
+`undo (C-_, C-x C-u)'
+     Incremental undo, separately remembered for each line.
+
+`revert-line (M-r)'
+     Undo all changes made to this line.  This is like typing the `undo'
+     command enough times to get back to the beginning.
+
+`tilde-expand (M-~)'
+     Perform tilde expansion on the current word.
+
+`dump-functions ()'
+     Print all of the functions and their key bindings to the readline
+     output stream.  If a numeric argument is supplied, the output is
+     formatted in such a way that it can be made part of an INPUTRC
+     file.
+
+
+File: readline.info,  Node: Readline vi Mode,  Prev: Bindable Readline Commands,  Up: Command Line Editing
+
+Readline vi Mode
+================
+
+   While the Readline library does not have a full set of `vi' editing
+functions, it does contain enough to allow simple editing of the line.
+The Readline `vi' mode behaves as specified in the Posix 1003.2
+standard.
+
+   In order to switch interactively between `Emacs' and `Vi' editing
+modes, use the command M-C-j (toggle-editing-mode).  The Readline
+default is `emacs' mode.
+
+   When you enter a line in `vi' mode, you are already placed in
+`insertion' mode, as if you had typed an `i'.  Pressing ESC switches
+you into `command' mode, where you can edit the text of the line with
+the standard `vi' movement keys, move to previous history lines with
+`k', and following lines with `j', and so forth.
+
+   This document describes the GNU Readline Library, a utility for
+aiding in the consitency of user interface across discrete programs
+that need to provide a command line interface.
+
+   Copyright (C) 1988, 1994 Free Software Foundation, Inc.
+
+   Permission is granted to make and distribute verbatim copies of this
+manual provided the copyright notice and this permission notice pare
+preserved on all copies.
+
+   Permission is granted to copy and distribute modified versions of
+this manual under the conditions for verbatim copying, provided that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+   Permission is granted to copy and distribute translations of this
+manual into another language, under the above conditions for modified
+versions, except that this permission notice may be stated in a
+translation approved by the Foundation.
+
+
+File: readline.info,  Node: Programming with GNU Readline,  Next: Concept Index,  Prev: Command Line Editing,  Up: Top
+
+Programming with GNU Readline
+*****************************
+
+   This chapter describes the interface between the GNU Readline
+Library and other programs.  If you are a programmer, and you wish to
+include the features found in GNU Readline such as completion, line
+editing, and interactive history manipulation in your own programs,
+this section is for you.
+
+* Menu:
+
+* Basic Behavior::	Using the default behavior of Readline.
+* Custom Functions::	Adding your own functions to Readline.
+* Readline Convenience Functions::	Functions which Readline supplies to
+					aid in writing your own
+* Custom Completers::	Supplanting or supplementing Readline's
+			completion functions.
+
+
+File: readline.info,  Node: Basic Behavior,  Next: Custom Functions,  Up: Programming with GNU Readline
+
+Basic Behavior
+==============
+
+   Many programs provide a command line interface, such as `mail',
+`ftp', and `sh'.  For such programs, the default behaviour of Readline
+is sufficient.  This section describes how to use Readline in the
+simplest way possible, perhaps to replace calls in your code to
+`gets()' or `fgets ()'.
+
+   The function `readline ()' prints a prompt and then reads and returns
+a single line of text from the user.  The line `readline' returns is
+allocated with `malloc ()'; you should `free ()' the line when you are
+done with it.  The declaration for `readline' in ANSI C is
+
+     `char *readline (char *PROMPT);'
+
+So, one might say
+     `char *line = readline ("Enter a line: ");'
+
+in order to read a line of text from the user.  The line returned has
+the final newline removed, so only the text remains.
+
+   If `readline' encounters an `EOF' while reading the line, and the
+line is empty at that point, then `(char *)NULL' is returned.
+Otherwise, the line is ended just as if a newline had been typed.
+
+   If you want the user to be able to get at the line later, (with C-p
+for example), you must call `add_history ()' to save the line away in a
+"history" list of such lines.
+
+     `add_history (line)';
+
+For full details on the GNU History Library, see the associated manual.
+
+   It is preferable to avoid saving empty lines on the history list,
+since users rarely have a burning need to reuse a blank line.  Here is
+a function which usefully replaces the standard `gets ()' library
+function, and has the advantage of no static buffer to overflow:
+
+     /* A static variable for holding the line. */
+     static char *line_read = (char *)NULL;
+     
+     /* Read a string, and return a pointer to it.  Returns NULL on EOF. */
+     char *
+     rl_gets ()
+     {
+       /* If the buffer has already been allocated, return the memory
+          to the free pool. */
+       if (line_read)
+         {
+           free (line_read);
+           line_read = (char *)NULL;
+         }
+     
+       /* Get a line from the user. */
+       line_read = readline ("");
+     
+       /* If the line has any text in it, save it on the history. */
+       if (line_read && *line_read)
+         add_history (line_read);
+     
+       return (line_read);
+     }
+
+   This function gives the user the default behaviour of TAB
+completion: completion on file names.  If you do not want Readline to
+complete on filenames, you can change the binding of the TAB key with
+`rl_bind_key ()'.
+
+     `int rl_bind_key (int KEY, int (*FUNCTION)());'
+
+   `rl_bind_key ()' takes two arguments: KEY is the character that you
+want to bind, and FUNCTION is the address of the function to call when
+KEY is pressed.  Binding TAB to `rl_insert ()' makes TAB insert itself.
+`rl_bind_key ()' returns non-zero if KEY is not a valid ASCII character
+code (between 0 and 255).
+
+   Thus, to disable the default TAB behavior, the following suffices:
+     `rl_bind_key ('\t', rl_insert);'
+
+   This code should be executed once at the start of your program; you
+might write a function called `initialize_readline ()' which performs
+this and other desired initializations, such as installing custom
+completers (*note Custom Completers::.).
+
+
+File: readline.info,  Node: Custom Functions,  Next: Readline Convenience Functions,  Prev: Basic Behavior,  Up: Programming with GNU Readline
+
+Custom Functions
+================
+
+   Readline provides many functions for manipulating the text of the
+line, but it isn't possible to anticipate the needs of all programs.
+This section describes the various functions and variables defined
+within the Readline library which allow a user program to add
+customized functionality to Readline.
+
+* Menu:
+
+* The Function Type::	C declarations to make code readable.
+* Function Writing::	Variables and calling conventions.
+
+
+File: readline.info,  Node: The Function Type,  Next: Function Writing,  Up: Custom Functions
+
+The Function Type
+-----------------
+
+   For readabilty, we declare a new type of object, called "Function".
+A `Function' is a C function which returns an `int'.  The type
+declaration for `Function' is:
+
+`typedef int Function ();'
+
+   The reason for declaring this new type is to make it easier to write
+code describing pointers to C functions.  Let us say we had a variable
+called FUNC which was a pointer to a function.  Instead of the classic
+C declaration
+
+   `int (*)()func;'
+
+we may write
+
+   `Function *func;'
+
+Similarly, there are
+
+     typedef void VFunction ();
+     typedef char *CPFunction (); and
+     typedef char **CPPFunction ();
+
+for functions returning no value, `pointer to char', and `pointer to
+pointer to char', respectively.
+
+
+File: readline.info,  Node: Function Writing,  Prev: The Function Type,  Up: Custom Functions
+
+Writing a New Function
+----------------------
+
+   In order to write new functions for Readline, you need to know the
+calling conventions for keyboard-invoked functions, and the names of the
+variables that describe the current state of the line read so far.
+
+   The calling sequence for a command `foo' looks like
+
+     `foo (int count, int key)'
+
+where COUNT is the numeric argument (or 1 if defaulted) and KEY is the
+key that invoked this function.
+
+   It is completely up to the function as to what should be done with
+the numeric argument.  Some functions use it as a repeat count, some as
+a flag, and others to choose alternate behavior (refreshing the current
+line as opposed to refreshing the screen, for example).  Some choose to
+ignore it.  In general, if a function uses the numeric argument as a
+repeat count, it should be able to do something useful with both
+negative and positive arguments.  At the very least, it should be aware
+that it can be passed a negative argument.
+
+ - Variable: char * rl_line_buffer
+     This is the line gathered so far.  You are welcome to modify the
+     contents of the line, but see *Note Allowing Undoing::.
+
+ - Variable: int rl_point
+     The offset of the current cursor position in `rl_line_buffer' (the
+     *point*).
+
+ - Variable: int rl_end
+     The number of characters present in `rl_line_buffer'.  When
+     `rl_point' is at the end of the line, `rl_point' and `rl_end' are
+     equal.
+
+ - Variable: int rl_mark
+     The mark (saved position) in the current line.  If set, the mark
+     and point define a *region*.
+
+ - Variable: int rl_done
+     Setting this to a non-zero value causes Readline to return the
+     current line immediately.
+
+ - Variable: int rl_pending_input
+     Setting this to a value makes it the next keystroke read.  This is
+     a way to stuff a single character into the input stream.
+
+ - Variable: char * rl_prompt
+     The prompt Readline uses.  This is set from the argument to
+     `readline ()', and should not be assigned to directly.
+
+ - Variable: char * rl_terminal_name
+     The terminal type, used for initialization.
+
+ - Variable: char * rl_readline_name
+     This variable is set to a unique name by each application using
+     Readline.  The value allows conditional parsing of the inputrc file
+     (*note Conditional Init Constructs::.).
+
+ - Variable: FILE * rl_instream
+     The stdio stream from which Readline reads input.
+
+ - Variable: FILE * rl_outstream
+     The stdio stream to which Readline performs output.
+
+ - Variable: Function * rl_startup_hook
+     If non-zero, this is the address of a function to call just before
+     `readline' prints the first prompt.
+
+
+File: readline.info,  Node: Readline Convenience Functions,  Next: Custom Completers,  Prev: Custom Functions,  Up: Programming with GNU Readline
+
+Readline Convenience Functions
+==============================
+
+* Menu:
+
+* Function Naming::	How to give a function you write a name.
+* Keymaps::		Making keymaps.
+* Binding Keys::	Changing Keymaps.
+* Associating Function Names and Bindings::	Translate function names to
+						key sequences.
+* Allowing Undoing::	How to make your functions undoable.
+* Redisplay::		Functions to control line display.
+* Modifying Text::	Functions to modify `rl_line_buffer'.
+* Utility Functions::	Generally useful functions and hooks.
+
+
+File: readline.info,  Node: Function Naming,  Next: Keymaps,  Up: Readline Convenience Functions
+
+Naming a Function
+-----------------
+
+   The user can dynamically change the bindings of keys while using
+Readline.  This is done by representing the function with a descriptive
+name.  The user is able to type the descriptive name when referring to
+the function.  Thus, in an init file, one might find
+
+     Meta-Rubout:	backward-kill-word
+
+   This binds the keystroke Meta-Rubout to the function *descriptively*
+named `backward-kill-word'.  You, as the programmer, should bind the
+functions you write to descriptive names as well.  Readline provides a
+function for doing that:
+
+ - Function: int rl_add_defun (char *name, Function *function, int key)
+     Add NAME to the list of named functions.  Make FUNCTION be the
+     function that gets called.  If KEY is not -1, then bind it to
+     FUNCTION using `rl_bind_key ()'.
+
+   Using this function alone is sufficient for most applications.  It is
+the recommended way to add a few functions to the default functions that
+Readline has built in.  If you need to do something other than adding a
+function to Readline, you may need to use the underlying functions
+described below.
+
+
+File: readline.info,  Node: Keymaps,  Next: Binding Keys,  Prev: Function Naming,  Up: Readline Convenience Functions
+
+Selecting a Keymap
+------------------
+
+   Key bindings take place on a "keymap".  The keymap is the
+association between the keys that the user types and the functions that
+get run.  You can make your own keymaps, copy existing keymaps, and tell
+Readline which keymap to use.
+
+ - Function: Keymap rl_make_bare_keymap ()
+     Returns a new, empty keymap.  The space for the keymap is
+     allocated with `malloc ()'; you should `free ()' it when you are
+     done.
+
+ - Function: Keymap rl_copy_keymap (Keymap map)
+     Return a new keymap which is a copy of MAP.
+
+ - Function: Keymap rl_make_keymap ()
+     Return a new keymap with the printing characters bound to
+     rl_insert, the lowercase Meta characters bound to run their
+     equivalents, and the Meta digits bound to produce numeric
+     arguments.
+
+ - Function: void rl_discard_keymap (Keymap keymap)
+     Free the storage associated with KEYMAP.
+
+   Readline has several internal keymaps.  These functions allow you to
+change which keymap is active.
+
+ - Function: Keymap rl_get_keymap ()
+     Returns the currently active keymap.
+
+ - Function: void rl_set_keymap (Keymap keymap)
+     Makes KEYMAP the currently active keymap.
+
+ - Function: Keymap rl_get_keymap_by_name (char *name)
+     Return the keymap matching NAME.  NAME is one which would be
+     supplied in a `set keymap' inputrc line (*note Readline Init
+     File::.).
+
+
+File: readline.info,  Node: Binding Keys,  Next: Associating Function Names and Bindings,  Prev: Keymaps,  Up: Readline Convenience Functions
+
+Binding Keys
+------------
+
+   You associate keys with functions through the keymap.  Readline has
+several internal keymaps: `emacs_standard_keymap', `emacs_meta_keymap',
+`emacs_ctlx_keymap', `vi_movement_keymap', and `vi_insertion_keymap'.
+`emacs_standard_keymap' is the default, and the examples in this manual
+assume that.
+
+   These functions manage key bindings.
+
+ - Function: int rl_bind_key (int key, Function *function)
+     Binds KEY to FUNCTION in the currently active keymap.  Returns
+     non-zero in the case of an invalid KEY.
+
+ - Function: int rl_bind_key_in_map (int key, Function *function,
+          Keymap map)
+     Bind KEY to FUNCTION in MAP.  Returns non-zero in the case of an
+     invalid KEY.
+
+ - Function: int rl_unbind_key (int key)
+     Bind KEY to the null function in the currently active keymap.
+     Returns non-zero in case of error.
+
+ - Function: int rl_unbind_key_in_map (int key, Keymap map)
+     Bind KEY to the null function in MAP.  Returns non-zero in case of
+     error.
+
+ - Function: int rl_generic_bind (int type, char *keyseq, char *data,
+          Keymap map)
+     Bind the key sequence represented by the string KEYSEQ to the
+     arbitrary pointer DATA.  TYPE says what kind of data is pointed to
+     by DATA; this can be a function (`ISFUNC'), a macro (`ISMACR'), or
+     a keymap (`ISKMAP').  This makes new keymaps as necessary.  The
+     initial keymap in which to do bindings is MAP.
+
+ - Function: int rl_parse_and_bind (char *line)
+     Parse LINE as if it had been read from the `inputrc' file and
+     perform any key bindings and variable assignments found (*note
+     Readline Init File::.).
+
+
+File: readline.info,  Node: Associating Function Names and Bindings,  Next: Allowing Undoing,  Prev: Binding Keys,  Up: Readline Convenience Functions
+
+Associating Function Names and Bindings
+---------------------------------------
+
+   These functions allow you to find out what keys invoke named
+functions and the functions invoked by a particular key sequence.
+
+ - Function: Function * rl_named_function (char *name)
+     Return the function with name NAME.
+
+ - Function: Function * rl_function_of_keyseq (char *keyseq, Keymap
+          map, int *type)
+     Return the function invoked by KEYSEQ in keymap MAP.  If MAP is
+     NULL, the current keymap is used.  If TYPE is not NULL, the type
+     of the object is returned in it (one of `ISFUNC', `ISKMAP', or
+     `ISMACR').
+
+ - Function: char ** rl_invoking_keyseqs (Function *function)
+     Return an array of strings representing the key sequences used to
+     invoke FUNCTION in the current keymap.
+
+ - Function: char ** rl_invoking_keyseqs_in_map (Function *function,
+          Keymap map)
+     Return an array of strings representing the key sequences used to
+     invoke FUNCTION in the keymap MAP.
+
+
+File: readline.info,  Node: Allowing Undoing,  Next: Redisplay,  Prev: Associating Function Names and Bindings,  Up: Readline Convenience Functions
+
+Allowing Undoing
+----------------
+
+   Supporting the undo command is a painless thing, and makes your
+functions much more useful.  It is certainly easy to try something if
+you know you can undo it.  I could use an undo function for the stock
+market.
+
+   If your function simply inserts text once, or deletes text once, and
+uses `rl_insert_text ()' or `rl_delete_text ()' to do it, then undoing
+is already done for you automatically.
+
+   If you do multiple insertions or multiple deletions, or any
+combination of these operations, you should group them together into
+one operation.  This is done with `rl_begin_undo_group ()' and
+`rl_end_undo_group ()'.
+
+   The types of events that can be undone are:
+
+     enum undo_code { UNDO_DELETE, UNDO_INSERT, UNDO_BEGIN, UNDO_END };
+
+   Notice that `UNDO_DELETE' means to insert some text, and
+`UNDO_INSERT' means to delete some text.  That is, the undo code tells
+undo what to undo, not how to undo it.  `UNDO_BEGIN' and `UNDO_END' are
+tags added by `rl_begin_undo_group ()' and `rl_end_undo_group ()'.
+
+ - Function: int rl_begin_undo_group ()
+     Begins saving undo information in a group construct.  The undo
+     information usually comes from calls to `rl_insert_text ()' and
+     `rl_delete_text ()', but could be the result of calls to
+     `rl_add_undo ()'.
+
+ - Function: int rl_end_undo_group ()
+     Closes the current undo group started with `rl_begin_undo_group
+     ()'.  There should be one call to `rl_end_undo_group ()' for each
+     call to `rl_begin_undo_group ()'.
+
+ - Function: void rl_add_undo (enum undo_code what, int start, int end,
+          char *text)
+     Remember how to undo an event (according to WHAT).  The affected
+     text runs from START to END, and encompasses TEXT.
+
+ - Function: void free_undo_list ()
+     Free the existing undo list.
+
+ - Function: int rl_do_undo ()
+     Undo the first thing on the undo list.  Returns `0' if there was
+     nothing to undo, non-zero if something was undone.
+
+   Finally, if you neither insert nor delete text, but directly modify
+the existing text (e.g., change its case), call `rl_modifying ()' once,
+just before you modify the text.  You must supply the indices of the
+text range that you are going to modify.
+
+ - Function: int rl_modifying (int start, int end)
+     Tell Readline to save the text between START and END as a single
+     undo unit.  It is assumed that you will subsequently modify that
+     text.
+
+
+File: readline.info,  Node: Redisplay,  Next: Modifying Text,  Prev: Allowing Undoing,  Up: Readline Convenience Functions
+
+Redisplay
+---------
+
+ - Function: int rl_redisplay ()
+     Change what's displayed on the screen to reflect the current
+     contents of `rl_line_buffer'.
+
+ - Function: int rl_forced_update_display ()
+     Force the line to be updated and redisplayed, whether or not
+     Readline thinks the screen display is correct.
+
+ - Function: int rl_on_new_line ()
+     Tell the update routines that we have moved onto a new (empty)
+     line, usually after ouputting a newline.
+
+ - Function: int rl_reset_line_state ()
+     Reset the display state to a clean state and redisplay the current
+     line starting on a new line.
+
+ - Function: int rl_message (va_alist)
+     The arguments are a string as would be supplied to `printf'.  The
+     resulting string is displayed in the "echo area".  The echo area
+     is also used to display numeric arguments and search strings.
+
+ - Function: int rl_clear_message ()
+     Clear the message in the echo area.
+
diff --git a/doc/readline.info-2 b/doc/readline.info-2
new file mode 100644
index 0000000..35681aa
--- /dev/null
+++ b/doc/readline.info-2
@@ -0,0 +1,978 @@
+This is Info file readline.info, produced by Makeinfo-1.55 from the
+input file rlman.texinfo.
+
+   This document describes the GNU Readline Library, a utility which
+aids in the consistency of user interface across discrete programs that
+need to provide a command line interface.
+
+   Copyright (C) 1988, 1991 Free Software Foundation, Inc.
+
+   Permission is granted to make and distribute verbatim copies of this
+manual provided the copyright notice and this permission notice pare
+preserved on all copies.
+
+   Permission is granted to copy and distribute modified versions of
+this manual under the conditions for verbatim copying, provided that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+   Permission is granted to copy and distribute translations of this
+manual into another language, under the above conditions for modified
+versions, except that this permission notice may be stated in a
+translation approved by the Foundation.
+
+
+File: readline.info,  Node: Modifying Text,  Next: Utility Functions,  Prev: Redisplay,  Up: Readline Convenience Functions
+
+Modifying Text
+--------------
+
+ - Function: int rl_insert_text (char *text)
+     Insert TEXT into the line at the current cursor position.
+
+ - Function: int rl_delete_text (int start, int end)
+     Delete the text between START and END in the current line.
+
+ - Function: char * rl_copy_text (int start, int end)
+     Return a copy of the text between START and END in the current
+     line.
+
+ - Function: int rl_kill_text (int start, int end)
+     Copy the text between START and END in the current line to the
+     kill ring, appending or prepending to the last kill if the last
+     command was a kill command.  The text is deleted.  If START is
+     less than END, the text is appended, otherwise prepended.  If the
+     last command was not a kill, a new kill ring slot is used.
+
+
+File: readline.info,  Node: Utility Functions,  Prev: Modifying Text,  Up: Readline Convenience Functions
+
+Utility Functions
+-----------------
+
+ - Function: int rl_reset_terminal (char *terminal_name)
+     Reinitialize Readline's idea of the terminal settings using
+     TERMINAL_NAME as the terminal type (e.g., `vt100').
+
+ - Function: int alphabetic (int c)
+     Return 1 if C is an alphabetic character.
+
+ - Function: int numeric (int c)
+     Return 1 if C is a numeric character.
+
+ - Function: int ding ()
+     Ring the terminal bell, obeying the setting of `bell-style'.
+
+   The following are implemented as macros, defined in `chartypes.h'.
+
+ - Function: int uppercase_p (int c)
+     Return 1 if C is an uppercase alphabetic character.
+
+ - Function: int lowercase_p (int c)
+     Return 1 if C is a lowercase alphabetic character.
+
+ - Function: int digit_p (int c)
+     Return 1 if C is a numeric character.
+
+ - Function: int to_upper (int c)
+     If C is a lowercase alphabetic character, return the corresponding
+     uppercase character.
+
+ - Function: int to_lower (int c)
+     If C is an uppercase alphabetic character, return the corresponding
+     lowercase character.
+
+ - Function: int digit_value (int c)
+     If C is a number, return the value it represents.
+
+An Example
+----------
+
+   Here is a function which changes lowercase characters to their
+uppercase equivalents, and uppercase characters to lowercase.  If this
+function was bound to `M-c', then typing `M-c' would change the case of
+the character under point.  Typing `M-1 0 M-c' would change the case of
+the following 10 characters, leaving the cursor on the last character
+changed.
+
+     /* Invert the case of the COUNT following characters. */
+     int
+     invert_case_line (count, key)
+          int count, key;
+     {
+       register int start, end, i;
+     
+       start = rl_point;
+     
+       if (rl_point >= rl_end)
+         return (0);
+     
+       if (count < 0)
+         {
+           direction = -1;
+           count = -count;
+         }
+       else
+         direction = 1;
+     
+       /* Find the end of the range to modify. */
+       end = start + (count * direction);
+     
+       /* Force it to be within range. */
+       if (end > rl_end)
+         end = rl_end;
+       else if (end < 0)
+         end = 0;
+     
+       if (start == end)
+         return (0);
+     
+       if (start > end)
+         {
+           int temp = start;
+           start = end;
+           end = temp;
+         }
+     
+       /* Tell readline that we are modifying the line, so it will save
+          the undo information. */
+       rl_modifying (start, end);
+     
+       for (i = start; i != end; i++)
+         {
+           if (uppercase_p (rl_line_buffer[i]))
+             rl_line_buffer[i] = to_lower (rl_line_buffer[i]);
+           else if (lowercase_p (rl_line_buffer[i]))
+             rl_line_buffer[i] = to_upper (rl_line_buffer[i]);
+         }
+       /* Move point to on top of the last character changed. */
+       rl_point = (direction == 1) ? end - 1 : start;
+       return (0);
+     }
+
+
+File: readline.info,  Node: Custom Completers,  Prev: Readline Convenience Functions,  Up: Programming with GNU Readline
+
+Custom Completers
+=================
+
+   Typically, a program that reads commands from the user has a way of
+disambiguating commands and data.  If your program is one of these, then
+it can provide completion for commands, data, or both.  The following
+sections describe how your program and Readline cooperate to provide
+this service.
+
+* Menu:
+
+* How Completing Works::	The logic used to do completion.
+* Completion Functions::	Functions provided by Readline.
+* Completion Variables::	Variables which control completion.
+* A Short Completion Example::	An example of writing completer subroutines.
+
+
+File: readline.info,  Node: How Completing Works,  Next: Completion Functions,  Up: Custom Completers
+
+How Completing Works
+--------------------
+
+   In order to complete some text, the full list of possible completions
+must be available.  That is, it is not possible to accurately expand a
+partial word without knowing all of the possible words which make sense
+in that context.  The Readline library provides the user interface to
+completion, and two of the most common completion functions:  filename
+and username.  For completing other types of text, you must write your
+own completion function.  This section describes exactly what such
+functions must do, and provides an example.
+
+   There are three major functions used to perform completion:
+
+  1. The user-interface function `rl_complete ()'.  This function is
+     called with the same arguments as other Readline functions
+     intended for interactive use:  COUNT and INVOKING_KEY.  It
+     isolates the word to be completed and calls `completion_matches
+     ()' to generate a list of possible completions.  It then either
+     lists the possible completions, inserts the possible completions,
+     or actually performs the completion, depending on which behavior
+     is desired.
+
+  2. The internal function `completion_matches ()' uses your
+     "generator" function to generate the list of possible matches, and
+     then returns the array of these matches.  You should place the
+     address of your generator function in
+     `rl_completion_entry_function'.
+
+  3. The generator function is called repeatedly from
+     `completion_matches ()', returning a string each time.  The
+     arguments to the generator function are TEXT and STATE.  TEXT is
+     the partial word to be completed.  STATE is zero the first time
+     the function is called, allowing the generator to perform any
+     necessary initialization, and a positive non-zero integer for each
+     subsequent call.  When the generator function returns `(char
+     *)NULL' this signals `completion_matches ()' that there are no
+     more possibilities left.  Usually the generator function computes
+     the list of possible completions when STATE is zero, and returns
+     them one at a time on subsequent calls.  Each string the generator
+     function returns as a match must be allocated with `malloc()';
+     Readline frees the strings when it has finished with them.
+
+
+ - Function: int rl_complete (int ignore, int invoking_key)
+     Complete the word at or before point.  You have supplied the
+     function that does the initial simple matching selection algorithm
+     (see `completion_matches ()').  The default is to do filename
+     completion.
+
+ - Variable: Function * rl_completion_entry_function
+     This is a pointer to the generator function for `completion_matches
+     ()'.  If the value of `rl_completion_entry_function' is `(Function
+     *)NULL' then the default filename generator function,
+     `filename_entry_function ()', is used.
+
+
+File: readline.info,  Node: Completion Functions,  Next: Completion Variables,  Prev: How Completing Works,  Up: Custom Completers
+
+Completion Functions
+--------------------
+
+   Here is the complete list of callable completion functions present in
+Readline.
+
+ - Function: int rl_complete_internal (int what_to_do)
+     Complete the word at or before point.  WHAT_TO_DO says what to do
+     with the completion.  A value of `?' means list the possible
+     completions.  `TAB' means do standard completion.  `*' means
+     insert all of the possible completions.  `!' means to display all
+     of the possible completions, if there is more than one, as well as
+     performing partial completion.
+
+ - Function: int rl_complete (int ignore, int invoking_key)
+     Complete the word at or before point.  You have supplied the
+     function that does the initial simple matching selection algorithm
+     (see `completion_matches ()' and `rl_completion_entry_function').
+     The default is to do filename completion.  This calls
+     `rl_complete_internal ()' with an argument depending on
+     INVOKING_KEY.
+
+ - Function: int rl_possible_completions (int count, int invoking_key))
+     List the possible completions.  See description of `rl_complete
+     ()'.  This calls `rl_complete_internal ()' with an argument of `?'.
+
+ - Function: int rl_insert_completions (int count, int invoking_key))
+     Insert the list of possible completions into the line, deleting the
+     partially-completed word.  See description of `rl_complete ()'.
+     This calls `rl_complete_internal ()' with an argument of `*'.
+
+ - Function: char ** completion_matches (char *text, CPFunction
+          *entry_func)
+     Returns an array of `(char *)' which is a list of completions for
+     TEXT.  If there are no completions, returns `(char **)NULL'.  The
+     first entry in the returned array is the substitution for TEXT.
+     The remaining entries are the possible completions.  The array is
+     terminated with a `NULL' pointer.
+
+     ENTRY_FUNC is a function of two args, and returns a `(char *)'.
+     The first argument is TEXT.  The second is a state argument; it is
+     zero on the first call, and non-zero on subsequent calls.
+     eNTRY_FUNC returns a `NULL'  pointer to the caller when there are
+     no more matches.
+
+ - Function: char * filename_completion_function (char *text, int state)
+     A generator function for filename completion in the general case.
+     Note that completion in Bash is a little different because of all
+     the pathnames that must be followed when looking up completions
+     for a command.  The Bash source is a useful reference for writing
+     custom completion functions.
+
+ - Function: char * username_completion_function (char *text, int state)
+     A completion generator for usernames.  TEXT contains a partial
+     username preceded by a random character (usually `~').  As with all
+     completion generators, STATE is zero on the first call and non-zero
+     for subsequent calls.
+
+
+File: readline.info,  Node: Completion Variables,  Next: A Short Completion Example,  Prev: Completion Functions,  Up: Custom Completers
+
+Completion Variables
+--------------------
+
+ - Variable: Function * rl_completion_entry_function
+     A pointer to the generator function for `completion_matches ()'.
+     `NULL' means to use `filename_entry_function ()', the default
+     filename completer.
+
+ - Variable: CPPFunction * rl_attempted_completion_function
+     A pointer to an alternative function to create matches.  The
+     function is called with TEXT, START, and END.  START and END are
+     indices in `rl_line_buffer' saying what the boundaries of TEXT
+     are.  If this function exists and returns `NULL', or if this
+     variable is set to `NULL', then `rl_complete ()' will call the
+     value of `rl_completion_entry_function' to generate matches,
+     otherwise the array of strings returned will be used.
+
+ - Variable: int rl_completion_query_items
+     Up to this many items will be displayed in response to a
+     possible-completions call.  After that, we ask the user if she is
+     sure she wants to see them all.  The default value is 100.
+
+ - Variable: char * rl_basic_word_break_characters
+     The basic list of characters that signal a break between words for
+     the completer routine.  The default value of this variable is the
+     characters which break words for completion in Bash, i.e., `"
+     \t\n\"\\'`@$><=;|&{("'.
+
+ - Variable: char * rl_completer_word_break_characters
+     The list of characters that signal a break between words for
+     `rl_complete_internal ()'.  The default list is the value of
+     `rl_basic_word_break_characters'.
+
+ - Variable: char * rl_special_prefixes
+     The list of characters that are word break characters, but should
+     be left in TEXT when it is passed to the completion function.
+     Programs can use this to help determine what kind of completing to
+     do.  For instance, Bash sets this variable to "$@" so that it can
+     complete shell variables and hostnames.
+
+ - Variable: int rl_ignore_completion_duplicates
+     If non-zero, then disallow duplicates in the matches.  Default is
+     1.
+
+ - Variable: int rl_filename_completion_desired
+     Non-zero means that the results of the matches are to be treated as
+     filenames.  This is *always* zero on entry, and can only be changed
+     within a completion entry generator function.  If it is set to a
+     non-zero value, directory names have a slash appended and Readline
+     attempts to quote completed filenames if they contain any embedded
+     word break characters.
+
+ - Variable: int rl_filename_quoting_desired
+     Non-zero means that the results of the matches are to be quoted
+     using double quotes (or an application-specific quoting mechanism)
+     if the completed filename contains any characters in
+     `rl_completer_word_break_chars'.  This is *always* non-zero on
+     entry, and can only be changed within a completion entry generator
+     function.
+
+ - Variable: Function * rl_ignore_some_completions_function
+     This function, if defined, is called by the completer when real
+     filename completion is done, after all the matching names have
+     been generated.  It is passed a `NULL' terminated array of matches.
+     The first element (`matches[0]') is the maximal substring common
+     to all matches. This function can re-arrange the list of matches
+     as required, but each element deleted from the array must be freed.
+
+ - Variable: char * rl_completer_quote_characters
+     List of characters which can be used to quote a substring of the
+     line.  Completion occurs on the entire substring, and within the
+     substring `rl_completer_word_break_characters' are treated as any
+     other character, unless they also appear within this list.
+
+
+File: readline.info,  Node: A Short Completion Example,  Prev: Completion Variables,  Up: Custom Completers
+
+A Short Completion Example
+--------------------------
+
+   Here is a small application demonstrating the use of the GNU Readline
+library.  It is called `fileman', and the source code resides in
+`examples/fileman.c'.  This sample application provides completion of
+command names, line editing features, and access to the history list.
+
+     /* fileman.c -- A tiny application which demonstrates how to use the
+        GNU Readline library.  This application interactively allows users
+        to manipulate files and their modes. */
+     
+     #include <stdio.h>
+     #include <sys/types.h>
+     #include <sys/file.h>
+     #include <sys/stat.h>
+     #include <sys/errno.h>
+     
+     #include <readline/readline.h>
+     #include <readline/history.h>
+     
+     extern char *getwd ();
+     extern char *xmalloc ();
+     
+     /* The names of functions that actually do the manipulation. */
+     int com_list (), com_view (), com_rename (), com_stat (), com_pwd ();
+     int com_delete (), com_help (), com_cd (), com_quit ();
+     
+     /* A structure which contains information on the commands this program
+        can understand. */
+     
+     typedef struct {
+       char *name;			/* User printable name of the function. */
+       Function *func;		/* Function to call to do the job. */
+       char *doc;			/* Documentation for this function.  */
+     } COMMAND;
+     
+     COMMAND commands[] = {
+       { "cd", com_cd, "Change to directory DIR" },
+       { "delete", com_delete, "Delete FILE" },
+       { "help", com_help, "Display this text" },
+       { "?", com_help, "Synonym for `help'" },
+       { "list", com_list, "List files in DIR" },
+       { "ls", com_list, "Synonym for `list'" },
+       { "pwd", com_pwd, "Print the current working directory" },
+       { "quit", com_quit, "Quit using Fileman" },
+       { "rename", com_rename, "Rename FILE to NEWNAME" },
+       { "stat", com_stat, "Print out statistics on FILE" },
+       { "view", com_view, "View the contents of FILE" },
+       { (char *)NULL, (Function *)NULL, (char *)NULL }
+     };
+     
+     /* Forward declarations. */
+     char *stripwhite ();
+     COMMAND *find_command ();
+     
+     /* The name of this program, as taken from argv[0]. */
+     char *progname;
+     
+     /* When non-zero, this global means the user is done using this program. */
+     int done;
+     
+     char *
+     dupstr (s)
+          int s;
+     {
+       char *r;
+     
+       r = xmalloc (strlen (s) + 1);
+       strcpy (r, s);
+       return (r);
+     }
+     
+     main (argc, argv)
+          int argc;
+          char **argv;
+     {
+       char *line, *s;
+     
+       progname = argv[0];
+     
+       initialize_readline ();	/* Bind our completer. */
+     
+       /* Loop reading and executing lines until the user quits. */
+       for ( ; done == 0; )
+         {
+           line = readline ("FileMan: ");
+     
+           if (!line)
+             break;
+     
+           /* Remove leading and trailing whitespace from the line.
+              Then, if there is anything left, add it to the history list
+              and execute it. */
+           s = stripwhite (line);
+     
+           if (*s)
+             {
+               add_history (s);
+               execute_line (s);
+             }
+     
+           free (line);
+         }
+       exit (0);
+     }
+     
+     /* Execute a command line. */
+     int
+     execute_line (line)
+          char *line;
+     {
+       register int i;
+       COMMAND *command;
+       char *word;
+     
+       /* Isolate the command word. */
+       i = 0;
+       while (line[i] && whitespace (line[i]))
+         i++;
+       word = line + i;
+     
+       while (line[i] && !whitespace (line[i]))
+         i++;
+     
+       if (line[i])
+         line[i++] = '\0';
+     
+       command = find_command (word);
+     
+       if (!command)
+         {
+           fprintf (stderr, "%s: No such command for FileMan.\n", word);
+           return (-1);
+         }
+     
+       /* Get argument to command, if any. */
+       while (whitespace (line[i]))
+         i++;
+     
+       word = line + i;
+     
+       /* Call the function. */
+       return ((*(command->func)) (word));
+     }
+     
+     /* Look up NAME as the name of a command, and return a pointer to that
+        command.  Return a NULL pointer if NAME isn't a command name. */
+     COMMAND *
+     find_command (name)
+          char *name;
+     {
+       register int i;
+     
+       for (i = 0; commands[i].name; i++)
+         if (strcmp (name, commands[i].name) == 0)
+           return (&commands[i]);
+     
+       return ((COMMAND *)NULL);
+     }
+     
+     /* Strip whitespace from the start and end of STRING.  Return a pointer
+        into STRING. */
+     char *
+     stripwhite (string)
+          char *string;
+     {
+       register char *s, *t;
+     
+       for (s = string; whitespace (*s); s++)
+         ;
+     
+       if (*s == 0)
+         return (s);
+     
+       t = s + strlen (s) - 1;
+       while (t > s && whitespace (*t))
+         t--;
+       *++t = '\0';
+     
+       return s;
+     }
+     
+     /* **************************************************************** */
+     /*                                                                  */
+     /*                  Interface to Readline Completion                */
+     /*                                                                  */
+     /* **************************************************************** */
+     
+     char *command_generator ();
+     char **fileman_completion ();
+     
+     /* Tell the GNU Readline library how to complete.  We want to try to complete
+        on command names if this is the first word in the line, or on filenames
+        if not. */
+     initialize_readline ()
+     {
+       /* Allow conditional parsing of the ~/.inputrc file. */
+       rl_readline_name = "FileMan";
+     
+       /* Tell the completer that we want a crack first. */
+       rl_attempted_completion_function = (CPPFunction *)fileman_completion;
+     }
+     
+     /* Attempt to complete on the contents of TEXT.  START and END show the
+        region of TEXT that contains the word to complete.  We can use the
+        entire line in case we want to do some simple parsing.  Return the
+        array of matches, or NULL if there aren't any. */
+     char **
+     fileman_completion (text, start, end)
+          char *text;
+          int start, end;
+     {
+       char **matches;
+     
+       matches = (char **)NULL;
+     
+       /* If this word is at the start of the line, then it is a command
+          to complete.  Otherwise it is the name of a file in the current
+          directory. */
+       if (start == 0)
+         matches = completion_matches (text, command_generator);
+     
+       return (matches);
+     }
+     
+     /* Generator function for command completion.  STATE lets us know whether
+        to start from scratch; without any state (i.e. STATE == 0), then we
+        start at the top of the list. */
+     char *
+     command_generator (text, state)
+          char *text;
+          int state;
+     {
+       static int list_index, len;
+       char *name;
+     
+       /* If this is a new word to complete, initialize now.  This includes
+          saving the length of TEXT for efficiency, and initializing the index
+          variable to 0. */
+       if (!state)
+         {
+           list_index = 0;
+           len = strlen (text);
+         }
+     
+       /* Return the next name which partially matches from the command list. */
+       while (name = commands[list_index].name)
+         {
+           list_index++;
+     
+           if (strncmp (name, text, len) == 0)
+             return (dupstr(name));
+         }
+     
+       /* If no names matched, then return NULL. */
+       return ((char *)NULL);
+     }
+     
+     /* **************************************************************** */
+     /*                                                                  */
+     /*                       FileMan Commands                           */
+     /*                                                                  */
+     /* **************************************************************** */
+     
+     /* String to pass to system ().  This is for the LIST, VIEW and RENAME
+        commands. */
+     static char syscom[1024];
+     
+     /* List the file(s) named in arg. */
+     com_list (arg)
+          char *arg;
+     {
+       if (!arg)
+         arg = "";
+     
+       sprintf (syscom, "ls -FClg %s", arg);
+       return (system (syscom));
+     }
+     
+     com_view (arg)
+          char *arg;
+     {
+       if (!valid_argument ("view", arg))
+         return 1;
+     
+       sprintf (syscom, "more %s", arg);
+       return (system (syscom));
+     }
+     
+     com_rename (arg)
+          char *arg;
+     {
+       too_dangerous ("rename");
+       return (1);
+     }
+     
+     com_stat (arg)
+          char *arg;
+     {
+       struct stat finfo;
+     
+       if (!valid_argument ("stat", arg))
+         return (1);
+     
+       if (stat (arg, &finfo) == -1)
+         {
+           perror (arg);
+           return (1);
+         }
+     
+       printf ("Statistics for `%s':\n", arg);
+     
+       printf ("%s has %d link%s, and is %d byte%s in length.\n", arg,
+               finfo.st_nlink,
+               (finfo.st_nlink == 1) ? "" : "s",
+               finfo.st_size,
+               (finfo.st_size == 1) ? "" : "s");
+       printf ("Inode Last Change at: %s", ctime (&finfo.st_ctime));
+       printf ("      Last access at: %s", ctime (&finfo.st_atime));
+       printf ("    Last modified at: %s", ctime (&finfo.st_mtime));
+       return (0);
+     }
+     
+     com_delete (arg)
+          char *arg;
+     {
+       too_dangerous ("delete");
+       return (1);
+     }
+     
+     /* Print out help for ARG, or for all of the commands if ARG is
+        not present. */
+     com_help (arg)
+          char *arg;
+     {
+       register int i;
+       int printed = 0;
+     
+       for (i = 0; commands[i].name; i++)
+         {
+           if (!*arg || (strcmp (arg, commands[i].name) == 0))
+             {
+               printf ("%s\t\t%s.\n", commands[i].name, commands[i].doc);
+               printed++;
+             }
+         }
+     
+       if (!printed)
+         {
+           printf ("No commands match `%s'.  Possibilties are:\n", arg);
+     
+           for (i = 0; commands[i].name; i++)
+             {
+               /* Print in six columns. */
+               if (printed == 6)
+                 {
+                   printed = 0;
+                   printf ("\n");
+                 }
+     
+               printf ("%s\t", commands[i].name);
+               printed++;
+             }
+     
+           if (printed)
+             printf ("\n");
+         }
+       return (0);
+     }
+     
+     /* Change to the directory ARG. */
+     com_cd (arg)
+          char *arg;
+     {
+       if (chdir (arg) == -1)
+         {
+           perror (arg);
+           return 1;
+         }
+     
+       com_pwd ("");
+       return (0);
+     }
+     
+     /* Print out the current working directory. */
+     com_pwd (ignore)
+          char *ignore;
+     {
+       char dir[1024], *s;
+     
+       s = getwd (dir);
+       if (s == 0)
+         {
+           printf ("Error getting pwd: %s\n", dir);
+           return 1;
+         }
+     
+       printf ("Current directory is %s\n", dir);
+       return 0;
+     }
+     
+     /* The user wishes to quit using this program.  Just set DONE non-zero. */
+     com_quit (arg)
+          char *arg;
+     {
+       done = 1;
+       return (0);
+     }
+     
+     /* Function which tells you that you can't do this. */
+     too_dangerous (caller)
+          char *caller;
+     {
+       fprintf (stderr,
+                "%s: Too dangerous for me to distribute.  Write it yourself.\n",
+                caller);
+     }
+     
+     /* Return non-zero if ARG is a valid argument for CALLER, else print
+        an error message and return zero. */
+     int
+     valid_argument (caller, arg)
+          char *caller, *arg;
+     {
+       if (!arg || !*arg)
+         {
+           fprintf (stderr, "%s: Argument required.\n", caller);
+           return (0);
+         }
+     
+       return (1);
+     }
+
+
+File: readline.info,  Node: Concept Index,  Next: Function and Variable Index,  Prev: Programming with GNU Readline,  Up: Top
+
+Concept Index
+*************
+
+* Menu:
+
+* interaction, readline:                Readline Interaction.
+* Kill ring:                            Readline Killing Commands.
+* Killing text:                         Readline Killing Commands.
+* readline, function:                   Basic Behavior.
+* Yanking text:                         Readline Killing Commands.
+
+
+File: readline.info,  Node: Function and Variable Index,  Prev: Concept Index,  Up: Top
+
+Function and Variable Index
+***************************
+
+* Menu:
+
+* $else:                                Conditional Init Constructs.
+* $endif:                               Conditional Init Constructs.
+* $if:                                  Conditional Init Constructs.
+* abort (C-g):                          Miscellaneous Commands.
+* accept-line (Newline, Return):        Commands For History.
+* alphabetic:                           Utility Functions.
+* backward-char (C-b):                  Commands For Moving.
+* backward-delete-char (Rubout):        Commands For Text.
+* backward-kill-line (C-x Rubout):      Commands For Killing.
+* backward-kill-word (M-DEL):           Commands For Killing.
+* backward-word (M-b):                  Commands For Moving.
+* beginning-of-history (M-<):           Commands For History.
+* beginning-of-line (C-a):              Commands For Moving.
+* bell-style:                           Readline Init Syntax.
+* call-last-kbd-macro (C-x e):          Keyboard Macros.
+* capitalize-word (M-c):                Commands For Text.
+* clear-screen (C-l):                   Commands For Moving.
+* comment-begin:                        Readline Init Syntax.
+* complete (TAB):                       Commands For Completion.
+* completion-query-items:               Readline Init Syntax.
+* completion_matches:                   Completion Functions.
+* convert-meta:                         Readline Init Syntax.
+* delete-char (C-d):                    Commands For Text.
+* delete-horizontal-space ():           Commands For Killing.
+* digit-argument (M-0, M-1, ... M-):    Numeric Arguments.
+* digit_p:                              Utility Functions.
+* digit_value:                          Utility Functions.
+* ding:                                 Utility Functions.
+* do-uppercase-version (M-a, M-b, ...): Miscellaneous Commands.
+* downcase-word (M-l):                  Commands For Text.
+* dump-functions ():                    Miscellaneous Commands.
+* editing-mode:                         Readline Init Syntax.
+* end-kbd-macro (C-x )):                Keyboard Macros.
+* end-of-history (M->):                 Commands For History.
+* end-of-line (C-e):                    Commands For Moving.
+* expand-tilde:                         Readline Init Syntax.
+* filename_completion_function:         Completion Functions.
+* forward-char (C-f):                   Commands For Moving.
+* forward-search-history (C-s):         Commands For History.
+* forward-word (M-f):                   Commands For Moving.
+* free_undo_list:                       Allowing Undoing.
+* history-search-backward ():           Commands For History.
+* history-search-forward ():            Commands For History.
+* horizontal-scroll-mode:               Readline Init Syntax.
+* insert-completions ():                Commands For Completion.
+* keymap:                               Readline Init Syntax.
+* kill-line (C-k):                      Commands For Killing.
+* kill-whole-line ():                   Commands For Killing.
+* kill-word (M-d):                      Commands For Killing.
+* lowercase_p:                          Utility Functions.
+* mark-modified-lines:                  Readline Init Syntax.
+* meta-flag:                            Readline Init Syntax.
+* next-history (C-n):                   Commands For History.
+* non-incremental-forward-search-history (M-n): Commands For History.
+* non-incremental-reverse-search-history (M-p): Commands For History.
+* numeric:                              Utility Functions.
+* output-meta:                          Readline Init Syntax.
+* possible-completions (M-?):           Commands For Completion.
+* prefix-meta (ESC):                    Miscellaneous Commands.
+* previous-history (C-p):               Commands For History.
+* quoted-insert (C-q, C-v):             Commands For Text.
+* re-read-init-file (C-x C-r):          Miscellaneous Commands.
+* readline:                             Basic Behavior.
+* redraw-current-line ():               Commands For Moving.
+* reverse-search-history (C-r):         Commands For History.
+* revert-line (M-r):                    Miscellaneous Commands.
+* rl_add_defun:                         Function Naming.
+* rl_add_undo:                          Allowing Undoing.
+* rl_attempted_completion_function:     Completion Variables.
+* rl_basic_word_break_characters:       Completion Variables.
+* rl_begin_undo_group:                  Allowing Undoing.
+* rl_bind_key:                          Binding Keys.
+* rl_bind_key_in_map:                   Binding Keys.
+* rl_clear_message:                     Redisplay.
+* rl_complete:                          How Completing Works.
+* rl_complete:                          Completion Functions.
+* rl_completer_quote_characters:        Completion Variables.
+* rl_completer_word_break_characters:   Completion Variables.
+* rl_complete_internal:                 Completion Functions.
+* rl_completion_entry_function:         Completion Variables.
+* rl_completion_entry_function:         How Completing Works.
+* rl_completion_query_items:            Completion Variables.
+* rl_copy_keymap:                       Keymaps.
+* rl_copy_text:                         Modifying Text.
+* rl_delete_text:                       Modifying Text.
+* rl_discard_keymap:                    Keymaps.
+* rl_done:                              Function Writing.
+* rl_do_undo:                           Allowing Undoing.
+* rl_end:                               Function Writing.
+* rl_end_undo_group:                    Allowing Undoing.
+* rl_filename_completion_desired:       Completion Variables.
+* rl_filename_quoting_desired:          Completion Variables.
+* rl_forced_update_display:             Redisplay.
+* rl_function_of_keyseq:                Associating Function Names and Bindings.
+* rl_generic_bind:                      Binding Keys.
+* rl_get_keymap:                        Keymaps.
+* rl_get_keymap_by_name:                Keymaps.
+* rl_ignore_completion_duplicates:      Completion Variables.
+* rl_ignore_some_completions_function:  Completion Variables.
+* rl_insert_completions:                Completion Functions.
+* rl_insert_text:                       Modifying Text.
+* rl_instream:                          Function Writing.
+* rl_invoking_keyseqs:                  Associating Function Names and Bindings.
+* rl_invoking_keyseqs_in_map:           Associating Function Names and Bindings.
+* rl_kill_text:                         Modifying Text.
+* rl_line_buffer:                       Function Writing.
+* rl_make_bare_keymap:                  Keymaps.
+* rl_make_keymap:                       Keymaps.
+* rl_mark:                              Function Writing.
+* rl_message:                           Redisplay.
+* rl_modifying:                         Allowing Undoing.
+* rl_named_function:                    Associating Function Names and Bindings.
+* rl_on_new_line:                       Redisplay.
+* rl_outstream:                         Function Writing.
+* rl_parse_and_bind:                    Binding Keys.
+* rl_pending_input:                     Function Writing.
+* rl_point:                             Function Writing.
+* rl_possible_completions:              Completion Functions.
+* rl_prompt:                            Function Writing.
+* rl_readline_name:                     Function Writing.
+* rl_redisplay:                         Redisplay.
+* rl_reset_line_state:                  Redisplay.
+* rl_reset_terminal:                    Utility Functions.
+* rl_set_keymap:                        Keymaps.
+* rl_special_prefixes:                  Completion Variables.
+* rl_startup_hook:                      Function Writing.
+* rl_terminal_name:                     Function Writing.
+* rl_unbind_key:                        Binding Keys.
+* rl_unbind_key_in_map:                 Binding Keys.
+* self-insert (a, b, A, 1, !, ...):     Commands For Text.
+* show-all-if-ambiguous:                Readline Init Syntax.
+* start-kbd-macro (C-x ():              Keyboard Macros.
+* tab-insert (M-TAB):                   Commands For Text.
+* tilde-expand (M-~):                   Miscellaneous Commands.
+* to_lower:                             Utility Functions.
+* to_upper:                             Utility Functions.
+* transpose-chars (C-t):                Commands For Text.
+* transpose-words (M-t):                Commands For Text.
+* undo (C-_, C-x C-u):                  Miscellaneous Commands.
+* universal-argument ():                Numeric Arguments.
+* unix-line-discard (C-u):              Commands For Killing.
+* unix-word-rubout (C-w):               Commands For Killing.
+* upcase-word (M-u):                    Commands For Text.
+* uppercase_p:                          Utility Functions.
+* username_completion_function:         Completion Functions.
+* yank (C-y):                           Commands For Killing.
+* yank-last-arg (M-., M-_):             Commands For History.
+* yank-nth-arg (M-C-y):                 Commands For History.
+* yank-pop (M-y):                       Commands For Killing.
+
+
diff --git a/doc/readline.ps b/doc/readline.ps
new file mode 100644
index 0000000..e96ac47
--- /dev/null
+++ b/doc/readline.ps
@@ -0,0 +1,3766 @@
+%!PS-Adobe-2.0
+%%Creator: dvipsk 5.490s Copyright 1986, 1992 Radical Eye Software
+%%Title: readline.dvi
+%%Pages: 52 1
+%%BoundingBox: 0 0 612 792
+%%EndComments
+%DVIPSCommandLine: dvips -D 300 -o readline.ps readline.dvi
+%%BeginProcSet: tex.pro
+%!
+/TeXDict 250 dict def TeXDict begin /N{def}def /B{bind def}N /S{exch}N /X{S N}
+B /TR{translate}N /isls false N /vsize 11 72 mul N /@rigin{isls{[0 -1 1 0 0 0]
+concat}if 72 Resolution div 72 VResolution div neg scale isls{Resolution hsize
+-72 div mul 0 TR}if Resolution VResolution vsize -72 div 1 add mul TR matrix
+currentmatrix dup dup 4 get round 4 exch put dup dup 5 get round 5 exch put
+setmatrix}N /@landscape{/isls true N}B /@manualfeed{statusdict /manualfeed
+true put}B /@copies{/#copies X}B /FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0]N /nn 0 N
+/IE 0 N /ctr 0 N /df-tail{/nn 8 dict N nn begin /FontType 3 N /FontMatrix
+fntrx N /FontBBox FBB N string /base X array /BitMaps X /BuildChar{
+CharBuilder}N /Encoding IE N end dup{/foo setfont}2 array copy cvx N load 0 nn
+put /ctr 0 N[}B /df{/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0
+0 sf neg 0 0]N df-tail}B /E{pop nn dup definefont setfont}B /ch-width{ch-data
+dup length 5 sub get}B /ch-height{ch-data dup length 4 sub get}B /ch-xoff{128
+ch-data dup length 3 sub get sub}B /ch-yoff{ch-data dup length 2 sub get 127
+sub}B /ch-dx{ch-data dup length 1 sub get}B /ch-image{ch-data dup type
+/stringtype ne{ctr get /ctr ctr 1 add N}if}B /id 0 N /rw 0 N /rc 0 N /gp 0 N
+/cp 0 N /G 0 N /sf 0 N /CharBuilder{save 3 1 roll S dup /base get 2 index get
+S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx 0 ch-xoff ch-yoff ch-height
+sub ch-xoff ch-width add ch-yoff setcachedevice ch-width ch-height true[1 0 0
+-1 -.1 ch-xoff sub ch-yoff .1 add]{ch-image}imagemask restore}B /D{/cc X dup
+type /stringtype ne{]}if nn /base get cc ctr put nn /BitMaps get S ctr S sf 1
+ne{dup dup length 1 sub dup 2 index S get sf div put}if put /ctr ctr 1 add N}
+B /I{cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI save N @rigin
+0 0 moveto /V matrix currentmatrix dup 1 get dup mul exch 0 get dup mul add
+.99 lt{/FV}{/RV}ifelse load def pop}N /eop{SI restore showpage userdict
+/eop-hook known{eop-hook}if}N /@start{userdict /start-hook known{start-hook}
+if /VResolution X /Resolution X 1000 div /DVImag X /IE 256 array N 0 1 255{IE
+S 1 string dup 0 3 index put cvn put}for 65781.76 div /vsize X 65781.76 div
+/hsize X}N /p{show}N /RMat[1 0 0 -1 0 0]N /BDot 260 string N /rulex 0 N /ruley
+0 N /v{/ruley X /rulex X V}B /V{}B /RV statusdict begin /product where{pop
+product dup length 7 ge{0 7 getinterval dup(Display)eq exch 0 4 getinterval
+(NeXT)eq or}{pop false}ifelse}{false}ifelse end{{gsave TR -.1 -.1 TR 1 1 scale
+rulex ruley false RMat{BDot}imagemask grestore}}{{gsave TR -.1 -.1 TR rulex
+ruley scale 1 1 false RMat{BDot}imagemask grestore}}ifelse B /FV{gsave
+transform round exch round exch itransform moveto rulex 0 rlineto 0 ruley neg
+rlineto rulex neg 0 rlineto fill grestore}B /a{moveto}B /delta 0 N /tail{dup
+/delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M}B /d{-3 M}
+B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{4 M}B /w{0
+rmoveto}B /l{p -4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{p 1 w}B /r{p 2 w}
+B /s{p 3 w}B /t{p 4 w}B /x{0 S rmoveto}B /y{3 2 roll p a}B /bos{/SS save N}B
+/eos{SS restore}B end
+%%EndProcSet
+TeXDict begin 40258431 52099146 1000 300 300 @start /Fa 1 59
+df<70F8F8F87005057C840D>58 D E /Fb 1 59 df<78FCFCFCFC7806067B8510>58
+D E /Fc 49 127 df<60F0F0F0F0F0F0F0F0F0F0F0F0F0600000000060F0F0600417789614>33
+D<00800180018007E01FF039BC619CC18EC18EC18EC18471807F803FE00FF001F8019C018E4186
+E186E186E186718C39B81FF00FC00180018000800F1D7E9914>36 D<00C001C0030006000C001C
+0038003000700070006000E000E000E000E000E000E000E000600070007000300038001C000C00
+0600030001C000C00A1D7A9914>40 D<8000C0006000300018001C000E00060007000700030003
+8003800380038003800380038003000700070006000E001C00180030006000C0008000091D7C99
+14>I<70F8FCFC7C0C1830E0C0060A798414>44 D<FFFEFFFEFFFE0F037E8C14>I<70F8F8F87005
+05798414>I<07C00FE01C7038383018701C701CE00EE00EE00EE00EE00EE00EE00EE00EE00E70
+1C701C383838381C700FE007C00F177E9614>48 D<0300030007000F003F00F700470007000700
+0700070007000700070007000700070007000700070007007FF07FF00C177C9614>I<000E003E
+007C00F003E007C01F003E00F800F000F8003E001F0007C003E000F0007C003E000E0F137E9414
+>60 D<4000E000F8007C001E000F8007C001F000F8003E001E003E00F801F007C00F801E007C00
+F800E00040000F157E9514>62 D<1FE03FF8701CE00EE00E400E003C007000E001C00380038003
+8003800300000000000000000003000780078003000F177E9614>I<01C00003E00003E0000360
+000360000770000770000770000770000630000E38000E38000E38000E38000E38001FFC001FFC
+001C1C001C1C003C1E00380E00FE3F80FE3F8011177F9614>65 D<FFF0FFFC381E380E38073807
+38073807380E381E3FFC3FFC381E380E38073807380738073807380E381EFFFCFFF810177F9614
+>I<03C60FFE1C3E181E381E700E700E600EE000E000E000E000E000E000E000600E700E700E38
+0C181C1C380FF003C00F177E9614>I<FFE000FFF800383C00381E00380E003807003807003807
+00380380380380380380380380380380380380380380380380380700380700380E00381E00383C
+00FFF800FFE00011177F9614>I<FFFF00FFFF0038070038070038070038070038000038000038
+70003870003FF0003FF000387000387000380000380000380000380380380380380380380380FF
+FF80FFFF8011177F9614>I<FF00FF003800380038003800380038003800380038003800380038
+003800380038003807380738073807FFFFFFFF10177E9614>76 D<FE0FE0FE0FE03E0F803B1B80
+3B1B803B1B803B1B803BBB803BBB8039B38039B38039B38039F38038E38038E380380380380380
+380380380380380380380380FE0FE0FE0FE01317809614>I<FE3F80FE3F803E0E003B0E003B0E
+003B0E003B0E003B8E00398E00398E0039CE0039CE0039CE0038CE0038CE0038EE00386E00386E
+00386E00386E00383E00FE3E00FE3E0011177F9614>I<FFE000FFF800383C00381C00380E0038
+0E00380E00380E00381C00383C003FF8003FF000383800381C00381C00381C00381C00381C0038
+1C80381DC0381DC0FE0F80FE070012177F9614>82 D<0FCC1FFC307C603CE01CE01CE01CE00070
+007E003FE00FF001F8001C001E000E600EE00EE00EF01CF838FFF0C7E00F177E9614>I<7FFF80
+FFFF80E1C380E1C380E1C380E1C38001C00001C00001C00001C00001C00001C00001C00001C000
+01C00001C00001C00001C00001C00001C00001C0000FF8000FF80011177F9614>I<1FC0007FF0
+00707800201800001C00001C0007FC001FFC003C1C00701C00E01C00E01C00E01C00707C003FFF
+800F8F8011107E8F14>97 D<FC0000FC00001C00001C00001C00001C00001C00001CF8001DFE00
+1F07001E03001C03801C01C01C01C01C01C01C01C01C01C01C01C01C03801E03001F0E001DFC00
+0CF8001217809614>I<03F80FFC1C1C380870006000E000E000E000E00060007000380E1C1E0F
+FC03F00F107E8F14>I<007E00007E00000E00000E00000E00000E00000E0007CE000FFE001C3E
+00301E00700E00E00E00E00E00E00E00E00E00E00E00E00E00700E00301E00383E001FEFC007CF
+C012177F9614>I<07E00FF01C38301C700CE00EE00EFFFEFFFEE00060007000380E1C1E0FFC03
+F00F107E8F14>I<007C00FE01CE03840380038003807FFEFFFE03800380038003800380038003
+80038003800380038003807FFC7FFC0F177F9614>I<07CF001FFF80383B80301800701C00701C
+00701C003018003838003FF00037C0007000007000003FF8001FFC003FFE00700F00E00380E003
+80E00380E003807007003C1E001FFC0007F00011197F8F14>I<FC0000FC00001C00001C00001C
+00001C00001C00001C78001DFE001F86001E07001C07001C07001C07001C07001C07001C07001C
+07001C07001C07001C0700FF8FE0FF8FE01317809614>I<030007800780030000000000000000
+007F807F80038003800380038003800380038003800380038003800380FFFCFFFC0E187D9714>
+I<FC0000FC00001C00001C00001C00001C00001C00001DFF801DFF801C3C001C78001CF0001DE0
+001FC0001FC0001FE0001EF0001C70001C38001C38001C1C00FE3F80FE3F8011177F9614>107
+D<FF80FF8003800380038003800380038003800380038003800380038003800380038003800380
+03800380FFFEFFFE0F177E9614>I<FB8E00FFDF003CF3803CF38038E38038E38038E38038E380
+38E38038E38038E38038E38038E38038E380FEFBE0FE79E01310808F14>I<FC7800FDFE001F86
+001E07001C07001C07001C07001C07001C07001C07001C07001C07001C07001C0700FF8FE0FF8F
+E01310808F14>I<07C01FF03C78701C701CE00EE00EE00EE00EE00EE00E701C783C3C781FF007
+C00F107E8F14>I<FCF800FDFE001F07001E03001C03801C01C01C01C01C01C01C01C01C01C01C
+01C01C03801E03001F0E001DFC001CF8001C00001C00001C00001C00001C00001C0000FF8000FF
+80001218808F14>I<03CE000FFE001C3E00301E00700E00E00E00E00E00E00E00E00E00E00E00
+E00E00700E00301E001C3E000FEE0007CE00000E00000E00000E00000E00000E00000E00007FC0
+007FC012187F8F14>I<FE1F00FE7F800EE3800F81000F00000F00000E00000E00000E00000E00
+000E00000E00000E00000E0000FFF000FFF00011107F8F14>I<0FD83FF86038C038C038F0007F
+803FF007F8001C6006E006F006F81CFFF8CFE00F107E8F14>I<030007000700070007007FFCFF
+FC07000700070007000700070007000700070E070E070E070C03FC00F00F157F9414>I<FC3F00
+FC3F001C07001C07001C07001C07001C07001C07001C07001C07001C07001C07001C07001C1F00
+0FFFE003E7E01310808F14>I<FE3F80FE3F801C1C001C1C001C1C001C1C000E38000E38000E38
+0006300007700007700007700003E00003E00003E00011107F8F14>I<FF7F80FF7F80380E0038
+0E00380E00380E0039CE0039CE0019CC001B6C001B6C001A6C001A6C001E7C000E78000E780011
+107F8F14>I<7E3F007E3F001E38000E780007700007E00003E00001C00003C00003E000077000
+0E78000E38001C1C00FE3F80FE3F8011107F8F14>I<FE3F80FE3F801C1C001C1C001C1C000E1C
+000E38000E380007380007300007300003700003700001E00001E00001E00001C00001C00001C0
+000380007380007700007E00003C000011187F8F14>I<3FFF7FFF700E701C7038007000E001C0
+038007000E001C0738077007FFFFFFFF10107F8F14>I<1C103F38E7E041C00D047D9614>126
+D E /Fd 1 59 df<60F0F06004047D830B>58 D E /Fe 41 123 df<00FC000182000703000607
+000E02000E00000E00000E00000E00000E0000FFFF000E07000E07000E07000E07000E07000E07
+000E07000E07000E07000E07000E07000E07000E07000E07007F0FE0131A809915>12
+D<00FF000387000707000607000E07000E07000E07000E07000E07000E0700FFFF000E07000E07
+000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07007F9F
+E0131A809915>I<60F0F07010101020204080040B7D830B>44 D<FFC0FFC00A0280880D>I<0780
+18603030303060186018E01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01C6018601870
+383030186007800E187E9713>48 D<03000700FF00070007000700070007000700070007000700
+07000700070007000700070007000700070007000700FFF00C187D9713>I<0F80106020304038
+803CC01CE01C401C003C003800380070006000C001800100020004040804100430083FF87FF8FF
+F80E187E9713>I<0F8010E02070607870382038007800700070006000C00F8000E00070003800
+3C003CE03CE03CC03C4038407030E00F800E187E9713>I<00300030007000F000F00170037002
+7004700C7008701070307020704070C070FFFF00700070007000700070007007FF10187F9713>
+I<30183FF03FE03FC02000200020002000200027C03860203000380018001C001C401CE01CE01C
+80184038403030E00F800E187E9713>I<01E006100C1818383038300070006000E000E7C0E860
+F030F018E018E01CE01CE01C601C601C701830183030186007C00E187E9713>I<40007FFE7FFC
+7FFC40088010801080200040004000800180018001000300030003000300070007000700070007
+00070002000F197E9813>I<078018603030201860186018601870103C303E600F8007C019F030
+F86038401CC00CC00CC00CC00C6008201018600FC00E187E9713>I<07801860303070306018E0
+18E018E01CE01CE01C601C603C303C185C0F9C001C00180018003870307060604021801F000E18
+7E9713>I<FFE07F800E001E000E0018000E0010000E0020000E0040000E0080000E0100000E02
+00000E0400000E0800000E1C00000E2E00000E4E00000E8700000F0380000E0380000E01C0000E
+00E0000E00E0000E0070000E0070000E0038000E001C000E003E00FFE0FF80191A7E991E>75
+D<FF801FE01E0007000E0006000F000400070008000780080003C0100001C0300001E0200000F0
+4000007040000078800000388000001D0000001F0000000E0000000E0000000E0000000E000000
+0E0000000E0000000E0000000E0000000E0000000E000000FFE0001B1A7F991D>89
+D<3F8070C070E020700070007007F01C7030707070E070E071E071E0F171FB1E3C10107E8F13>
+97 D<FC00001C00001C00001C00001C00001C00001C00001C00001C00001C00001CF8001F0E00
+1E07001C03801C01801C01C01C01C01C01C01C01C01C01C01C01C01C03801C03001E07001B0C00
+10F000121A7F9915>I<07F80C1C381C30087000E000E000E000E000E000E0007000300438080C
+1807E00E107F8F11>I<007E00000E00000E00000E00000E00000E00000E00000E00000E00000E
+0003CE000C3E00380E00300E00700E00E00E00E00E00E00E00E00E00E00E00E00E00600E00700E
+00381E001C2E0007CFC0121A7F9915>I<07C01C3030187018600CE00CFFFCE000E000E000E000
+6000300438080C1807E00E107F8F11>I<01F0031807380E100E000E000E000E000E000E00FFC0
+0E000E000E000E000E000E000E000E000E000E000E000E000E000E007FE00D1A80990C>I<0FCE
+187330307038703870387038303018602FC02000600070003FF03FFC1FFE600FC003C003C003C0
+036006381C07E010187F8F13>I<FC00001C00001C00001C00001C00001C00001C00001C00001C
+00001C00001CF8001D0C001E0E001E0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C
+0E001C0E001C0E001C0E00FF9FC0121A7F9915>I<18003C003C00180000000000000000000000
+0000FC001C001C001C001C001C001C001C001C001C001C001C001C001C001C00FF80091A80990A
+>I<FC00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C3F801C1E001C
+18001C10001C20001C40001DC0001FE0001CE0001C70001C78001C38001C1C001C1E001C1F00FF
+3FC0121A7F9914>107 D<FC001C001C001C001C001C001C001C001C001C001C001C001C001C00
+1C001C001C001C001C001C001C001C001C001C001C00FF80091A80990A>I<FC7C1F001D8E6380
+1E0781C01E0781C01C0701C01C0701C01C0701C01C0701C01C0701C01C0701C01C0701C01C0701
+C01C0701C01C0701C01C0701C0FF9FE7F81D107F8F20>I<FCF8001D0C001E0E001E0E001C0E00
+1C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E00FF9FC012107F8F15>
+I<07E01C38300C700E6006E007E007E007E007E007E0076006700E381C1C3807E010107F8F13>
+I<FCF8001F0E001E07001C03801C03801C01C01C01C01C01C01C01C01C01C01C01C01C03801C03
+001E07001F0C001CF0001C00001C00001C00001C00001C00001C0000FF800012177F8F15>I<03
+C2000C2600381E00300E00700E00E00E00E00E00E00E00E00E00E00E00E00E00700E00700E0038
+1E001C2E0007CE00000E00000E00000E00000E00000E00000E00007FC012177F8F14>I<FCE01D
+701E701E201C001C001C001C001C001C001C001C001C001C001C00FFC00C107F8F0F>I<1F2060
+E04020C020C020F0007F003FC01FE000F080708030C030C020F0408F800C107F8F0F>I<040004
+0004000C000C001C003C00FFC01C001C001C001C001C001C001C001C001C201C201C201C201C20
+0E4003800B177F960F>I<FC7E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C
+0E001C0E001C0E001C0E001C1E000C2E0007CFC012107F8F15>I<FF1F803C06001C04001C0400
+1E0C000E08000E080007100007100007900003A00003A00001C00001C00001C00000800011107F
+8F14>I<FF3F9F803C0E0700380E06001C1604001C1704001E170C000E2308000E2388000F2398
+00074190000741D00003C1E0000380E0000380E0000180C0000100400019107F8F1C>I<FF3F80
+3C1C001C18000E100007200007600003C00001C00001E00003E000027000043800083800181C00
+381E00FC3FC012107F8F14>I<FF1F803C06001C04001C04001E0C000E08000E08000710000710
+0007900003A00003A00001C00001C00001C000008000008000010000010000E10000E20000E400
+0078000011177F8F14>I<7FF86070407040E041C041C00380070007000E081C081C0838107010
+7030FFF00D107F8F11>I E /Ff 2 42 df<007000E001C00380078007000E001E001E003C003C
+003C0078007800780078007000F000F000F000F000F000F000F000F000F000F000F000F0007000
+78007800780078003C003C003C001E001E000E0007000780038001C000E000700C2E7EA112>40
+D<E000700038001C001E000E0007000780078003C003C003C001E001E001E001E000E000F000F0
+00F000F000F000F000F000F000F000F000F000F000E001E001E001E001E003C003C003C0078007
+8007000E001E001C0038007000E0000C2E7DA112>I E /Fg 26 122 df<000FF07F00007FFBFF
+C001F83FE3C003F07F87E007E07F87E00FC07F07E00FC07F03C00FC03F00000FC03F00000FC03F
+00000FC03F00000FC03F00000FC03F0000FFFFFFFC00FFFFFFFC000FC03F00000FC03F00000FC0
+3F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000F
+C03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F00000FC03F0000
+7FF9FFF0007FF9FFF00023237FA221>11 D<0007F800007FFC0001FC0E0003F01F0007E03F000F
+C03F000FC03F000FC03F000FC01E000FC00C000FC000000FC000000FC0FF80FFFFFF80FFFFFF80
+0FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F
+800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F807FF8FFF07FF8
+FFF01C237FA220>I<07FE00001FFF80003F07E0003F03F0003F01F0003F01F8001E01F8000001
+F8000001F800003FF80003FDF8001F81F8003E01F8007C01F800F801F800F801F800F801F800F8
+01F8007C02F8007E0CF8001FF87F8007E03F8019167E951C>97 D<FF800000FF8000001F800000
+1F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000
+001F87F0001FBFFC001FF03E001FC01F001F800F801F800FC01F8007C01F8007E01F8007E01F80
+07E01F8007E01F8007E01F8007E01F8007E01F8007C01F8007C01F800FC01F800F801FC01F001E
+707E001C3FFC00180FE0001B237EA220>I<00FF8007FFE00F83F01F03F03E03F07E03F07C01E0
+7C0000FC0000FC0000FC0000FC0000FC0000FC00007C00007E00007E00003F00301F00600FC0E0
+07FF8000FE0014167E9519>I<0001FF000001FF0000003F0000003F0000003F0000003F000000
+3F0000003F0000003F0000003F0000003F0000003F0000003F0000FE3F0007FFBF000FC1FF001F
+007F003E003F007E003F007C003F007C003F00FC003F00FC003F00FC003F00FC003F00FC003F00
+FC003F00FC003F007C003F007E003F003E003F001F007F000F81FF0007FF3FE001FC3FE01B237E
+A220>I<00FE0007FF800F83C01F01E03E00F07E00F07C00F87C0078FC0078FFFFF8FFFFF8FC00
+00FC0000FC00007C00007C00003E00183E00181F00300F80E003FFC000FF0015167E951A>I<00
+1F8000FFE001F1F003E3F007E3F00FC3F00FC1E00FC0000FC0000FC0000FC0000FC0000FC000FF
+FE00FFFE000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000F
+C0000FC0000FC0000FC0000FC0000FC0000FC0007FFC007FFC0014237EA212>I<00FE0F8003FF
+9FC00F83E3C01F01F3C01E00F0003E00F8003E00F8003E00F8003E00F8003E00F8001E00F0001F
+01F0000F83E0000BFF800008FE000018000000180000001C0000001FFFE0001FFFFC000FFFFF00
+07FFFF001FFFFF807C001FC078000FC0F80007C0F80007C0F80007C07C000F803E001F001F807E
+000FFFFC0001FFE0001A217F951D>I<FF800000FF8000001F8000001F8000001F8000001F8000
+001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F83F0001F8FFC001F98
+7E001FA03E001FC03F001FC03F001F803F001F803F001F803F001F803F001F803F001F803F001F
+803F001F803F001F803F001F803F001F803F001F803F001F803F001F803F00FFF1FFE0FFF1FFE0
+1B237DA220>I<1E003F007F807F807F807F803F001E00000000000000000000000000FF80FF80
+1F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80FFF0FF
+F00C247EA30F>I<FF800000FF8000001F8000001F8000001F8000001F8000001F8000001F8000
+001F8000001F8000001F8000001F8000001F8000001F80FF801F80FF801F803C001F8030001F80
+E0001F81C0001F8300001F8600001F9E00001FBE00001FFF00001FDF80001F8FC0001F07C0001F
+07E0001F03F0001F01F8001F00F8001F00FC001F007E00FFE1FFC0FFE1FFC01A237EA21E>107
+D<FF80FF801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80
+1F801F801F801F801F801F801F801F801F801F801F801F801F801F80FFF0FFF00C237EA20F>I<
+FF03F803F800FF0FFE0FFE001F183F183F001F201F201F001F401FC01F801F401FC01F801F801F
+801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F80
+1F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F801F
+801F80FFF0FFF0FFF0FFF0FFF0FFF02C167D9531>I<FF03F000FF0FFC001F187E001F203E001F
+403F001F403F001F803F001F803F001F803F001F803F001F803F001F803F001F803F001F803F00
+1F803F001F803F001F803F001F803F001F803F001F803F00FFF1FFE0FFF1FFE01B167D9520>I<
+00FF0007FFE00F81F01F00F83E007C7C003E7C003E7C003EFC003FFC003FFC003FFC003FFC003F
+FC003FFC003F7C003E7E007E3E007C1F00F80F81F007FFE000FF0018167E951D>I<FF87F000FF
+BFFC001FF07E001FC01F001F800F801F800FC01F800FC01F8007E01F8007E01F8007E01F8007E0
+1F8007E01F8007E01F8007E01F8007C01F800FC01F800FC01F801F801FC01F001FF07E001FBFFC
+001F8FE0001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F800000FFF0
+0000FFF000001B207E9520>I<00FE030007FF07000FC1CF001F00DF003F007F007E003F007E00
+3F007C003F00FC003F00FC003F00FC003F00FC003F00FC003F00FC003F00FC003F007E003F007E
+003F003E007F001F00FF000FC1FF0007FF3F0001FC3F0000003F0000003F0000003F0000003F00
+00003F0000003F0000003F0000003F000001FFE00001FFE01B207E951E>I<FF0F80FF1FE01F33
+F01F63F01F43F01F43F01FC1E01F80001F80001F80001F80001F80001F80001F80001F80001F80
+001F80001F80001F80001F8000FFF800FFF80014167E9518>I<07F9801FFF80380780700380F0
+0180F00180F80000FF0000FFF8007FFE003FFF001FFF8007FF80003FC0C007C0C003C0E003C0E0
+03C0F00380FC0F00EFFE00C3F80012167E9517>I<00C00000C00000C00000C00001C00001C000
+03C00007C0000FC0001FC000FFFF00FFFF000FC0000FC0000FC0000FC0000FC0000FC0000FC000
+0FC0000FC0000FC0000FC0000FC1800FC1800FC1800FC1800FC18007C18007E30003FE0000FC00
+11207F9F16>I<FF81FF00FF81FF001F803F001F803F001F803F001F803F001F803F001F803F00
+1F803F001F803F001F803F001F803F001F803F001F803F001F803F001F803F001F803F001F807F
+001F80FF000FC1BF0007FF3FE001FC3FE01B167D9520>I<FFF01FE0FFF01FE00FC007000FC006
+000FE00E0007E00C0007F01C0003F0180003F8180001F8300001F8300000FC600000FC6000007E
+C000007EC000007FC000003F8000003F8000001F0000001F0000000E0000000E00001B167F951E
+>I<FFF3FF87FCFFF3FF87FC1F807C00E00FC07C00C00FC07E00C00FE03E01C007E03F018007E0
+7F018003F07F030003F0CF830001F8CF860001F8CFC60001FD87C60000FD87CC0000FF03EC0000
+7F03F800007F03F800007E01F800003E01F000003C00F000001C00E000001800600026167F9529
+>I<FFF0FFC0FFF0FFC00FC01C0007E0380007F0700003F0E00001F8C00000FD8000007F000000
+7F0000003F0000001F8000003FC0000037E0000067F00000C3F00001C1F8000380FC000700FE00
+0E007E00FFC1FFE0FFC1FFE01B167F951E>I<FFF01FE0FFF01FE00FC007000FC006000FE00E00
+07E00C0007F01C0003F0180003F8180001F8300001F8300000FC600000FC6000007EC000007EC0
+00007FC000003F8000003F8000001F0000001F0000000E0000000E0000000C0000000C00000018
+000078180000FC380000FC300000FC60000069E000007F8000001F0000001B207F951E>I
+E /Fh 23 122 df<00E00000E00000E00000E00040E040F0E1E0F8E3E07EEFC01FFF0007FC0003
+F80007FC001FFF007EEFC0F8E3E0F0E1E040E04000E00000E00000E00000E00013157D991A>42
+D<007C3801FF3807FFF80F83F81E00F81C0078380078380038700038700038700000E00000E000
+00E00000E00000E00000E00000E00000E000007000007000387000383800383800381C00701E00
+F00F83E007FFC001FF80007C00151E7E9D1A>67 D<7FFFFCFFFFFC7FFFFC0E001C0E001C0E001C
+0E001C0E001C0E00000E00000E07000E07000E07000FFF000FFF000FFF000E07000E07000E0700
+0E00000E00000E00000E000E0E000E0E000E0E000E0E000E7FFFFEFFFFFE7FFFFE171E7F9D1A>
+69 D<7FFFFCFFFFFC7FFFFC0E001C0E001C0E001C0E001C0E001C0E00000E00000E07000E0700
+0E07000FFF000FFF000FFF000E07000E07000E07000E00000E00000E00000E00000E00000E0000
+0E00000E00007FE000FFF0007FE000161E7F9D1A>I<FFFF80FFFF80FFFF8001C00001C00001C0
+0001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0
+0001C00001C00001C00001C00001C00001C00001C00001C000FFFF80FFFF80FFFF80111E7C9D1A
+>73 D<FF83F8FF87FCFF83F81C01E01C03C01C03801C07001C0F001C1E001C1C001C38001C7800
+1CF0001CF8001DF8001FDC001F9C001F0E001E0F001E07001C07801C03801C01C01C01C01C00E0
+1C00E01C0070FF81FCFF81FEFF81FC171E7F9D1A>75 D<7FE000FFF0007FE0000E00000E00000E
+00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E
+00000E00000E00000E00000E00380E00380E00380E00380E00387FFFF8FFFFF87FFFF8151E7E9D
+1A>I<7FFF00FFFFC07FFFE00E01F00E00780E00380E003C0E001C0E001C0E001C0E001C0E003C
+0E00380E00780E01F00FFFE00FFFC00FFF000E00000E00000E00000E00000E00000E00000E0000
+0E00000E00007FC000FFE0007FC000161E7F9D1A>80 D<1FF0003FFC007FFE00780F0030070000
+0380000380007F8007FF801FFF803F8380780380700380E00380E00380E00380700780780F803F
+FFFC1FFDFC07F0FC16157D941A>97 D<00FF8003FFC00FFFE01F01E03C00C07800007000007000
+00E00000E00000E00000E00000E000007000007000007800703C00701F01F00FFFE003FFC000FE
+0014157D941A>99 D<001FC0001FC0001FC00001C00001C00001C00001C00001C00001C001F1C0
+07FDC00FFFC01E0FC03C07C07803C07001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0
+7003C07003C03807C03E0FC01FFFFC07FDFC01F1FC161E7E9D1A>I<01F80007FF000FFF801E07
+C03C01C07800E07000E0E00070E00070FFFFF0FFFFF0FFFFF0E000007000007000007800703C00
+701F01F00FFFE003FFC000FE0014157D941A>I<FE0000FE0000FE00000E00000E00000E00000E
+00000E00000E00000E3E000EFF800FFFC00FC1C00F80E00F00E00E00E00E00E00E00E00E00E00E
+00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E0FFE3FEFFE3FEFFE3FE171E7F9D1A>
+104 D<01C00003E00003E00003E00001C0000000000000000000000000000000007FE000FFE000
+7FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000
+00E00000E00000E000FFFFC0FFFFC0FFFFC0121F7C9E1A>I<7CE0E000FFFBF8007FFFF8001F1F
+1C001E1E1C001E1E1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C
+1C1C001C1C1C001C1C1C001C1C1C001C1C1C007F1F1F00FF9F9F807F1F1F00191580941A>109
+D<FE3E00FEFF80FFFFC00FC1C00F80E00F00E00E00E00E00E00E00E00E00E00E00E00E00E00E00
+E00E00E00E00E00E00E00E00E00E00E0FFE3FEFFE3FEFFE3FE17157F941A>I<01F00007FC001F
+FF003E0F803C07807803C07001C0E000E0E000E0E000E0E000E0E000E0E000E0F001E07001C078
+03C03C07803E0F801FFF0007FC0001F00013157D941A>I<FE3E00FEFF80FFFFE00FC1F00F8070
+0F00380E00380E001C0E001C0E001C0E001C0E001C0E001C0E001C0F00380F00780F80F00FC1E0
+0FFFC00EFF800E3E000E00000E00000E00000E00000E00000E00000E00000E0000FFE000FFE000
+FFE00016207F941A>I<FF83F0FF8FF8FFBFFC03FC3C03F01803E00003C00003C0000380000380
+00038000038000038000038000038000038000038000038000FFFF00FFFF80FFFF0016157E941A
+>114 D<00C00001C00001C00001C00001C00001C00001C0007FFFE0FFFFE0FFFFE001C00001C0
+0001C00001C00001C00001C00001C00001C00001C00001C00001C07001C07001C07001C07000E0
+E000FFE0007FC0001F00141C7F9B1A>116 D<FE0FE0FE0FE0FE0FE00E00E00E00E00E00E00E00
+E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E01E00F03E007FFFE03FF
+FE00FCFE17157F941A>I<7FC7FCFFC7FE7FC7FC0E00E00E00E00F01E00701C00701C00783C003
+838003838003838001C70001C70001C70000EE0000EE0000EE00007C00007C0000380017157F94
+1A>I<7FC7FCFFC7FE7FC7FC0E00E00F00E00701E00701C00781C00381C003838001C38001C380
+01C70000E70000E70000E600006600006E00003C00003C00003C00003C00003800003800007800
+00700030700078E00079E0007FC0003F80001E000017207F941A>121 D
+E /Fi 51 122 df<3C7EFFFFFFFF7E3C08087C8711>46 D<001C00003C0000FC00FFFC00FFFC00
+00FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC00
+00FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC00
+00FC0000FC007FFFFC7FFFFC16237CA21F>49 D<01FF0007FFC01E07F03803F86001FC7C00FEFE
+00FEFE00FFFE007FFE007F7C007F3800FF0000FF0000FE0000FE0001FC0001F80003F00007E000
+0780000F00001E00003C0000700000E00301C0030380070700060600060FFFFE1FFFFE3FFFFE7F
+FFFCFFFFFCFFFFFC18237DA21F>I<01FF0007FFE01E03F03801F83C01FC7E00FE7E00FE7E00FE
+3E00FE1C01FE0001FC0001FC0003F80007F0000FC001FF0001FF000007E00001F00001F80000FC
+0000FE0000FF0000FF1000FF7C00FFFE00FFFE00FFFE00FEFE00FE7C01FC7001F83E07F00FFFC0
+01FF0018237DA21F>I<0000380000007800000078000000F8000001F8000003F8000007F80000
+06F800000CF800001CF8000038F8000030F8000060F80000E0F80001C0F8000180F8000300F800
+0700F8000E00F8001C00F8001800F8003000F8007000F800E000F800FFFFFFC0FFFFFFC00001F8
+000001F8000001F8000001F8000001F8000001F8000001F800007FFFC0007FFFC01A237EA21F>
+I<18000C1F007C1FFFF81FFFF01FFFE01FFFC01FFF801FFE001800001800001800001800001800
+0018FF001BFFE01F01F01C00F80800FC00007E00007E00007E00007F00007F78007FFC007FFC00
+7FFC007FFC007EF8007E6000FC7000FC3801F81E07E007FFC001FE0018237DA21F>I<001FC000
+7FF001F83803E00C07803E0F807E1F007E3F007E3F007E7E003C7E00007E00007E0000FE3FC0FE
+7FF0FE80F8FF80FCFF007CFF007EFE007EFE007FFE007FFE007FFE007F7E007F7E007F7E007F7E
+007F3E007E3F007E1F007C0F80F807C1F003FFC0007F0018237DA21F>I<300000003C0000003F
+FFFFC03FFFFFC03FFFFF807FFFFF007FFFFE007FFFFC006000180060001800E0003000C0006000
+C000C0000001800000018000000300000007000000060000000E0000001E0000001E0000001E00
+00003C0000003C0000007C0000007C0000007C0000007C000000FC000000FC000000FC000000FC
+000000FC000000FC000000FC000000780000003000001A257DA41F>I<00FF8003FFE00F01F81C
+007C38003C38001E78001E78001E7C001E7E001E7F803C7FE03C3FF8781FFCF01FFFC00FFFC003
+FFE003FFF80FFFFC1E1FFC3C07FE7801FE7800FFF0003FF0001FF0000FF0000FF0000FF0000E78
+000E78001C3E00381F80F007FFE000FF0018237DA21F>I<00FF0003FFC00F83E01F00F03F00F8
+7E007C7E007C7E007EFE007EFE007EFE007EFE007FFE007FFE007FFE007F7E007F7E00FF3E00FF
+3F01FF1F017F0FFE7F03FC7F00007F00007E00007E3C007E7E00FC7E00FC7E00F87E00F07C01F0
+3003E01C0F800FFF0003F80018237DA21F>I<00001C00000000001C00000000003E0000000000
+3E00000000003E00000000007F00000000007F0000000000FF8000000000FF8000000000FF8000
+0000019FC0000000019FC0000000031FE0000000030FE0000000030FE00000000607F000000006
+07F00000000C07F80000000C03F80000001C03FC0000001801FC0000001801FC0000003001FE00
+00003000FE0000007FFFFF0000007FFFFF00000060007F000000C0007F800000C0003F800001C0
+003FC0000180001FC0000180001FC0000300000FE0000300000FE0000780000FF000FFF801FFFF
+80FFF801FFFF8029257EA42E>65 D<FFFFFFE000FFFFFFFC0003F0007F0003F0003F8003F0001F
+C003F0000FE003F0000FE003F0000FF003F0000FF003F00007F003F0000FF003F0000FF003F000
+0FE003F0001FE003F0001FC003F0007F8003F001FE0003FFFFF80003FFFFFF0003F0003FC003F0
+000FE003F00007F003F00007F803F00003F803F00003FC03F00003FC03F00003FC03F00003FC03
+F00003FC03F00003FC03F00003F803F00007F803F0000FF003F0001FE003F0007FC0FFFFFFFF00
+FFFFFFF80026257EA42C>I<0000FF8008000FFFF018003FC03C7800FE0006F801F80003F803F0
+0001F807E00000F80FC00000781FC00000783F800000383F800000387F800000187F000000187F
+00000018FF00000000FF00000000FF00000000FF00000000FF00000000FF00000000FF00000000
+FF00000000FF000000007F000000007F000000187F800000183F800000183F800000181FC00000
+300FC000003007E000006003F00000C001F800018000FE000700003FC01E00000FFFF8000000FF
+C00025257DA42C>I<FFFFFFFF00FFFFFFFF0003F8007F0003F8000F8003F800078003F8000380
+03F800038003F800018003F800018003F800018003F80000C003F80600C003F80600C003F80600
+0003F806000003F80E000003F81E000003FFFE000003FFFE000003F81E000003F80E000003F806
+000003F806000003F806006003F806006003F800006003F80000C003F80000C003F80000C003F8
+0000C003F80001C003F80003C003F80003C003F8000F8003F8003F80FFFFFFFF80FFFFFFFF8023
+257EA428>69 D<FFFFFFFE00FFFFFFFE0003F800FE0003F8001F0003F8000F0003F800070003F8
+00070003F800030003F800030003F800030003F800018003F806018003F806018003F806000003
+F806000003F80E000003F81E000003FFFE000003FFFE000003F81E000003F80E000003F8060000
+03F806000003F806000003F806000003F800000003F800000003F800000003F800000003F80000
+0003F800000003F800000003F800000003F800000003F8000000FFFFF00000FFFFF0000021257E
+A427>I<FFFFE0FFFFE0FFFFE0FFFFE003F80003F80003F80003F80003F80003F80003F80003F8
+0003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F8
+0003F80003F80003F80003F80003F80003F80003F80003F80003F80003FFFFFFF80003FFFFFFF8
+0003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F8
+0003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F8
+0003F80003F80003F80003F80003F80003F800FFFFE0FFFFE0FFFFE0FFFFE02B257EA430>72
+D<FFFFE0FFFFE003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F8
+0003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F8
+0003F80003F80003F80003F80003F80003F80003F80003F80003F800FFFFE0FFFFE013257EA417
+>I<FFFFE007FF80FFFFE007FF8003F80000780003F80000600003F80000C00003F80001800003
+F80007000003F8000E000003F80018000003F80030000003F80060000003F800C0000003F80380
+000003F80700000003F80E00000003F81F00000003F83F80000003F87F80000003F8DFC0000003
+FB8FE0000003FF0FF0000003FC07F0000003F803F8000003F803FC000003F801FE000003F800FE
+000003F8007F000003F8007F800003F8003F800003F8001FC00003F8000FE00003F8000FF00003
+F80007F00003F80003F80003F80003FC00FFFFE03FFFC0FFFFE03FFFC02A257EA430>75
+D<FFFFF000FFFFF00003F8000003F8000003F8000003F8000003F8000003F8000003F8000003F8
+000003F8000003F8000003F8000003F8000003F8000003F8000003F8000003F8000003F8000003
+F8000003F8000003F8000003F8000003F8000603F8000603F8000603F8000C03F8000C03F8000C
+03F8001C03F8001C03F8003C03F8007C03F800F803F803F8FFFFFFF8FFFFFFF81F257EA425>I<
+FFF8000000FFF8FFFC000001FFF803FC000001FE00037E0000037E00037E0000037E00037E0000
+037E00033F0000067E00033F0000067E00031F80000C7E00031F80000C7E00030FC000187E0003
+0FC000187E000307E000307E000307E000307E000307E000307E000303F000607E000303F00060
+7E000301F800C07E000301F800C07E000300FC01807E000300FC01807E0003007E03007E000300
+7E03007E0003007E03007E0003003F06007E0003003F06007E0003001F8C007E0003001F8C007E
+0003000FD8007E0003000FD8007E00030007F0007E00030007F0007E00030007F0007E00030003
+E0007E00078003E0007E00FFFC01C01FFFF8FFFC01C01FFFF835257EA43A>I<FFF80007FFE0FF
+FC0007FFE003FE00003C0003FF00001800037F00001800033F80001800031FC0001800031FE000
+1800030FF00018000307F80018000303F80018000301FC0018000300FE0018000300FF00180003
+007F80180003003FC0180003001FC0180003000FE0180003000FF01800030007F81800030003FC
+1800030001FC1800030000FE18000300007F18000300007F98000300003FD8000300001FF80003
+00000FF80003000007F80003000003F80003000003F80003000001F80003000000F80003000000
+7800078000003800FFFC00001800FFFC000018002B257EA430>I<FFFFFF800000FFFFFFF80000
+03F801FE000003F8007F000003F8003F800003F8001FC00003F8001FC00003F8001FE00003F800
+1FE00003F8001FE00003F8001FE00003F8001FE00003F8001FC00003F8001FC00003F8003F8000
+03F8007F000003F801FE000003FFFFF8000003FFFFC0000003F803F0000003F801F8000003F800
+FC000003F8007E000003F8007E000003F8007F000003F8007F000003F8007F000003F8007F0000
+03F8007F800003F8007F800003F8007F800003F8007F806003F8003FC06003F8003FC0C003F800
+1FE1C0FFFFE00FFF80FFFFE001FE002B257EA42E>82 D<00FF008007FFE3800F80F7801E001F80
+3C000F807800078078000380F8000380F8000180F8000180FC000180FC000000FF0000007FE000
+007FFF00003FFFE0003FFFF8001FFFFE0007FFFF0003FFFF80007FFF800003FFC000003FC00000
+0FE0000007E0000007E0C00003E0C00003E0C00003E0C00003C0E00003C0F00007C0F8000780FC
+000F00FFC03E00E3FFF800803FE0001B257DA422>I<7FFFFFFFF87FFFFFFFF87E00FE01F87800
+FE00787000FE00386000FE00186000FE0018E000FE001CE000FE000CC000FE000CC000FE000CC0
+00FE000CC000FE000C0000FE00000000FE00000000FE00000000FE00000000FE00000000FE0000
+0000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00
+000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE000000FFFF
+FE0000FFFFFE0026247EA32B>I<FFFFE00FFFC0FFFFE00FFFC003F80000780003F80000300003
+F80000300003F80000300003F80000300003F80000300003F80000300003F80000300003F80000
+300003F80000300003F80000300003F80000300003F80000300003F80000300003F80000300003
+F80000300003F80000300003F80000300003F80000300003F80000300003F80000300003F80000
+300003F80000300003F80000300003F80000300003F80000300001F80000600001FC0000600000
+FC0000C000007C0000C000003E00018000001F00070000000FE03E00000003FFF8000000007FC0
+00002A257EA42F>I<FFFFC003FFE0FFFFC003FFE007F800003C0003F80000180003FC00001800
+01FC0000300001FC0000300001FE0000700000FE0000600000FF0000E000007F0000C000007F80
+00C000003F80018000003F80018000001FC0030000001FC0030000001FE0070000000FE0060000
+000FF00600000007F00C00000007F80C00000003F81800000003F81800000003FC3800000001FC
+3000000001FE7000000000FE6000000000FF60000000007FC0000000007FC0000000003F800000
+00003F80000000003F80000000001F00000000001F00000000000E00000000000E0000002B257F
+A42E>I<FFFF83FFFE01FFF0FFFF83FFFE01FFF007F0001FC0000F0007F0001FC000060003F800
+0FE0000C0003F8000FE0000C0003FC000FF0001C0001FC0007F000180001FC0007F000180000FE
+000FF800300000FE000FF800300000FE000FFC003000007F0019FC006000007F0019FC00600000
+7F8039FE00E000003F8030FE00C000003F8030FE00C000001FC0607F018000001FC0607F018000
+001FE0607F818000000FE0C03F830000000FE0C03F830000000FF1C03FC700000007F1801FC600
+000007F1801FC600000003FB000FEC00000003FB000FEC00000003FF000FFC00000001FE0007F8
+00000001FE0007F800000001FE0007F800000000FC0003F000000000FC0003F000000000780001
+E000000000780001E000000000780001E000000000300000C000003C257FA43F>I<FFFFC001FF
+E0FFFFC001FFE007F800001C0003FC0000180003FE0000300001FE0000700000FF0000600000FF
+0000C000007F8001C000003FC0018000003FC0038000001FE0070000000FF0060000000FF00E00
+000007F81C00000003FC1800000003FC3800000001FE7000000000FF6000000000FFE000000000
+7FC0000000003F80000000003F80000000003F80000000003F80000000003F80000000003F8000
+0000003F80000000003F80000000003F80000000003F80000000003F80000000003F8000000000
+3F80000000003F800000000FFFFE0000000FFFFE00002B257FA42E>89 D<07FF00001FFFC0003E
+03E0003F01F0003F01F8003F00FC001E00FC000000FC000000FC000000FC00003FFC0003FCFC00
+0FC0FC003F00FC007E00FC007E00FC00FC00FC00FC00FC00FC00FC00FC017C007E017C003F067C
+001FFC3FE007F01FE01B187E971E>97 D<FFC00000FFC000000FC000000FC000000FC000000FC0
+00000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC3F8000F
+CFFE000FF81F800FE00FC00FC007E00FC007E00FC003F00FC003F00FC003F80FC003F80FC003F8
+0FC003F80FC003F80FC003F80FC003F80FC003F80FC003F00FC003F00FC007E00FC007C00FE00F
+C00F383F000E1FFE000C07F0001D267EA522>I<007FE003FFF807C07C1F80FC1F00FC3F00FC7E
+00787E0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00007E00007F00003F000C1F
+800C1FC01807E07003FFE0007F0016187E971B>I<0001FF800001FF8000001F8000001F800000
+1F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000001F8000
+7F1F8003FFDF8007E0FF801F803F803F001F803F001F807E001F807E001F80FE001F80FE001F80
+FE001F80FE001F80FE001F80FE001F80FE001F80FE001F807E001F807E001F803F001F803F003F
+801F807F800FC0FF8003FF9FF800FE1FF81D267EA522>I<007F0003FFC007C1F00F80F81F00F8
+3F007C7E007C7E007EFE007EFE007EFFFFFEFFFFFEFE0000FE0000FE00007E00007E00007E0006
+3F00061F000C0F801807E07003FFE0007F8017187E971C>I<000FC0007FF000F8F001F1F803F1
+F803E1F807E0F007E00007E00007E00007E00007E00007E00007E000FFFF00FFFF0007E00007E0
+0007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E0
+0007E00007E00007E00007E00007E0007FFF007FFF0015267EA513>I<01FF07C007FFDFE00F83
+F1E01F01F1E03E00F8007E00FC007E00FC007E00FC007E00FC007E00FC007E00FC003E00F8001F
+01F0000F83E0000FFFC00011FF00003000000030000000380000003C0000003FFFE0001FFFFC00
+1FFFFE000FFFFF001FFFFF803C003F8078000FC0F80007C0F80007C0F80007C0F80007C07C000F
+803E001F001F807E0007FFF80000FFC0001B247E971F>I<FFC00000FFC000000FC000000FC000
+000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC0
+00000FC1F8000FC7FE000FCC3F000FD01F000FF01F800FE01F800FE01F800FC01F800FC01F800F
+C01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F80
+0FC01F800FC01F800FC01F80FFFCFFF8FFFCFFF81D267DA522>I<0F001F803FC03FC03FC03FC0
+1F800F000000000000000000000000000000FFC0FFC00FC00FC00FC00FC00FC00FC00FC00FC00F
+C00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0FFF8FFF80D277EA611>I<FFC00000FF
+C000000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC000000FC00000
+0FC000000FC000000FC000000FC07FC00FC07FC00FC01E000FC018000FC030000FC060000FC0C0
+000FC380000FC700000FCF00000FDF80000FFFC0000FE7C0000FC7E0000F83F0000F81F0000F80
+F8000F80FC000F807E000F803E000F803F000F801F80FFF8FFF0FFF8FFF01C267EA520>107
+D<FFC0FFC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0
+0FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0FFFCFFFC0E
+267EA511>I<FF81FC01FC00FF87FF07FF000F8C1F8C1F800F980F980F800FB00FF00FC00FA00F
+E00FC00FA00FE00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0
+0FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC00F
+C00FC00FC00FC00FC00FC00FC00FC00FC00FC00FC0FFFCFFFCFFFCFFFCFFFCFFFC2E187D9733>
+I<FF81F800FF87FE000F8C3F000F901F000FB01F800FA01F800FA01F800FC01F800FC01F800FC0
+1F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800F
+C01F800FC01F800FC01F80FFFCFFF8FFFCFFF81D187D9722>I<007F800003FFF00007C0F8001F
+807E003F003F003F003F007E001F807E001F80FE001FC0FE001FC0FE001FC0FE001FC0FE001FC0
+FE001FC0FE001FC0FE001FC07E001F807E001F803F003F003F003F001F807E000FC0FC0003FFF0
+00007F80001A187E971F>I<FFC3F800FFCFFE000FF83F800FE00FC00FC00FE00FC007E00FC007
+F00FC003F00FC003F80FC003F80FC003F80FC003F80FC003F80FC003F80FC003F80FC003F80FC0
+07F00FC007F00FC007E00FC00FC00FE01FC00FF83F000FDFFE000FC7F0000FC000000FC000000F
+C000000FC000000FC000000FC000000FC000000FC000000FC00000FFFC0000FFFC00001D237E97
+22>I<FF87C0FF8FF00F98F80FB1F80FA1F80FA1F80FE0F00FC0000FC0000FC0000FC0000FC000
+0FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC0000FC000FFFE00FFFE0015187E
+9719>114 D<07F9801FFF803C0F80700380F00180F00180F00180FC0000FF80007FFC007FFE00
+3FFF800FFFC003FFC0001FE00003E0C001E0C001E0E001E0E001C0F003C0FC0780EFFF00C3FC00
+13187E9718>I<00600000600000600000600000E00000E00001E00001E00003E00007E0001FE0
+00FFFFC0FFFFC007E00007E00007E00007E00007E00007E00007E00007E00007E00007E00007E0
+0007E00007E06007E06007E06007E06007E06007E06003E0C003F0C001FF80007E0013237FA218
+>I<FFC1FF80FFC1FF800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800F
+C01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC01F800FC03F80
+0FC03F8007C07F8007E0DF8003FF9FF800FE1FF81D187D9722>I<FFF80FF8FFF80FF80FC003C0
+0FE0018007E0030007E0030003F0060003F0060003F80E0001F80C0001FC1C0000FC180000FE18
+00007E3000007E3000003F6000003F6000001FC000001FC000001FC000000F8000000F80000007
+0000000700001D187F9720>I<FFF9FFE0FF80FFF9FFE0FF801FC03F001C000FC01F0018000FC0
+1F80180007E01F80300007E01F80300007F01FC0700003F037C0600003F037C0600001F877E0C0
+0001F863E0C00001FC63F1C00000FCC1F1800000FCC1F18000007FC1FB0000007F80FB0000007F
+80FF0000003F007E0000003F007E0000001F007C0000001E003C0000001E003C0000000C001800
+0029187F972C>I<FFF83FF0FFF83FF00FC00F0007E00C0003F01C0003F8380001FC700000FCE0
+00007EC000003F8000003F8000001F8000000FC000001FE000001FF0000033F8000071F80000E0
+FC0001C07E0003807F0003003F000F001F80FFC07FF8FFC07FF81D187F9720>I<FFF80FF8FFF8
+0FF80FC003C00FE0018007E0030007E0030003F0060003F0060003F80E0001F80C0001FC1C0000
+FC180000FE1800007E3000007E3000003F6000003F6000001FC000001FC000001FC000000F8000
+000F800000070000000700000006000000060000000C0000300C0000781C0000FC180000FC3800
+00FC70000078E000007FC000001F0000001D237F9720>I E /Fj 27 122
+df<0003E0001C1800381800703C00E03C00E03801C00001C00001C00001C00001C0000380007F
+FFF00380700380700380700380700700E00700E00700E00700E00700E00700E00E01C00E01C00E
+01C00E01C00E01C00E01C01C03801E03C0FF0FF816207E9F19>12 D<FFC0FFC00A027D8A0F>45
+D<07FFFFF8007C0078003C0038003C001800780018007800080078000800780008007800080078
+000800F0100000F0100000F0100000F0300000F0700000FFF00001E0600001E0200001E0200001
+E0200001E0200001E0000003C0000003C0000003C0000003C0000003C0000003C0000007800000
+07C00000FFFE00001D1F7E9E1E>70 D<07FFE07FE0007C001F00003C000C00003C001800007800
+10000078004000007800800000780100000078020000007804000000F008000000F010000000F0
+60000000F0F0000000F1F0000000F278000001E478000001E878000001F03C000001E03C000001
+E01E000001E01E000003C00F000003C00F000003C00F000003C007800003C007800003C003C000
+078003C00007C007E000FFFC3FFC00231F7E9E23>75 D<07F8000C0C001E06001E07001C070000
+070000070000070000FF0007C7001E07003C0E00780E00F00E10F00E10F00E10F01E10F02E2078
+4F401F878014147D9317>97 D<01FC07060E0F1C0F380E78007000F000F000F000F000E000E000
+E000E000F0027004300818300FC010147C9314>99 D<0000700003F00000F00000700000700000
+E00000E00000E00000E00000E00000E00001C000F9C00305C00E03C01C03C03801C07803807003
+80F00380F00380F00380F00380E00700E00700E00700E00700E00700700F00301E00186F000F8F
+E014207C9F19>I<00F800070E000E07001C0700380380780380700380F00380F00380FFFF80F0
+0000E00000E00000E00000E00000F001007002003004001C180007E00011147D9314>I<000780
+0018C00031E00061E000E1C000C00001C00001C00001C00001C00001C0000380007FF800038000
+0380000380000380000700000700000700000700000700000700000E00000E00000E00000E0000
+0E00000E00001C00001E0000FFE00013207E9F0E>I<00000E003E1100E1A301C1C20381E00780
+E00701E00F01E00F01E00F01E00703C007038007870004FC000800000800001800001C00000FFF
+000FFFC007FFE01800F0300030600030C00030C00030C000306000603000C01C070007FC00181F
+809417>I<00E00007E00001E00000E00000E00001C00001C00001C00001C00001C00001C00003
+8000038F800390E003A0E003C0600380600780E00700E00700E00700E00700E00700E00E01C00E
+01C00E01C00E01C00E01C00E01C01C03801E03C0FFCFF815207E9F19>I<01C003E003E003C001
+8000000000000000000000000003801F800780038003800700070007000700070007000E000E00
+0E000E000E000E001C001E00FF800B1F7F9E0C>I<00E00007E00001E00000E00000E00001C000
+01C00001C00001C00001C00001C0000380000383FC0380F00380C0038180038100070400070800
+071800073800077C00071C000E1C000E0E000E0E000E0F000E07000E07801C03801E07C0FF8FF0
+16207E9F18>107 D<00E007E001E000E000E001C001C001C001C001C001C00380038003800380
+038003800700070007000700070007000E000E000E000E000E000E001C001E00FFC00B207F9F0C
+>I<0387C07C001F9861860007A072070003C03403000380380300078078070007007007000700
+7007000700700700070070070007007007000E00E00E000E00E00E000E00E00E000E00E00E000E
+00E00E000E00E00E001C01C01C001E01E01E00FFCFFCFFC022147E9326>I<038F801F90E007A0
+E003C0600380600780E00700E00700E00700E00700E00700E00E01C00E01C00E01C00E01C00E01
+C00E01C01C03801E03C0FFCFF815147E9319>I<00FC000387000E01801C00C03800E03800E070
+00F0F000F0F000F0F000F0F000F0E001E0E001E0E001C0E003C0F00380700700380E001C1C0007
+E00014147D9317>I<00E3E007EC3800F01C00E01E00E00E01C00E01C00F01C00F01C00F01C00F
+01C00F03801E03801E03801C03803C0380380380700740E00721C0071F00070000070000070000
+0E00000E00000E00000E00001E0000FFC000181D809319>I<00F040038CC00E04C01C03C03C03
+C0780380780380F00380F00380F00380F00380E00700E00700E00700F00700F00F00700F00301E
+00186E000F8E00000E00000E00000E00001C00001C00001C00001C00003C0001FF80121D7C9318
+>I<038E001FB38007C78003C7800383000780000700000700000700000700000700000E00000E
+00000E00000E00000E00000E00001C00001E0000FFE00011147E9312>I<01F2060E0806180618
+02380438001E001FE00FF003F8003C401C400C400C600C6018E010D0608FC00F147E9312>I<00
+80010001000100030007000F001E00FFF80E000E000E000E001C001C001C001C001C001C003800
+38203820382038203840384018800F000D1C7C9B12>I<1C0380FC1F803C07801C03801C038038
+0700380700380700380700380700380700700E00700E00700E00700E00701E00701E00703C0030
+5E001F9FC012147B9319>I<FF83F81E00E01C00C01C00800E00800E01000E02000E02000F0400
+07040007080007080007100003900003A00003E00003C00003800001800001000015147C9318>
+I<FF9FE1FC3E0780701C0300601C0300401C0380401C0380800E0780800E0581000E0981000E09
+C2000E11C2000731C4000721C4000760C8000740C8000780F0000780F0000300E0000300600002
+0040001E147C9321>I<1FF0FF03C07801C06001C04000E08000E180007300007600003C00003C
+00001C00002E00004E000087000107000203800603800C01C03E03E0FF07FC18147F9318>I<0F
+F83F8001E00E0001C00C0001C0080000E0180000E0100000E0200000E0200000F0400000704000
+00708000007080000071000000390000003A0000003E0000003C00000038000000180000001000
+000010000000200000002000000040000070C00000F0800000F1000000E20000007C000000191D
+809318>I E /Fk 34 121 df<0001C0000003C000000FC000007FC0001FFFC000FFFFC000FFBF
+C000E03FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC00000
+3FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000
+003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC0
+00003FC000003FC000003FC000003FC000003FC000003FC000003FC0007FFFFFE07FFFFFE07FFF
+FFE01B2E7AAD28>49 D<003FE00001FFFE0007FFFF800F80FFC01E003FE038001FF07C000FF87E
+0007FCFF0007FCFF8007FEFF8007FEFF8003FEFF8003FE7F0003FE3E0007FE000007FE000007FC
+000007FC00000FF800000FF800000FF000001FE000001FC000003F8000007F0000007E000000F8
+000001F0000003E0000007C000000F0000001E000E003C000E0038000E0070001E00E0001C01C0
+001C0300003C07FFFFFC0FFFFFFC1FFFFFFC3FFFFFFC7FFFFFF8FFFFFFF8FFFFFFF8FFFFFFF81F
+2E7CAD28>I<000003FF80018000003FFFF003800001FFFFFC07800007FF003F0F80001FF80007
+9F80003FC00001FF8000FF800000FF8001FE0000007F8003FC0000003F8007FC0000001F8007F8
+0000000F800FF00000000F801FF000000007801FF000000007803FE000000007803FE000000003
+807FE000000003807FE000000003807FC000000000007FC00000000000FFC00000000000FFC000
+00000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000
+FFC00000000000FFC000000000007FC000000000007FC000000000007FE000000000007FE00000
+0003803FE000000003803FE000000003801FF000000003801FF000000007800FF0000000070007
+F8000000070007FC0000000E0003FC0000001E0001FE0000001C0000FF8000007800003FC00000
+F000001FF80003E0000007FF003F80000001FFFFFE000000003FFFF80000000003FF8000003131
+7CB03A>67 D<FFFFFFFFFFF0FFFFFFFFFFF0FFFFFFFFFFF000FF80003FF000FF800007F800FF80
+0003F800FF800000F800FF800000F800FF8000007800FF8000007800FF8000003800FF80000038
+00FF8000003800FF8000001C00FF8007001C00FF8007001C00FF8007001C00FF8007000000FF80
+07000000FF800F000000FF801F000000FF803F000000FFFFFF000000FFFFFF000000FFFFFF0000
+00FF803F000000FF801F000000FF800F000000FF8007000000FF8007000000FF8007000700FF80
+07000700FF8007000700FF8000000E00FF8000000E00FF8000000E00FF8000000E00FF8000001E
+00FF8000001E00FF8000003C00FF8000003C00FF8000007C00FF800000FC00FF800001FC00FF80
+0007FC00FF80003FFCFFFFFFFFFFF8FFFFFFFFFFF8FFFFFFFFFFF830317EB035>69
+D<FFFFFFFFFFE0FFFFFFFFFFE0FFFFFFFFFFE000FF80007FE000FF80000FF000FF800003F000FF
+800001F000FF800001F000FF800000F000FF800000F000FF8000007000FF8000007000FF800000
+7000FF8000003800FF8000003800FF8007003800FF8007003800FF8007000000FF8007000000FF
+8007000000FF800F000000FF801F000000FF803F000000FFFFFF000000FFFFFF000000FFFFFF00
+0000FF803F000000FF801F000000FF800F000000FF8007000000FF8007000000FF8007000000FF
+8007000000FF8007000000FF8000000000FF8000000000FF8000000000FF8000000000FF800000
+0000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF
+80000000FFFFFFE00000FFFFFFE00000FFFFFFE000002D317EB033>I<000003FF00030000007F
+FFF007000001FFFFFC0F000007FF007E1F00001FF0000FBF00007FC00003FF0000FF800001FF00
+01FE0000007F0003FC0000007F0007FC0000003F000FF80000001F000FF00000001F001FF00000
+000F001FF00000000F003FE000000007003FE000000007007FE000000007007FE000000007007F
+C00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC0000000
+0000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC00000000000FFC0
+0007FFFFFC7FC00007FFFFFC7FE00007FFFFFC7FE0000001FF003FE0000001FF003FE0000001FF
+001FF0000001FF001FF0000001FF000FF0000001FF000FF8000001FF0007FC000001FF0003FC00
+0001FF0001FE000001FF0000FF800001FF00007FC00003FF00001FF800077F000007FF003E3F00
+0001FFFFFC1F0000007FFFF00F00000003FF80030036317CB03F>I<FFFFFF80FFFFFF80FFFFFF
+8000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF
+800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000
+FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF8000
+00FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF800000FF80
+0000FF800000FF800000FF800000FF8000FFFFFF80FFFFFF80FFFFFF8019317EB01E>73
+D<FFFFFFE00000FFFFFFE00000FFFFFFE0000000FF8000000000FF8000000000FF8000000000FF
+8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF800000
+0000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF
+8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF800000
+0000FF8000000000FF8000000000FF8000000000FF8000000000FF800001C000FF800001C000FF
+800001C000FF800001C000FF800003C000FF8000038000FF8000038000FF8000078000FF800007
+8000FF8000078000FF80000F8000FF80001F8000FF80003F8000FF80007F8000FF8000FF0000FF
+8007FF00FFFFFFFFFF00FFFFFFFFFF00FFFFFFFFFF002A317EB030>76 D<FFFF800001FFFFC0FF
+FFC00001FFFFC0FFFFE00001FFFFC000FFF0000003E00000FFF8000001C00000EFFC000001C000
+00E7FC000001C00000E7FE000001C00000E3FF000001C00000E1FF800001C00000E0FFC00001C0
+0000E07FE00001C00000E03FE00001C00000E03FF00001C00000E01FF80001C00000E00FFC0001
+C00000E007FE0001C00000E003FE0001C00000E001FF0001C00000E001FF8001C00000E000FFC0
+01C00000E0007FE001C00000E0003FF001C00000E0001FF001C00000E0001FF801C00000E0000F
+FC01C00000E00007FE01C00000E00003FF01C00000E00001FF81C00000E00000FF81C00000E000
+00FFC1C00000E000007FE1C00000E000003FF1C00000E000001FF9C00000E000000FFDC00000E0
+000007FDC00000E0000007FFC00000E0000003FFC00000E0000001FFC00000E0000000FFC00000
+E00000007FC00000E00000003FC00000E00000003FC00000E00000001FC00000E00000000FC000
+01F000000007C000FFFFE0000003C000FFFFE0000001C000FFFFE0000001C0003A317EB03F>78
+D<FFFFFFFFE000FFFFFFFFFE00FFFFFFFFFF8000FF8000FFE000FF80003FF000FF80000FF800FF
+800007FC00FF800007FC00FF800003FE00FF800003FE00FF800003FF00FF800003FF00FF800003
+FF00FF800003FF00FF800003FF00FF800003FF00FF800003FF00FF800003FE00FF800003FE00FF
+800007FC00FF800007F800FF80000FF800FF80003FE000FF8000FFC000FFFFFFFF0000FFFFFFF8
+0000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF
+8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF800000
+0000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF
+80000000FFFFFF800000FFFFFF800000FFFFFF80000030317EB037>80 D<FFFFFFFF80000000FF
+FFFFFFF8000000FFFFFFFFFE00000000FF8003FF80000000FF80007FE0000000FF80001FF00000
+00FF80000FF8000000FF80000FF8000000FF80000FFC000000FF800007FC000000FF800007FE00
+0000FF800007FE000000FF800007FE000000FF800007FE000000FF800007FE000000FF800007FE
+000000FF800007FC000000FF80000FFC000000FF80000FF8000000FF80001FF0000000FF80003F
+E0000000FF80007FC0000000FF8003FF00000000FFFFFFF800000000FFFFFFE000000000FF8007
+F800000000FF8001FC00000000FF8000FE00000000FF80007F00000000FF80007F80000000FF80
+003FC0000000FF80003FC0000000FF80003FE0000000FF80003FE0000000FF80003FE0000000FF
+80003FE0000000FF80003FE0000000FF80003FF0000000FF80003FF0000000FF80003FF0000000
+FF80003FF0000000FF80003FF0038000FF80003FF8038000FF80001FF8038000FF80001FF80300
+00FF80000FFC0700FFFFFF8003FE0E00FFFFFF8001FFFC00FFFFFF80001FF00039317EB03C>82
+D<7FFFFFFFFFFF007FFFFFFFFFFF007FFFFFFFFFFF007FC00FF801FF007E000FF8003F007C000F
+F8001F0078000FF8000F0078000FF8000F0070000FF8000700F0000FF8000780F0000FF8000780
+F0000FF8000780E0000FF8000380E0000FF8000380E0000FF8000380E0000FF8000380E0000FF8
+00038000000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000
+000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000FF800
+000000000FF800000000000FF800000000000FF800000000000FF800000000000FF80000000000
+0FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000FF80000
+0000000FF800000000000FF800000000000FF800000000000FF800000000000FF800000000000F
+F8000000007FFFFFFF0000007FFFFFFF0000007FFFFFFF000031307DAF38>84
+D<FFFFFF8003FFFF80FFFFFF8003FFFF80FFFFFF8003FFFF8000FF80000007C00000FF80000003
+800000FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF800000
+03800000FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF8000
+0003800000FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF80
+000003800000FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF
+80000003800000FF80000003800000FF80000003800000FF80000003800000FF80000003800000
+FF80000003800000FF80000003800000FF80000003800000FF80000003800000FF800000038000
+00FF80000003800000FF800000038000007F800000038000007F800000070000007FC000000700
+00003FC000000E0000003FC000000E0000001FE000001C0000000FF000003800000007F8000070
+00000003FC0001E000000000FF801FC0000000003FFFFF80000000000FFFFE000000000000FFE0
+00000039317EB03E>I<FFFFFC0000FFFFFFFFFC0000FFFFFFFFFC0000FFFF03FF00000003C001
+FF000000038001FF800000078000FF800000070000FFC000000700007FC000000E00007FC00000
+0E00007FE000001E00003FE000001C00003FF000003C00001FF000003800001FF800003800000F
+F800007000000FFC000070000007FC0000E0000007FC0000E0000007FE0001E0000003FE0001C0
+000003FF0003C0000001FF000380000001FF800380000000FF800700000000FFC00700000000FF
+C00F000000007FC00E000000007FE01E000000003FE01C000000003FF03C000000001FF0380000
+00001FF838000000000FF870000000000FF870000000000FFCF00000000007FCE00000000007FF
+E00000000003FFC00000000003FFC00000000001FF800000000001FF800000000000FF00000000
+0000FF000000000000FF0000000000007E0000000000007E0000000000003C0000000000003C00
+000038317EB03D>I<00FFF0000003FFFE00000F803F80000FC00FE0001FE007F0001FE007F000
+1FE003F8000FC003FC00078003FC00000003FC00000003FC00000003FC00000003FC000000FFFC
+00001FFFFC0000FFE3FC0003FC03FC000FF003FC001FC003FC003FC003FC007F8003FC007F8003
+FC00FF0003FC00FF0003FC00FF0003FC00FF0007FC00FF0007FC007F800DFC003FC019FE001FE0
+70FFF007FFE07FF000FF803FF024207E9F27>97 D<01F8000000FFF8000000FFF8000000FFF800
+00000FF800000007F800000007F800000007F800000007F800000007F800000007F800000007F8
+00000007F800000007F800000007F800000007F800000007F800000007F800000007F83FE00007
+F8FFFC0007FBE07F0007FF001F8007FE000FC007FC000FE007F80007F007F80007F807F80007F8
+07F80003FC07F80003FC07F80003FC07F80003FE07F80003FE07F80003FE07F80003FE07F80003
+FE07F80003FE07F80003FE07F80003FE07F80003FC07F80003FC07F80003FC07F80007F807F800
+07F807F80007F007FC000FE007FE000FC007E7003F8007C3C0FE000780FFF80007003FC0002732
+7EB12D>I<000FFF00007FFFC001FC01F003F003F007E007F80FE007F81FC007F83FC003F03FC0
+01E07F8000007F8000007F800000FF800000FF800000FF800000FF800000FF800000FF800000FF
+800000FF8000007F8000007F8000007F8000003FC0001C3FC0001C1FC000380FE0003807E00070
+03F001E001FC07C0007FFF00000FF8001E207D9F24>I<0000000FC0000007FFC0000007FFC000
+0007FFC00000007FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC0
+0000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00007F83F
+C0003FFF3FC000FE07BFC003F801FFC007E0007FC00FE0007FC01FC0003FC03FC0003FC03FC000
+3FC07F80003FC07F80003FC07F80003FC0FF80003FC0FF80003FC0FF80003FC0FF80003FC0FF80
+003FC0FF80003FC0FF80003FC0FF80003FC07F80003FC07F80003FC07F80003FC03FC0003FC03F
+C0003FC01FC0003FC00FE0007FC007E000FFC003F003FFE001FC0F3FFE007FFE3FFE000FF03FFE
+27327DB12D>I<000FFC00007FFF8001FC0FC003F003E007E001F00FE001F81FC000FC3FC000FE
+3FC000FE7F80007E7F80007F7F80007FFF80007FFF80007FFFFFFFFFFFFFFFFFFF800000FF8000
+00FF800000FF8000007F8000007F8000007F8000003FC000071FC000071FC0000E0FE0000E07F0
+001C03F8007800FE03E0003FFFC00007FE0020207E9F25>I<0001FE00000FFF80001FC3C0007F
+07E000FE0FF001FE0FF001FC0FF003FC0FF003FC07E003FC018003FC000003FC000003FC000003
+FC000003FC000003FC000003FC000003FC0000FFFFFC00FFFFFC00FFFFFC0003FC000003FC0000
+03FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC00
+0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC
+000003FC000003FC000003FC000003FC00007FFFF0007FFFF0007FFFF0001C327EB119>I<001F
+F007C000FFFE3FE001F83F79F007E00FC3F00FE00FE1F00FC007E0E01FC007F0001FC007F0003F
+C007F8003FC007F8003FC007F8003FC007F8003FC007F8001FC007F0001FC007F0000FC007E000
+0FE00FE00007E00FC00003F83F000006FFFE00000E1FF000000E000000001E000000001E000000
+001F000000001F800000001FFFFF80000FFFFFF0000FFFFFFC0007FFFFFE0003FFFFFF0003FFFF
+FF800FFFFFFFC01F00007FC07E00001FE07C00000FE0FC000007E0FC000007E0FC000007E0FC00
+0007E07E00000FC03E00000F803F00001F800FC0007E0007F803FC0001FFFFF000001FFF000024
+2F7E9F28>I<01F8000000FFF8000000FFF8000000FFF80000000FF800000007F800000007F800
+000007F800000007F800000007F800000007F800000007F800000007F800000007F800000007F8
+00000007F800000007F800000007F800000007F807F80007F83FFE0007F8783F0007F8C03F8007
+F9801FC007FB001FC007FE001FE007FC001FE007FC001FE007FC001FE007F8001FE007F8001FE0
+07F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001F
+E007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F800
+1FE007F8001FE0FFFFC3FFFFFFFFC3FFFFFFFFC3FFFF28327DB12D>I<03C00007E0000FF0001F
+F8001FF8001FF8001FF8000FF00007E00003C00000000000000000000000000000000000000000
+000000000000000001F800FFF800FFF800FFF8000FF80007F80007F80007F80007F80007F80007
+F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007
+F80007F80007F80007F80007F80007F800FFFF80FFFF80FFFF8011337DB217>I<01F800FFF800
+FFF800FFF8000FF80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800
+07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800
+07F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F80007F800
+07F80007F80007F80007F80007F80007F800FFFFC0FFFFC0FFFFC012327DB117>108
+D<03F007F8001FE000FFF03FFE00FFF800FFF0783F01E0FC00FFF0C03F8300FE000FF1801FC600
+7F0007F3001FCC007F0007F6001FF8007F8007FC001FF0007F8007FC001FF0007F8007FC001FF0
+007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001F
+E0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F800
+1FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8
+001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F8007F8001FE0007F80FF
+FFC3FFFF0FFFFCFFFFC3FFFF0FFFFCFFFFC3FFFF0FFFFC3E207D9F43>I<03F007F800FFF03FFE
+00FFF0783F00FFF0C03F800FF1801FC007F3001FC007F6001FE007FC001FE007FC001FE007FC00
+1FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8
+001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007
+F8001FE007F8001FE007F8001FE007F8001FE0FFFFC3FFFFFFFFC3FFFFFFFFC3FFFF28207D9F2D
+>I<0007FC0000007FFFC00001FC07F00003F001F80007E000FC000FC0007E001FC0007F003FC0
+007F803F80003F807F80003FC07F80003FC07F80003FC0FF80003FE0FF80003FE0FF80003FE0FF
+80003FE0FF80003FE0FF80003FE0FF80003FE0FF80003FE07F80003FC07F80003FC07F80003FC0
+3FC0007F803FC0007F801FC0007F000FE000FE0007E000FC0003F803F80001FE0FF000007FFFC0
+000007FC000023207E9F28>I<01F83FE000FFF8FFFC00FFFBE07F00FFFF003F8007FE001FC007
+FC000FE007F8000FF007F80007F807F80007F807F80007FC07F80003FC07F80003FC07F80003FE
+07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003FE07F80003
+FC07F80007FC07F80007FC07F80007F807F80007F807F8000FF007FC000FE007FE001FC007FF00
+3F8007FBC0FE0007F8FFF80007F83FC00007F800000007F800000007F800000007F800000007F8
+00000007F800000007F800000007F800000007F800000007F800000007F8000000FFFFC00000FF
+FFC00000FFFFC00000272E7E9F2D>I<03F03F00FFF07FC0FFF1C3E0FFF187E00FF30FF007F60F
+F007F60FF007FC07E007FC03C007FC000007FC000007F8000007F8000007F8000007F8000007F8
+000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007F8000007
+F8000007F8000007F8000007F80000FFFFE000FFFFE000FFFFE0001C207E9F21>114
+D<01FF860007FFFE001F00FE003C003E0078001E0078000E00F8000E00F8000E00F8000E00FC00
+0000FF800000FFFC00007FFFC0007FFFF0003FFFF8001FFFFC0007FFFE0001FFFF00003FFF0000
+00FF8000003F8060001F80E0000F80E0000F80F0000F80F0000F00F8000F00FC001E00FE001C00
+FF807800F3FFF000C07F800019207D9F20>I<001C0000001C0000001C0000001C0000001C0000
+003C0000003C0000003C0000007C0000007C000000FC000001FC000003FC000007FC00001FFFFE
+00FFFFFE00FFFFFE0003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC
+000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC000003FC038003
+FC038003FC038003FC038003FC038003FC038003FC038001FC038001FC070000FE0700007F0E00
+003FFC000007F000192E7FAD1F>I<01F80007E0FFF803FFE0FFF803FFE0FFF803FFE00FF8003F
+E007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F800
+1FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8001FE007F8
+001FE007F8001FE007F8001FE007F8001FE007F8003FE007F8003FE003F8007FE003F8007FE001
+FC00DFF000FE039FFF007FFF1FFF000FFC1FFF28207D9F2D>I<FFFF1FFFE07FF8FFFF1FFFE07F
+F8FFFF1FFFE07FF80FF000FE0007800FF800FE00078007F800FE00070007F8007F00070003FC00
+7F000E0003FC00FF800E0003FE00FF801E0001FE00FF801C0001FE01DFC01C0001FF01DFC03C00
+00FF03DFE0380000FF838FE07800007F838FE07000007F8707F07000007FC707F0F000003FCF07
+F8E000003FCE03F8E000001FEE03F9C000001FFC01FDC000001FFC01FFC000000FFC01FF800000
+0FF800FF80000007F800FF00000007F0007F00000007F0007F00000003F0007E00000003E0003E
+00000001E0003C00000001C0001C000035207E9F3A>119 D<7FFF807FFC7FFF807FFC7FFF807F
+FC03FE000F0001FE001E0000FF003C0000FF807800007FC07800003FE0F000001FE1E000000FF3
+C000000FFF80000007FF00000003FE00000001FE00000000FF00000000FF80000000FFC0000001
+FFC0000003DFE00000078FF00000078FF800000F07FC00001E03FC00003C01FE00007800FF0000
+F000FF8000E0007FC001E0003FC0FFFC01FFFFFFFC01FFFFFFFC01FFFF28207F9F2B>I
+E /Fl 1 14 df<0001FE00000007FF8000001E01E000007800780000E0001C0001800006000300
+00030006000001800C000000C00C000000C0180000006030000000303000000030300000003060
+0000001860000000186000000018C00000000CC00000000CC00000000CC00000000CC00000000C
+C00000000CC00000000CC00000000CC00000000C60000000186000000018600000001830000000
+303000000030300000003018000000600C000000C00C000000C006000001800300000300018000
+060000E0001C000078007800001E01E0000007FF80000001FE0000262B7DA02D>13
+D E /Fm 53 122 df<001C0000001C0000001C0000007F800003FFE0000FFFF8001F9CFC003E1C
+1E003C1C0F007C1C0700781C0F80F81C1F80F81C3F80F81C3F80F81C3F80FC1C3F80FE1C1F00FF
+1C00007FDC00007FFC00007FFFC0003FFFE0001FFFF8000FFFFC0007FFFC0001FFFE00007FFF00
+001FFF00001C7F00001C3F80381C1F807C1C1F80FE1C0F80FE1C0F80FE1C0F80FC1C0F80F81C0F
+00701C0F00701C1F00381C1E003C1C3C001F9CF8000FFFF00003FFE00000FF0000001C0000001C
+0000001C000019307CAC22>36 D<3C007F00FF80FF80FFC0FFC0FFC07FC03EC000C000C0018001
+8001800300030006000E001C00380030000A157B8813>44 D<1C007F007F00FF80FF80FF807F00
+7F001C0009097B8813>46 D<000E00001E00007E0007FE00FFFE00FFFE00F8FE0000FE0000FE00
+00FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00
+00FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00
+00FE007FFFFE7FFFFE7FFFFE17277BA622>49 D<00FF800007FFF0000FFFFC001E03FE003800FF
+807C003F80FE003FC0FF001FC0FF001FE0FF000FE0FF000FE07E000FE03C001FE000001FE00000
+1FC000001FC000003F8000003F0000007E000000FC000000F8000001F0000003E0000007800000
+0F0000001E0000003C00E0007000E000E000E001C001C0038001C0060001C00FFFFFC01FFFFFC0
+3FFFFFC07FFFFFC0FFFFFF80FFFFFF80FFFFFF801B277DA622>I<007F800003FFF00007FFFC00
+0F80FE001F007F003F807F003F803F803F803F803F803F801F803F801F003F8000007F0000007F
+0000007E000000FC000001F8000007F00000FFC00000FFC0000001F80000007E0000003F000000
+3F8000001FC000001FC000001FE000001FE03C001FE07E001FE0FF001FE0FF001FE0FF001FC0FF
+003FC0FE003F807C007F003F00FE001FFFFC0007FFF00000FF80001B277DA622>I<00000E0000
+001E0000003E0000007E000000FE000000FE000001FE000003FE0000077E00000E7E00000E7E00
+001C7E0000387E0000707E0000E07E0000E07E0001C07E0003807E0007007E000E007E000E007E
+001C007E0038007E0070007E00E0007E00FFFFFFF8FFFFFFF8FFFFFFF80000FE000000FE000000
+FE000000FE000000FE000000FE000000FE000000FE00007FFFF8007FFFF8007FFFF81D277EA622
+>I<180003001F801F001FFFFE001FFFFC001FFFF8001FFFF0001FFFC0001FFF00001C0000001C
+0000001C0000001C0000001C0000001C0000001C0000001C7FC0001DFFF8001F80FC001E003F00
+08003F0000001F8000001FC000001FC000001FE000001FE018001FE07C001FE0FE001FE0FE001F
+E0FE001FE0FE001FC0FC001FC078003F8078003F803C007F001F01FE000FFFFC0003FFF00000FF
+80001B277DA622>I<00000780000000000780000000000FC0000000000FC0000000000FC00000
+00001FE0000000001FE0000000003FF0000000003FF0000000003FF00000000077F80000000077
+F800000000F7FC00000000E3FC00000000E3FC00000001C1FE00000001C1FE00000003C1FF0000
+000380FF0000000380FF00000007007F80000007007F8000000F007FC000000E003FC000000E00
+3FC000001C001FE000001C001FE000003FFFFFF000003FFFFFF000003FFFFFF00000700007F800
+00700007F80000F00007FC0000E00003FC0000E00003FC0001C00001FE0001C00001FE0003C000
+01FF00FFFE003FFFFCFFFE003FFFFCFFFE003FFFFC2E297EA833>65 D<FFFFFFF800FFFFFFFF00
+FFFFFFFFC003F8001FE003F8000FF003F80007F803F80003F803F80003FC03F80003FC03F80001
+FC03F80001FC03F80001FC03F80003FC03F80003F803F80003F803F80007F003F8000FF003F800
+1FC003F800FF8003FFFFFE0003FFFFFFC003F8000FF003F80003F803F80001FC03F80001FE03F8
+0000FE03F80000FE03F80000FF03F80000FF03F80000FF03F80000FF03F80000FF03F80000FF03
+F80000FE03F80001FE03F80003FC03F80007FC03F8001FF8FFFFFFFFE0FFFFFFFFC0FFFFFFFE00
+28297DA830>I<00007FE0030007FFFC07001FFFFF0F007FF00F9F00FF0001FF01FC0000FF03F8
+00007F07F000003F0FE000001F1FC000001F1FC000000F3F8000000F3F800000077F800000077F
+800000077F00000000FF00000000FF00000000FF00000000FF00000000FF00000000FF00000000
+FF00000000FF00000000FF000000007F000000007F800000007F800000073F800000073F800000
+071FC00000071FC000000E0FE000000E07F000001C03F800003C01FC00007800FF0001F0007FF0
+07C0001FFFFF800007FFFE0000007FF00028297CA831>I<FFFFFFFC0000FFFFFFFF8000FFFFFF
+FFE00003FC001FF80003FC0003FC0003FC0000FE0003FC00007F0003FC00003F8003FC00001FC0
+03FC00001FC003FC00000FE003FC00000FE003FC000007F003FC000007F003FC000007F003FC00
+0007F003FC000007F803FC000007F803FC000007F803FC000007F803FC000007F803FC000007F8
+03FC000007F803FC000007F803FC000007F803FC000007F803FC000007F003FC000007F003FC00
+0007F003FC00000FE003FC00000FE003FC00000FC003FC00001FC003FC00003F8003FC00007F00
+03FC0000FF0003FC0003FC0003FC001FF800FFFFFFFFF000FFFFFFFF8000FFFFFFFC00002D297E
+A834>I<FFFFFFFFE0FFFFFFFFE0FFFFFFFFE003FC001FE003FC0007F003FC0001F003FC0001F0
+03FC0000F003FC00007003FC00007003FC00007003FC01C07803FC01C03803FC01C03803FC01C0
+3803FC03C00003FC03C00003FC0FC00003FFFFC00003FFFFC00003FFFFC00003FC0FC00003FC03
+C00003FC03C00003FC01C00E03FC01C00E03FC01C00E03FC01C01C03FC00001C03FC00001C03FC
+00001C03FC00003C03FC00003803FC00007803FC0000F803FC0001F803FC0003F803FC001FF8FF
+FFFFFFF0FFFFFFFFF0FFFFFFFFF027297EA82C>I<FFFFFFFFC0FFFFFFFFC0FFFFFFFFC003FC00
+3FC003FC000FE003FC0003E003FC0001E003FC0001E003FC0000E003FC0000E003FC0000E003FC
+0000F003FC01C07003FC01C07003FC01C07003FC01C00003FC03C00003FC03C00003FC0FC00003
+FFFFC00003FFFFC00003FFFFC00003FC0FC00003FC03C00003FC03C00003FC01C00003FC01C000
+03FC01C00003FC01C00003FC00000003FC00000003FC00000003FC00000003FC00000003FC0000
+0003FC00000003FC00000003FC000000FFFFFC0000FFFFFC0000FFFFFC000024297EA82A>I<00
+007FE003000007FFFC0700001FFFFF0F00007FF00F9F0000FF0001FF0001FC0000FF0003F80000
+7F0007F000003F000FE000001F001FC000001F001FC000000F003F8000000F003F80000007007F
+80000007007F80000007007F0000000000FF0000000000FF0000000000FF0000000000FF000000
+0000FF0000000000FF0000000000FF0000000000FF0000000000FF0000FFFFF87F0000FFFFF87F
+8000FFFFF87F800000FF003F800000FF003F800000FF001FC00000FF001FC00000FF000FE00000
+FF0007F00000FF0003F80000FF0001FC0000FF0000FF0001FF00007FF007FF00001FFFFF9F0000
+07FFFE0F0000007FF003002D297CA835>I<FFFFF00FFFFFFFFFF00FFFFFFFFFF00FFFFF03FC00
+003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC0
+03FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00
+003FC003FC00003FC003FFFFFFFFC003FFFFFFFFC003FFFFFFFFC003FC00003FC003FC00003FC0
+03FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00
+003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC003FC00003FC0
+03FC00003FC003FC00003FC0FFFFF00FFFFFFFFFF00FFFFFFFFFF00FFFFF30297EA835>I<FFFF
+FCFFFFFCFFFFFC01FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE
+0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE
+0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE0001FE00FFFFFCFFFF
+FCFFFFFC16297FA819>I<FFFFF001FFFCFFFFF001FFFCFFFFF001FFFC03FC00001E0003FC0000
+3C0003FC0000780003FC0000F00003FC0001E00003FC0003C00003FC0007000003FC001E000003
+FC003C000003FC0078000003FC00F0000003FC01E0000003FC0380000003FC07C0000003FC1FC0
+000003FC3FE0000003FC7FF0000003FCFFF8000003FDE7F8000003FF83FC000003FF03FE000003
+FE01FF000003FC00FF000003FC007F800003FC007FC00003FC003FE00003FC001FE00003FC000F
+F00003FC000FF80003FC0007F80003FC0003FC0003FC0001FE0003FC0001FF0003FC0000FF0003
+FC00007F80FFFFF00FFFFEFFFFF00FFFFEFFFFF00FFFFE2F297EA835>75
+D<FFFFFC0000FFFFFC0000FFFFFC000003FC00000003FC00000003FC00000003FC00000003FC00
+000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC
+00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003
+FC00000003FC0001C003FC0001C003FC0001C003FC0001C003FC0003C003FC00038003FC000380
+03FC00078003FC00078003FC000F8003FC000F8003FC001F8003FC007F8003FC01FF00FFFFFFFF
+00FFFFFFFF00FFFFFFFF0022297EA828>I<FFFE0000003FFF80FFFE0000003FFF80FFFF000000
+7FFF8003FF0000007FE00003FF0000007FE00003BF800000EFE00003BF800000EFE000039FC000
+01CFE000039FC00001CFE000038FE000038FE000038FE000038FE000038FE000038FE0000387F0
+00070FE0000387F000070FE0000383F8000E0FE0000383F8000E0FE0000381FC001C0FE0000381
+FC001C0FE0000381FC001C0FE0000380FE00380FE0000380FE00380FE00003807F00700FE00003
+807F00700FE00003803F80E00FE00003803F80E00FE00003803F80E00FE00003801FC1C00FE000
+03801FC1C00FE00003800FE3800FE00003800FE3800FE000038007F7000FE000038007F7000FE0
+00038007F7000FE000038003FE000FE000038003FE000FE000038001FC000FE000038001FC000F
+E000038000F8000FE000FFFE00F803FFFF80FFFE00F803FFFF80FFFE007003FFFF8039297DA840
+>I<FFFC00007FFFFFFE00007FFFFFFF00007FFF03FF800001C003FFC00001C003BFE00001C003
+9FE00001C0039FF00001C0038FF80001C00387FC0001C00383FE0001C00381FF0001C00380FF80
+01C003807F8001C003807FC001C003803FE001C003801FF001C003800FF801C0038007FC01C003
+8003FC01C0038003FE01C0038001FF01C0038000FF81C00380007FC1C00380003FE1C00380001F
+F1C00380000FF1C00380000FF9C003800007FDC003800003FFC003800001FFC003800000FFC003
+8000007FC0038000007FC0038000003FC0038000001FC0038000000FC00380000007C0FFFE0000
+03C0FFFE000001C0FFFE000001C030297EA835>I<0000FFC00000000FFFFC0000003F807F0000
+00FE001FC00001F80007E00003F00003F00007E00001F8000FE00001FC001FC00000FE001FC000
+00FE003F8000007F003F8000007F007F8000007F807F0000003F807F0000003F807F0000003F80
+FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000
+003FC0FF0000003FC0FF0000003FC0FF0000003FC07F0000003F807F8000007F807F8000007F80
+3F8000007F003F8000007F001FC00000FE001FC00000FE000FE00001FC0007F00003F80003F800
+07F00001FC000FE00000FE001FC000003FC0FF0000000FFFFC00000000FFC000002A297CA833>
+I<FFFFFFF800FFFFFFFF00FFFFFFFFC003FC003FE003FC0007F003FC0003F803FC0003FC03FC00
+01FC03FC0001FE03FC0001FE03FC0001FE03FC0001FE03FC0001FE03FC0001FE03FC0001FE03FC
+0001FC03FC0003FC03FC0003F803FC0007F003FC003FE003FFFFFF8003FFFFFE0003FC00000003
+FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC000000
+03FC00000003FC00000003FC00000003FC00000003FC00000003FC00000003FC000000FFFFF000
+00FFFFF00000FFFFF0000027297EA82E>I<0000FFC00000000FFFFC0000003FC0FF000000FE00
+1FC00001FC000FE00003F00003F00007F00003F8000FE00001FC001FC00000FE001FC00000FE00
+3F8000007F003F8000007F007F8000007F807F8000007F807F0000003F807F0000003F80FF0000
+003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0FF0000003FC0
+FF0000003FC0FF0000003FC0FF0000003FC07F0000003F807F8000007F807F8000007F803F8000
+007F003F8000007F001FC00000FE001FC03E00FE000FE07F81FC0007E0C1C1F80003F18063F000
+01F98067E00000FF803FC000003FC07F0000000FFFFC00000000FFF800C00000003C00C0000000
+1E00C00000001E01C00000001F83C00000001FFFC00000000FFF800000000FFF800000000FFF00
+00000007FF0000000003FE0000000001FC0000000000F8002A357CA833>I<FFFFFFE00000FFFF
+FFFE0000FFFFFFFF800003FC003FE00003FC000FF00003FC0007F80003FC0003FC0003FC0001FC
+0003FC0001FE0003FC0001FE0003FC0001FE0003FC0001FE0003FC0001FE0003FC0001FE0003FC
+0001FC0003FC0003F80003FC0007F80003FC000FE00003FC003FC00003FFFFFE000003FFFFFE00
+0003FC00FF800003FC003FC00003FC001FE00003FC000FF00003FC0007F80003FC0007F80003FC
+0007F80003FC0007F80003FC0007F80003FC0007F80003FC0007F80003FC0007F80003FC0007F8
+0003FC0007F80E03FC0007F80E03FC0003F80E03FC0001FC1CFFFFF000FE1CFFFFF0007FF8FFFF
+F0000FE02F297EA832>I<00FF00C003FFE1C00FFFF9C01F80FFC03F003FC03E000FC07C0007C0
+7C0007C0FC0003C0FC0003C0FC0001C0FE0001C0FE0001C0FF000000FFC000007FFC00007FFFE0
+003FFFF8001FFFFE001FFFFF0007FFFF8003FFFFC000FFFFC0000FFFE000007FE000001FF00000
+0FF0000007F0E00003F0E00003F0E00003F0E00003F0F00003E0F00003E0F80007E0FC0007C0FF
+000F80FFE01F80E3FFFF00E1FFFC00C01FF0001C297CA825>I<7FFFFFFFFF807FFFFFFFFF807F
+FFFFFFFF807F807F807F807C007F800F8078007F80078078007F80078070007F800380F0007F80
+03C0F0007F8003C0E0007F8001C0E0007F8001C0E0007F8001C0E0007F8001C0E0007F8001C000
+007F80000000007F80000000007F80000000007F80000000007F80000000007F80000000007F80
+000000007F80000000007F80000000007F80000000007F80000000007F80000000007F80000000
+007F80000000007F80000000007F80000000007F80000000007F80000000007F80000000007F80
+000000007F80000000007F80000000FFFFFFC00000FFFFFFC00000FFFFFFC0002A287EA72F>I<
+FFFFF000FFFEFFFFF000FFFEFFFFF000FFFE03FC0000038003FC0000038003FC0000038003FC00
+00038003FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC00000380
+03FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC00
+00038003FC0000038003FC0000038003FC0000038003FC0000038003FC0000038003FC00000380
+03FC0000038003FC0000038003FC0000038003FC0000038003FC0000038001FC0000070001FE00
+00070000FE00000E00007F00000E00003F00003C00001FC0007800000FF003F0000007FFFFE000
+0000FFFF800000001FFC00002F297EA834>I<FFFFF0007FFFFFFFF0007FFFFFFFF0007FFF03FE
+000001C001FE0000038001FE0000038000FF0000070000FF0000070000FF80000F00007F80000E
+00007FC0000E00003FC0001C00003FE0001C00001FE0003800001FE0003800001FF0007800000F
+F0007000000FF800F0000007F800E0000007FC00E0000003FC01C0000003FC01C0000003FE03C0
+000001FE0380000001FF0780000000FF0700000000FF87000000007F8E000000007F8E00000000
+7FDE000000003FDC000000003FFC000000001FF8000000001FF8000000000FF0000000000FF000
+0000000FF00000000007E00000000007E00000000003C00000000003C0000030297FA833>I<FF
+FFE0FFFFE01FFFC0FFFFE0FFFFE01FFFC0FFFFE0FFFFE01FFFC003FC0003FC0000700003FC0003
+FC0000700003FE0003FE0000F00001FE0001FE0000E00001FE0001FE0000E00001FF0001FF0001
+E00000FF0001FF0001C00000FF0001FF0001C000007F8003FF80038000007F8003FF8003800000
+7FC007FFC0078000003FC0073FC0070000003FC0073FC0070000003FE00F3FE00F0000001FE00E
+1FE00E0000001FE00E1FE00E0000000FF01C0FF01C0000000FF01C0FF01C0000000FF01C0FF81C
+00000007F83807F83800000007F83807F83800000007FC7807FC7800000003FC7003FC70000000
+03FC7003FC7000000003FEF003FEF000000001FEE001FEE000000001FEE001FEE000000000FFC0
+00FFC000000000FFC000FFC000000000FFC000FFC0000000007F80007F80000000007F80007F80
+000000007F80007F80000000003F00003F00000000003F00003F00000000003F00003F00000000
+001E00001E00000000001E00001E00000042297FA845>I<FFFFF0003FFFFFFFF0003FFFFFFFF0
+003FFF03FE000003C001FF0000078000FF8000070000FF80000F00007FC0001E00003FE0001C00
+003FE0003C00001FF0007800001FF8007000000FF800F0000007FC00E0000007FE01C0000003FE
+03C0000001FF0380000001FF8700000000FF8F000000007FCE000000007FFC000000003FFC0000
+00001FF8000000001FF0000000000FF0000000000FF0000000000FF0000000000FF0000000000F
+F0000000000FF0000000000FF0000000000FF0000000000FF0000000000FF0000000000FF00000
+00000FF0000000000FF0000000000FF000000003FFFFC0000003FFFFC0000003FFFFC00030297F
+A833>89 D<03FF80000FFFF0001F01FC003F80FE003F807F003F803F003F803F801F003F800000
+3F8000003F8000003F8000003F80003FFF8001FC3F800FE03F801F803F803F003F807E003F80FC
+003F80FC003F80FC003F80FC003F80FC005F807E00DF803F839FFC1FFE0FFC03F803FC1E1B7E9A
+21>97 D<FFE00000FFE00000FFE000000FE000000FE000000FE000000FE000000FE000000FE000
+000FE000000FE000000FE000000FE000000FE000000FE000000FE1FE000FE7FF800FFE07E00FF8
+03F00FF001F80FE000FC0FE000FC0FE0007E0FE0007E0FE0007F0FE0007F0FE0007F0FE0007F0F
+E0007F0FE0007F0FE0007F0FE0007F0FE0007E0FE0007E0FE0007E0FE000FC0FE000FC0FF001F8
+0FF803F00F9C0FE00F0FFF800E01FC00202A7EA925>I<003FF00001FFFC0003F03E000FC07F00
+1F807F003F007F003F007F007F003E007E0000007E000000FE000000FE000000FE000000FE0000
+00FE000000FE000000FE0000007E0000007E0000007F0000003F0003803F8003801F8007000FE0
+0E0003F83C0001FFF800003FC000191B7E9A1E>I<00007FF000007FF000007FF0000007F00000
+07F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F000
+0007F0003F87F001FFF7F007F03FF00FC00FF01F8007F03F0007F03F0007F07E0007F07E0007F0
+7E0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F07E0007
+F07E0007F03F0007F03F0007F01F800FF00FC01FF007E07FFF01FFE7FF007F87FF202A7EA925>
+I<003FC00001FFF00003E07C000F803E001F801F001F001F003F000F807E000F807E000FC07E00
+0FC0FE0007C0FE0007C0FFFFFFC0FFFFFFC0FE000000FE000000FE0000007E0000007E0000007F
+0000003F0001C01F0001C00F80038007C0070003F01E0000FFFC00003FE0001A1B7E9A1F>I<00
+07F8003FFC007E3E01FC7F03F87F03F07F07F07F07F03E07F00007F00007F00007F00007F00007
+F00007F000FFFFC0FFFFC0FFFFC007F00007F00007F00007F00007F00007F00007F00007F00007
+F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F0007F
+FF807FFF807FFF80182A7EA915>I<007F80F001FFE3F807C0FE1C0F807C7C1F003E7C1F003E10
+3F003F003F003F003F003F003F003F003F003F003F003F001F003E001F003E000F807C0007C0F8
+0005FFE0000C7F8000180000001C0000001C0000001E0000001FFFF8001FFFFF000FFFFFC007FF
+FFE003FFFFF00FFFFFF03E0007F07C0001F8F80000F8F80000F8F80000F8F80000F87C0001F07C
+0001F03F0007E00FC01F8007FFFF00007FF0001E287E9A22>I<FFE00000FFE00000FFE000000F
+E000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE00000
+0FE000000FE000000FE07E000FE1FF800FE30FC00FE40FE00FE807E00FF807F00FF007F00FF007
+F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE0
+07F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F0FFFE3FFFFFFE3FFFFFFE3FFF20
+2A7DA925>I<07000F801FC03FE03FE03FE01FC00F8007000000000000000000000000000000FF
+E0FFE0FFE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0
+0FE00FE00FE00FE0FFFEFFFEFFFE0F2B7EAA12>I<FFE0FFE0FFE00FE00FE00FE00FE00FE00FE0
+0FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00F
+E00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0FFFEFFFEFFFE0F2A7EA912>108
+D<FFC07F001FC000FFC1FFC07FF000FFC307E0C1F8000FC407F101FC000FC803F200FC000FD803
+FE00FE000FD003FC00FE000FD003FC00FE000FE003F800FE000FE003F800FE000FE003F800FE00
+0FE003F800FE000FE003F800FE000FE003F800FE000FE003F800FE000FE003F800FE000FE003F8
+00FE000FE003F800FE000FE003F800FE000FE003F800FE000FE003F800FE000FE003F800FE000F
+E003F800FE000FE003F800FE00FFFE3FFF8FFFE0FFFE3FFF8FFFE0FFFE3FFF8FFFE0331B7D9A38
+>I<FFC07E00FFC1FF80FFC30FC00FC40FE00FC807E00FD807F00FD007F00FD007F00FE007F00F
+E007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F0
+0FE007F00FE007F00FE007F00FE007F00FE007F0FFFE3FFFFFFE3FFFFFFE3FFF201B7D9A25>I<
+003FE00001FFFC0003F07E000FC01F801F800FC03F0007E03F0007E07E0003F07E0003F07E0003
+F0FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F87E0003F07E00
+03F03F0007E03F0007E01F800FC00FC01F8007F07F0001FFFC00003FE0001D1B7E9A22>I<FFE1
+FE00FFE7FF80FFFE0FE00FF803F00FF001F80FE001FC0FE000FC0FE000FE0FE000FE0FE0007F0F
+E0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007F0FE0007E0FE000FE0FE000FE
+0FE000FC0FE001FC0FF001F80FF803F00FFC0FE00FEFFF800FE1FC000FE000000FE000000FE000
+000FE000000FE000000FE000000FE000000FE000000FE00000FFFE0000FFFE0000FFFE00002027
+7E9A25>I<FFC3E0FFC7F8FFCC7C0FD8FE0FD0FE0FD0FE0FF0FE0FE07C0FE0000FE0000FE0000F
+E0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE000FF
+FF00FFFF00FFFF00171B7E9A1B>114 D<03FE300FFFF03E03F07800F07000F0F00070F00070F8
+0070FE0000FFE0007FFF007FFFC03FFFE01FFFF007FFF800FFF80007FC0000FCE0007CE0003CF0
+003CF00038F80038FC0070FF01E0E7FFC0C1FF00161B7E9A1B>I<007000007000007000007000
+00F00000F00000F00001F00003F00003F00007F0001FFFE0FFFFE0FFFFE007F00007F00007F000
+07F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F07007F07007F070
+07F07007F07007F07007F07003F0E001F8C000FFC0003F0014267FA51A>I<FFE07FF0FFE07FF0
+FFE07FF00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007
+F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE007F00FE0
+0FF00FE00FF007E017F003F067FF01FFC7FF007F87FF201B7D9A25>I<FFFE07FFFFFE07FFFFFE
+07FF07F000E007F000E007F801E003F801C003F801C001FC038001FC038001FE078000FE070000
+FF0F00007F0E00007F0E00003F9C00003F9C00003FFC00001FF800001FF800000FF000000FF000
+000FF0000007E0000007E0000003C0000003C000201B7F9A23>I<FFFC7FFC1FFCFFFC7FFC1FFC
+FFFC7FFC1FFC0FE00FE001C007F007E0038007F007E0038007F807F0078003F807F0070003F807
+F8070001FC0FF80E0001FC0FF80E0001FE1FFC1E0000FE1CFC1C0000FE1CFE1C0000FF387E3C00
+007F387E3800007F787F3800003FF03F7000003FF03F7000003FE01FF000001FE01FE000001FE0
+1FE000000FC00FC000000FC00FC000000FC00FC0000007800780000007800780002E1B7F9A31>
+I<FFFC1FFEFFFC1FFEFFFC1FFE07F0078003F8070001FC0F0001FE1E0000FE3C00007F7800003F
+F800003FF000001FE000000FE0000007F0000007F800000FF800001FFC00003DFE000038FF0000
+787F0000F03F8001E03FC003C01FE003800FE0FFF03FFFFFF03FFFFFF03FFF201B7F9A23>I<FF
+FE07FFFFFE07FFFFFE07FF07F000E007F000E007F801E003F801C003F801C001FC038001FC0380
+01FE078000FE070000FF0F00007F0E00007F0E00003F9C00003F9C00003FFC00001FF800001FF8
+00000FF000000FF0000007F0000007E0000007E0000003C0000003C00000038000000380000007
+8000380700007C070000FE0E0000FE0E0000FE1C0000FE3800007C7000003FE000000F80000020
+277F9A23>I E /Fn 86 127 df<70F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F870000000000070F8
+F8F870051C779B18>33 D<4010E038F078E038E038E038E038E038E038E038E038E038E0386030
+0D0E7B9C18>I<030600078F00078F00078F00078F00078F00078F007FFFC0FFFFE0FFFFE07FFF
+C00F1E000F1E000F1E000F1E000F1E000F1E007FFFC0FFFFE0FFFFE07FFFC01E3C001E3C001E3C
+001E3C001E3C001E3C000C1800131C7E9B18>I<00C00001C00001C00001C00003F0000FFC003F
+FE007DCF0071C700E1C380E1C780E1C780E1C780F1C00079C0003DC0001FE0000FF80003FC0001
+DE0001CF0001C70061C380F1C380F1C380E1C380E1C70071C70079DE003FFE001FF80007E00001
+C00001C00001C00000C00011247D9F18>I<3803007C07807C0780EE0F80EE0F00EE0F00EE1F00
+EE1E00EE1E00EE3E007C3C007C3C00387C0000780000780000F80000F00001F00001E00001E000
+03E00003C00003C00007C0000783800787C00F87C00F0EE00F0EE01F0EE01E0EE01E0EE03E0EE0
+3C07C03C07C018038013247E9F18>I<01C00007E0000FF0000E70001C38001C38001C38001C38
+001C73F01C73F01CE3F00FE3800FC7000F87000F07001F0E003F0E007B8E0073DC00E1DC00E0F8
+00E0F800E07070E0787070FC707FFFE03FCFE00F03C0141C7F9B18>I<387C7C7E3E0E0E0E1C1C
+38F8F0C0070E789B18>I<007000F001E003C007800F001E001C00380038007000700070007000
+E000E000E000E000E000E000E000E0007000700070007000380038001C001E000F00078003C001
+F000F000700C24799F18>I<6000F00078003C001E000F000780038001C001C000E000E000E000
+E00070007000700070007000700070007000E000E000E000E001C001C0038007800F001E003C00
+7800F00060000C247C9F18>I<01C00001C00001C00001C000C1C180F1C780F9CF807FFF001FFC
+0007F00007F0001FFC007FFF00F9CF80F1C780C1C18001C00001C00001C00001C00011147D9718
+>I<00600000F00000F00000F00000F00000F00000F00000F0007FFFC0FFFFE0FFFFE07FFFC000
+F00000F00000F00000F00000F00000F00000F00000600013147E9718>I<1C3E7E7F3F1F070E1E
+7CF860080C788518>I<7FFF00FFFF80FFFF807FFF0011047D8F18>I<3078FCFC78300606778518
+>I<000300000780000780000F80000F00001F00001E00001E00003E00003C00007C0000780000
+780000F80000F00001F00001E00003E00003C00003C00007C0000780000F80000F00000F00001F
+00001E00003E00003C00003C00007C0000780000F80000F00000F0000060000011247D9F18>I<
+01F00007FC000FFE001F1F001C07003803807803C07001C07001C0E000E0E000E0E000E0E000E0
+E000E0E000E0E000E0E000E0E000E0F001E07001C07001C07803C03803801C07001F1F000FFE00
+07FC0001F000131C7E9B18>I<01800380038007800F803F80FF80FB8043800380038003800380
+0380038003800380038003800380038003800380038003807FFCFFFE7FFC0F1C7B9B18>I<03F0
+000FFE003FFF007C0F807003C0E001C0F000E0F000E06000E00000E00000E00001C00001C00003
+C0000780000F00001E00003C0000780000F00001E00007C0000F80001E00E03C00E07FFFE0FFFF
+E07FFFE0131C7E9B18>I<001F00003F0000770000770000E70001E70001C70003870007870007
+07000E07001E07003C0700380700780700F00700FFFFF8FFFFF8FFFFF800070000070000070000
+0700000700000700007FF000FFF8007FF0151C7F9B18>52 D<007E0001FF0007FF800F83C01E03
+C01C03C0380180380000700000700000E1F800E7FE00FFFF00FE0780F803C0F001C0F000E0E000
+E0F000E07000E07000E07000E03801C03C03C01E07800FFF0007FE0001F800131C7E9B18>54
+D<3078FCFC783000000000000000003078FCFC78300614779318>58 D<183C7E7E3C1800000000
+00000000183C7E7E3E1E0E1C3C78F060071A789318>I<000300000780001F80003F00007E0001
+FC0003F00007E0001FC0003F00007E0000FC0000FC00007E00003F00001FC00007E00003F00001
+FC00007E00003F00001F8000078000030011187D9918>I<7FFFC0FFFFE0FFFFE0FFFFE0000000
+000000000000000000FFFFE0FFFFE0FFFFE07FFFC0130C7E9318>I<600000F00000FC00007E00
+003F00001FC00007E00003F00001FC00007E00003F00001F80001F80003F00007E0001FC0003F0
+0007E0001FC0003F00007E0000FC0000F0000060000011187D9918>I<0FF0003FFC007FFF0070
+0F00F00380F00380600780000F00003E00007C0001F00001E00003C00003C00003C00003C00003
+C00003800000000000000000000000000000000003800007C00007C00007C000038000111C7D9B
+18>I<007C0001FE0007FF000F87801E03C03C1DC0387FC070FFE071E3E071C1E0E1C1E0E380E0
+E380E0E380E0E380E0E380E0E380E0E1C1C071C1C071E3C070FF80387F003C1C001E00E00F83E0
+07FFC001FF80007E00131C7E9B18>I<00700000F80000F80000D80000D80001DC0001DC0001DC
+00018C00038E00038E00038E00038E000306000707000707000707000707000FFF800FFF800FFF
+800E03800E03801C01C01C01C07F07F0FF8FF87F07F0151C7F9B18>I<FFFC00FFFF00FFFF801C
+03C01C01C01C00E01C00E01C00E01C00E01C01E01C01C01C07C01FFF801FFF001FFFC01C03C01C
+00E01C00F01C00701C00701C00701C00701C00F01C00E01C03E0FFFFC0FFFF80FFFE00141C7F9B
+18>I<00F8E003FEE007FFE00F07E01E03E03C01E03800E07000E07000E0700000E00000E00000
+E00000E00000E00000E00000E00000E000007000007000E07000E03800E03C00E01E01C00F07C0
+07FF8003FE0000F800131C7E9B18>I<7FF800FFFE007FFF001C0F801C03C01C03C01C01E01C00
+E01C00E01C00F01C00701C00701C00701C00701C00701C00701C00701C00701C00F01C00E01C00
+E01C01E01C01C01C03C01C0F807FFF00FFFE007FF800141C7F9B18>I<FFFFF0FFFFF0FFFFF01C
+00701C00701C00701C00701C00001C00001C0E001C0E001C0E001FFE001FFE001FFE001C0E001C
+0E001C0E001C00001C00001C00381C00381C00381C00381C0038FFFFF8FFFFF8FFFFF8151C7F9B
+18>I<FFFFE0FFFFE0FFFFE01C00E01C00E01C00E01C00E01C00001C00001C1C001C1C001C1C00
+1FFC001FFC001FFC001C1C001C1C001C1C001C00001C00001C00001C00001C00001C00001C0000
+FFC000FFC000FFC000131C7E9B18>I<01F1C003FDC00FFFC01F0FC01C03C03803C03801C07001
+C07001C0700000E00000E00000E00000E00000E00000E00FF0E01FF0E00FF07001C07001C07003
+C03803C03803C01C07C01F0FC00FFFC003FDC001F1C0141C7E9B18>I<7FFF00FFFF807FFF0001
+C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001
+C00001C00001C00001C00001C00001C00001C00001C00001C0007FFF00FFFF807FFF00111C7D9B
+18>73 D<01FFC003FFC001FFC0000E00000E00000E00000E00000E00000E00000E00000E00000E
+00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00F00E00F00E00F03C
+007FFC003FF0000FC000121C7D9B18>I<7F07F0FF87F87F07F01C03C01C07801C07001C0E001C
+1E001C3C001C38001C70001CF0001DF0001DF0001FB8001FB8001F1C001E1C001C0E001C0E001C
+07001C07001C03801C03801C01C07F03F0FF87F87F03F0151C7F9B18>I<7FE000FFE0007FE000
+0E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0000
+0E00000E00000E00000E00000E00700E00700E00700E00700E00707FFFF0FFFFF07FFFF0141C7F
+9B18>I<FC01F8FE03F8FE03F83B06E03B06E03B06E03B06E03B8EE03B8EE0398CE0398CE039DC
+E039DCE039DCE038D8E038D8E038F8E03870E03870E03800E03800E03800E03800E03800E03800
+E0FE03F8FE03F8FE03F8151C7F9B18>I<7E07F0FF0FF87F07F01D81C01D81C01D81C01DC1C01C
+C1C01CC1C01CE1C01CE1C01CE1C01C61C01C71C01C71C01C31C01C39C01C39C01C39C01C19C01C
+19C01C1DC01C0DC01C0DC01C0DC07F07C0FF87C07F03C0151C7F9B18>I<0FF8003FFE007FFF00
+780F00700700F00780E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380
+E00380E00380E00380E00380E00380E00380F00780700700780F007FFF003FFE000FF800111C7D
+9B18>I<FFFE00FFFF80FFFFC01C03C01C01E01C00E01C00701C00701C00701C00701C00701C00
+E01C01E01C03C01FFFC01FFF801FFE001C00001C00001C00001C00001C00001C00001C00001C00
+00FF8000FF8000FF8000141C7F9B18>I<0FF8003FFE007FFF00780F00700700F00780E00380E0
+0380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380E1
+E380E1E380F0E78070F700787F007FFF003FFE000FFC00001C00001E00000E00000F0000070000
+070011227D9B18>I<7FF800FFFE007FFF001C0F801C03801C03C01C01C01C01C01C01C01C03C0
+1C03801C0F801FFF001FFE001FFE001C0F001C07001C03801C03801C03801C03801C03801C039C
+1C039C1C039C7F01F8FF81F87F00F0161C7F9B18>I<03F3801FFF803FFF807C0F80700780E003
+80E00380E00380E000007000007800003F00001FF00007FE0000FF00000F800003C00001C00000
+E00000E06000E0E000E0E001E0F001C0F80780FFFF80FFFE00E7F800131C7E9B18>I<7FFFF8FF
+FFF8FFFFF8E07038E07038E07038E0703800700000700000700000700000700000700000700000
+700000700000700000700000700000700000700000700000700000700000700007FF0007FF0007
+FF00151C7F9B18>I<FF83FEFF83FEFF83FE1C00701C00701C00701C00701C00701C00701C0070
+1C00701C00701C00701C00701C00701C00701C00701C00701C00701C00701C00701C00700E00E0
+0F01E00783C003FF8001FF00007C00171C809B18>I<FF07F8FF07F8FF07F81C01C01C01C01C01
+C01C01C00E03800E03800E03800E03800F0780070700070700070700070700038E00038E00038E
+00038E00018C0001DC0001DC0001DC0000D80000F80000F800007000151C7F9B18>I<FE03F8FE
+03F8FE03F87000707000707000703800E03800E03800E03800E03800E038F8E038F8E039DCE039
+DCE019DCC019DCC019DCC0198CC01D8DC01D8DC01D8DC01D8DC00D8D800D05800F07800F07800E
+0380151C7F9B18>I<7F8FE07F9FE07F8FE00E07000F0700070E00078E00039C0003DC0001F800
+01F80000F00000F00000700000F00000F80001F80001DC00039E00038E00070F000707000E0780
+0E03801E03C07F07F0FF8FF87F07F0151C7F9B18>I<FF07F8FF07F8FF07F81C01C01E03C00E03
+800F0780070700070700038E00038E0001DC0001DC0001DC0000F80000F8000070000070000070
+0000700000700000700000700000700000700001FC0003FE0001FC00151C7F9B18>I<FFF8FFF8
+FFF8E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E0
+00E000E000E000E000E000E000E000E000E000E000E000FFF8FFF8FFF80D24779F18>91
+D<600000F00000F00000F800007800007C00003C00003C00003E00001E00001F00000F00000F00
+000F800007800007C00003C00003C00003E00001E00001F00000F00000F800007800007800007C
+00003C00003E00001E00001E00001F00000F00000F8000078000078000030011247D9F18>I<FF
+F8FFF8FFF800380038003800380038003800380038003800380038003800380038003800380038
+0038003800380038003800380038003800380038003800380038FFF8FFF8FFF80D247F9F18>I<
+7FFF00FFFF80FFFF807FFF0011047D7F18>95 D<061E3E387070E0E0E0F8FC7C7C38070E789E18
+>I<1FE0003FF8007FFC00781E00300E0000070000070000FF0007FF001FFF007F0700780700E0
+0700E00700E00700F00F00781F003FFFF01FFBF007E1F014147D9318>I<7E0000FE00007E0000
+0E00000E00000E00000E00000E00000E3E000EFF800FFFC00FC1E00F80E00F00700E00700E0038
+0E00380E00380E00380E00380E00380F00700F00700F80E00FC1E00FFFC00EFF80063E00151C80
+9B18>I<01FE0007FF001FFF803E0780380300700000700000E00000E00000E00000E00000E000
+00E000007000007001C03801C03E03C01FFF8007FF0001FC0012147D9318>I<001F80003F8000
+1F8000038000038000038000038000038003E3800FFB801FFF803C1F80380F80700780700380E0
+0380E00380E00380E00380E00380E00380700780700780380F803C1F801FFFF00FFBF803E3F015
+1C7E9B18>I<01F00007FC001FFE003E0F00380780700380700380E001C0E001C0FFFFC0FFFFC0
+FFFFC0E000007000007001C03801C03E03C01FFF8007FF0001FC0012147D9318>I<001F80007F
+C000FFE000E1E001C0C001C00001C00001C0007FFFC0FFFFC0FFFFC001C00001C00001C00001C0
+0001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0007FFF007FFF007FFF
+00131C7F9B18>I<01E1F007FFF80FFFF81E1E301C0E003807003807003807003807003807001C
+0E001E1E001FFC001FF80039E0003800001C00001FFE001FFFC03FFFE07801F0700070E00038E0
+0038E00038E000387800F07E03F01FFFC00FFF8001FC00151F7F9318>I<7E0000FE00007E0000
+0E00000E00000E00000E00000E00000E3E000EFF800FFFC00FC1C00F80E00F00E00E00E00E00E0
+0E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E07FC3FCFFE7FE7FC3FC171C80
+9B18>I<03800007C00007C00007C0000380000000000000000000000000007FC000FFC0007FC0
+0001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0
+0001C000FFFF00FFFF80FFFF00111D7C9C18>I<0038007C007C007C003800000000000000000F
+FC1FFC0FFC001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C
+001C001C001C001C001C6038F078FFF07FE03F800E277E9C18>I<FE0000FE0000FE00000E0000
+0E00000E00000E00000E00000E3FF00E7FF00E3FF00E07800E0F000E1E000E3C000E78000EF000
+0FF8000FFC000F9C000F0E000E0F000E07000E03800E03C0FFC7F8FFC7F8FFC7F8151C7F9B18>
+I<7FE000FFE0007FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0
+0000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0007FFF
+C0FFFFE07FFFC0131C7E9B18>I<7CE0E000FFFBF8007FFFF8001F1F1C001E1E1C001E1E1C001C
+1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C00
+1C1C1C007F1F1F00FFBFBF807F1F1F001914819318>I<7E3E00FEFF807FFFC00FC1C00F80E00F
+00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E07FC3FCFF
+E7FE7FC3FC1714809318>I<01F0000FFE001FFF003E0F803803807001C07001C0E000E0E000E0
+E000E0E000E0E000E0F001E07001C07803C03C07803E0F801FFF000FFE0001F00013147E9318>
+I<7E3E00FEFF807FFFC00FC1E00F80E00F00700E00700E00380E00380E00380E00380E00380E00
+380F00700F00700F80E00FC1E00FFFC00EFF800E3E000E00000E00000E00000E00000E00000E00
+000E00007FC000FFE0007FC000151E809318>I<01E38007FB801FFF803E1F80380F8070078070
+0780E00380E00380E00380E00380E00380E00380700780700780380F803C1F801FFF800FFB8003
+E380000380000380000380000380000380000380000380003FF8003FF8003FF8151E7E9318>I<
+7F87E0FF9FF07FBFF803F87803F03003E00003C00003C000038000038000038000038000038000
+0380000380000380000380007FFE00FFFF007FFE0015147F9318>I<07F7003FFF007FFF00780F
+00E00700E00700E007007C00007FE0001FFC0003FE00001F00600780E00380E00380F00380F80F
+00FFFF00FFFC00E7F00011147D9318>I<0180000380000380000380000380007FFFC0FFFFC0FF
+FFC00380000380000380000380000380000380000380000380000380000380400380E00380E003
+80E001C1C001FFC000FF80003E0013197F9818>I<7E07E0FE0FE07E07E00E00E00E00E00E00E0
+0E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E01E00F03E007FFFC03FFFE
+01FCFC1714809318>I<7F8FF0FF8FF87F8FF01E03C00E03800E03800E03800707000707000707
+00038E00038E00038E00038E0001DC0001DC0001DC0000F80000F80000700015147F9318>I<FF
+8FF8FF8FF8FF8FF83800E03800E03800E01C01C01C01C01C71C01CF9C01CF9C01CD9C01CD9C00D
+DD800DDD800DDD800D8D800F8F800F8F8007070015147F9318>I<7F8FF07F9FF07F8FF0070700
+078E00039E0001DC0001F80000F80000700000F00000F80001DC00039E00038E000707000F0780
+7F8FF0FF8FF87F8FF015147F9318>I<7F8FF0FF8FF87F8FF00E01C00E03800E03800703800707
+00070700038700038600038E0001CE0001CE0000CC0000CC0000DC000078000078000078000070
+0000700000700000F00000E00079E0007BC0007F80003F00001E0000151E7F9318>I<3FFFF07F
+FFF07FFFF07001E07003C0700780000F00001E00003C0000F80001F00003C0000780000F00701E
+00703C0070780070FFFFF0FFFFF0FFFFF014147F9318>I<0007E0001FE0007FE000780000E000
+00E00000E00000E00000E00000E00000E00000E00000E00000E00000E00001E0007FC000FF8000
+FF80007FC00001E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000
+00E000007800007FE0001FE00007E013247E9F18>I<60F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0
+F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0600424769F18>I<7C0000FF0000FFC00003C00000
+E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000F000007FC000
+3FE0003FE0007FC000F00000E00000E00000E00000E00000E00000E00000E00000E00000E00000
+E00000E00003C000FFC000FF00007C000013247E9F18>I<060C1F1E3FBEFBF8F1F060C00F067C
+9B18>I E /Fo 76 124 df<001F83E000F06E3001C078780380F8780300F03007007000070070
+000700700007007000070070000700700007007000FFFFFF800700700007007000070070000700
+700007007000070070000700700007007000070070000700700007007000070070000700700007
+007000070070000700700007007000070070007FE3FF001D20809F1B>11
+D<003F0000E0C001C0C00381E00701E00701E0070000070000070000070000070000070000FFFF
+E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700
+E00700E00700E00700E00700E00700E07FC3FE1720809F19>I<003FE000E0E001C1E00381E007
+00E00700E00700E00700E00700E00700E00700E00700E0FFFFE00700E00700E00700E00700E007
+00E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E007
+00E07FE7FE1720809F19>I<001F81F80000F04F040001C07C06000380F80F000300F00F000700
+F00F00070070000007007000000700700000070070000007007000000700700000FFFFFFFF0007
+007007000700700700070070070007007007000700700700070070070007007007000700700700
+070070070007007007000700700700070070070007007007000700700700070070070007007007
+00070070070007007007007FE3FE3FF02420809F26>I<0080008007E00C981084208260824081
+C087C08FC08FC086E080F08078803F803FE01FF807FC00FE009E008E00870087F083F083F08380
+83808240864084208818B007C000800080008010257DA117>36 D<70F8FCFC7404040408081010
+2040060E7C9F0D>39 D<0020004000800100020006000C000C0018001800300030003000700060
+0060006000E000E000E000E000E000E000E000E000E000E000E000E00060006000600070003000
+30003000180018000C000C000600020001000080004000200B2E7DA112>I<8000400020001000
+08000C00060006000300030001800180018001C000C000C000C000E000E000E000E000E000E000
+E000E000E000E000E000E000C000C000C001C001800180018003000300060006000C0008001000
+2000400080000B2E7DA112>I<70F8FCFC74040404080810102040060E7C840D>44
+D<FFC0FFC00A027F8A0F>I<70F8F8F87005057C840D>I<03F0000E1C001C0E0018060038070070
+0380700380700380700380F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F0
+03C0F003C0F003C0F003C07003807003807003807807803807001806001C0E000E1C0003F00012
+1F7E9D17>48 D<018003800F80F380038003800380038003800380038003800380038003800380
+03800380038003800380038003800380038003800380038007C0FFFE0F1E7C9D17>I<03F0000C
+1C00100E00200700400780800780F007C0F803C0F803C0F803C02007C00007C000078000078000
+0F00000E00001C0000380000700000600000C0000180000300000600400C00401800401000803F
+FF807FFF80FFFF80121E7E9D17>I<03F0000C1C00100E00200F00780F80780780780780380F80
+000F80000F00000F00000E00001C0000380003F000003C00000E00000F000007800007800007C0
+2007C0F807C0F807C0F807C0F00780400780400F00200E001C3C0003F000121F7E9D17>I<0006
+00000600000E00000E00001E00002E00002E00004E00008E00008E00010E00020E00020E00040E
+00080E00080E00100E00200E00200E00400E00C00E00FFFFF0000E00000E00000E00000E00000E
+00000E00000E0000FFE0141E7F9D17>I<1803001FFE001FFC001FF8001FE00010000010000010
+000010000010000010000011F000161C00180E001007001007800003800003800003C00003C000
+03C07003C0F003C0F003C0E00380400380400700200600100E000C380003E000121F7E9D17>I<
+007C000182000701000E03800C07801C0780380300380000780000700000700000F1F000F21C00
+F40600F80700F80380F80380F003C0F003C0F003C0F003C0F003C07003C07003C0700380380380
+3807001807000C0E00061C0001F000121F7E9D17>I<4000007FFFC07FFF807FFF804001008002
+0080020080040000080000080000100000200000200000400000400000C00000C00001C0000180
+00038000038000038000038000078000078000078000078000078000078000078000030000121F
+7D9D17>I<03F0000C0C001006003003002001806001806001806001807001807803003E03003F
+06001FC8000FF00003F80007FC000C7E00103F00300F806003804001C0C001C0C000C0C000C0C0
+00C0C000806001802001001002000C0C0003F000121F7E9D17>I<03F0000E18001C0C00380600
+380700700700700380F00380F00380F003C0F003C0F003C0F003C0F003C07007C07007C03807C0
+180BC00E13C003E3C0000380000380000380000700300700780600780E00700C00201800107000
+0FC000121F7E9D17>I<70F8F8F8700000000000000000000070F8F8F87005147C930D>I<70F8F8
+F8700000000000000000000070F0F8F878080808101010202040051D7C930D>I<000100000003
+800000038000000380000007C0000007C0000007C0000009E0000009E0000009E0000010F00000
+10F0000010F00000207800002078000020780000403C0000403C0000403C0000801E0000801E00
+00FFFE0001000F0001000F0001000F00020007800200078002000780040003C00E0003C01F0007
+E0FFC03FFE1F207F9F22>65 D<FFFFE0000F80380007801E0007801F0007800F0007800F800780
+0F8007800F8007800F8007800F8007800F0007801F0007801E0007803C0007FFF00007803C0007
+801E0007800F0007800F8007800780078007C0078007C0078007C0078007C0078007C007800780
+07800F8007800F0007801F000F803C00FFFFF0001A1F7E9E20>I<000FC040007030C001C009C0
+038005C0070003C00E0001C01E0000C01C0000C03C0000C07C0000407C00004078000040F80000
+00F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8000000780000007C00
+00407C0000403C0000401C0000401E0000800E000080070001000380020001C004000070380000
+0FC0001A217D9F21>I<FFFFE0000F803C0007801E000780070007800380078003C0078001E007
+8001E0078001F0078000F0078000F0078000F8078000F8078000F8078000F8078000F8078000F8
+078000F8078000F8078000F8078000F0078000F0078000F0078001E0078001E0078003C0078003
+800780070007800E000F803C00FFFFE0001D1F7E9E23>I<FFFFFF000F800F0007800300078003
+000780010007800180078000800780008007800080078080800780800007808000078080000781
+800007FF8000078180000780800007808000078080000780800007800020078000200780002007
+8000400780004007800040078000C0078000C0078001800F800F80FFFFFF801B1F7E9E1F>I<FF
+FFFF000F800F000780030007800300078001000780018007800080078000800780008007800080
+078080000780800007808000078080000781800007FF8000078180000780800007808000078080
+000780800007800000078000000780000007800000078000000780000007800000078000000FC0
+0000FFFE0000191F7E9E1E>I<000FE0200078186000E004E0038002E0070001E00F0000E01E00
+00601E0000603C0000603C0000207C00002078000020F8000000F8000000F8000000F8000000F8
+000000F8000000F8000000F8007FFCF80003E0780001E07C0001E03C0001E03C0001E01E0001E0
+1E0001E00F0001E0070001E0038002E000E0046000781820000FE0001E217D9F24>I<FFF8FFF8
+0F800F8007800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F
+0007800F0007800F0007800F0007FFFF0007800F0007800F0007800F0007800F0007800F000780
+0F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F000F800F80FF
+F8FFF81D1F7E9E22>I<FFFC0FC007800780078007800780078007800780078007800780078007
+80078007800780078007800780078007800780078007800780078007800FC0FFFC0E1F7F9E10>
+I<0FFFC0007C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C
+00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00203C00F83C00F83C
+00F83C00F0380040780040700030E0000F800012207E9E17>I<FFFC0FFC0FC003E00780018007
+800100078002000780040007800800078010000780200007804000078080000781000007830000
+07878000078F80000793C0000791E00007A1E00007C0F0000780F0000780780007803C0007803C
+0007801E0007801E0007800F000780078007800780078007C00FC007E0FFFC3FFC1E1F7E9E23>
+I<FFFE000FC0000780000780000780000780000780000780000780000780000780000780000780
+000780000780000780000780000780000780000780000780020780020780020780020780060780
+0407800407800C07801C0F807CFFFFFC171F7E9E1C>I<FF80001FF80F80001F800780001F0005
+C0002F0005C0002F0005C0002F0004E0004F0004E0004F000470008F000470008F000470008F00
+0438010F000438010F000438010F00041C020F00041C020F00041C020F00040E040F00040E040F
+00040E040F000407080F000407080F000407080F000403900F000403900F000401E00F000401E0
+0F000401E00F000E00C00F001F00C01F80FFE0C1FFF8251F7E9E2A>I<FF803FF807C007C007C0
+038005E0010005E0010004F001000478010004780100043C0100043C0100041E0100040F010004
+0F010004078100040781000403C1000401E1000401E1000400F1000400F1000400790004003D00
+04003D0004001F0004001F0004000F0004000700040007000E0003001F000300FFE001001D1F7E
+9E22>I<001F800000F0F00001C0380007801E000F000F000E0007001E0007803C0003C03C0003
+C07C0003E0780001E0780001E0F80001F0F80001F0F80001F0F80001F0F80001F0F80001F0F800
+01F0F80001F0F80001F0780001E07C0003E07C0003E03C0003C03C0003C01E0007800E0007000F
+000F0007801E0001C0380000F0F000001F80001C217D9F23>I<FFFFE0000F80780007801C0007
+801E0007800F0007800F8007800F8007800F8007800F8007800F8007800F8007800F0007801E00
+07801C000780780007FFE000078000000780000007800000078000000780000007800000078000
+000780000007800000078000000780000007800000078000000FC00000FFFC0000191F7E9E1F>
+I<FFFF80000F80F0000780780007803C0007801E0007801E0007801F0007801F0007801F000780
+1F0007801E0007801E0007803C00078078000780F00007FF80000781C0000780E0000780F00007
+80700007807800078078000780780007807C0007807C0007807C0007807C0407807E0407803E04
+0FC01E08FFFC0F10000003E01E207E9E21>82 D<07E0800C1980100780300380600180600180E0
+0180E00080E00080E00080F00000F000007800007F00003FF0001FFC000FFE0003FF00001F8000
+07800003C00003C00001C08001C08001C08001C08001C0C00180C00380E00300F00600CE0C0081
+F80012217D9F19>I<7FFFFFE0780F01E0600F0060400F0020400F0020C00F0030800F0010800F
+0010800F0010800F0010000F0000000F0000000F0000000F0000000F0000000F0000000F000000
+0F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000
+000F0000000F0000001F800007FFFE001C1F7E9E21>I<FFFC3FF80FC007C00780038007800100
+078001000780010007800100078001000780010007800100078001000780010007800100078001
+000780010007800100078001000780010007800100078001000780010007800100078001000780
+0100038002000380020001C0020001C0040000E008000070180000382000000FC0001D207E9E22
+>I<FFF003FE1F8000F80F0000600F800060078000400780004003C0008003C0008003C0008001
+E0010001E0010001F0010000F0020000F0020000F806000078040000780400003C0800003C0800
+003C0800001E1000001E1000001F3000000F2000000F20000007C0000007C0000007C000000380
+000003800000038000000100001F207F9E22>I<FFF07FF81FF01F800FC007C00F00078003800F
+00078001000F0007C00100078007C00200078007C00200078007C0020003C009E0040003C009E0
+040003C009E0040003E010F00C0001E010F0080001E010F0080001F02078080000F02078100000
+F02078100000F0403C10000078403C20000078403C20000078C03E2000003C801E4000003C801E
+4000003C801E4000001F000F8000001F000F8000001F000F8000001E00078000000E0007000000
+0E00070000000C000300000004000200002C207F9E2F>I<FFF003FF1F8000F80F800060078000
+4007C0004003E0008001E0008001F0010000F0030000F80200007C0400003C0400003E0800001E
+0800001F1000000FB0000007A0000007C0000003C0000003C0000003C0000003C0000003C00000
+03C0000003C0000003C0000003C0000003C0000003C0000007C000007FFE00201F7F9E22>89
+D<FEFEC0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0
+C0C0C0C0C0FEFE072D7CA10D>91 D<FEFE06060606060606060606060606060606060606060606
+06060606060606060606060606060606060606FEFE072D7FA10D>93 D<081020204040808080B8
+FCFC7C38060E7D9F0D>96 D<1FE000303000781800781C00300E00000E00000E00000E0000FE00
+078E001E0E00380E00780E00F00E10F00E10F00E10F01E10781E103867200F83C014147E9317>
+I<0E0000FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E3E
+000EC3800F01C00F00E00E00E00E00700E00700E00780E00780E00780E00780E00780E00780E00
+700E00700E00E00F00E00D01C00CC300083E0015207F9F19>I<03F80E0C1C1E381E380C700070
+00F000F000F000F000F000F00070007000380138011C020E0C03F010147E9314>I<000380003F
+8000038000038000038000038000038000038000038000038000038000038003E380061B801C07
+80380380380380700380700380F00380F00380F00380F00380F00380F003807003807003803803
+803807801C07800E1B8003E3F815207E9F19>I<03F0000E1C001C0E0038070038070070070070
+0380F00380F00380FFFF80F00000F00000F000007000007000003800801800800C010007060001
+F80011147F9314>I<007C00C6018F038F07060700070007000700070007000700FFF007000700
+07000700070007000700070007000700070007000700070007000700070007007FF01020809F0E
+>I<0000E003E3300E3C301C1C30380E00780F00780F00780F00780F00780F00380E001C1C001E
+380033E0002000002000003000003000003FFE001FFF800FFFC03001E0600070C00030C00030C0
+0030C000306000603000C01C038003FC00141F7F9417>I<0E0000FE00000E00000E00000E0000
+0E00000E00000E00000E00000E00000E00000E00000E3E000E43000E81800F01C00F01C00E01C0
+0E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0
+FFE7FC16207F9F19>I<1C003E003E003E001C000000000000000000000000000E007E000E000E
+000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E00FFC00A1F809E0C>
+I<00E001F001F001F000E0000000000000000000000000007007F000F000700070007000700070
+00700070007000700070007000700070007000700070007000700070007000706070F060F0C061
+803F000C28829E0E>I<0E0000FE00000E00000E00000E00000E00000E00000E00000E00000E00
+000E00000E00000E0FF00E03C00E03000E02000E04000E08000E10000E30000E70000EF8000F38
+000E1C000E1E000E0E000E07000E07800E03800E03C00E03E0FFCFF815207F9F18>I<0E00FE00
+0E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E
+000E000E000E000E000E000E000E000E000E00FFE00B20809F0C>I<0E1F01F000FE618618000E
+81C81C000F00F00E000F00F00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E00
+0E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E
+000E00E00E00FFE7FE7FE023147F9326>I<0E3E00FE43000E81800F01C00F01C00E01C00E01C0
+0E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0FFE7FC
+16147F9319>I<01F800070E001C03803801C03801C07000E07000E0F000F0F000F0F000F0F000
+F0F000F0F000F07000E07000E03801C03801C01C0380070E0001F80014147F9317>I<0E3E00FE
+C3800F01C00F00E00E00E00E00F00E00700E00780E00780E00780E00780E00780E00780E00700E
+00F00E00E00F01E00F01C00EC3000E3E000E00000E00000E00000E00000E00000E00000E00000E
+0000FFE000151D7F9319>I<03E0800619801C05803C0780380380780380700380F00380F00380
+F00380F00380F00380F003807003807803803803803807801C0B800E138003E380000380000380
+000380000380000380000380000380000380003FF8151D7E9318>I<0E78FE8C0F1E0F1E0F0C0E
+000E000E000E000E000E000E000E000E000E000E000E000E000E00FFE00F147F9312>I<1F9030
+704030C010C010C010E00078007F803FE00FF00070803880188018C018C018E030D0608F800D14
+7E9312>I<020002000200060006000E000E003E00FFF80E000E000E000E000E000E000E000E00
+0E000E000E000E080E080E080E080E080610031001E00D1C7F9B12>I<0E01C0FE1FC00E01C00E
+01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E
+03C00603C0030DC001F1FC16147F9319>I<FF83F81E01E01C00C00E00800E00800E0080070100
+07010003820003820003820001C40001C40001EC0000E80000E800007000007000007000002000
+15147F9318>I<FF9FE1FC3C0780701C0300601C0380200E0380400E0380400E03C0400707C080
+0704C0800704E080038861000388710003C8730001D0320001D03A0000F03C0000E01C0000E01C
+0000601800004008001E147F9321>I<7FC3FC0F01E00701C007018003810001C20000E40000EC
+00007800003800003C00007C00004E000087000107000303800201C00601E01E01E0FF07FE1714
+809318>I<FF83F81E01E01C00C00E00800E00800E008007010007010003820003820003820001
+C40001C40001EC0000E80000E800007000007000007000002000002000004000004000004000F0
+8000F08000F100006200003C0000151D7F9318>I<3FFF380E200E201C40384078407000E001E0
+01C00380078007010E011E011C0338027006700EFFFE10147F9314>I<FFFFFC1601808C17>I
+E /Fp 14 122 df<0000001FFC0000C000000003FFFFC001C00000001FFFFFF003C00000007FFF
+FFFC07C0000001FFFC00FE0FC0000007FFC0001F9FC000000FFE000007FFC000003FF8000003FF
+C000007FF0000000FFC00000FFE00000007FC00001FFC00000007FC00001FF800000003FC00003
+FF000000001FC00007FE000000001FC0000FFE000000000FC0000FFC000000000FC0001FFC0000
+000007C0001FFC0000000007C0003FF80000000007C0003FF80000000003C0003FF80000000003
+C0007FF80000000003C0007FF80000000003C0007FF0000000000000007FF000000000000000FF
+F000000000000000FFF000000000000000FFF000000000000000FFF000000000000000FFF00000
+0000000000FFF000000000000000FFF000000000000000FFF000000000000000FFF00000000000
+0000FFF000000000000000FFF000001FFFFFFF807FF000001FFFFFFF807FF000001FFFFFFF807F
+F800001FFFFFFF807FF800000001FFC0003FF800000001FFC0003FF800000001FFC0003FF80000
+0001FFC0001FFC00000001FFC0001FFC00000001FFC0000FFE00000001FFC0000FFE00000001FF
+C00007FF00000001FFC00003FF00000001FFC00001FF80000001FFC00001FFC0000001FFC00000
+FFE0000001FFC000007FF0000003FFC000003FFC000003FFC000000FFF000007FFC0000007FFC0
+001FBFC0000001FFFC00FF1FC00000007FFFFFFE0FC00000001FFFFFF803C000000003FFFFE000
+C0000000001FFE00000000413D7BBB4C>71 D<FFFFFFFE000000FFFFFFFE000000FFFFFFFE0000
+00FFFFFFFE000000007FF000000000007FF000000000007FF000000000007FF000000000007FF0
+00000000007FF000000000007FF000000000007FF000000000007FF000000000007FF000000000
+007FF000000000007FF000000000007FF000000000007FF000000000007FF000000000007FF000
+000000007FF000000000007FF000000000007FF000000000007FF000000000007FF00000000000
+7FF000000000007FF000000000007FF000000000007FF000000000007FF000000000007FF00000
+0000007FF000000000007FF000000000007FF000000000007FF000000000007FF000000780007F
+F000000780007FF000000780007FF000000780007FF000000780007FF000000F80007FF000000F
+00007FF000000F00007FF000000F00007FF000001F00007FF000001F00007FF000001F00007FF0
+00003F00007FF000003F00007FF000007F00007FF00000FF00007FF00001FF00007FF00003FF00
+007FF0000FFE00007FF0007FFE00FFFFFFFFFFFE00FFFFFFFFFFFE00FFFFFFFFFFFE00FFFFFFFF
+FFFE00313B7CBA3A>76 D<FFFFF0000007FFFFE0FFFFF8000007FFFFE0FFFFFC000007FFFFE0FF
+FFFE000007FFFFE0007FFE00000007E000007FFF00000003C000007FFF80000003C000007BFFC0
+000003C000007BFFE0000003C0000079FFE0000003C0000078FFF0000003C00000787FF8000003
+C00000783FFC000003C00000783FFE000003C00000781FFE000003C00000780FFF000003C00000
+7807FF800003C000007803FFC00003C000007803FFE00003C000007801FFE00003C000007800FF
+F00003C0000078007FF80003C0000078003FFC0003C0000078003FFE0003C0000078001FFF0003
+C0000078000FFF0003C00000780007FF8003C00000780003FFC003C00000780003FFE003C00000
+780001FFF003C00000780000FFF003C000007800007FF803C000007800003FFC03C00000780000
+3FFE03C000007800001FFF03C000007800000FFF03C0000078000007FF83C0000078000003FFC3
+C0000078000003FFE3C0000078000001FFF3C0000078000000FFF3C00000780000007FFBC00000
+780000003FFFC00000780000003FFFC00000780000001FFFC00000780000000FFFC00000780000
+0007FFC000007800000003FFC000007800000003FFC000007800000001FFC000007800000000FF
+C0000078000000007FC0000078000000003FC0000078000000003FC00000FC000000001FC000FF
+FFFC0000000FC000FFFFFC00000007C000FFFFFC00000003C000FFFFFC00000003C000433B7CBA
+4C>78 D<FFFFFFFFF800000000FFFFFFFFFFC0000000FFFFFFFFFFF8000000FFFFFFFFFFFE0000
+00007FF0001FFF000000007FF00003FFC00000007FF00000FFE00000007FF000007FF00000007F
+F000003FF80000007FF000003FF80000007FF000003FFC0000007FF000001FFC0000007FF00000
+1FFC0000007FF000001FFE0000007FF000001FFE0000007FF000001FFE0000007FF000001FFE00
+00007FF000001FFE0000007FF000001FFE0000007FF000001FFC0000007FF000001FFC0000007F
+F000003FFC0000007FF000003FF80000007FF000007FF00000007FF000007FE00000007FF00001
+FFC00000007FF00003FF800000007FF0001FFE000000007FFFFFFFF8000000007FFFFFFFC00000
+00007FFFFFFFC0000000007FF0007FF0000000007FF0001FF8000000007FF0000FFC000000007F
+F00007FE000000007FF00003FF000000007FF00003FF800000007FF00001FF800000007FF00001
+FF800000007FF00001FFC00000007FF00001FFC00000007FF00001FFC00000007FF00001FFC000
+00007FF00001FFC00000007FF00001FFE00000007FF00001FFE00000007FF00001FFE00000007F
+F00001FFE00000007FF00001FFE00000007FF00001FFE001E0007FF00001FFE001E0007FF00000
+FFF001E0007FF00000FFF001E0007FF00000FFF003C0007FF000007FF803C0FFFFFFF8003FFC07
+80FFFFFFF8001FFE0F80FFFFFFF80007FFFF00FFFFFFF80001FFFC000000000000001FF000433C
+7CBA48>82 D<FFFFFFF8001FFFFF80FFFFFFF8001FFFFF80FFFFFFF8001FFFFF80FFFFFFF8001F
+FFFF80007FF00000001F8000007FF00000000F0000007FF00000000F0000007FF00000000F0000
+007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF0
+0000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF0000000
+0F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000
+007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF0
+0000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF0000000
+0F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000
+007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF0
+0000000F0000007FF00000000F0000007FF00000000F0000007FF00000000F0000007FF0000000
+0F0000007FF00000000F0000003FF00000001E0000003FF00000001E0000003FF80000001E0000
+001FF80000003C0000001FF80000003C0000000FFC0000007800000007FC000000F800000007FE
+000001F000000003FF000003F000000001FF800007E000000000FFE0001FC0000000003FFC01FF
+80000000001FFFFFFE000000000007FFFFF8000000000000FFFFE00000000000000FFE00000000
+413C7CBA4A>85 D<003FFE00000001FFFFE0000007FFFFF800000FE007FC00000FF001FE00001F
+F800FF00001FF8007F80001FF8007FC0001FF8003FC0000FF0003FE00007E0003FE00003C0003F
+E0000000003FE0000000003FE0000000003FE0000000003FE0000000FFFFE000001FFFFFE00000
+7FF83FE00003FF803FE00007FC003FE0000FF0003FE0001FE0003FE0003FE0003FE0007FC0003F
+E0007FC0003FE000FF80003FE000FF80003FE000FF80003FE000FF80003FE000FF80007FE0007F
+C0007FE0007FC000DFE0003FE0039FF0001FF80F0FFFE007FFFE0FFFE001FFF807FFE0003FE000
+FFE02B267DA52F>97 D<00FE00000000FFFE00000000FFFE00000000FFFE00000000FFFE000000
+0007FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE
+0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE0000000003FE000000
+0003FE0000000003FE0000000003FE0000000003FE0000000003FE01FF000003FE1FFFF00003FE
+7FFFFC0003FEFC03FE0003FFF000FF0003FFC0003F8003FF00001FC003FE00001FE003FE00000F
+F003FE00000FF803FE00000FF803FE000007FC03FE000007FC03FE000007FC03FE000007FE03FE
+000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007FE03FE000007
+FE03FE000007FE03FE000007FC03FE000007FC03FE000007FC03FE00000FFC03FE00000FF803FE
+00000FF003FE00001FF003FF00001FE003FF80003FC003FFC0007F8003F9E000FF0003F0FC07FE
+0003F07FFFF80003E01FFFE00003C003FE00002F3C7DBB36>I<000000003F800000003FFF8000
+00003FFF800000003FFF800000003FFF8000000001FF8000000000FF8000000000FF8000000000
+FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000
+000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000FF8000000000
+FF800000FF80FF80000FFFF0FF80003FFFFCFF8000FFC03FFF8001FE000FFF8003FC0003FF8007
+F80001FF800FF00000FF801FF00000FF803FE00000FF803FE00000FF807FE00000FF807FC00000
+FF807FC00000FF807FC00000FF80FFC00000FF80FFC00000FF80FFC00000FF80FFC00000FF80FF
+C00000FF80FFC00000FF80FFC00000FF80FFC00000FF80FFC00000FF807FC00000FF807FC00000
+FF807FC00000FF803FE00000FF803FE00000FF801FE00000FF800FF00001FF8007F00003FF8003
+F80007FF8001FE001FFFC000FF807EFFFE007FFFF8FFFE000FFFE0FFFE0001FF00FFFE2F3C7DBB
+36>100 D<0001FF8000000FFFF000003FFFFC0000FF81FE0003FE007F8007F8003F800FF8001F
+C00FF0000FE01FE0000FE03FE0000FF03FE00007F07FC00007F07FC00007F87FC00007F8FFC000
+07F8FFC00007F8FFFFFFFFF8FFFFFFFFF8FFFFFFFFF8FFC0000000FFC0000000FFC0000000FFC0
+0000007FC00000007FC00000007FC00000003FE00000003FE00000781FE00000781FF00000780F
+F00000F007F80001F003FC0003E001FE000FC000FFC07F80003FFFFE00000FFFF8000000FFC000
+25267DA52C>I<01E00007F8000FFC000FFC001FFE001FFE001FFE001FFE000FFC000FFC0007F8
+0001E00000000000000000000000000000000000000000000000000000000000000000000000FE
+00FFFE00FFFE00FFFE00FFFE0007FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE
+0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE
+0003FE0003FE0003FE0003FE0003FE0003FE0003FE00FFFFF0FFFFF0FFFFF0FFFFF0143D7DBC1A
+>105 D<00FE00FFFE00FFFE00FFFE00FFFE0007FE0003FE0003FE0003FE0003FE0003FE0003FE
+0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE
+0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE
+0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE0003FE
+0003FE0003FE0003FE0003FE0003FE00FFFFF8FFFFF8FFFFF8FFFFF8153C7DBB1A>108
+D<01FC00FF8000FFFC03FFF000FFFC0FFFF800FFFC1E03FC00FFFC3801FE0007FC6001FF0003FC
+C000FF0003FDC000FF8003FD8000FF8003FF0000FF8003FF0000FF8003FF0000FF8003FE0000FF
+8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE
+0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF
+8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE0000FF8003FE
+0000FF8003FE0000FF80FFFFF83FFFFEFFFFF83FFFFEFFFFF83FFFFEFFFFF83FFFFE2F267CA536
+>110 D<01FC03F000FFFC0FFC00FFFC1FFF00FFFC3C3F80FFFC707F8007FCE0FFC003FCC0FFC0
+03FD80FFC003FD80FFC003FF807F8003FF003F0003FF001E0003FF00000003FE00000003FE0000
+0003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00
+000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE00000003FE
+00000003FE00000003FE00000003FE000000FFFFFC0000FFFFFC0000FFFFFC0000FFFFFC000022
+267DA528>114 D<FFFFF001FFFCFFFFF001FFFCFFFFF001FFFCFFFFF001FFFC03FE00001F8003
+FF00001F0001FF00001E0001FF80003E0000FF80003C0000FF80003C00007FC0007800007FC000
+7800007FE000F800003FE000F000003FF001F000001FF001E000001FF803E000000FF803C00000
+0FFC03C0000007FC0780000007FC0780000007FE0F80000003FE0F00000003FF1F00000001FF1E
+00000001FFBE00000000FFBC00000000FFFC000000007FF8000000007FF8000000007FF8000000
+003FF0000000003FF0000000001FE0000000001FE0000000000FC0000000000FC0000000000780
+000000000780000000000F80000000000F00000000001F00000000001E00000008003E0000007F
+003C0000007F007C000000FF8078000000FF80F8000000FF80F0000000FF81E00000007F07C000
+00007C1F800000003FFF000000001FFE0000000007F0000000002E377EA533>121
+D E end
+%%EndProlog
+%%BeginSetup
+%%Feature: *Resolution 300dpi
+TeXDict begin
+
+%%EndSetup
+%%Page: 1 1
+0 bop 0 1152 a Fp(GNU)33 b(Readline)h(Library)p 0 1201 1950
+17 v 1011 1250 a Fo(Edition)17 b(2.0,)c(for)i Fn(Readline)f(Library)g
+Fo(V)l(ersion)i(2.0.)1759 1304 y(July)g(1994)0 2443 y Fm(Brian)23
+b(F)-6 b(o)n(x,)23 b(F)-6 b(ree)23 b(Soft)n(w)n(are)f(F)-6
+b(oundation)0 2509 y(Chet)22 b(Ramey)-6 b(,)23 b(Case)e(W)-6
+b(estern)23 b(Reserv)n(e)f(Univ)n(ersit)n(y)p 0 2545 1950 9
+v eop
+%%Page: 2 2
+1 bop 0 295 a Fo(This)15 b(do)q(cumen)o(t)f(describ)q(es)i(the)e(GNU)g
+(Readline)j(Library)l(,)d(a)g(utilit)o(y)h(whic)o(h)g(aids)g(in)g(the)f
+(consistency)h(of)f(user)0 358 y(in)o(terface)h(across)g(discrete)h(programs)
+e(that)g(need)j(to)d(pro)o(vide)i(a)f(command)g(line)i(in)o(terface.)0
+495 y(Published)g(b)o(y)f(the)f(F)l(ree)g(Soft)o(w)o(are)f(F)l(oundation)0
+557 y(675)g(Massac)o(h)o(usetts)g(Av)o(en)o(ue,)0 619 y(Cam)o(bridge,)h(MA)g
+(02139)f(USA)0 756 y(P)o(ermission)f(is)g(gran)o(ted)f(to)f(mak)o(e)h(and)h
+(distribute)h(v)o(erbatim)e(copies)h(of)f(this)h(man)o(ual)g(pro)o(vided)g
+(the)f(cop)o(yrigh)o(t)0 818 y(notice)k(and)f(this)h(p)q(ermission)h(notice)e
+(are)g(preserv)o(ed)h(on)f(all)h(copies.)0 955 y(P)o(ermission)f(is)f(gran)o
+(ted)f(to)h(cop)o(y)g(and)g(distribute)h(mo)q(di\014ed)h(v)o(ersions)e(of)f
+(this)i(man)o(ual)f(under)h(the)f(conditions)0 1018 y(for)e(v)o(erbatim)g
+(cop)o(ying,)h(pro)o(vided)h(that)d(the)i(en)o(tire)g(resulting)h(deriv)o(ed)
+f(w)o(ork)f(is)h(distributed)h(under)f(the)g(terms)0 1080 y(of)i(a)g(p)q
+(ermission)h(notice)g(iden)o(tical)h(to)e(this)g(one.)0 1217
+y(P)o(ermission)20 b(is)g(gran)o(ted)f(to)g(cop)o(y)h(and)f(distribute)i
+(translations)f(of)f(this)h(man)o(ual)f(in)o(to)h(another)f(language,)0
+1279 y(under)c(the)f(ab)q(o)o(v)o(e)g(conditions)h(for)e(mo)q(di\014ed)j(v)o
+(ersions,)e(except)g(that)g(this)g(p)q(ermission)i(notice)e(ma)o(y)g(b)q(e)h
+(stated)0 1341 y(in)h(a)f(translation)g(appro)o(v)o(ed)g(b)o(y)g(the)g(F)l
+(oundation.)0 2636 y(Cop)o(yrigh)o(t)226 2635 y(c)214 2636
+y Fl(\015)g Fo(1989,)f(1991)g(F)l(ree)h(Soft)o(w)o(are)f(F)l(oundation,)h
+(Inc.)p eop
+%%Page: 1 3
+2 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227
+b(1)0 158 y Fk(1)41 b(Command)16 b(Line)f(Editing)62 383 y
+Fo(This)h(c)o(hapter)f(describ)q(es)i(the)e(basic)h(features)f(of)g(the)g
+(GNU)g(command)g(line)i(editing)f(in)o(terface.)0 676 y Fm(1.1)33
+b(In)n(tro)r(duction)17 b(to)e(Line)h(Editing)62 820 y Fo(The)g(follo)o(wing)
+g(paragraphs)e(describ)q(e)j(the)e(notation)g(used)h(to)e(represen)o(t)i(k)o
+(eystrok)o(es.)62 965 y(The)f(text)e Fn(C-K)h Fo(is)g(read)g(as)g(`Con)o
+(trol-K')f(and)h(describ)q(es)i(the)e(c)o(haracter)f(pro)q(duced)i(when)g
+(the)f(Con)o(trol)f(k)o(ey)0 1027 y(is)j(depressed)g(and)f(the)h
+Fn(K)f Fo(k)o(ey)g(is)g(struc)o(k.)62 1172 y(The)i(text)f Fn(M-K)g
+Fo(is)i(read)e(as)g(`Meta-K')g(and)h(describ)q(es)h(the)f(c)o(haracter)f(pro)
+q(duced)h(when)h(the)e(meta)g(k)o(ey)h(\(if)0 1234 y(y)o(ou)g(ha)o(v)o(e)f
+(one\))h(is)g(depressed,)h(and)f(the)g Fn(K)g Fo(k)o(ey)g(is)g(struc)o(k.)25
+b(If)17 b(y)o(ou)f(do)h(not)g(ha)o(v)o(e)f(a)h(meta)f(k)o(ey)l(,)h(the)g
+(iden)o(tical)0 1296 y(k)o(eystrok)o(e)i(can)g(b)q(e)i(generated)e(b)o(y)h(t)
+o(yping)f Fn(ESC)h Fj(\014rst)p Fo(,)g(and)f(then)h(t)o(yping)g
+Fn(K)p Fo(.)33 b(Either)20 b(pro)q(cess)g(is)g(kno)o(wn)f(as)0
+1358 y Fj(metafying)g Fo(the)c Fn(K)g Fo(k)o(ey)l(.)62 1503
+y(The)h(text)e Fn(M-C-K)g Fo(is)i(read)f(as)f(`Meta-Con)o(trol-k')g(and)h
+(describ)q(es)h(the)g(c)o(haracter)e(pro)q(duced)i(b)o(y)f
+Fj(metafying)0 1565 y Fn(C-K)p Fo(.)62 1710 y(In)i(addition,)h(sev)o(eral)e
+(k)o(eys)g(ha)o(v)o(e)g(their)h(o)o(wn)f(names.)23 b(Sp)q(eci\014cally)m(,)c
+Fn(DEL)p Fo(,)d Fn(ESC)p Fo(,)f Fn(LFD)p Fo(,)h Fn(SPC)p Fo(,)g
+Fn(RET)p Fo(,)g(and)g Fn(TAB)0 1772 y Fo(all)e(stand)f(for)f(themselv)o(es)i
+(when)f(seen)h(in)g(this)f(text,)g(or)g(in)g(an)g(init)i(\014le)f(\(see)f
+(Section)h(1.3)e([Readline)j(Init)f(File],)0 1834 y(page)h(4,)g(for)f(more)h
+(info\).)0 2127 y Fm(1.2)33 b(Readline)16 b(In)n(teraction)62
+2271 y Fo(Often)g(during)h(an)f(in)o(teractiv)o(e)g(session)h(y)o(ou)e(t)o
+(yp)q(e)h(in)h(a)f(long)g(line)h(of)f(text,)f(only)h(to)g(notice)g(that)f
+(the)h(\014rst)0 2334 y(w)o(ord)d(on)i(the)f(line)i(is)e(missp)q(elled.)23
+b(The)14 b(Readline)i(library)f(giv)o(es)g(y)o(ou)e(a)h(set)g(of)g(commands)g
+(for)f(manipulating)0 2396 y(the)18 b(text)g(as)g(y)o(ou)g(t)o(yp)q(e)g(it)h
+(in,)g(allo)o(wing)g(y)o(ou)f(to)g(just)g(\014x)g(y)o(our)g(t)o(yp)q(o,)g
+(and)h(not)f(forcing)g(y)o(ou)g(to)g(ret)o(yp)q(e)g(the)0 2458
+y(ma)s(jorit)o(y)d(of)h(the)g(line.)25 b(Using)17 b(these)g(editing)h
+(commands,)e(y)o(ou)g(mo)o(v)o(e)f(the)i(cursor)f(to)g(the)g(place)h(that)f
+(needs)0 2521 y(correction,)g(and)h(delete)g(or)f(insert)g(the)h(text)e(of)h
+(the)g(corrections.)23 b(Then,)17 b(when)g(y)o(ou)f(are)g(satis\014ed)g(with)
+h(the)0 2583 y(line,)h(y)o(ou)e(simply)i(press)f Fn(RETURN)p
+Fo(.)23 b(Y)l(ou)17 b(do)f(not)g(ha)o(v)o(e)g(to)g(b)q(e)i(at)e(the)g(end)h
+(of)f(the)h(line)h(to)e(press)h Fn(RETURN)p Fo(;)f(the)0 2645
+y(en)o(tire)g(line)h(is)e(accepted)h(regardless)f(of)g(the)g(lo)q(cation)h
+(of)f(the)h(cursor)e(within)j(the)e(line.)p eop
+%%Page: 2 4
+3 bop 0 -83 a Fo(2)1472 b(GNU)15 b(Readline)i(Library)0 158
+y Fi(1.2.1)30 b(Readline)15 b(Bare)g(Essen)n(tials)62 295 y
+Fo(In)f(order)f(to)f(en)o(ter)h(c)o(haracters)g(in)o(to)g(the)g(line,)i
+(simply)f(t)o(yp)q(e)f(them.)19 b(The)14 b(t)o(yp)q(ed)f(c)o(haracter)f(app)q
+(ears)i(where)0 358 y(the)h(cursor)h(w)o(as,)e(and)h(then)h(the)g(cursor)f
+(mo)o(v)o(es)f(one)i(space)g(to)e(the)i(righ)o(t.)k(If)c(y)o(ou)f(mist)o(yp)q
+(e)h(a)f(c)o(haracter,)f(y)o(ou)0 420 y(can)h(use)h(y)o(our)f(erase)g(c)o
+(haracter)f(to)h(bac)o(k)g(up)g(and)h(delete)g(the)f(mist)o(yp)q(ed)h(c)o
+(haracter.)62 557 y(Sometimes)f(y)o(ou)e(ma)o(y)h(miss)g(t)o(yping)g(a)g(c)o
+(haracter)g(that)f(y)o(ou)h(w)o(an)o(ted)f(to)g(t)o(yp)q(e,)h(and)h(not)e
+(notice)i(y)o(our)f(error)0 619 y(un)o(til)k(y)o(ou)e(ha)o(v)o(e)g(t)o(yp)q
+(ed)h(sev)o(eral)g(other)f(c)o(haracters.)23 b(In)18 b(that)d(case,)i(y)o(ou)
+f(can)h(t)o(yp)q(e)g Fn(C-B)f Fo(to)g(mo)o(v)o(e)g(the)g(cursor)0
+681 y(to)f(the)h(left,)g(and)g(then)g(correct)f(y)o(our)h(mistak)o(e.)21
+b(Afterw)o(ards,)14 b(y)o(ou)i(can)g(mo)o(v)o(e)f(the)h(cursor)f(to)g(the)h
+(righ)o(t)g(with)0 744 y Fn(C-F)p Fo(.)62 881 y(When)i(y)o(ou)f(add)g(text)g
+(in)h(the)f(middle)i(of)e(a)g(line,)i(y)o(ou)e(will)i(notice)e(that)g(c)o
+(haracters)f(to)h(the)g(righ)o(t)g(of)g(the)0 943 y(cursor)h(are)h(`pushed)g
+(o)o(v)o(er')e(to)h(mak)o(e)g(ro)q(om)g(for)g(the)h(text)f(that)g(y)o(ou)g
+(ha)o(v)o(e)h(inserted.)31 b(Lik)o(ewise,)20 b(when)f(y)o(ou)0
+1005 y(delete)f(text)f(b)q(ehind)i(the)f(cursor,)f(c)o(haracters)f(to)h(the)g
+(righ)o(t)g(of)g(the)h(cursor)f(are)g(`pulled)i(bac)o(k')d(to)h(\014ll)i(in)f
+(the)0 1067 y(blank)g(space)f(created)g(b)o(y)g(the)h(remo)o(v)m(al)f(of)f
+(the)i(text.)25 b(A)17 b(list)h(of)e(the)h(basic)h(bare)f(essen)o(tials)h
+(for)e(editing)j(the)0 1130 y(text)c(of)f(an)i(input)g(line)h(follo)o(ws.)0
+1279 y Fn(C-B)168 b Fo(Mo)o(v)o(e)14 b(bac)o(k)h(one)h(c)o(haracter.)0
+1366 y Fn(C-F)168 b Fo(Mo)o(v)o(e)14 b(forw)o(ard)g(one)h(c)o(haracter.)0
+1454 y Fn(DEL)168 b Fo(Delete)16 b(the)f(c)o(haracter)g(to)f(the)h(left)h(of)
+f(the)g(cursor.)0 1541 y Fn(C-D)168 b Fo(Delete)16 b(the)f(c)o(haracter)g
+(underneath)h(the)f(cursor.)0 1615 y(Prin)o(ting)h(c)o(haracters)240
+1678 y(Insert)f(the)h(c)o(haracter)e(in)o(to)h(the)h(line)h(at)d(the)h
+(cursor.)0 1765 y Fn(C-_)168 b Fo(Undo)15 b(the)h(last)f(thing)h(that)e(y)o
+(ou)h(did.)21 b(Y)l(ou)15 b(can)h(undo)f(all)h(the)g(w)o(a)o(y)e(bac)o(k)h
+(to)f(an)i(empt)o(y)e(line.)0 1973 y Fi(1.2.2)30 b(Readline)15
+b(Mo)n(v)n(emen)n(t)h(Commands)62 2110 y Fo(The)c(ab)q(o)o(v)o(e)g(table)g
+(describ)q(es)i(the)e(most)f(basic)h(p)q(ossible)i(k)o(eystrok)o(es)d(that)g
+(y)o(ou)g(need)i(in)g(order)f(to)f(do)h(editing)0 2172 y(of)g(the)h(input)h
+(line.)21 b(F)l(or)12 b(y)o(our)g(con)o(v)o(enience,)i(man)o(y)f(other)f
+(commands)h(ha)o(v)o(e)f(b)q(een)i(added)f(in)h(addition)g(to)e
+Fn(C-B)p Fo(,)0 2234 y Fn(C-F)p Fo(,)i Fn(C-D)p Fo(,)h(and)g
+Fn(DEL)p Fo(.)20 b(Here)15 b(are)g(some)g(commands)g(for)f(mo)o(ving)h(more)g
+(rapidly)i(ab)q(out)e(the)g(line.)0 2384 y Fn(C-A)168 b Fo(Mo)o(v)o(e)14
+b(to)h(the)g(start)f(of)h(the)g(line.)0 2471 y Fn(C-E)168 b
+Fo(Mo)o(v)o(e)14 b(to)h(the)g(end)h(of)f(the)g(line.)0 2558
+y Fn(M-F)168 b Fo(Mo)o(v)o(e)14 b(forw)o(ard)g(a)h(w)o(ord.)0
+2645 y Fn(M-B)168 b Fo(Mo)o(v)o(e)14 b(bac)o(kw)o(ard)h(a)g(w)o(ord.)p
+eop
+%%Page: 3 5
+4 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227
+b(3)0 158 y Fn(C-L)168 b Fo(Clear)15 b(the)h(screen,)f(reprin)o(ting)h(the)f
+(curren)o(t)g(line)i(at)e(the)g(top.)62 325 y(Notice)22 b(ho)o(w)e
+Fn(C-F)h Fo(mo)o(v)o(es)f(forw)o(ard)g(a)g(c)o(haracter,)i(while)g
+Fn(M-F)f Fo(mo)o(v)o(es)f(forw)o(ard)g(a)h(w)o(ord.)36 b(It)21
+b(is)h(a)f(lo)q(ose)0 387 y(con)o(v)o(en)o(tion)15 b(that)g(con)o(trol)g(k)o
+(eystrok)o(es)f(op)q(erate)h(on)g(c)o(haracters)f(while)j(meta)e(k)o(eystrok)
+o(es)f(op)q(erate)h(on)g(w)o(ords.)0 671 y Fi(1.2.3)30 b(Readline)15
+b(Killing)g(Commands)62 816 y Fj(Killing)25 b Fo(text)18 b(means)g(to)f
+(delete)i(the)g(text)e(from)h(the)g(line,)i(but)e(to)g(sa)o(v)o(e)f(it)i(a)o
+(w)o(a)o(y)d(for)i(later)g(use,)h(usually)0 878 y(b)o(y)c Fj(y)o(anking)k
+Fo(\(re-inserting\))c(it)g(bac)o(k)g(in)o(to)g(the)g(line.)21
+b(If)16 b(the)f(description)h(for)e(a)h(command)f(sa)o(ys)h(that)f(it)h
+(`kills')0 941 y(text,)f(then)i(y)o(ou)f(can)g(b)q(e)h(sure)f(that)g(y)o(ou)g
+(can)g(get)g(the)g(text)g(bac)o(k)g(in)h(a)f(di\013eren)o(t)g(\(or)f(the)i
+(same\))e(place)i(later.)62 1086 y(When)g(y)o(ou)f(use)g(a)g(kill)i(command,)
+e(the)h(text)e(is)i(sa)o(v)o(ed)f(in)h(a)f Fj(kill-ring)p Fo(.)22
+b(An)o(y)16 b(n)o(um)o(b)q(er)f(of)g(consecutiv)o(e)h(kills)0
+1148 y(sa)o(v)o(e)g(all)i(of)e(the)h(killed)i(text)d(together,)g(so)g(that)g
+(when)h(y)o(ou)f(y)o(ank)h(it)g(bac)o(k,)f(y)o(ou)h(get)f(it)h(all.)25
+b(The)17 b(kill)h(ring)f(is)0 1211 y(not)e(line)i(sp)q(eci\014c;)g(the)f
+(text)f(that)g(y)o(ou)g(killed)j(on)d(a)h(previously)g(t)o(yp)q(ed)g(line)h
+(is)f(a)o(v)m(ailable)i(to)d(b)q(e)h(y)o(ank)o(ed)f(bac)o(k)0
+1273 y(later,)g(when)h(y)o(ou)e(are)h(t)o(yping)h(another)e(line.)62
+1418 y(Here)i(is)f(the)h(list)g(of)e(commands)h(for)g(killing)j(text.)0
+1585 y Fn(C-K)168 b Fo(Kill)17 b(the)f(text)e(from)h(the)g(curren)o(t)g
+(cursor)g(p)q(osition)h(to)f(the)g(end)h(of)f(the)g(line.)0
+1689 y Fn(M-D)168 b Fo(Kill)17 b(from)d(the)h(cursor)g(to)f(the)h(end)g(of)g
+(the)g(curren)o(t)f(w)o(ord,)g(or)g(if)i(b)q(et)o(w)o(een)f(w)o(ords,)f(to)g
+(the)h(end)g(of)240 1751 y(the)g(next)h(w)o(ord.)0 1855 y Fn(M-DEL)120
+b Fo(Kill)16 b(from)d(the)i(cursor)e(the)h(start)f(of)h(the)g(previous)h(w)o
+(ord,)e(or)g(if)i(b)q(et)o(w)o(een)f(w)o(ords,)f(to)h(the)g(start)e(of)240
+1917 y(the)j(previous)h(w)o(ord.)0 2021 y Fn(C-W)168 b Fo(Kill)18
+b(from)e(the)g(cursor)g(to)f(the)h(previous)h(whitespace.)24
+b(This)17 b(is)f(di\013eren)o(t)h(than)f Fn(M-DEL)f Fo(b)q(ecause)240
+2084 y(the)g(w)o(ord)g(b)q(oundaries)h(di\013er.)62 2250 y(And,)e(here)g(is)h
+(ho)o(w)e(to)g Fj(y)o(ank)j Fo(the)e(text)f(bac)o(k)g(in)o(to)h(the)f(line.)
+22 b(Y)l(anking)14 b(means)g(to)f(cop)o(y)g(the)h(most-recen)o(tly-)0
+2312 y(killed)j(text)e(from)g(the)g(kill)i(bu\013er.)0 2479
+y Fn(C-Y)168 b Fo(Y)l(ank)15 b(the)h(most)e(recen)o(tly)i(killed)h(text)e
+(bac)o(k)g(in)o(to)g(the)h(bu\013er)f(at)f(the)i(cursor.)0
+2583 y Fn(M-Y)168 b Fo(Rotate)13 b(the)h(kill-ring,)i(and)e(y)o(ank)g(the)g
+(new)g(top.)19 b(Y)l(ou)14 b(can)g(only)g(do)g(this)g(if)g(the)g(prior)g
+(command)240 2645 y(is)i Fn(C-Y)e Fo(or)h Fn(M-Y)p Fo(.)p eop
+%%Page: 4 6
+5 bop 0 -83 a Fo(4)1472 b(GNU)15 b(Readline)i(Library)0 158
+y Fi(1.2.4)30 b(Readline)15 b(Argumen)n(ts)62 305 y Fo(Y)l(ou)k(can)g(pass)f
+(n)o(umeric)i(argumen)o(ts)d(to)h(Readline)j(commands.)30 b(Sometimes)19
+b(the)f(argumen)o(t)g(acts)g(as)g(a)0 367 y(rep)q(eat)f(coun)o(t,)f(other)g
+(times)g(it)h(is)g(the)g Fj(sign)f Fo(of)g(the)h(argumen)o(t)f(that)f(is)i
+(signi\014can)o(t.)25 b(If)16 b(y)o(ou)h(pass)f(a)g(negativ)o(e)0
+430 y(argumen)o(t)g(to)g(a)h(command)g(whic)o(h)h(normally)f(acts)g(in)h(a)e
+(forw)o(ard)g(direction,)i(that)f(command)f(will)j(act)d(in)i(a)0
+492 y(bac)o(kw)o(ard)13 b(direction.)21 b(F)l(or)13 b(example,)h(to)f(kill)i
+(text)e(bac)o(k)h(to)f(the)h(start)e(of)h(the)h(line,)h(y)o(ou)e(migh)o(t)h
+(t)o(yp)q(e)g Fn(M--)f(C-K)p Fo(.)62 639 y(The)19 b(general)g(w)o(a)o(y)f(to)
+g(pass)g(n)o(umeric)i(argumen)o(ts)e(to)g(a)g(command)h(is)g(to)f(t)o(yp)q(e)
+g(meta)g(digits)i(b)q(efore)f(the)0 701 y(command.)36 b(If)21
+b(the)g(\014rst)f(`digit')h(y)o(ou)g(t)o(yp)q(e)f(is)i(a)e(min)o(us)h(sign)g
+(\()p Fn(-)p Fo(\),)g(then)g(the)g(sign)g(of)g(the)f(argumen)o(t)g(will)0
+763 y(b)q(e)i(negativ)o(e.)40 b(Once)22 b(y)o(ou)f(ha)o(v)o(e)h(t)o(yp)q(ed)g
+(one)f(meta)g(digit)i(to)e(get)g(the)h(argumen)o(t)f(started,)h(y)o(ou)f(can)
+h(t)o(yp)q(e)0 826 y(the)c(remainder)h(of)f(the)g(digits,)h(and)f(then)h(the)
+f(command.)29 b(F)l(or)17 b(example,)i(to)f(giv)o(e)g(the)g
+Fn(C-D)g Fo(command)g(an)0 888 y(argumen)o(t)c(of)h(10,)f(y)o(ou)h(could)h(t)
+o(yp)q(e)g Fn(M-1)23 b(0)h(C-D)p Fo(.)0 1201 y Fm(1.3)33 b(Readline)16
+b(Init)g(File)62 1348 y Fo(Although)g(the)g(Readline)h(library)g(comes)e
+(with)h(a)f(set)g(of)g(Emacs-lik)o(e)h(k)o(eybindings)h(installed)g(b)o(y)f
+(default,)0 1410 y(it)e(is)g(p)q(ossible)i(that)d(y)o(ou)g(w)o(ould)h(lik)o
+(e)h(to)e(use)h(a)f(di\013eren)o(t)h(set)g(of)f(k)o(eybindings.)21
+b(Y)l(ou)14 b(can)g(customize)g(programs)0 1472 y(that)e(use)i(Readline)h(b)o
+(y)e(putting)h(commands)f(in)h(an)f Fj(init)i Fo(\014le)f(in)g(y)o(our)f
+(home)g(directory)l(.)19 b(The)14 b(name)f(of)f(this)i(\014le)0
+1535 y(is)i(tak)o(en)f(from)g(the)g(v)m(alue)i(of)e(the)h(en)o(vironmen)o(t)f
+(v)m(ariable)i Fn(INPUTRC)p Fo(.)j(If)c(that)f(v)m(ariable)h(is)g(unset,)g
+(the)f(default)0 1597 y(is)h(`)p Fn(~/.inputrc)p Fo('.)62 1744
+y(When)j(a)g(program)e(whic)o(h)j(uses)f(the)g(Readline)i(library)e(starts)f
+(up,)h(the)g(init)h(\014le)g(is)f(read,)g(and)g(the)g(k)o(ey)0
+1806 y(bindings)e(are)e(set.)62 1953 y(In)j(addition,)h(the)f
+Fn(C-x)c(C-r)k Fo(command)f(re-reads)g(this)h(init)h(\014le,)g(th)o(us)e
+(incorp)q(orating)h(an)o(y)f(c)o(hanges)h(that)0 2015 y(y)o(ou)d(migh)o(t)g
+(ha)o(v)o(e)g(made)g(to)f(it.)0 2311 y Fi(1.3.1)30 b(Readline)15
+b(Init)g(Syn)n(tax)62 2458 y Fo(There)h(are)f(only)h(a)f(few)g(basic)h
+(constructs)f(allo)o(w)o(ed)h(in)g(the)g(Readline)i(init)e(\014le.)22
+b(Blank)16 b(lines)h(are)e(ignored.)0 2521 y(Lines)j(b)q(eginning)g(with)f(a)
+f Fn(#)g Fo(are)g(commen)o(ts.)22 b(Lines)c(b)q(eginning)g(with)f(a)f
+Fn($)g Fo(indicate)h(conditional)h(constructs)0 2583 y(\(see)e(Section)h
+(1.3.2)e([Conditional)i(Init)g(Constructs],)e(page)i(7\).)22
+b(Other)16 b(lines)i(denote)f(v)m(ariable)h(settings)e(and)0
+2645 y(k)o(ey)f(bindings.)p eop
+%%Page: 5 7
+6 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227
+b(5)0 158 y(V)l(ariable)16 b(Settings)240 221 y(Y)l(ou)j(can)g(c)o(hange)g
+(the)g(state)f(of)g(a)g(few)h(v)m(ariables)h(in)g(Readline)h(b)o(y)d(using)i
+(the)f Fn(set)f Fo(command)240 283 y(within)e(the)f(init)h(\014le.)k(Here)15
+b(is)g(ho)o(w)g(y)o(ou)f(w)o(ould)h(sp)q(ecify)h(that)e(y)o(ou)g(wish)i(to)e
+(use)h Fn(vi)f Fo(line)j(editing)240 345 y(commands:)360 408
+y Fn(set)23 b(editing-mode)g(vi)240 484 y Fo(Righ)o(t)14 b(no)o(w,)f(there)h
+(are)f(only)h(a)f(few)h(v)m(ariables)g(whic)o(h)h(can)f(b)q(e)g(set;)f(so)g
+(few,)h(in)g(fact,)f(that)g(w)o(e)g(just)240 546 y(list)j(them)f(here:)240
+622 y Fn(editing-mode)480 684 y Fo(The)e Fn(editing-mode)e
+Fo(v)m(ariable)j(con)o(trols)e(whic)o(h)h(editing)h(mo)q(de)f(y)o(ou)f(are)g
+(using.)20 b(By)480 746 y(default,)f(Readline)h(starts)c(up)i(in)h(Emacs)e
+(editing)i(mo)q(de,)f(where)g(the)g(k)o(eystrok)o(es)480 808
+y(are)c(most)g(similar)h(to)f(Emacs.)19 b(This)c(v)m(ariable)h(can)f(b)q(e)g
+(set)f(to)g(either)h Fn(emacs)f Fo(or)g Fn(vi)p Fo(.)240 884
+y Fn(horizontal-scroll-mode)480 946 y Fo(This)k(v)m(ariable)g(can)f(b)q(e)g
+(set)g(to)f(either)i Fn(On)f Fo(or)f Fn(Off)p Fo(.)25 b(Setting)17
+b(it)g(to)f Fn(On)h Fo(means)g(that)480 1009 y(the)d(text)g(of)f(the)h(lines)
+i(that)d(y)o(ou)h(edit)h(will)g(scroll)g(horizon)o(tally)g(on)f(a)g(single)h
+(screen)480 1071 y(line)f(when)f(they)g(are)f(longer)h(than)f(the)h(width)g
+(of)f(the)g(screen,)h(instead)g(of)g(wrapping)480 1133 y(on)o(to)h(a)h(new)h
+(screen)f(line.)22 b(By)15 b(default,)h(this)f(v)m(ariable)i(is)f(set)e(to)h
+Fn(Off)p Fo(.)240 1209 y Fn(mark-modified-lines)480 1271 y
+Fo(This)h(v)m(ariable,)g(when)g(set)f(to)f Fn(On)p Fo(,)h(sa)o(ys)f(to)g
+(displa)o(y)j(an)e(asterisk)g(\(`)p Fn(*)p Fo('\))e(at)i(the)g(start)480
+1333 y(of)f(history)h(lines)i(whic)o(h)e(ha)o(v)o(e)g(b)q(een)h(mo)q
+(di\014ed.)21 b(This)15 b(v)m(ariable)h(is)g Fn(off)e Fo(b)o(y)h(default.)240
+1409 y Fn(bell-style)480 1471 y Fo(Con)o(trols)h(what)f(happ)q(ens)j(when)f
+(Readline)h(w)o(an)o(ts)e(to)f(ring)i(the)f(terminal)h(b)q(ell.)26
+b(If)480 1533 y(set)13 b(to)g Fn(none)p Fo(,)g(Readline)j(nev)o(er)e(rings)g
+(the)g(b)q(ell.)21 b(If)14 b(set)f(to)g Fn(visible)p Fo(,)g(Readline)j(uses)
+480 1596 y(a)g(visible)j(b)q(ell)g(if)e(one)g(is)g(a)o(v)m(ailable.)27
+b(If)17 b(set)f(to)g Fn(audible)g Fo(\(the)h(default\),)g(Readline)480
+1658 y(attempts)d(to)h(ring)g(the)h(terminal's)f(b)q(ell.)240
+1733 y Fn(comment-begin)480 1796 y Fo(The)21 b(string)h(to)e(insert)i(at)e
+(the)h(b)q(eginning)j(of)c(the)i(line)g(when)g(the)f Fn(vi-comment)480
+1858 y Fo(command)15 b(is)h(executed.)21 b(The)15 b(default)h(v)m(alue)g(is)g
+Fn("#")p Fo(.)240 1934 y Fn(meta-flag)480 1996 y Fo(If)d(set)g(to)f
+Fn(on)p Fo(,)g(Readline)j(will)g(enable)f(eigh)o(t-bit)f(input)h(\(it)f(will)
+h(not)f(strip)g(the)g(eigh)o(th)480 2058 y(bit)i(from)g(the)g(c)o(haracters)f
+(it)h(reads\),)f(regardless)h(of)g(what)f(the)h(terminal)h(claims)g(it)480
+2120 y(can)f(supp)q(ort.)20 b(The)c(default)g(v)m(alue)g(is)g
+Fn(off)p Fo(.)240 2196 y Fn(convert-meta)480 2258 y Fo(If)23
+b(set)f(to)f Fn(on)p Fo(,)j(Readline)h(will)f(con)o(v)o(ert)d(c)o(haracters)h
+(with)g(the)h(eigth)g(bit)f(set)h(to)480 2320 y(an)17 b(ASCI)q(I)g(k)o(ey)g
+(sequence)h(b)o(y)e(stripping)i(the)f(eigth)g(bit)g(and)g(prep)q(ending)i(an)
+d Fn(ESC)480 2383 y Fo(c)o(haracter,)h(con)o(v)o(erting)g(them)g(to)f(a)h
+(meta-pre\014xed)h(k)o(ey)f(sequence.)27 b(The)17 b(default)480
+2445 y(v)m(alue)f(is)g Fn(on)p Fo(.)240 2521 y Fn(output-meta)480
+2583 y Fo(If)d(set)f(to)g Fn(on)p Fo(,)h(Readline)i(will)f(displa)o(y)g(c)o
+(haracters)d(with)i(the)g(eigh)o(th)g(bit)g(set)g(directly)480
+2645 y(rather)i(than)g(as)f(a)h(meta-pre\014xed)h(escap)q(e)g(sequence.)21
+b(The)16 b(default)f(is)h Fn(off)p Fo(.)p eop
+%%Page: 6 8
+7 bop 0 -83 a Fo(6)1472 b(GNU)15 b(Readline)i(Library)240 158
+y Fn(completion-query-items)480 221 y Fo(The)12 b(n)o(um)o(b)q(er)g(of)f(p)q
+(ossible)j(completions)e(that)f(determines)i(when)f(the)g(user)g(is)g(ask)o
+(ed)480 283 y(whether)k(he)h(w)o(an)o(ts)d(to)i(see)g(the)g(list)h(of)e(p)q
+(ossibiliti)q(es.)25 b(If)16 b(the)g(n)o(um)o(b)q(er)h(of)e(p)q(ossible)480
+345 y(completions)i(is)f(greater)f(than)h(this)h(v)m(alue,)f(Readline)j(will)
+e(ask)f(the)g(user)g(whether)480 407 y(or)k(not)h(he)h(wishes)f(to)g(view)g
+(them;)j(otherwise,)e(they)f(are)g(simply)h(listed.)39 b(The)480
+470 y(default)16 b(limit)g(is)g Fn(100)p Fo(.)240 564 y Fn(keymap)96
+b Fo(Sets)13 b(Readline's)i(idea)e(of)g(the)g(curren)o(t)f(k)o(eymap)h(for)f
+(k)o(ey)h(binding)i(commands.)k(Ac-)480 626 y(ceptable)d Fn(keymap)e
+Fo(names)h(are)g Fn(emacs)p Fo(,)f Fn(emacs-standard)p Fo(,)f
+Fn(emacs-meta)p Fo(,)g Fn(emacs-)480 688 y(ctlx)p Fo(,)j Fn(vi)p
+Fo(,)h Fn(vi-move)p Fo(,)f Fn(vi-command)p Fo(,)g(and)h Fn(vi-insert)p
+Fo(.)23 b Fn(vi)17 b Fo(is)g(equiv)m(alen)o(t)i(to)d Fn(vi-)480
+750 y(command)p Fo(;)22 b Fn(emacs)e Fo(is)h(equiv)m(alen)o(t)h(to)e
+Fn(emacs-standard)p Fo(.)35 b(The)20 b(default)i(v)m(alue)f(is)480
+813 y Fn(emacs)p Fo(.)33 b(The)21 b(v)m(alue)g(of)e(the)i Fn(editing-mode)d
+Fo(v)m(ariable)j(also)f(a\013ects)f(the)h(default)480 875 y(k)o(eymap.)240
+953 y Fn(show-all-if-ambiguous)480 1015 y Fo(This)d(alters)f(the)h(default)g
+(b)q(eha)o(vior)g(of)f(the)g(completion)i(functions.)24 b(If)17
+b(set)f(to)g Fn(on)p Fo(,)480 1077 y(w)o(ords)d(whic)o(h)h(ha)o(v)o(e)f(more)
+h(than)f(one)h(p)q(ossible)h(completion)g(cause)f(the)f(matc)o(hes)h(to)480
+1140 y(b)q(e)h(listed)g(immediately)h(instead)f(of)f(ringing)h(the)f(b)q
+(ell.)22 b(The)14 b(default)h(v)m(alue)g(is)g Fn(off)p Fo(.)240
+1218 y Fn(expand-tilde)480 1280 y Fo(If)20 b(set)f(to)g Fn(on)p
+Fo(,)h(tilde)h(expansion)f(is)g(p)q(erformed)g(when)g(Readline)i(attempts)d
+(w)o(ord)480 1342 y(completion.)i(The)15 b(default)h(is)g Fn(off)p
+Fo(.)0 1420 y(Key)g(Bindings)240 1483 y(The)k(syn)o(tax)f(for)g(con)o
+(trolling)i(k)o(ey)e(bindings)j(in)e(the)g(init)h(\014le)g(is)f(simple.)35
+b(First)19 b(y)o(ou)g(ha)o(v)o(e)h(to)240 1545 y(kno)o(w)13
+b(the)h(name)g(of)f(the)h(command)g(that)f(y)o(ou)g(w)o(an)o(t)g(to)g(c)o
+(hange.)20 b(The)14 b(follo)o(wing)g(pages)g(con)o(tain)240
+1607 y(tables)i(of)f(the)h(command)g(name,)f(the)h(default)g(k)o(eybinding,)i
+(and)e(a)f(short)g(description)i(of)f(what)240 1669 y(the)f(command)g(do)q
+(es.)240 1748 y(Once)h(y)o(ou)e(kno)o(w)g(the)h(name)g(of)f(the)h(command,)f
+(simply)i(place)g(the)f(name)f(of)h(the)f(k)o(ey)h(y)o(ou)f(wish)240
+1810 y(to)g(bind)j(the)e(command)g(to,)f(a)g(colon,)i(and)f(then)g(the)g
+(name)g(of)g(the)g(command)g(on)g(a)f(line)j(in)f(the)240 1872
+y(init)h(\014le.)22 b(The)16 b(name)g(of)f(the)h(k)o(ey)f(can)h(b)q(e)g
+(expressed)h(in)f(di\013eren)o(t)g(w)o(a)o(ys,)f(dep)q(ending)i(on)f(whic)o
+(h)240 1934 y(is)g(most)e(comfortable)h(for)g(y)o(ou.)240 2012
+y Fj(k)o(eyname)s Fo(:)k Fj(function-name)g Fo(or)c Fj(macro)480
+2075 y(k)o(eyname)j Fo(is)d(the)h(name)f(of)g(a)g(k)o(ey)g(sp)q(elled)i(out)e
+(in)h(English.)21 b(F)l(or)15 b(example:)600 2140 y Fn(Control-u:)22
+b(universal-argument)600 2190 y(Meta-Rubout:)g(backward-kill-word)600
+2240 y(Control-o:)g(">&output")480 2318 y Fo(In)12 b(the)g(ab)q(o)o(v)o(e)f
+(example,)h(`)p Fn(C-u)p Fo(')f(is)h(b)q(ound)g(to)f(the)h(function)g
+Fn(universal-argument)p Fo(,)480 2380 y(and)h(`)p Fn(C-o)p
+Fo(')f(is)h(b)q(ound)h(to)f(run)g(the)g(macro)f(expressed)i(on)f(the)g(righ)o
+(t)g(hand)g(side)h(\(that)480 2442 y(is,)h(to)g(insert)h(the)f(text)g(`)p
+Fn(>&output)p Fo(')e(in)o(to)i(the)g(line\).)240 2521 y Fn(")p
+Fj(k)o(eyseq)q Fn(")p Fo(:)20 b Fj(function-name)e Fo(or)d
+Fj(macro)480 2583 y(k)o(eyseq)j Fo(di\013ers)f(from)f Fj(k)o(eyname)k
+Fo(ab)q(o)o(v)o(e)c(in)i(that)e(strings)h(denoting)h(an)f(en)o(tire)g(k)o(ey)
+480 2645 y(sequence)i(can)f(b)q(e)h(sp)q(eci\014ed,)i(b)o(y)d(placing)h(the)f
+(k)o(ey)g(sequence)h(in)g(double)h(quotes.)p eop
+%%Page: 7 9
+8 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227
+b(7)480 158 y(Some)18 b(GNU)g(Emacs)f(st)o(yle)h(k)o(ey)g(escap)q(es)g(can)g
+(b)q(e)h(used,)g(as)e(in)i(the)f(follo)o(wing)h(ex-)480 221
+y(ample,)c(but)h(the)f(sp)q(ecial)i(c)o(haracter)e(names)g(are)g(not)f
+(recognized.)600 283 y Fn("\\C-u":)23 b(universal-argument)600
+333 y("\\C-x\\C-r":)f(re-read-init-file)600 383 y("\\e[11~":)h("Function)f
+(Key)i(1")480 457 y Fo(In)13 b(the)g(ab)q(o)o(v)o(e)g(example,)g(`)p
+Fn(C-u)p Fo(')f(is)h(b)q(ound)h(to)e(the)h(function)g Fn(universal-argument)
+480 519 y Fo(\(just)g(as)f(it)i(w)o(as)e(in)i(the)f(\014rst)g(example\),)h(`)
+p Fn(C-x)g(C-r)p Fo(')f(is)g(b)q(ound)i(to)d(the)h(function)h
+Fn(re-)480 582 y(read-init-file)p Fo(,)g(and)i(`)p Fn(ESC)e([)h(1)g(1)g(~)p
+Fo(')h(is)g(b)q(ound)h(to)f(insert)g(the)g(text)f(`)p Fn(Function)480
+644 y(Key)g(1)p Fo('.)24 b(The)18 b(follo)o(wing)f(escap)q(e)h(sequences)g
+(are)f(a)o(v)m(ailable)i(when)e(sp)q(ecifying)i(k)o(ey)480
+706 y(sequences:)480 793 y Fn(\\C-)168 b Fo(con)o(trol)15 b(pre\014x)480
+881 y Fn(\\M-)168 b Fo(meta)15 b(pre\014x)480 968 y Fn(\\e)192
+b Fo(an)15 b(escap)q(e)h(c)o(haracter)480 1055 y Fn(\\\\)192
+b Fo(bac)o(kslash)480 1142 y Fn(\\")g(")480 1229 y(\\')g(')480
+1317 y Fo(When)14 b(en)o(tering)h(the)f(text)f(of)h(a)f(macro,)g(single)j(or)
+d(double)i(quotes)f(should)h(b)q(e)f(used)480 1379 y(to)g(indicate)j(a)e
+(macro)f(de\014nition.)22 b(Unquoted)15 b(text)g(is)g(assumed)g(to)g(b)q(e)g
+(a)g(function)480 1441 y(name.)27 b(Bac)o(kslash)18 b(will)h(quote)e(an)o(y)g
+(c)o(haracter)g(in)h(the)g(macro)f(text,)g(including)j Fn(")480
+1503 y Fo(and)c Fn(')p Fo(.)22 b(F)l(or)16 b(example,)h(the)f(follo)o(wing)h
+(binding)h(will)f(mak)o(e)f Fn(C-x)f(\\)g Fo(insert)i(a)f(single)480
+1566 y Fn(\\)f Fo(in)o(to)g(the)g(line:)600 1628 y Fn("\\C-x\\\\":)23
+b("\\\\")0 1836 y Fi(1.3.2)30 b(Conditional)15 b(Init)g(Constructs)62
+1973 y Fo(Readline)j(implemen)o(ts)e(a)f(facilit)o(y)h(similar)g(in)g(spirit)
+g(to)f(the)g(conditional)i(compilation)f(features)f(of)g(the)g(C)0
+2035 y(prepro)q(cessor)f(whic)o(h)h(allo)o(ws)f(k)o(ey)g(bindings)h(and)f(v)m
+(ariable)i(settings)e(to)f(b)q(e)h(p)q(erformed)h(as)e(the)h(result)g(of)g
+(tests.)0 2097 y(There)h(are)g(three)h(parser)e(directiv)o(es)j(used.)0
+2247 y Fn($if)168 b Fo(The)14 b Fn($if)e Fo(construct)h(allo)o(ws)h(bindings)
+h(to)e(b)q(e)h(made)f(based)h(on)f(the)h(editing)g(mo)q(de,)g(the)f(terminal)
+240 2309 y(b)q(eing)k(used,)e(or)g(the)g(application)i(using)f(Readline.)22
+b(The)16 b(text)f(of)g(the)g(test)g(extends)g(to)g(the)g(end)240
+2371 y(of)g(the)g(line;)i(no)e(c)o(haracters)f(are)h(required)h(to)f(isolate)
+g(it.)240 2458 y Fn(mode)144 b Fo(The)19 b Fn(mode=)f Fo(form)g(of)h(the)g
+Fn($if)f Fo(directiv)o(e)i(is)f(used)h(to)e(test)g(whether)h(Readline)i(is)
+480 2521 y(in)h Fn(emacs)f Fo(or)f Fn(vi)h Fo(mo)q(de.)38 b(This)22
+b(ma)o(y)f(b)q(e)h(used)g(in)g(conjunction)g(with)f(the)h(`)p
+Fn(set)480 2583 y(keymap)p Fo(')d(command,)i(for)e(instance,)j(to)d(set)h
+(bindings)i(in)f(the)f Fn(emacs-standard)480 2645 y Fo(and)15
+b Fn(emacs-ctlx)f Fo(k)o(eymaps)h(only)h(if)f(Readline)j(is)e(starting)e(out)
+h(in)h Fn(emacs)f Fo(mo)q(de.)p eop
+%%Page: 8 10
+9 bop 0 -83 a Fo(8)1472 b(GNU)15 b(Readline)i(Library)240 158
+y Fn(term)144 b Fo(The)21 b Fn(term=)f Fo(form)g(ma)o(y)h(b)q(e)g(used)h(to)e
+(include)j(terminal-sp)q(eci\014c)h(k)o(ey)c(bindings,)480
+221 y(p)q(erhaps)15 b(to)f(bind)j(the)d(k)o(ey)h(sequences)h(output)e(b)o(y)h
+(the)g(terminal's)g(function)h(k)o(eys.)480 283 y(The)f(w)o(ord)g(on)f(the)i
+(righ)o(t)e(side)i(of)f(the)g(`)p Fn(=)p Fo(')f(is)h(tested)g(against)g(the)g
+(full)h(name)f(of)g(the)480 345 y(terminal)k(and)g(the)g(p)q(ortion)g(of)f
+(the)h(terminal)g(name)g(b)q(efore)g(the)g(\014rst)f(`)p Fn(-)p
+Fo('.)29 b(This)480 407 y(allo)o(ws)15 b Fj(sun)h Fo(to)e(matc)o(h)h(b)q(oth)
+g Fj(sun)h Fo(and)f Fj(sun-cmd)p Fo(,)h(for)f(instance.)240
+485 y Fn(application)480 547 y Fo(The)j Fj(application)i Fo(construct)e(is)g
+(used)h(to)e(include)k(application-sp)q(eci\014c)g(settings.)480
+610 y(Eac)o(h)d(program)g(using)h(the)f(Readline)j(library)e(sets)f(the)h
+Fj(application)h(name)p Fo(,)f(and)480 672 y(y)o(ou)c(can)h(test)f(for)g(it.)
+21 b(This)16 b(could)g(b)q(e)h(used)f(to)e(bind)j(k)o(ey)f(sequences)g(to)f
+(functions)480 734 y(useful)h(for)e(a)h(sp)q(eci\014c)i(program.)h(F)l(or)d
+(instance,)g(the)g(follo)o(wing)h(command)e(adds)h(a)480 796
+y(k)o(ey)g(sequence)h(that)f(quotes)g(the)g(curren)o(t)g(or)g(previous)h(w)o
+(ord)e(in)i(Bash:)600 862 y Fn($if)23 b(bash)600 911 y(#)h(Quote)f(the)g
+(current)g(or)h(previous)f(word)600 961 y("\\C-xq":)g("\\eb\\"\\ef\\"")600
+1011 y($endif)0 1104 y($endif)96 b Fo(This)16 b(command,)e(as)h(y)o(ou)g(sa)o
+(w)g(in)h(the)f(previous)h(example,)f(terminates)h(an)f Fn($if)f
+Fo(command.)0 1197 y Fn($else)120 b Fo(Commands)15 b(in)h(this)f(branc)o(h)h
+(of)e(the)i Fn($if)e Fo(directiv)o(e)j(are)e(executed)h(if)g(the)f(test)g
+(fails.)0 1447 y Fm(1.4)33 b(Bindable)16 b(Readline)h(Commands)0
+1681 y Fi(1.4.1)30 b(Commands)15 b(F)-5 b(or)15 b(Mo)n(ving)0
+1821 y Fn(beginning-of-line)e(\(C-a\))240 1883 y Fo(Mo)o(v)o(e)h(to)h(the)g
+(start)f(of)h(the)g(curren)o(t)g(line.)0 1961 y Fn(end-of-line)f(\(C-e\))240
+2023 y Fo(Mo)o(v)o(e)g(to)h(the)g(end)h(of)f(the)g(line.)0
+2101 y Fn(forward-char)f(\(C-f\))240 2163 y Fo(Mo)o(v)o(e)g(forw)o(ard)g(a)h
+(c)o(haracter.)0 2241 y Fn(backward-char)e(\(C-b\))240 2303
+y Fo(Mo)o(v)o(e)h(bac)o(k)h(a)g(c)o(haracter.)0 2381 y Fn(forward-word)f
+(\(M-f\))240 2443 y Fo(Mo)o(v)o(e)g(forw)o(ard)g(to)h(the)g(end)h(of)f(the)g
+(next)g(w)o(ord.)k(W)l(ords)c(are)g(comp)q(osed)h(of)e(letters)i(and)f
+(digits.)0 2521 y Fn(backward-word)e(\(M-b\))240 2583 y Fo(Mo)o(v)o(e)j(bac)o
+(k)g(to)g(the)h(start)f(of)g(this,)h(or)g(the)f(previous,)i(w)o(ord.)24
+b(W)l(ords)16 b(are)g(comp)q(osed)i(of)e(letters)240 2645 y(and)f(digits.)p
+eop
+%%Page: 9 11
+10 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1227
+b(9)0 158 y Fn(clear-screen)14 b(\(C-l\))240 221 y Fo(Clear)h(the)g(screen)g
+(and)g(redra)o(w)f(the)h(curren)o(t)g(line,)h(lea)o(ving)g(the)f(curren)o(t)f
+(line)j(at)d(the)h(top)f(of)h(the)240 283 y(screen.)0 361 y
+Fn(redraw-current-line)e(\(\))240 423 y Fo(Refresh)j(the)f(curren)o(t)g
+(line.)22 b(By)15 b(default,)h(this)f(is)h(un)o(b)q(ound.)0
+663 y Fi(1.4.2)30 b(Commands)15 b(F)-5 b(or)15 b(Manipulating)g(The)g
+(History)0 804 y Fn(accept-line)f(\(Newline,)g(Return\))240
+866 y Fo(Accept)g(the)f(line)i(regardless)e(of)g(where)g(the)g(cursor)g(is.)
+20 b(If)13 b(this)h(line)h(is)e(non-empt)o(y)l(,)h(add)f(it)g(to)g(the)240
+928 y(history)k(list.)25 b(If)17 b(this)g(line)i(w)o(as)c(a)i(history)g
+(line,)h(then)f(restore)f(the)h(history)f(line)j(to)d(its)h(original)240
+990 y(state.)0 1069 y Fn(previous-history)c(\(C-p\))240 1131
+y Fo(Mo)o(v)o(e)h(`up')h(through)g(the)g(history)g(list.)0
+1209 y Fn(next-history)f(\(C-n\))240 1272 y Fo(Mo)o(v)o(e)g(`do)o(wn')g
+(through)h(the)h(history)f(list.)0 1350 y Fn(beginning-of-history)d(\(M-<\))
+240 1412 y Fo(Mo)o(v)o(e)i(to)h(the)g(\014rst)g(line)i(in)f(the)f(history)l
+(.)0 1490 y Fn(end-of-history)e(\(M->\))240 1553 y Fo(Mo)o(v)o(e)h(to)h(the)g
+(end)h(of)f(the)g(input)h(history)l(,)f(i.e.,)g(the)g(line)i(y)o(ou)e(are)g
+(en)o(tering.)0 1631 y Fn(reverse-search-history)d(\(C-r\))240
+1693 y Fo(Searc)o(h)18 b(bac)o(kw)o(ard)f(starting)g(at)g(the)g(curren)o(t)h
+(line)h(and)f(mo)o(ving)f(`up')h(through)f(the)h(history)f(as)240
+1756 y(necessary)l(.)j(This)c(is)g(an)f(incremen)o(tal)h(searc)o(h.)0
+1834 y Fn(forward-search-history)c(\(C-s\))240 1896 y Fo(Searc)o(h)j(forw)o
+(ard)e(starting)h(at)g(the)g(curren)o(t)h(line)h(and)f(mo)o(ving)f(`do)o(wn')
+g(through)g(the)g(the)h(history)240 1958 y(as)g(necessary)l(.)20
+b(This)c(is)g(an)f(incremen)o(tal)h(searc)o(h.)0 2037 y Fn
+(non-incremental-reverse-se)o(arch-hi)o(story)c(\(M-p\))240
+2099 y Fo(Searc)o(h)18 b(bac)o(kw)o(ard)f(starting)g(at)g(the)g(curren)o(t)h
+(line)h(and)f(mo)o(ving)f(`up')h(through)f(the)h(history)f(as)240
+2161 y(necessary)e(using)h(a)f(non-incremen)o(tal)i(searc)o(h)e(for)g(a)f
+(string)i(supplied)h(b)o(y)e(the)h(user.)0 2239 y Fn
+(non-incremental-forward-se)o(arch-hi)o(story)c(\(M-n\))240
+2302 y Fo(Searc)o(h)j(forw)o(ard)e(starting)h(at)g(the)g(curren)o(t)h(line)h
+(and)f(mo)o(ving)f(`do)o(wn')g(through)g(the)g(the)h(history)240
+2364 y(as)g(necessary)g(using)h(a)f(non-incremen)o(tal)i(searc)o(h)e(for)f(a)
+h(string)g(supplied)j(b)o(y)d(the)g(user.)0 2442 y Fn(history-search-forward)
+d(\(\))240 2505 y Fo(Searc)o(h)h(forw)o(ard)f(through)h(the)g(history)g(for)g
+(the)g(string)g(of)g(c)o(haracters)f(b)q(et)o(w)o(een)i(the)f(start)f(of)h
+(the)240 2567 y(curren)o(t)j(line)i(and)e(the)h(curren)o(t)f(p)q(oin)o(t.)23
+b(This)17 b(is)f(a)g(non-incremen)o(tal)i(searc)o(h.)23 b(By)16
+b(default,)h(this)240 2629 y(command)e(is)h(un)o(b)q(ound.)p
+eop
+%%Page: 10 12
+11 bop 0 -83 a Fo(10)1449 b(GNU)15 b(Readline)i(Library)0 158
+y Fn(history-search-backward)12 b(\(\))240 221 y Fo(Searc)o(h)k(bac)o(kw)o
+(ard)g(through)g(the)g(history)g(for)g(the)g(string)g(of)g(c)o(haracters)g(b)
+q(et)o(w)o(een)g(the)g(start)f(of)240 283 y(the)i(curren)o(t)g(line)h(and)f
+(the)g(curren)o(t)g(p)q(oin)o(t.)25 b(This)17 b(is)g(a)g(non-incremen)o(tal)h
+(searc)o(h.)25 b(By)17 b(default,)240 345 y(this)f(command)f(is)g(un)o(b)q
+(ound.)0 425 y Fn(yank-nth-arg)f(\(M-C-y\))240 487 y Fo(Insert)19
+b(the)g(\014rst)f(argumen)o(t)g(to)g(the)h(previous)g(command)g(\(usually)g
+(the)g(second)g(w)o(ord)f(on)h(the)240 550 y(previous)e(line\).)23
+b(With)16 b(an)g(argumen)o(t)f Fj(n)p Fo(,)h(insert)h(the)f
+Fj(n)p Fo(th)g(w)o(ord)f(from)g(the)h(previous)h(command)240
+612 y(\(the)d(w)o(ords)g(in)h(the)g(previous)g(command)f(b)q(egin)i(with)f(w)
+o(ord)f(0\).)19 b(A)14 b(negativ)o(e)h(argumen)o(t)f(inserts)240
+674 y(the)h Fj(n)p Fo(th)h(w)o(ord)e(from)h(the)g(end)h(of)e(the)i(previous)g
+(command.)0 754 y Fn(yank-last-arg)d(\(M-.,)i(M-_\))240 816
+y Fo(Insert)k(last)g(argumen)o(t)g(to)f(the)h(previous)h(command)f(\(the)g
+(last)g(w)o(ord)f(on)h(the)g(previous)h(line\).)240 879 y(With)15
+b(an)h(argumen)o(t,)e(b)q(eha)o(v)o(e)h(exactly)h(lik)o(e)g
+Fn(yank-nth-arg)p Fo(.)0 1134 y Fi(1.4.3)30 b(Commands)15 b(F)-5
+b(or)15 b(Changing)g(T)-5 b(ext)0 1276 y Fn(delete-char)14
+b(\(C-d\))240 1338 y Fo(Delete)f(the)f(c)o(haracter)f(under)i(the)f(cursor.)
+19 b(If)12 b(the)g(cursor)g(is)g(at)g(the)g(b)q(eginning)i(of)e(the)g(line,)i
+(there)240 1400 y(are)k(no)g(c)o(haracters)g(in)h(the)g(line,)h(and)f(the)f
+(last)g(c)o(haracter)g(t)o(yp)q(ed)h(w)o(as)e(not)h(C-d,)h(then)g(return)240
+1463 y(EOF.)0 1543 y Fn(backward-delete-char)12 b(\(Rubout\))240
+1605 y Fo(Delete)g(the)f(c)o(haracter)f(b)q(ehind)j(the)e(cursor.)18
+b(A)11 b(n)o(umeric)h(arg)e(sa)o(ys)g(to)g(kill)j(the)e(c)o(haracters)f
+(instead)240 1667 y(of)15 b(deleting)h(them.)0 1747 y Fn(quoted-insert)d
+(\(C-q,)i(C-v\))240 1809 y Fo(Add)i(the)f(next)h(c)o(haracter)f(that)f(y)o
+(ou)h(t)o(yp)q(e)h(to)f(the)g(line)i(v)o(erbatim.)24 b(This)17
+b(is)g(ho)o(w)e(to)h(insert)h(k)o(ey)240 1872 y(sequences)f(lik)o(e)h
+Fn(C-Q)p Fo(,)d(for)h(example.)0 1952 y Fn(tab-insert)f(\(M-TAB\))240
+2014 y Fo(Insert)h(a)g(tab)g(c)o(haracter.)0 2094 y Fn(self-insert)f(\(a,)g
+(b,)h(A,)g(1,)g(!,)g(...\))240 2156 y Fo(Insert)g(y)o(ourself.)0
+2236 y Fn(transpose-chars)e(\(C-t\))240 2298 y Fo(Drag)h(the)h(c)o(haracter)g
+(b)q(efore)g(the)h(cursor)f(forw)o(ard)f(o)o(v)o(er)g(the)h(c)o(haracter)g
+(at)f(the)i(cursor,)e(mo)o(ving)240 2361 y(the)k(cursor)h(forw)o(ard)e(as)h
+(w)o(ell.)30 b(If)19 b(the)f(insertion)i(p)q(oin)o(t)f(is)g(at)e(the)i(end)g
+(of)f(the)g(line,)j(then)e(this)240 2423 y(transp)q(oses)c(the)g(last)g(t)o
+(w)o(o)f(c)o(haracters)h(of)f(the)i(line.)21 b(Negativ)o(e)15
+b(argumen)o(tss)f(don't)h(w)o(ork.)0 2503 y Fn(transpose-words)e(\(M-t\))240
+2565 y Fo(Drag)f(the)h(w)o(ord)f(b)q(ehind)i(the)f(cursor)g(past)f(the)h(w)o
+(ord)f(in)h(fron)o(t)f(of)h(the)f(cursor)h(mo)o(ving)f(the)h(cursor)240
+2627 y(o)o(v)o(er)h(that)h(w)o(ord)f(as)h(w)o(ell.)p eop
+%%Page: 11 13
+12 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1205
+b(11)0 158 y Fn(upcase-word)14 b(\(M-u\))240 221 y Fo(Upp)q(ercase)h(the)e
+(curren)o(t)h(\(or)f(follo)o(wing\))h(w)o(ord.)k(With)c(a)f(negativ)o(e)h
+(argumen)o(t,)f(do)g(the)h(previous)240 283 y(w)o(ord,)g(but)h(do)h(not)e(mo)
+o(v)o(e)h(the)g(cursor.)0 358 y Fn(downcase-word)e(\(M-l\))240
+420 y Fo(Lo)o(w)o(ercase)g(the)i(curren)o(t)f(\(or)f(follo)o(wing\))h(w)o
+(ord.)19 b(With)14 b(a)g(negativ)o(e)g(argumen)o(t,)f(do)h(the)g(previous)240
+482 y(w)o(ord,)g(but)h(do)h(not)e(mo)o(v)o(e)h(the)g(cursor.)0
+557 y Fn(capitalize-word)e(\(M-c\))240 619 y Fo(Capitalize)j(the)e(curren)o
+(t)g(\(or)f(follo)o(wing\))i(w)o(ord.)j(With)d(a)f(negativ)o(e)g(argumen)o
+(t,)f(do)h(the)g(previous)240 682 y(w)o(ord,)g(but)h(do)h(not)e(mo)o(v)o(e)h
+(the)g(cursor.)0 891 y Fi(1.4.4)30 b(Killing)15 b(And)h(Y)-5
+b(anking)0 1028 y Fn(kill-line)14 b(\(C-k\))240 1090 y Fo(Kill)j(the)f(text)e
+(from)h(the)g(curren)o(t)g(cursor)g(p)q(osition)h(to)f(the)g(end)h(of)f(the)g
+(line.)0 1165 y Fn(backward-kill-line)e(\(C-x)h(Rubout\))240
+1228 y Fo(Kill)j(bac)o(kw)o(ard)e(to)f(the)i(b)q(eginning)h(of)e(the)g(line.)
+0 1302 y Fn(unix-line-discard)e(\(C-u\))240 1365 y Fo(Kill)j(bac)o(kw)o(ard)d
+(from)f(the)i(cursor)f(to)g(the)h(b)q(eginning)i(of)d(the)g(curren)o(t)h
+(line.)21 b(Sa)o(v)o(e)13 b(the)h(killed)h(text)240 1427 y(on)g(the)g
+(kill-ring.)0 1502 y Fn(kill-whole-line)e(\(\))240 1564 y Fo(Kill)18
+b(all)f(c)o(haracters)e(on)h(the)g(curren)o(t)f(line,)j(no)e(matter)e(where)i
+(the)g(cursor)g(is.)22 b(By)16 b(default,)h(this)240 1626 y(is)f(un)o(b)q
+(ound.)0 1701 y Fn(kill-word)e(\(M-d\))240 1764 y Fo(Kill)j(from)d(the)h
+(cursor)g(to)f(the)h(end)g(of)g(the)g(curren)o(t)f(w)o(ord,)g(or)g(if)i(b)q
+(et)o(w)o(een)f(w)o(ords,)f(to)g(the)h(end)g(of)240 1826 y(the)g(next)h(w)o
+(ord.)j(W)l(ord)c(b)q(oundaries)h(are)f(the)g(same)g(as)g Fn(forward-word)p
+Fo(.)0 1901 y Fn(backward-kill-word)e(\(M-DEL\))240 1963 y
+Fo(Kill)k(the)f(w)o(ord)e(b)q(ehind)j(the)f(cursor.)j(W)l(ord)c(b)q
+(oundaries)i(are)d(the)i(same)f(as)f Fn(backward-word)p Fo(.)0
+2038 y Fn(unix-word-rubout)f(\(C-w\))240 2100 y Fo(Kill)i(the)e(w)o(ord)f(b)q
+(ehind)j(the)f(cursor,)e(using)i(white)f(space)h(as)e(a)h(w)o(ord)f(b)q
+(oundary)l(.)20 b(The)13 b(killed)i(text)240 2162 y(is)h(sa)o(v)o(ed)e(on)i
+(the)f(kill-ring.)0 2237 y Fn(delete-horizontal-space)d(\(\))240
+2300 y Fo(Delete)k(all)g(spaces)f(and)h(tabs)e(around)i(p)q(oin)o(t.)k(By)15
+b(default,)h(this)f(is)h(un)o(b)q(ound.)0 2375 y Fn(yank)f(\(C-y\))240
+2437 y Fo(Y)l(ank)g(the)h(top)f(of)f(the)i(kill)h(ring)e(in)o(to)g(the)h
+(bu\013er)f(at)f(the)i(curren)o(t)f(cursor)g(p)q(osition.)0
+2512 y Fn(yank-pop)f(\(M-y\))240 2574 y Fo(Rotate)f(the)h(kill-ring,)i(and)e
+(y)o(ank)g(the)g(new)g(top.)19 b(Y)l(ou)14 b(can)g(only)g(do)g(this)g(if)g
+(the)g(prior)g(command)240 2636 y(is)i(y)o(ank)f(or)f(y)o(ank-p)q(op.)p
+eop
+%%Page: 12 14
+13 bop 0 -83 a Fo(12)1449 b(GNU)15 b(Readline)i(Library)0 158
+y Fi(1.4.5)30 b(Sp)r(ecifying)15 b(Numeric)h(Argumen)n(ts)0
+301 y Fn(digit-argument)d(\(M-0,)i(M-1,)f(...)h(M--\))240 364
+y Fo(Add)k(this)f(digit)h(to)f(the)g(argumen)o(t)f(already)i(accum)o
+(ulating,)g(or)f(start)f(a)g(new)i(argumen)o(t.)28 b(M{)240
+426 y(starts)14 b(a)h(negativ)o(e)g(argumen)o(t.)0 507 y Fn
+(universal-argument)e(\(\))240 569 y Fo(Eac)o(h)k(time)h(this)g(is)f
+(executed,)i(the)e(argumen)o(t)g(coun)o(t)g(is)h(m)o(ultiplied)i(b)o(y)d
+(four.)26 b(The)18 b(argumen)o(t)240 631 y(coun)o(t)i(is)h(initially)j(one,)d
+(so)f(executing)i(this)f(function)g(the)g(\014rst)f(time)h(mak)o(es)f(the)h
+(argumen)o(t)240 693 y(coun)o(t)15 b(four.)20 b(By)15 b(default,)g(this)h(is)
+g(not)e(b)q(ound)j(to)d(a)h(k)o(ey)l(.)0 956 y Fi(1.4.6)30
+b(Letting)14 b(Readline)h(T)n(yp)r(e)h(F)-5 b(or)14 b(Y)-5
+b(ou)0 1099 y Fn(complete)14 b(\(TAB\))240 1161 y Fo(A)o(ttempt)i(to)h(do)g
+(completion)i(on)e(the)g(text)g(b)q(efore)h(the)f(cursor.)26
+b(This)18 b(is)g(application-sp)q(eci\014c.)240 1223 y(Generally)l(,)h(if)f
+(y)o(ou)f(are)h(t)o(yping)g(a)f(\014lename)i(argumen)o(t,)e(y)o(ou)g(can)h
+(do)f(\014lename)i(completion;)g(if)240 1285 y(y)o(ou)f(are)f(t)o(yping)i(a)e
+(command,)i(y)o(ou)e(can)i(do)f(command)g(completion,)h(if)g(y)o(ou)e(are)h
+(t)o(yping)g(in)h(a)240 1348 y(sym)o(b)q(ol)e(to)f(GDB,)g(y)o(ou)g(can)h(do)g
+(sym)o(b)q(ol)g(name)g(completion,)h(if)f(y)o(ou)f(are)h(t)o(yping)g(in)g(a)g
+(v)m(ariable)240 1410 y(to)e(Bash,)f(y)o(ou)h(can)h(do)f(v)m(ariable)h(name)g
+(completion,)g(and)f(so)g(on.)0 1491 y Fn(possible-completions)d(\(M-?\))240
+1553 y Fo(List)k(the)f(p)q(ossible)i(completions)f(of)f(the)g(text)g(b)q
+(efore)h(the)f(cursor.)0 1634 y Fn(insert-completions)e(\(\))240
+1696 y Fo(Insert)22 b(all)h(completions)g(of)f(the)g(text)f(b)q(efore)h(p)q
+(oin)o(t)h(that)e(w)o(ould)h(ha)o(v)o(e)g(b)q(een)h(generated)f(b)o(y)240
+1758 y Fn(possible-completions)p Fo(.)17 b(By)e(default,)h(this)f(is)h(not)f
+(b)q(ound)h(to)f(a)g(k)o(ey)l(.)0 2020 y Fi(1.4.7)30 b(Keyb)r(oard)15
+b(Macros)0 2163 y Fn(start-kbd-macro)e(\(C-x)i(\(\))240 2226
+y Fo(Begin)h(sa)o(ving)f(the)h(c)o(haracters)e(t)o(yp)q(ed)i(in)o(to)f(the)g
+(curren)o(t)g(k)o(eyb)q(oard)g(macro.)0 2306 y Fn(end-kbd-macro)e(\(C-x)i
+(\)\))240 2369 y Fo(Stop)f(sa)o(ving)h(the)g(c)o(haracters)f(t)o(yp)q(ed)h
+(in)o(to)f(the)h(curren)o(t)f(k)o(eyb)q(oard)h(macro)f(and)h(sa)o(v)o(e)f
+(the)g(de\014ni-)240 2431 y(tion.)0 2512 y Fn(call-last-kbd-macro)f(\(C-x)h
+(e\))240 2574 y Fo(Re-execute)20 b(the)f(last)f(k)o(eyb)q(oard)g(macro)g
+(de\014ned,)i(b)o(y)f(making)f(the)h(c)o(haracters)f(in)h(the)g(macro)240
+2636 y(app)q(ear)c(as)g(if)h(t)o(yp)q(ed)f(at)g(the)g(k)o(eyb)q(oard.)p
+eop
+%%Page: 13 15
+14 bop 0 -83 a Fo(Chapter)15 b(1:)k(Command)c(Line)i(Editing)1205
+b(13)0 158 y Fi(1.4.8)30 b(Some)15 b(Miscellaneous)h(Commands)0
+299 y Fn(re-read-init-file)d(\(C-x)h(C-r\))240 361 y Fo(Read)i(in)g(the)f
+(con)o(ten)o(ts)f(of)h(y)o(our)g(init)h(\014le,)g(and)f(incorp)q(orate)h(an)o
+(y)e(bindings)j(or)e(v)m(ariable)i(assign-)240 423 y(men)o(ts)e(found)g
+(there.)0 502 y Fn(abort)f(\(C-g\))240 564 y Fo(Ab)q(ort)f(the)h(curren)o(t)f
+(editing)i(command)e(and)h(ring)g(the)f(terminal's)h(b)q(ell)h(\(sub)s(ject)f
+(to)e(the)i(setting)240 626 y(of)h Fn(bell-style)p Fo(\).)0
+704 y Fn(do-uppercase-version)d(\(M-a,)j(M-b,)f(...\))240 767
+y Fo(Run)i(the)f(command)g(that)g(is)h(b)q(ound)g(to)e(the)i(corresop)q
+(onding)g(upp)q(ercase)g(c)o(haracter.)0 845 y Fn(prefix-meta)e(\(ESC\))240
+907 y Fo(Mak)o(e)g(the)g(next)h(c)o(haracter)f(that)g(y)o(ou)g(t)o(yp)q(e)h
+(b)q(e)g(meta\014ed.)20 b(This)15 b(is)g(for)f(p)q(eople)i(without)e(a)h
+(meta)240 970 y(k)o(ey)l(.)20 b(T)o(yping)c(`)p Fn(ESC)e(f)p
+Fo(')h(is)g(equiv)m(alen)o(t)i(to)e(t)o(yping)g(`)p Fn(M-f)p
+Fo('.)0 1048 y Fn(undo)g(\(C-_,)f(C-x)h(C-u\))240 1110 y Fo(Incremen)o(tal)h
+(undo,)f(separately)h(remem)o(b)q(ered)g(for)e(eac)o(h)h(line.)0
+1188 y Fn(revert-line)f(\(M-r\))240 1251 y Fo(Undo)20 b(all)h(c)o(hanges)f
+(made)g(to)f(this)i(line.)35 b(This)21 b(is)f(lik)o(e)h(t)o(yping)f(the)g
+Fn(undo)g Fo(command)g(enough)240 1313 y(times)15 b(to)g(get)g(bac)o(k)g(to)f
+(the)i(b)q(eginning.)0 1391 y Fn(tilde-expand)e(\(M-~\))240
+1453 y Fo(P)o(erform)g(tilde)j(expansion)f(on)f(the)g(curren)o(t)g(w)o(ord.)0
+1532 y Fn(dump-functions)e(\(\))240 1594 y Fo(Prin)o(t)18 b(all)h(of)f(the)g
+(functions)h(and)g(their)g(k)o(ey)f(bindings)i(to)d(the)i(readline)h(output)e
+(stream.)28 b(If)18 b(a)240 1656 y(n)o(umeric)i(argumen)o(t)d(is)i(supplied,)
+j(the)d(output)f(is)h(formatted)f(in)h(suc)o(h)g(a)f(w)o(a)o(y)g(that)g(it)h
+(can)f(b)q(e)240 1718 y(made)d(part)g(of)g(an)g Fj(inputrc)k
+Fo(\014le.)0 1974 y Fm(1.5)33 b(Readline)16 b(vi)g(Mo)r(de)62
+2115 y Fo(While)d(the)f(Readline)i(library)e(do)q(es)g(not)g(ha)o(v)o(e)f(a)g
+(full)i(set)f(of)f Fn(vi)g Fo(editing)i(functions,)g(it)f(do)q(es)g(con)o
+(tain)g(enough)0 2177 y(to)i(allo)o(w)h(simple)i(editing)f(of)f(the)g(line.)
+21 b(The)15 b(Readline)i Fn(vi)e Fo(mo)q(de)g(b)q(eha)o(v)o(es)h(as)e(sp)q
+(eci\014ed)j(in)f(the)f(P)o(osix)g(1003.2)0 2240 y(standard.)62
+2380 y(In)i(order)e(to)g(switc)o(h)h(in)o(teractiv)o(ely)h(b)q(et)o(w)o(een)f
+Fn(Emacs)f Fo(and)h Fn(Vi)f Fo(editing)i(mo)q(des,)f(use)g(the)g(command)f
+(M-C-j)0 2442 y(\(toggle-editing-mo)q(de\).)21 b(The)15 b(Readline)j(default)
+e(is)f Fn(emacs)g Fo(mo)q(de.)62 2583 y(When)k(y)o(ou)f(en)o(ter)g(a)g(line)i
+(in)g Fn(vi)e Fo(mo)q(de,)h(y)o(ou)f(are)g(already)g(placed)i(in)f
+(`insertion')g(mo)q(de,)g(as)f(if)h(y)o(ou)f(had)0 2645 y(t)o(yp)q(ed)e(an)f
+(`)p Fn(i)p Fo('.)20 b(Pressing)c Fn(ESC)f Fo(switc)o(hes)h(y)o(ou)f(in)o(to)
+h(`command')f(mo)q(de,)g(where)h(y)o(ou)f(can)h(edit)g(the)g(text)f(of)g(the)
+p eop
+%%Page: 14 16
+15 bop 0 -83 a Fo(14)1449 b(GNU)15 b(Readline)i(Library)0 158
+y(line)j(with)e(the)g(standard)g Fn(vi)f Fo(mo)o(v)o(emen)o(t)g(k)o(eys,)h
+(mo)o(v)o(e)g(to)f(previous)i(history)f(lines)h(with)g(`)p
+Fn(k)p Fo(',)e(and)h(follo)o(wing)0 221 y(lines)f(with)e(`)p
+Fn(j)p Fo(',)f(and)i(so)e(forth.)p eop
+%%Page: 15 17
+16 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(15)0 158 y Fk(2)41 b(Programming)16 b(with)f(GNU)h(Readline)62
+370 y Fo(This)j(c)o(hapter)f(describ)q(es)i(the)e(in)o(terface)g(b)q(et)o(w)o
+(een)h(the)f(GNU)g(Readline)j(Library)d(and)h(other)f(programs.)0
+433 y(If)h(y)o(ou)g(are)f(a)h(programmer,)f(and)i(y)o(ou)e(wish)i(to)e
+(include)j(the)e(features)g(found)g(in)h(GNU)f(Readline)i(suc)o(h)e(as)0
+495 y(completion,)f(line)h(editing,)f(and)f(in)o(teractiv)o(e)h(history)f
+(manipulation)h(in)g(y)o(our)f(o)o(wn)f(programs,)g(this)h(section)0
+557 y(is)f(for)e(y)o(ou.)0 826 y Fm(2.1)33 b(Basic)14 b(Beha)n(vior)62
+968 y Fo(Man)o(y)c(programs)g(pro)o(vide)h(a)g(command)f(line)j(in)o
+(terface,)e(suc)o(h)g(as)g Fn(mail)p Fo(,)f Fn(ftp)p Fo(,)h(and)g
+Fn(sh)p Fo(.)18 b(F)l(or)10 b(suc)o(h)i(programs,)0 1031 y(the)17
+b(default)h(b)q(eha)o(viour)g(of)e(Readline)k(is)e(su\016cien)o(t.)26
+b(This)18 b(section)f(describ)q(es)i(ho)o(w)e(to)f(use)i(Readline)h(in)f(the)
+0 1093 y(simplest)e(w)o(a)o(y)e(p)q(ossible,)j(p)q(erhaps)f(to)e(replace)j
+(calls)f(in)g(y)o(our)f(co)q(de)g(to)g Fn(gets\(\))f Fo(or)h
+Fn(fgets)f(\(\))p Fo(.)62 1235 y(The)g(function)g Fn(readline)g(\(\))f
+Fo(prin)o(ts)h(a)f(prompt)g(and)h(then)g(reads)f(and)g(returns)h(a)f(single)i
+(line)g(of)e(text)g(from)0 1297 y(the)g(user.)19 b(The)13 b(line)i
+Fn(readline)d Fo(returns)g(is)i(allo)q(cated)g(with)f Fn(malloc)h(\(\))p
+Fo(;)f(y)o(ou)g(should)h Fn(free)g(\(\))f Fo(the)g(line)h(when)0
+1360 y(y)o(ou)h(are)g(done)g(with)h(it.)k(The)15 b(declaration)h(for)f
+Fn(readline)f Fo(in)i(ANSI)g(C)f(is)120 1489 y Fn(char)23 b(*readline)g
+(\(char)g(*)p Fj(prompt)q Fn(\);)0 1631 y Fo(So,)15 b(one)g(migh)o(t)g(sa)o
+(y)120 1761 y Fn(char)23 b(*line)g(=)h(readline)f(\("Enter)g(a)h(line:)f
+("\);)0 1903 y Fo(in)17 b(order)g(to)f(read)g(a)g(line)j(of)d(text)g(from)g
+(the)g(user.)24 b(The)17 b(line)h(returned)f(has)g(the)f(\014nal)i(newline)g
+(remo)o(v)o(ed,)e(so)0 1965 y(only)g(the)f(text)g(remains.)62
+2107 y(If)g Fn(readline)f Fo(encoun)o(ters)h(an)f Fn(EOF)h
+Fo(while)h(reading)f(the)g(line,)h(and)f(the)g(line)h(is)f(empt)o(y)g(at)f
+(that)g(p)q(oin)o(t,)h(then)0 2169 y Fn(\(char)f(*\)NULL)h
+Fo(is)h(returned.)k(Otherwise,)15 b(the)h(line)h(is)e(ended)i(just)d(as)h(if)
+h(a)f(newline)i(had)e(b)q(een)i(t)o(yp)q(ed.)62 2311 y(If)g(y)o(ou)g(w)o(an)o
+(t)f(the)h(user)g(to)f(b)q(e)i(able)f(to)g(get)f(at)g(the)h(line)i(later,)e
+(\(with)g Fn(C-P)f Fo(for)g(example\),)i(y)o(ou)e(m)o(ust)h(call)0
+2374 y Fn(add_history)d(\(\))h Fo(to)f(sa)o(v)o(e)h(the)g(line)i(a)o(w)o(a)o
+(y)c(in)j(a)f Fj(history)k Fo(list)d(of)f(suc)o(h)h(lines.)120
+2503 y Fn(add_history)22 b(\(line\);)0 2645 y Fo(F)l(or)15
+b(full)h(details)g(on)f(the)h(GNU)f(History)g(Library)l(,)g(see)h(the)f(asso)
+q(ciated)g(man)o(ual.)p eop
+%%Page: 16 18
+17 bop 0 -83 a Fo(16)1449 b(GNU)15 b(Readline)i(Library)62
+158 y(It)e(is)g(preferable)g(to)f(a)o(v)o(oid)g(sa)o(ving)h(empt)o(y)f(lines)
+i(on)f(the)f(history)h(list,)g(since)g(users)g(rarely)g(ha)o(v)o(e)f(a)g
+(burning)0 221 y(need)i(to)e(reuse)h(a)f(blank)i(line.)21 b(Here)15
+b(is)g(a)g(function)g(whic)o(h)h(usefully)g(replaces)g(the)f(standard)f
+Fn(gets)h(\(\))f Fo(library)0 283 y(function,)i(and)f(has)g(the)g(adv)m(an)o
+(tage)g(of)g(no)g(static)g(bu\013er)g(to)g(o)o(v)o(er\015o)o(w:)120
+428 y Fn(/*)24 b(A)f(static)g(variable)g(for)h(holding)e(the)i(line.)f(*/)120
+477 y(static)g(char)g(*line_read)g(=)h(\(char)f(*\)NULL;)120
+577 y(/*)h(Read)f(a)h(string,)f(and)g(return)g(a)h(pointer)f(to)g(it.)48
+b(Returns)22 b(NULL)i(on)f(EOF.)h(*/)120 627 y(char)f(*)120
+677 y(rl_gets)g(\(\))120 726 y({)168 776 y(/*)g(If)h(the)f(buffer)g(has)h
+(already)f(been)g(allocated,)g(return)g(the)g(memory)239 826
+y(to)h(the)f(free)h(pool.)f(*/)168 876 y(if)g(\(line_read\))215
+926 y({)263 975 y(free)g(\(line_read\);)263 1025 y(line_read)g(=)h(\(char)f
+(*\)NULL;)215 1075 y(})168 1175 y(/*)g(Get)h(a)f(line)h(from)f(the)h(user.)f
+(*/)168 1225 y(line_read)f(=)i(readline)f(\(""\);)168 1324
+y(/*)g(If)h(the)f(line)h(has)f(any)h(text)f(in)g(it,)h(save)f(it)h(on)f(the)h
+(history.)f(*/)168 1374 y(if)g(\(line_read)g(&&)g(*line_read\))215
+1424 y(add_history)g(\(line_read\);)168 1523 y(return)g(\(line_read\);)120
+1573 y(})62 1730 y Fo(This)15 b(function)g(giv)o(es)f(the)g(user)g(the)g
+(default)h(b)q(eha)o(viour)g(of)e Fn(TAB)h Fo(completion:)20
+b(completion)15 b(on)f(\014le)h(names.)0 1793 y(If)h(y)o(ou)f(do)h(not)f(w)o
+(an)o(t)g(Readline)j(to)d(complete)i(on)e(\014lenames,)i(y)o(ou)e(can)h(c)o
+(hange)g(the)g(binding)i(of)d(the)h Fn(TAB)f Fo(k)o(ey)0 1855
+y(with)h Fn(rl_bind_key)d(\(\))p Fo(.)120 1999 y Fn(int)23
+b(rl_bind_key)g(\(int)g Fj(k)o(ey)p Fn(,)h(int)f(\(*)p Fj(function)p
+Fn(\)\(\)\);)62 2157 y(rl_bind_key)14 b(\(\))f Fo(tak)o(es)g(t)o(w)o(o)f
+(argumen)o(ts:)19 b Fj(k)o(ey)e Fo(is)d(the)g(c)o(haracter)f(that)g(y)o(ou)g
+(w)o(an)o(t)f(to)h(bind,)i(and)f Fj(function)0 2219 y Fo(is)g(the)g(address)g
+(of)f(the)h(function)g(to)f(call)i(when)f Fj(k)o(ey)j Fo(is)d(pressed.)20
+b(Binding)c Fn(TAB)d Fo(to)g Fn(rl_insert)h(\(\))f Fo(mak)o(es)g
+Fn(TAB)0 2281 y Fo(insert)i(itself.)20 b Fn(rl_bind_key)14
+b(\(\))g Fo(returns)g(non-zero)h(if)g Fj(k)o(ey)j Fo(is)d(not)f(a)g(v)m(alid)
+i(ASCI)q(I)f(c)o(haracter)f(co)q(de)h(\(b)q(et)o(w)o(een)0
+2343 y(0)g(and)g(255\).)62 2500 y(Th)o(us,)g(to)g(disable)h(the)g(default)f
+Fn(TAB)g Fo(b)q(eha)o(vior,)h(the)f(follo)o(wing)h(su\016ces:)120
+2645 y Fn(rl_bind_key)22 b(\('\\t',)h(rl_insert\);)p eop
+%%Page: 17 19
+18 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(17)62 158 y(This)12 b(co)q(de)f(should)h(b)q(e)f(executed)h(once)f(at)f
+(the)h(start)f(of)g(y)o(our)g(program;)h(y)o(ou)g(migh)o(t)f(write)h(a)g
+(function)g(called)0 221 y Fn(initialize_readline)i(\(\))j
+Fo(whic)o(h)h(p)q(erforms)f(this)h(and)f(other)g(desired)i(initializations,)h
+(suc)o(h)e(as)f(installing)0 283 y(custom)f(completers)g(\(see)h(Section)g
+(2.4)e([Custom)g(Completers],)h(page)g(28\).)0 539 y Fm(2.2)33
+b(Custom)14 b(F)-6 b(unctions)62 680 y Fo(Readline)18 b(pro)o(vides)f(man)o
+(y)e(functions)i(for)e(manipulating)j(the)e(text)f(of)g(the)h(line,)i(but)e
+(it)g(isn't)g(p)q(ossible)i(to)0 742 y(an)o(ticipate)i(the)g(needs)g(of)f
+(all)h(programs.)31 b(This)20 b(section)g(describ)q(es)h(the)f(v)m(arious)g
+(functions)g(and)g(v)m(ariables)0 804 y(de\014ned)c(within)f(the)g(Readline)i
+(library)e(whic)o(h)g(allo)o(w)g(a)f(user)g(program)f(to)h(add)h(customized)g
+(functionalit)o(y)h(to)0 866 y(Readline.)0 1106 y Fi(2.2.1)30
+b(The)15 b(F)-5 b(unction)14 b(T)n(yp)r(e)62 1247 y Fo(F)l(or)j(readabilt)o
+(y)l(,)h(w)o(e)f(declare)i(a)e(new)g(t)o(yp)q(e)h(of)f(ob)s(ject,)f(called)j
+Fj(F)l(unction)p Fo(.)28 b(A)17 b Fn(Function)f Fo(is)i(a)f(C)g(function)0
+1309 y(whic)o(h)f(returns)f(an)g Fn(int)p Fo(.)20 b(The)15
+b(t)o(yp)q(e)g(declaration)h(for)f Fn(Function)f Fo(is:)0 1450
+y Fn(typedef)g(int)h(Function)f(\(\);)62 1590 y Fo(The)i(reason)f(for)g
+(declaring)i(this)f(new)g(t)o(yp)q(e)f(is)h(to)f(mak)o(e)g(it)h(easier)g(to)f
+(write)g(co)q(de)h(describing)i(p)q(oin)o(ters)e(to)0 1652
+y(C)g(functions.)25 b(Let)17 b(us)f(sa)o(y)g(w)o(e)g(had)h(a)f(v)m(ariable)i
+(called)g Fj(func)i Fo(whic)o(h)d(w)o(as)f(a)g(p)q(oin)o(ter)h(to)f(a)g
+(function.)25 b(Instead)0 1715 y(of)15 b(the)g(classic)h(C)f(declaration)62
+1855 y Fn(int)g(\(*\)\(\)func;)0 1996 y Fo(w)o(e)g(ma)o(y)f(write)62
+2136 y Fn(Function)g(*func;)0 2277 y Fo(Similarly)l(,)j(there)e(are)120
+2405 y Fn(typedef)23 b(void)g(VFunction)g(\(\);)120 2455 y(typedef)g(char)g
+(*CPFunction)g(\(\);)g Fo(and)120 2505 y Fn(typedef)g(char)g(**CPPFunction)f
+(\(\);)0 2645 y Fo(for)12 b(functions)h(returning)g(no)g(v)m(alue,)g
+Fn(pointer)i(to)g(char)p Fo(,)d(and)g Fn(pointer)i(to)h(pointer)g(to)f(char)p
+Fo(,)e(resp)q(ectiv)o(ely)l(.)p eop
+%%Page: 18 20
+19 bop 0 -83 a Fo(18)1449 b(GNU)15 b(Readline)i(Library)0 158
+y Fi(2.2.2)30 b(W)-5 b(riting)15 b(a)g(New)g(F)-5 b(unction)62
+296 y Fo(In)22 b(order)f(to)g(write)g(new)h(functions)g(for)f(Readline,)j(y)o
+(ou)d(need)h(to)f(kno)o(w)g(the)g(calling)i(con)o(v)o(en)o(tions)f(for)0
+358 y(k)o(eyb)q(oard-in)o(v)o(ok)o(ed)17 b(functions,)g(and)f(the)h(names)f
+(of)g(the)h(v)m(ariables)h(that)d(describ)q(e)j(the)f(curren)o(t)f(state)g
+(of)g(the)0 420 y(line)h(read)e(so)g(far.)62 558 y(The)h(calling)h(sequence)f
+(for)f(a)f(command)i Fn(foo)e Fo(lo)q(oks)i(lik)o(e)120 683
+y Fn(foo)23 b(\(int)h(count,)f(int)g(key\))0 820 y Fo(where)f
+Fj(coun)o(t)g Fo(is)g(the)f(n)o(umeric)i(argumen)o(t)d(\(or)h(1)g(if)h
+(defaulted\))g(and)f Fj(k)o(ey)26 b Fo(is)21 b(the)h(k)o(ey)f(that)g(in)o(v)o
+(ok)o(ed)h(this)0 882 y(function.)62 1020 y(It)f(is)h(completely)g(up)f(to)f
+(the)h(function)h(as)f(to)f(what)g(should)i(b)q(e)g(done)f(with)g(the)g(n)o
+(umeric)h(argumen)o(t.)0 1082 y(Some)c(functions)g(use)g(it)g(as)f(a)h(rep)q
+(eat)g(coun)o(t,)f(some)h(as)f(a)g(\015ag,)h(and)g(others)f(to)g(c)o(ho)q
+(ose)h(alternate)f(b)q(eha)o(vior)0 1144 y(\(refreshing)12
+b(the)g(curren)o(t)g(line)h(as)f(opp)q(osed)g(to)f(refreshing)i(the)f
+(screen,)g(for)g(example\).)19 b(Some)12 b(c)o(ho)q(ose)f(to)h(ignore)0
+1207 y(it.)24 b(In)17 b(general,)g(if)g(a)g(function)g(uses)g(the)g(n)o
+(umeric)g(argumen)o(t)f(as)g(a)g(rep)q(eat)h(coun)o(t,)f(it)h(should)h(b)q(e)
+f(able)g(to)f(do)0 1269 y(something)f(useful)g(with)g(b)q(oth)f(negativ)o(e)h
+(and)f(p)q(ositiv)o(e)i(argumen)o(ts.)i(A)o(t)c(the)h(v)o(ery)f(least,)g(it)h
+(should)g(b)q(e)g(a)o(w)o(are)0 1331 y(that)f(it)i(can)f(b)q(e)h(passed)g(a)e
+(negativ)o(e)i(argumen)o(t.)1736 1494 y(V)l(ariable)-1899 b
+Fh(char)20 b(*)f Fg(rl)p 211 1494 18 3 v 21 w(line)p 320 1494
+V 23 w(bu\013er)120 1557 y Fo(This)f(is)g(the)f(line)i(gathered)e(so)g(far.)
+25 b(Y)l(ou)18 b(are)f(w)o(elcome)g(to)g(mo)q(dify)h(the)f(con)o(ten)o(ts)g
+(of)f(the)i(line,)120 1619 y(but)d(see)h(Section)g(2.3.5)d([Allo)o(wing)k
+(Undoing],)e(page)g(23.)1736 1782 y(V)l(ariable)-1899 b Fh(int)20
+b Fg(rl)p 140 1782 V 21 w(p)r(oin)n(t)120 1844 y Fo(The)15
+b(o\013set)g(of)f(the)i(curren)o(t)f(cursor)g(p)q(osition)h(in)g
+Fn(rl_line_buffer)d Fo(\(the)i Fj(p)q(oin)o(t)q Fo(\).)1736
+2007 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 2007 V 21
+w(end)120 2070 y Fo(The)d(n)o(um)o(b)q(er)f(of)g(c)o(haracters)g(presen)o(t)g
+(in)h Fn(rl_line_buffer)p Fo(.)k(When)c Fn(rl_point)e Fo(is)i(at)f(the)g(end)
+120 2132 y(of)f(the)g(line,)i Fn(rl_point)d Fo(and)h Fn(rl_end)f
+Fo(are)h(equal.)1736 2295 y(V)l(ariable)-1899 b Fh(int)20 b
+Fg(rl)p 140 2295 V 21 w(mark)120 2357 y Fo(The)h(mark)e(\(sa)o(v)o(ed)h(p)q
+(osition\))h(in)g(the)f(curren)o(t)h(line.)37 b(If)20 b(set,)h(the)g(mark)e
+(and)i(p)q(oin)o(t)g(de\014ne)g(a)120 2420 y Fj(region)p Fo(.)1736
+2583 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 2583 V 21
+w(done)120 2645 y Fo(Setting)13 b(this)h(to)f(a)f(non-zero)i(v)m(alue)g
+(causes)f(Readline)j(to)c(return)h(the)h(curren)o(t)f(line)h(immediately)l(.)
+p eop
+%%Page: 19 21
+20 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(19)1736 158 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140
+158 18 3 v 21 w(p)r(ending)p 361 158 V 20 w(input)120 221 y
+Fo(Setting)15 b(this)f(to)g(a)g(v)m(alue)i(mak)o(es)d(it)i(the)f(next)h(k)o
+(eystrok)o(e)e(read.)19 b(This)c(is)g(a)f(w)o(a)o(y)f(to)h(stu\013)g(a)g
+(single)120 283 y(c)o(haracter)g(in)o(to)i(the)f(input)h(stream.)1736
+451 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(rl)p 211 451
+V 21 w(prompt)120 513 y Fo(The)c(prompt)e(Readline)k(uses.)j(This)15
+b(is)f(set)h(from)e(the)h(argumen)o(t)g(to)g Fn(readline)g(\(\))p
+Fo(,)f(and)i(should)120 575 y(not)g(b)q(e)h(assigned)f(to)g(directly)l(.)1736
+743 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(rl)p 211 743
+V 21 w(terminal)p 443 743 V 21 w(name)120 806 y Fo(The)c(terminal)h(t)o(yp)q
+(e,)f(used)h(for)f(initialization.)1736 974 y(V)l(ariable)-1899
+b Fh(char)20 b(*)f Fg(rl)p 211 974 V 21 w(readline)p 430 974
+V 22 w(name)120 1036 y Fo(This)f(v)m(ariable)h(is)f(set)f(to)g(a)g(unique)i
+(name)f(b)o(y)f(eac)o(h)h(application)h(using)f(Readline.)29
+b(The)18 b(v)m(alue)120 1098 y(allo)o(ws)f(conditional)h(parsing)f(of)f(the)g
+(inputrc)i(\014le)f(\(see)g(Section)g(1.3.2)e([Conditional)j(Init)f(Con-)120
+1160 y(structs],)d(page)h(7\).)1736 1328 y(V)l(ariable)-1899
+b Fh(FILE)20 b(*)f Fg(rl)p 211 1328 V 21 w(instream)120 1391
+y Fo(The)c(stdio)h(stream)e(from)h(whic)o(h)h(Readline)h(reads)e(input.)1736
+1559 y(V)l(ariable)-1899 b Fh(FILE)20 b(*)f Fg(rl)p 211 1559
+V 21 w(outstream)120 1621 y Fo(The)c(stdio)h(stream)e(to)h(whic)o(h)h
+(Readline)h(p)q(erforms)e(output.)1736 1789 y(V)l(ariable)-1899
+b Fh(Function)20 b(*)g Fg(rl)p 316 1789 V 21 w(startup)p 520
+1789 V 20 w(ho)r(ok)120 1851 y Fo(If)13 b(non-zero,)h(this)f(is)h(the)f
+(address)g(of)g(a)f(function)i(to)f(call)h(just)f(b)q(efore)g
+Fn(readline)f Fo(prin)o(ts)h(the)g(\014rst)120 1913 y(prompt.)0
+2156 y Fm(2.3)33 b(Readline)16 b(Con)n(v)n(enience)g(F)-6 b(unctions)0
+2382 y Fi(2.3.1)30 b(Naming)15 b(a)g(F)-5 b(unction)62 2521
+y Fo(The)19 b(user)f(can)g(dynamically)i(c)o(hange)e(the)g(bindings)i(of)e(k)
+o(eys)f(while)j(using)f(Readline.)30 b(This)19 b(is)g(done)f(b)o(y)0
+2583 y(represen)o(ting)f(the)g(function)h(with)f(a)g(descriptiv)o(e)h(name.)
+25 b(The)17 b(user)g(is)g(able)h(to)e(t)o(yp)q(e)h(the)g(descriptiv)o(e)h
+(name)0 2645 y(when)e(referring)f(to)g(the)g(function.)21 b(Th)o(us,)14
+b(in)j(an)e(init)h(\014le,)g(one)f(migh)o(t)g(\014nd)p eop
+%%Page: 20 22
+21 bop 0 -83 a Fo(20)1449 b(GNU)15 b(Readline)i(Library)120
+158 y Fn(Meta-Rubout:)46 b(backward-kill-word)62 297 y Fo(This)21
+b(binds)f(the)g(k)o(eystrok)o(e)f Fn(META-RUBOUT)f Fo(to)h(the)h(function)g
+Fj(descriptiv)o(ely)26 b Fo(named)20 b Fn(backward-kill-)0
+359 y(word)p Fo(.)j(Y)l(ou,)16 b(as)g(the)g(programmer,)f(should)i(bind)h
+(the)e(functions)i(y)o(ou)d(write)i(to)e(descriptiv)o(e)j(names)e(as)g(w)o
+(ell.)0 421 y(Readline)i(pro)o(vides)d(a)g(function)h(for)f(doing)g(that:)
+1725 587 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 587
+18 3 v 21 w(add)p 253 587 V 20 w(defun)i Ff(\()p Fn(char)14
+b(*name,)g(Function)g(*function,)g(int)h(key)p Ff(\))120 649
+y Fo(Add)20 b Fj(name)i Fo(to)d(the)h(list)g(of)f(named)h(functions.)33
+b(Mak)o(e)19 b Fj(function)i Fo(b)q(e)f(the)f(function)i(that)d(gets)120
+711 y(called.)j(If)16 b Fj(k)o(ey)j Fo(is)d(not)e(-1,)h(then)h(bind)g(it)g
+(to)e Fj(function)i Fo(using)g Fn(rl_bind_key)e(\(\))p Fo(.)62
+877 y(Using)i(this)g(function)g(alone)g(is)g(su\016cien)o(t)h(for)d(most)h
+(applications.)22 b(It)16 b(is)g(the)f(recommended)i(w)o(a)o(y)d(to)h(add)0
+940 y(a)i(few)h(functions)g(to)f(the)h(default)g(functions)h(that)e(Readline)
+j(has)d(built)i(in.)28 b(If)18 b(y)o(ou)g(need)g(to)f(do)h(something)0
+1002 y(other)c(than)h(adding)h(a)e(function)i(to)e(Readline,)j(y)o(ou)d(ma)o
+(y)g(need)i(to)e(use)h(the)g(underlying)h(functions)g(describ)q(ed)0
+1064 y(b)q(elo)o(w.)0 1283 y Fi(2.3.2)30 b(Selecting)15 b(a)g(Keymap)62
+1422 y Fo(Key)k(bindings)i(tak)o(e)c(place)j(on)e(a)g Fj(k)o(eymap)p
+Fo(.)30 b(The)18 b(k)o(eymap)h(is)g(the)f(asso)q(ciation)h(b)q(et)o(w)o(een)g
+(the)f(k)o(eys)h(that)0 1484 y(the)g(user)g(t)o(yp)q(es)g(and)g(the)g
+(functions)g(that)f(get)h(run.)30 b(Y)l(ou)20 b(can)e(mak)o(e)h(y)o(our)f(o)o
+(wn)g(k)o(eymaps,)h(cop)o(y)g(existing)0 1546 y(k)o(eymaps,)14
+b(and)i(tell)g(Readline)i(whic)o(h)e(k)o(eymap)f(to)f(use.)1725
+1712 y(F)l(unction)-1899 b Fh(Keymap)20 b Fg(rl)p 218 1712
+V 21 w(mak)n(e)p 370 1712 V 20 w(bare)p 500 1712 V 20 w(k)n(eymap)j
+Ff(\(\))120 1774 y Fo(Returns)14 b(a)f(new,)g(empt)o(y)g(k)o(eymap.)19
+b(The)14 b(space)f(for)g(the)h(k)o(eymap)f(is)g(allo)q(cated)i(with)e
+Fn(malloc)i(\(\))p Fo(;)120 1836 y(y)o(ou)g(should)h Fn(free)f(\(\))g
+Fo(it)g(when)h(y)o(ou)f(are)f(done.)1725 2002 y(F)l(unction)-1899
+b Fh(Keymap)20 b Fg(rl)p 218 2002 V 21 w(cop)n(y)p 353 2002
+V 21 w(k)n(eymap)j Ff(\()p Fn(Keymap)14 b(map)p Ff(\))120 2064
+y Fo(Return)i(a)f(new)g(k)o(eymap)g(whic)o(h)h(is)g(a)f(cop)o(y)g(of)g
+Fj(map)p Fo(.)1725 2230 y(F)l(unction)-1899 b Fh(Keymap)20
+b Fg(rl)p 218 2230 V 21 w(mak)n(e)p 370 2230 V 20 w(k)n(eymap)j
+Ff(\(\))120 2293 y Fo(Return)c(a)f(new)h(k)o(eymap)f(with)h(the)f(prin)o
+(ting)i(c)o(haracters)d(b)q(ound)j(to)e(rl)p 1407 2293 14 2
+v 16 w(insert,)i(the)e(lo)o(w)o(ercase)120 2355 y(Meta)13 b(c)o(haracters)g
+(b)q(ound)h(to)f(run)h(their)g(equiv)m(alen)o(ts,)i(and)d(the)h(Meta)f
+(digits)h(b)q(ound)h(to)e(pro)q(duce)120 2417 y(n)o(umeric)j(argumen)o(ts.)
+1725 2583 y(F)l(unction)-1899 b Fh(void)20 b Fg(rl)p 166 2583
+18 3 v 21 w(discard)p 366 2583 V 21 w(k)n(eymap)i Ff(\()p Fn(Keymap)14
+b(keymap)p Ff(\))120 2645 y Fo(F)l(ree)h(the)h(storage)d(asso)q(ciated)j
+(with)f Fj(k)o(eymap)p Fo(.)p eop
+%%Page: 21 23
+22 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(21)62 158 y(Readline)20 b(has)d(sev)o(eral)h(in)o(ternal)g(k)o(eymaps.)26
+b(These)18 b(functions)g(allo)o(w)g(y)o(ou)f(to)g(c)o(hange)g(whic)o(h)h(k)o
+(eymap)f(is)0 221 y(activ)o(e.)1725 383 y(F)l(unction)-1899
+b Fh(Keymap)20 b Fg(rl)p 218 383 18 3 v 21 w(get)p 316 383
+V 21 w(k)n(eymap)i Ff(\(\))120 445 y Fo(Returns)16 b(the)f(curren)o(tly)h
+(activ)o(e)f(k)o(eymap.)1725 607 y(F)l(unction)-1899 b Fh(void)20
+b Fg(rl)p 166 607 V 21 w(set)p 258 607 V 21 w(k)n(eymap)i Ff(\()p
+Fn(Keymap)14 b(keymap)p Ff(\))120 669 y Fo(Mak)o(es)g Fj(k)o(eymap)j
+Fo(the)e(curren)o(tly)h(activ)o(e)f(k)o(eymap.)1725 831 y(F)l(unction)-1899
+b Fh(Keymap)20 b Fg(rl)p 218 831 V 21 w(get)p 316 831 V 21
+w(k)n(eymap)p 530 831 V 20 w(b)n(y)p 610 831 V 21 w(name)i
+Ff(\()p Fn(char)14 b(*name)p Ff(\))120 893 y Fo(Return)19 b(the)g(k)o(eymap)f
+(matc)o(hing)g Fj(name)p Fo(.)30 b Fj(name)21 b Fo(is)e(one)g(whic)o(h)g(w)o
+(ould)g(b)q(e)g(supplied)i(in)e(a)f Fn(set)120 955 y(keymap)c
+Fo(inputrc)j(line)f(\(see)g(Section)g(1.3)e([Readline)j(Init)f(File],)g(page)
+f(4\).)0 1163 y Fi(2.3.3)30 b(Binding)15 b(Keys)62 1300 y Fo(Y)l(ou)h(asso)q
+(ciate)f(k)o(eys)f(with)i(functions)g(through)e(the)i(k)o(eymap.)j(Readline)f
+(has)c(sev)o(eral)i(in)o(ternal)g(k)o(eymaps:)0 1362 y Fn
+(emacs_standard_keymap)p Fo(,)i Fn(emacs_meta_keymap)p Fo(,)g
+Fn(emacs_ctlx_keymap)p Fo(,)h Fn(vi_movement_keymap)p Fo(,)f(and)0
+1425 y Fn(vi_insertion_keymap)p Fo(.)h Fn(emacs_standard_keymap)13
+b Fo(is)k(the)f(default,)g(and)g(the)g(examples)h(in)f(this)h(man)o(ual)0
+1487 y(assume)e(that.)62 1624 y(These)h(functions)g(manage)e(k)o(ey)i
+(bindings.)1725 1786 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p
+140 1786 V 21 w(bind)p 272 1786 V 21 w(k)n(ey)k Ff(\()p Fn(int)14
+b(key,)h(Function)f(*function)p Ff(\))120 1848 y Fo(Binds)i
+Fj(k)o(ey)j Fo(to)14 b Fj(function)i Fo(in)g(the)f(curren)o(tly)h(activ)o(e)f
+(k)o(eymap.)k(Returns)d(non-zero)f(in)h(the)f(case)g(of)120
+1910 y(an)g(in)o(v)m(alid)j Fj(k)o(ey)p Fo(.)1725 2072 y(F)l(unction)-1899
+b Fh(int)19 b Fg(rl)p 139 2072 V 21 w(bind)p 271 2072 V 21
+w(k)n(ey)p 376 2072 V 21 w(in)p 444 2072 V 22 w(map)i Ff(\()p
+Fn(int)14 b(key,)h(Function)f(*function,)g(Keymap)g(map)p Ff(\))120
+2134 y Fo(Bind)i Fj(k)o(ey)j Fo(to)c Fj(function)h Fo(in)g
+Fj(map)p Fo(.)k(Returns)15 b(non-zero)h(in)g(the)f(case)g(of)g(an)g(in)o(v)m
+(alid)j Fj(k)o(ey)p Fo(.)1725 2296 y(F)l(unction)-1899 b Fh(int)20
+b Fg(rl)p 140 2296 V 21 w(un)n(bind)p 334 2296 V 21 w(k)n(ey)k
+Ff(\()p Fn(int)14 b(key)p Ff(\))120 2359 y Fo(Bind)h Fj(k)o(ey)i
+Fo(to)c(the)h(n)o(ull)h(function)f(in)g(the)g(curren)o(tly)g(activ)o(e)g(k)o
+(eymap.)19 b(Returns)14 b(non-zero)g(in)g(case)120 2421 y(of)h(error.)1725
+2583 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 2583 V 21
+w(un)n(bind)p 334 2583 V 21 w(k)n(ey)p 439 2583 V 21 w(in)p
+507 2583 V 22 w(map)h Ff(\()p Fn(int)14 b(key,)h(Keymap)f(map)p
+Ff(\))120 2645 y Fo(Bind)i Fj(k)o(ey)j Fo(to)c(the)g(n)o(ull)i(function)f(in)
+g Fj(map)p Fo(.)k(Returns)15 b(non-zero)h(in)g(case)f(of)g(error.)p
+eop
+%%Page: 22 24
+23 bop 0 -83 a Fo(22)1449 b(GNU)15 b(Readline)i(Library)1725
+158 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 158 18 3
+v 21 w(generic)p 338 158 V 21 w(bind)j Ff(\()p Fn(int)15 b(type,)f(char)h
+(*keyseq,)f(char)h(*data,)f(Keymap)208 221 y(map)p Ff(\))120
+283 y Fo(Bind)j(the)f(k)o(ey)g(sequence)h(represen)o(ted)f(b)o(y)g(the)g
+(string)g Fj(k)o(eyseq)g Fo(to)g(the)f(arbitrary)h(p)q(oin)o(ter)g
+Fj(data)p Fo(.)120 345 y Fj(t)o(yp)q(e)j Fo(sa)o(ys)c(what)g(kind)i(of)f
+(data)f(is)i(p)q(oin)o(ted)g(to)e(b)o(y)h Fj(data)p Fo(;)f(this)i(can)f(b)q
+(e)g(a)g(function)h(\()p Fn(ISFUNC)p Fo(\),)d(a)120 407 y(macro)i(\()p
+Fn(ISMACR)p Fo(\),)f(or)i(a)f(k)o(eymap)g(\()p Fn(ISKMAP)p
+Fo(\).)23 b(This)18 b(mak)o(es)e(new)h(k)o(eymaps)f(as)h(necessary)l(.)25
+b(The)120 470 y(initial)17 b(k)o(eymap)e(in)h(whic)o(h)g(to)f(do)g(bindings)i
+(is)f Fj(map)p Fo(.)1725 656 y(F)l(unction)-1899 b Fh(int)20
+b Fg(rl)p 140 656 V 21 w(parse)p 294 656 V 19 w(and)p 405 656
+V 21 w(bind)j Ff(\()p Fn(char)14 b(*line)p Ff(\))120 718 y
+Fo(P)o(arse)i Fj(line)21 b Fo(as)16 b(if)h(it)g(had)f(b)q(een)i(read)f(from)e
+(the)i Fn(inputrc)f Fo(\014le)h(and)g(p)q(erform)f(an)o(y)h(k)o(ey)f
+(bindings)120 780 y(and)f(v)m(ariable)i(assignmen)o(ts)e(found)h(\(see)f
+(Section)h(1.3)e([Readline)j(Init)f(File],)g(page)f(4\).)0
+1061 y Fi(2.3.4)30 b(Asso)r(ciating)15 b(F)-5 b(unction)15
+b(Names)g(and)g(Bindings)62 1206 y Fo(These)22 b(functions)g(allo)o(w)g(y)o
+(ou)f(to)f(\014nd)i(out)f(what)g(k)o(eys)g(in)o(v)o(ok)o(e)h(named)f
+(functions)h(and)g(the)f(functions)0 1269 y(in)o(v)o(ok)o(ed)15
+b(b)o(y)h(a)e(particular)i(k)o(ey)f(sequence.)1725 1455 y(F)l(unction)-1899
+b Fh(Function)20 b(*)g Fg(rl)p 316 1455 V 21 w(named)p 504
+1455 V 19 w(function)j Ff(\()p Fn(char)14 b(*name)p Ff(\))120
+1517 y Fo(Return)i(the)f(function)h(with)g(name)f Fj(name)p
+Fo(.)1725 1703 y(F)l(unction)-1899 b Fh(Function)20 b(*)g Fg(rl)p
+316 1703 V 21 w(function)p 542 1703 V 21 w(of)p 610 1703 V
+19 w(k)n(eyseq)k Ff(\()p Fn(char)15 b(*keyseq,)f(Keymap)g(map,)h(int)208
+1766 y(*type)p Ff(\))120 1828 y Fo(Return)i(the)f(function)h(in)o(v)o(ok)o
+(ed)g(b)o(y)f Fj(k)o(eyseq)i Fo(in)f(k)o(eymap)f Fj(map)p Fo(.)23
+b(If)16 b Fj(map)i Fo(is)f(NULL,)g(the)f(curren)o(t)120 1890
+y(k)o(eymap)g(is)i(used.)25 b(If)17 b Fj(t)o(yp)q(e)i Fo(is)e(not)g(NULL,)g
+(the)g(t)o(yp)q(e)g(of)f(the)h(ob)s(ject)f(is)h(returned)g(in)h(it)f(\(one)f
+(of)120 1952 y Fn(ISFUNC)p Fo(,)e Fn(ISKMAP)p Fo(,)g(or)h Fn(ISMACR)p
+Fo(\).)1725 2139 y(F)l(unction)-1899 b Fh(char)20 b(**)f Fg(rl)p
+237 2139 V 21 w(in)n(v)n(oking)p 466 2139 V 23 w(k)n(eyseqs)k
+Ff(\()p Fn(Function)14 b(*function)p Ff(\))120 2201 y Fo(Return)19
+b(an)e(arra)o(y)g(of)h(strings)f(represen)o(ting)i(the)f(k)o(ey)g(sequences)h
+(used)f(to)f(in)o(v)o(ok)o(e)h Fj(function)h Fo(in)120 2263
+y(the)c(curren)o(t)g(k)o(eymap.)1725 2449 y(F)l(unction)-1899
+b Fh(char)20 b(**)f Fg(rl)p 237 2449 V 21 w(in)n(v)n(oking)p
+466 2449 V 23 w(k)n(eyseqs)p 675 2449 V 21 w(in)p 743 2449
+V 22 w(map)i Ff(\()p Fn(Function)14 b(*function,)f(Keymap)208
+2512 y(map)p Ff(\))120 2574 y Fo(Return)19 b(an)e(arra)o(y)g(of)h(strings)f
+(represen)o(ting)i(the)f(k)o(ey)g(sequences)h(used)f(to)f(in)o(v)o(ok)o(e)h
+Fj(function)h Fo(in)120 2636 y(the)c(k)o(eymap)g Fj(map)p Fo(.)p
+eop
+%%Page: 23 25
+24 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(23)0 158 y Fi(2.3.5)30 b(Allo)n(wing)16 b(Undoing)62 297
+y Fo(Supp)q(orting)f(the)f(undo)g(command)g(is)g(a)g(painless)h(thing,)f(and)
+g(mak)o(es)f(y)o(our)h(functions)g(m)o(uc)o(h)g(more)f(useful.)0
+359 y(It)i(is)g(certainly)g(easy)f(to)g(try)g(something)h(if)g(y)o(ou)f(kno)o
+(w)g(y)o(ou)g(can)h(undo)g(it.)20 b(I)15 b(could)g(use)g(an)f(undo)h
+(function)h(for)0 422 y(the)f(sto)q(c)o(k)g(mark)o(et.)62 561
+y(If)h(y)o(our)f(function)i(simply)g(inserts)f(text)f(once,)h(or)f(deletes)h
+(text)f(once,)h(and)g(uses)g Fn(rl_insert_text)d(\(\))i Fo(or)0
+623 y Fn(rl_delete_text)e(\(\))i Fo(to)g(do)g(it,)g(then)g(undoing)i(is)e
+(already)h(done)f(for)g(y)o(ou)g(automatically)l(.)62 762 y(If)h(y)o(ou)f(do)
+g(m)o(ultiple)i(insertions)f(or)f(m)o(ultiple)i(deletions,)f(or)f(an)o(y)g
+(com)o(bination)h(of)f(these)g(op)q(erations,)g(y)o(ou)0 824
+y(should)j(group)e(them)g(together)g(in)o(to)g(one)h(op)q(eration.)24
+b(This)17 b(is)g(done)g(with)g Fn(rl_begin_undo_group)c(\(\))j
+Fo(and)0 886 y Fn(rl_end_undo_group)d(\(\))p Fo(.)62 1025 y(The)j(t)o(yp)q
+(es)f(of)g(ev)o(en)o(ts)g(that)f(can)h(b)q(e)h(undone)g(are:)120
+1151 y Fn(enum)23 b(undo_code)g({)h(UNDO_DELETE,)e(UNDO_INSERT,)g
+(UNDO_BEGIN,)g(UNDO_END)h(};)62 1290 y Fo(Notice)c(that)e Fn(UNDO_DELETE)f
+Fo(means)i(to)f(insert)i(some)e(text,)h(and)g Fn(UNDO_INSERT)e
+Fo(means)i(to)f(delete)i(some)0 1353 y(text.)37 b(That)21 b(is,)i(the)e(undo)
+h(co)q(de)f(tells)i(undo)e(what)g(to)f(undo,)j(not)e(ho)o(w)g(to)f(undo)i
+(it.)38 b Fn(UNDO_BEGIN)20 b Fo(and)0 1415 y Fn(UNDO_END)14
+b Fo(are)h(tags)f(added)i(b)o(y)f Fn(rl_begin_undo_group)e(\(\))i
+Fo(and)g Fn(rl_end_undo_group)e(\(\))p Fo(.)1725 1582 y(F)l(unction)-1899
+b Fh(int)20 b Fg(rl)p 140 1582 18 3 v 21 w(b)r(egin)p 297 1582
+V 20 w(undo)p 442 1582 V 20 w(group)h Ff(\(\))120 1645 y Fo(Begins)e(sa)o
+(ving)e(undo)i(information)f(in)g(a)g(group)f(construct.)27
+b(The)18 b(undo)h(information)f(usually)120 1707 y(comes)j(from)f(calls)h(to)
+g Fn(rl_insert_text)13 b(\(\))20 b Fo(and)h Fn(rl_delete_text)13
+b(\(\))p Fo(,)22 b(but)f(could)g(b)q(e)h(the)120 1769 y(result)16
+b(of)e(calls)j(to)d Fn(rl_add_undo)g(\(\))p Fo(.)1725 1937
+y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 1937 V 21 w(end)p
+251 1937 V 20 w(undo)p 396 1937 V 20 w(group)h Ff(\(\))120
+1999 y Fo(Closes)d(the)f(curren)o(t)g(undo)h(group)f(started)g(with)h
+Fn(rl_begin_undo_group)12 b(\(\))p Fo(.)26 b(There)18 b(should)120
+2061 y(b)q(e)e(one)f(call)i(to)d Fn(rl_end_undo_group)f(\(\))i
+Fo(for)f(eac)o(h)i(call)g(to)f Fn(rl_begin_undo_group)d(\(\))p
+Fo(.)1725 2229 y(F)l(unction)-1899 b Fh(void)20 b Fg(rl)p 166
+2229 V 21 w(add)p 279 2229 V 20 w(undo)i Ff(\()p Fn(enum)14
+b(undo_code)g(what,)g(int)h(start,)g(int)f(end,)h(char)208
+2291 y(*text)p Ff(\))120 2353 y Fo(Remem)o(b)q(er)20 b(ho)o(w)e(to)h(undo)g
+(an)g(ev)o(en)o(t)g(\(according)g(to)g Fj(what)q Fo(\).)30
+b(The)19 b(a\013ected)g(text)f(runs)i(from)120 2415 y Fj(start)15
+b Fo(to)g Fj(end)p Fo(,)g(and)g(encompasses)h Fj(text)p Fo(.)1725
+2583 y(F)l(unction)-1899 b Fh(void)20 b Fg(free)p 221 2583
+V 20 w(undo)p 366 2583 V 20 w(list)k Ff(\(\))120 2645 y Fo(F)l(ree)15
+b(the)h(existing)g(undo)f(list.)p eop
+%%Page: 24 26
+25 bop 0 -83 a Fo(24)1449 b(GNU)15 b(Readline)i(Library)1725
+158 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 158 18 3
+v 21 w(do)p 222 158 V 20 w(undo)i Ff(\(\))120 221 y Fo(Undo)14
+b(the)f(\014rst)g(thing)h(on)g(the)f(undo)h(list.)20 b(Returns)14
+b Fn(0)f Fo(if)h(there)g(w)o(as)e(nothing)i(to)f(undo,)h(non-zero)120
+283 y(if)i(something)f(w)o(as)f(undone.)62 454 y(Finally)l(,)j(if)f(y)o(ou)f
+(neither)i(insert)f(nor)f(delete)i(text,)d(but)i(directly)h(mo)q(dify)f(the)f
+(existing)i(text)e(\(e.g.,)f(c)o(hange)0 516 y(its)g(case\),)f(call)i
+Fn(rl_modifying)e(\(\))g Fo(once,)h(just)f(b)q(efore)h(y)o(ou)f(mo)q(dify)h
+(the)g(text.)19 b(Y)l(ou)14 b(m)o(ust)f(supply)h(the)g(indices)0
+578 y(of)h(the)g(text)g(range)g(that)f(y)o(ou)h(are)g(going)g(to)g(mo)q(dify)
+l(.)1725 749 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140
+749 V 21 w(mo)r(difying)h Ff(\()p Fn(int)15 b(start,)f(int)h(end)p
+Ff(\))120 811 y Fo(T)l(ell)e(Readline)g(to)e(sa)o(v)o(e)f(the)i(text)f(b)q
+(et)o(w)o(een)g Fj(start)g Fo(and)h Fj(end)h Fo(as)e(a)g(single)i(undo)e
+(unit.)20 b(It)11 b(is)h(assumed)120 873 y(that)i(y)o(ou)h(will)i(subsequen)o
+(tly)g(mo)q(dify)e(that)g(text.)0 1107 y Fi(2.3.6)30 b(Redispla)n(y)1725
+1278 y Fo(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 1278
+V 21 w(redispla)n(y)k Ff(\(\))120 1340 y Fo(Change)d(what's)g(displa)o(y)o
+(ed)h(on)g(the)f(screen)h(to)f(re\015ect)h(the)f(curren)o(t)g(con)o(ten)o(ts)
+g(of)g Fn(rl_line_)120 1402 y(buffer)p Fo(.)1725 1573 y(F)l(unction)-1899
+b Fh(int)20 b Fg(rl)p 140 1573 V 21 w(forced)p 315 1573 V 20
+w(up)r(date)p 509 1573 V 20 w(displa)n(y)k Ff(\(\))120 1635
+y Fo(F)l(orce)12 b(the)g(line)h(to)f(b)q(e)g(up)q(dated)h(and)f(redispla)o(y)
+o(ed,)i(whether)e(or)f(not)h(Readline)i(thinks)e(the)g(screen)120
+1697 y(displa)o(y)k(is)g(correct.)1725 1868 y(F)l(unction)-1899
+b Fh(int)20 b Fg(rl)p 140 1868 V 21 w(on)p 222 1868 V 20 w(new)p
+341 1868 V 21 w(line)k Ff(\(\))120 1930 y Fo(T)l(ell)c(the)f(up)q(date)g
+(routines)g(that)f(w)o(e)g(ha)o(v)o(e)g(mo)o(v)o(ed)g(on)o(to)g(a)g(new)h
+(\(empt)o(y\))e(line,)k(usually)f(after)120 1992 y(ouputting)c(a)e(newline.)
+1725 2163 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 2163
+V 21 w(reset)p 282 2163 V 20 w(line)p 390 2163 V 23 w(state)j
+Ff(\(\))120 2225 y Fo(Reset)14 b(the)f(displa)o(y)h(state)f(to)f(a)h(clean)h
+(state)f(and)g(redispla)o(y)i(the)e(curren)o(t)g(line)i(starting)e(on)g(a)g
+(new)120 2288 y(line.)1725 2458 y(F)l(unction)-1899 b Fh(int)20
+b Fg(rl)p 140 2458 V 21 w(message)g Ff(\()p Fn(va_alist)p Ff(\))120
+2521 y Fo(The)f(argumen)o(ts)e(are)h(a)g(string)g(as)g(w)o(ould)h(b)q(e)g
+(supplied)i(to)d Fn(printf)p Fo(.)28 b(The)19 b(resulting)g(string)f(is)120
+2583 y(displa)o(y)o(ed)h(in)f(the)g Fj(ec)o(ho)f(area)p Fo(.)27
+b(The)18 b(ec)o(ho)f(area)g(is)h(also)g(used)g(to)f(displa)o(y)h(n)o(umeric)h
+(argumen)o(ts)120 2645 y(and)c(searc)o(h)g(strings.)p eop
+%%Page: 25 27
+26 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(25)1725 158 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140
+158 18 3 v 21 w(clear)p 279 158 V 21 w(message)h Ff(\(\))120
+221 y Fo(Clear)15 b(the)h(message)e(in)i(the)g(ec)o(ho)f(area.)0
+423 y Fi(2.3.7)30 b(Mo)r(difying)15 b(T)-5 b(ext)1725 582 y
+Fo(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 582 V 21 w(insert)p
+303 582 V 21 w(text)k Ff(\()p Fn(char)14 b(*text)p Ff(\))120
+644 y Fo(Insert)h Fj(text)h Fo(in)o(to)f(the)h(line)g(at)f(the)g(curren)o(t)g
+(cursor)g(p)q(osition.)1725 803 y(F)l(unction)-1899 b Fh(int)20
+b Fg(rl)p 140 803 V 21 w(delete)p 308 803 V 22 w(text)k Ff(\()p
+Fn(int)14 b(start,)h(int)f(end)p Ff(\))120 865 y Fo(Delete)i(the)f(text)g(b)q
+(et)o(w)o(een)g Fj(start)g Fo(and)h Fj(end)h Fo(in)f(the)g(curren)o(t)f
+(line.)1725 1025 y(F)l(unction)-1899 b Fh(char)20 b(*)f Fg(rl)p
+211 1025 V 21 w(cop)n(y)p 346 1025 V 21 w(text)24 b Ff(\()p
+Fn(int)14 b(start,)h(int)g(end)p Ff(\))120 1087 y Fo(Return)h(a)f(cop)o(y)g
+(of)g(the)g(text)f(b)q(et)o(w)o(een)i Fj(start)f Fo(and)g Fj(end)j
+Fo(in)e(the)f(curren)o(t)g(line.)1725 1246 y(F)l(unction)-1899
+b Fh(int)20 b Fg(rl)p 140 1246 V 21 w(kill)p 236 1246 V 23
+w(text)k Ff(\()p Fn(int)14 b(start,)h(int)g(end)p Ff(\))120
+1308 y Fo(Cop)o(y)k(the)g(text)f(b)q(et)o(w)o(een)i Fj(start)e
+Fo(and)i Fj(end)h Fo(in)f(the)f(curren)o(t)g(line)i(to)d(the)h(kill)i(ring,)f
+(app)q(ending)120 1371 y(or)e(prep)q(ending)j(to)d(the)h(last)f(kill)j(if)e
+(the)g(last)f(command)h(w)o(as)e(a)i(kill)h(command.)30 b(The)19
+b(text)f(is)120 1433 y(deleted.)j(If)13 b Fj(start)g Fo(is)h(less)f(than)h
+Fj(end)p Fo(,)f(the)h(text)e(is)i(app)q(ended,)h(otherwise)e(prep)q(ended.)21
+b(If)14 b(the)f(last)120 1495 y(command)i(w)o(as)f(not)h(a)g(kill,)i(a)e(new)
+g(kill)i(ring)f(slot)f(is)g(used.)0 1697 y Fi(2.3.8)30 b(Utilit)n(y)16
+b(F)-5 b(unctions)1725 1856 y Fo(F)l(unction)-1899 b Fh(int)20
+b Fg(rl)p 140 1856 V 21 w(reset)p 282 1856 V 20 w(terminal)j
+Ff(\()p Fn(char)15 b(*terminal_name)p Ff(\))120 1919 y Fo(Reinitializ)q(e)f
+(Readline's)e(idea)g(of)e(the)h(terminal)h(settings)f(using)g
+Fj(terminal)p 1404 1919 14 2 v 17 w(name)j Fo(as)c(the)h(terminal)120
+1981 y(t)o(yp)q(e)k(\(e.g.,)f Fn(vt100)p Fo(\).)1725 2140 y(F)l(unction)-1899
+b Fh(int)20 b Fg(alphab)r(etic)k Ff(\()p Fn(int)14 b(c)p Ff(\))120
+2202 y Fo(Return)i(1)f(if)g Fj(c)j Fo(is)e(an)f(alphab)q(etic)i(c)o
+(haracter.)1725 2361 y(F)l(unction)-1899 b Fh(int)20 b Fg(n)n(umeric)i
+Ff(\()p Fn(int)15 b(c)p Ff(\))120 2424 y Fo(Return)h(1)f(if)g
+Fj(c)j Fo(is)e(a)f(n)o(umeric)h(c)o(haracter.)1725 2583 y(F)l(unction)-1899
+b Fh(int)20 b Fg(ding)i Ff(\(\))120 2645 y Fo(Ring)16 b(the)f(terminal)h(b)q
+(ell,)h(ob)q(eying)f(the)g(setting)f(of)g Fn(bell-style)p Fo(.)p
+eop
+%%Page: 26 28
+27 bop 0 -83 a Fo(26)1449 b(GNU)15 b(Readline)i(Library)62
+158 y(The)f(follo)o(wing)g(are)f(implemen)o(ted)h(as)f(macros,)f(de\014ned)j
+(in)f Fn(chartypes.h)p Fo(.)1725 319 y(F)l(unction)-1899 b
+Fh(int)20 b Fg(upp)r(ercase)p 351 319 18 3 v 19 w(p)j Ff(\()p
+Fn(int)14 b(c)p Ff(\))120 381 y Fo(Return)i(1)f(if)g Fj(c)j
+Fo(is)e(an)f(upp)q(ercase)i(alphab)q(etic)f(c)o(haracter.)1725
+541 y(F)l(unction)-1899 b Fh(int)20 b Fg(lo)n(w)n(ercase)p
+334 541 V 22 w(p)i Ff(\()p Fn(int)15 b(c)p Ff(\))120 604 y
+Fo(Return)h(1)f(if)g Fj(c)j Fo(is)e(a)f(lo)o(w)o(ercase)g(alphab)q(etic)i(c)o
+(haracter.)1725 764 y(F)l(unction)-1899 b Fh(int)20 b Fg(digit)p
+214 764 V 22 w(p)i Ff(\()p Fn(int)15 b(c)p Ff(\))120 826 y
+Fo(Return)h(1)f(if)g Fj(c)j Fo(is)e(a)f(n)o(umeric)h(c)o(haracter.)1725
+987 y(F)l(unction)-1899 b Fh(int)20 b Fg(to)p 152 987 V 20
+w(upp)r(er)i Ff(\()p Fn(int)14 b(c)p Ff(\))120 1049 y Fo(If)h
+Fj(c)i Fo(is)f(a)e(lo)o(w)o(ercase)g(alphab)q(etic)j(c)o(haracter,)c(return)i
+(the)g(corresp)q(onding)g(upp)q(ercase)h(c)o(haracter.)1725
+1209 y(F)l(unction)-1899 b Fh(int)20 b Fg(to)p 152 1209 V 20
+w(lo)n(w)n(er)k Ff(\()p Fn(int)15 b(c)p Ff(\))120 1272 y Fo(If)e
+Fj(c)i Fo(is)e(an)f(upp)q(ercase)h(alphab)q(etic)h(c)o(haracter,)e(return)g
+(the)h(corresp)q(onding)g(lo)o(w)o(ercase)f(c)o(haracter.)1725
+1432 y(F)l(unction)-1899 b Fh(int)20 b Fg(digit)p 214 1432
+V 22 w(v)m(alue)j Ff(\()p Fn(int)15 b(c)p Ff(\))120 1494 y
+Fo(If)g Fj(c)k Fo(is)c(a)g(n)o(um)o(b)q(er,)g(return)g(the)h(v)m(alue)g(it)g
+(represen)o(ts.)0 1699 y Fi(2.3.9)30 b(An)15 b(Example)62 1836
+y Fo(Here)e(is)g(a)f(function)h(whic)o(h)g(c)o(hanges)g(lo)o(w)o(ercase)f(c)o
+(haracters)f(to)h(their)h(upp)q(ercase)g(equiv)m(alen)o(ts,)h(and)f(upp)q
+(er-)0 1898 y(case)j(c)o(haracters)g(to)g(lo)o(w)o(ercase.)23
+b(If)16 b(this)h(function)g(w)o(as)f(b)q(ound)h(to)f(`)p Fn(M-c)p
+Fo(',)f(then)h(t)o(yping)h(`)p Fn(M-c)p Fo(')e(w)o(ould)i(c)o(hange)0
+1960 y(the)g(case)f(of)g(the)h(c)o(haracter)f(under)h(p)q(oin)o(t.)25
+b(T)o(yping)17 b(`)p Fn(M-1)d(0)h(M-c)p Fo(')h(w)o(ould)h(c)o(hange)f(the)h
+(case)f(of)h(the)f(follo)o(wing)0 2022 y(10)f(c)o(haracters,)f(lea)o(ving)i
+(the)f(cursor)g(on)g(the)g(last)g(c)o(haracter)g(c)o(hanged.)120
+2147 y Fn(/*)24 b(Invert)f(the)g(case)g(of)h(the)f(COUNT)h(following)e
+(characters.)h(*/)120 2197 y(int)120 2247 y(invert_case_line)f(\(count,)h
+(key\))239 2296 y(int)h(count,)f(key;)120 2346 y({)168 2396
+y(register)f(int)i(start,)f(end,)g(i;)168 2496 y(start)g(=)h(rl_point;)168
+2595 y(if)f(\(rl_point)g(>=)h(rl_end\))215 2645 y(return)f(\(0\);)p
+eop
+%%Page: 27 29
+28 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(27)168 208 y Fn(if)23 b(\(count)g(<)h(0\))215 258 y({)263
+308 y(direction)f(=)h(-1;)263 358 y(count)f(=)h(-count;)215
+407 y(})168 457 y(else)215 507 y(direction)f(=)h(1;)168 607
+y(/*)f(Find)h(the)f(end)h(of)f(the)h(range)f(to)g(modify.)g(*/)168
+656 y(end)g(=)h(start)f(+)h(\(count)f(*)h(direction\);)168
+756 y(/*)f(Force)g(it)h(to)g(be)f(within)g(range.)g(*/)168
+806 y(if)g(\(end)h(>)f(rl_end\))215 856 y(end)h(=)g(rl_end;)168
+906 y(else)f(if)h(\(end)f(<)h(0\))215 955 y(end)g(=)g(0;)168
+1055 y(if)f(\(start)g(==)h(end\))215 1105 y(return)f(\(0\);)168
+1204 y(if)g(\(start)g(>)h(end\))215 1254 y({)263 1304 y(int)g(temp)f(=)h
+(start;)263 1354 y(start)f(=)h(end;)263 1404 y(end)g(=)f(temp;)215
+1453 y(})168 1553 y(/*)g(Tell)h(readline)e(that)i(we)f(are)h(modifying)e(the)
+i(line,)f(so)h(it)f(will)h(save)239 1603 y(the)g(undo)f(information.)f(*/)168
+1653 y(rl_modifying)g(\(start,)h(end\);)168 1752 y(for)g(\(i)h(=)f(start;)h
+(i)f(!=)h(end;)f(i++\))215 1802 y({)263 1852 y(if)h(\(uppercase_p)e
+(\(rl_line_buffer[i]\)\))311 1902 y(rl_line_buffer[i])f(=)j(to_lower)f
+(\(rl_line_buffer[i]\);)263 1952 y(else)g(if)h(\(lowercase_p)e
+(\(rl_line_buffer[i]\)\))311 2001 y(rl_line_buffer[i])f(=)j(to_upper)f
+(\(rl_line_buffer[i]\);)215 2051 y(})168 2101 y(/*)g(Move)h(point)f(to)g(on)h
+(top)f(of)h(the)f(last)h(character)e(changed.)h(*/)168 2151
+y(rl_point)f(=)i(\(direction)f(==)g(1\))h(?)g(end)f(-)h(1)g(:)f(start;)168
+2201 y(return)g(\(0\);)120 2250 y(})p eop
+%%Page: 28 30
+29 bop 0 -83 a Fo(28)1449 b(GNU)15 b(Readline)i(Library)0 158
+y Fm(2.4)33 b(Custom)14 b(Completers)62 306 y Fo(T)o(ypically)l(,)g(a)c
+(program)g(that)h(reads)g(commands)g(from)f(the)h(user)h(has)e(a)h(w)o(a)o(y)
+f(of)h(disam)o(biguating)h(commands)0 368 y(and)k(data.)k(If)c(y)o(our)f
+(program)g(is)h(one)g(of)f(these,)h(then)g(it)g(can)g(pro)o(vide)g
+(completion)g(for)g(commands,)f(data,)f(or)0 430 y(b)q(oth.)28
+b(The)18 b(follo)o(wing)h(sections)f(describ)q(e)h(ho)o(w)f(y)o(our)f
+(program)g(and)h(Readline)i(co)q(op)q(erate)e(to)f(pro)o(vide)i(this)0
+493 y(service.)0 795 y Fi(2.4.1)30 b(Ho)n(w)15 b(Completing)g(W)-5
+b(orks)62 942 y Fo(In)16 b(order)f(to)g(complete)h(some)f(text,)f(the)h(full)
+i(list)f(of)f(p)q(ossible)i(completions)f(m)o(ust)f(b)q(e)h(a)o(v)m(ailable.)
+21 b(That)15 b(is,)0 1004 y(it)k(is)f(not)g(p)q(ossible)i(to)e(accurately)h
+(expand)g(a)f(partial)h(w)o(ord)e(without)i(kno)o(wing)f(all)h(of)f(the)h(p)q
+(ossible)h(w)o(ords)0 1067 y(whic)o(h)c(mak)o(e)f(sense)h(in)g(that)e(con)o
+(text.)20 b(The)15 b(Readline)j(library)e(pro)o(vides)f(the)h(user)f(in)o
+(terface)h(to)e(completion,)0 1129 y(and)h(t)o(w)o(o)f(of)h(the)h(most)e
+(common)h(completion)h(functions:)21 b(\014lename)c(and)e(username.)20
+b(F)l(or)15 b(completing)h(other)0 1191 y(t)o(yp)q(es)h(of)f(text,)g(y)o(ou)h
+(m)o(ust)f(write)h(y)o(our)f(o)o(wn)g(completion)i(function.)25
+b(This)18 b(section)f(describ)q(es)h(exactly)g(what)0 1253
+y(suc)o(h)e(functions)f(m)o(ust)g(do,)g(and)g(pro)o(vides)h(an)f(example.)62
+1401 y(There)h(are)f(three)g(ma)s(jor)f(functions)i(used)f(to)g(p)q(erform)g
+(completion:)25 1548 y(1.)29 b(The)15 b(user-in)o(terface)g(function)g
+Fn(rl_complete)e(\(\))p Fo(.)20 b(This)15 b(function)g(is)g(called)h(with)e
+(the)h(same)f(argumen)o(ts)90 1611 y(as)j(other)g(Readline)j(functions)f(in)o
+(tended)g(for)e(in)o(teractiv)o(e)h(use:)25 b Fj(coun)o(t)18
+b Fo(and)g Fj(in)o(v)o(oking)p 1633 1611 14 2 v 17 w(k)o(ey)p
+Fo(.)27 b(It)18 b(isolates)90 1673 y(the)j(w)o(ord)g(to)f(b)q(e)i(completed)h
+(and)e(calls)h Fn(completion_matches)13 b(\(\))21 b Fo(to)f(generate)h(a)g
+(list)h(of)f(p)q(ossible)90 1735 y(completions.)h(It)16 b(then)g(either)h
+(lists)f(the)g(p)q(ossible)h(completions,)g(inserts)f(the)g(p)q(ossible)h
+(completions,)f(or)90 1797 y(actually)g(p)q(erforms)f(the)g(completion,)h
+(dep)q(ending)i(on)d(whic)o(h)h(b)q(eha)o(vior)f(is)h(desired.)25
+1883 y(2.)29 b(The)18 b(in)o(ternal)h(function)g Fn(completion_matches)13
+b(\(\))18 b Fo(uses)g(y)o(our)f Fj(generator)k Fo(function)e(to)e(generate)h
+(the)90 1945 y(list)h(of)e(p)q(ossible)j(matc)o(hes,)e(and)g(then)g(returns)g
+(the)g(arra)o(y)f(of)h(these)g(matc)o(hes.)28 b(Y)l(ou)18 b(should)h(place)g
+(the)90 2007 y(address)c(of)g(y)o(our)g(generator)f(function)i(in)g
+Fn(rl_completion_entry_functi)o(on)p Fo(.)25 2092 y(3.)29 b(The)16
+b(generator)g(function)h(is)f(called)i(rep)q(eatedly)g(from)d
+Fn(completion_matches)e(\(\))p Fo(,)i(returning)i(a)f(string)90
+2155 y(eac)o(h)j(time.)31 b(The)19 b(argumen)o(ts)f(to)g(the)h(generator)e
+(function)j(are)e Fj(text)i Fo(and)f Fj(state)p Fo(.)29 b Fj(text)19
+b Fo(is)h(the)f(partial)90 2217 y(w)o(ord)13 b(to)g(b)q(e)h(completed.)21
+b Fj(state)15 b Fo(is)f(zero)g(the)g(\014rst)f(time)h(the)g(function)g(is)g
+(called,)i(allo)o(wing)e(the)g(generator)90 2279 y(to)19 b(p)q(erform)f(an)o
+(y)h(necessary)h(initialization,)i(and)e(a)f(p)q(ositiv)o(e)h(non-zero)f(in)o
+(teger)h(for)e(eac)o(h)h(subsequen)o(t)90 2341 y(call.)35 b(When)21
+b(the)f(generator)f(function)i(returns)f Fn(\(char)14 b(*\)NULL)19
+b Fo(this)i(signals)f Fn(completion_matches)90 2404 y(\(\))c
+Fo(that)g(there)h(are)f(no)h(more)f(p)q(ossibilitie)q(s)j(left.)25
+b(Usually)18 b(the)e(generator)g(function)i(computes)e(the)h(list)90
+2466 y(of)j(p)q(ossible)i(completions)f(when)g Fj(state)h Fo(is)f(zero,)g
+(and)f(returns)g(them)h(one)f(at)g(a)g(time)g(on)g(subsequen)o(t)90
+2528 y(calls.)g(Eac)o(h)14 b(string)f(the)h(generator)e(function)j(returns)e
+(as)g(a)g(matc)o(h)g(m)o(ust)g(b)q(e)h(allo)q(cated)h(with)e
+Fn(malloc\(\))p Fo(;)90 2590 y(Readline)18 b(frees)d(the)g(strings)g(when)h
+(it)f(has)g(\014nished)i(with)f(them.)p eop
+%%Page: 29 31
+30 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(29)1725 158 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140
+158 18 3 v 21 w(complete)j Ff(\()p Fn(int)14 b(ignore,)g(int)h(invoking_key)p
+Ff(\))120 221 y Fo(Complete)j(the)f(w)o(ord)f(at)h(or)g(b)q(efore)g(p)q(oin)o
+(t.)27 b(Y)l(ou)17 b(ha)o(v)o(e)g(supplied)i(the)f(function)g(that)e(do)q(es)
+i(the)120 283 y(initial)d(simple)f(matc)o(hing)f(selection)h(algorithm)f
+(\(see)f Fn(completion_matches)h(\(\))p Fo(\).)18 b(The)13
+b(default)120 345 y(is)j(to)e(do)h(\014lename)i(completion.)1736
+520 y(V)l(ariable)-1899 b Fh(Function)20 b(*)g Fg(rl)p 316
+520 V 21 w(completion)p 611 520 V 21 w(en)n(try)p 764 520 V
+21 w(function)120 582 y Fo(This)e(is)g(a)f(p)q(oin)o(ter)h(to)f(the)g
+(generator)g(function)h(for)f Fn(completion_matches)12 b(\(\))p
+Fo(.)27 b(If)17 b(the)h(v)m(alue)120 644 y(of)j Fn(rl_completion_entry_funct)
+o(ion)d Fo(is)k Fn(\(Function)14 b(*\)NULL)20 b Fo(then)i(the)f(default)h
+(\014lename)120 707 y(generator)14 b(function,)i Fn(filename_entry_function)c
+(\(\))p Fo(,)i(is)i(used.)0 953 y Fi(2.4.2)30 b(Completion)15
+b(F)-5 b(unctions)62 1094 y Fo(Here)16 b(is)f(the)h(complete)g(list)g(of)e
+(callable)k(completion)e(functions)g(presen)o(t)f(in)h(Readline.)1725
+1269 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 1269 V 21
+w(complete)p 385 1269 V 21 w(in)n(ternal)k Ff(\()p Fn(int)15
+b(what_to_do)p Ff(\))120 1331 y Fo(Complete)d(the)g(w)o(ord)f(at)g(or)g(b)q
+(efore)h(p)q(oin)o(t.)19 b Fj(what)p 979 1331 14 2 v 16 w(to)p
+1036 1331 V 16 w(do)14 b Fo(sa)o(ys)d(what)g(to)g(do)g(with)h(the)g
+(completion.)120 1394 y(A)g(v)m(alue)h(of)f(`)p Fn(?)p Fo(')f(means)h(list)h
+(the)f(p)q(ossible)i(completions.)20 b(`)p Fn(TAB)p Fo(')11
+b(means)h(do)g(standard)f(completion.)120 1456 y(`)p Fn(*)p
+Fo(')i(means)h(insert)h(all)g(of)f(the)g(p)q(ossible)i(completions.)21
+b(`)p Fn(!)p Fo(')13 b(means)h(to)g(displa)o(y)h(all)g(of)f(the)g(p)q
+(ossible)120 1518 y(completions,)i(if)g(there)f(is)h(more)e(than)h(one,)g(as)
+g(w)o(ell)h(as)f(p)q(erforming)h(partial)f(completion.)1725
+1693 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 1693 18
+3 v 21 w(complete)j Ff(\()p Fn(int)14 b(ignore,)g(int)h(invoking_key)p
+Ff(\))120 1755 y Fo(Complete)23 b(the)g(w)o(ord)e(at)h(or)g(b)q(efore)h(p)q
+(oin)o(t.)43 b(Y)l(ou)23 b(ha)o(v)o(e)f(supplied)j(the)d(function)i(that)e
+(do)q(es)120 1817 y(the)16 b(initial)j(simple)f(matc)o(hing)e(selection)i
+(algorithm)e(\(see)g Fn(completion_matches)d(\(\))j Fo(and)g
+Fn(rl_)120 1880 y(completion_entry_function)p Fo(\))o(.)25
+b(The)18 b(default)g(is)g(to)f(do)h(\014lename)h(completion.)29
+b(This)18 b(calls)120 1942 y Fn(rl_complete_internal)12 b(\(\))j
+Fo(with)h(an)f(argumen)o(t)f(dep)q(ending)k(on)d Fj(in)o(v)o(oking)p
+1496 1942 14 2 v 17 w(k)o(ey)p Fo(.)1725 2117 y(F)l(unction)-1899
+b Fh(int)20 b Fg(rl)p 140 2117 18 3 v 21 w(p)r(ossible)p 358
+2117 V 20 w(completions)j Ff(\()p Fn(int)15 b(count,)f(int)h(invoking_key)p
+Ff(\)\))120 2179 y Fo(List)23 b(the)f(p)q(ossible)j(completions.)42
+b(See)23 b(description)h(of)e Fn(rl_complete)14 b(\(\))p Fo(.)41
+b(This)23 b(calls)g Fn(rl_)120 2241 y(complete_internal)13
+b(\(\))i Fo(with)g(an)g(argumen)o(t)g(of)g(`)p Fn(?)p Fo('.)1725
+2416 y(F)l(unction)-1899 b Fh(int)20 b Fg(rl)p 140 2416 V 21
+w(insert)p 303 2416 V 21 w(completions)j Ff(\()p Fn(int)14
+b(count,)g(int)h(invoking_key)p Ff(\)\))120 2478 y Fo(Insert)20
+b(the)f(list)i(of)e(p)q(ossible)i(completions)f(in)o(to)g(the)f(line,)j
+(deleting)f(the)f(partially-completed)120 2540 y(w)o(ord.)h(See)c
+(description)g(of)e Fn(rl_complete)f(\(\))p Fo(.)21 b(This)c(calls)g
+Fn(rl_complete_internal)12 b(\(\))k Fo(with)120 2603 y(an)f(argumen)o(t)g(of)
+f(`)p Fn(*)p Fo('.)p eop
+%%Page: 30 32
+31 bop 0 -83 a Fo(30)1449 b(GNU)15 b(Readline)i(Library)1725
+158 y(F)l(unction)-1899 b Fh(char)20 b(**)f Fg(completion)p
+472 158 18 3 v 21 w(matc)n(hes)j Ff(\()p Fn(char)15 b(*text,)f(CPFunction)208
+221 y(*entry_func)p Ff(\))120 283 y Fo(Returns)22 b(an)g(arra)o(y)e(of)h
+Fn(\(char)15 b(*\))21 b Fo(whic)o(h)i(is)f(a)f(list)i(of)e(completions)i(for)
+e Fj(text)p Fo(.)39 b(If)22 b(there)f(are)120 345 y(no)d(completions,)i
+(returns)e Fn(\(char)c(**\)NULL)p Fo(.)28 b(The)19 b(\014rst)e(en)o(try)h(in)
+h(the)g(returned)f(arra)o(y)f(is)i(the)120 407 y(substitution)c(for)e
+Fj(text)p Fo(.)19 b(The)c(remaining)g(en)o(tries)f(are)g(the)g(p)q(ossible)i
+(completions.)k(The)15 b(arra)o(y)d(is)120 470 y(terminated)j(with)h(a)f
+Fn(NULL)f Fo(p)q(oin)o(ter.)120 613 y Fj(en)o(try)p 227 613
+14 2 v 16 w(func)h Fo(is)d(a)g(function)h(of)e(t)o(w)o(o)g(args,)g(and)h
+(returns)g(a)f Fn(\(char)k(*\))p Fo(.)j(The)12 b(\014rst)f(argumen)o(t)g(is)i
+Fj(text)p Fo(.)120 675 y(The)i(second)f(is)h(a)f(state)g(argumen)o(t;)f(it)i
+(is)g(zero)f(on)g(the)h(\014rst)f(call,)h(and)f(non-zero)h(on)f(subsequen)o
+(t)120 738 y(calls.)21 b Fj(en)o(try)p 346 738 V 16 w(func)c
+Fo(returns)e(a)f Fn(NULL)g Fo(p)q(oin)o(ter)h(to)f(the)g(caller)i(when)f
+(there)f(are)g(no)h(more)f(matc)o(hes.)1725 919 y(F)l(unction)-1899
+b Fh(char)20 b(*)f Fg(\014lename)p 380 919 18 3 v 20 w(completion)p
+674 919 V 21 w(function)k Ff(\()p Fn(char)15 b(*text,)f(int)h(state)p
+Ff(\))120 981 y Fo(A)e(generator)f(function)h(for)f(\014lename)i(completion)g
+(in)f(the)g(general)g(case.)19 b(Note)13 b(that)f(completion)120
+1043 y(in)18 b(Bash)f(is)h(a)f(little)h(di\013eren)o(t)f(b)q(ecause)h(of)f
+(all)h(the)f(pathnames)g(that)g(m)o(ust)f(b)q(e)i(follo)o(w)o(ed)f(when)120
+1105 y(lo)q(oking)23 b(up)f(completions)h(for)e(a)g(command.)39
+b(The)22 b(Bash)g(source)g(is)g(a)f(useful)i(reference)g(for)120
+1168 y(writing)16 b(custom)f(completion)h(functions.)1725 1349
+y(F)l(unction)-1899 b Fh(char)20 b(*)f Fg(username)p 412 1349
+V 19 w(completion)p 705 1349 V 21 w(function)k Ff(\()p Fn(char)14
+b(*text,)g(int)h(state)p Ff(\))120 1411 y Fo(A)i(completion)h(generator)e
+(for)g(usernames.)24 b Fj(text)18 b Fo(con)o(tains)e(a)h(partial)g(username)g
+(preceded)h(b)o(y)120 1473 y(a)f(random)g(c)o(haracter)f(\(usually)j(`)p
+Fn(~)p Fo('\).)24 b(As)18 b(with)f(all)h(completion)h(generators,)d
+Fj(state)j Fo(is)f(zero)f(on)120 1536 y(the)e(\014rst)g(call)h(and)g
+(non-zero)f(for)g(subsequen)o(t)h(calls.)0 1801 y Fi(2.4.3)30
+b(Completion)15 b(V)-5 b(ariables)1736 1982 y Fo(V)l(ariable)-1899
+b Fh(Function)20 b(*)g Fg(rl)p 316 1982 V 21 w(completion)p
+611 1982 V 21 w(en)n(try)p 764 1982 V 21 w(function)120 2044
+y Fo(A)d(p)q(oin)o(ter)h(to)f(the)g(generator)f(function)i(for)f
+Fn(completion_matches)c(\(\))p Fo(.)25 b Fn(NULL)17 b Fo(means)g(to)g(use)120
+2106 y Fn(filename_entry_function)12 b(\(\))p Fo(,)j(the)g(default)h
+(\014lename)g(completer.)1736 2287 y(V)l(ariable)-1899 b Fh(CPPFunction)21
+b(*)e Fg(rl)p 394 2287 V 21 w(attempted)p 674 2287 V 20 w(completion)p
+968 2287 V 21 w(function)120 2350 y Fo(A)g(p)q(oin)o(ter)h(to)f(an)g
+(alternativ)o(e)h(function)g(to)f(create)g(matc)o(hes.)32 b(The)20
+b(function)g(is)g(called)h(with)120 2412 y Fj(text)p Fo(,)e
+Fj(start)p Fo(,)g(and)g Fj(end)p Fo(.)32 b Fj(start)19 b Fo(and)g
+Fj(end)j Fo(are)c(indices)j(in)f Fn(rl_line_buffer)d Fo(sa)o(ying)i(what)g
+(the)120 2474 y(b)q(oundaries)c(of)e Fj(text)h Fo(are.)19 b(If)13
+b(this)h(function)g(exists)g(and)g(returns)f Fn(NULL)p Fo(,)g(or)g(if)h(this)
+f(v)m(ariable)i(is)f(set)120 2536 y(to)h Fn(NULL)p Fo(,)f(then)i
+Fn(rl_complete)e(\(\))h Fo(will)i(call)g(the)e(v)m(alue)i(of)e
+Fn(rl_completion_entry_funct)o(ion)120 2599 y Fo(to)g(generate)f(matc)o(hes,)
+h(otherwise)g(the)h(arra)o(y)e(of)g(strings)h(returned)h(will)h(b)q(e)f
+(used.)p eop
+%%Page: 31 33
+32 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(31)1736 158 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140
+158 18 3 v 21 w(completion)p 435 158 V 21 w(query)p 598 158
+V 21 w(items)120 221 y Fo(Up)h(to)e(this)i(man)o(y)f(items)h(will)h(b)q(e)f
+(displa)o(y)o(ed)h(in)f(resp)q(onse)g(to)f(a)g(p)q(ossible-completions)j
+(call.)120 283 y(After)16 b(that,)f(w)o(e)g(ask)h(the)g(user)g(if)g(she)g(is)
+h(sure)f(she)g(w)o(an)o(ts)f(to)g(see)h(them)g(all.)23 b(The)16
+b(default)h(v)m(alue)120 345 y(is)f(100.)1736 524 y(V)l(ariable)-1899
+b Fh(char)20 b(*)f Fg(rl)p 211 524 V 21 w(basic)p 355 524 V
+21 w(w)n(ord)p 500 524 V 21 w(break)p 661 524 V 20 w(c)n(haracters)120
+586 y Fo(The)12 b(basic)g(list)h(of)e(c)o(haracters)g(that)g(signal)h(a)g
+(break)f(b)q(et)o(w)o(een)h(w)o(ords)f(for)g(the)h(completer)g(routine.)120
+648 y(The)17 b(default)h(v)m(alue)g(of)e(this)i(v)m(ariable)g(is)g(the)f(c)o
+(haracters)f(whic)o(h)h(break)g(w)o(ords)g(for)f(completion)120
+711 y(in)g(Bash,)f(i.e.,)g Fn(")g(\\t\\n\\"\\\\'`@$><=;|&{\(")p
+Fo(.)1736 889 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(rl)p
+211 889 V 21 w(completer)p 480 889 V 21 w(w)n(ord)p 625 889
+V 20 w(break)p 785 889 V 20 w(c)n(haracters)120 952 y Fo(The)f(list)h(of)e(c)
+o(haracters)g(that)g(signal)i(a)f(break)f(b)q(et)o(w)o(een)h(w)o(ords)g(for)f
+Fn(rl_complete_internal)120 1014 y(\(\))p Fo(.)j(The)15 b(default)h(list)g
+(is)f(the)h(v)m(alue)g(of)f Fn(rl_basic_word_break_charac)o(ters)p
+Fo(.)1736 1192 y(V)l(ariable)-1899 b Fh(char)20 b(*)f Fg(rl)p
+211 1192 V 21 w(sp)r(ecial)p 398 1192 V 22 w(pre\014xes)120
+1255 y Fo(The)d(list)h(of)e(c)o(haracters)g(that)g(are)h(w)o(ord)f(break)h(c)
+o(haracters,)f(but)h(should)h(b)q(e)f(left)g(in)h Fj(text)f
+Fo(when)120 1317 y(it)f(is)g(passed)g(to)f(the)g(completion)i(function.)k
+(Programs)14 b(can)g(use)h(this)g(to)f(help)i(determine)g(what)120
+1379 y(kind)h(of)f(completing)i(to)e(do.)23 b(F)l(or)16 b(instance,)h(Bash)f
+(sets)g(this)h(v)m(ariable)h(to)e Fn(")p Fo($)p Fn(@")f Fo(so)h(that)g(it)h
+(can)120 1442 y(complete)f(shell)h(v)m(ariables)f(and)g(hostnames.)1736
+1620 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 1620 V 21
+w(ignore)p 316 1620 V 20 w(completion)p 610 1620 V 21 w(duplicates)120
+1682 y Fo(If)15 b(non-zero,)h(then)f(disallo)o(w)h(duplicates)h(in)f(the)g
+(matc)o(hes.)j(Default)c(is)h(1.)1736 1861 y(V)l(ariable)-1899
+b Fh(int)20 b Fg(rl)p 140 1861 V 21 w(\014lename)p 369 1861
+V 20 w(completion)p 663 1861 V 21 w(desired)120 1923 y Fo(Non-zero)e(means)g
+(that)f(the)g(results)i(of)e(the)h(matc)o(hes)f(are)h(to)f(b)q(e)h(treated)f
+(as)h(\014lenames.)28 b(This)120 1986 y(is)16 b Fj(alw)o(a)o(ys)h
+Fo(zero)e(on)g(en)o(try)l(,)g(and)h(can)g(only)g(b)q(e)g(c)o(hanged)f(within)
+i(a)e(completion)i(en)o(try)e(generator)120 2048 y(function.)26
+b(If)18 b(it)f(is)h(set)f(to)f(a)h(non-zero)g(v)m(alue,)i(directory)e(names)g
+(ha)o(v)o(e)g(a)g(slash)g(app)q(ended)i(and)120 2110 y(Readline)i(attempts)c
+(to)g(quote)h(completed)i(\014lenames)f(if)f(they)h(con)o(tain)f(an)o(y)g(em)
+o(b)q(edded)i(w)o(ord)120 2172 y(break)15 b(c)o(haracters.)1736
+2351 y(V)l(ariable)-1899 b Fh(int)20 b Fg(rl)p 140 2351 V 21
+w(\014lename)p 369 2351 V 20 w(quoting)p 578 2351 V 21 w(desired)120
+2413 y Fo(Non-zero)c(means)g(that)g(the)g(results)h(of)e(the)i(matc)o(hes)e
+(are)h(to)g(b)q(e)h(quoted)f(using)h(double)g(quotes)120 2476
+y(\(or)d(an)h(application-sp)q(eci\014)q(c)j(quoting)d(mec)o(hanism\))g(if)h
+(the)f(completed)h(\014lename)g(con)o(tains)f(an)o(y)120 2538
+y(c)o(haracters)c(in)h Fn(rl_completer_word_break_cha)o(rs)p
+Fo(.)k(This)c(is)g Fj(alw)o(a)o(ys)h Fo(non-zero)f(on)f(en)o(try)l(,)h(and)
+120 2600 y(can)j(only)h(b)q(e)g(c)o(hanged)f(within)i(a)e(completion)h(en)o
+(try)f(generator)f(function.)p eop
+%%Page: 32 34
+33 bop 0 -83 a Fo(32)1449 b(GNU)15 b(Readline)i(Library)1736
+158 y(V)l(ariable)-1899 b Fh(Function)20 b(*)g Fg(rl)p 316
+158 18 3 v 21 w(ignore)p 492 158 V 20 w(some)p 639 158 V 19
+w(completions)p 955 158 V 21 w(function)120 221 y Fo(This)e(function,)g(if)g
+(de\014ned,)h(is)f(called)h(b)o(y)e(the)h(completer)g(when)g(real)f
+(\014lename)i(completion)f(is)120 283 y(done,)13 b(after)e(all)i(the)g(matc)o
+(hing)f(names)g(ha)o(v)o(e)g(b)q(een)h(generated.)19 b(It)12
+b(is)h(passed)f(a)g Fn(NULL)g Fo(terminated)120 345 y(arra)o(y)k(of)h(matc)o
+(hes.)26 b(The)17 b(\014rst)g(elemen)o(t)h(\()p Fn(matches[0])p
+Fo(\))e(is)h(the)h(maximal)g(substring)f(common)120 407 y(to)f(all)h(matc)o
+(hes.)22 b(This)17 b(function)g(can)f(re-arrange)g(the)g(list)h(of)f(matc)o
+(hes)g(as)f(required,)j(but)e(eac)o(h)120 470 y(elemen)o(t)g(deleted)g(from)f
+(the)g(arra)o(y)f(m)o(ust)h(b)q(e)h(freed.)1736 632 y(V)l(ariable)-1899
+b Fh(char)20 b(*)f Fg(rl)p 211 632 V 21 w(completer)p 480 632
+V 21 w(quote)p 640 632 V 21 w(c)n(haracters)120 694 y Fo(List)j(of)e(c)o
+(haracters)g(whic)o(h)i(can)f(b)q(e)h(used)f(to)f(quote)h(a)g(substring)g(of)
+f(the)h(line.)39 b(Completion)120 756 y(o)q(ccurs)17 b(on)f(the)h(en)o(tire)g
+(substring,)g(and)f(within)i(the)e(substring)h Fn(rl_completer_word_break_)
+120 818 y(characters)i Fo(are)g(treated)h(as)f(an)o(y)h(other)g(c)o
+(haracter,)g(unless)h(they)f(also)g(app)q(ear)g(within)i(this)120
+881 y(list.)0 1088 y Fi(2.4.4)30 b(A)15 b(Short)g(Completion)g(Example)62
+1225 y Fo(Here)20 b(is)h(a)e(small)i(application)g(demonstrating)f(the)f(use)
+i(of)e(the)h(GNU)f(Readline)k(library)l(.)34 b(It)20 b(is)g(called)0
+1287 y Fn(fileman)p Fo(,)14 b(and)i(the)f(source)g(co)q(de)h(resides)g(in)h
+(`)p Fn(examples/fileman.c)p Fo(')o(.)h(This)e(sample)f(application)i(pro)o
+(vides)0 1350 y(completion)f(of)f(command)g(names,)g(line)i(editing)f
+(features,)f(and)g(access)g(to)g(the)g(history)g(list.)p eop
+%%Page: 33 35
+34 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(33)120 158 y Fn(/*)24 b(fileman.c)e(--)i(A)g(tiny)f(application)f(which)h
+(demonstrates)g(how)g(to)h(use)f(the)192 208 y(GNU)g(Readline)g(library.)46
+b(This)24 b(application)e(interactively)g(allows)h(users)192
+258 y(to)g(manipulate)g(files)g(and)g(their)g(modes.)h(*/)120
+358 y(#include)f(<stdio.h>)120 407 y(#include)g(<sys/types.h>)120
+457 y(#include)g(<sys/file.h>)120 507 y(#include)g(<sys/stat.h>)120
+557 y(#include)g(<sys/errno.h>)120 656 y(#include)g(<readline/readline.h>)120
+706 y(#include)g(<readline/history.h>)120 806 y(extern)g(char)g(*getwd)g
+(\(\);)120 856 y(extern)g(char)g(*xmalloc)g(\(\);)120 955 y(/*)h(The)f(names)
+g(of)h(functions)e(that)i(actually)f(do)g(the)h(manipulation.)e(*/)120
+1005 y(int)h(com_list)g(\(\),)h(com_view)e(\(\),)i(com_rename)e(\(\),)i
+(com_stat)f(\(\),)g(com_pwd)g(\(\);)120 1055 y(int)g(com_delete)g(\(\),)g
+(com_help)g(\(\),)h(com_cd)f(\(\),)g(com_quit)g(\(\);)120 1155
+y(/*)h(A)f(structure)g(which)g(contains)g(information)f(on)i(the)f(commands)g
+(this)g(program)192 1204 y(can)g(understand.)f(*/)120 1304
+y(typedef)h(struct)g({)168 1354 y(char)g(*name;)g(/*)h(User)f(printable)g
+(name)g(of)h(the)f(function.)g(*/)168 1404 y(Function)f(*func;)i(/*)f
+(Function)g(to)g(call)h(to)f(do)h(the)f(job.)h(*/)168 1453
+y(char)f(*doc;)g(/*)h(Documentation)e(for)h(this)h(function.)46
+b(*/)120 1503 y(})24 b(COMMAND;)120 1603 y(COMMAND)f(commands[])f(=)i({)168
+1653 y({)f("cd",)h(com_cd,)f("Change)f(to)i(directory)f(DIR")g(},)168
+1703 y({)g("delete",)g(com_delete,)f("Delete)h(FILE")h(},)168
+1752 y({)f("help",)g(com_help,)g("Display)g(this)g(text")g(},)168
+1802 y({)g("?",)h(com_help,)e("Synonym)h(for)h(`help'")f(},)168
+1852 y({)g("list",)g(com_list,)g("List)g(files)g(in)h(DIR")f(},)168
+1902 y({)g("ls",)h(com_list,)e("Synonym)h(for)g(`list'")g(},)168
+1952 y({)g("pwd",)g(com_pwd,)g("Print)g(the)h(current)f(working)g(directory")
+f(},)168 2001 y({)h("quit",)g(com_quit,)g("Quit)g(using)g(Fileman")g(},)168
+2051 y({)g("rename",)g(com_rename,)f("Rename)h(FILE)h(to)f(NEWNAME")g(},)168
+2101 y({)g("stat",)g(com_stat,)g("Print)g(out)g(statistics)g(on)h(FILE")f(},)
+168 2151 y({)g("view",)g(com_view,)g("View)g(the)h(contents)e(of)i(FILE")f
+(},)168 2201 y({)g(\(char)h(*\)NULL,)f(\(Function)f(*\)NULL,)h(\(char)g
+(*\)NULL)g(})120 2250 y(};)120 2350 y(/*)h(Forward)e(declarations.)h(*/)120
+2400 y(char)g(*stripwhite)g(\(\);)120 2450 y(COMMAND)g(*find_command)f(\(\);)
+120 2549 y(/*)i(The)f(name)g(of)h(this)f(program,)g(as)h(taken)f(from)g
+(argv[0].)g(*/)120 2599 y(char)g(*progname;)p eop
+%%Page: 34 36
+35 bop 0 -83 a Fo(34)1449 b(GNU)15 b(Readline)i(Library)120
+208 y Fn(/*)24 b(When)f(non-zero,)g(this)g(global)g(means)g(the)h(user)f(is)g
+(done)h(using)f(this)g(program.)g(*/)120 258 y(int)g(done;)120
+358 y(char)g(*)120 407 y(dupstr)g(\(s\))239 457 y(int)h(s;)120
+507 y({)168 557 y(char)f(*r;)168 656 y(r)g(=)h(xmalloc)f(\(strlen)g(\(s\))g
+(+)h(1\);)168 706 y(strcpy)f(\(r,)g(s\);)168 756 y(return)g(\(r\);)120
+806 y(})120 906 y(main)g(\(argc,)g(argv\))239 955 y(int)h(argc;)239
+1005 y(char)g(**argv;)120 1055 y({)168 1105 y(char)f(*line,)g(*s;)168
+1204 y(progname)f(=)i(argv[0];)168 1304 y(initialize_readline)d(\(\);)i(/*)h
+(Bind)f(our)h(completer.)e(*/)168 1404 y(/*)h(Loop)h(reading)f(and)g
+(executing)g(lines)g(until)g(the)g(user)h(quits.)f(*/)168 1453
+y(for)g(\()h(;)g(done)f(==)h(0;)f(\))215 1503 y({)263 1553
+y(line)g(=)h(readline)f(\("FileMan:)f("\);)263 1653 y(if)i(\(!line\))311
+1703 y(break;)263 1802 y(/*)g(Remove)f(leading)g(and)g(trailing)g(whitespace)
+f(from)i(the)f(line.)335 1852 y(Then,)g(if)h(there)f(is)g(anything)g(left,)g
+(add)h(it)f(to)h(the)f(history)g(list)335 1902 y(and)g(execute)g(it.)h(*/)263
+1952 y(s)g(=)g(stripwhite)e(\(line\);)263 2051 y(if)i(\(*s\))311
+2101 y({)359 2151 y(add_history)e(\(s\);)359 2201 y(execute_line)g(\(s\);)311
+2250 y(})263 2350 y(free)h(\(line\);)215 2400 y(})168 2450
+y(exit)g(\(0\);)120 2500 y(})120 2599 y(/*)h(Execute)e(a)i(command)f(line.)g
+(*/)p eop
+%%Page: 35 37
+36 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(35)120 158 y Fn(int)120 208 y(execute_line)22 b(\(line\))239
+258 y(char)i(*line;)120 308 y({)168 358 y(register)e(int)i(i;)168
+407 y(COMMAND)f(*command;)168 457 y(char)g(*word;)168 557 y(/*)g(Isolate)g
+(the)h(command)f(word.)g(*/)168 607 y(i)g(=)h(0;)168 656 y(while)f(\(line[i])
+g(&&)g(whitespace)g(\(line[i]\)\))215 706 y(i++;)168 756 y(word)g(=)h(line)f
+(+)h(i;)168 856 y(while)f(\(line[i])g(&&)g(!whitespace)g(\(line[i]\)\))215
+906 y(i++;)168 1005 y(if)g(\(line[i]\))215 1055 y(line[i++])g(=)h('\\0';)168
+1155 y(command)f(=)g(find_command)g(\(word\);)168 1254 y(if)g(\(!command\))
+215 1304 y({)263 1354 y(fprintf)g(\(stderr,)g("\045s:)g(No)h(such)f(command)g
+(for)g(FileMan.\\n",)g(word\);)263 1404 y(return)g(\(-1\);)215
+1453 y(})168 1553 y(/*)g(Get)h(argument)f(to)g(command,)g(if)g(any.)h(*/)168
+1603 y(while)f(\(whitespace)f(\(line[i]\)\))215 1653 y(i++;)168
+1752 y(word)h(=)h(line)f(+)h(i;)168 1852 y(/*)f(Call)h(the)f(function.)g(*/)
+168 1902 y(return)g(\(\(*\(command->func\)\))e(\(word\)\);)120
+1952 y(})120 2051 y(/*)j(Look)f(up)g(NAME)h(as)f(the)h(name)f(of)h(a)f
+(command,)g(and)h(return)f(a)g(pointer)g(to)h(that)192 2101
+y(command.)46 b(Return)23 b(a)h(NULL)f(pointer)g(if)h(NAME)f(isn't)g(a)h
+(command)f(name.)g(*/)120 2151 y(COMMAND)g(*)120 2201 y(find_command)f
+(\(name\))239 2250 y(char)i(*name;)120 2300 y({)168 2350 y(register)e(int)i
+(i;)168 2450 y(for)f(\(i)h(=)f(0;)h(commands[i].name;)e(i++\))215
+2500 y(if)i(\(strcmp)f(\(name,)g(commands[i].name\))f(==)h(0\))263
+2549 y(return)g(\(&commands[i]\);)p eop
+%%Page: 36 38
+37 bop 0 -83 a Fo(36)1449 b(GNU)15 b(Readline)i(Library)168
+208 y Fn(return)23 b(\(\(COMMAND)f(*\)NULL\);)120 258 y(})120
+358 y(/*)i(Strip)f(whitespace)f(from)i(the)f(start)g(and)h(end)f(of)h
+(STRING.)46 b(Return)24 b(a)f(pointer)192 407 y(into)g(STRING.)g(*/)120
+457 y(char)g(*)120 507 y(stripwhite)f(\(string\))239 557 y(char)i(*string;)
+120 607 y({)168 656 y(register)e(char)i(*s,)f(*t;)168 756 y(for)g(\(s)h(=)f
+(string;)g(whitespace)g(\(*s\);)g(s++\))215 806 y(;)168 906
+y(if)g(\(*s)h(==)f(0\))215 955 y(return)g(\(s\);)168 1055 y(t)g(=)h(s)g(+)g
+(strlen)f(\(s\))g(-)h(1;)168 1105 y(while)f(\(t)g(>)h(s)g(&&)g(whitespace)e
+(\(*t\)\))215 1155 y(t--;)168 1204 y(*++t)h(=)h('\\0';)168
+1304 y(return)f(s;)120 1354 y(})120 1453 y(/*)h(***********************)o
+(*******)o(********)o(*******)o(*******)o(********)o(****)d(*/)120
+1503 y(/*)1575 b(*/)120 1553 y(/*)429 b(Interface)23 b(to)g(Readline)g
+(Completion)381 b(*/)120 1603 y(/*)1575 b(*/)120 1653 y(/*)24
+b(***********************)o(*******)o(********)o(*******)o(*******)o
+(********)o(****)d(*/)120 1752 y(char)i(*command_generator)f(\(\);)120
+1802 y(char)h(**fileman_completion)e(\(\);)120 1902 y(/*)j(Tell)f(the)g(GNU)h
+(Readline)f(library)f(how)i(to)g(complete.)46 b(We)24 b(want)f(to)h(try)f(to)
+h(complete)192 1952 y(on)f(command)g(names)g(if)h(this)f(is)h(the)f(first)g
+(word)h(in)f(the)h(line,)f(or)h(on)f(filenames)192 2001 y(if)g(not.)g(*/)120
+2051 y(initialize_readline)e(\(\))120 2101 y({)168 2151 y(/*)i(Allow)g
+(conditional)g(parsing)g(of)g(the)h(~/.inputrc)e(file.)h(*/)168
+2201 y(rl_readline_name)e(=)j("FileMan";)168 2300 y(/*)f(Tell)h(the)f
+(completer)g(that)g(we)h(want)f(a)h(crack)f(first.)g(*/)168
+2350 y(rl_attempted_completion_)o(functio)o(n)e(=)j(\(CPPFunction)e
+(*\)fileman_completion;)120 2400 y(})p eop
+%%Page: 37 39
+38 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(37)120 158 y Fn(/*)24 b(Attempt)e(to)i(complete)f(on)g(the)h(contents)f(of)
+g(TEXT.)47 b(START)23 b(and)h(END)f(show)h(the)192 208 y(region)f(of)g(TEXT)h
+(that)f(contains)g(the)g(word)g(to)h(complete.)46 b(We)24 b(can)g(use)f(the)
+192 258 y(entire)g(line)g(in)h(case)f(we)g(want)h(to)f(do)h(some)f(simple)g
+(parsing.)47 b(Return)23 b(the)192 308 y(array)g(of)g(matches,)g(or)h(NULL)f
+(if)h(there)f(aren't)g(any.)g(*/)120 358 y(char)g(**)120 407
+y(fileman_completion)e(\(text,)i(start,)g(end\))239 457 y(char)h(*text;)239
+507 y(int)g(start,)f(end;)120 557 y({)168 607 y(char)g(**matches;)168
+706 y(matches)g(=)g(\(char)h(**\)NULL;)168 806 y(/*)f(If)h(this)f(word)h(is)f
+(at)h(the)f(start)g(of)h(the)f(line,)h(then)f(it)g(is)h(a)g(command)239
+856 y(to)g(complete.)46 b(Otherwise)23 b(it)h(is)f(the)h(name)f(of)h(a)f
+(file)h(in)f(the)h(current)239 906 y(directory.)f(*/)168 955
+y(if)g(\(start)g(==)h(0\))215 1005 y(matches)f(=)h(completion_matches)d
+(\(text,)j(command_generator\);)168 1105 y(return)f(\(matches\);)120
+1155 y(})120 1254 y(/*)h(Generator)e(function)h(for)g(command)g(completion.)
+47 b(STATE)23 b(lets)g(us)h(know)f(whether)192 1304 y(to)g(start)g(from)h
+(scratch;)e(without)h(any)h(state)f(\(i.e.)g(STATE)g(==)h(0\),)f(then)h(we)
+192 1354 y(start)f(at)g(the)h(top)f(of)h(the)f(list.)g(*/)120
+1404 y(char)g(*)120 1453 y(command_generator)f(\(text,)h(state\))239
+1503 y(char)h(*text;)239 1553 y(int)g(state;)120 1603 y({)168
+1653 y(static)f(int)g(list_index,)g(len;)168 1703 y(char)g(*name;)168
+1802 y(/*)g(If)h(this)f(is)h(a)g(new)f(word)g(to)h(complete,)f(initialize)f
+(now.)47 b(This)24 b(includes)239 1852 y(saving)f(the)h(length)f(of)g(TEXT)h
+(for)f(efficiency,)g(and)g(initializing)f(the)i(index)239 1902
+y(variable)f(to)h(0.)f(*/)168 1952 y(if)g(\(!state\))215 2001
+y({)263 2051 y(list_index)g(=)g(0;)263 2101 y(len)h(=)f(strlen)g(\(text\);)
+215 2151 y(})168 2250 y(/*)g(Return)g(the)h(next)f(name)g(which)h(partially)e
+(matches)h(from)g(the)h(command)f(list.)g(*/)168 2300 y(while)g(\(name)g(=)h
+(commands[list_index].name)o(\))215 2350 y({)263 2400 y(list_index++;)263
+2500 y(if)g(\(strncmp)f(\(name,)g(text,)g(len\))g(==)h(0\))311
+2549 y(return)f(\(dupstr\(name\)\);)215 2599 y(})p eop
+%%Page: 38 40
+39 bop 0 -83 a Fo(38)1449 b(GNU)15 b(Readline)i(Library)168
+208 y Fn(/*)23 b(If)h(no)f(names)h(matched,)e(then)i(return)f(NULL.)g(*/)168
+258 y(return)g(\(\(char)g(*\)NULL\);)120 308 y(})120 407 y(/*)h
+(***********************)o(*******)o(********)o(*******)o(*******)o(********)
+o(****)d(*/)120 457 y(/*)1575 b(*/)120 507 y(/*)549 b(FileMan)22
+b(Commands)644 b(*/)120 557 y(/*)1575 b(*/)120 607 y(/*)24
+b(***********************)o(*******)o(********)o(*******)o(*******)o
+(********)o(****)d(*/)120 706 y(/*)j(String)f(to)g(pass)h(to)f(system)g
+(\(\).)47 b(This)24 b(is)f(for)h(the)f(LIST,)g(VIEW)h(and)f(RENAME)192
+756 y(commands.)f(*/)120 806 y(static)h(char)g(syscom[1024];)120
+906 y(/*)h(List)f(the)g(file\(s\))g(named)g(in)h(arg.)f(*/)120
+955 y(com_list)g(\(arg\))239 1005 y(char)h(*arg;)120 1055 y({)168
+1105 y(if)f(\(!arg\))215 1155 y(arg)h(=)g("";)168 1254 y(sprintf)f(\(syscom,)
+f("ls)i(-FClg)f(\045s",)g(arg\);)168 1304 y(return)g(\(system)g
+(\(syscom\)\);)120 1354 y(})120 1453 y(com_view)g(\(arg\))239
+1503 y(char)h(*arg;)120 1553 y({)168 1603 y(if)f(\(!valid_argument)f
+(\("view",)h(arg\)\))215 1653 y(return)g(1;)168 1752 y(sprintf)g(\(syscom,)f
+("more)i(\045s",)f(arg\);)168 1802 y(return)g(\(system)g(\(syscom\)\);)120
+1852 y(})120 1952 y(com_rename)f(\(arg\))239 2001 y(char)i(*arg;)120
+2051 y({)168 2101 y(too_dangerous)e(\("rename"\);)168 2151
+y(return)h(\(1\);)120 2201 y(})120 2300 y(com_stat)g(\(arg\))239
+2350 y(char)h(*arg;)120 2400 y({)168 2450 y(struct)f(stat)g(finfo;)168
+2549 y(if)g(\(!valid_argument)f(\("stat",)h(arg\)\))215 2599
+y(return)g(\(1\);)p eop
+%%Page: 39 41
+40 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(39)168 208 y Fn(if)23 b(\(stat)g(\(arg,)h(&finfo\))f(==)g(-1\))215
+258 y({)263 308 y(perror)g(\(arg\);)263 358 y(return)g(\(1\);)215
+407 y(})168 507 y(printf)g(\("Statistics)f(for)h(`\045s':\\n",)g(arg\);)168
+607 y(printf)g(\("\045s)g(has)h(\045d)f(link\045s,)g(and)g(is)h(\045d)g
+(byte\045s)f(in)g(length.\\n",)g(arg,)359 656 y(finfo.st_nlink,)359
+706 y(\(finfo.st_nlink)e(==)j(1\))g(?)f("")h(:)g("s",)359 756
+y(finfo.st_size,)359 806 y(\(finfo.st_size)e(==)h(1\))h(?)f("")h(:)g("s"\);)
+168 856 y(printf)f(\("Inode)g(Last)g(Change)g(at:)g(\045s",)h(ctime)f
+(\(&finfo.st_ctime\)\);)168 906 y(printf)g(\(")143 b(Last)23
+b(access)g(at:)g(\045s",)h(ctime)f(\(&finfo.st_atime\)\);)168
+955 y(printf)g(\(")95 b(Last)23 b(modified)g(at:)g(\045s",)h(ctime)f
+(\(&finfo.st_mtime\)\);)168 1005 y(return)g(\(0\);)120 1055
+y(})120 1155 y(com_delete)f(\(arg\))239 1204 y(char)i(*arg;)120
+1254 y({)168 1304 y(too_dangerous)e(\("delete"\);)168 1354
+y(return)h(\(1\);)120 1404 y(})120 1503 y(/*)h(Print)f(out)g(help)h(for)f
+(ARG,)g(or)h(for)f(all)h(of)f(the)h(commands)f(if)g(ARG)h(is)192
+1553 y(not)f(present.)g(*/)120 1603 y(com_help)g(\(arg\))239
+1653 y(char)h(*arg;)120 1703 y({)168 1752 y(register)e(int)i(i;)168
+1802 y(int)f(printed)g(=)h(0;)168 1902 y(for)f(\(i)h(=)f(0;)h
+(commands[i].name;)e(i++\))215 1952 y({)263 2001 y(if)i(\(!*arg)f(||)g
+(\(strcmp)g(\(arg,)g(commands[i].name\))f(==)i(0\)\))311 2051
+y({)359 2101 y(printf)f(\("\045s\\t\\t\045s.\\n",)e(commands[i].name,)h
+(commands[i].doc\);)359 2151 y(printed++;)311 2201 y(})215
+2250 y(})168 2350 y(if)h(\(!printed\))215 2400 y({)263 2450
+y(printf)g(\("No)h(commands)e(match)h(`\045s'.)48 b(Possibilties)22
+b(are:\\n",)h(arg\);)p eop
+%%Page: 40 42
+41 bop 0 -83 a Fo(40)1449 b(GNU)15 b(Readline)i(Library)263
+208 y Fn(for)24 b(\(i)f(=)h(0;)g(commands[i].name;)d(i++\))311
+258 y({)359 308 y(/*)i(Print)g(in)h(six)f(columns.)g(*/)359
+358 y(if)g(\(printed)g(==)h(6\))406 407 y({)454 457 y(printed)f(=)h(0;)454
+507 y(printf)f(\("\\n"\);)406 557 y(})359 656 y(printf)g(\("\045s\\t",)f
+(commands[i].name\);)359 706 y(printed++;)311 756 y(})263 856
+y(if)i(\(printed\))311 906 y(printf)f(\("\\n"\);)215 955 y(})168
+1005 y(return)g(\(0\);)120 1055 y(})120 1155 y(/*)h(Change)f(to)g(the)h
+(directory)e(ARG.)i(*/)120 1204 y(com_cd)f(\(arg\))239 1254
+y(char)h(*arg;)120 1304 y({)168 1354 y(if)f(\(chdir)g(\(arg\))h(==)f(-1\))215
+1404 y({)263 1453 y(perror)g(\(arg\);)263 1503 y(return)g(1;)215
+1553 y(})168 1653 y(com_pwd)g(\(""\);)168 1703 y(return)g(\(0\);)120
+1752 y(})120 1852 y(/*)h(Print)f(out)g(the)h(current)f(working)f(directory.)h
+(*/)120 1902 y(com_pwd)g(\(ignore\))239 1952 y(char)h(*ignore;)120
+2001 y({)168 2051 y(char)f(dir[1024],)g(*s;)168 2151 y(s)g(=)h(getwd)f
+(\(dir\);)168 2201 y(if)g(\(s)h(==)f(0\))215 2250 y({)263 2300
+y(printf)g(\("Error)g(getting)g(pwd:)g(\045s\\n",)g(dir\);)263
+2350 y(return)g(1;)215 2400 y(})168 2500 y(printf)g(\("Current)f(directory)h
+(is)h(\045s\\n",)f(dir\);)168 2549 y(return)g(0;)120 2599 y(})p
+eop
+%%Page: 41 43
+42 bop 0 -83 a Fo(Chapter)15 b(2:)k(Programming)c(with)g(GNU)g(Readline)994
+b(41)120 208 y Fn(/*)24 b(The)f(user)g(wishes)g(to)h(quit)f(using)g(this)h
+(program.)46 b(Just)24 b(set)f(DONE)h(non-zero.)e(*/)120 258
+y(com_quit)h(\(arg\))239 308 y(char)h(*arg;)120 358 y({)168
+407 y(done)f(=)h(1;)168 457 y(return)f(\(0\);)120 507 y(})120
+607 y(/*)h(Function)e(which)i(tells)f(you)g(that)g(you)h(can't)f(do)h(this.)f
+(*/)120 656 y(too_dangerous)f(\(caller\))239 706 y(char)i(*caller;)120
+756 y({)168 806 y(fprintf)f(\(stderr,)382 856 y("\045s:)h(Too)f(dangerous)g
+(for)g(me)h(to)g(distribute.)46 b(Write)23 b(it)h(yourself.\\n",)382
+906 y(caller\);)120 955 y(})120 1055 y(/*)g(Return)f(non-zero)f(if)i(ARG)f
+(is)h(a)g(valid)f(argument)g(for)g(CALLER,)g(else)g(print)192
+1105 y(an)g(error)g(message)g(and)h(return)f(zero.)g(*/)120
+1155 y(int)120 1204 y(valid_argument)f(\(caller,)h(arg\))239
+1254 y(char)h(*caller,)e(*arg;)120 1304 y({)168 1354 y(if)h(\(!arg)g(||)h
+(!*arg\))215 1404 y({)263 1453 y(fprintf)f(\(stderr,)g("\045s:)g(Argument)g
+(required.\\n",)f(caller\);)263 1503 y(return)h(\(0\);)215
+1553 y(})168 1653 y(return)g(\(1\);)120 1703 y(})p eop
+%%Page: 42 44
+43 bop 0 -83 a Fo(42)1449 b(GNU)15 b(Readline)i(Library)p eop
+%%Page: 43 45
+44 bop 0 -83 a Fo(Concept)15 b(Index)1616 b(43)0 158 y Fk(Concept)16
+b(Index)0 405 y Fm(I)0 471 y Fe(in)o(teraction,)f(readline)5
+b Fd(:)j(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)17
+b Fe(1)0 579 y Fm(K)0 646 y Fe(Kill)e(ring)8 b Fd(:)f(:)f(:)g(:)h(:)f(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21
+b Fe(3)0 704 y(Killing)16 b(text)8 b Fd(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)20 b Fe(3)1015
+405 y Fm(R)1015 471 y Fe(readline,)15 b(function)8 b Fd(:)g(:)e(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(15)1015 637
+y Fm(Y)1015 704 y Fe(Y)m(anking)15 b(text)t Fd(:)6 b(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)17 b
+Fe(3)p eop
+%%Page: 44 46
+45 bop 0 -83 a Fo(44)1449 b(GNU)15 b(Readline)i(Library)p eop
+%%Page: 45 47
+46 bop 0 -83 a Fo(F)l(unction)16 b(and)f(V)l(ariable)i(Index)1337
+b(45)0 158 y Fk(F)-7 b(unction)15 b(and)g(V)-7 b(ariable)14
+b(Index)0 399 y Fm($)0 466 y Fc($else)t Fd(:)t(:)6 b(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)17 b Fe(8)0 524 y Fc($endif)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)24
+b Fe(8)0 582 y Fc($if)7 b Fd(:)e(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)19
+b Fe(7)0 699 y Fm(A)0 765 y Fc(abort)11 b(\(C-g\))c Fd(:)t(:)f(:)h(:)f(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)20 b
+Fe(13)0 824 y Fc(accept-lin)o(e)10 b(\(Newline)o(,)g(Return\))c
+Fd(:)s(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)19 b Fe(9)0 882 y Fc(alphabetic)t Fd(:)s(:)7 b(:)f(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b Fe(25)0
+999 y Fm(B)0 1065 y Fc(backward-c)o(ha)o(r)10 b(\(C-b\))d Fd(:)t(:)f(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)19 b Fe(8)0 1124 y Fc(backward-d)o(el)o(ete)o
+(-c)o(har)9 b(\(Rubout\))e Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)23 b Fe(10)0 1182 y Fc(backward-k)o(il)o(l-l)o(in)o(e)
+10 b(\(C-x)h(Rubout\))d Fd(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)24 b Fe(11)0 1240 y Fc(backward-k)o(il)o(l-w)o(or)o(d)10
+b(\(M-DEL\))5 b Fd(:)t(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)h(:)f(:)g(:)g(:)g(:)g(:)18 b Fe(11)0 1298 y Fc(backward-w)o(or)o(d)10
+b(\(M-b\))d Fd(:)t(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)19
+b Fe(8)0 1356 y Fc(beginning-)o(of)o(-hi)o(st)o(ory)9 b(\(M-<\))d
+Fd(:)f(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)
+g(:)g(:)g(:)g(:)19 b Fe(9)0 1414 y Fc(beginning-)o(of)o(-li)o(ne)9
+b(\(C-a\))g Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)
+f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23 b Fe(8)0 1472 y(b)q(ell-st)o(yle)s
+Fd(:)9 b(:)d(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)16 b Fe(5)0 1590 y Fm(C)0 1656 y
+Fc(call-last-)o(kb)o(d-m)o(ac)o(ro)9 b(\(C-x)j(e\))7 b Fd(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)20
+b Fe(12)0 1714 y Fc(capitalize)o(-w)o(ord)9 b(\(M-c\))s Fd(:)t(:)d(:)g(:)h(:)
+f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)16 b Fe(11)0 1772 y Fc(clear-scre)o(en)9 b(\(C-l\))f
+Fd(:)t(:)e(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)
+f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(9)0
+1830 y(commen)o(t-b)q(egin)13 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)23 b Fe(5)0 1888 y Fc(complete)10
+b(\(TAB\))t Fd(:)s(:)c(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g
+(:)16 b Fe(12)0 1947 y(completion-query-i)q(tems)d Fd(:)6 b(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)23 b Fe(6)0 2005 y Fc(completion)p 201 2005
+12 2 v 10 w(matches)6 b Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)19
+b Fe(29)0 2063 y(con)o(v)o(ert-meta)t Fd(:)6 b(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)16 b Fe(5)0
+2180 y Fm(D)0 2247 y Fc(delete-cha)o(r)10 b(\(C-d\))e Fd(:)t(:)e(:)g(:)g(:)g
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(10)0 2305 y Fc(delete-hor)o(iz)o(ont)o
+(al)o(-sp)o(ace)9 b(\(\))c Fd(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)18 b Fe(11)0 2363 y
+Fc(digit-argu)o(me)o(nt)9 b(\(M-0,)i(M-1,)h(...)f(M--\))5 b
+Fd(:)g(:)h(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)18
+b Fe(12)0 2421 y Fc(digit)p 102 2421 V 12 w(p)s Fd(:)6 b(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)16
+b Fe(26)0 2479 y Fc(digit)p 102 2479 V 12 w(value)7 b Fd(:)t(:)f(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20
+b Fe(26)0 2537 y Fc(ding)t Fd(:)5 b(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)17
+b Fe(25)0 2595 y Fc(do-upperca)o(se)o(-ve)o(rs)o(ion)9 b(\(M-a,)i(M-b,)g
+(...\))d Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b
+Fe(13)0 2653 y Fc(downcase-w)o(or)o(d)10 b(\(M-l\))c Fd(:)t(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(11)1015 399 y Fc(dump-functi)o(on)o(s)10
+b(\(\))e Fd(:)d(:)i(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22
+b Fe(13)1015 513 y Fm(E)1015 579 y Fe(editing-mo)q(de)t Fd(:)9
+b(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)17 b Fe(5)1015 637 y Fc(end-kbd-mac)o(ro)9 b(\(C-x)j(\)\))7
+b Fd(:)t(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(12)1015 695
+y Fc(end-of-hist)o(or)o(y)10 b(\(M->\))c Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)19 b Fe(9)1015 754 y Fc(end-of-line)9 b(\(C-e\))e
+Fd(:)g(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)22
+b Fe(8)1015 812 y(expand-tilde)10 b Fd(:)f(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(6)1015 925
+y Fm(F)1015 992 y Fc(filename)p 1177 992 V 12 w(completi)o(on)p
+1388 992 V 11 w(function)5 b Fd(:)s(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)18 b Fe(30)1015 1050 y Fc(forward-cha)o(r)
+10 b(\(C-f\))e Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)21
+b Fe(8)1015 1108 y Fc(forward-sea)o(rc)o(h-h)o(ist)o(or)o(y)10
+b(\(C-s\))t Fd(:)t(:)c(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)17 b Fe(9)1015 1166 y Fc(forward-wor)o(d)10
+b(\(M-f\))e Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)21
+b Fe(8)1015 1224 y Fc(free)p 1097 1224 V 13 w(undo)p 1190 1224
+V 13 w(list)6 b Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)19 b Fe(23)1015 1338 y Fm(H)1015 1404 y Fc(history-sea)o(rc)o(h-b)o
+(ack)o(wa)o(rd)9 b(\(\))d Fd(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)19 b Fe(9)1015 1462
+y Fc(history-sea)o(rc)o(h-f)o(orw)o(ar)o(d)10 b(\(\))e Fd(:)d(:)h(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21
+b Fe(9)1015 1521 y(horizon)o(tal-scrol)q(l)q(-mo)q(de)t Fd(:)9
+b(:)d(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(5)1015 1634
+y Fm(I)1015 1701 y Fc(insert-comp)o(le)o(tio)o(ns)9 b(\(\))s
+Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)16 b Fe(12)1015 1814 y
+Fm(K)1015 1881 y Fe(k)o(eymap)6 b Fd(:)h(:)f(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19
+b Fe(6)1015 1939 y Fc(kill-line)10 b(\(C-k\))f Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(11)1015 1997 y Fc(kill-whole-)o(li)o
+(ne)10 b(\(\))d Fd(:)e(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)20
+b Fe(11)1015 2055 y Fc(kill-word)10 b(\(M-d\))f Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(11)1015 2169 y Fm(L)1015
+2235 y Fc(lowercase)p 1197 2235 V 11 w(p)7 b Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(26)1015
+2349 y Fm(M)1015 2415 y Fe(mark-mo)q(di\014ed-li)q(nes)8 b
+Fd(:)h(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)20
+b Fe(5)1015 2473 y(meta-\015ag)11 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23
+b Fe(5)1015 2587 y Fm(N)1015 2653 y Fc(next-histor)o(y)10 b(\(C-n\))e
+Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)21 b Fe(9)p
+eop
+%%Page: 46 48
+47 bop 0 -83 a Fo(46)1449 b(GNU)15 b(Readline)i(Library)0 158
+y Fc(non-increm)o(en)o(tal)o(-f)o(orw)o(ard)o(-s)o(ear)o(ch)o(-hi)o(st)o(ory)
+9 b(\(M-n\))g Fd(:)t(:)22 b Fe(9)0 216 y Fc(non-increm)o(en)o(tal)o(-r)o(eve)
+o(rse)o(-s)o(ear)o(ch)o(-hi)o(st)o(ory)9 b(\(M-p\))g Fd(:)t(:)22
+b Fe(9)0 275 y Fc(numeric)9 b Fd(:)s(:)e(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(25)0
+394 y Fm(O)0 460 y Fe(output-meta)8 b Fd(:)g(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(5)0
+580 y Fm(P)0 646 y Fc(possible-c)o(om)o(ple)o(ti)o(ons)9 b(\(M-?\))c
+Fd(:)g(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)
+g(:)g(:)g(:)18 b Fe(12)0 704 y Fc(prefix-met)o(a)10 b(\(ESC\))e
+Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(13)0
+762 y Fc(previous-h)o(is)o(tor)o(y)10 b(\(C-p\))f Fd(:)d(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)24 b Fe(9)0 882 y Fm(Q)0 948 y Fc(quoted-ins)o(er)o(t)10
+b(\(C-q,)h(C-v\))e Fd(:)d(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(10)0 1068 y
+Fm(R)0 1134 y Fc(re-read-in)o(it)o(-fi)o(le)9 b(\(C-x)i(C-r\))c
+Fd(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)
+g(:)g(:)20 b Fe(13)0 1192 y Fc(readline)8 b Fd(:)s(:)e(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21
+b Fe(15)0 1250 y Fc(redraw-cur)o(re)o(nt-)o(li)o(ne)9 b(\(\))i
+Fd(:)6 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(9)0 1308 y Fc(reverse-se)o(ar)o
+(ch-)o(hi)o(sto)o(ry)9 b(\(C-r\))t Fd(:)t(:)d(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)16 b Fe(9)0 1367
+y Fc(revert-lin)o(e)10 b(\(M-r\))e Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)21 b Fe(13)0 1425 y Fc(rl)p 42 1425 12 2 v 13 w(add)p
+115 1425 V 13 w(defun)8 b Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(20)0 1483 y Fc(rl)p 42 1483
+V 13 w(add)p 115 1483 V 13 w(undo)8 b Fd(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)22 b Fe(23)0 1541
+y Fc(rl)p 42 1541 V 13 w(attempted)p 235 1541 V 11 w(completion)p
+445 1541 V 10 w(function)15 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)h(:)17 b Fe(30)0 1599 y Fc(rl)p 42 1599 V 13 w(basic)p
+155 1599 V 13 w(word)p 248 1599 V 12 w(break)p 360 1599 V 12
+w(characters)i Fd(:)6 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)23 b Fe(31)0 1657 y Fc(rl)p 42 1657 V 13 w(begin)p
+155 1657 V 13 w(undo)p 248 1657 V 12 w(group)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)23 b Fe(23)0 1715 y Fc(rl)p 42 1715 V 13
+w(bind)p 135 1715 V 13 w(key)8 b Fd(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)22 b Fe(21)0 1773 y
+Fc(rl)p 42 1773 V 13 w(bind)p 135 1773 V 13 w(key)p 208 1773
+V 13 w(in)p 261 1773 V 13 w(map)6 b Fd(:)f(:)h(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)19 b Fe(21)0 1831 y Fc(rl)p 42 1831 V 13 w(clear)p
+155 1831 V 13 w(message)s Fd(:)s(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)16 b Fe(25)0 1890 y Fc(rl)p 42 1890 V 13 w(complete)7
+b Fd(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)23
+b Fe(28,)13 b(29)0 1948 y Fc(rl)p 42 1948 V 13 w(complete)p
+215 1948 V 11 w(internal)7 b Fd(:)s(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)19
+b Fe(29)0 2006 y Fc(rl)p 42 2006 V 13 w(completer)p 235 2006
+V 11 w(quote)p 346 2006 V 12 w(characters)f Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)21 b Fe(32)0 2064
+y Fc(rl)p 42 2064 V 13 w(completer)p 235 2064 V 11 w(word)p
+326 2064 V 13 w(break)p 439 2064 V 12 w(character)o(s)15 b
+Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b
+Fe(31)0 2122 y Fc(rl)p 42 2122 V 13 w(completion)p 254 2122
+V 11 w(entry)p 366 2122 V 12 w(function)c Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(29,)c(30)0 2180 y Fc(rl)p
+42 2180 V 13 w(completion)p 254 2180 V 11 w(query)p 366 2180
+V 12 w(items)j Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b Fe(30)0 2238 y Fc(rl)p
+42 2238 V 13 w(copy)p 135 2238 V 13 w(keymap)6 b Fd(:)s(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)18 b Fe(20)0 2296
+y Fc(rl)p 42 2296 V 13 w(copy)p 135 2296 V 13 w(text)8 b Fd(:)d(:)h(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)21
+b Fe(25)0 2355 y Fc(rl)p 42 2355 V 13 w(delete)p 175 2355 V
+12 w(text)6 b Fd(:)t(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)18 b Fe(25)0 2413 y Fc(rl)p 42 2413 V 13 w(discard)p
+195 2413 V 12 w(keymap)8 b Fd(:)e(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)23 b Fe(20)0 2471 y Fc(rl)p 42 2471 V 13 w(do)p 95 2471
+V 14 w(undo)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(24)0 2529 y Fc(rl)p 42 2529
+V 13 w(done)17 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)18 b Fe(18)0 2587 y
+Fc(rl)p 42 2587 V 13 w(end)h Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)19 b
+Fe(18)0 2645 y Fc(rl)p 42 2645 V 13 w(end)p 115 2645 V 13 w(undo)p
+208 2645 V 13 w(group)5 b Fd(:)t(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)17 b Fe(23)1015 158 y Fc(rl)p 1057 158 V 14 w(filename)p
+1231 158 V 11 w(completio)o(n)p 1441 158 V 11 w(desired)g Fd(:)7
+b(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)20
+b Fe(31)1015 216 y Fc(rl)p 1057 216 V 14 w(filename)p 1231
+216 V 11 w(quoting)p 1382 216 V 11 w(desired)h Fd(:)7 b(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)24 b
+Fe(31)1015 275 y Fc(rl)p 1057 275 V 14 w(forced)p 1191 275
+V 12 w(update)p 1323 275 V 11 w(display)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)
+g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)17
+b Fe(24)1015 333 y Fc(rl)p 1057 333 V 14 w(function)p 1231
+333 V 11 w(of)p 1282 333 V 13 w(keyseq)8 b Fd(:)t(:)e(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)21 b Fe(22)1015 391 y Fc(rl)p 1057 391 V 14 w(generic)p
+1211 391 V 11 w(bind)t Fd(:)5 b(:)h(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)18 b Fe(22)1015 449 y Fc(rl)p 1057 449 V 14
+w(get)p 1131 449 V 13 w(keymap)7 b Fd(:)t(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)20 b Fe(21)1015 507 y Fc(rl)p
+1057 507 V 14 w(get)p 1131 507 V 13 w(keymap)p 1264 507 V 12
+w(by)p 1316 507 V 13 w(name)9 b Fd(:)d(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)24
+b Fe(21)1015 565 y Fc(rl)p 1057 565 V 14 w(ignore)p 1191 565
+V 12 w(completio)o(n)p 1402 565 V 11 w(duplicate)o(s)16 b Fd(:)6
+b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)19
+b Fe(31)1015 623 y Fc(rl)p 1057 623 V 14 w(ignore)p 1191 623
+V 12 w(some)p 1283 623 V 12 w(completion)o(s)p 1514 623 V 11
+w(function)13 b Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17
+b Fe(31)1015 681 y Fc(rl)p 1057 681 V 14 w(insert)p 1191 681
+V 12 w(completio)o(ns)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19
+b Fe(29)1015 739 y Fc(rl)p 1057 739 V 14 w(insert)p 1191 739
+V 12 w(text)6 b Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)19 b Fe(25)1015 798 y Fc(rl)p 1057 798 V 14 w(instream)f
+Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)22 b Fe(19)1015 856 y Fc(rl)p 1057 856 V 14 w(invoking)p
+1231 856 V 11 w(keyseqs)8 b Fd(:)s(:)e(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21
+b Fe(22)1015 914 y Fc(rl)p 1057 914 V 14 w(invoking)p 1231
+914 V 11 w(keyseqs)p 1382 914 V 11 w(in)p 1433 914 V 14 w(map)t
+Fd(:)5 b(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)18 b Fe(22)1015 972 y Fc(rl)p 1057 972 V
+14 w(kill)p 1151 972 V 12 w(text)8 b Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)21 b Fe(25)1015 1030
+y Fc(rl)p 1057 1030 V 14 w(line)p 1151 1030 V 12 w(buffer)e
+Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)21
+b Fe(18)1015 1088 y Fc(rl)p 1057 1088 V 14 w(make)p 1151 1088
+V 12 w(bare)p 1243 1088 V 13 w(keymap)8 b Fd(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)24 b Fe(20)1015 1146 y Fc(rl)p 1057 1146 V 14 w(make)p
+1151 1146 V 12 w(keymap)6 b Fd(:)t(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)19 b Fe(20)1015 1204 y Fc(rl)p 1057 1204
+V 14 w(mark)e Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(18)1015 1263 y Fc(rl)p
+1057 1263 V 14 w(message)8 b Fd(:)s(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)21 b Fe(24)1015 1321
+y Fc(rl)p 1057 1321 V 14 w(modifying)t Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(24)1015
+1379 y Fc(rl)p 1057 1379 V 14 w(named)p 1171 1379 V 12 w(function)7
+b Fd(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)24 b
+Fe(22)1015 1437 y Fc(rl)p 1057 1437 V 14 w(on)p 1111 1437 V
+13 w(new)p 1184 1437 V 13 w(line)8 b Fd(:)d(:)h(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(24)1015 1495 y Fc(rl)p
+1057 1495 V 14 w(outstream)17 b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)21 b Fe(19)1015 1553 y Fc(rl)p
+1057 1553 V 14 w(parse)p 1171 1553 V 12 w(and)p 1243 1553 V
+13 w(bind)5 b Fd(:)t(:)h(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18
+b Fe(22)1015 1611 y Fc(rl)p 1057 1611 V 14 w(pending)p 1211
+1611 V 11 w(input)e Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)19 b Fe(19)1015 1669 y Fc(rl)p 1057 1669 V 14 w(point)c
+Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)17 b Fe(18)1015 1727 y Fc(rl)p 1057 1727
+V 14 w(possible)p 1231 1727 V 11 w(completio)o(ns)8 b Fd(:)e(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)25 b Fe(29)1015 1786 y Fc(rl)p 1057 1786 V 14 w(prompt)d
+Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)25 b Fe(19)1015 1844 y Fc(rl)p 1057 1844 V 14 w(readline)p
+1231 1844 V 11 w(name)16 b Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)19 b Fe(19)1015 1902 y Fc(rl)p 1057 1902 V 14 w(redisplay)t
+Fd(:)t(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)19 b Fe(24)1015 1960 y Fc(rl)p 1057 1960 V 14 w(reset)p
+1171 1960 V 12 w(line)p 1263 1960 V 13 w(state)8 b Fd(:)e(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)24 b Fe(24)1015 2018 y Fc(rl)p 1057 2018
+V 14 w(reset)p 1171 2018 V 12 w(terminal)7 b Fd(:)f(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(25)1015 2076 y Fc(rl)p 1057
+2076 V 14 w(set)p 1131 2076 V 13 w(keymap)7 b Fd(:)t(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)20 b Fe(21)1015
+2134 y Fc(rl)p 1057 2134 V 14 w(special)p 1211 2134 V 11 w(prefixes)g
+Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)23 b Fe(31)1015
+2192 y Fc(rl)p 1057 2192 V 14 w(startup)p 1211 2192 V 11 w(hook)18
+b Fd(:)6 b(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20
+b Fe(19)1015 2250 y Fc(rl)p 1057 2250 V 14 w(terminal)p 1231
+2250 V 11 w(name)c Fd(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)19 b Fe(19)1015 2309 y Fc(rl)p 1057 2309 V 14 w(unbind)p
+1191 2309 V 12 w(key)7 b Fd(:)e(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)20 b Fe(21)1015 2367 y Fc(rl)p 1057
+2367 V 14 w(unbind)p 1191 2367 V 12 w(key)p 1263 2367 V 13
+w(in)p 1316 2367 V 13 w(map)t Fd(:)t(:)6 b(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+17 b Fe(21)1015 2521 y Fm(S)1015 2587 y Fc(self-insert)9 b(\(a,)j(b,)g(A,)g
+(1,)g(!,)g(...\))6 b Fd(:)f(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)19 b Fe(10)1015 2645 y(sho)o(w-all-if-am)o(bigu)q(ous)9
+b Fd(:)g(:)d(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(6)p
+eop
+%%Page: 47 49
+48 bop 0 -83 a Fo(F)l(unction)16 b(and)f(V)l(ariable)i(Index)1337
+b(47)0 158 y Fc(start-kbd-)o(ma)o(cro)9 b(\(C-x)i(\(\))t Fd(:)6
+b(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(12)0 266 y Fm(T)0 333 y Fc(tab-insert)9
+b(\(M-TAB\))e Fd(:)s(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)20
+b Fe(10)0 391 y Fc(tilde-expa)o(nd)9 b(\(M-~\))e Fd(:)t(:)f(:)g(:)h(:)f(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)20 b Fe(13)0 449 y Fc(to)p 42 449 12
+2 v 13 w(lower)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 b Fe(26)0 507 y Fc(to)p
+42 507 V 13 w(upper)9 b Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)23 b Fe(26)0 565 y Fc(transpose-)o(ch)
+o(ars)9 b(\(C-t\))s Fd(:)t(:)d(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)16
+b Fe(10)0 623 y Fc(transpose-)o(wo)o(rds)9 b(\(M-t\))s Fd(:)t(:)d(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)16 b Fe(10)0 731 y Fm(U)0 798 y Fc(undo)11 b(\(C-)p
+153 798 V 13 w(,)i(C-x)e(C-u\))c Fd(:)e(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)20 b Fe(13)1015 158 y Fc(universal-a)o(rg)o(ume)o(nt)9
+b(\(\))s Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)16 b Fe(12)1015
+216 y Fc(unix-line-d)o(is)o(car)o(d)10 b(\(C-u\))f Fd(:)t(:)d(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)22
+b Fe(11)1015 275 y Fc(unix-word-r)o(ub)o(out)9 b(\(C-w\))g
+Fd(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)24 b Fe(11)1015 333 y Fc(upcase-word)9
+b(\(M-u\))f Fd(:)t(:)f(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)
+g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22
+b Fe(10)1015 391 y Fc(uppercase)p 1197 391 V 11 w(p)7 b Fd(:)f(:)g(:)g(:)g(:)
+g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)20
+b Fe(26)1015 449 y Fc(username)p 1177 449 V 12 w(completi)o(on)p
+1388 449 V 11 w(function)5 b Fd(:)s(:)h(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)18 b Fe(30)1015 557 y Fm(Y)1015
+623 y Fc(yank)12 b(\(C-y\))d Fd(:)t(:)d(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)22 b Fe(11)1015 681
+y Fc(yank-last-a)o(rg)9 b(\(M-.,)i(M-)p 1436 681 V 13 w(\))6
+b Fd(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)g(:)g(:)g(:)g(:)g(:)g(:)19 b Fe(10)1015 739 y Fc(yank-nth-ar)o(g)10
+b(\(M-C-y\))t Fd(:)s(:)d(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)18 b
+Fe(10)1015 798 y Fc(yank-pop)10 b(\(M-y\))t Fd(:)t(:)c(:)g(:)g(:)g(:)g(:)g(:)
+g(:)g(:)h(:)f(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)g(:)17 b Fe(11)p eop
+%%Page: 48 50
+49 bop 0 -83 a Fo(48)1449 b(GNU)15 b(Readline)i(Library)p eop
+%%Page: -1 51
+50 bop 1937 -83 a Fo(i)0 158 y Fk(T)-7 b(able)15 b(of)g(Con)n(ten)n(ts)0
+333 y Fm(1)67 b(Command)22 b(Line)i(Editing)13 b Fb(:)f(:)e(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)36 b Fm(1)149 411 y Fo(1.1)45 b(In)o(tro)q(duction)16
+b(to)f(Line)h(Editing)5 b Fa(:)k(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)20 b Fo(1)149 473 y(1.2)45 b(Readline)17
+b(In)o(teraction)6 b Fa(:)i(:)g(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)21
+b Fo(1)299 535 y(1.2.1)44 b(Readline)17 b(Bare)e(Essen)o(tials)f
+Fa(:)7 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)27
+b Fo(2)299 597 y(1.2.2)44 b(Readline)17 b(Mo)o(v)o(emen)o(t)d(Commands)f
+Fa(:)7 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)27 b Fo(2)299 660 y(1.2.3)44
+b(Readline)17 b(Killing)h(Commands)9 b Fa(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)23 b Fo(3)299 722 y(1.2.4)44 b(Readline)17 b(Argumen)o(ts)5
+b Fa(:)i(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)19 b Fo(4)149 784 y(1.3)45 b(Readline)17 b(Init)g(File)d
+Fa(:)8 b(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)28 b Fo(4)299
+846 y(1.3.1)44 b(Readline)17 b(Init)f(Syn)o(tax)11 b Fa(:)d(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)25 b Fo(4)299
+909 y(1.3.2)44 b(Conditional)16 b(Init)g(Constructs)d Fa(:)7
+b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)27 b Fo(7)149 971 y(1.4)45
+b(Bindable)17 b(Readline)h(Commands)9 b Fa(:)e(:)g(:)g(:)g(:)g(:)h(:)f(:)g(:)
+g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)23 b Fo(8)299 1033 y(1.4.1)44
+b(Commands)14 b(F)l(or)h(Mo)o(ving)t Fa(:)7 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)18 b Fo(8)299 1095 y(1.4.2)44 b(Commands)14
+b(F)l(or)h(Manipulating)i(The)e(History)9 b Fa(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)
+g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)23 b Fo(9)299 1158 y(1.4.3)44
+b(Commands)14 b(F)l(or)h(Changing)h(T)l(ext)10 b Fa(:)c(:)i(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)25 b Fo(10)299 1220 y(1.4.4)44 b(Killing)18 b(And)e(Y)l(anking)10
+b Fa(:)e(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)25
+b Fo(11)299 1282 y(1.4.5)44 b(Sp)q(ecifying)17 b(Numeric)f(Argumen)o(ts)8
+b Fa(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)22 b Fo(12)299 1345 y(1.4.6)44
+b(Letting)15 b(Readline)j(T)o(yp)q(e)d(F)l(or)g(Y)l(ou)5 b
+Fa(:)i(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)
+g(:)g(:)g(:)h(:)f(:)g(:)g(:)20 b Fo(12)299 1407 y(1.4.7)44
+b(Keyb)q(oard)15 b(Macros)9 b Fa(:)e(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)24 b Fo(12)299 1469 y(1.4.8)44
+b(Some)15 b(Miscellaneous)i(Commands)11 b Fa(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)27
+b Fo(13)149 1531 y(1.5)45 b(Readline)17 b(vi)f(Mo)q(de)d Fa(:)7
+b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)27 b Fo(13)0 1656 y Fm(2)67
+b(Programming)23 b(with)g(GNU)f(Readline)d Fb(:)10 b(:)g(:)g(:)h(:)f(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)41 b Fm(15)149 1734 y Fo(2.1)k(Basic)16
+b(Beha)o(vior)9 b Fa(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)23
+b Fo(15)149 1796 y(2.2)45 b(Custom)14 b(F)l(unctions)6 b Fa(:)j(:)e(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)21 b Fo(17)299 1858 y(2.2.1)44 b(The)15
+b(F)l(unction)h(T)o(yp)q(e)e Fa(:)7 b(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)g(:)28 b Fo(17)299 1920 y(2.2.2)44 b(W)l(riting)16
+b(a)e(New)i(F)l(unction)6 b Fa(:)h(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)
+h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)20 b Fo(18)149 1983 y(2.3)45 b(Readline)17 b(Con)o(v)o(enience)g(F)l
+(unctions)8 b Fa(:)g(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)23
+b Fo(19)299 2045 y(2.3.1)44 b(Naming)15 b(a)g(F)l(unction)t
+Fa(:)9 b(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)19 b Fo(19)299 2107 y(2.3.2)44 b(Selecting)17 b(a)e(Keymap)8
+b Fa(:)g(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)23
+b Fo(20)299 2170 y(2.3.3)44 b(Binding)17 b(Keys)11 b Fa(:)d(:)f(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)26
+b Fo(21)299 2232 y(2.3.4)44 b(Asso)q(ciating)16 b(F)l(unction)g(Names)f(and)g
+(Bindings)7 b Fa(:)i(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)22
+b Fo(22)299 2294 y(2.3.5)44 b(Allo)o(wing)16 b(Undoing)7 b
+Fa(:)i(:)e(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)
+g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)22 b Fo(23)299 2356 y(2.3.6)44 b(Redispla)o(y)9 b Fa(:)f(:)g(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)23 b Fo(24)299 2419 y(2.3.7)44 b(Mo)q(difying)16
+b(T)l(ext)11 b Fa(:)d(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h
+(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)26 b Fo(25)299 2481 y(2.3.8)44 b(Utilit)o(y)16
+b(F)l(unctions)7 b Fa(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)22 b Fo(25)299 2543 y(2.3.9)44 b(An)15
+b(Example)c Fa(:)d(:)g(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)
+g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)26 b Fo(26)149 2605 y(2.4)45
+b(Custom)14 b(Completers)c Fa(:)e(:)f(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)25
+b Fo(28)p eop
+%%Page: -2 52
+51 bop 0 -83 a Fo(ii)1471 b(GNU)15 b(Readline)i(Library)299
+17 y(2.4.1)44 b(Ho)o(w)14 b(Completing)i(W)l(orks)10 b Fa(:)c(:)i(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)24 b Fo(28)299 79 y(2.4.2)44
+b(Completion)16 b(F)l(unctions)7 b Fa(:)h(:)f(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g
+(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)22 b Fo(29)299 141 y(2.4.3)44 b(Completion)16
+b(V)l(ariables)e Fa(:)7 b(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)28 b Fo(30)299 203 y(2.4.4)44 b(A)15 b(Short)g(Completion)h(Example)11
+b Fa(:)d(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)26 b Fo(32)0 328 y Fm(Concept)c(Index)5
+b Fb(:)12 b(:)e(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g
+(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g
+(:)h(:)f(:)g(:)g(:)g(:)h(:)28 b Fm(43)0 468 y(F)-6 b(unction)25
+b(and)d(V)-6 b(ariable)24 b(Index)11 b Fb(:)g(:)f(:)g(:)h(:)f(:)g(:)g(:)h(:)f
+(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)h(:)f(:)g(:)g(:)h(:)f(:)g(:)g(:)g(:)34
+b Fm(45)p eop
+%%Trailer
+end
+userdict /end-hook known{end-hook}if
+%%EOF
diff --git a/doc/rlman.texinfo b/doc/rlman.texinfo
new file mode 100644
index 0000000..ec14066
--- /dev/null
+++ b/doc/rlman.texinfo
@@ -0,0 +1,111 @@
+\input texinfo    @c -*-texinfo-*-
+@comment %**start of header (This is for running Texinfo on a region.)
+@setfilename readline.info
+@settitle GNU Readline Library
+@comment %**end of header (This is for running Texinfo on a region.)
+@synindex vr fn
+@setchapternewpage odd
+
+@ignore
+last change: Thu Jul 21 16:02:40 EDT 1994
+@end ignore
+
+@set EDITION 2.0
+@set VERSION 2.0
+@set UPDATED 21 July 1994
+@set UPDATE-MONTH July 1994
+
+@ifinfo
+This document describes the GNU Readline Library, a utility which aids
+in the consistency of user interface across discrete programs that need
+to provide a command line interface.
+
+Copyright (C) 1988, 1991 Free Software Foundation, Inc.
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+pare preserved on all copies.
+
+@ignore
+Permission is granted to process this file through TeX and print the
+results, provided the printed document carries copying permission
+notice identical to this one except for the removal of this paragraph
+(this paragraph not being relevant to the printed manual).
+@end ignore
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided that the entire
+resulting derived work is distributed under the terms of a permission
+notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions,
+except that this permission notice may be stated in a translation approved
+by the Foundation.
+@end ifinfo
+
+@titlepage  
+@sp 10
+@title GNU Readline Library
+@subtitle Edition @value{EDITION}, for @code{Readline Library} Version @value{VERSION}.
+@subtitle @value{UPDATE-MONTH}
+@author Brian Fox, Free Software Foundation
+@author Chet Ramey, Case Western Reserve University
+
+@page
+This document describes the GNU Readline Library, a utility which aids
+in the consistency of user interface across discrete programs that need
+to provide a command line interface.
+
+Published by the Free Software Foundation @*
+675 Massachusetts Avenue, @*
+Cambridge, MA 02139 USA
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+are preserved on all copies.
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided that the entire
+resulting derived work is distributed under the terms of a permission
+notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions,
+except that this permission notice may be stated in a translation approved
+by the Foundation.
+
+@vskip 0pt plus 1filll
+Copyright @copyright{} 1989, 1991 Free Software Foundation, Inc.
+@end titlepage
+
+@ifinfo
+@node Top
+@top GNU Readline Library
+
+This document describes the GNU Readline Library, a utility which aids
+in the consistency of user interface across discrete programs that need
+to provide a command line interface.
+
+@menu
+* Command Line Editing::	   GNU Readline User's Manual.
+* Programming with GNU Readline::  GNU Readline Programmer's Manual.
+* Concept Index::		   Index of concepts described in this manual.
+* Function and Variable Index::	   Index of externally visible functions
+				   and variables.
+@end menu
+@end ifinfo
+
+@include rluser.texinfo
+@include rltech.texinfo
+
+@node Concept Index
+@unnumbered Concept Index
+@printindex cp
+
+@node Function and Variable Index
+@unnumbered Function and Variable Index
+@printindex fn
+
+@contents
+@bye
diff --git a/doc/rltech.texinfo b/doc/rltech.texinfo
new file mode 100644
index 0000000..f24ac1f
--- /dev/null
+++ b/doc/rltech.texinfo
@@ -0,0 +1,1356 @@
+@comment %**start of header (This is for running Texinfo on a region.)
+@setfilename rltech.info
+@comment %**end of header (This is for running Texinfo on a region.)
+@setchapternewpage odd
+
+@ifinfo
+This document describes the GNU Readline Library, a utility for aiding
+in the consitency of user interface across discrete programs that need
+to provide a command line interface.
+
+Copyright (C) 1988, 1994 Free Software Foundation, Inc.
+
+Permission is granted to make and distribute verbatim copies of
+this manual provided the copyright notice and this permission notice
+pare preserved on all copies.
+
+@ignore
+Permission is granted to process this file through TeX and print the
+results, provided the printed document carries copying permission
+notice identical to this one except for the removal of this paragraph
+(this paragraph not being relevant to the printed manual).
+@end ignore
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided that the entire
+resulting derived work is distributed under the terms of a permission
+notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions,
+except that this permission notice may be stated in a translation approved
+by the Foundation.
+@end ifinfo
+
+@node Programming with GNU Readline
+@chapter Programming with GNU Readline
+
+This chapter describes the interface between the GNU Readline Library and
+other programs.  If you are a programmer, and you wish to include the
+features found in GNU Readline
+such as completion, line editing, and interactive history manipulation
+in your own programs, this section is for you.
+
+@menu
+* Basic Behavior::	Using the default behavior of Readline.
+* Custom Functions::	Adding your own functions to Readline.
+* Readline Convenience Functions::	Functions which Readline supplies to
+					aid in writing your own
+* Custom Completers::	Supplanting or supplementing Readline's
+			completion functions.
+@end menu
+
+@node Basic Behavior
+@section Basic Behavior
+
+Many programs provide a command line interface, such as @code{mail},
+@code{ftp}, and @code{sh}.  For such programs, the default behaviour of
+Readline is sufficient.  This section describes how to use Readline in
+the simplest way possible, perhaps to replace calls in your code to
+@code{gets()} or @code{fgets ()}.
+
+@findex readline
+@cindex readline, function
+The function @code{readline ()} prints a prompt and then reads and returns
+a single line of text from the user.  The line @code{readline}
+returns is allocated with @code{malloc ()}; you should @code{free ()}
+the line when you are done with it.  The declaration for @code{readline}
+in ANSI C is
+
+@example
+@code{char *readline (char *@var{prompt});}
+@end example
+
+@noindent
+So, one might say
+@example
+@code{char *line = readline ("Enter a line: ");}
+@end example
+@noindent
+in order to read a line of text from the user.
+The line returned has the final newline removed, so only the
+text remains.
+
+If @code{readline} encounters an @code{EOF} while reading the line, and the
+line is empty at that point, then @code{(char *)NULL} is returned.
+Otherwise, the line is ended just as if a newline had been typed.
+
+If you want the user to be able to get at the line later, (with
+@key{C-p} for example), you must call @code{add_history ()} to save the
+line away in a @dfn{history} list of such lines.
+
+@example
+@code{add_history (line)};
+@end example
+
+@noindent
+For full details on the GNU History Library, see the associated manual.
+
+It is preferable to avoid saving empty lines on the history list, since
+users rarely have a burning need to reuse a blank line.  Here is
+a function which usefully replaces the standard @code{gets ()} library
+function, and has the advantage of no static buffer to overflow:
+
+@example
+/* A static variable for holding the line. */
+static char *line_read = (char *)NULL;
+
+/* Read a string, and return a pointer to it.  Returns NULL on EOF. */
+char *
+rl_gets ()
+@{
+  /* If the buffer has already been allocated, return the memory
+     to the free pool. */
+  if (line_read)
+    @{
+      free (line_read);
+      line_read = (char *)NULL;
+    @}
+
+  /* Get a line from the user. */
+  line_read = readline ("");
+
+  /* If the line has any text in it, save it on the history. */
+  if (line_read && *line_read)
+    add_history (line_read);
+
+  return (line_read);
+@}
+@end example
+
+This function gives the user the default behaviour of @key{TAB}
+completion: completion on file names.  If you do not want Readline to
+complete on filenames, you can change the binding of the @key{TAB} key
+with @code{rl_bind_key ()}.
+
+@example
+@code{int rl_bind_key (int @var{key}, int (*@var{function})());}
+@end example
+
+@code{rl_bind_key ()} takes two arguments: @var{key} is the character that
+you want to bind, and @var{function} is the address of the function to
+call when @var{key} is pressed.  Binding @key{TAB} to @code{rl_insert ()}
+makes @key{TAB} insert itself.
+@code{rl_bind_key ()} returns non-zero if @var{key} is not a valid
+ASCII character code (between 0 and 255).
+
+Thus, to disable the default @key{TAB} behavior, the following suffices:
+@example
+@code{rl_bind_key ('\t', rl_insert);}
+@end example
+
+This code should be executed once at the start of your program; you
+might write a function called @code{initialize_readline ()} which
+performs this and other desired initializations, such as installing
+custom completers (@pxref{Custom Completers}).
+
+@node Custom Functions
+@section Custom Functions
+
+Readline provides many functions for manipulating the text of
+the line, but it isn't possible to anticipate the needs of all
+programs.  This section describes the various functions and variables
+defined within the Readline library which allow a user program to add
+customized functionality to Readline.
+
+@menu
+* The Function Type::	C declarations to make code readable.
+* Function Writing::	Variables and calling conventions.
+@end menu
+
+@node The Function Type
+@subsection The Function Type
+
+For readabilty, we declare a new type of object, called
+@dfn{Function}.  A @code{Function} is a C function which
+returns an @code{int}.  The type declaration for @code{Function} is:
+
+@noindent
+@code{typedef int Function ();}
+
+The reason for declaring this new type is to make it easier to write
+code describing pointers to C functions.  Let us say we had a variable
+called @var{func} which was a pointer to a function.  Instead of the
+classic C declaration
+
+@code{int (*)()func;}
+
+@noindent
+we may write
+
+@code{Function *func;}
+
+@noindent
+Similarly, there are
+
+@example
+typedef void VFunction ();
+typedef char *CPFunction (); @r{and}
+typedef char **CPPFunction ();
+@end example
+
+@noindent
+for functions returning no value, @code{pointer to char}, and
+@code{pointer to pointer to char}, respectively.
+
+@node Function Writing
+@subsection Writing a New Function
+
+In order to write new functions for Readline, you need to know the
+calling conventions for keyboard-invoked functions, and the names of the
+variables that describe the current state of the line read so far.
+
+The calling sequence for a command @code{foo} looks like
+
+@example
+@code{foo (int count, int key)}
+@end example
+
+@noindent
+where @var{count} is the numeric argument (or 1 if defaulted) and
+@var{key} is the key that invoked this function.
+
+It is completely up to the function as to what should be done with the
+numeric argument.  Some functions use it as a repeat count, some
+as a flag, and others to choose alternate behavior (refreshing the current
+line as opposed to refreshing the screen, for example).  Some choose to
+ignore it.  In general, if a
+function uses the numeric argument as a repeat count, it should be able
+to do something useful with both negative and positive arguments.
+At the very least, it should be aware that it can be passed a
+negative argument.
+
+@deftypevar {char *} rl_line_buffer
+This is the line gathered so far.  You are welcome to modify the
+contents of the line, but see @ref{Allowing Undoing}.
+@end deftypevar
+
+@deftypevar int rl_point
+The offset of the current cursor position in @code{rl_line_buffer}
+(the @emph{point}).
+@end deftypevar
+
+@deftypevar int rl_end
+The number of characters present in @code{rl_line_buffer}.  When
+@code{rl_point} is at the end of the line, @code{rl_point} and
+@code{rl_end} are equal.
+@end deftypevar
+
+@deftypevar int rl_mark
+The mark (saved position) in the current line.  If set, the mark
+and point define a @emph{region}.
+@end deftypevar
+
+@deftypevar int rl_done
+Setting this to a non-zero value causes Readline to return the current
+line immediately.
+@end deftypevar
+
+@deftypevar int rl_pending_input
+Setting this to a value makes it the next keystroke read.  This is a
+way to stuff a single character into the input stream.
+@end deftypevar
+
+@deftypevar {char *} rl_prompt
+The prompt Readline uses.  This is set from the argument to
+@code{readline ()}, and should not be assigned to directly.
+@end deftypevar
+
+@deftypevar {char *} rl_terminal_name
+The terminal type, used for initialization.
+@end deftypevar
+
+@deftypevar {char *} rl_readline_name
+This variable is set to a unique name by each application using Readline.
+The value allows conditional parsing of the inputrc file
+(@pxref{Conditional Init Constructs}).
+@end deftypevar
+
+@deftypevar {FILE *} rl_instream
+The stdio stream from which Readline reads input.
+@end deftypevar
+
+@deftypevar {FILE *} rl_outstream
+The stdio stream to which Readline performs output.
+@end deftypevar
+
+@deftypevar {Function *} rl_startup_hook
+If non-zero, this is the address of a function to call just
+before @code{readline} prints the first prompt.
+@end deftypevar
+
+@node Readline Convenience Functions
+@section Readline Convenience Functions
+
+@menu
+* Function Naming::	How to give a function you write a name.
+* Keymaps::		Making keymaps.
+* Binding Keys::	Changing Keymaps.
+* Associating Function Names and Bindings::	Translate function names to
+						key sequences.
+* Allowing Undoing::	How to make your functions undoable.
+* Redisplay::		Functions to control line display.
+* Modifying Text::	Functions to modify @code{rl_line_buffer}.
+* Utility Functions::	Generally useful functions and hooks.
+@end menu
+
+@node Function Naming
+@subsection Naming a Function
+
+The user can dynamically change the bindings of keys while using
+Readline.  This is done by representing the function with a descriptive
+name.  The user is able to type the descriptive name when referring to
+the function.  Thus, in an init file, one might find
+
+@example
+Meta-Rubout:	backward-kill-word
+@end example
+
+This binds the keystroke @key{Meta-Rubout} to the function
+@emph{descriptively} named @code{backward-kill-word}.  You, as the
+programmer, should bind the functions you write to descriptive names as
+well.  Readline provides a function for doing that:
+
+@deftypefun int rl_add_defun (char *name, Function *function, int key)
+Add @var{name} to the list of named functions.  Make @var{function} be
+the function that gets called.  If @var{key} is not -1, then bind it to
+@var{function} using @code{rl_bind_key ()}.
+@end deftypefun
+
+Using this function alone is sufficient for most applications.  It is
+the recommended way to add a few functions to the default functions that
+Readline has built in.  If you need to do something other
+than adding a function to Readline, you may need to use the
+underlying functions described below.
+
+@node Keymaps
+@subsection Selecting a Keymap
+
+Key bindings take place on a @dfn{keymap}.  The keymap is the
+association between the keys that the user types and the functions that
+get run.  You can make your own keymaps, copy existing keymaps, and tell
+Readline which keymap to use.
+
+@deftypefun Keymap rl_make_bare_keymap ()
+Returns a new, empty keymap.  The space for the keymap is allocated with
+@code{malloc ()}; you should @code{free ()} it when you are done.
+@end deftypefun
+
+@deftypefun Keymap rl_copy_keymap (Keymap map)
+Return a new keymap which is a copy of @var{map}.
+@end deftypefun
+
+@deftypefun Keymap rl_make_keymap ()
+Return a new keymap with the printing characters bound to rl_insert,
+the lowercase Meta characters bound to run their equivalents, and
+the Meta digits bound to produce numeric arguments.
+@end deftypefun
+
+@deftypefun void rl_discard_keymap (Keymap keymap)
+Free the storage associated with @var{keymap}.
+@end deftypefun
+
+Readline has several internal keymaps.  These functions allow you to
+change which keymap is active.
+
+@deftypefun Keymap rl_get_keymap ()
+Returns the currently active keymap.
+@end deftypefun
+
+@deftypefun void rl_set_keymap (Keymap keymap)
+Makes @var{keymap} the currently active keymap.
+@end deftypefun
+
+@deftypefun Keymap rl_get_keymap_by_name (char *name)
+Return the keymap matching @var{name}.  @var{name} is one which would
+be supplied in a @code{set keymap} inputrc line (@pxref{Readline Init File}).
+@end deftypefun
+
+@node Binding Keys
+@subsection Binding Keys
+
+You associate keys with functions through the keymap.  Readline has
+several internal keymaps: @code{emacs_standard_keymap},
+@code{emacs_meta_keymap}, @code{emacs_ctlx_keymap},
+@code{vi_movement_keymap}, and @code{vi_insertion_keymap}.
+@code{emacs_standard_keymap} is the default, and the examples in
+this manual assume that.
+
+These functions manage key bindings.
+
+@deftypefun int rl_bind_key (int key, Function *function)
+Binds @var{key} to @var{function} in the currently active keymap.
+Returns non-zero in the case of an invalid @var{key}.
+@end deftypefun
+
+@deftypefun int rl_bind_key_in_map (int key, Function *function, Keymap map)
+Bind @var{key} to @var{function} in @var{map}.  Returns non-zero in the case
+of an invalid @var{key}.
+@end deftypefun
+
+@deftypefun int rl_unbind_key (int key)
+Bind @var{key} to the null function in the currently active keymap.
+Returns non-zero in case of error.
+@end deftypefun
+
+@deftypefun int rl_unbind_key_in_map (int key, Keymap map)
+Bind @var{key} to the null function in @var{map}.
+Returns non-zero in case of error.
+@end deftypefun
+
+@deftypefun int rl_generic_bind (int type, char *keyseq, char *data, Keymap map)
+Bind the key sequence represented by the string @var{keyseq} to the arbitrary
+pointer @var{data}.  @var{type} says what kind of data is pointed to by
+@var{data}; this can be a function (@code{ISFUNC}), a macro
+(@code{ISMACR}), or a keymap (@code{ISKMAP}).  This makes new keymaps as
+necessary.  The initial keymap in which to do bindings is @var{map}.
+@end deftypefun
+
+@deftypefun int rl_parse_and_bind (char *line)
+Parse @var{line} as if it had been read from the @code{inputrc} file and
+perform any key bindings and variable assignments found
+(@pxref{Readline Init File}).
+@end deftypefun
+
+@node Associating Function Names and Bindings
+@subsection Associating Function Names and Bindings
+
+These functions allow you to find out what keys invoke named functions
+and the functions invoked by a particular key sequence.
+
+@deftypefun {Function *} rl_named_function (char *name)
+Return the function with name @var{name}.
+@end deftypefun
+
+@deftypefun {Function *} rl_function_of_keyseq (char *keyseq, Keymap map, int *type)
+Return the function invoked by @var{keyseq} in keymap @var{map}.
+If @var{map} is NULL, the current keymap is used.  If @var{type} is
+not NULL, the type of the object is returned in it (one of @code{ISFUNC},
+@code{ISKMAP}, or @code{ISMACR}).
+@end deftypefun
+
+@deftypefun {char **} rl_invoking_keyseqs (Function *function)
+Return an array of strings representing the key sequences used to
+invoke @var{function} in the current keymap.
+@end deftypefun
+
+@deftypefun {char **} rl_invoking_keyseqs_in_map (Function *function, Keymap map)
+Return an array of strings representing the key sequences used to
+invoke @var{function} in the keymap @var{map}.
+@end deftypefun
+
+@node Allowing Undoing
+@subsection Allowing Undoing
+
+Supporting the undo command is a painless thing, and makes your
+functions much more useful.  It is certainly easy to try
+something if you know you can undo it.  I could use an undo function for
+the stock market.
+
+If your function simply inserts text once, or deletes text once, and
+uses @code{rl_insert_text ()} or @code{rl_delete_text ()} to do it, then
+undoing is already done for you automatically.
+
+If you do multiple insertions or multiple deletions, or any combination
+of these operations, you should group them together into one operation.
+This is done with @code{rl_begin_undo_group ()} and
+@code{rl_end_undo_group ()}.
+
+The types of events that can be undone are:
+
+@example
+enum undo_code @{ UNDO_DELETE, UNDO_INSERT, UNDO_BEGIN, UNDO_END @}; 
+@end example
+
+Notice that @code{UNDO_DELETE} means to insert some text, and
+@code{UNDO_INSERT} means to delete some text.  That is, the undo code
+tells undo what to undo, not how to undo it.  @code{UNDO_BEGIN} and
+@code{UNDO_END} are tags added by @code{rl_begin_undo_group ()} and
+@code{rl_end_undo_group ()}.
+
+@deftypefun int rl_begin_undo_group ()
+Begins saving undo information in a group construct.  The undo
+information usually comes from calls to @code{rl_insert_text ()} and
+@code{rl_delete_text ()}, but could be the result of calls to
+@code{rl_add_undo ()}.
+@end deftypefun
+
+@deftypefun int rl_end_undo_group ()
+Closes the current undo group started with @code{rl_begin_undo_group
+()}.  There should be one call to @code{rl_end_undo_group ()}
+for each call to @code{rl_begin_undo_group ()}.
+@end deftypefun
+
+@deftypefun void rl_add_undo (enum undo_code what, int start, int end, char *text)
+Remember how to undo an event (according to @var{what}).  The affected
+text runs from @var{start} to @var{end}, and encompasses @var{text}.
+@end deftypefun
+
+@deftypefun void free_undo_list ()
+Free the existing undo list.
+@end deftypefun
+
+@deftypefun int rl_do_undo ()
+Undo the first thing on the undo list.  Returns @code{0} if there was
+nothing to undo, non-zero if something was undone.
+@end deftypefun
+
+Finally, if you neither insert nor delete text, but directly modify the
+existing text (e.g., change its case), call @code{rl_modifying ()}
+once, just before you modify the text.  You must supply the indices of
+the text range that you are going to modify.
+
+@deftypefun int rl_modifying (int start, int end)
+Tell Readline to save the text between @var{start} and @var{end} as a
+single undo unit.  It is assumed that you will subsequently modify
+that text.
+@end deftypefun
+
+@node Redisplay
+@subsection Redisplay
+
+@deftypefun int rl_redisplay ()
+Change what's displayed on the screen to reflect the current contents
+of @code{rl_line_buffer}.
+@end deftypefun
+
+@deftypefun int rl_forced_update_display ()
+Force the line to be updated and redisplayed, whether or not
+Readline thinks the screen display is correct.
+@end deftypefun
+
+@deftypefun int rl_on_new_line ()
+Tell the update routines that we have moved onto a new (empty) line,
+usually after ouputting a newline.
+@end deftypefun
+
+@deftypefun int rl_reset_line_state ()
+Reset the display state to a clean state and redisplay the current line
+starting on a new line.
+@end deftypefun
+
+@deftypefun int rl_message (va_alist)
+The arguments are a string as would be supplied to @code{printf}.  The
+resulting string is displayed in the @dfn{echo area}.  The echo area
+is also used to display numeric arguments and search strings.
+@end deftypefun
+
+@deftypefun int rl_clear_message ()
+Clear the message in the echo area.
+@end deftypefun
+
+@node Modifying Text
+@subsection Modifying Text
+
+@deftypefun int rl_insert_text (char *text)
+Insert @var{text} into the line at the current cursor position.
+@end deftypefun
+
+@deftypefun int rl_delete_text (int start, int end)
+Delete the text between @var{start} and @var{end} in the current line.
+@end deftypefun
+
+@deftypefun {char *} rl_copy_text (int start, int end)
+Return a copy of the text between @var{start} and @var{end} in
+the current line.
+@end deftypefun
+
+@deftypefun int rl_kill_text (int start, int end)
+Copy the text between @var{start} and @var{end} in the current line
+to the kill ring, appending or prepending to the last kill if the
+last command was a kill command.  The text is deleted.
+If @var{start} is less than @var{end},
+the text is appended, otherwise prepended.  If the last command was
+not a kill, a new kill ring slot is used.
+@end deftypefun
+
+@node Utility Functions
+@subsection Utility Functions
+
+@deftypefun int rl_reset_terminal (char *terminal_name)
+Reinitialize Readline's idea of the terminal settings using
+@var{terminal_name} as the terminal type (e.g., @code{vt100}).
+@end deftypefun
+
+@deftypefun int alphabetic (int c)
+Return 1 if @var{c} is an alphabetic character.
+@end deftypefun
+
+@deftypefun int numeric (int c)
+Return 1 if @var{c} is a numeric character.
+@end deftypefun
+
+@deftypefun int ding ()
+Ring the terminal bell, obeying the setting of @code{bell-style}.
+@end deftypefun
+
+The following are implemented as macros, defined in @code{chartypes.h}.
+
+@deftypefun int uppercase_p (int c)
+Return 1 if @var{c} is an uppercase alphabetic character.
+@end deftypefun
+
+@deftypefun int lowercase_p (int c)
+Return 1 if @var{c} is a lowercase alphabetic character.
+@end deftypefun
+
+@deftypefun int digit_p (int c)
+Return 1 if @var{c} is a numeric character.
+@deftypefun
+
+@deftypefun int to_upper (int c)
+If @var{c} is a lowercase alphabetic character, return the corresponding
+uppercase character.
+@end deftypefun
+
+@deftypefun int to_lower (int c)
+If @var{c} is an uppercase alphabetic character, return the corresponding
+lowercase character.
+@end deftypefun
+
+@deftypefun int digit_value (int c)
+If @var{c} is a number, return the value it represents.
+@end deftypefun
+
+@subsection An Example
+
+Here is a function which changes lowercase characters to their uppercase
+equivalents, and uppercase characters to lowercase.  If
+this function was bound to @samp{M-c}, then typing @samp{M-c} would
+change the case of the character under point.  Typing @samp{M-1 0 M-c}
+would change the case of the following 10 characters, leaving the cursor on
+the last character changed.
+
+@example
+/* Invert the case of the COUNT following characters. */
+int
+invert_case_line (count, key)
+     int count, key;
+@{
+  register int start, end, i;
+
+  start = rl_point;
+
+  if (rl_point >= rl_end)
+    return (0);
+
+  if (count < 0)
+    @{
+      direction = -1;
+      count = -count;
+    @}
+  else
+    direction = 1;
+      
+  /* Find the end of the range to modify. */
+  end = start + (count * direction);
+
+  /* Force it to be within range. */
+  if (end > rl_end)
+    end = rl_end;
+  else if (end < 0)
+    end = 0;
+
+  if (start == end)
+    return (0);
+
+  if (start > end)
+    @{
+      int temp = start;
+      start = end;
+      end = temp;
+    @}
+
+  /* Tell readline that we are modifying the line, so it will save
+     the undo information. */
+  rl_modifying (start, end);
+
+  for (i = start; i != end; i++)
+    @{
+      if (uppercase_p (rl_line_buffer[i]))
+        rl_line_buffer[i] = to_lower (rl_line_buffer[i]);
+      else if (lowercase_p (rl_line_buffer[i]))
+        rl_line_buffer[i] = to_upper (rl_line_buffer[i]);
+    @}
+  /* Move point to on top of the last character changed. */
+  rl_point = (direction == 1) ? end - 1 : start;
+  return (0);
+@}
+@end example
+
+@node Custom Completers
+@section Custom Completers
+
+Typically, a program that reads commands from the user has a way of
+disambiguating commands and data.  If your program is one of these, then
+it can provide completion for commands, data, or both.
+The following sections describe how your program and Readline
+cooperate to provide this service.
+
+@menu
+* How Completing Works::	The logic used to do completion.
+* Completion Functions::	Functions provided by Readline.
+* Completion Variables::	Variables which control completion.
+* A Short Completion Example::	An example of writing completer subroutines.
+@end menu
+
+@node How Completing Works
+@subsection How Completing Works
+
+In order to complete some text, the full list of possible completions
+must be available.  That is, it is not possible to accurately
+expand a partial word without knowing all of the possible words
+which make sense in that context.  The Readline library provides
+the user interface to completion, and two of the most common
+completion functions:  filename and username.  For completing other types
+of text, you must write your own completion function.  This section
+describes exactly what such functions must do, and provides an example.
+
+There are three major functions used to perform completion:
+
+@enumerate
+@item
+The user-interface function @code{rl_complete ()}.  This function is
+called with the same arguments as other Readline
+functions intended for interactive use:  @var{count} and
+@var{invoking_key}.  It isolates the word to be completed and calls
+@code{completion_matches ()} to generate a list of possible completions.
+It then either lists the possible completions, inserts the possible
+completions, or actually performs the
+completion, depending on which behavior is desired.
+
+@item
+The internal function @code{completion_matches ()} uses your
+@dfn{generator} function to generate the list of possible matches, and
+then returns the array of these matches.  You should place the address
+of your generator function in @code{rl_completion_entry_function}.
+
+@item
+The generator function is called repeatedly from
+@code{completion_matches ()}, returning a string each time.  The
+arguments to the generator function are @var{text} and @var{state}.
+@var{text} is the partial word to be completed.  @var{state} is zero the
+first time the function is called, allowing the generator to perform
+any necessary initialization, and a positive non-zero integer for
+each subsequent call.  When the generator function returns
+@code{(char *)NULL} this signals @code{completion_matches ()} that there are
+no more possibilities left.  Usually the generator function computes the
+list of possible completions when @var{state} is zero, and returns them
+one at a time on subsequent calls.  Each string the generator function
+returns as a match must be allocated with @code{malloc()}; Readline
+frees the strings when it has finished with them.
+
+@end enumerate
+
+@deftypefun int rl_complete (int ignore, int invoking_key)
+Complete the word at or before point.  You have supplied the function
+that does the initial simple matching selection algorithm (see
+@code{completion_matches ()}).  The default is to do filename completion.
+@end deftypefun
+
+@deftypevar {Function *} rl_completion_entry_function
+This is a pointer to the generator function for @code{completion_matches
+()}.  If the value of @code{rl_completion_entry_function} is
+@code{(Function *)NULL} then the default filename generator function,
+@code{filename_entry_function ()}, is used.
+@end deftypevar
+
+@node Completion Functions
+@subsection Completion Functions
+
+Here is the complete list of callable completion functions present in
+Readline.
+
+@deftypefun int rl_complete_internal (int what_to_do)
+Complete the word at or before point.  @var{what_to_do} says what to do
+with the completion.  A value of @samp{?} means list the possible
+completions.  @samp{TAB} means do standard completion.  @samp{*} means
+insert all of the possible completions.  @samp{!} means to display
+all of the possible completions, if there is more than one, as well as
+performing partial completion.
+@end deftypefun
+
+@deftypefun int rl_complete (int ignore, int invoking_key)
+Complete the word at or before point.  You have supplied the function
+that does the initial simple matching selection algorithm (see
+@code{completion_matches ()} and @code{rl_completion_entry_function}).
+The default is to do filename
+completion.  This calls @code{rl_complete_internal ()} with an
+argument depending on @var{invoking_key}.
+@end deftypefun
+
+@deftypefun int rl_possible_completions (int count, int invoking_key))
+List the possible completions.  See description of @code{rl_complete
+()}.  This calls @code{rl_complete_internal ()} with an argument of
+@samp{?}.
+@end deftypefun
+
+@deftypefun int rl_insert_completions (int count, int invoking_key))
+Insert the list of possible completions into the line, deleting the
+partially-completed word.  See description of @code{rl_complete ()}.
+This calls @code{rl_complete_internal ()} with an argument of @samp{*}.
+@end deftypefun
+
+@deftypefun {char **} completion_matches (char *text, CPFunction *entry_func)
+Returns an array of @code{(char *)} which is a list of completions for
+@var{text}.  If there are no completions, returns @code{(char **)NULL}.
+The first entry in the returned array is the substitution for @var{text}.
+The remaining entries are the possible completions.  The array is
+terminated with a @code{NULL} pointer.
+
+@var{entry_func} is a function of two args, and returns a
+@code{(char *)}.  The first argument is @var{text}.  The second is a
+state argument; it is zero on the first call, and non-zero on subsequent
+calls.  @var{entry_func} returns a @code{NULL}  pointer to the caller
+when there are no more matches.
+@end deftypefun
+
+@deftypefun {char *} filename_completion_function (char *text, int state)
+A generator function for filename completion in the general case.  Note
+that completion in Bash is a little different because of all
+the pathnames that must be followed when looking up completions for a
+command.  The Bash source is a useful reference for writing custom
+completion functions.
+@end deftypefun
+
+@deftypefun {char *} username_completion_function (char *text, int state)
+A completion generator for usernames.  @var{text} contains a partial
+username preceded by a random character (usually @samp{~}).  As with all
+completion generators, @var{state} is zero on the first call and non-zero
+for subsequent calls.
+@end deftypefun
+
+@node Completion Variables
+@subsection Completion Variables
+
+@deftypevar {Function *} rl_completion_entry_function
+A pointer to the generator function for @code{completion_matches ()}.
+@code{NULL} means to use @code{filename_entry_function ()}, the default
+filename completer.
+@end deftypevar
+
+@deftypevar {CPPFunction *} rl_attempted_completion_function
+A pointer to an alternative function to create matches.
+The function is called with @var{text}, @var{start}, and @var{end}.
+@var{start} and @var{end} are indices in @code{rl_line_buffer} saying
+what the boundaries of @var{text} are.  If this function exists and
+returns @code{NULL}, or if this variable is set to @code{NULL}, then
+@code{rl_complete ()} will call the value of
+@code{rl_completion_entry_function} to generate matches, otherwise the
+array of strings returned will be used.
+@end deftypevar
+
+@deftypevar int rl_completion_query_items
+Up to this many items will be displayed in response to a
+possible-completions call.  After that, we ask the user if she is sure
+she wants to see them all.  The default value is 100.
+@end deftypevar
+
+@deftypevar {char *} rl_basic_word_break_characters
+The basic list of characters that signal a break between words for the
+completer routine.  The default value of this variable is the characters
+which break words for completion in Bash, i.e.,
+@code{" \t\n\"\\'`@@$><=;|&@{("}.
+@end deftypevar
+
+@deftypevar {char *} rl_completer_word_break_characters
+The list of characters that signal a break between words for
+@code{rl_complete_internal ()}.  The default list is the value of
+@code{rl_basic_word_break_characters}.
+@end deftypevar
+
+@deftypevar {char *} rl_special_prefixes
+The list of characters that are word break characters, but should be
+left in @var{text} when it is passed to the completion function.
+Programs can use this to help determine what kind of completing to do.
+For instance, Bash sets this variable to "$@@" so that it can complete
+shell variables and hostnames.
+@end deftypevar
+
+@deftypevar int rl_ignore_completion_duplicates
+If non-zero, then disallow duplicates in the matches.  Default is 1.
+@end deftypevar
+
+@deftypevar int rl_filename_completion_desired
+Non-zero means that the results of the matches are to be treated as
+filenames.  This is @emph{always} zero on entry, and can only be changed
+within a completion entry generator function.  If it is set to a non-zero
+value, directory names have a slash appended and Readline attempts to
+quote completed filenames if they contain any embedded word break
+characters.
+@end deftypevar
+
+@deftypevar int rl_filename_quoting_desired
+Non-zero means that the results of the matches are to be quoted using
+double quotes (or an application-specific quoting mechanism) if the
+completed filename contains any characters in
+@code{rl_completer_word_break_chars}.  This is @emph{always} non-zero
+on entry, and can only be changed within a completion entry generator
+function.
+@end deftypevar
+
+@deftypevar {Function *} rl_ignore_some_completions_function
+This function, if defined, is called by the completer when real filename
+completion is done, after all the matching names have been generated.
+It is passed a @code{NULL} terminated array of matches.
+The first element (@code{matches[0]}) is the
+maximal substring common to all matches. This function can
+re-arrange the list of matches as required, but each element deleted
+from the array must be freed.
+@end deftypevar
+
+@deftypevar {char *} rl_completer_quote_characters
+List of characters which can be used to quote a substring of the line.
+Completion occurs on the entire substring, and within the substring
+@code{rl_completer_word_break_characters} are treated as any other character,
+unless they also appear within this list.
+@end deftypevar
+
+
+@node A Short Completion Example
+@subsection A Short Completion Example
+
+Here is a small application demonstrating the use of the GNU Readline
+library.  It is called @code{fileman}, and the source code resides in
+@file{examples/fileman.c}.  This sample application provides
+completion of command names, line editing features, and access to the
+history list.
+
+@page
+@smallexample
+/* fileman.c -- A tiny application which demonstrates how to use the
+   GNU Readline library.  This application interactively allows users
+   to manipulate files and their modes. */
+
+#include <stdio.h>
+#include <sys/types.h>
+#include <sys/file.h>
+#include <sys/stat.h>
+#include <sys/errno.h>
+
+#include <readline/readline.h>
+#include <readline/history.h>
+
+extern char *getwd ();
+extern char *xmalloc ();
+
+/* The names of functions that actually do the manipulation. */
+int com_list (), com_view (), com_rename (), com_stat (), com_pwd ();
+int com_delete (), com_help (), com_cd (), com_quit ();
+
+/* A structure which contains information on the commands this program
+   can understand. */
+
+typedef struct @{
+  char *name;			/* User printable name of the function. */
+  Function *func;		/* Function to call to do the job. */
+  char *doc;			/* Documentation for this function.  */
+@} COMMAND;
+
+COMMAND commands[] = @{
+  @{ "cd", com_cd, "Change to directory DIR" @},
+  @{ "delete", com_delete, "Delete FILE" @},
+  @{ "help", com_help, "Display this text" @},
+  @{ "?", com_help, "Synonym for `help'" @},
+  @{ "list", com_list, "List files in DIR" @},
+  @{ "ls", com_list, "Synonym for `list'" @},
+  @{ "pwd", com_pwd, "Print the current working directory" @},
+  @{ "quit", com_quit, "Quit using Fileman" @},
+  @{ "rename", com_rename, "Rename FILE to NEWNAME" @},
+  @{ "stat", com_stat, "Print out statistics on FILE" @},
+  @{ "view", com_view, "View the contents of FILE" @},
+  @{ (char *)NULL, (Function *)NULL, (char *)NULL @}
+@};
+
+/* Forward declarations. */
+char *stripwhite ();
+COMMAND *find_command ();
+
+/* The name of this program, as taken from argv[0]. */
+char *progname;
+
+/* When non-zero, this global means the user is done using this program. */
+int done;
+
+char *
+dupstr (s)
+     int s;
+@{
+  char *r;
+
+  r = xmalloc (strlen (s) + 1);
+  strcpy (r, s);
+  return (r);
+@}
+
+main (argc, argv)
+     int argc;
+     char **argv;
+@{
+  char *line, *s;
+
+  progname = argv[0];
+
+  initialize_readline ();	/* Bind our completer. */
+
+  /* Loop reading and executing lines until the user quits. */
+  for ( ; done == 0; )
+    @{
+      line = readline ("FileMan: ");
+
+      if (!line)
+        break;
+
+      /* Remove leading and trailing whitespace from the line.
+         Then, if there is anything left, add it to the history list
+         and execute it. */
+      s = stripwhite (line);
+
+      if (*s)
+        @{
+          add_history (s);
+          execute_line (s);
+        @}
+
+      free (line);
+    @}
+  exit (0);
+@}
+
+/* Execute a command line. */
+int
+execute_line (line)
+     char *line;
+@{
+  register int i;
+  COMMAND *command;
+  char *word;
+
+  /* Isolate the command word. */
+  i = 0;
+  while (line[i] && whitespace (line[i]))
+    i++;
+  word = line + i;
+
+  while (line[i] && !whitespace (line[i]))
+    i++;
+
+  if (line[i])
+    line[i++] = '\0';
+
+  command = find_command (word);
+
+  if (!command)
+    @{
+      fprintf (stderr, "%s: No such command for FileMan.\n", word);
+      return (-1);
+    @}
+
+  /* Get argument to command, if any. */
+  while (whitespace (line[i]))
+    i++;
+
+  word = line + i;
+
+  /* Call the function. */
+  return ((*(command->func)) (word));
+@}
+
+/* Look up NAME as the name of a command, and return a pointer to that
+   command.  Return a NULL pointer if NAME isn't a command name. */
+COMMAND *
+find_command (name)
+     char *name;
+@{
+  register int i;
+
+  for (i = 0; commands[i].name; i++)
+    if (strcmp (name, commands[i].name) == 0)
+      return (&commands[i]);
+
+  return ((COMMAND *)NULL);
+@}
+
+/* Strip whitespace from the start and end of STRING.  Return a pointer
+   into STRING. */
+char *
+stripwhite (string)
+     char *string;
+@{
+  register char *s, *t;
+
+  for (s = string; whitespace (*s); s++)
+    ;
+    
+  if (*s == 0)
+    return (s);
+
+  t = s + strlen (s) - 1;
+  while (t > s && whitespace (*t))
+    t--;
+  *++t = '\0';
+
+  return s;
+@}
+
+/* **************************************************************** */
+/*                                                                  */
+/*                  Interface to Readline Completion                */
+/*                                                                  */
+/* **************************************************************** */
+
+char *command_generator ();
+char **fileman_completion ();
+
+/* Tell the GNU Readline library how to complete.  We want to try to complete
+   on command names if this is the first word in the line, or on filenames
+   if not. */
+initialize_readline ()
+@{
+  /* Allow conditional parsing of the ~/.inputrc file. */
+  rl_readline_name = "FileMan";
+
+  /* Tell the completer that we want a crack first. */
+  rl_attempted_completion_function = (CPPFunction *)fileman_completion;
+@}
+
+/* Attempt to complete on the contents of TEXT.  START and END show the
+   region of TEXT that contains the word to complete.  We can use the
+   entire line in case we want to do some simple parsing.  Return the
+   array of matches, or NULL if there aren't any. */
+char **
+fileman_completion (text, start, end)
+     char *text;
+     int start, end;
+@{
+  char **matches;
+
+  matches = (char **)NULL;
+
+  /* If this word is at the start of the line, then it is a command
+     to complete.  Otherwise it is the name of a file in the current
+     directory. */
+  if (start == 0)
+    matches = completion_matches (text, command_generator);
+
+  return (matches);
+@}
+
+/* Generator function for command completion.  STATE lets us know whether
+   to start from scratch; without any state (i.e. STATE == 0), then we
+   start at the top of the list. */
+char *
+command_generator (text, state)
+     char *text;
+     int state;
+@{
+  static int list_index, len;
+  char *name;
+
+  /* If this is a new word to complete, initialize now.  This includes
+     saving the length of TEXT for efficiency, and initializing the index
+     variable to 0. */
+  if (!state)
+    @{
+      list_index = 0;
+      len = strlen (text);
+    @}
+
+  /* Return the next name which partially matches from the command list. */
+  while (name = commands[list_index].name)
+    @{
+      list_index++;
+
+      if (strncmp (name, text, len) == 0)
+        return (dupstr(name));
+    @}
+
+  /* If no names matched, then return NULL. */
+  return ((char *)NULL);
+@}
+
+/* **************************************************************** */
+/*                                                                  */
+/*                       FileMan Commands                           */
+/*                                                                  */
+/* **************************************************************** */
+
+/* String to pass to system ().  This is for the LIST, VIEW and RENAME
+   commands. */
+static char syscom[1024];
+
+/* List the file(s) named in arg. */
+com_list (arg)
+     char *arg;
+@{
+  if (!arg)
+    arg = "";
+
+  sprintf (syscom, "ls -FClg %s", arg);
+  return (system (syscom));
+@}
+
+com_view (arg)
+     char *arg;
+@{
+  if (!valid_argument ("view", arg))
+    return 1;
+
+  sprintf (syscom, "more %s", arg);
+  return (system (syscom));
+@}
+
+com_rename (arg)
+     char *arg;
+@{
+  too_dangerous ("rename");
+  return (1);
+@}
+
+com_stat (arg)
+     char *arg;
+@{
+  struct stat finfo;
+
+  if (!valid_argument ("stat", arg))
+    return (1);
+
+  if (stat (arg, &finfo) == -1)
+    @{
+      perror (arg);
+      return (1);
+    @}
+
+  printf ("Statistics for `%s':\n", arg);
+
+  printf ("%s has %d link%s, and is %d byte%s in length.\n", arg,
+          finfo.st_nlink,
+          (finfo.st_nlink == 1) ? "" : "s",
+          finfo.st_size,
+          (finfo.st_size == 1) ? "" : "s");
+  printf ("Inode Last Change at: %s", ctime (&finfo.st_ctime));
+  printf ("      Last access at: %s", ctime (&finfo.st_atime));
+  printf ("    Last modified at: %s", ctime (&finfo.st_mtime));
+  return (0);
+@}
+
+com_delete (arg)
+     char *arg;
+@{
+  too_dangerous ("delete");
+  return (1);
+@}
+
+/* Print out help for ARG, or for all of the commands if ARG is
+   not present. */
+com_help (arg)
+     char *arg;
+@{
+  register int i;
+  int printed = 0;
+
+  for (i = 0; commands[i].name; i++)
+    @{
+      if (!*arg || (strcmp (arg, commands[i].name) == 0))
+        @{
+          printf ("%s\t\t%s.\n", commands[i].name, commands[i].doc);
+          printed++;
+        @}
+    @}
+
+  if (!printed)
+    @{
+      printf ("No commands match `%s'.  Possibilties are:\n", arg);
+
+      for (i = 0; commands[i].name; i++)
+        @{
+          /* Print in six columns. */
+          if (printed == 6)
+            @{
+              printed = 0;
+              printf ("\n");
+            @}
+
+          printf ("%s\t", commands[i].name);
+          printed++;
+        @}
+
+      if (printed)
+        printf ("\n");
+    @}
+  return (0);
+@}
+
+/* Change to the directory ARG. */
+com_cd (arg)
+     char *arg;
+@{
+  if (chdir (arg) == -1)
+    @{
+      perror (arg);
+      return 1;
+    @}
+
+  com_pwd ("");
+  return (0);
+@}
+
+/* Print out the current working directory. */
+com_pwd (ignore)
+     char *ignore;
+@{
+  char dir[1024], *s;
+
+  s = getwd (dir);
+  if (s == 0)
+    @{
+      printf ("Error getting pwd: %s\n", dir);
+      return 1;
+    @}
+
+  printf ("Current directory is %s\n", dir);
+  return 0;
+@}
+
+/* The user wishes to quit using this program.  Just set DONE non-zero. */
+com_quit (arg)
+     char *arg;
+@{
+  done = 1;
+  return (0);
+@}
+
+/* Function which tells you that you can't do this. */
+too_dangerous (caller)
+     char *caller;
+@{
+  fprintf (stderr,
+           "%s: Too dangerous for me to distribute.  Write it yourself.\n",
+           caller);
+@}
+
+/* Return non-zero if ARG is a valid argument for CALLER, else print
+   an error message and return zero. */
+int
+valid_argument (caller, arg)
+     char *caller, *arg;
+@{
+  if (!arg || !*arg)
+    @{
+      fprintf (stderr, "%s: Argument required.\n", caller);
+      return (0);
+    @}
+
+  return (1);
+@}
+@end smallexample
diff --git a/doc/rluser.texinfo b/doc/rluser.texinfo
new file mode 100644
index 0000000..3567549
--- /dev/null
+++ b/doc/rluser.texinfo
@@ -0,0 +1,875 @@
+@comment %**start of header (This is for running Texinfo on a region.)
+@setfilename rluser.info
+@comment %**end of header (This is for running Texinfo on a region.)
+@setchapternewpage odd
+
+@ignore
+This file documents the end user interface to the GNU command line
+editing features.  It is to be an appendix to manuals for programs which
+use these features.  There is a document entitled "readline.texinfo"
+which contains both end-user and programmer documentation for the GNU
+Readline Library.
+
+Copyright (C) 1988 Free Software Foundation, Inc.
+
+Authored by Brian Fox and Chet Ramey.
+
+Permission is granted to process this file through Tex and print the
+results, provided the printed document carries copying permission notice
+identical to this one except for the removal of this paragraph (this
+paragraph not being relevant to the printed manual).
+
+Permission is granted to make and distribute verbatim copies of this manual
+provided the copyright notice and this permission notice are preserved on
+all copies.
+
+Permission is granted to copy and distribute modified versions of this
+manual under the conditions for verbatim copying, provided also that the
+GNU Copyright statement is available to the distributee, and provided that
+the entire resulting derived work is distributed under the terms of a
+permission notice identical to this one.
+
+Permission is granted to copy and distribute translations of this manual
+into another language, under the above conditions for modified versions.
+@end ignore
+
+@comment If you are including this manual as an appendix, then set the
+@comment variable readline-appendix.
+
+@node Command Line Editing
+@chapter Command Line Editing
+
+This chapter describes the basic features of the GNU
+command line editing interface.
+
+@menu
+* Introduction and Notation::	Notation used in this text.
+* Readline Interaction::	The minimum set of commands for editing a line.
+* Readline Init File::		Customizing Readline from a user's view.
+* Bindable Readline Commands::	A description of most of the Readline commands
+				available for binding
+* Readline vi Mode::		A short description of how to make Readline
+				behave like the vi editor.
+@end menu
+
+@node Introduction and Notation
+@section Introduction to Line Editing
+
+The following paragraphs describe the notation used to represent
+keystrokes.
+
+The text @key{C-k} is read as `Control-K' and describes the character
+produced when the Control key is depressed and the @key{k} key is struck.
+
+The text @key{M-k} is read as `Meta-K' and describes the character
+produced when the meta key (if you have one) is depressed, and the @key{k}
+key is struck.  If you do not have a meta key, the identical keystroke
+can be generated by typing @key{ESC} @i{first}, and then typing @key{k}.
+Either process is known as @dfn{metafying} the @key{k} key.
+
+The text @key{M-C-k} is read as `Meta-Control-k' and describes the
+character produced by @dfn{metafying} @key{C-k}.
+
+In addition, several keys have their own names.  Specifically,
+@key{DEL}, @key{ESC}, @key{LFD}, @key{SPC}, @key{RET}, and @key{TAB} all
+stand for themselves when seen in this text, or in an init file
+(@pxref{Readline Init File}, for more info).
+
+@node Readline Interaction
+@section Readline Interaction
+@cindex interaction, readline
+
+Often during an interactive session you type in a long line of text,
+only to notice that the first word on the line is misspelled.  The
+Readline library gives you a set of commands for manipulating the text
+as you type it in, allowing you to just fix your typo, and not forcing
+you to retype the majority of the line.  Using these editing commands,
+you move the cursor to the place that needs correction, and delete or
+insert the text of the corrections.  Then, when you are satisfied with
+the line, you simply press @key{RETURN}.  You do not have to be at the
+end of the line to press @key{RETURN}; the entire line is accepted
+regardless of the location of the cursor within the line.
+
+@menu
+* Readline Bare Essentials::	The least you need to know about Readline.
+* Readline Movement Commands::	Moving about the input line.
+* Readline Killing Commands::	How to delete text, and how to get it back!
+* Readline Arguments::		Giving numeric arguments to commands.
+@end menu
+
+@node Readline Bare Essentials
+@subsection Readline Bare Essentials
+
+In order to enter characters into the line, simply type them.  The typed
+character appears where the cursor was, and then the cursor moves one
+space to the right.  If you mistype a character, you can use your
+erase character to back up and delete the mistyped character.
+
+Sometimes you may miss typing a character that you wanted to type, and
+not notice your error until you have typed several other characters.  In
+that case, you can type @key{C-b} to move the cursor to the left, and then
+correct your mistake.  Afterwards, you can move the cursor to the right
+with @key{C-f}.
+
+When you add text in the middle of a line, you will notice that characters
+to the right of the cursor are `pushed over' to make room for the text
+that you have inserted.  Likewise, when you delete text behind the cursor,
+characters to the right of the cursor are `pulled back' to fill in the
+blank space created by the removal of the text.  A list of the basic bare
+essentials for editing the text of an input line follows.
+
+@table @asis
+@item @key{C-b}
+Move back one character.
+@item @key{C-f}
+Move forward one character.
+@item @key{DEL}
+Delete the character to the left of the cursor.
+@item @key{C-d}
+Delete the character underneath the cursor.
+@item @w{Printing characters}
+Insert the character into the line at the cursor.
+@item @key{C-_}
+Undo the last thing that you did.  You can undo all the way back to an
+empty line.
+@end table
+
+@node Readline Movement Commands
+@subsection Readline Movement Commands
+
+
+The above table describes the most basic possible keystrokes that you need
+in order to do editing of the input line.  For your convenience, many
+other commands have been added in addition to @key{C-b}, @key{C-f},
+@key{C-d}, and @key{DEL}.  Here are some commands for moving more rapidly
+about the line.
+
+@table @key
+@item C-a
+Move to the start of the line.
+@item C-e
+Move to the end of the line.
+@item M-f
+Move forward a word.
+@item M-b
+Move backward a word.
+@item C-l
+Clear the screen, reprinting the current line at the top.
+@end table
+
+Notice how @key{C-f} moves forward a character, while @key{M-f} moves
+forward a word.  It is a loose convention that control keystrokes
+operate on characters while meta keystrokes operate on words.
+
+@node Readline Killing Commands
+@subsection Readline Killing Commands
+
+@cindex Killing text
+@cindex Yanking text
+
+@dfn{Killing} text means to delete the text from the line, but to save
+it away for later use, usually by @dfn{yanking} (re-inserting)
+it back into the line.
+If the description for a command says that it `kills' text, then you can
+be sure that you can get the text back in a different (or the same)
+place later.
+
+When you use a kill command, the text is saved in a @dfn{kill-ring}.
+Any number of consecutive kills save all of the killed text together, so
+that when you yank it back, you get it all.  The kill
+ring is not line specific; the text that you killed on a previously
+typed line is available to be yanked back later, when you are typing
+another line.
+@cindex Kill ring
+
+Here is the list of commands for killing text.
+
+@table @key
+@item C-k
+Kill the text from the current cursor position to the end of the line.
+
+@item M-d
+Kill from the cursor to the end of the current word, or if between
+words, to the end of the next word.
+
+@item M-DEL
+Kill from the cursor the start of the previous word, or if between
+words, to the start of the previous word.
+
+@item C-w
+Kill from the cursor to the previous whitespace.  This is different than
+@key{M-DEL} because the word boundaries differ.
+
+@end table
+
+And, here is how to @dfn{yank} the text back into the line.  Yanking
+means to copy the most-recently-killed text from the kill buffer.
+
+@table @key
+@item C-y
+Yank the most recently killed text back into the buffer at the cursor.
+
+@item M-y
+Rotate the kill-ring, and yank the new top.  You can only do this if
+the prior command is @key{C-y} or @key{M-y}.
+@end table
+
+@node Readline Arguments
+@subsection Readline Arguments
+
+You can pass numeric arguments to Readline commands.  Sometimes the
+argument acts as a repeat count, other times it is the @i{sign} of the
+argument that is significant.  If you pass a negative argument to a
+command which normally acts in a forward direction, that command will
+act in a backward direction.  For example, to kill text back to the
+start of the line, you might type @key{M--} @key{C-k}.
+
+The general way to pass numeric arguments to a command is to type meta
+digits before the command.  If the first `digit' you type is a minus
+sign (@key{-}), then the sign of the argument will be negative.  Once
+you have typed one meta digit to get the argument started, you can type
+the remainder of the digits, and then the command.  For example, to give
+the @key{C-d} command an argument of 10, you could type @key{M-1 0 C-d}.
+
+
+@node Readline Init File
+@section Readline Init File
+
+Although the Readline library comes with a set of Emacs-like
+keybindings installed by default,
+it is possible that you would like to use a different set
+of keybindings.  You can customize programs that use Readline by putting
+commands in an @dfn{init} file in your home directory.  The name of this
+@ifset BashFeatures
+file is taken from the value of the shell variable @code{INPUTRC}.  If
+@end ifset
+@ifclear BashFeatures
+file is taken from the value of the environment variable @code{INPUTRC}.  If
+@end ifclear
+that variable is unset, the default is @file{~/.inputrc}.
+
+When a program which uses the Readline library starts up, the
+init file is read, and the key bindings are set.
+
+In addition, the @code{C-x C-r} command re-reads this init file, thus
+incorporating any changes that you might have made to it.
+
+@menu
+* Readline Init Syntax::	Syntax for the commands in the inputrc file.
+* Conditional Init Constructs::	Conditional key bindings in the inputrc file.
+@end menu
+
+@node Readline Init Syntax
+@subsection Readline Init Syntax
+
+There are only a few basic constructs allowed in the
+Readline init file.  Blank lines are ignored.
+Lines beginning with a @key{#} are comments.
+Lines beginning with a @key{$} indicate conditional
+constructs (@pxref{Conditional Init Constructs}).  Other lines
+denote variable settings and key bindings.
+
+@table @asis
+@item Variable Settings
+You can change the state of a few variables in Readline by
+using the @code{set} command within the init file.  Here is how you
+would specify that you wish to use @code{vi} line editing commands:
+
+@example
+set editing-mode vi
+@end example
+
+Right now, there are only a few variables which can be set;
+so few, in fact, that we just list them here:
+
+@table @code
+
+@item editing-mode
+@vindex editing-mode
+The @code{editing-mode} variable controls which editing mode you are
+using.  By default, Readline starts up in Emacs editing mode, where
+the keystrokes are most similar to Emacs.  This variable can be
+set to either @code{emacs} or @code{vi}.
+
+@item horizontal-scroll-mode
+@vindex horizontal-scroll-mode
+This variable can be set to either @code{On} or @code{Off}.  Setting it
+to @code{On} means that the text of the lines that you edit will scroll
+horizontally on a single screen line when they are longer than the width
+of the screen, instead of wrapping onto a new screen line.  By default,
+this variable is set to @code{Off}.
+
+@item mark-modified-lines
+@vindex mark-modified-lines
+This variable, when set to @code{On}, says to display an asterisk
+(@samp{*}) at the start of history lines which have been modified.
+This variable is @code{off} by default.
+
+@item bell-style
+@vindex bell-style
+Controls what happens when Readline wants to ring the terminal bell.
+If set to @code{none}, Readline never rings the bell.  If set to
+@code{visible}, Readline uses a visible bell if one is available.
+If set to @code{audible} (the default), Readline attempts to ring
+the terminal's bell.
+
+@item comment-begin
+@vindex comment-begin
+The string to insert at the beginning of the line when the
+@code{vi-comment} command is executed.  The default value
+is @code{"#"}.
+
+@item meta-flag
+@vindex meta-flag
+If set to @code{on}, Readline will enable eight-bit input (it
+will not strip the eighth bit from the characters it reads),
+regardless of what the terminal claims it can support.  The
+default value is @code{off}.
+
+@item convert-meta
+@vindex convert-meta
+If set to @code{on}, Readline will convert characters with the
+eigth bit set to an ASCII key sequence by stripping the eigth
+bit and prepending an @key{ESC} character, converting them to a
+meta-prefixed key sequence.  The default value is @code{on}.
+
+@item output-meta
+@vindex output-meta
+If set to @code{on}, Readline will display characters with the
+eighth bit set directly rather than as a meta-prefixed escape
+sequence.  The default is @code{off}.
+
+@item completion-query-items
+@vindex completion-query-items
+The number of possible completions that determines when the user is
+asked whether he wants to see the list of possibilities.  If the
+number of possible completions is greater than this value,
+Readline will ask the user whether or not he wishes to view
+them; otherwise, they are simply listed.  The default limit is
+@code{100}.
+
+@item keymap
+@vindex keymap
+Sets Readline's idea of the current keymap for key binding commands.
+Acceptable @code{keymap} names are
+@code{emacs},
+@code{emacs-standard},
+@code{emacs-meta},
+@code{emacs-ctlx},
+@code{vi},
+@code{vi-move},
+@code{vi-command}, and
+@code{vi-insert}.
+@code{vi} is equivalent to @code{vi-command}; @code{emacs} is
+equivalent to @code{emacs-standard}.  The default value is @code{emacs}.
+The value of the @code{editing-mode} variable also affects the
+default keymap.
+
+@item show-all-if-ambiguous
+@vindex show-all-if-ambiguous
+This alters the default behavior of the completion functions.  If
+set to @code{on}, 
+words which have more than one possible completion cause the
+matches to be listed immediately instead of ringing the bell.
+The default value is @code{off}.
+
+@item expand-tilde
+@vindex expand-tilde
+If set to @code{on}, tilde expansion is performed when Readline
+attempts word completion.  The default is @code{off}.
+
+@end table
+
+@item Key Bindings
+The syntax for controlling key bindings in the init file is
+simple.  First you have to know the name of the command that you
+want to change.  The following pages contain tables of the command name,
+the default keybinding, and a short description of what the command
+does.
+
+Once you know the name of the command, simply place the name of the key
+you wish to bind the command to, a colon, and then the name of the
+command on a line in the init file.  The name of the key
+can be expressed in different ways, depending on which is most
+comfortable for you.
+
+@table @asis
+@item @w{@var{keyname}: @var{function-name} or @var{macro}}
+@var{keyname} is the name of a key spelled out in English.  For example:
+@example
+Control-u: universal-argument
+Meta-Rubout: backward-kill-word
+Control-o: ">&output"
+@end example
+
+In the above example, @samp{C-u} is bound to the function
+@code{universal-argument}, and @samp{C-o} is bound to run the macro
+expressed on the right hand side (that is, to insert the text
+@samp{>&output} into the line).
+
+@item @w{"@var{keyseq}": @var{function-name} or @var{macro}}
+@var{keyseq} differs from @var{keyname} above in that strings
+denoting an entire key sequence can be specified, by placing
+the key sequence in double quotes.  Some GNU Emacs style key
+escapes can be used, as in the following example, but the
+special character names are not recognized.
+
+@example
+"\C-u": universal-argument
+"\C-x\C-r": re-read-init-file
+"\e[11~": "Function Key 1"
+@end example
+
+In the above example, @samp{C-u} is bound to the function
+@code{universal-argument} (just as it was in the first example),
+@samp{C-x C-r} is bound to the function @code{re-read-init-file}, and
+@samp{ESC [ 1 1 ~} is bound to insert the text @samp{Function Key 1}.
+The following escape sequences are available when specifying key
+sequences:
+
+@table @code
+@item @kbd{\C-}
+control prefix
+@item @kbd{\M-}
+meta prefix
+@item @kbd{\e}
+an escape character
+@item @kbd{\\}
+backslash
+@item @kbd{\"}
+@key{"}
+@item @kbd{\'}
+@key{'}
+@end table
+
+When entering the text of a macro, single or double quotes should
+be used to indicate a macro definition.  Unquoted text
+is assumed to be a function name.  Backslash
+will quote any character in the macro text, including @key{"}
+and @key{'}.
+For example, the following binding will make @kbd{C-x \}
+insert a single @key{\} into the line:
+@example
+"\C-x\\": "\\"
+@end example
+
+@end table
+@end table
+
+@node Conditional Init Constructs
+@subsection Conditional Init Constructs
+
+Readline implements a facility similar in spirit to the conditional
+compilation features of the C preprocessor which allows key
+bindings and variable settings to be performed as the result
+of tests.  There are three parser directives used.
+
+@ftable @code
+@item $if
+The @code{$if} construct allows bindings to be made based on the
+editing mode, the terminal being used, or the application using
+Readline.  The text of the test extends to the end of the line;
+no characters are required to isolate it.
+
+@table @code
+@item mode
+The @code{mode=} form of the @code{$if} directive is used to test
+whether Readline is in @code{emacs} or @code{vi} mode.
+This may be used in conjunction
+with the @samp{set keymap} command, for instance, to set bindings in
+the @code{emacs-standard} and @code{emacs-ctlx} keymaps only if
+Readline is starting out in @code{emacs} mode.
+
+@item term
+The @code{term=} form may be used to include terminal-specific
+key bindings, perhaps to bind the key sequences output by the
+terminal's function keys.  The word on the right side of the
+@samp{=} is tested against the full name of the terminal and the
+portion of the terminal name before the first @samp{-}.  This
+allows @var{sun} to match both @var{sun} and @var{sun-cmd},
+for instance.
+
+@item application
+The @var{application} construct is used to include
+application-specific settings.  Each program using the Readline
+library sets the @var{application name}, and you can test for it. 
+This could be used to bind key sequences to functions useful for
+a specific program.  For instance, the following command adds a
+key sequence that quotes the current or previous word in Bash:
+@example
+$if bash
+# Quote the current or previous word
+"\C-xq": "\eb\"\ef\""
+$endif
+@end example
+@end table
+
+@item $endif
+This command, as you saw in the previous example, terminates an
+@code{$if} command.
+
+@item $else
+Commands in this branch of the @code{$if} directive are executed if
+the test fails.
+@end ftable
+
+@node Bindable Readline Commands
+@section Bindable Readline Commands
+
+@menu
+* Commands For Moving::		Moving about the line.
+* Commands For History::	Getting at previous lines.
+* Commands For Text::		Commands for changing text.
+* Commands For Killing::	Commands for killing and yanking.
+* Numeric Arguments::		Specifying numeric arguments, repeat counts.
+* Commands For Completion::	Getting Readline to do the typing for you.
+* Keyboard Macros::		Saving and re-executing typed characters
+* Miscellaneous Commands::	Other miscellaneous commands.
+@end menu
+
+@node Commands For Moving
+@subsection Commands For Moving
+@ftable @code
+@item beginning-of-line (C-a)
+Move to the start of the current line.
+
+@item end-of-line (C-e)
+Move to the end of the line.
+
+@item forward-char (C-f)
+Move forward a character.
+
+@item backward-char (C-b)
+Move back a character.
+
+@item forward-word (M-f)
+Move forward to the end of the next word.  Words are composed of
+letters and digits.
+
+@item backward-word (M-b)
+Move back to the start of this, or the previous, word.  Words are
+composed of letters and digits.
+
+@item clear-screen (C-l)
+Clear the screen and redraw the current line,
+leaving the current line at the top of the screen.
+
+@item redraw-current-line ()
+Refresh the current line.  By default, this is unbound.
+
+@end ftable
+
+@node Commands For History
+@subsection Commands For Manipulating The History
+
+@ftable @code
+@item accept-line (Newline, Return)
+@ifset BashFeatures
+Accept the line regardless of where the cursor is.  If this line is
+non-empty, add it to the history list according to the setting of
+the @code{HISTCONTROL} variable.  If this line was a history
+line, then restore the history line to its original state.
+@end ifset
+@ifclear BashFeatures
+Accept the line regardless of where the cursor is.  If this line is
+non-empty, add it to the history list.  If this line was a history
+line, then restore the history line to its original state.
+@end ifclear
+
+@item previous-history (C-p)
+Move `up' through the history list.
+
+@item next-history (C-n)
+Move `down' through the history list.
+
+@item beginning-of-history (M-<)
+Move to the first line in the history.
+
+@item end-of-history (M->)
+Move to the end of the input history, i.e., the line you are entering.
+
+@item reverse-search-history (C-r)
+Search backward starting at the current line and moving `up' through
+the history as necessary.  This is an incremental search.
+
+@item forward-search-history (C-s)
+Search forward starting at the current line and moving `down' through
+the the history as necessary.  This is an incremental search.
+
+@item non-incremental-reverse-search-history (M-p)
+Search backward starting at the current line and moving `up'
+through the history as necessary using a non-incremental search
+for a string supplied by the user.
+
+@item non-incremental-forward-search-history (M-n)
+Search forward starting at the current line and moving `down'
+through the the history as necessary using a non-incremental search
+for a string supplied by the user.
+
+@item history-search-forward ()
+Search forward through the history for the string of characters
+between the start of the current line and the current point.  This
+is a non-incremental search.  By default, this command is unbound.
+
+@item history-search-backward ()
+Search backward through the history for the string of characters
+between the start of the current line and the current point.  This
+is a non-incremental search.  By default, this command is unbound.
+
+@item yank-nth-arg (M-C-y)
+Insert the first argument to the previous command (usually
+the second word on the previous line).  With an argument @var{n},
+insert the @var{n}th word from the previous command (the words
+in the previous command begin with word 0).  A negative argument
+inserts the @var{n}th word from the end of the previous command.
+
+@item yank-last-arg (M-., M-_)
+Insert last argument to the previous command (the last word on the
+previous line).  With an
+argument, behave exactly like @code{yank-nth-arg}.
+
+@end ftable
+
+@node Commands For Text
+@subsection Commands For Changing Text
+
+@ftable @code
+@item delete-char (C-d)
+Delete the character under the cursor.  If the cursor is at the
+beginning of the line, there are no characters in the line, and
+the last character typed was not C-d, then return EOF.
+
+@item backward-delete-char (Rubout)
+Delete the character behind the cursor.  A numeric arg says to kill
+the characters instead of deleting them.
+
+@item quoted-insert (C-q, C-v)
+Add the next character that you type to the line verbatim.  This is
+how to insert key sequences like @key{C-q}, for example.
+
+@item tab-insert (M-TAB)
+Insert a tab character.
+
+@item self-insert (a, b, A, 1, !, ...)
+Insert yourself.
+
+@item transpose-chars (C-t)
+Drag the character before the cursor forward over
+the character at the cursor, moving the
+cursor forward as well.  If the insertion point
+is at the end of the line, then this
+transposes the last two characters of the line.
+Negative argumentss don't work.
+
+@item transpose-words (M-t)
+Drag the word behind the cursor past the word in front of the cursor
+moving the cursor over that word as well.
+
+@item upcase-word (M-u)
+Uppercase the current (or following) word.  With a negative argument,
+do the previous word, but do not move the cursor.
+
+@item downcase-word (M-l)
+Lowercase the current (or following) word.  With a negative argument,
+do the previous word, but do not move the cursor.
+
+@item capitalize-word (M-c)
+Capitalize the current (or following) word.  With a negative argument,
+do the previous word, but do not move the cursor.
+
+@end ftable
+
+@node Commands For Killing
+@subsection Killing And Yanking
+
+@ftable @code
+
+@item kill-line (C-k)
+Kill the text from the current cursor position to the end of the line.
+
+@item backward-kill-line (C-x Rubout)
+Kill backward to the beginning of the line.
+
+@item unix-line-discard (C-u)
+Kill backward from the cursor to the beginning of the current line.
+Save the killed text on the kill-ring.
+
+@item kill-whole-line ()
+Kill all characters on the current line, no matter where the
+cursor is.  By default, this is unbound.
+
+@item kill-word (M-d)
+Kill from the cursor to the end of the current word, or if between
+words, to the end of the next word.  Word boundaries are the same
+as @code{forward-word}.
+
+@item backward-kill-word (M-DEL)
+Kill the word behind the cursor.  Word boundaries are the same
+as @code{backward-word}.
+
+@item unix-word-rubout (C-w)
+Kill the word behind the cursor, using white space as a word
+boundary.  The killed text is saved on the kill-ring.
+
+@item delete-horizontal-space ()
+Delete all spaces and tabs around point.  By default, this is unbound.
+
+@item yank (C-y)
+Yank the top of the kill ring into the buffer at the current
+cursor position.
+
+@item yank-pop (M-y)
+Rotate the kill-ring, and yank the new top.  You can only do this if
+the prior command is yank or yank-pop.
+@end ftable
+
+@node Numeric Arguments
+@subsection Specifying Numeric Arguments
+@ftable @code
+
+@item digit-argument (M-0, M-1, ... M--)
+Add this digit to the argument already accumulating, or start a new
+argument.  M-- starts a negative argument.
+
+@item universal-argument ()
+Each time this is executed, the argument count is multiplied by four.
+The argument count is initially one, so executing this function the
+first time makes the argument count four.  By default, this is not
+bound to a key.
+@end ftable
+
+@node Commands For Completion
+@subsection Letting Readline Type For You
+
+@ftable @code
+@item complete (TAB)
+Attempt to do completion on the text before the cursor.  This is
+application-specific.  Generally, if you are typing a filename
+argument, you can do filename completion; if you are typing a command,
+you can do command completion, if you are typing in a symbol to GDB, you
+can do symbol name completion, if you are typing in a variable to Bash,
+you can do variable name completion, and so on.
+@ifset BashFeatures
+See the Bash manual page for a complete list of available completion
+functions.
+@end ifset
+
+@item possible-completions (M-?)
+List the possible completions of the text before the cursor.
+
+@item insert-completions ()
+Insert all completions of the text before point that would have
+been generated by @code{possible-completions}.  By default, this
+is not bound to a key.
+
+@end ftable
+
+@node Keyboard Macros
+@subsection Keyboard Macros
+@ftable @code
+
+@item start-kbd-macro (C-x ()
+Begin saving the characters typed into the current keyboard macro.
+
+@item end-kbd-macro (C-x ))
+Stop saving the characters typed into the current keyboard macro
+and save the definition.
+
+@item call-last-kbd-macro (C-x e)
+Re-execute the last keyboard macro defined, by making the characters
+in the macro appear as if typed at the keyboard.
+
+@end ftable
+
+@node Miscellaneous Commands
+@subsection Some Miscellaneous Commands
+@ftable @code
+
+@item re-read-init-file (C-x C-r)
+Read in the contents of your init file, and incorporate
+any bindings or variable assignments found there.
+
+@item abort (C-g)
+Abort the current editing command and
+ring the terminal's bell (subject to the setting of
+@code{bell-style}).
+
+@item do-uppercase-version (M-a, M-b, ...)
+Run the command that is bound to the corresoponding uppercase
+character.
+
+@item prefix-meta (ESC)
+Make the next character that you type be metafied.  This is for people
+without a meta key.  Typing @samp{ESC f} is equivalent to typing
+@samp{M-f}.
+
+@item undo (C-_, C-x C-u)
+Incremental undo, separately remembered for each line.
+
+@item revert-line (M-r)
+Undo all changes made to this line.  This is like typing the @code{undo}
+command enough times to get back to the beginning.
+
+@item tilde-expand (M-~)
+Perform tilde expansion on the current word.
+
+@item dump-functions ()
+Print all of the functions and their key bindings to the
+readline output stream.  If a numeric argument is supplied,
+the output is formatted in such a way that it can be made part
+of an @var{inputrc} file.
+
+@ifset BashFeatures
+@item display-shell-version (C-x C-v)
+Display version information about the current instance of Bash.
+
+@item shell-expand-line (M-C-e)
+Expand the line the way the shell does when it reads it.  This
+performs alias and history expansion as well as all of the shell
+word expansions.
+
+@item history-expand-line (M-^)
+Perform history expansion on the current line.
+
+@item insert-last-argument (M-., M-_)
+A synonym for @code{yank-last-arg}.
+
+@item operate-and-get-next (C-o)
+Accept the current line for execution and fetch the next line
+relative to the current line from the history for editing.  Any
+argument is ignored.
+
+@item emacs-editing-mode (C-e)
+When in @code{vi} editing mode, this causes a switch back to
+emacs editing mode, as if the command @code{set -o emacs} had
+been executed.
+
+@end ifset
+
+@end ftable
+
+@node Readline vi Mode
+@section Readline vi Mode
+
+While the Readline library does not have a full set of @code{vi}
+editing functions, it does contain enough to allow simple editing
+of the line.  The Readline @code{vi} mode behaves as specified in
+the Posix 1003.2 standard.
+
+@ifset BashFeatures
+In order to switch interactively between @code{Emacs} and @code{Vi}
+editing modes, use the @code{set -o emacs} and @code{set -o vi}
+commands (@pxref{The Set Builtin}).
+@end ifset
+@ifclear BashFeatures
+In order to switch interactively between @code{Emacs} and @code{Vi}
+editing modes, use the command M-C-j (toggle-editing-mode).
+@end ifclear
+The Readline default is @code{emacs} mode.
+
+When you enter a line in @code{vi} mode, you are already placed in
+`insertion' mode, as if you had typed an @samp{i}.  Pressing @key{ESC}
+switches you into `command' mode, where you can edit the text of the
+line with the standard @code{vi} movement keys, move to previous
+history lines with @samp{k}, and following lines with @samp{j}, and
+so forth.
diff --git a/doc/texinfo.tex b/doc/texinfo.tex
new file mode 100644
index 0000000..ce8124e
--- /dev/null
+++ b/doc/texinfo.tex
@@ -0,0 +1,4003 @@
+%% TeX macros to handle texinfo files
+
+%   Copyright (C) 1985, 86, 88, 90, 91, 92, 1993 Free Software Foundation, Inc.
+
+%This texinfo.tex file is free software; you can redistribute it and/or
+%modify it under the terms of the GNU General Public License as
+%published by the Free Software Foundation; either version 2, or (at
+%your option) any later version.
+
+%This texinfo.tex file is distributed in the hope that it will be
+%useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+%of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+%General Public License for more details.
+
+%You should have received a copy of the GNU General Public License
+%along with this texinfo.tex file; see the file COPYING.  If not, write
+%to the Free Software Foundation, 675 Mass Ave, Cambridge, MA 02139,
+%USA.
+
+
+%In other words, you are welcome to use, share and improve this program.
+%You are forbidden to forbid anyone else to use, share and improve
+%what you give them.   Help stamp out software-hoarding!
+
+\def\texinfoversion{2.108}
+\message{Loading texinfo package [Version \texinfoversion]:}
+
+% Print the version number if in a .fmt file.
+\everyjob{\message{[Texinfo version \texinfoversion]}\message{}}
+
+% Save some parts of plain tex whose names we will redefine.
+
+\let\ptexlbrace=\{
+\let\ptexrbrace=\}
+\let\ptexdots=\dots
+\let\ptexdot=\.
+\let\ptexstar=\*
+\let\ptexend=\end
+\let\ptexbullet=\bullet
+\let\ptexb=\b
+\let\ptexc=\c
+\let\ptexi=\i
+\let\ptext=\t
+\let\ptexl=\l
+\let\ptexL=\L
+
+\def\tie{\penalty 10000\ }     % Save plain tex definition of ~.
+
+\message{Basics,}
+\chardef\other=12
+
+% If this character appears in an error message or help string, it
+% starts a new line in the output.
+\newlinechar = `^^J
+
+% Ignore a token.
+%
+\def\gobble#1{}
+
+\hyphenation{ap-pen-dix}
+\hyphenation{mini-buf-fer mini-buf-fers}
+\hyphenation{eshell}
+
+% Margin to add to right of even pages, to left of odd pages.
+\newdimen \bindingoffset  \bindingoffset=0pt
+\newdimen \normaloffset   \normaloffset=\hoffset
+\newdimen\pagewidth \newdimen\pageheight
+\pagewidth=\hsize \pageheight=\vsize
+
+% Sometimes it is convenient to have everything in the transcript file
+% and nothing on the terminal.  We don't just call \tracingall here,
+% since that produces some useless output on the terminal.
+%
+\def\gloggingall{\begingroup \globaldefs = 1 \loggingall \endgroup}%
+\def\loggingall{\tracingcommands2 \tracingstats2
+   \tracingpages1 \tracingoutput1 \tracinglostchars1
+   \tracingmacros2 \tracingparagraphs1 \tracingrestores1
+   \showboxbreadth\maxdimen\showboxdepth\maxdimen
+}%
+
+%---------------------Begin change-----------------------
+%
+%%%% For @cropmarks command.
+% Dimensions to add cropmarks at corners Added by P. A. MacKay, 12 Nov. 1986
+%
+\newdimen\cornerlong \newdimen\cornerthick
+\newdimen \topandbottommargin
+\newdimen \outerhsize \newdimen \outervsize
+\cornerlong=1pc\cornerthick=.3pt	% These set size of cropmarks
+\outerhsize=7in
+%\outervsize=9.5in
+% Alternative @smallbook page size is 9.25in
+\outervsize=9.25in
+\topandbottommargin=.75in
+%
+%---------------------End change-----------------------
+
+% \onepageout takes a vbox as an argument.  Note that \pagecontents
+% does insertions itself, but you have to call it yourself.
+\chardef\PAGE=255  \output={\onepageout{\pagecontents\PAGE}}
+\def\onepageout#1{\hoffset=\normaloffset
+\ifodd\pageno  \advance\hoffset by \bindingoffset
+\else \advance\hoffset by -\bindingoffset\fi
+{\escapechar=`\\\relax % makes sure backslash is used in output files.
+\shipout\vbox{{\let\hsize=\pagewidth \makeheadline} \pagebody{#1}%
+{\let\hsize=\pagewidth \makefootline}}}%
+\advancepageno \ifnum\outputpenalty>-20000 \else\dosupereject\fi}
+
+%%%% For @cropmarks command %%%%
+
+% Here is a modification of the main output routine for Near East Publications
+% This provides right-angle cropmarks at all four corners.
+% The contents of the page are centerlined into the cropmarks,
+% and any desired binding offset is added as an \hskip on either
+% site of the centerlined box.  (P. A. MacKay, 12 November, 1986)
+%
+\def\croppageout#1{\hoffset=0pt % make sure this doesn't mess things up
+{\escapechar=`\\\relax % makes sure backslash is used in output files.
+		 \shipout
+		 \vbox to \outervsize{\hsize=\outerhsize
+                 \vbox{\line{\ewtop\hfill\ewtop}}
+                 \nointerlineskip
+                 \line{\vbox{\moveleft\cornerthick\nstop}
+                       \hfill
+                       \vbox{\moveright\cornerthick\nstop}}
+                 \vskip \topandbottommargin
+                 \centerline{\ifodd\pageno\hskip\bindingoffset\fi
+			\vbox{
+			{\let\hsize=\pagewidth \makeheadline}
+			\pagebody{#1}
+			{\let\hsize=\pagewidth \makefootline}}
+			\ifodd\pageno\else\hskip\bindingoffset\fi}
+		 \vskip \topandbottommargin plus1fill minus1fill
+                 \boxmaxdepth\cornerthick
+                 \line{\vbox{\moveleft\cornerthick\nsbot}
+                       \hfill
+                       \vbox{\moveright\cornerthick\nsbot}}
+                 \nointerlineskip
+                 \vbox{\line{\ewbot\hfill\ewbot}}
+	}}
+  \advancepageno
+  \ifnum\outputpenalty>-20000 \else\dosupereject\fi}
+%
+% Do @cropmarks to get crop marks
+\def\cropmarks{\let\onepageout=\croppageout }
+
+\def\pagebody#1{\vbox to\pageheight{\boxmaxdepth=\maxdepth #1}}
+{\catcode`\@ =11
+\gdef\pagecontents#1{\ifvoid\topins\else\unvbox\topins\fi
+\dimen@=\dp#1 \unvbox#1
+\ifvoid\footins\else\vskip\skip\footins\footnoterule \unvbox\footins\fi
+\ifr@ggedbottom \kern-\dimen@ \vfil \fi}
+}
+
+%
+% Here are the rules for the cropmarks.  Note that they are
+% offset so that the space between them is truly \outerhsize or \outervsize
+% (P. A. MacKay, 12 November, 1986)
+%
+\def\ewtop{\vrule height\cornerthick depth0pt width\cornerlong}
+\def\nstop{\vbox
+  {\hrule height\cornerthick depth\cornerlong width\cornerthick}}
+\def\ewbot{\vrule height0pt depth\cornerthick width\cornerlong}
+\def\nsbot{\vbox
+  {\hrule height\cornerlong depth\cornerthick width\cornerthick}}
+
+% Parse an argument, then pass it to #1.  The argument is the rest of
+% the input line (except we remove a trailing comment).  #1 should be a
+% macro which expects an ordinary undelimited TeX argument.
+%
+\def\parsearg#1{%
+  \let\next = #1%
+  \begingroup
+    \obeylines
+    \futurelet\temp\parseargx
+}
+
+% If the next token is an obeyed space (from an @example environment or
+% the like), remove it and recurse.  Otherwise, we're done.
+\def\parseargx{%
+  % \obeyedspace is defined far below, after the definition of \sepspaces.
+  \ifx\obeyedspace\temp
+    \expandafter\parseargdiscardspace
+  \else
+    \expandafter\parseargline
+  \fi
+}
+
+% Remove a single space (as the delimiter token to the macro call).
+{\obeyspaces %
+ \gdef\parseargdiscardspace {\futurelet\temp\parseargx}}
+
+{\obeylines %
+  \gdef\parseargline#1^^M{%
+    \endgroup % End of the group started in \parsearg.
+    %
+    % First remove any @c comment, then any @comment.
+    % Result of each macro is put in \toks0.
+    \argremovec #1\c\relax %
+    \expandafter\argremovecomment \the\toks0 \comment\relax %
+    %
+    % Call the caller's macro, saved as \next in \parsearg.
+    \expandafter\next\expandafter{\the\toks0}%
+  }%
+}
+
+% Since all \c{,omment} does is throw away the argument, we can let TeX
+% do that for us.  The \relax here is matched by the \relax in the call
+% in \parseargline; it could be more or less anything, its purpose is
+% just to delimit the argument to the \c.
+\def\argremovec#1\c#2\relax{\toks0 = {#1}}
+\def\argremovecomment#1\comment#2\relax{\toks0 = {#1}}
+
+% \argremovec{,omment} might leave us with trailing spaces, though; e.g.,
+%    @end itemize  @c foo
+% will have two active spaces as part of the argument with the
+% `itemize'.  Here we remove all active spaces from #1, and assign the
+% result to \toks0.
+%
+% This loses if there are any *other* active characters besides spaces
+% in the argument -- _ ^ +, for example -- since they get expanded.
+% Fortunately, Texinfo does not define any such commands.  (If it ever
+% does, the catcode of the characters in questionwill have to be changed
+% here.)  But this means we cannot call \removeactivespaces as part of
+% \argremovec{,omment}, since @c uses \parsearg, and thus the argument
+% that \parsearg gets might well have any character at all in it.
+%
+\def\removeactivespaces#1{%
+  \begingroup
+    \ignoreactivespaces
+    \edef\temp{#1}%
+    \global\toks0 = \expandafter{\temp}%
+  \endgroup
+}
+
+% Change the active space to expand to nothing.
+%
+\begingroup
+  \obeyspaces
+  \gdef\ignoreactivespaces{\obeyspaces\let =\empty}
+\endgroup
+
+
+\def\flushcr{\ifx\par\lisppar \def\next##1{}\else \let\next=\relax \fi \next}
+
+%% These are used to keep @begin/@end levels from running away
+%% Call \inENV within environments (after a \begingroup)
+\newif\ifENV \ENVfalse \def\inENV{\ifENV\relax\else\ENVtrue\fi}
+\def\ENVcheck{%
+\ifENV\errmessage{Still within an environment.  Type Return to continue.}
+\endgroup\fi} % This is not perfect, but it should reduce lossage
+
+% @begin foo  is the same as @foo, for now.
+\newhelp\EMsimple{Type <Return> to continue.}
+
+\outer\def\begin{\parsearg\beginxxx}
+
+\def\beginxxx #1{%
+\expandafter\ifx\csname #1\endcsname\relax
+{\errhelp=\EMsimple \errmessage{Undefined command @begin #1}}\else
+\csname #1\endcsname\fi}
+
+% @end foo executes the definition of \Efoo.
+%
+\def\end{\parsearg\endxxx}
+\def\endxxx #1{%
+  \removeactivespaces{#1}%
+  \edef\endthing{\the\toks0}%
+  %
+  \expandafter\ifx\csname E\endthing\endcsname\relax
+    \expandafter\ifx\csname \endthing\endcsname\relax
+      % There's no \foo, i.e., no ``environment'' foo.
+      \errhelp = \EMsimple
+      \errmessage{Undefined command `@end \endthing'}%
+    \else
+      \unmatchedenderror\endthing
+    \fi
+  \else
+    % Everything's ok; the right environment has been started.
+    \csname E\endthing\endcsname
+  \fi
+}
+
+% There is an environment #1, but it hasn't been started.  Give an error.
+%
+\def\unmatchedenderror#1{%
+  \errhelp = \EMsimple
+  \errmessage{This `@end #1' doesn't have a matching `@#1'}%
+}
+
+% Define the control sequence \E#1 to give an unmatched @end error.
+%
+\def\defineunmatchedend#1{%
+  \expandafter\def\csname E#1\endcsname{\unmatchedenderror{#1}}%
+}
+
+
+% Single-spacing is done by various environments (specifically, in
+% \nonfillstart and \quotations).
+\newskip\singlespaceskip \singlespaceskip = \baselineskip
+\def\singlespace{%
+% Why was this kern here?  It messes up equalizing space above and below
+% environments.  --karl, 6may93
+%{\advance \baselineskip by -\singlespaceskip
+%\kern \baselineskip}%
+\baselineskip=\singlespaceskip
+}
+
+%% Simple single-character @ commands
+
+% @@ prints an @
+% Kludge this until the fonts are right (grr).
+\def\@{{\tt \char '100}}
+
+% This is turned off because it was never documented
+% and you can use @w{...} around a quote to suppress ligatures.
+%% Define @` and @' to be the same as ` and '
+%% but suppressing ligatures.
+%\def\`{{`}}
+%\def\'{{'}}
+
+% Used to generate quoted braces.
+
+\def\mylbrace {{\tt \char '173}}
+\def\myrbrace {{\tt \char '175}}
+\let\{=\mylbrace
+\let\}=\myrbrace
+
+% @: forces normal size whitespace following.
+\def\:{\spacefactor=1000 }
+
+% @* forces a line break.
+\def\*{\hfil\break\hbox{}\ignorespaces}
+
+% @. is an end-of-sentence period.
+\def\.{.\spacefactor=3000 }
+
+% @w prevents a word break.  Without the \leavevmode, @w at the
+% beginning of a paragraph, when TeX is still in vertical mode, would
+% produce a whole line of output instead of starting the paragraph.
+\def\w#1{\leavevmode\hbox{#1}}
+
+% @group ... @end group forces ... to be all on one page, by enclosing
+% it in a TeX vbox.  We use \vtop instead of \vbox to construct the box
+% to keep its height that of a normal line.  According to the rules for
+% \topskip (p.114 of the TeXbook), the glue inserted is
+% max (\topskip - \ht (first item), 0).  If that height is large,
+% therefore, no glue is inserted, and the space between the headline and
+% the text is small, which looks bad.
+%
+\def\group{\begingroup
+  \ifnum\catcode13=\active \else
+    \errhelp = \groupinvalidhelp
+    \errmessage{@group invalid in context where filling is enabled}%
+  \fi
+  %
+  % The \vtop we start below produces a box with normal height and large
+  % depth; thus, TeX puts \baselineskip glue before it, and (when the
+  % next line of text is done) \lineskip glue after it.  (See p.82 of
+  % the TeXbook.)  Thus, space below is not quite equal to space
+  % above.  But it's pretty close.
+  \def\Egroup{%
+    \egroup           % End the \vtop.
+    \endgroup         % End the \group.
+  }%
+  %
+  \vtop\bgroup
+    % We have to put a strut on the last line in case the @group is in
+    % the midst of an example, rather than completely enclosing it.
+    % Otherwise, the interline space between the last line of the group
+    % and the first line afterwards is too small.  But we can't put the
+    % strut in \Egroup, since there it would be on a line by itself.
+    % Hence this just inserts a strut at the beginning of each line.
+    \everypar = {\strut}%
+    %
+    % Since we have a strut on every line, we don't need any of TeX's
+    % normal interline spacing.
+    \offinterlineskip
+    %
+    % OK, but now we have to do something about blank
+    % lines in the input in @example-like environments, which normally
+    % just turn into \lisppar, which will insert no space now that we've
+    % turned off the interline space.  Simplest is to make them be an
+    % empty paragraph.
+    \ifx\par\lisppar
+      \edef\par{\leavevmode \par}%
+      %
+      % Reset ^^M's definition to new definition of \par.
+      \obeylines
+    \fi
+    %
+    % We do @comment here in case we are called inside an environment,
+    % such as @example, where each end-of-line in the input causes an
+    % end-of-line in the output.  We don't want the end-of-line after
+    % the `@group' to put extra space in the output.  Since @group
+    % should appear on a line by itself (according to the Texinfo
+    % manual), we don't worry about eating any user text.
+    \comment
+}
+%
+% TeX puts in an \escapechar (i.e., `@') at the beginning of the help
+% message, so this ends up printing `@group can only ...'.
+%
+\newhelp\groupinvalidhelp{%
+group can only be used in environments such as @example,^^J%
+where each line of input produces a line of output.}
+
+% @need space-in-mils
+% forces a page break if there is not space-in-mils remaining.
+
+\newdimen\mil  \mil=0.001in
+
+\def\need{\parsearg\needx}
+
+% Old definition--didn't work.
+%\def\needx #1{\par %
+%% This method tries to make TeX break the page naturally
+%% if the depth of the box does not fit.
+%{\baselineskip=0pt%
+%\vtop to #1\mil{\vfil}\kern -#1\mil\penalty 10000
+%\prevdepth=-1000pt
+%}}
+
+\def\needx#1{%
+  % Go into vertical mode, so we don't make a big box in the middle of a
+  % paragraph.
+  \par
+  %
+  % Don't add any leading before our big empty box, but allow a page
+  % break, since the best break might be right here.
+  \allowbreak
+  \nointerlineskip
+  \vtop to #1\mil{\vfil}%
+  %
+  % TeX does not even consider page breaks if a penalty added to the
+  % main vertical list is 10000 or more.  But in order to see if the
+  % empty box we just added fits on the page, we must make it consider
+  % page breaks.  On the other hand, we don't want to actually break the
+  % page after the empty box.  So we use a penalty of 9999.
+  %
+  % There is an extremely small chance that TeX will actually break the
+  % page at this \penalty, if there are no other feasible breakpoints in
+  % sight.  (If the user is using lots of big @group commands, which
+  % almost-but-not-quite fill up a page, TeX will have a hard time doing
+  % good page breaking, for example.)  However, I could not construct an
+  % example where a page broke at this \penalty; if it happens in a real
+  % document, then we can reconsider our strategy.
+  \penalty9999
+  %
+  % Back up by the size of the box, whether we did a page break or not.
+  \kern -#1\mil
+  %
+  % Do not allow a page break right after this kern.
+  \nobreak
+}
+
+% @br   forces paragraph break
+
+\let\br = \par
+
+% @dots{}  output some dots
+
+\def\dots{$\ldots$}
+
+% @page    forces the start of a new page
+
+\def\page{\par\vfill\supereject}
+
+% @exdent text....
+% outputs text on separate line in roman font, starting at standard page margin
+
+% This records the amount of indent in the innermost environment.
+% That's how much \exdent should take out.
+\newskip\exdentamount
+
+% This defn is used inside fill environments such as @defun.
+\def\exdent{\parsearg\exdentyyy}
+\def\exdentyyy #1{{\hfil\break\hbox{\kern -\exdentamount{\rm#1}}\hfil\break}}
+
+% This defn is used inside nofill environments such as @example.
+\def\nofillexdent{\parsearg\nofillexdentyyy}
+\def\nofillexdentyyy #1{{\advance \leftskip by -\exdentamount
+\leftline{\hskip\leftskip{\rm#1}}}}
+
+%\hbox{{\rm#1}}\hfil\break}}
+
+% @include file    insert text of that file as input.
+
+\def\include{\parsearg\includezzz}
+%Use \input\thisfile to avoid blank after \input, which may be an active
+%char (in which case the blank would become the \input argument).
+%The grouping keeps the value of \thisfile correct even when @include
+%is nested.
+\def\includezzz #1{\begingroup
+\def\thisfile{#1}\input\thisfile
+\endgroup}
+
+\def\thisfile{}
+
+% @center line   outputs that line, centered
+
+\def\center{\parsearg\centerzzz}
+\def\centerzzz #1{{\advance\hsize by -\leftskip
+\advance\hsize by -\rightskip
+\centerline{#1}}}
+
+% @sp n   outputs n lines of vertical space
+
+\def\sp{\parsearg\spxxx}
+\def\spxxx #1{\par \vskip #1\baselineskip}
+
+% @comment ...line which is ignored...
+% @c is the same as @comment
+% @ignore ... @end ignore  is another way to write a comment
+
+\def\comment{\catcode 64=\other \catcode 123=\other \catcode 125=\other%
+\parsearg \commentxxx}
+
+\def\commentxxx #1{\catcode 64=0 \catcode 123=1 \catcode 125=2 }
+
+\let\c=\comment
+
+% Prevent errors for section commands.
+% Used in @ignore and in failing conditionals.
+\def\ignoresections{%
+\let\chapter=\relax
+\let\unnumbered=\relax
+\let\top=\relax
+\let\unnumberedsec=\relax
+\let\unnumberedsection=\relax
+\let\unnumberedsubsec=\relax
+\let\unnumberedsubsection=\relax
+\let\unnumberedsubsubsec=\relax
+\let\unnumberedsubsubsection=\relax
+\let\section=\relax
+\let\subsec=\relax
+\let\subsubsec=\relax
+\let\subsection=\relax
+\let\subsubsection=\relax
+\let\appendix=\relax
+\let\appendixsec=\relax
+\let\appendixsection=\relax
+\let\appendixsubsec=\relax
+\let\appendixsubsection=\relax
+\let\appendixsubsubsec=\relax
+\let\appendixsubsubsection=\relax
+\let\contents=\relax
+\let\smallbook=\relax
+\let\titlepage=\relax
+}
+
+% Used in nested conditionals, where we have to parse the Texinfo source
+% and so want to turn off most commands, in case they are used
+% incorrectly.
+%
+\def\ignoremorecommands{%
+  \let\defcv = \relax
+  \let\deffn = \relax
+  \let\deffnx = \relax
+  \let\defindex = \relax
+  \let\defivar = \relax
+  \let\defmac = \relax
+  \let\defmethod = \relax
+  \let\defop = \relax
+  \let\defopt = \relax
+  \let\defspec = \relax
+  \let\deftp = \relax
+  \let\deftypefn = \relax
+  \let\deftypefun = \relax
+  \let\deftypevar = \relax
+  \let\deftypevr = \relax
+  \let\defun = \relax
+  \let\defvar = \relax
+  \let\defvr = \relax
+  \let\ref = \relax
+  \let\xref = \relax
+  \let\printindex = \relax
+  \let\pxref = \relax
+  \let\settitle = \relax
+  \let\include = \relax
+  \let\lowersections = \relax
+  \let\down = \relax
+  \let\raisesections = \relax
+  \let\up = \relax
+  \let\set = \relax
+  \let\clear = \relax
+}
+
+% Ignore @ignore ... @end ignore.
+%
+\def\ignore{\doignore{ignore}}
+
+% Also ignore @ifinfo, @menu, and @direntry text.
+%
+\def\ifinfo{\doignore{ifinfo}}
+\def\menu{\doignore{menu}}
+\def\direntry{\doignore{direntry}}
+
+% Ignore text until a line `@end #1'.
+%
+\def\doignore#1{\begingroup
+  % Don't complain about control sequences we have declared \outer.
+  \ignoresections
+  %
+  % Define a command to swallow text until we reach `@end #1'.
+  \long\def\doignoretext##1\end #1{\enddoignore}%
+  %
+  % Make sure that spaces turn into tokens that match what \doignoretext wants.
+  \catcode32 = 10
+  %
+  % And now expand that command.
+  \doignoretext
+}
+
+% What we do to finish off ignored text.
+%
+\def\enddoignore{\endgroup\ignorespaces}%
+
+\newif\ifwarnedobs\warnedobsfalse
+\def\obstexwarn{%
+  \ifwarnedobs\relax\else
+  % We need to warn folks that they may have trouble with TeX 3.0.
+  % This uses \immediate\write16 rather than \message to get newlines.
+    \immediate\write16{}
+    \immediate\write16{***WARNING*** for users of Unix TeX 3.0!}
+    \immediate\write16{This manual trips a bug in TeX version 3.0 (tex hangs).}
+    \immediate\write16{If you are running another version of TeX, relax.}
+    \immediate\write16{If you are running Unix TeX 3.0, kill this TeX process.}
+    \immediate\write16{  Then upgrade your TeX installation if you can.}
+    \immediate\write16{If you are stuck with version 3.0, run the}
+    \immediate\write16{  script ``tex3patch'' from the Texinfo distribution}
+    \immediate\write16{  to use a workaround.}
+    \immediate\write16{}
+    \warnedobstrue
+    \fi
+}
+
+% **In TeX 3.0, setting text in \nullfont hangs tex.  For a
+% workaround (which requires the file ``dummy.tfm'' to be installed),
+% uncomment the following line:
+%%%%%\font\nullfont=dummy\let\obstexwarn=\relax
+
+% Ignore text, except that we keep track of conditional commands for
+% purposes of nesting, up to an `@end #1' command.
+%
+\def\nestedignore#1{%
+  \obstexwarn
+  % We must actually expand the ignored text to look for the @end
+  % command, so that nested ignore constructs work.  Thus, we put the
+  % text into a \vbox and then do nothing with the result.  To minimize
+  % the change of memory overflow, we follow the approach outlined on
+  % page 401 of the TeXbook: make the current font be a dummy font.
+  %
+  \setbox0 = \vbox\bgroup
+    % Don't complain about control sequences we have declared \outer.
+    \ignoresections
+    %
+    % Define `@end #1' to end the box, which will in turn undefine the
+    % @end command again.
+    \expandafter\def\csname E#1\endcsname{\egroup\ignorespaces}%
+    %
+    % We are going to be parsing Texinfo commands.  Most cause no
+    % trouble when they are used incorrectly, but some commands do
+    % complicated argument parsing or otherwise get confused, so we
+    % undefine them.
+    %
+    % We can't do anything about stray @-signs, unfortunately;
+    % they'll produce `undefined control sequence' errors.
+    \ignoremorecommands
+    %
+    % Set the current font to be \nullfont, a TeX primitive, and define
+    % all the font commands to also use \nullfont.  We don't use
+    % dummy.tfm, as suggested in the TeXbook, because not all sites
+    % might have that installed.  Therefore, math mode will still
+    % produce output, but that should be an extremely small amount of
+    % stuff compared to the main input.
+    %
+    \nullfont
+    \let\tenrm = \nullfont  \let\tenit = \nullfont  \let\tensl = \nullfont
+    \let\tenbf = \nullfont  \let\tentt = \nullfont  \let\smallcaps = \nullfont
+    \let\tensf = \nullfont
+    %
+    % Don't complain when characters are missing from the fonts.
+    \tracinglostchars = 0
+    %
+    % Don't bother to do space factor calculations.
+    \frenchspacing
+    %
+    % Don't report underfull hboxes.
+    \hbadness = 10000
+    %
+    % Do minimal line-breaking.
+    \pretolerance = 10000
+    %
+    % Do not execute instructions in @tex
+    \def\tex{\doignore{tex}}
+}
+
+% @set VAR sets the variable VAR to an empty value.
+% @set VAR REST-OF-LINE sets VAR to the value REST-OF-LINE.
+%
+% Since we want to separate VAR from REST-OF-LINE (which might be
+% empty), we can't just use \parsearg; we have to insert a space of our
+% own to delimit the rest of the line, and then take it out again if we
+% didn't need it.
+%
+\def\set{\parsearg\setxxx}
+\def\setxxx#1{\setyyy#1 \endsetyyy}
+\def\setyyy#1 #2\endsetyyy{%
+  \def\temp{#2}%
+  \ifx\temp\empty \global\expandafter\let\csname SET#1\endcsname = \empty
+  \else \setzzz{#1}#2\endsetzzz % Remove the trailing space \setxxx inserted.
+  \fi
+}
+\def\setzzz#1#2 \endsetzzz{\expandafter\xdef\csname SET#1\endcsname{#2}}
+
+% @clear VAR clears (i.e., unsets) the variable VAR.
+%
+\def\clear{\parsearg\clearxxx}
+\def\clearxxx#1{\global\expandafter\let\csname SET#1\endcsname=\relax}
+
+% @value{foo} gets the text saved in variable foo.
+%
+\def\value#1{\expandafter
+		\ifx\csname SET#1\endcsname\relax
+			{\{No value for ``#1''\}}
+		\else \csname SET#1\endcsname \fi}
+
+% @ifset VAR ... @end ifset reads the `...' iff VAR has been defined
+% with @set.
+%
+\def\ifset{\parsearg\ifsetxxx}
+\def\ifsetxxx #1{%
+  \expandafter\ifx\csname SET#1\endcsname\relax
+    \expandafter\ifsetfail
+  \else
+    \expandafter\ifsetsucceed
+  \fi
+}
+\def\ifsetsucceed{\conditionalsucceed{ifset}}
+\def\ifsetfail{\nestedignore{ifset}}
+\defineunmatchedend{ifset}
+
+% @ifclear VAR ... @end ifclear reads the `...' iff VAR has never been
+% defined with @set, or has been undefined with @clear.
+%
+\def\ifclear{\parsearg\ifclearxxx}
+\def\ifclearxxx #1{%
+  \expandafter\ifx\csname SET#1\endcsname\relax
+    \expandafter\ifclearsucceed
+  \else
+    \expandafter\ifclearfail
+  \fi
+}
+\def\ifclearsucceed{\conditionalsucceed{ifclear}}
+\def\ifclearfail{\nestedignore{ifclear}}
+\defineunmatchedend{ifclear}
+
+% @iftex always succeeds; we read the text following, through @end
+% iftex).  But `@end iftex' should be valid only after an @iftex.
+%
+\def\iftex{\conditionalsucceed{iftex}}
+\defineunmatchedend{iftex}
+
+% We can't just want to start a group at @iftex (for example) and end it
+% at @end iftex, since then @set commands inside the conditional have no
+% effect (they'd get reverted at the end of the group).  So we must
+% define \Eiftex to redefine itself to be its previous value.  (We can't
+% just define it to fail again with an ``unmatched end'' error, since
+% the @ifset might be nested.)
+%
+\def\conditionalsucceed#1{%
+  \edef\temp{%
+    % Remember the current value of \E#1.
+    \let\nece{prevE#1} = \nece{E#1}%
+    %
+    % At the `@end #1', redefine \E#1 to be its previous value.
+    \def\nece{E#1}{\let\nece{E#1} = \nece{prevE#1}}%
+  }%
+  \temp
+}
+
+% We need to expand lots of \csname's, but we don't want to expand the
+% control sequences after we've constructed them.
+%
+\def\nece#1{\expandafter\noexpand\csname#1\endcsname}
+
+% @asis just yields its argument.  Used with @table, for example.
+%
+\def\asis#1{#1}
+
+% @math means output in math mode.
+% We don't use $'s directly in the definition of \math because control
+% sequences like \math are expanded when the toc file is written.  Then,
+% we read the toc file back, the $'s will be normal characters (as they
+% should be, according to the definition of Texinfo).  So we must use a
+% control sequence to switch into and out of math mode.
+%
+% This isn't quite enough for @math to work properly in indices, but it
+% seems unlikely it will ever be needed there.
+%
+\let\implicitmath = $
+\def\math#1{\implicitmath #1\implicitmath}
+
+% @bullet and @minus need the same treatment as @math, just above.
+\def\bullet{\implicitmath\ptexbullet\implicitmath}
+\def\minus{\implicitmath-\implicitmath}
+
+\def\node{\ENVcheck\parsearg\nodezzz}
+\def\nodezzz#1{\nodexxx [#1,]}
+\def\nodexxx[#1,#2]{\gdef\lastnode{#1}}
+\let\nwnode=\node
+\let\lastnode=\relax
+
+\def\donoderef{\ifx\lastnode\relax\else
+\expandafter\expandafter\expandafter\setref{\lastnode}\fi
+\let\lastnode=\relax}
+
+\def\unnumbnoderef{\ifx\lastnode\relax\else
+\expandafter\expandafter\expandafter\unnumbsetref{\lastnode}\fi
+\let\lastnode=\relax}
+
+\def\appendixnoderef{\ifx\lastnode\relax\else
+\expandafter\expandafter\expandafter\appendixsetref{\lastnode}\fi
+\let\lastnode=\relax}
+
+\let\refill=\relax
+
+% @setfilename is done at the beginning of every texinfo file.
+% So open here the files we need to have open while reading the input.
+% This makes it possible to make a .fmt file for texinfo.
+\def\setfilename{%
+   \readauxfile
+   \opencontents
+   \openindices
+   \fixbackslash  % Turn off hack to swallow `\input texinfo'.
+   \global\let\setfilename=\comment % Ignore extra @setfilename cmds.
+   \comment % Ignore the actual filename.
+}
+
+\outer\def\bye{\pagealignmacro\tracingstats=1\ptexend}
+
+\def\inforef #1{\inforefzzz #1,,,,**}
+\def\inforefzzz #1,#2,#3,#4**{See Info file \file{\ignorespaces #3{}},
+  node \samp{\ignorespaces#1{}}}
+
+\message{fonts,}
+
+% Font-change commands.
+
+% Texinfo supports the sans serif font style, which plain TeX does not.
+% So we set up a \sf analogous to plain's \rm, etc.
+\newfam\sffam
+\def\sf{\fam=\sffam \tensf}
+\let\li = \sf % Sometimes we call it \li, not \sf.
+
+%% Try out Computer Modern fonts at \magstephalf
+\let\mainmagstep=\magstephalf
+
+\ifx\bigger\relax
+\let\mainmagstep=\magstep1
+\font\textrm=cmr12
+\font\texttt=cmtt12
+\else
+\font\textrm=cmr10 scaled \mainmagstep
+\font\texttt=cmtt10 scaled \mainmagstep
+\fi
+% Instead of cmb10, you many want to use cmbx10.
+% cmbx10 is a prettier font on its own, but cmb10
+% looks better when embedded in a line with cmr10.
+\font\textbf=cmb10 scaled \mainmagstep
+\font\textit=cmti10 scaled \mainmagstep
+\font\textsl=cmsl10 scaled \mainmagstep
+\font\textsf=cmss10 scaled \mainmagstep
+\font\textsc=cmcsc10 scaled \mainmagstep
+\font\texti=cmmi10 scaled \mainmagstep
+\font\textsy=cmsy10 scaled \mainmagstep
+
+% A few fonts for @defun, etc.
+\font\defbf=cmbx10 scaled \magstep1 %was 1314
+\font\deftt=cmtt10 scaled \magstep1
+\def\df{\let\tentt=\deftt \let\tenbf = \defbf \bf}
+
+% Fonts for indices and small examples.
+% We actually use the slanted font rather than the italic,
+% because texinfo normally uses the slanted fonts for that.
+% Do not make many font distinctions in general in the index, since they
+% aren't very useful.
+\font\ninett=cmtt9
+\font\indrm=cmr9
+\font\indit=cmsl9
+\let\indsl=\indit
+\let\indtt=\ninett
+\let\indsf=\indrm
+\let\indbf=\indrm
+\let\indsc=\indrm
+\font\indi=cmmi9
+\font\indsy=cmsy9
+
+% Fonts for headings
+\font\chaprm=cmbx12 scaled \magstep2
+\font\chapit=cmti12 scaled \magstep2
+\font\chapsl=cmsl12 scaled \magstep2
+\font\chaptt=cmtt12 scaled \magstep2
+\font\chapsf=cmss12 scaled \magstep2
+\let\chapbf=\chaprm
+\font\chapsc=cmcsc10 scaled\magstep3
+\font\chapi=cmmi12 scaled \magstep2
+\font\chapsy=cmsy10 scaled \magstep3
+
+\font\secrm=cmbx12 scaled \magstep1
+\font\secit=cmti12 scaled \magstep1
+\font\secsl=cmsl12 scaled \magstep1
+\font\sectt=cmtt12 scaled \magstep1
+\font\secsf=cmss12 scaled \magstep1
+\font\secbf=cmbx12 scaled \magstep1
+\font\secsc=cmcsc10 scaled\magstep2
+\font\seci=cmmi12 scaled \magstep1
+\font\secsy=cmsy10 scaled \magstep2
+
+% \font\ssecrm=cmbx10 scaled \magstep1    % This size an font looked bad.
+% \font\ssecit=cmti10 scaled \magstep1    % The letters were too crowded.
+% \font\ssecsl=cmsl10 scaled \magstep1
+% \font\ssectt=cmtt10 scaled \magstep1
+% \font\ssecsf=cmss10 scaled \magstep1
+
+%\font\ssecrm=cmb10 scaled 1315	% Note the use of cmb rather than cmbx.
+%\font\ssecit=cmti10 scaled 1315	% Also, the size is a little larger than
+%\font\ssecsl=cmsl10 scaled 1315	% being scaled magstep1.
+%\font\ssectt=cmtt10 scaled 1315
+%\font\ssecsf=cmss10 scaled 1315
+
+%\let\ssecbf=\ssecrm
+
+\font\ssecrm=cmbx12 scaled \magstephalf
+\font\ssecit=cmti12 scaled \magstephalf
+\font\ssecsl=cmsl12 scaled \magstephalf
+\font\ssectt=cmtt12 scaled \magstephalf
+\font\ssecsf=cmss12 scaled \magstephalf
+\font\ssecbf=cmbx12 scaled \magstephalf
+\font\ssecsc=cmcsc10 scaled \magstep1
+\font\sseci=cmmi12 scaled \magstephalf
+\font\ssecsy=cmsy10 scaled \magstep1
+% The smallcaps and symbol fonts should actually be scaled \magstep1.5,
+% but that is not a standard magnification.
+
+% Fonts for title page:
+\font\titlerm = cmbx12 scaled \magstep3
+\let\authorrm = \secrm
+
+% In order for the font changes to affect most math symbols and letters,
+% we have to define the \textfont of the standard families.  Since
+% texinfo doesn't allow for producing subscripts and superscripts, we
+% don't bother to reset \scriptfont and \scriptscriptfont (which would
+% also require loading a lot more fonts).
+%
+\def\resetmathfonts{%
+  \textfont0 = \tenrm \textfont1 = \teni \textfont2 = \tensy
+  \textfont\itfam = \tenit \textfont\slfam = \tensl \textfont\bffam = \tenbf
+  \textfont\ttfam = \tentt \textfont\sffam = \tensf
+}
+
+
+% The font-changing commands redefine the meanings of \tenSTYLE, instead
+% of just \STYLE.  We do this so that font changes will continue to work
+% in math mode, where it is the current \fam that is relevant in most
+% cases, not the current.  Plain TeX does, for example,
+% \def\bf{\fam=\bffam \tenbf}  By redefining \tenbf, we obviate the need
+% to redefine \bf itself.
+\def\textfonts{%
+  \let\tenrm=\textrm \let\tenit=\textit \let\tensl=\textsl
+  \let\tenbf=\textbf \let\tentt=\texttt \let\smallcaps=\textsc
+  \let\tensf=\textsf \let\teni=\texti \let\tensy=\textsy
+  \resetmathfonts}
+\def\chapfonts{%
+  \let\tenrm=\chaprm \let\tenit=\chapit \let\tensl=\chapsl
+  \let\tenbf=\chapbf \let\tentt=\chaptt \let\smallcaps=\chapsc
+  \let\tensf=\chapsf \let\teni=\chapi \let\tensy=\chapsy
+  \resetmathfonts}
+\def\secfonts{%
+  \let\tenrm=\secrm \let\tenit=\secit \let\tensl=\secsl
+  \let\tenbf=\secbf \let\tentt=\sectt \let\smallcaps=\secsc
+  \let\tensf=\secsf \let\teni=\seci \let\tensy=\secsy
+  \resetmathfonts}
+\def\subsecfonts{%
+  \let\tenrm=\ssecrm \let\tenit=\ssecit \let\tensl=\ssecsl
+  \let\tenbf=\ssecbf \let\tentt=\ssectt \let\smallcaps=\ssecsc
+  \let\tensf=\ssecsf \let\teni=\sseci \let\tensy=\ssecsy
+  \resetmathfonts}
+\def\indexfonts{%
+  \let\tenrm=\indrm \let\tenit=\indit \let\tensl=\indsl
+  \let\tenbf=\indbf \let\tentt=\indtt \let\smallcaps=\indsc
+  \let\tensf=\indsf \let\teni=\indi \let\tensy=\indsy
+  \resetmathfonts}
+
+% Set up the default fonts, so we can use them for creating boxes.
+%
+\textfonts
+
+% Count depth in font-changes, for error checks
+\newcount\fontdepth \fontdepth=0
+
+% Fonts for short table of contents.
+\font\shortcontrm=cmr12
+\font\shortcontbf=cmbx12
+\font\shortcontsl=cmsl12
+
+%% Add scribe-like font environments, plus @l for inline lisp (usually sans
+%% serif) and @ii for TeX italic
+
+% \smartitalic{ARG} outputs arg in italics, followed by an italic correction
+% unless the following character is such as not to need one.
+\def\smartitalicx{\ifx\next,\else\ifx\next-\else\ifx\next.\else\/\fi\fi\fi}
+\def\smartitalic#1{{\sl #1}\futurelet\next\smartitalicx}
+
+\let\i=\smartitalic
+\let\var=\smartitalic
+\let\dfn=\smartitalic
+\let\emph=\smartitalic
+\let\cite=\smartitalic
+
+\def\b#1{{\bf #1}}
+\let\strong=\b
+
+% We can't just use \exhyphenpenalty, because that only has effect at
+% the end of a paragraph.  Restore normal hyphenation at the end of the
+% group within which \nohyphenation is presumably called.
+%
+\def\nohyphenation{\hyphenchar\font = -1  \aftergroup\restorehyphenation}
+\def\restorehyphenation{\hyphenchar\font = `- }
+
+\def\t#1{%
+  {\tt \nohyphenation \rawbackslash \frenchspacing #1}%
+  \null
+}
+\let\ttfont = \t
+%\def\samp #1{`{\tt \rawbackslash \frenchspacing #1}'\null}
+\def\samp #1{`\tclose{#1}'\null}
+\def\key #1{{\tt \nohyphenation \uppercase{#1}}\null}
+\def\ctrl #1{{\tt \rawbackslash \hat}#1}
+
+\let\file=\samp
+
+% @code is a modification of @t,
+% which makes spaces the same size as normal in the surrounding text.
+\def\tclose#1{%
+  {%
+    % Change normal interword space to be same as for the current font.
+    \spaceskip = \fontdimen2\font
+    %
+    % Switch to typewriter.
+    \tt
+    %
+    % But `\ ' produces the large typewriter interword space.
+    \def\ {{\spaceskip = 0pt{} }}%
+    %
+    % Turn off hyphenation.
+    \nohyphenation
+    %
+    \rawbackslash
+    \frenchspacing
+    #1%
+  }%
+  \null
+}
+
+% We *must* turn on hyphenation at `-' and `_' in \code.
+% Otherwise, it is too hard to avoid overful hboxes
+% in the Emacs manual, the Library manual, etc.
+
+% Unfortunately, TeX uses one parameter (\hyphenchar) to control
+% both hyphenation at - and hyphenation within words.
+% We must therefore turn them both off (\tclose does that)
+% and arrange explicitly to hyphenate an a dash.
+%  -- rms.
+{
+\catcode `\-=\active
+\catcode `\_=\active
+\global\def\code{\begingroup \catcode `\-=\active \let-\codedash \let_\codeunder \codex}
+}
+\def\codedash{-\discretionary{}{}{}}
+\def\codeunder{\normalunderscore\discretionary{}{}{}}
+\def\codex #1{\tclose{#1}\endgroup}
+
+%\let\exp=\tclose  %Was temporary
+
+% @kbd is like @code, except that if the argument is just one @key command,
+% then @kbd has no effect.
+
+\def\xkey{\key}
+\def\kbdfoo#1#2#3\par{\def\one{#1}\def\three{#3}\def\threex{??}%
+\ifx\one\xkey\ifx\threex\three \key{#2}%
+\else\tclose{\look}\fi
+\else\tclose{\look}\fi}
+
+% Typeset a dimension, e.g., `in' or `pt'.  The only reason for the
+% argument is to make the input look right: @dmn{pt} instead of
+% @dmn{}pt.
+%
+\def\dmn#1{\thinspace #1}
+
+\def\kbd#1{\def\look{#1}\expandafter\kbdfoo\look??\par}
+
+\def\l#1{{\li #1}\null}		%
+
+\def\r#1{{\rm #1}}		% roman font
+% Use of \lowercase was suggested.
+\def\sc#1{{\smallcaps#1}}	% smallcaps font
+\def\ii#1{{\it #1}}		% italic font
+
+\message{page headings,}
+
+\newskip\titlepagetopglue \titlepagetopglue = 1.5in
+\newskip\titlepagebottomglue \titlepagebottomglue = 2pc
+
+% First the title page.  Must do @settitle before @titlepage.
+\def\titlefont#1{{\titlerm #1}}
+
+\newif\ifseenauthor
+\newif\iffinishedtitlepage
+
+\def\shorttitlepage{\parsearg\shorttitlepagezzz}
+\def\shorttitlepagezzz #1{\begingroup\hbox{}\vskip 1.5in \chaprm \centerline{#1}%
+	\endgroup\page\hbox{}\page}
+
+\def\titlepage{\begingroup \parindent=0pt \textfonts
+   \let\subtitlerm=\tenrm
+% I deinstalled the following change because \cmr12 is undefined.
+% This change was not in the ChangeLog anyway.  --rms.
+%   \let\subtitlerm=\cmr12
+   \def\subtitlefont{\subtitlerm \normalbaselineskip = 13pt \normalbaselines}%
+   %
+   \def\authorfont{\authorrm \normalbaselineskip = 16pt \normalbaselines}%
+   %
+   % Leave some space at the very top of the page.
+   \vglue\titlepagetopglue
+   %
+   % Now you can print the title using @title.
+   \def\title{\parsearg\titlezzz}%
+   \def\titlezzz##1{\leftline{\titlefont{##1}}
+		    % print a rule at the page bottom also.
+		    \finishedtitlepagefalse
+		    \vskip4pt \hrule height 4pt \vskip4pt}%
+   % No rule at page bottom unless we print one at the top with @title.
+   \finishedtitlepagetrue
+   %
+   % Now you can put text using @subtitle.
+   \def\subtitle{\parsearg\subtitlezzz}%
+   \def\subtitlezzz##1{{\subtitlefont \rightline{##1}}}%
+   %
+   % @author should come last, but may come many times.
+   \def\author{\parsearg\authorzzz}%
+   \def\authorzzz##1{\ifseenauthor\else\vskip 0pt plus 1filll\seenauthortrue\fi
+      {\authorfont \leftline{##1}}}%
+   %
+   % Most title ``pages'' are actually two pages long, with space
+   % at the top of the second.  We don't want the ragged left on the second.
+   \let\oldpage = \page
+   \def\page{%
+      \iffinishedtitlepage\else
+	 \finishtitlepage
+      \fi
+      \oldpage
+      \let\page = \oldpage
+      \hbox{}}%
+%   \def\page{\oldpage \hbox{}}
+}
+
+\def\Etitlepage{%
+   \iffinishedtitlepage\else
+      \finishtitlepage
+   \fi
+   % It is important to do the page break before ending the group,
+   % because the headline and footline are only empty inside the group.
+   % If we use the new definition of \page, we always get a blank page
+   % after the title page, which we certainly don't want.
+   \oldpage
+   \endgroup
+   \HEADINGSon
+}
+
+\def\finishtitlepage{%
+   \vskip4pt \hrule height 2pt
+   \vskip\titlepagebottomglue
+   \finishedtitlepagetrue
+}
+
+%%% Set up page headings and footings.
+
+\let\thispage=\folio
+
+\newtoks \evenheadline    % Token sequence for heading line of even pages
+\newtoks \oddheadline     % Token sequence for heading line of odd pages
+\newtoks \evenfootline    % Token sequence for footing line of even pages
+\newtoks \oddfootline     % Token sequence for footing line of odd pages
+
+% Now make Tex use those variables
+\headline={{\textfonts\rm \ifodd\pageno \the\oddheadline
+                            \else \the\evenheadline \fi}}
+\footline={{\textfonts\rm \ifodd\pageno \the\oddfootline
+                            \else \the\evenfootline \fi}\HEADINGShook}
+\let\HEADINGShook=\relax
+
+% Commands to set those variables.
+% For example, this is what  @headings on  does
+% @evenheading @thistitle|@thispage|@thischapter
+% @oddheading @thischapter|@thispage|@thistitle
+% @evenfooting @thisfile||
+% @oddfooting ||@thisfile
+
+\def\evenheading{\parsearg\evenheadingxxx}
+\def\oddheading{\parsearg\oddheadingxxx}
+\def\everyheading{\parsearg\everyheadingxxx}
+
+\def\evenfooting{\parsearg\evenfootingxxx}
+\def\oddfooting{\parsearg\oddfootingxxx}
+\def\everyfooting{\parsearg\everyfootingxxx}
+
+{\catcode`\@=0 %
+
+\gdef\evenheadingxxx #1{\evenheadingyyy #1@|@|@|@|\finish}
+\gdef\evenheadingyyy #1@|#2@|#3@|#4\finish{%
+\global\evenheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}}}
+
+\gdef\oddheadingxxx #1{\oddheadingyyy #1@|@|@|@|\finish}
+\gdef\oddheadingyyy #1@|#2@|#3@|#4\finish{%
+\global\oddheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}}}
+
+\gdef\everyheadingxxx #1{\everyheadingyyy #1@|@|@|@|\finish}
+\gdef\everyheadingyyy #1@|#2@|#3@|#4\finish{%
+\global\evenheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}}
+\global\oddheadline={\rlap{\centerline{#2}}\line{#1\hfil#3}}}
+
+\gdef\evenfootingxxx #1{\evenfootingyyy #1@|@|@|@|\finish}
+\gdef\evenfootingyyy #1@|#2@|#3@|#4\finish{%
+\global\evenfootline={\rlap{\centerline{#2}}\line{#1\hfil#3}}}
+
+\gdef\oddfootingxxx #1{\oddfootingyyy #1@|@|@|@|\finish}
+\gdef\oddfootingyyy #1@|#2@|#3@|#4\finish{%
+\global\oddfootline={\rlap{\centerline{#2}}\line{#1\hfil#3}}}
+
+\gdef\everyfootingxxx #1{\everyfootingyyy #1@|@|@|@|\finish}
+\gdef\everyfootingyyy #1@|#2@|#3@|#4\finish{%
+\global\evenfootline={\rlap{\centerline{#2}}\line{#1\hfil#3}}
+\global\oddfootline={\rlap{\centerline{#2}}\line{#1\hfil#3}}}
+%
+}% unbind the catcode of @.
+
+% @headings double	turns headings on for double-sided printing.
+% @headings single	turns headings on for single-sided printing.
+% @headings off		turns them off.
+% @headings on		same as @headings double, retained for compatibility.
+% @headings after	turns on double-sided headings after this page.
+% @headings doubleafter	turns on double-sided headings after this page.
+% @headings singleafter turns on single-sided headings after this page.
+% By default, they are off.
+
+\def\headings #1 {\csname HEADINGS#1\endcsname}
+
+\def\HEADINGSoff{
+\global\evenheadline={\hfil} \global\evenfootline={\hfil}
+\global\oddheadline={\hfil} \global\oddfootline={\hfil}}
+\HEADINGSoff
+% When we turn headings on, set the page number to 1.
+% For double-sided printing, put current file name in lower left corner,
+% chapter name on inside top of right hand pages, document
+% title on inside top of left hand pages, and page numbers on outside top
+% edge of all pages.
+\def\HEADINGSdouble{
+%\pagealignmacro
+\global\pageno=1
+\global\evenfootline={\hfil}
+\global\oddfootline={\hfil}
+\global\evenheadline={\line{\folio\hfil\thistitle}}
+\global\oddheadline={\line{\thischapter\hfil\folio}}
+}
+% For single-sided printing, chapter title goes across top left of page,
+% page number on top right.
+\def\HEADINGSsingle{
+%\pagealignmacro
+\global\pageno=1
+\global\evenfootline={\hfil}
+\global\oddfootline={\hfil}
+\global\evenheadline={\line{\thischapter\hfil\folio}}
+\global\oddheadline={\line{\thischapter\hfil\folio}}
+}
+\def\HEADINGSon{\HEADINGSdouble}
+
+\def\HEADINGSafter{\let\HEADINGShook=\HEADINGSdoublex}
+\let\HEADINGSdoubleafter=\HEADINGSafter
+\def\HEADINGSdoublex{%
+\global\evenfootline={\hfil}
+\global\oddfootline={\hfil}
+\global\evenheadline={\line{\folio\hfil\thistitle}}
+\global\oddheadline={\line{\thischapter\hfil\folio}}
+}
+
+\def\HEADINGSsingleafter{\let\HEADINGShook=\HEADINGSsinglex}
+\def\HEADINGSsinglex{%
+\global\evenfootline={\hfil}
+\global\oddfootline={\hfil}
+\global\evenheadline={\line{\thischapter\hfil\folio}}
+\global\oddheadline={\line{\thischapter\hfil\folio}}
+}
+
+% Subroutines used in generating headings
+% Produces Day Month Year style of output.
+\def\today{\number\day\space
+\ifcase\month\or
+January\or February\or March\or April\or May\or June\or
+July\or August\or September\or October\or November\or December\fi
+\space\number\year}
+
+% Use this if you want the Month Day, Year style of output.
+%\def\today{\ifcase\month\or
+%January\or February\or March\or April\or May\or June\or
+%July\or August\or September\or October\or November\or December\fi
+%\space\number\day, \number\year}
+
+% @settitle line...  specifies the title of the document, for headings
+% It generates no output of its own
+
+\def\thistitle{No Title}
+\def\settitle{\parsearg\settitlezzz}
+\def\settitlezzz #1{\gdef\thistitle{#1}}
+
+\message{tables,}
+
+% @tabs -- simple alignment
+
+% These don't work.  For one thing, \+ is defined as outer.
+% So these macros cannot even be defined.
+
+%\def\tabs{\parsearg\tabszzz}
+%\def\tabszzz #1{\settabs\+#1\cr}
+%\def\tabline{\parsearg\tablinezzz}
+%\def\tablinezzz #1{\+#1\cr}
+%\def\&{&}
+
+% Tables -- @table, @ftable, @vtable, @item(x), @kitem(x), @xitem(x).
+
+% default indentation of table text
+\newdimen\tableindent \tableindent=.8in
+% default indentation of @itemize and @enumerate text
+\newdimen\itemindent  \itemindent=.3in
+% margin between end of table item and start of table text.
+\newdimen\itemmargin  \itemmargin=.1in
+
+% used internally for \itemindent minus \itemmargin
+\newdimen\itemmax
+
+% Note @table, @vtable, and @vtable define @item, @itemx, etc., with
+% these defs.
+% They also define \itemindex
+% to index the item name in whatever manner is desired (perhaps none).
+
+\def\internalBitem{\smallbreak \parsearg\itemzzz}
+\def\internalBitemx{\par \parsearg\itemzzz}
+
+\def\internalBxitem "#1"{\def\xitemsubtopix{#1} \smallbreak \parsearg\xitemzzz}
+\def\internalBxitemx "#1"{\def\xitemsubtopix{#1} \par \parsearg\xitemzzz}
+
+\def\internalBkitem{\smallbreak \parsearg\kitemzzz}
+\def\internalBkitemx{\par \parsearg\kitemzzz}
+
+\def\kitemzzz #1{\dosubind {kw}{\code{#1}}{for {\bf \lastfunction}}%
+                 \itemzzz {#1}}
+
+\def\xitemzzz #1{\dosubind {kw}{\code{#1}}{for {\bf \xitemsubtopic}}%
+                 \itemzzz {#1}}
+
+\def\itemzzz #1{\begingroup %
+  \advance\hsize by -\rightskip
+  \advance\hsize by -\tableindent
+  \setbox0=\hbox{\itemfont{#1}}%
+  \itemindex{#1}%
+  \nobreak % This prevents a break before @itemx.
+  %
+  % Be sure we are not still in the middle of a paragraph.
+  {\parskip = 0in
+  \par
+  }%
+  %
+  % If the item text does not fit in the space we have, put it on a line
+  % by itself, and do not allow a page break either before or after that
+  % line.  We do not start a paragraph here because then if the next
+  % command is, e.g., @kindex, the whatsit would get put into the
+  % horizontal list on a line by itself, resulting in extra blank space.
+  \ifdim \wd0>\itemmax
+    \setbox0=\hbox{\hskip \leftskip \hskip -\tableindent \unhbox0}\box0
+    %
+    % We're going to be starting a paragraph, but we don't want the
+    % \parskip glue -- logically it's part of the @item we just started.
+    \nobreak \vskip-\parskip
+    %
+    % Stop a page break at the \parskip glue coming up.  Unfortunately
+    % we can't prevent a possible page break at the following
+    % \baselineskip glue.
+    \nobreak
+  \else
+    % The item text fits into the space.  Start a paragraph, so that the
+    % following text (if any) will end up on the same line.  Since that
+    % text will be indented by \tableindent, we make the item text be in
+    % a zero-width box.
+    \noindent
+    \rlap{\hskip -\tableindent\box0}%
+  \fi
+  \endgroup
+}
+
+\def\item{\errmessage{@item while not in a table}}
+\def\itemx{\errmessage{@itemx while not in a table}}
+\def\kitem{\errmessage{@kitem while not in a table}}
+\def\kitemx{\errmessage{@kitemx while not in a table}}
+\def\xitem{\errmessage{@xitem while not in a table}}
+\def\xitemx{\errmessage{@xitemx while not in a table}}
+
+%% Contains a kludge to get @end[description] to work
+\def\description{\tablez{\dontindex}{1}{}{}{}{}}
+
+\def\table{\begingroup\inENV\obeylines\obeyspaces\tablex}
+{\obeylines\obeyspaces%
+\gdef\tablex #1^^M{%
+\tabley\dontindex#1        \endtabley}}
+
+\def\ftable{\begingroup\inENV\obeylines\obeyspaces\ftablex}
+{\obeylines\obeyspaces%
+\gdef\ftablex #1^^M{%
+\tabley\fnitemindex#1        \endtabley
+\def\Eftable{\endgraf\afterenvbreak\endgroup}%
+\let\Etable=\relax}}
+
+\def\vtable{\begingroup\inENV\obeylines\obeyspaces\vtablex}
+{\obeylines\obeyspaces%
+\gdef\vtablex #1^^M{%
+\tabley\vritemindex#1        \endtabley
+\def\Evtable{\endgraf\afterenvbreak\endgroup}%
+\let\Etable=\relax}}
+
+\def\dontindex #1{}
+\def\fnitemindex #1{\doind {fn}{\code{#1}}}%
+\def\vritemindex #1{\doind {vr}{\code{#1}}}%
+
+{\obeyspaces %
+\gdef\tabley#1#2 #3 #4 #5 #6 #7\endtabley{\endgroup%
+\tablez{#1}{#2}{#3}{#4}{#5}{#6}}}
+
+\def\tablez #1#2#3#4#5#6{%
+\aboveenvbreak %
+\begingroup %
+\def\Edescription{\Etable}% Neccessary kludge.
+\let\itemindex=#1%
+\ifnum 0#3>0 \advance \leftskip by #3\mil \fi %
+\ifnum 0#4>0 \tableindent=#4\mil \fi %
+\ifnum 0#5>0 \advance \rightskip by #5\mil \fi %
+\def\itemfont{#2}%
+\itemmax=\tableindent %
+\advance \itemmax by -\itemmargin %
+\advance \leftskip by \tableindent %
+\exdentamount=\tableindent
+\parindent = 0pt
+\parskip = \smallskipamount
+\ifdim \parskip=0pt \parskip=2pt \fi%
+\def\Etable{\endgraf\afterenvbreak\endgroup}%
+\let\item = \internalBitem %
+\let\itemx = \internalBitemx %
+\let\kitem = \internalBkitem %
+\let\kitemx = \internalBkitemx %
+\let\xitem = \internalBxitem %
+\let\xitemx = \internalBxitemx %
+}
+
+% This is the counter used by @enumerate, which is really @itemize
+
+\newcount \itemno
+
+\def\itemize{\parsearg\itemizezzz}
+
+\def\itemizezzz #1{%
+  \begingroup % ended by the @end itemsize
+  \itemizey {#1}{\Eitemize}
+}
+
+\def\itemizey #1#2{%
+\aboveenvbreak %
+\itemmax=\itemindent %
+\advance \itemmax by -\itemmargin %
+\advance \leftskip by \itemindent %
+\exdentamount=\itemindent
+\parindent = 0pt %
+\parskip = \smallskipamount %
+\ifdim \parskip=0pt \parskip=2pt \fi%
+\def#2{\endgraf\afterenvbreak\endgroup}%
+\def\itemcontents{#1}%
+\let\item=\itemizeitem}
+
+% Set sfcode to normal for the chars that usually have another value.
+% These are `.?!:;,'
+\def\frenchspacing{\sfcode46=1000 \sfcode63=1000 \sfcode33=1000
+  \sfcode58=1000 \sfcode59=1000 \sfcode44=1000 }
+
+% \splitoff TOKENS\endmark defines \first to be the first token in
+% TOKENS, and \rest to be the remainder.
+%
+\def\splitoff#1#2\endmark{\def\first{#1}\def\rest{#2}}%
+
+% Allow an optional argument of an uppercase letter, lowercase letter,
+% or number, to specify the first label in the enumerated list.  No
+% argument is the same as `1'.
+%
+\def\enumerate{\parsearg\enumeratezzz}
+\def\enumeratezzz #1{\enumeratey #1  \endenumeratey}
+\def\enumeratey #1 #2\endenumeratey{%
+  \begingroup % ended by the @end enumerate
+  %
+  % If we were given no argument, pretend we were given `1'.
+  \def\thearg{#1}%
+  \ifx\thearg\empty \def\thearg{1}\fi
+  %
+  % Detect if the argument is a single token.  If so, it might be a
+  % letter.  Otherwise, the only valid thing it can be is a number.
+  % (We will always have one token, because of the test we just made.
+  % This is a good thing, since \splitoff doesn't work given nothing at
+  % all -- the first parameter is undelimited.)
+  \expandafter\splitoff\thearg\endmark
+  \ifx\rest\empty
+    % Only one token in the argument.  It could still be anything.
+    % A ``lowercase letter'' is one whose \lccode is nonzero.
+    % An ``uppercase letter'' is one whose \lccode is both nonzero, and
+    %   not equal to itself.
+    % Otherwise, we assume it's a number.
+    %
+    % We need the \relax at the end of the \ifnum lines to stop TeX from
+    % continuing to look for a <number>.
+    %
+    \ifnum\lccode\expandafter`\thearg=0\relax
+      \numericenumerate % a number (we hope)
+    \else
+      % It's a letter.
+      \ifnum\lccode\expandafter`\thearg=\expandafter`\thearg\relax
+        \lowercaseenumerate % lowercase letter
+      \else
+        \uppercaseenumerate % uppercase letter
+      \fi
+    \fi
+  \else
+    % Multiple tokens in the argument.  We hope it's a number.
+    \numericenumerate
+  \fi
+}
+
+% An @enumerate whose labels are integers.  The starting integer is
+% given in \thearg.
+%
+\def\numericenumerate{%
+  \itemno = \thearg
+  \startenumeration{\the\itemno}%
+}
+
+% The starting (lowercase) letter is in \thearg.
+\def\lowercaseenumerate{%
+  \itemno = \expandafter`\thearg
+  \startenumeration{%
+    % Be sure we're not beyond the end of the alphabet.
+    \ifnum\itemno=0
+      \errmessage{No more lowercase letters in @enumerate; get a bigger
+                  alphabet}%
+    \fi
+    \char\lccode\itemno
+  }%
+}
+
+% The starting (uppercase) letter is in \thearg.
+\def\uppercaseenumerate{%
+  \itemno = \expandafter`\thearg
+  \startenumeration{%
+    % Be sure we're not beyond the end of the alphabet.
+    \ifnum\itemno=0
+      \errmessage{No more uppercase letters in @enumerate; get a bigger
+                  alphabet}
+    \fi
+    \char\uccode\itemno
+  }%
+}
+
+% Call itemizey, adding a period to the first argument and supplying the
+% common last two arguments.  Also subtract one from the initial value in
+% \itemno, since @item increments \itemno.
+%
+\def\startenumeration#1{%
+  \advance\itemno by -1
+  \itemizey{#1.}\Eenumerate\flushcr
+}
+
+% @alphaenumerate and @capsenumerate are abbreviations for giving an arg
+% to @enumerate.
+%
+\def\alphaenumerate{\enumerate{a}}
+\def\capsenumerate{\enumerate{A}}
+\def\Ealphaenumerate{\Eenumerate}
+\def\Ecapsenumerate{\Eenumerate}
+
+% Definition of @item while inside @itemize.
+
+\def\itemizeitem{%
+\advance\itemno by 1
+{\let\par=\endgraf \smallbreak}%
+\ifhmode \errmessage{\in hmode at itemizeitem}\fi
+{\parskip=0in \hskip 0pt
+\hbox to 0pt{\hss \itemcontents\hskip \itemmargin}%
+\vadjust{\penalty 1200}}%
+\flushcr}
+
+\message{indexing,}
+% Index generation facilities
+
+% Define \newwrite to be identical to plain tex's \newwrite
+% except not \outer, so it can be used within \newindex.
+{\catcode`\@=11
+\gdef\newwrite{\alloc@7\write\chardef\sixt@@n}}
+
+% \newindex {foo} defines an index named foo.
+% It automatically defines \fooindex such that
+% \fooindex ...rest of line... puts an entry in the index foo.
+% It also defines \fooindfile to be the number of the output channel for
+% the file that	accumulates this index.  The file's extension is foo.
+% The name of an index should be no more than 2 characters long
+% for the sake of vms.
+
+\def\newindex #1{
+\expandafter\newwrite \csname#1indfile\endcsname% Define number for output file
+\openout \csname#1indfile\endcsname \jobname.#1	% Open the file
+\expandafter\xdef\csname#1index\endcsname{%	% Define \xxxindex
+\noexpand\doindex {#1}}
+}
+
+% @defindex foo  ==  \newindex{foo}
+
+\def\defindex{\parsearg\newindex}
+
+% Define @defcodeindex, like @defindex except put all entries in @code.
+
+\def\newcodeindex #1{
+\expandafter\newwrite \csname#1indfile\endcsname% Define number for output file
+\openout \csname#1indfile\endcsname \jobname.#1	% Open the file
+\expandafter\xdef\csname#1index\endcsname{%	% Define \xxxindex
+\noexpand\docodeindex {#1}}
+}
+
+\def\defcodeindex{\parsearg\newcodeindex}
+
+% @synindex foo bar    makes index foo feed into index bar.
+% Do this instead of @defindex foo if you don't want it as a separate index.
+\def\synindex #1 #2 {%
+\expandafter\let\expandafter\synindexfoo\expandafter=\csname#2indfile\endcsname
+\expandafter\let\csname#1indfile\endcsname=\synindexfoo
+\expandafter\xdef\csname#1index\endcsname{%	% Define \xxxindex
+\noexpand\doindex {#2}}%
+}
+
+% @syncodeindex foo bar   similar, but put all entries made for index foo
+% inside @code.
+\def\syncodeindex #1 #2 {%
+\expandafter\let\expandafter\synindexfoo\expandafter=\csname#2indfile\endcsname
+\expandafter\let\csname#1indfile\endcsname=\synindexfoo
+\expandafter\xdef\csname#1index\endcsname{%	% Define \xxxindex
+\noexpand\docodeindex {#2}}%
+}
+
+% Define \doindex, the driver for all \fooindex macros.
+% Argument #1 is generated by the calling \fooindex macro,
+%  and it is "foo", the name of the index.
+
+% \doindex just uses \parsearg; it calls \doind for the actual work.
+% This is because \doind is more useful to call from other macros.
+
+% There is also \dosubind {index}{topic}{subtopic}
+% which makes an entry in a two-level index such as the operation index.
+
+\def\doindex#1{\edef\indexname{#1}\parsearg\singleindexer}
+\def\singleindexer #1{\doind{\indexname}{#1}}
+
+% like the previous two, but they put @code around the argument.
+\def\docodeindex#1{\edef\indexname{#1}\parsearg\singlecodeindexer}
+\def\singlecodeindexer #1{\doind{\indexname}{\code{#1}}}
+
+\def\indexdummies{%
+\def\_{{\realbackslash _}}%
+\def\w{\realbackslash w }%
+\def\bf{\realbackslash bf }%
+\def\rm{\realbackslash rm }%
+\def\sl{\realbackslash sl }%
+\def\sf{\realbackslash sf}%
+\def\tt{\realbackslash tt}%
+\def\gtr{\realbackslash gtr}%
+\def\less{\realbackslash less}%
+\def\hat{\realbackslash hat}%
+\def\char{\realbackslash char}%
+\def\TeX{\realbackslash TeX}%
+\def\dots{\realbackslash dots }%
+\def\copyright{\realbackslash copyright }%
+\def\tclose##1{\realbackslash tclose {##1}}%
+\def\code##1{\realbackslash code {##1}}%
+\def\samp##1{\realbackslash samp {##1}}%
+\def\t##1{\realbackslash r {##1}}%
+\def\r##1{\realbackslash r {##1}}%
+\def\i##1{\realbackslash i {##1}}%
+\def\b##1{\realbackslash b {##1}}%
+\def\cite##1{\realbackslash cite {##1}}%
+\def\key##1{\realbackslash key {##1}}%
+\def\file##1{\realbackslash file {##1}}%
+\def\var##1{\realbackslash var {##1}}%
+\def\kbd##1{\realbackslash kbd {##1}}%
+\def\dfn##1{\realbackslash dfn {##1}}%
+\def\emph##1{\realbackslash emph {##1}}%
+}
+
+% \indexnofonts no-ops all font-change commands.
+% This is used when outputting the strings to sort the index by.
+\def\indexdummyfont#1{#1}
+\def\indexdummytex{TeX}
+\def\indexdummydots{...}
+
+\def\indexnofonts{%
+\let\w=\indexdummyfont
+\let\t=\indexdummyfont
+\let\r=\indexdummyfont
+\let\i=\indexdummyfont
+\let\b=\indexdummyfont
+\let\emph=\indexdummyfont
+\let\strong=\indexdummyfont
+\let\cite=\indexdummyfont
+\let\sc=\indexdummyfont
+%Don't no-op \tt, since it isn't a user-level command
+% and is used in the definitions of the active chars like <, >, |...
+%\let\tt=\indexdummyfont
+\let\tclose=\indexdummyfont
+\let\code=\indexdummyfont
+\let\file=\indexdummyfont
+\let\samp=\indexdummyfont
+\let\kbd=\indexdummyfont
+\let\key=\indexdummyfont
+\let\var=\indexdummyfont
+\let\TeX=\indexdummytex
+\let\dots=\indexdummydots
+}
+
+% To define \realbackslash, we must make \ not be an escape.
+% We must first make another character (@) an escape
+% so we do not become unable to do a definition.
+
+{\catcode`\@=0 \catcode`\\=\other
+@gdef@realbackslash{\}}
+
+\let\indexbackslash=0  %overridden during \printindex.
+
+\def\doind #1#2{%
+{\count10=\lastpenalty %
+{\indexdummies % Must do this here, since \bf, etc expand at this stage
+\escapechar=`\\%
+{\let\folio=0% Expand all macros now EXCEPT \folio
+\def\rawbackslashxx{\indexbackslash}% \indexbackslash isn't defined now
+% so it will be output as is; and it will print as backslash in the indx.
+%
+% Now process the index-string once, with all font commands turned off,
+% to get the string to sort the index by.
+{\indexnofonts
+\xdef\temp1{#2}%
+}%
+% Now produce the complete index entry.  We process the index-string again,
+% this time with font commands expanded, to get what to print in the index.
+\edef\temp{%
+\write \csname#1indfile\endcsname{%
+\realbackslash entry {\temp1}{\folio}{#2}}}%
+\temp }%
+}\penalty\count10}}
+
+\def\dosubind #1#2#3{%
+{\count10=\lastpenalty %
+{\indexdummies % Must do this here, since \bf, etc expand at this stage
+\escapechar=`\\%
+{\let\folio=0%
+\def\rawbackslashxx{\indexbackslash}%
+%
+% Now process the index-string once, with all font commands turned off,
+% to get the string to sort the index by.
+{\indexnofonts
+\xdef\temp1{#2 #3}%
+}%
+% Now produce the complete index entry.  We process the index-string again,
+% this time with font commands expanded, to get what to print in the index.
+\edef\temp{%
+\write \csname#1indfile\endcsname{%
+\realbackslash entry {\temp1}{\folio}{#2}{#3}}}%
+\temp }%
+}\penalty\count10}}
+
+% The index entry written in the file actually looks like
+%  \entry {sortstring}{page}{topic}
+% or
+%  \entry {sortstring}{page}{topic}{subtopic}
+% The texindex program reads in these files and writes files
+% containing these kinds of lines:
+%  \initial {c}
+%     before the first topic whose initial is c
+%  \entry {topic}{pagelist}
+%     for a topic that is used without subtopics
+%  \primary {topic}
+%     for the beginning of a topic that is used with subtopics
+%  \secondary {subtopic}{pagelist}
+%     for each subtopic.
+
+% Define the user-accessible indexing commands
+% @findex, @vindex, @kindex, @cindex.
+
+\def\findex {\fnindex}
+\def\kindex {\kyindex}
+\def\cindex {\cpindex}
+\def\vindex {\vrindex}
+\def\tindex {\tpindex}
+\def\pindex {\pgindex}
+
+\def\cindexsub {\begingroup\obeylines\cindexsub}
+{\obeylines %
+\gdef\cindexsub "#1" #2^^M{\endgroup %
+\dosubind{cp}{#2}{#1}}}
+
+% Define the macros used in formatting output of the sorted index material.
+
+% This is what you call to cause a particular index to get printed.
+% Write
+% @unnumbered Function Index
+% @printindex fn
+
+\def\printindex{\parsearg\doprintindex}
+
+\def\doprintindex#1{%
+  \tex
+  \dobreak \chapheadingskip {10000}
+  \catcode`\%=\other\catcode`\&=\other\catcode`\#=\other
+  \catcode`\$=\other\catcode`\_=\other
+  \catcode`\~=\other
+  %
+  % The following don't help, since the chars were translated
+  % when the raw index was written, and their fonts were discarded
+  % due to \indexnofonts.
+  %\catcode`\"=\active
+  %\catcode`\^=\active
+  %\catcode`\_=\active
+  %\catcode`\|=\active
+  %\catcode`\<=\active
+  %\catcode`\>=\active
+  % %
+  \def\indexbackslash{\rawbackslashxx}
+  \indexfonts\rm \tolerance=9500 \advance\baselineskip -1pt
+  \begindoublecolumns
+  %
+  % See if the index file exists and is nonempty.
+  \openin 1 \jobname.#1s
+  \ifeof 1
+    % \enddoublecolumns gets confused if there is no text in the index,
+    % and it loses the chapter title and the aux file entries for the
+    % index.  The easiest way to prevent this problem is to make sure
+    % there is some text.
+    (Index is nonexistent)
+    \else
+    %
+    % If the index file exists but is empty, then \openin leaves \ifeof
+    % false.  We have to make TeX try to read something from the file, so
+    % it can discover if there is anything in it.
+    \read 1 to \temp
+    \ifeof 1
+      (Index is empty)
+    \else
+      \input \jobname.#1s
+    \fi
+  \fi
+  \closein 1
+  \enddoublecolumns
+  \Etex
+}
+
+% These macros are used by the sorted index file itself.
+% Change them to control the appearance of the index.
+
+% Same as \bigskipamount except no shrink.
+% \balancecolumns gets confused if there is any shrink.
+\newskip\initialskipamount \initialskipamount 12pt plus4pt
+
+\def\initial #1{%
+{\let\tentt=\sectt \let\tt=\sectt \let\sf=\sectt
+\ifdim\lastskip<\initialskipamount
+\removelastskip \penalty-200 \vskip \initialskipamount\fi
+\line{\secbf#1\hfill}\kern 2pt\penalty10000}}
+
+% This typesets a paragraph consisting of #1, dot leaders, and then #2
+% flush to the right margin.  It is used for index and table of contents
+% entries.  The paragraph is indented by \leftskip.
+%
+\def\entry #1#2{\begingroup
+  %
+  % Start a new paragraph if necessary, so our assignments below can't
+  % affect previous text.
+  \par
+  %
+  % Do not fill out the last line with white space.
+  \parfillskip = 0in
+  %
+  % No extra space above this paragraph.
+  \parskip = 0in
+  %
+  % Do not prefer a separate line ending with a hyphen to fewer lines.
+  \finalhyphendemerits = 0
+  %
+  % \hangindent is only relevant when the entry text and page number
+  % don't both fit on one line.  In that case, bob suggests starting the
+  % dots pretty far over on the line.  Unfortunately, a large
+  % indentation looks wrong when the entry text itself is broken across
+  % lines.  So we use a small indentation and put up with long leaders.
+  %
+  % \hangafter is reset to 1 (which is the value we want) at the start
+  % of each paragraph, so we need not do anything with that.
+  \hangindent=2em
+  %
+  % When the entry text needs to be broken, just fill out the first line
+  % with blank space.
+  \rightskip = 0pt plus1fil
+  %
+  % Start a ``paragraph'' for the index entry so the line breaking
+  % parameters we've set above will have an effect.
+  \noindent
+  %
+  % Insert the text of the index entry.  TeX will do line-breaking on it.
+  #1%
+  %
+  % If we must, put the page number on a line of its own, and fill out
+  % this line with blank space.  (The \hfil is overwhelmed with the
+  % fill leaders glue in \indexdotfill if the page number does fit.)
+  \hfil\penalty50
+  \null\nobreak\indexdotfill % Have leaders before the page number.
+  %
+  % The `\ ' here is removed by the implicit \unskip that TeX does as
+  % part of (the primitive) \par.  Without it, a spurious underfull
+  % \hbox ensues.
+  \ #2% The page number ends the paragraph.
+  \par
+\endgroup}
+
+% Like \dotfill except takes at least 1 em.
+\def\indexdotfill{\cleaders
+  \hbox{$\mathsurround=0pt \mkern1.5mu . \mkern1.5mu$}\hskip 1em plus 1fill}
+
+\def\primary #1{\line{#1\hfil}}
+
+\newskip\secondaryindent \secondaryindent=0.5cm
+
+\def\secondary #1#2{
+{\parfillskip=0in \parskip=0in
+\hangindent =1in \hangafter=1
+\noindent\hskip\secondaryindent\hbox{#1}\indexdotfill #2\par
+}}
+
+%% Define two-column mode, which is used in indexes.
+%% Adapted from the TeXbook, page 416.
+\catcode `\@=11
+
+\newbox\partialpage
+
+\newdimen\doublecolumnhsize
+
+\def\begindoublecolumns{\begingroup
+  % Grab any single-column material above us.
+  \output = {\global\setbox\partialpage
+    =\vbox{\unvbox255\kern -\topskip \kern \baselineskip}}%
+  \eject
+  %
+  % Now switch to the double-column output routine.
+  \output={\doublecolumnout}%
+  %
+  % Change the page size parameters.  We could do this once outside this
+  % routine, in each of @smallbook, @afourpaper, and the default 8.5x11
+  % format, but then we repeat the same computation.  Repeating a couple
+  % of assignments once per index is clearly meaningless for the
+  % execution time, so we may as well do it once.
+  %
+  % First we halve the line length, less a little for the gutter between
+  % the columns.  We compute the gutter based on the line length, so it
+  % changes automatically with the paper format.  The magic constant
+  % below is chosen so that the gutter has the same value (well, +- <
+  % 1pt) as it did when we hard-coded it.
+  %
+  % We put the result in a separate register, \doublecolumhsize, so we
+  % can restore it in \pagesofar, after \hsize itself has (potentially)
+  % been clobbered.
+  %
+  \doublecolumnhsize = \hsize
+    \advance\doublecolumnhsize by -.04154\hsize
+    \divide\doublecolumnhsize by 2
+  \hsize = \doublecolumnhsize
+  %
+  % Double the \vsize as well.  (We don't need a separate register here,
+  % since nobody clobbers \vsize.)
+  \vsize = 2\vsize
+  \doublecolumnpagegoal
+}
+
+\def\enddoublecolumns{\eject \endgroup \pagegoal=\vsize \unvbox\partialpage}
+
+\def\doublecolumnsplit{\splittopskip=\topskip \splitmaxdepth=\maxdepth
+  \global\dimen@=\pageheight \global\advance\dimen@ by-\ht\partialpage
+  \global\setbox1=\vsplit255 to\dimen@ \global\setbox0=\vbox{\unvbox1}
+  \global\setbox3=\vsplit255 to\dimen@ \global\setbox2=\vbox{\unvbox3}
+  \ifdim\ht0>\dimen@ \setbox255=\vbox{\unvbox0\unvbox2} \global\setbox255=\copy5 \fi
+  \ifdim\ht2>\dimen@ \setbox255=\vbox{\unvbox0\unvbox2} \global\setbox255=\copy5 \fi
+}
+\def\doublecolumnpagegoal{%
+  \dimen@=\vsize \advance\dimen@ by-2\ht\partialpage \global\pagegoal=\dimen@
+}
+\def\pagesofar{\unvbox\partialpage %
+  \hsize=\doublecolumnhsize % have to restore this since output routine
+  \wd0=\hsize \wd2=\hsize \hbox to\pagewidth{\box0\hfil\box2}}
+\def\doublecolumnout{%
+  \setbox5=\copy255
+  {\vbadness=10000 \doublecolumnsplit}
+  \ifvbox255
+    \setbox0=\vtop to\dimen@{\unvbox0}
+    \setbox2=\vtop to\dimen@{\unvbox2}
+    \onepageout\pagesofar \unvbox255 \penalty\outputpenalty
+  \else
+    \setbox0=\vbox{\unvbox5}
+    \ifvbox0
+      \dimen@=\ht0 \advance\dimen@ by\topskip \advance\dimen@ by-\baselineskip
+      \divide\dimen@ by2 \splittopskip=\topskip \splitmaxdepth=\maxdepth
+      {\vbadness=10000
+	\loop \global\setbox5=\copy0
+          \setbox1=\vsplit5 to\dimen@
+          \setbox3=\vsplit5 to\dimen@
+          \ifvbox5 \global\advance\dimen@ by1pt \repeat
+        \setbox0=\vbox to\dimen@{\unvbox1}
+        \setbox2=\vbox to\dimen@{\unvbox3}
+        \global\setbox\partialpage=\vbox{\pagesofar}
+        \doublecolumnpagegoal
+      }
+    \fi
+  \fi
+}
+
+\catcode `\@=\other
+\message{sectioning,}
+% Define chapters, sections, etc.
+
+\newcount \chapno
+\newcount \secno        \secno=0
+\newcount \subsecno     \subsecno=0
+\newcount \subsubsecno  \subsubsecno=0
+
+% This counter is funny since it counts through charcodes of letters A, B, ...
+\newcount \appendixno  \appendixno = `\@
+\def\appendixletter{\char\the\appendixno}
+
+\newwrite \contentsfile
+% This is called from \setfilename.
+\def\opencontents{\openout \contentsfile = \jobname.toc}
+
+% Each @chapter defines this as the name of the chapter.
+% page headings and footings can use it.  @section does likewise
+
+\def\thischapter{} \def\thissection{}
+\def\seccheck#1{\if \pageno<0 %
+\errmessage{@#1 not allowed after generating table of contents}\fi
+%
+}
+
+\def\chapternofonts{%
+\let\rawbackslash=\relax%
+\let\frenchspacing=\relax%
+\def\result{\realbackslash result}
+\def\equiv{\realbackslash equiv}
+\def\expansion{\realbackslash expansion}
+\def\print{\realbackslash print}
+\def\TeX{\realbackslash TeX}
+\def\dots{\realbackslash dots}
+\def\copyright{\realbackslash copyright}
+\def\tt{\realbackslash tt}
+\def\bf{\realbackslash bf }
+\def\w{\realbackslash w}
+\def\less{\realbackslash less}
+\def\gtr{\realbackslash gtr}
+\def\hat{\realbackslash hat}
+\def\char{\realbackslash char}
+\def\tclose##1{\realbackslash tclose {##1}}
+\def\code##1{\realbackslash code {##1}}
+\def\samp##1{\realbackslash samp {##1}}
+\def\r##1{\realbackslash r {##1}}
+\def\b##1{\realbackslash b {##1}}
+\def\key##1{\realbackslash key {##1}}
+\def\file##1{\realbackslash file {##1}}
+\def\kbd##1{\realbackslash kbd {##1}}
+% These are redefined because @smartitalic wouldn't work inside xdef.
+\def\i##1{\realbackslash i {##1}}
+\def\cite##1{\realbackslash cite {##1}}
+\def\var##1{\realbackslash var {##1}}
+\def\emph##1{\realbackslash emph {##1}}
+\def\dfn##1{\realbackslash dfn {##1}}
+}
+
+\newcount\absseclevel % used to calculate proper heading level
+\newcount\secbase\secbase=0 % @raise/lowersections modify this count
+
+% @raisesections: treat @section as chapter, @subsection as section, etc.
+\def\raisesections{\global\advance\secbase by -1}
+\let\up=\raisesections % original BFox name
+
+% @lowersections: treat @chapter as section, @section as subsection, etc.
+\def\lowersections{\global\advance\secbase by 1}
+\let\down=\lowersections % original BFox name
+
+% Choose a numbered-heading macro
+% #1 is heading level if unmodified by @raisesections or @lowersections
+% #2 is text for heading
+\def\numhead#1#2{\absseclevel=\secbase\advance\absseclevel by #1
+\ifcase\absseclevel
+  \chapterzzz{#2}
+\or
+  \seczzz{#2}
+\or
+  \numberedsubseczzz{#2}
+\or
+  \numberedsubsubseczzz{#2}
+\else
+  \ifnum \absseclevel<0
+    \chapterzzz{#2}
+  \else
+    \numberedsubsubseczzz{#2}
+  \fi
+\fi
+}
+
+% like \numhead, but chooses appendix heading levels
+\def\apphead#1#2{\absseclevel=\secbase\advance\absseclevel by #1
+\ifcase\absseclevel
+  \appendixzzz{#2}
+\or
+  \appendixsectionzzz{#2}
+\or
+  \appendixsubseczzz{#2}
+\or
+  \appendixsubsubseczzz{#2}
+\else
+  \ifnum \absseclevel<0
+    \appendixzzz{#2}
+  \else
+    \appendixsubsubseczzz{#2}
+  \fi
+\fi
+}
+
+% like \numhead, but chooses numberless heading levels
+\def\unnmhead#1#2{\absseclevel=\secbase\advance\absseclevel by #1
+\ifcase\absseclevel
+  \unnumberedzzz{#2}
+\or
+  \unnumberedseczzz{#2}
+\or
+  \unnumberedsubseczzz{#2}
+\or
+  \unnumberedsubsubseczzz{#2}
+\else
+  \ifnum \absseclevel<0
+    \unnumberedzzz{#2}
+  \else
+    \unnumberedsubsubseczzz{#2}
+  \fi
+\fi
+}
+
+
+\def\thischaptername{No Chapter Title}
+\outer\def\chapter{\parsearg\chapteryyy}
+\def\chapteryyy #1{\numhead0{#1}} % normally numhead0 calls chapterzzz
+\def\chapterzzz #1{\seccheck{chapter}%
+\secno=0 \subsecno=0 \subsubsecno=0
+\global\advance \chapno by 1 \message{Chapter \the\chapno}%
+\chapmacro {#1}{\the\chapno}%
+\gdef\thissection{#1}%
+\gdef\thischaptername{#1}%
+% We don't substitute the actual chapter name into \thischapter
+% because we don't want its macros evaluated now.
+\xdef\thischapter{Chapter \the\chapno: \noexpand\thischaptername}%
+{\chapternofonts%
+\edef\temp{{\realbackslash chapentry {#1}{\the\chapno}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp  %
+\donoderef %
+\global\let\section = \numberedsec
+\global\let\subsection = \numberedsubsec
+\global\let\subsubsection = \numberedsubsubsec
+}}
+
+\outer\def\appendix{\parsearg\appendixyyy}
+\def\appendixyyy #1{\apphead0{#1}} % normally apphead0 calls appendixzzz
+\def\appendixzzz #1{\seccheck{appendix}%
+\secno=0 \subsecno=0 \subsubsecno=0
+\global\advance \appendixno by 1 \message{Appendix \appendixletter}%
+\chapmacro {#1}{Appendix \appendixletter}%
+\gdef\thissection{#1}%
+\gdef\thischaptername{#1}%
+\xdef\thischapter{Appendix \appendixletter: \noexpand\thischaptername}%
+{\chapternofonts%
+\edef\temp{{\realbackslash chapentry
+  {#1}{Appendix \appendixletter}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp  %
+\appendixnoderef %
+\global\let\section = \appendixsec
+\global\let\subsection = \appendixsubsec
+\global\let\subsubsection = \appendixsubsubsec
+}}
+
+\outer\def\top{\parsearg\unnumberedyyy}
+\outer\def\unnumbered{\parsearg\unnumberedyyy}
+\def\unnumberedyyy #1{\unnmhead0{#1}} % normally unnmhead0 calls unnumberedzzz
+\def\unnumberedzzz #1{\seccheck{unnumbered}%
+\secno=0 \subsecno=0 \subsubsecno=0
+%
+% This used to be simply \message{#1}, but TeX fully expands the
+% argument to \message.  Therefore, if #1 contained @-commands, TeX
+% expanded them.  For example, in `@unnumbered The @cite{Book}', TeX
+% expanded @cite (which turns out to cause errors because \cite is meant
+% to be executed, not expanded).
+%
+% Anyway, we don't want the fully-expanded definition of @cite to appear
+% as a result of the \message, we just want `@cite' itself.  We use
+% \the<toks register> to achieve this: TeX expands \the<toks> only once,
+% simply yielding the contents of the <toks register>.
+\toks0 = {#1}\message{(\the\toks0)}%
+%
+\unnumbchapmacro {#1}%
+\gdef\thischapter{#1}\gdef\thissection{#1}%
+{\chapternofonts%
+\edef\temp{{\realbackslash unnumbchapentry {#1}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp  %
+\unnumbnoderef %
+\global\let\section = \unnumberedsec
+\global\let\subsection = \unnumberedsubsec
+\global\let\subsubsection = \unnumberedsubsubsec
+}}
+
+\outer\def\numberedsec{\parsearg\secyyy}
+\def\secyyy #1{\numhead1{#1}} % normally calls seczzz
+\def\seczzz #1{\seccheck{section}%
+\subsecno=0 \subsubsecno=0 \global\advance \secno by 1 %
+\gdef\thissection{#1}\secheading {#1}{\the\chapno}{\the\secno}%
+{\chapternofonts%
+\edef\temp{{\realbackslash secentry %
+{#1}{\the\chapno}{\the\secno}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp %
+\donoderef %
+\penalty 10000 %
+}}
+
+\outer\def\appenixsection{\parsearg\appendixsecyyy}
+\outer\def\appendixsec{\parsearg\appendixsecyyy}
+\def\appendixsecyyy #1{\apphead1{#1}} % normally calls appendixsectionzzz
+\def\appendixsectionzzz #1{\seccheck{appendixsection}%
+\subsecno=0 \subsubsecno=0 \global\advance \secno by 1 %
+\gdef\thissection{#1}\secheading {#1}{\appendixletter}{\the\secno}%
+{\chapternofonts%
+\edef\temp{{\realbackslash secentry %
+{#1}{\appendixletter}{\the\secno}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp %
+\appendixnoderef %
+\penalty 10000 %
+}}
+
+\outer\def\unnumberedsec{\parsearg\unnumberedsecyyy}
+\def\unnumberedsecyyy #1{\unnmhead1{#1}} % normally calls unnumberedseczzz
+\def\unnumberedseczzz #1{\seccheck{unnumberedsec}%
+\plainsecheading {#1}\gdef\thissection{#1}%
+{\chapternofonts%
+\edef\temp{{\realbackslash unnumbsecentry{#1}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp %
+\unnumbnoderef %
+\penalty 10000 %
+}}
+
+\outer\def\numberedsubsec{\parsearg\numberedsubsecyyy}
+\def\numberedsubsecyyy #1{\numhead2{#1}} % normally calls numberedsubseczzz
+\def\numberedsubseczzz #1{\seccheck{subsection}%
+\gdef\thissection{#1}\subsubsecno=0 \global\advance \subsecno by 1 %
+\subsecheading {#1}{\the\chapno}{\the\secno}{\the\subsecno}%
+{\chapternofonts%
+\edef\temp{{\realbackslash subsecentry %
+{#1}{\the\chapno}{\the\secno}{\the\subsecno}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp %
+\donoderef %
+\penalty 10000 %
+}}
+
+\outer\def\appendixsubsec{\parsearg\appendixsubsecyyy}
+\def\appendixsubsecyyy #1{\apphead2{#1}} % normally calls appendixsubseczzz
+\def\appendixsubseczzz #1{\seccheck{appendixsubsec}%
+\gdef\thissection{#1}\subsubsecno=0 \global\advance \subsecno by 1 %
+\subsecheading {#1}{\appendixletter}{\the\secno}{\the\subsecno}%
+{\chapternofonts%
+\edef\temp{{\realbackslash subsecentry %
+{#1}{\appendixletter}{\the\secno}{\the\subsecno}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp %
+\appendixnoderef %
+\penalty 10000 %
+}}
+
+\outer\def\unnumberedsubsec{\parsearg\unnumberedsubsecyyy}
+\def\unnumberedsubsecyyy #1{\unnmhead2{#1}} %normally calls unnumberedsubseczzz
+\def\unnumberedsubseczzz #1{\seccheck{unnumberedsubsec}%
+\plainsecheading {#1}\gdef\thissection{#1}%
+{\chapternofonts%
+\edef\temp{{\realbackslash unnumbsubsecentry{#1}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp %
+\unnumbnoderef %
+\penalty 10000 %
+}}
+
+\outer\def\numberedsubsubsec{\parsearg\numberedsubsubsecyyy}
+\def\numberedsubsubsecyyy #1{\numhead3{#1}} % normally numberedsubsubseczzz
+\def\numberedsubsubseczzz #1{\seccheck{subsubsection}%
+\gdef\thissection{#1}\global\advance \subsubsecno by 1 %
+\subsubsecheading {#1}
+  {\the\chapno}{\the\secno}{\the\subsecno}{\the\subsubsecno}%
+{\chapternofonts%
+\edef\temp{{\realbackslash subsubsecentry %
+  {#1}
+  {\the\chapno}{\the\secno}{\the\subsecno}{\the\subsubsecno}
+  {\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp %
+\donoderef %
+\penalty 10000 %
+}}
+
+\outer\def\appendixsubsubsec{\parsearg\appendixsubsubsecyyy}
+\def\appendixsubsubsecyyy #1{\apphead3{#1}} % normally appendixsubsubseczzz
+\def\appendixsubsubseczzz #1{\seccheck{appendixsubsubsec}%
+\gdef\thissection{#1}\global\advance \subsubsecno by 1 %
+\subsubsecheading {#1}
+  {\appendixletter}{\the\secno}{\the\subsecno}{\the\subsubsecno}%
+{\chapternofonts%
+\edef\temp{{\realbackslash subsubsecentry{#1}%
+  {\appendixletter}
+  {\the\secno}{\the\subsecno}{\the\subsubsecno}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp %
+\appendixnoderef %
+\penalty 10000 %
+}}
+
+\outer\def\unnumberedsubsubsec{\parsearg\unnumberedsubsubsecyyy}
+\def\unnumberedsubsubsecyyy #1{\unnmhead3{#1}} %normally unnumberedsubsubseczzz
+\def\unnumberedsubsubseczzz #1{\seccheck{unnumberedsubsubsec}%
+\plainsecheading {#1}\gdef\thissection{#1}%
+{\chapternofonts%
+\edef\temp{{\realbackslash unnumbsubsubsecentry{#1}{\noexpand\folio}}}%
+\escapechar=`\\%
+\write \contentsfile \temp %
+\unnumbnoderef %
+\penalty 10000 %
+}}
+
+% These are variants which are not "outer", so they can appear in @ifinfo.
+% Actually, they should now be obsolete; ordinary section commands should work.
+\def\infotop{\parsearg\unnumberedzzz}
+\def\infounnumbered{\parsearg\unnumberedzzz}
+\def\infounnumberedsec{\parsearg\unnumberedseczzz}
+\def\infounnumberedsubsec{\parsearg\unnumberedsubseczzz}
+\def\infounnumberedsubsubsec{\parsearg\unnumberedsubsubseczzz}
+
+\def\infoappendix{\parsearg\appendixzzz}
+\def\infoappendixsec{\parsearg\appendixseczzz}
+\def\infoappendixsubsec{\parsearg\appendixsubseczzz}
+\def\infoappendixsubsubsec{\parsearg\appendixsubsubseczzz}
+
+\def\infochapter{\parsearg\chapterzzz}
+\def\infosection{\parsearg\sectionzzz}
+\def\infosubsection{\parsearg\subsectionzzz}
+\def\infosubsubsection{\parsearg\subsubsectionzzz}
+
+% These macros control what the section commands do, according
+% to what kind of chapter we are in (ordinary, appendix, or unnumbered).
+% Define them by default for a numbered chapter.
+\global\let\section = \numberedsec
+\global\let\subsection = \numberedsubsec
+\global\let\subsubsection = \numberedsubsubsec
+
+% Define @majorheading, @heading and @subheading
+
+% NOTE on use of \vbox for chapter headings, section headings, and
+% such:
+%	1) We use \vbox rather than the earlier \line to permit
+%	   overlong headings to fold.
+%	2) \hyphenpenalty is set to 10000 because hyphenation in a
+%	   heading is obnoxious; this forbids it.
+%       3) Likewise, headings look best if no \parindent is used, and
+%          if justification is not attempted.  Hence \raggedright.
+
+
+\def\majorheading{\parsearg\majorheadingzzz}
+\def\majorheadingzzz #1{%
+{\advance\chapheadingskip by 10pt \chapbreak }%
+{\chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000
+                  \parindent=0pt\raggedright
+                  \rm #1\hfill}}\bigskip \par\penalty 200}
+
+\def\chapheading{\parsearg\chapheadingzzz}
+\def\chapheadingzzz #1{\chapbreak %
+{\chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000
+                  \parindent=0pt\raggedright
+                  \rm #1\hfill}}\bigskip \par\penalty 200}
+
+\def\heading{\parsearg\secheadingi}
+
+\def\subheading{\parsearg\subsecheadingi}
+
+\def\subsubheading{\parsearg\subsubsecheadingi}
+
+% These macros generate a chapter, section, etc. heading only
+% (including whitespace, linebreaking, etc. around it),
+% given all the information in convenient, parsed form.
+
+%%% Args are the skip and penalty (usually negative)
+\def\dobreak#1#2{\par\ifdim\lastskip<#1\removelastskip\penalty#2\vskip#1\fi}
+
+\def\setchapterstyle #1 {\csname CHAPF#1\endcsname}
+
+%%% Define plain chapter starts, and page on/off switching for it
+% Parameter controlling skip before chapter headings (if needed)
+
+\newskip \chapheadingskip \chapheadingskip = 30pt plus 8pt minus 4pt
+
+\def\chapbreak{\dobreak \chapheadingskip {-4000}}
+\def\chappager{\par\vfill\supereject}
+\def\chapoddpage{\chappager \ifodd\pageno \else \hbox to 0pt{} \chappager\fi}
+
+\def\setchapternewpage #1 {\csname CHAPPAG#1\endcsname}
+
+\def\CHAPPAGoff{
+\global\let\pchapsepmacro=\chapbreak
+\global\let\pagealignmacro=\chappager}
+
+\def\CHAPPAGon{
+\global\let\pchapsepmacro=\chappager
+\global\let\pagealignmacro=\chappager
+\global\def\HEADINGSon{\HEADINGSsingle}}
+
+\def\CHAPPAGodd{
+\global\let\pchapsepmacro=\chapoddpage
+\global\let\pagealignmacro=\chapoddpage
+\global\def\HEADINGSon{\HEADINGSdouble}}
+
+\CHAPPAGon
+
+\def\CHAPFplain{
+\global\let\chapmacro=\chfplain
+\global\let\unnumbchapmacro=\unnchfplain}
+
+\def\chfplain #1#2{%
+  \pchapsepmacro
+  {%
+    \chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000
+                     \parindent=0pt\raggedright
+                     \rm #2\enspace #1}%
+  }%
+  \bigskip
+  \penalty5000
+}
+
+\def\unnchfplain #1{%
+\pchapsepmacro %
+{\chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000
+                  \parindent=0pt\raggedright
+                  \rm #1\hfill}}\bigskip \par\penalty 10000 %
+}
+\CHAPFplain % The default
+
+\def\unnchfopen #1{%
+\chapoddpage {\chapfonts \vbox{\hyphenpenalty=10000\tolerance=5000
+                       \parindent=0pt\raggedright
+                       \rm #1\hfill}}\bigskip \par\penalty 10000 %
+}
+
+\def\chfopen #1#2{\chapoddpage {\chapfonts
+\vbox to 3in{\vfil \hbox to\hsize{\hfil #2} \hbox to\hsize{\hfil #1} \vfil}}%
+\par\penalty 5000 %
+}
+
+\def\CHAPFopen{
+\global\let\chapmacro=\chfopen
+\global\let\unnumbchapmacro=\unnchfopen}
+
+% Parameter controlling skip before section headings.
+
+\newskip \subsecheadingskip  \subsecheadingskip = 17pt plus 8pt minus 4pt
+\def\subsecheadingbreak{\dobreak \subsecheadingskip {-500}}
+
+\newskip \secheadingskip  \secheadingskip = 21pt plus 8pt minus 4pt
+\def\secheadingbreak{\dobreak \secheadingskip {-1000}}
+
+% @paragraphindent  is defined for the Info formatting commands only.
+\let\paragraphindent=\comment
+
+% Section fonts are the base font at magstep2, which produces
+% a size a bit more than 14 points in the default situation.
+
+\def\secheading #1#2#3{\secheadingi {#2.#3\enspace #1}}
+\def\plainsecheading #1{\secheadingi {#1}}
+\def\secheadingi #1{{\advance \secheadingskip by \parskip %
+\secheadingbreak}%
+{\secfonts \vbox{\hyphenpenalty=10000\tolerance=5000
+                 \parindent=0pt\raggedright
+                 \rm #1\hfill}}%
+\ifdim \parskip<10pt \kern 10pt\kern -\parskip\fi \penalty 10000 }
+
+
+% Subsection fonts are the base font at magstep1,
+% which produces a size of 12 points.
+
+\def\subsecheading #1#2#3#4{\subsecheadingi {#2.#3.#4\enspace #1}}
+\def\subsecheadingi #1{{\advance \subsecheadingskip by \parskip %
+\subsecheadingbreak}%
+{\subsecfonts \vbox{\hyphenpenalty=10000\tolerance=5000
+                     \parindent=0pt\raggedright
+                     \rm #1\hfill}}%
+\ifdim \parskip<10pt \kern 10pt\kern -\parskip\fi \penalty 10000 }
+
+\def\subsubsecfonts{\subsecfonts} % Maybe this should change:
+				  % Perhaps make sssec fonts scaled
+				  % magstep half
+\def\subsubsecheading #1#2#3#4#5{\subsubsecheadingi {#2.#3.#4.#5\enspace #1}}
+\def\subsubsecheadingi #1{{\advance \subsecheadingskip by \parskip %
+\subsecheadingbreak}%
+{\subsubsecfonts \vbox{\hyphenpenalty=10000\tolerance=5000
+                       \parindent=0pt\raggedright
+                       \rm #1\hfill}}%
+\ifdim \parskip<10pt \kern 10pt\kern -\parskip\fi \penalty 10000}
+
+
+\message{toc printing,}
+
+% Finish up the main text and prepare to read what we've written
+% to \contentsfile.
+
+\newskip\contentsrightmargin \contentsrightmargin=1in
+\def\startcontents#1{%
+   \pagealignmacro
+   \immediate\closeout \contentsfile
+   \ifnum \pageno>0
+      \pageno = -1		% Request roman numbered pages.
+   \fi
+   % Don't need to put `Contents' or `Short Contents' in the headline.
+   % It is abundantly clear what they are.
+   \unnumbchapmacro{#1}\def\thischapter{}%
+   \begingroup   		% Set up to handle contents files properly.
+      \catcode`\\=0  \catcode`\{=1  \catcode`\}=2  \catcode`\@=11
+      \raggedbottom             % Worry more about breakpoints than the bottom.
+      \advance\hsize by -\contentsrightmargin % Don't use the full line length.
+}
+
+
+% Normal (long) toc.
+\outer\def\contents{%
+   \startcontents{Table of Contents}%
+      \input \jobname.toc
+   \endgroup
+   \vfill \eject
+}
+
+% And just the chapters.
+\outer\def\summarycontents{%
+   \startcontents{Short Contents}%
+      %
+      \let\chapentry = \shortchapentry
+      \let\unnumbchapentry = \shortunnumberedentry
+      % We want a true roman here for the page numbers.
+      \secfonts
+      \let\rm=\shortcontrm \let\bf=\shortcontbf \let\sl=\shortcontsl
+      \rm
+      \advance\baselineskip by 1pt % Open it up a little.
+      \def\secentry ##1##2##3##4{}
+      \def\unnumbsecentry ##1##2{}
+      \def\subsecentry ##1##2##3##4##5{}
+      \def\unnumbsubsecentry ##1##2{}
+      \def\subsubsecentry ##1##2##3##4##5##6{}
+      \def\unnumbsubsubsecentry ##1##2{}
+      \input \jobname.toc
+   \endgroup
+   \vfill \eject
+}
+\let\shortcontents = \summarycontents
+
+% These macros generate individual entries in the table of contents.
+% The first argument is the chapter or section name.
+% The last argument is the page number.
+% The arguments in between are the chapter number, section number, ...
+
+% Chapter-level things, for both the long and short contents.
+\def\chapentry#1#2#3{\dochapentry{#2\labelspace#1}{#3}}
+
+% See comments in \dochapentry re vbox and related settings
+\def\shortchapentry#1#2#3{%
+  \tocentry{\shortchaplabel{#2}\labelspace #1}{\doshortpageno{#3}}%
+}
+
+% Typeset the label for a chapter or appendix for the short contents.
+% The arg is, e.g. `Appendix A' for an appendix, or `3' for a chapter.
+% We could simplify the code here by writing out an \appendixentry
+% command in the toc file for appendices, instead of using \chapentry
+% for both, but it doesn't seem worth it.
+\setbox0 = \hbox{\shortcontrm Appendix }
+\newdimen\shortappendixwidth \shortappendixwidth = \wd0
+
+\def\shortchaplabel#1{%
+  % We typeset #1 in a box of constant width, regardless of the text of
+  % #1, so the chapter titles will come out aligned.
+  \setbox0 = \hbox{#1}%
+  \dimen0 = \ifdim\wd0 > \shortappendixwidth \shortappendixwidth \else 0pt \fi
+  %
+  % This space should be plenty, since a single number is .5em, and the
+  % widest letter (M) is 1em, at least in the Computer Modern fonts.
+  % (This space doesn't include the extra space that gets added after
+  % the label; that gets put in in \shortchapentry above.)
+  \advance\dimen0 by 1.1em
+  \hbox to \dimen0{#1\hfil}%
+}
+
+\def\unnumbchapentry#1#2{\dochapentry{#1}{#2}}
+\def\shortunnumberedentry#1#2{\tocentry{#1}{\doshortpageno{#2}}}
+
+% Sections.
+\def\secentry#1#2#3#4{\dosecentry{#2.#3\labelspace#1}{#4}}
+\def\unnumbsecentry#1#2{\dosecentry{#1}{#2}}
+
+% Subsections.
+\def\subsecentry#1#2#3#4#5{\dosubsecentry{#2.#3.#4\labelspace#1}{#5}}
+\def\unnumbsubsecentry#1#2{\dosubsecentry{#1}{#2}}
+
+% And subsubsections.
+\def\subsubsecentry#1#2#3#4#5#6{%
+  \dosubsubsecentry{#2.#3.#4.#5\labelspace#1}{#6}}
+\def\unnumbsubsubsecentry#1#2{\dosubsubsecentry{#1}{#2}}
+
+
+% This parameter controls the indentation of the various levels.
+\newdimen\tocindent \tocindent = 3pc
+
+% Now for the actual typesetting. In all these, #1 is the text and #2 is the
+% page number.
+%
+% If the toc has to be broken over pages, we would want to be at chapters
+% if at all possible; hence the \penalty.
+\def\dochapentry#1#2{%
+   \penalty-300 \vskip\baselineskip
+   \begingroup
+     \chapentryfonts
+     \tocentry{#1}{\dopageno{#2}}%
+   \endgroup
+   \nobreak\vskip .25\baselineskip
+}
+
+\def\dosecentry#1#2{\begingroup
+  \secentryfonts \leftskip=\tocindent
+  \tocentry{#1}{\dopageno{#2}}%
+\endgroup}
+
+\def\dosubsecentry#1#2{\begingroup
+  \subsecentryfonts \leftskip=2\tocindent
+  \tocentry{#1}{\dopageno{#2}}%
+\endgroup}
+
+\def\dosubsubsecentry#1#2{\begingroup
+  \subsubsecentryfonts \leftskip=3\tocindent
+  \tocentry{#1}{\dopageno{#2}}%
+\endgroup}
+
+% Final typesetting of a toc entry; we use the same \entry macro as for
+% the index entries, but we want to suppress hyphenation here.  (We
+% can't do that in the \entry macro, since index entries might consist
+% of hyphenated-identifiers-that-do-not-fit-on-a-line-and-nothing-else.)
+%
+\def\tocentry#1#2{\begingroup
+  \hyphenpenalty = 10000
+  \entry{#1}{#2}%
+\endgroup}
+
+% Space between chapter (or whatever) number and the title.
+\def\labelspace{\hskip1em \relax}
+
+\def\dopageno#1{{\rm #1}}
+\def\doshortpageno#1{{\rm #1}}
+
+\def\chapentryfonts{\secfonts \rm}
+\def\secentryfonts{\textfonts}
+\let\subsecentryfonts = \textfonts
+\let\subsubsecentryfonts = \textfonts
+
+
+\message{environments,}
+
+% Since these characters are used in examples, it should be an even number of
+% \tt widths. Each \tt character is 1en, so two makes it 1em.
+% Furthermore, these definitions must come after we define our fonts.
+\newbox\dblarrowbox    \newbox\longdblarrowbox
+\newbox\pushcharbox    \newbox\bullbox
+\newbox\equivbox       \newbox\errorbox
+
+\let\ptexequiv = \equiv
+
+%{\tentt
+%\global\setbox\dblarrowbox = \hbox to 1em{\hfil$\Rightarrow$\hfil}
+%\global\setbox\longdblarrowbox = \hbox to 1em{\hfil$\mapsto$\hfil}
+%\global\setbox\pushcharbox = \hbox to 1em{\hfil$\dashv$\hfil}
+%\global\setbox\equivbox = \hbox to 1em{\hfil$\ptexequiv$\hfil}
+% Adapted from the manmac format (p.420 of TeXbook)
+%\global\setbox\bullbox = \hbox to 1em{\kern.15em\vrule height .75ex width .85ex
+%                                      depth .1ex\hfil}
+%}
+
+\def\point{$\star$}
+
+\def\result{\leavevmode\raise.15ex\hbox to 1em{\hfil$\Rightarrow$\hfil}}
+\def\expansion{\leavevmode\raise.1ex\hbox to 1em{\hfil$\mapsto$\hfil}}
+\def\print{\leavevmode\lower.1ex\hbox to 1em{\hfil$\dashv$\hfil}}
+
+\def\equiv{\leavevmode\lower.1ex\hbox to 1em{\hfil$\ptexequiv$\hfil}}
+
+% Adapted from the TeXbook's \boxit.
+{\tentt \global\dimen0 = 3em}% Width of the box.
+\dimen2 = .55pt % Thickness of rules
+% The text. (`r' is open on the right, `e' somewhat less so on the left.)
+\setbox0 = \hbox{\kern-.75pt \tensf error\kern-1.5pt}
+
+\global\setbox\errorbox=\hbox to \dimen0{\hfil
+   \hsize = \dimen0 \advance\hsize by -5.8pt % Space to left+right.
+   \advance\hsize by -2\dimen2 % Rules.
+   \vbox{
+      \hrule height\dimen2
+      \hbox{\vrule width\dimen2 \kern3pt          % Space to left of text.
+         \vtop{\kern2.4pt \box0 \kern2.4pt}% Space above/below.
+         \kern3pt\vrule width\dimen2}% Space to right.
+      \hrule height\dimen2}
+    \hfil}
+
+% The @error{} command.
+\def\error{\leavevmode\lower.7ex\copy\errorbox}
+
+% @tex ... @end tex    escapes into raw Tex temporarily.
+% One exception: @ is still an escape character, so that @end tex works.
+% But \@ or @@ will get a plain tex @ character.
+
+\def\tex{\begingroup
+\catcode `\\=0 \catcode `\{=1 \catcode `\}=2
+\catcode `\$=3 \catcode `\&=4 \catcode `\#=6
+\catcode `\^=7 \catcode `\_=8 \catcode `\~=13 \let~=\tie
+\catcode `\%=14
+\catcode 43=12
+\catcode`\"=12
+\catcode`\==12
+\catcode`\|=12
+\catcode`\<=12
+\catcode`\>=12
+\escapechar=`\\
+%
+\let\{=\ptexlbrace
+\let\}=\ptexrbrace
+\let\.=\ptexdot
+\let\*=\ptexstar
+\let\dots=\ptexdots
+\def\@{@}%
+\let\bullet=\ptexbullet
+\let\b=\ptexb \let\c=\ptexc \let\i=\ptexi \let\t=\ptext \let\l=\ptexl
+\let\L=\ptexL
+%
+\let\Etex=\endgroup}
+
+% Define @lisp ... @endlisp.
+% @lisp does a \begingroup so it can rebind things,
+% including the definition of @endlisp (which normally is erroneous).
+
+% Amount to narrow the margins by for @lisp.
+\newskip\lispnarrowing \lispnarrowing=0.4in
+
+% This is the definition that ^^M gets inside @lisp, @example, and other
+% such environments.  \null is better than a space, since it doesn't
+% have any width.
+\def\lisppar{\null\endgraf}
+
+% Make each space character in the input produce a normal interword
+% space in the output.  Don't allow a line break at this space, as this
+% is used only in environments like @example, where each line of input
+% should produce a line of output anyway.
+%
+{\obeyspaces %
+\gdef\sepspaces{\obeyspaces\let =\tie}}
+
+% Define \obeyedspace to be our active space, whatever it is.  This is
+% for use in \parsearg.
+{\sepspaces %
+\global\let\obeyedspace= }
+
+% This space is always present above and below environments.
+\newskip\envskipamount \envskipamount = 0pt
+
+% Make spacing and below environment symmetrical.  We use \parskip here
+% to help in doing that, since in @example-like environments \parskip
+% is reset to zero; thus the \afterenvbreak inserts no space -- but the
+% start of the next paragraph will insert \parskip
+%
+\def\aboveenvbreak{{\advance\envskipamount by \parskip
+\endgraf \ifdim\lastskip<\envskipamount
+\removelastskip \penalty-50 \vskip\envskipamount \fi}}
+
+\let\afterenvbreak = \aboveenvbreak
+
+% \nonarrowing is a flag.  If "set", @lisp etc don't narrow margins.
+\let\nonarrowing=\relax
+
+%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+% \cartouche: draw rectangle w/rounded corners around argument
+\font\circle=lcircle10
+\newdimen\circthick
+\newdimen\cartouter\newdimen\cartinner
+\newskip\normbskip\newskip\normpskip\newskip\normlskip
+\circthick=\fontdimen8\circle
+%
+\def\ctl{{\circle\char'013\hskip -6pt}}% 6pt from pl file: 1/2charwidth
+\def\ctr{{\hskip 6pt\circle\char'010}}
+\def\cbl{{\circle\char'012\hskip -6pt}}
+\def\cbr{{\hskip 6pt\circle\char'011}}
+\def\carttop{\hbox to \cartouter{\hskip\lskip
+	\ctl\leaders\hrule height\circthick\hfil\ctr
+	\hskip\rskip}}
+\def\cartbot{\hbox to \cartouter{\hskip\lskip
+	\cbl\leaders\hrule height\circthick\hfil\cbr
+	\hskip\rskip}}
+%
+\newskip\lskip\newskip\rskip
+
+\long\def\cartouche{%
+\begingroup
+	\lskip=\leftskip \rskip=\rightskip
+	\leftskip=0pt\rightskip=0pt %we want these *outside*.
+	\cartinner=\hsize \advance\cartinner by-\lskip
+		 	  \advance\cartinner by-\rskip
+	\cartouter=\hsize
+	\advance\cartouter by 18pt % allow for 3pt kerns on either
+%				     side, and for 6pt waste from
+%				     each corner char
+	\normbskip=\baselineskip \normpskip=\parskip \normlskip=\lineskip
+	% Flag to tell @lisp, etc., not to narrow margin.
+	\let\nonarrowing=\comment
+	\vbox\bgroup
+		\baselineskip=0pt\parskip=0pt\lineskip=0pt
+		\carttop
+		\hbox\bgroup
+			\hskip\lskip
+			\vrule\kern3pt
+			\vbox\bgroup
+				\hsize=\cartinner
+				\kern3pt
+				\begingroup
+					\baselineskip=\normbskip
+					\lineskip=\normlskip
+					\parskip=\normpskip
+					\vskip -\parskip
+\def\Ecartouche{%
+				\endgroup
+				\kern3pt
+			\egroup
+			\kern3pt\vrule
+			\hskip\rskip
+		\egroup
+		\cartbot
+	\egroup
+\endgroup
+}}
+
+
+% This macro is called at the beginning of all the @example variants,
+% inside a group.
+\def\nonfillstart{%
+  \aboveenvbreak
+  \inENV % This group ends at the end of the body
+  \hfuzz = 12pt % Don't be fussy
+  \sepspaces % Make spaces be word-separators rather than space tokens.
+  \singlespace
+  \let\par = \lisppar % don't ignore blank lines
+  \obeylines % each line of input is a line of output
+  \parskip = 0pt
+  \parindent = 0pt
+  \emergencystretch = 0pt % don't try to avoid overfull boxes
+  % @cartouche defines \nonarrowing to inhibit narrowing
+  % at next level down.
+  \ifx\nonarrowing\relax
+    \advance \leftskip by \lispnarrowing
+    \exdentamount=\lispnarrowing
+    \let\exdent=\nofillexdent
+    \let\nonarrowing=\relax
+  \fi
+}
+
+% To ending an @example-like environment, we first end the paragraph
+% (via \afterenvbreak's vertical glue), and then the group.  That way we
+% keep the zero \parskip that the environments set -- \parskip glue
+% will be inserted at the beginning of the next paragraph in the
+% document, after the environment.
+%
+\def\nonfillfinish{\afterenvbreak\endgroup}%
+
+% This macro is
+\def\lisp{\begingroup
+  \nonfillstart
+  \let\Elisp = \nonfillfinish
+  \tt
+  \rawbackslash % have \ input char produce \ char from current font
+  \gobble
+}
+
+% Define the \E... control sequence only if we are inside the
+% environment, so the error checking in \end will work.
+%
+% We must call \lisp last in the definition, since it reads the
+% return following the @example (or whatever) command.
+%
+\def\example{\begingroup \def\Eexample{\nonfillfinish\endgroup}\lisp}
+\def\smallexample{\begingroup \def\Esmallexample{\nonfillfinish\endgroup}\lisp}
+\def\smalllisp{\begingroup \def\Esmalllisp{\nonfillfinish\endgroup}\lisp}
+
+% @smallexample and @smalllisp.  This is not used unless the @smallbook
+% command is given.  Originally contributed by Pavel@xerox.
+%
+\def\smalllispx{\begingroup
+  \nonfillstart
+  \let\Esmalllisp = \nonfillfinish
+  \let\Esmallexample = \nonfillfinish
+  %
+  % Smaller interline space and fonts for small examples.
+  \baselineskip 10pt
+  \indexfonts \tt
+  \rawbackslash % output the \ character from the current font
+  \gobble
+}
+
+% This is @display; same as @lisp except use roman font.
+%
+\def\display{\begingroup
+  \nonfillstart
+  \let\Edisplay = \nonfillfinish
+  \gobble
+}
+
+% This is @format; same as @display except don't narrow margins.
+%
+\def\format{\begingroup
+  \let\nonarrowing = t
+  \nonfillstart
+  \let\Eformat = \nonfillfinish
+  \gobble
+}
+
+% @flushleft (same as @format) and @flushright.
+%
+\def\flushleft{\begingroup
+  \let\nonarrowing = t
+  \nonfillstart
+  \let\Eflushleft = \nonfillfinish
+  \gobble
+}
+\def\flushright{\begingroup
+  \let\nonarrowing = t
+  \nonfillstart
+  \let\Eflushright = \nonfillfinish
+  \advance\leftskip by 0pt plus 1fill
+  \gobble}
+
+% @quotation does normal linebreaking and narrows the margins.
+%
+\def\quotation{%
+\begingroup\inENV %This group ends at the end of the @quotation body
+{\parskip=0pt  % because we will skip by \parskip too, later
+\aboveenvbreak}%
+\singlespace
+\parindent=0pt
+\let\Equotation = \nonfillfinish
+% @cartouche defines \nonarrowing to inhibit narrowing
+% at next level down.
+\ifx\nonarrowing\relax
+\advance \leftskip by \lispnarrowing
+\advance \rightskip by \lispnarrowing
+\exdentamount=\lispnarrowing
+\let\nonarrowing=\relax
+\fi}
+
+\message{defuns,}
+% Define formatter for defuns
+% First, allow user to change definition object font (\df) internally
+\def\setdeffont #1 {\csname DEF#1\endcsname}
+
+\newskip\defbodyindent \defbodyindent=.4in
+\newskip\defargsindent \defargsindent=50pt
+\newskip\deftypemargin \deftypemargin=12pt
+\newskip\deflastargmargin \deflastargmargin=18pt
+
+\newcount\parencount
+% define \functionparens, which makes ( and ) and & do special things.
+% \functionparens affects the group it is contained in.
+\def\activeparens{%
+\catcode`\(=\active \catcode`\)=\active \catcode`\&=\active
+\catcode`\[=\active \catcode`\]=\active}
+
+% Make control sequences which act like normal parenthesis chars.
+\let\lparen = ( \let\rparen = )
+
+{\activeparens % Now, smart parens don't turn on until &foo (see \amprm)
+
+% Be sure that we always have a definition for `(', etc.  For example,
+% if the fn name has parens in it, \boldbrax will not be in effect yet,
+% so TeX would otherwise complain about undefined control sequence.
+\global\let(=\lparen \global\let)=\rparen
+\global\let[=\lbrack \global\let]=\rbrack
+
+\gdef\functionparens{\boldbrax\let&=\amprm\parencount=0 }
+\gdef\boldbrax{\let(=\opnr\let)=\clnr\let[=\lbrb\let]=\rbrb}
+
+% Definitions of (, ) and & used in args for functions.
+% This is the definition of ( outside of all parentheses.
+\gdef\oprm#1 {{\rm\char`\(}#1 \bf \let(=\opnested %
+\global\advance\parencount by 1 }
+%
+% This is the definition of ( when already inside a level of parens.
+\gdef\opnested{\char`\(\global\advance\parencount by 1 }
+%
+\gdef\clrm{% Print a paren in roman if it is taking us back to depth of 0.
+% also in that case restore the outer-level definition of (.
+\ifnum \parencount=1 {\rm \char `\)}\sl \let(=\oprm \else \char `\) \fi
+\global\advance \parencount by -1 }
+% If we encounter &foo, then turn on ()-hacking afterwards
+\gdef\amprm#1 {{\rm\&#1}\let(=\oprm \let)=\clrm\ }
+%
+\gdef\normalparens{\boldbrax\let&=\ampnr}
+} % End of definition inside \activeparens
+%% These parens (in \boldbrax) actually are a little bolder than the
+%% contained text.  This is especially needed for [ and ]
+\def\opnr{{\sf\char`\(}} \def\clnr{{\sf\char`\)}} \def\ampnr{\&}
+\def\lbrb{{\bf\char`\[}} \def\rbrb{{\bf\char`\]}}
+
+% First, defname, which formats the header line itself.
+% #1 should be the function name.
+% #2 should be the type of definition, such as "Function".
+
+\def\defname #1#2{%
+% Get the values of \leftskip and \rightskip as they were
+% outside the @def...
+\dimen2=\leftskip
+\advance\dimen2 by -\defbodyindent
+\dimen3=\rightskip
+\advance\dimen3 by -\defbodyindent
+\noindent        %
+\setbox0=\hbox{\hskip \deflastargmargin{\rm #2}\hskip \deftypemargin}%
+\dimen0=\hsize \advance \dimen0 by -\wd0 % compute size for first line
+\dimen1=\hsize \advance \dimen1 by -\defargsindent %size for continuations
+\parshape 2 0in \dimen0 \defargsindent \dimen1     %
+% Now output arg 2 ("Function" or some such)
+% ending at \deftypemargin from the right margin,
+% but stuck inside a box of width 0 so it does not interfere with linebreaking
+{% Adjust \hsize to exclude the ambient margins,
+% so that \rightline will obey them.
+\advance \hsize by -\dimen2 \advance \hsize by -\dimen3
+\rlap{\rightline{{\rm #2}\hskip \deftypemargin}}}%
+% Make all lines underfull and no complaints:
+\tolerance=10000 \hbadness=10000
+\advance\leftskip by -\defbodyindent
+\exdentamount=\defbodyindent
+{\df #1}\enskip        % Generate function name
+}
+
+% Actually process the body of a definition
+% #1 should be the terminating control sequence, such as \Edefun.
+% #2 should be the "another name" control sequence, such as \defunx.
+% #3 should be the control sequence that actually processes the header,
+%    such as \defunheader.
+
+\def\defparsebody #1#2#3{\begingroup\inENV% Environment for definitionbody
+\medbreak %
+% Define the end token that this defining construct specifies
+% so that it will exit this group.
+\def#1{\endgraf\endgroup\medbreak}%
+\def#2{\begingroup\obeylines\activeparens\spacesplit#3}%
+\parindent=0in
+\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent
+\exdentamount=\defbodyindent
+\begingroup %
+\catcode 61=\active %
+\obeylines\activeparens\spacesplit#3}
+
+\def\defmethparsebody #1#2#3#4 {\begingroup\inENV %
+\medbreak %
+% Define the end token that this defining construct specifies
+% so that it will exit this group.
+\def#1{\endgraf\endgroup\medbreak}%
+\def#2##1 {\begingroup\obeylines\activeparens\spacesplit{#3{##1}}}%
+\parindent=0in
+\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent
+\exdentamount=\defbodyindent
+\begingroup\obeylines\activeparens\spacesplit{#3{#4}}}
+
+\def\defopparsebody #1#2#3#4#5 {\begingroup\inENV %
+\medbreak %
+% Define the end token that this defining construct specifies
+% so that it will exit this group.
+\def#1{\endgraf\endgroup\medbreak}%
+\def#2##1 ##2 {\def#4{##1}%
+\begingroup\obeylines\activeparens\spacesplit{#3{##2}}}%
+\parindent=0in
+\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent
+\exdentamount=\defbodyindent
+\begingroup\obeylines\activeparens\spacesplit{#3{#5}}}
+
+% These parsing functions are similar to the preceding ones
+% except that they do not make parens into active characters.
+% These are used for "variables" since they have no arguments.
+
+\def\defvarparsebody #1#2#3{\begingroup\inENV% Environment for definitionbody
+\medbreak %
+% Define the end token that this defining construct specifies
+% so that it will exit this group.
+\def#1{\endgraf\endgroup\medbreak}%
+\def#2{\begingroup\obeylines\spacesplit#3}%
+\parindent=0in
+\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent
+\exdentamount=\defbodyindent
+\begingroup %
+\catcode 61=\active %
+\obeylines\spacesplit#3}
+
+\def\defvrparsebody #1#2#3#4 {\begingroup\inENV %
+\medbreak %
+% Define the end token that this defining construct specifies
+% so that it will exit this group.
+\def#1{\endgraf\endgroup\medbreak}%
+\def#2##1 {\begingroup\obeylines\spacesplit{#3{##1}}}%
+\parindent=0in
+\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent
+\exdentamount=\defbodyindent
+\begingroup\obeylines\spacesplit{#3{#4}}}
+
+% This seems to work right in all cases.
+\let\deftpparsebody=\defvrparsebody
+% This fails to work.  When given `@deftp {Data Type} foo_t',
+% it thinks the type name is just `f'.
+%%% This is the same as all the others except for the last line.  We need
+%%% to parse the arguments differently for @deftp, since the ``attributes''
+%%% there are optional.
+%%%
+%%\def\deftpparsebody #1#2#3#4 {\begingroup\inENV %
+%%\medbreak %
+%%% Define the end token that this defining construct specifies
+%%% so that it will exit this group.
+%%\def#1{\endgraf\endgroup\medbreak}%
+%%\def#2##1 {\begingroup\obeylines\spacesplit{#3{##1}}}%
+%%\parindent=0in
+%%\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent
+%%\exdentamount=\defbodyindent
+%%\begingroup\obeylines\parsetpheaderline{#3{#4}}}
+
+%%{\obeylines %
+%%  % Parse the type name and any attributes (field names, etc.).
+%%  % #1 is the beginning of the macro call that will produce the output,
+%%  %   i.e., \deftpheader{CLASS}; this is passed from \deftpparsebody.
+%%  % #2 is the type name, e.g., `struct termios'.
+%%  % #3 is the (possibly empty) attribute list.
+%%  %
+%%  \gdef\parsetpheaderline#1#2#3^^M{%
+%%    \endgroup % Started in \deftpparsebody.
+%%    %
+%%    % If the attribute list is in fact empty, there will be no space after
+%%    % #2; so we can't put a space in our TeX parameter list.  But if it
+%%    % isn't empty, then #3 will begin with an unwanted space.
+%%    \def\theargs{\ignorespaces #3}%
+%%    %
+%%    % Call the macro to produce the output.
+%%    #1{#2}\theargs %
+%%  }%
+%%}
+
+\def\defopvarparsebody #1#2#3#4#5 {\begingroup\inENV %
+\medbreak %
+% Define the end token that this defining construct specifies
+% so that it will exit this group.
+\def#1{\endgraf\endgroup\medbreak}%
+\def#2##1 ##2 {\def#4{##1}%
+\begingroup\obeylines\spacesplit{#3{##2}}}%
+\parindent=0in
+\advance\leftskip by \defbodyindent \advance \rightskip by \defbodyindent
+\exdentamount=\defbodyindent
+\begingroup\obeylines\spacesplit{#3{#5}}}
+
+% Split up #2 at the first space token.
+% call #1 with two arguments:
+%  the first is all of #2 before the space token,
+%  the second is all of #2 after that space token.
+% If #2 contains no space token, all of it is passed as the first arg
+% and the second is passed as empty.
+
+{\obeylines
+\gdef\spacesplit#1#2^^M{\endgroup\spacesplitfoo{#1}#2 \relax\spacesplitfoo}%
+\long\gdef\spacesplitfoo#1#2 #3#4\spacesplitfoo{%
+\ifx\relax #3%
+#1{#2}{}\else #1{#2}{#3#4}\fi}}
+
+% So much for the things common to all kinds of definitions.
+
+% Define @defun.
+
+% First, define the processing that is wanted for arguments of \defun
+% Use this to expand the args and terminate the paragraph they make up
+
+\def\defunargs #1{\functionparens \sl
+% Expand, preventing hyphenation at `-' chars.
+% Note that groups don't affect changes in \hyphenchar.
+\hyphenchar\tensl=0
+#1%
+\hyphenchar\tensl=45
+\ifnum\parencount=0 \else \errmessage{unbalanced parens in @def arguments}\fi%
+\interlinepenalty=10000
+\advance\rightskip by 0pt plus 1fil
+\endgraf\penalty 10000\vskip -\parskip\penalty 10000%
+}
+
+\def\deftypefunargs #1{%
+% Expand, preventing hyphenation at `-' chars.
+% Note that groups don't affect changes in \hyphenchar.
+\functionparens
+\code{#1}%
+\interlinepenalty=10000
+\advance\rightskip by 0pt plus 1fil
+\endgraf\penalty 10000\vskip -\parskip\penalty 10000%
+}
+
+% Do complete processing of one @defun or @defunx line already parsed.
+
+% @deffn Command forward-char nchars
+
+\def\deffn{\defmethparsebody\Edeffn\deffnx\deffnheader}
+
+\def\deffnheader #1#2#3{\doind {fn}{\code{#2}}%
+\begingroup\defname {#2}{#1}\defunargs{#3}\endgroup %
+\catcode 61=\other % Turn off change made in \defparsebody
+}
+
+% @defun == @deffn Function
+
+\def\defun{\defparsebody\Edefun\defunx\defunheader}
+
+\def\defunheader #1#2{\doind {fn}{\code{#1}}% Make entry in function index
+\begingroup\defname {#1}{Function}%
+\defunargs {#2}\endgroup %
+\catcode 61=\other % Turn off change made in \defparsebody
+}
+
+% @deftypefun int foobar (int @var{foo}, float @var{bar})
+
+\def\deftypefun{\defparsebody\Edeftypefun\deftypefunx\deftypefunheader}
+
+% #1 is the data type.  #2 is the name and args.
+\def\deftypefunheader #1#2{\deftypefunheaderx{#1}#2 \relax}
+% #1 is the data type, #2 the name, #3 the args.
+\def\deftypefunheaderx #1#2 #3\relax{%
+\doind {fn}{\code{#2}}% Make entry in function index
+\begingroup\defname {\code{#1} #2}{Function}%
+\deftypefunargs {#3}\endgroup %
+\catcode 61=\other % Turn off change made in \defparsebody
+}
+
+% @deftypefn {Library Function} int foobar (int @var{foo}, float @var{bar})
+
+\def\deftypefn{\defmethparsebody\Edeftypefn\deftypefnx\deftypefnheader}
+
+% #1 is the classification.  #2 is the data type.  #3 is the name and args.
+\def\deftypefnheader #1#2#3{\deftypefnheaderx{#1}{#2}#3 \relax}
+% #1 is the classification, #2 the data type, #3 the name, #4 the args.
+\def\deftypefnheaderx #1#2#3 #4\relax{%
+\doind {fn}{\code{#3}}% Make entry in function index
+\begingroup\defname {\code{#2} #3}{#1}%
+\deftypefunargs {#4}\endgroup %
+\catcode 61=\other % Turn off change made in \defparsebody
+}
+
+% @defmac == @deffn Macro
+
+\def\defmac{\defparsebody\Edefmac\defmacx\defmacheader}
+
+\def\defmacheader #1#2{\doind {fn}{\code{#1}}% Make entry in function index
+\begingroup\defname {#1}{Macro}%
+\defunargs {#2}\endgroup %
+\catcode 61=\other % Turn off change made in \defparsebody
+}
+
+% @defspec == @deffn Special Form
+
+\def\defspec{\defparsebody\Edefspec\defspecx\defspecheader}
+
+\def\defspecheader #1#2{\doind {fn}{\code{#1}}% Make entry in function index
+\begingroup\defname {#1}{Special Form}%
+\defunargs {#2}\endgroup %
+\catcode 61=\other % Turn off change made in \defparsebody
+}
+
+% This definition is run if you use @defunx
+% anywhere other than immediately after a @defun or @defunx.
+
+\def\deffnx #1 {\errmessage{@deffnx in invalid context}}
+\def\defunx #1 {\errmessage{@defunx in invalid context}}
+\def\defmacx #1 {\errmessage{@defmacx in invalid context}}
+\def\defspecx #1 {\errmessage{@defspecx in invalid context}}
+\def\deftypefnx #1 {\errmessage{@deftypefnx in invalid context}}
+\def\deftypeunx #1 {\errmessage{@deftypeunx in invalid context}}
+
+% @defmethod, and so on
+
+% @defop {Funny Method} foo-class frobnicate argument
+
+\def\defop #1 {\def\defoptype{#1}%
+\defopparsebody\Edefop\defopx\defopheader\defoptype}
+
+\def\defopheader #1#2#3{%
+\dosubind {fn}{\code{#2}}{on #1}% Make entry in function index
+\begingroup\defname {#2}{\defoptype{} on #1}%
+\defunargs {#3}\endgroup %
+}
+
+% @defmethod == @defop Method
+
+\def\defmethod{\defmethparsebody\Edefmethod\defmethodx\defmethodheader}
+
+\def\defmethodheader #1#2#3{%
+\dosubind {fn}{\code{#2}}{on #1}% entry in function index
+\begingroup\defname {#2}{Method on #1}%
+\defunargs {#3}\endgroup %
+}
+
+% @defcv {Class Option} foo-class foo-flag
+
+\def\defcv #1 {\def\defcvtype{#1}%
+\defopvarparsebody\Edefcv\defcvx\defcvarheader\defcvtype}
+
+\def\defcvarheader #1#2#3{%
+\dosubind {vr}{\code{#2}}{of #1}% Make entry in var index
+\begingroup\defname {#2}{\defcvtype{} of #1}%
+\defvarargs {#3}\endgroup %
+}
+
+% @defivar == @defcv {Instance Variable}
+
+\def\defivar{\defvrparsebody\Edefivar\defivarx\defivarheader}
+
+\def\defivarheader #1#2#3{%
+\dosubind {vr}{\code{#2}}{of #1}% Make entry in var index
+\begingroup\defname {#2}{Instance Variable of #1}%
+\defvarargs {#3}\endgroup %
+}
+
+% These definitions are run if you use @defmethodx, etc.,
+% anywhere other than immediately after a @defmethod, etc.
+
+\def\defopx #1 {\errmessage{@defopx in invalid context}}
+\def\defmethodx #1 {\errmessage{@defmethodx in invalid context}}
+\def\defcvx #1 {\errmessage{@defcvx in invalid context}}
+\def\defivarx #1 {\errmessage{@defivarx in invalid context}}
+
+% Now @defvar
+
+% First, define the processing that is wanted for arguments of @defvar.
+% This is actually simple: just print them in roman.
+% This must expand the args and terminate the paragraph they make up
+\def\defvarargs #1{\normalparens #1%
+\interlinepenalty=10000
+\endgraf\penalty 10000\vskip -\parskip\penalty 10000}
+
+% @defvr Counter foo-count
+
+\def\defvr{\defvrparsebody\Edefvr\defvrx\defvrheader}
+
+\def\defvrheader #1#2#3{\doind {vr}{\code{#2}}%
+\begingroup\defname {#2}{#1}\defvarargs{#3}\endgroup}
+
+% @defvar == @defvr Variable
+
+\def\defvar{\defvarparsebody\Edefvar\defvarx\defvarheader}
+
+\def\defvarheader #1#2{\doind {vr}{\code{#1}}% Make entry in var index
+\begingroup\defname {#1}{Variable}%
+\defvarargs {#2}\endgroup %
+}
+
+% @defopt == @defvr {User Option}
+
+\def\defopt{\defvarparsebody\Edefopt\defoptx\defoptheader}
+
+\def\defoptheader #1#2{\doind {vr}{\code{#1}}% Make entry in var index
+\begingroup\defname {#1}{User Option}%
+\defvarargs {#2}\endgroup %
+}
+
+% @deftypevar int foobar
+
+\def\deftypevar{\defvarparsebody\Edeftypevar\deftypevarx\deftypevarheader}
+
+% #1 is the data type.  #2 is the name.
+\def\deftypevarheader #1#2{%
+\doind {vr}{\code{#2}}% Make entry in variables index
+\begingroup\defname {\code{#1} #2}{Variable}%
+\interlinepenalty=10000
+\endgraf\penalty 10000\vskip -\parskip\penalty 10000
+\endgroup}
+
+% @deftypevr {Global Flag} int enable
+
+\def\deftypevr{\defvrparsebody\Edeftypevr\deftypevrx\deftypevrheader}
+
+\def\deftypevrheader #1#2#3{\doind {vr}{\code{#3}}%
+\begingroup\defname {\code{#2} #3}{#1}
+\interlinepenalty=10000
+\endgraf\penalty 10000\vskip -\parskip\penalty 10000
+\endgroup}
+
+% This definition is run if you use @defvarx
+% anywhere other than immediately after a @defvar or @defvarx.
+
+\def\defvrx #1 {\errmessage{@defvrx in invalid context}}
+\def\defvarx #1 {\errmessage{@defvarx in invalid context}}
+\def\defoptx #1 {\errmessage{@defoptx in invalid context}}
+\def\deftypevarx #1 {\errmessage{@deftypevarx in invalid context}}
+\def\deftypevrx #1 {\errmessage{@deftypevrx in invalid context}}
+
+% Now define @deftp
+% Args are printed in bold, a slight difference from @defvar.
+
+\def\deftpargs #1{\bf \defvarargs{#1}}
+
+% @deftp Class window height width ...
+
+\def\deftp{\deftpparsebody\Edeftp\deftpx\deftpheader}
+
+\def\deftpheader #1#2#3{\doind {tp}{\code{#2}}%
+\begingroup\defname {#2}{#1}\deftpargs{#3}\endgroup}
+
+% This definition is run if you use @deftpx, etc
+% anywhere other than immediately after a @deftp, etc.
+
+\def\deftpx #1 {\errmessage{@deftpx in invalid context}}
+
+\message{cross reference,}
+% Define cross-reference macros
+\newwrite \auxfile
+
+\newif\ifhavexrefs  % True if xref values are known.
+\newif\ifwarnedxrefs  % True if we warned once that they aren't known.
+
+% \setref{foo} defines a cross-reference point named foo.
+
+\def\setref#1{%
+%\dosetq{#1-title}{Ytitle}%
+\dosetq{#1-pg}{Ypagenumber}%
+\dosetq{#1-snt}{Ysectionnumberandtype}}
+
+\def\unnumbsetref#1{%
+%\dosetq{#1-title}{Ytitle}%
+\dosetq{#1-pg}{Ypagenumber}%
+\dosetq{#1-snt}{Ynothing}}
+
+\def\appendixsetref#1{%
+%\dosetq{#1-title}{Ytitle}%
+\dosetq{#1-pg}{Ypagenumber}%
+\dosetq{#1-snt}{Yappendixletterandtype}}
+
+% \xref, \pxref, and \ref generate cross-references to specified points.
+% For \xrefX, #1 is the node name, #2 the name of the Info
+% cross-reference, #3 the printed node name, #4 the name of the Info
+% file, #5 the name of the printed manual.  All but the node name can be
+% omitted.
+%
+\def\pxref#1{see \xrefX[#1,,,,,,,]}
+\def\xref#1{See \xrefX[#1,,,,,,,]}
+\def\ref#1{\xrefX[#1,,,,,,,]}
+\def\xrefX[#1,#2,#3,#4,#5,#6]{\begingroup%
+\def\printedmanual{\ignorespaces #5}%
+\def\printednodename{\ignorespaces #3}%
+%
+\setbox1=\hbox{\printedmanual}%
+\setbox0=\hbox{\printednodename}%
+\ifdim \wd0=0pt%
+\def\printednodename{\ignorespaces #1}%
+%%% Uncommment the following line to make the actual chapter or section title
+%%% appear inside the square brackets.
+%\def\printednodename{#1-title}%
+\fi%
+%
+%
+% If we use \unhbox0 and \unhbox1 to print the node names, TeX does
+% not insert empty discretionaries after hyphens, which means that it
+% will not find a line break at a hyphen in a node names.  Since some
+% manuals are best written with fairly long node names, containing
+% hyphens, this is a loss.  Therefore, we simply give the text of
+% the node name again, so it is as if TeX is seeing it for the first
+% time.
+\ifdim \wd1>0pt
+section ``\printednodename'' in \cite{\printedmanual}%
+\else%
+\turnoffactive%
+\refx{#1-snt}{} [\printednodename], page\tie\refx{#1-pg}{}%
+\fi
+\endgroup}
+
+% \dosetq is the interface for calls from other macros
+
+% Use \turnoffactive so that punctuation chars such as underscore
+% work in node names.
+\def\dosetq #1#2{{\let\folio=0 \turnoffactive%
+\edef\next{\write\auxfile{\internalsetq {#1}{#2}}}%
+\next}}
+
+% \internalsetq {foo}{page} expands into
+% CHARACTERS 'xrdef {foo}{...expansion of \Ypage...}
+% When the aux file is read, ' is the escape character
+
+\def\internalsetq #1#2{'xrdef {#1}{\csname #2\endcsname}}
+
+% Things to be expanded by \internalsetq
+
+\def\Ypagenumber{\folio}
+
+\def\Ytitle{\thischapter}
+
+\def\Ynothing{}
+
+\def\Ysectionnumberandtype{%
+\ifnum\secno=0 Chapter\xreftie\the\chapno %
+\else \ifnum \subsecno=0 Section\xreftie\the\chapno.\the\secno %
+\else \ifnum \subsubsecno=0 %
+Section\xreftie\the\chapno.\the\secno.\the\subsecno %
+\else %
+Section\xreftie\the\chapno.\the\secno.\the\subsecno.\the\subsubsecno %
+\fi \fi \fi }
+
+\def\Yappendixletterandtype{%
+\ifnum\secno=0 Appendix\xreftie'char\the\appendixno{}%
+\else \ifnum \subsecno=0 Section\xreftie'char\the\appendixno.\the\secno %
+\else \ifnum \subsubsecno=0 %
+Section\xreftie'char\the\appendixno.\the\secno.\the\subsecno %
+\else %
+Section\xreftie'char\the\appendixno.\the\secno.\the\subsecno.\the\subsubsecno %
+\fi \fi \fi }
+
+\gdef\xreftie{'tie}
+
+% Use TeX 3.0's \inputlineno to get the line number, for better error
+% messages, but if we're using an old version of TeX, don't do anything.
+%
+\ifx\inputlineno\thisisundefined
+  \let\linenumber = \empty % Non-3.0.
+\else
+  \def\linenumber{\the\inputlineno:\space}
+\fi
+
+% Define \refx{NAME}{SUFFIX} to reference a cross-reference string named NAME.
+% If its value is nonempty, SUFFIX is output afterward.
+
+\def\refx#1#2{%
+  \expandafter\ifx\csname X#1\endcsname\relax
+    % If not defined, say something at least.
+    $\langle$un\-de\-fined$\rangle$%
+    \ifhavexrefs
+      \message{\linenumber Undefined cross reference `#1'.}%
+    \else
+      \ifwarnedxrefs\else
+        \global\warnedxrefstrue
+        \message{Cross reference values unknown; you must run TeX again.}%
+      \fi
+    \fi
+  \else
+    % It's defined, so just use it.
+    \csname X#1\endcsname
+  \fi
+  #2% Output the suffix in any case.
+}
+
+% Read the last existing aux file, if any.  No error if none exists.
+
+% This is the macro invoked by entries in the aux file.
+\def\xrdef #1#2{
+{\catcode`\'=\other\expandafter \gdef \csname X#1\endcsname {#2}}}
+
+\def\readauxfile{%
+\begingroup
+\catcode `\^^@=\other
+\catcode `\
=\other
+\catcode `\=\other
+\catcode `\^^C=\other
+\catcode `\^^D=\other
+\catcode `\^^E=\other
+\catcode `\^^F=\other
+\catcode `\^^G=\other
+\catcode `\^^H=\other
+\catcode `\=\other
+\catcode `\^^L=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode `\=\other
+\catcode 26=\other
+\catcode `\^^[=\other
+\catcode `\^^\=\other
+\catcode `\^^]=\other
+\catcode `\^^^=\other
+\catcode `\^^_=\other
+\catcode `\@=\other
+\catcode `\^=\other
+\catcode `\~=\other
+\catcode `\[=\other
+\catcode `\]=\other
+\catcode`\"=\other
+\catcode`\_=\other
+\catcode`\|=\other
+\catcode`\<=\other
+\catcode`\>=\other
+\catcode `\$=\other
+\catcode `\#=\other
+\catcode `\&=\other
+% `\+ does not work, so use 43.
+\catcode 43=\other
+% the aux file uses ' as the escape.
+% Turn off \ as an escape so we do not lose on
+% entries which were dumped with control sequences in their names.
+% For example, 'xrdef {$\leq $-fun}{page ...} made by @defun ^^
+% Reference to such entries still does not work the way one would wish,
+% but at least they do not bomb out when the aux file is read in.
+\catcode `\{=1 \catcode `\}=2
+\catcode `\%=\other
+\catcode `\'=0
+\catcode `\\=\other
+\openin 1 \jobname.aux
+\ifeof 1 \else \closein 1 \input \jobname.aux \global\havexrefstrue
+\global\warnedobstrue
+\fi
+% Open the new aux file.  Tex will close it automatically at exit.
+\openout \auxfile=\jobname.aux
+\endgroup}
+
+
+% Footnotes.
+
+\newcount \footnoteno
+
+% The trailing space in the following definition for supereject is
+% vital for proper filling; pages come out unaligned when you do a
+% pagealignmacro call if that space before the closing brace is
+% removed.
+\def\supereject{\par\penalty -20000\footnoteno =0 }
+
+% @footnotestyle is meaningful for info output only..
+\let\footnotestyle=\comment
+
+\let\ptexfootnote=\footnote
+
+{\catcode `\@=11
+%
+% Auto-number footnotes.  Otherwise like plain.
+\gdef\footnote{%
+  \global\advance\footnoteno by \@ne
+  \edef\thisfootno{$^{\the\footnoteno}$}%
+  %
+  % In case the footnote comes at the end of a sentence, preserve the
+  % extra spacing after we do the footnote number.
+  \let\@sf\empty
+  \ifhmode\edef\@sf{\spacefactor\the\spacefactor}\/\fi
+  %
+  % Remove inadvertent blank space before typesetting the footnote number.
+  \unskip
+  \thisfootno\@sf
+  \footnotezzz
+}%
+
+% Don't bother with the trickery in plain.tex to not require the
+% footnote text as a parameter.  Our footnotes don't need to be so general.
+%
+\long\gdef\footnotezzz#1{\insert\footins{%
+  % We want to typeset this text as a normal paragraph, even if the
+  % footnote reference occurs in (for example) a display environment.
+  % So reset some parameters.
+  \interlinepenalty\interfootnotelinepenalty
+  \splittopskip\ht\strutbox % top baseline for broken footnotes
+  \splitmaxdepth\dp\strutbox
+  \floatingpenalty\@MM
+  \leftskip\z@skip
+  \rightskip\z@skip
+  \spaceskip\z@skip
+  \xspaceskip\z@skip
+  \parindent\defaultparindent
+  %
+  % Hang the footnote text off the number.
+  \hang
+  \textindent{\thisfootno}%
+  %
+  % Don't crash into the line above the footnote text.  Since this
+  % expands into a box, it must come within the paragraph, lest it
+  % provide a place where TeX can split the footnote.
+  \footstrut
+  #1\strut}%
+}
+
+}%end \catcode `\@=11
+
+% Set the baselineskip to #1, and the lineskip and strut size
+% correspondingly.  There is no deep meaning behind these magic numbers
+% used as factors; they just match (closely enough) what Knuth defined.
+%
+\def\lineskipfactor{.08333}
+\def\strutheightpercent{.70833}
+\def\strutdepthpercent {.29167}
+%
+\def\setleading#1{%
+  \normalbaselineskip = #1\relax
+  \normallineskip = \lineskipfactor\normalbaselineskip
+  \normalbaselines
+  \setbox\strutbox =\hbox{%
+    \vrule width0pt height\strutheightpercent\baselineskip
+                    depth \strutdepthpercent \baselineskip
+  }%
+}
+
+% @| inserts a changebar to the left of the current line.  It should
+% surround any changed text.  This approach does *not* work if the
+% change spans more than two lines of output.  To handle that, we would
+% have adopt a much more difficult approach (putting marks into the main
+% vertical list for the beginning and end of each change).
+%
+\def\|{%
+  % \vadjust can only be used in horizontal mode.
+  \leavevmode
+  %
+  % Append this vertical mode material after the current line in the output.
+  \vadjust{%
+    % We want to insert a rule with the height and depth of the current
+    % leading; that is exactly what \strutbox is supposed to record.
+    \vskip-\baselineskip
+    %
+    % \vadjust-items are inserted at the left edge of the type.  So
+    % the \llap here moves out into the left-hand margin.
+    \llap{%
+      %
+      % For a thicker or thinner bar, change the `1pt'.
+      \vrule height\baselineskip width1pt
+      %
+      % This is the space between the bar and the text.
+      \hskip 12pt
+    }%
+  }%
+}
+
+% For a final copy, take out the rectangles
+% that mark overfull boxes (in case you have decided
+% that the text looks ok even though it passes the margin).
+%
+\def\finalout{\overfullrule=0pt}
+
+
+% End of control word definitions.
+
+\message{and turning on texinfo input format.}
+
+\def\openindices{%
+   \newindex{cp}%
+   \newcodeindex{fn}%
+   \newcodeindex{vr}%
+   \newcodeindex{tp}%
+   \newcodeindex{ky}%
+   \newcodeindex{pg}%
+}
+
+% Set some numeric style parameters, for 8.5 x 11 format.
+
+%\hsize = 6.5in
+\newdimen\defaultparindent \defaultparindent = 15pt
+\parindent = \defaultparindent
+\parskip 18pt plus 1pt
+\setleading{15pt}
+\advance\topskip by 1.2cm
+
+% Prevent underfull vbox error messages.
+\vbadness=10000
+
+% Following George Bush, just get rid of widows and orphans.
+\widowpenalty=10000
+\clubpenalty=10000
+
+% Use TeX 3.0's \emergencystretch to help line breaking, but if we're
+% using an old version of TeX, don't do anything.  We want the amount of
+% stretch added to depend on the line length, hence the dependence on
+% \hsize.  This makes it come to about 9pt for the 8.5x11 format.
+%
+\ifx\emergencystretch\thisisundefined
+  % Allow us to assign to \emergencystretch anyway.
+  \def\emergencystretch{\dimen0}%
+\else
+  \emergencystretch = \hsize
+  \divide\emergencystretch by 45
+\fi
+
+% Use @smallbook to reset parameters for 7x9.5 format  (or else 7x9.25)
+\def\smallbook{
+
+% These values for secheadingskip and subsecheadingskip are
+% experiments.  RJC 7 Aug 1992
+\global\secheadingskip = 17pt plus 6pt minus 3pt
+\global\subsecheadingskip = 14pt plus 6pt minus 3pt
+
+\global\lispnarrowing = 0.3in
+\setleading{12pt}
+\advance\topskip by -1cm
+\global\parskip 3pt plus 1pt
+\global\hsize = 5in
+\global\vsize=7.5in
+\global\tolerance=700
+\global\hfuzz=1pt
+\global\contentsrightmargin=0pt
+
+\global\pagewidth=\hsize
+\global\pageheight=\vsize
+
+\global\let\smalllisp=\smalllispx
+\global\let\smallexample=\smalllispx
+\global\def\Esmallexample{\Esmalllisp}
+}
+
+% Use @afourpaper to print on European A4 paper.
+\def\afourpaper{
+\global\tolerance=700
+\global\hfuzz=1pt
+\setleading{12pt}
+\global\parskip 15pt plus 1pt
+
+\global\vsize= 53\baselineskip
+\advance\vsize by \topskip
+%\global\hsize=   5.85in     % A4 wide 10pt
+\global\hsize=  6.5in
+\global\outerhsize=\hsize
+\global\advance\outerhsize by 0.5in
+\global\outervsize=\vsize
+\global\advance\outervsize by 0.6in
+
+\global\pagewidth=\hsize
+\global\pageheight=\vsize
+}
+
+% Define macros to output various characters with catcode for normal text.
+\catcode`\"=\other
+\catcode`\~=\other
+\catcode`\^=\other
+\catcode`\_=\other
+\catcode`\|=\other
+\catcode`\<=\other
+\catcode`\>=\other
+\catcode`\+=\other
+\def\normaldoublequote{"}
+\def\normaltilde{~}
+\def\normalcaret{^}
+\def\normalunderscore{_}
+\def\normalverticalbar{|}
+\def\normalless{<}
+\def\normalgreater{>}
+\def\normalplus{+}
+
+% This macro is used to make a character print one way in ttfont
+% where it can probably just be output, and another way in other fonts,
+% where something hairier probably needs to be done.
+%
+% #1 is what to print if we are indeed using \tt; #2 is what to print
+% otherwise.  Since all the Computer Modern typewriter fonts have zero
+% interword stretch (and shrink), and it is reasonable to expect all
+% typewriter fonts to have this, we can check that font parameter.
+%
+\def\ifusingtt#1#2{\ifdim \fontdimen3\the\font=0pt #1\else #2\fi}
+
+% Turn off all special characters except @
+% (and those which the user can use as if they were ordinary).
+% Most of these we simply print from the \tt font, but for some, we can
+% use math or other variants that look better in normal text.
+
+\catcode`\"=\active
+\def\activedoublequote{{\tt \char '042}}
+\let"=\activedoublequote
+\catcode`\~=\active
+\def~{{\tt \char '176}}
+\chardef\hat=`\^
+\catcode`\^=\active
+\def^{{\tt \hat}}
+
+\catcode`\_=\active
+\def_{\ifusingtt\normalunderscore\_}
+% Subroutine for the previous macro.
+\def\_{\lvvmode \kern.06em \vbox{\hrule width.3em height.1ex}}
+
+% \lvvmode is equivalent in function to \leavevmode.
+% Using \leavevmode runs into trouble when written out to
+% an index file due to the expansion of \leavevmode into ``\unhbox
+% \voidb@x'' ---which looks to TeX like ``\unhbox \voidb\x'' due to our
+% magic tricks with @.
+\def\lvvmode{\vbox to 0pt{}}
+
+\catcode`\|=\active
+\def|{{\tt \char '174}}
+\chardef \less=`\<
+\catcode`\<=\active
+\def<{{\tt \less}}
+\chardef \gtr=`\>
+\catcode`\>=\active
+\def>{{\tt \gtr}}
+\catcode`\+=\active
+\def+{{\tt \char 43}}
+%\catcode 27=\active
+%\def^^[{$\diamondsuit$}
+
+% Used sometimes to turn off (effectively) the active characters
+% even after parsing them.
+\def\turnoffactive{\let"=\normaldoublequote
+\let~=\normaltilde
+\let^=\normalcaret
+\let_=\normalunderscore
+\let|=\normalverticalbar
+\let<=\normalless
+\let>=\normalgreater
+\let+=\normalplus}
+
+% Set up an active definition for =, but don't enable it most of the time.
+{\catcode`\==\active
+\global\def={{\tt \char 61}}}
+
+\catcode`\@=0
+
+% \rawbackslashxx output one backslash character in current font
+\global\chardef\rawbackslashxx=`\\
+%{\catcode`\\=\other
+%@gdef@rawbackslashxx{\}}
+
+% \rawbackslash redefines \ as input to do \rawbackslashxx.
+{\catcode`\\=\active
+@gdef@rawbackslash{@let\=@rawbackslashxx }}
+
+% \normalbackslash outputs one backslash in fixed width font.
+\def\normalbackslash{{\tt\rawbackslashxx}}
+
+% Say @foo, not \foo, in error messages.
+\escapechar=`\@
+
+% \catcode 17=0   % Define control-q
+\catcode`\\=\active
+
+% If a .fmt file is being used, we don't want the `\input texinfo' to show up.
+% That is what \eatinput is for; after that, the `\' should revert to printing
+% a backslash.
+%
+@gdef@eatinput input texinfo{@fixbackslash}
+@global@let\ = @eatinput
+
+% On the other hand, perhaps the file did not have a `\input texinfo'. Then
+% the first `\{ in the file would cause an error. This macro tries to fix
+% that, assuming it is called before the first `\' could plausibly occur.
+%
+@gdef@fixbackslash{@ifx\@eatinput @let\ = @normalbackslash @fi}
+
+%% These look ok in all fonts, so just make them not special.  The @rm below
+%% makes sure that the current font starts out as the newly loaded cmr10
+@catcode`@$=@other @catcode`@%=@other @catcode`@&=@other @catcode`@#=@other
+
+@textfonts
+@rm
+
+@c Local variables:
+@c page-delimiter: "^\\\\message"
+@c End:
diff --git a/emacs_keymap.c b/emacs_keymap.c
new file mode 100644
index 0000000..849d85f
--- /dev/null
+++ b/emacs_keymap.c
@@ -0,0 +1,885 @@
+/* emacs_keymap.c -- the keymap for emacs_mode in readline (). */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#if !defined (BUFSIZ)
+#include <stdio.h>
+#endif /* !BUFSIZ */
+
+#include "readline.h"
+
+/* An array of function pointers, one for each possible key.
+   If the type byte is ISKMAP, then the pointer is the address of
+   a keymap. */
+
+KEYMAP_ENTRY_ARRAY emacs_standard_keymap = {
+
+  /* Control keys. */
+  { ISFUNC, (Function *)0x0 },		/* Control-@ */
+  { ISFUNC, rl_beg_of_line },		/* Control-a */
+  { ISFUNC, rl_backward },		/* Control-b */
+  { ISFUNC, (Function *)0x0 },		/* Control-c */
+  { ISFUNC, rl_delete },		/* Control-d */
+  { ISFUNC, rl_end_of_line },		/* Control-e */
+  { ISFUNC, rl_forward },		/* Control-f */
+  { ISFUNC, rl_abort },			/* Control-g */
+  { ISFUNC, rl_rubout },		/* Control-h */
+  { ISFUNC, rl_complete },		/* Control-i */
+  { ISFUNC, rl_newline },		/* Control-j */
+  { ISFUNC, rl_kill_line },		/* Control-k */
+  { ISFUNC, rl_clear_screen },		/* Control-l */
+  { ISFUNC, rl_newline },		/* Control-m */
+  { ISFUNC, rl_get_next_history },	/* Control-n */
+  { ISFUNC, (Function *)0x0 },		/* Control-o */
+  { ISFUNC, rl_get_previous_history },	/* Control-p */
+  { ISFUNC, rl_quoted_insert },		/* Control-q */
+  { ISFUNC, rl_reverse_search_history }, /* Control-r */
+  { ISFUNC, rl_forward_search_history }, /* Control-s */
+  { ISFUNC, rl_transpose_chars },	/* Control-t */
+  { ISFUNC, rl_unix_line_discard },	/* Control-u */
+  { ISFUNC, rl_quoted_insert },		/* Control-v */
+  { ISFUNC, rl_unix_word_rubout },	/* Control-w */
+  { ISKMAP, (Function *)emacs_ctlx_keymap },	/* Control-x */
+  { ISFUNC, rl_yank },			/* Control-y */
+  { ISFUNC, (Function *)0x0 },		/* Control-z */
+  { ISKMAP, (Function *)emacs_meta_keymap }, /* Control-[ */
+  { ISFUNC, (Function *)0x0 },		/* Control-\ */
+  { ISFUNC, (Function *)0x0 },		/* Control-] */
+  { ISFUNC, (Function *)0x0 },		/* Control-^ */
+  { ISFUNC, rl_undo_command },		/* Control-_ */
+
+  /* The start of printing characters. */
+  { ISFUNC, rl_insert },	/* SPACE */
+  { ISFUNC, rl_insert },	/* ! */
+  { ISFUNC, rl_insert },	/* " */
+  { ISFUNC, rl_insert },	/* # */
+  { ISFUNC, rl_insert },	/* $ */
+  { ISFUNC, rl_insert },	/* % */
+  { ISFUNC, rl_insert },	/* & */
+  { ISFUNC, rl_insert },	/* ' */
+  { ISFUNC, rl_insert },	/* ( */
+#if defined (PAREN_MATCHING)
+  { ISFUNC, rl_insert_close },	/* ) */
+#else
+  { ISFUNC, rl_insert },	/* ) */
+#endif /* !PAREN_MATCHING */
+  { ISFUNC, rl_insert },	/* * */
+  { ISFUNC, rl_insert },	/* + */
+  { ISFUNC, rl_insert },	/* , */
+  { ISFUNC, rl_insert },	/* - */
+  { ISFUNC, rl_insert },	/* . */
+  { ISFUNC, rl_insert },	/* / */
+
+  /* Regular digits. */
+  { ISFUNC, rl_insert },	/* 0 */
+  { ISFUNC, rl_insert },	/* 1 */
+  { ISFUNC, rl_insert },	/* 2 */
+  { ISFUNC, rl_insert },	/* 3 */
+  { ISFUNC, rl_insert },	/* 4 */
+  { ISFUNC, rl_insert },	/* 5 */
+  { ISFUNC, rl_insert },	/* 6 */
+  { ISFUNC, rl_insert },	/* 7 */
+  { ISFUNC, rl_insert },	/* 8 */
+  { ISFUNC, rl_insert },	/* 9 */
+
+  /* A little more punctuation. */
+  { ISFUNC, rl_insert },	/* : */
+  { ISFUNC, rl_insert },	/* ; */
+  { ISFUNC, rl_insert },	/* < */
+  { ISFUNC, rl_insert },	/* = */
+  { ISFUNC, rl_insert },	/* > */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* @ */
+
+  /* Uppercase alphabet. */
+  { ISFUNC, rl_insert },	/* A */
+  { ISFUNC, rl_insert },	/* B */
+  { ISFUNC, rl_insert },	/* C */
+  { ISFUNC, rl_insert },	/* D */
+  { ISFUNC, rl_insert },	/* E */
+  { ISFUNC, rl_insert },	/* F */
+  { ISFUNC, rl_insert },	/* G */
+  { ISFUNC, rl_insert },	/* H */
+  { ISFUNC, rl_insert },	/* I */
+  { ISFUNC, rl_insert },	/* J */
+  { ISFUNC, rl_insert },	/* K */
+  { ISFUNC, rl_insert },	/* L */
+  { ISFUNC, rl_insert },	/* M */
+  { ISFUNC, rl_insert },	/* N */
+  { ISFUNC, rl_insert },	/* O */
+  { ISFUNC, rl_insert },	/* P */
+  { ISFUNC, rl_insert },	/* Q */
+  { ISFUNC, rl_insert },	/* R */
+  { ISFUNC, rl_insert },	/* S */
+  { ISFUNC, rl_insert },	/* T */
+  { ISFUNC, rl_insert },	/* U */
+  { ISFUNC, rl_insert },	/* V */
+  { ISFUNC, rl_insert },	/* W */
+  { ISFUNC, rl_insert },	/* X */
+  { ISFUNC, rl_insert },	/* Y */
+  { ISFUNC, rl_insert },	/* Z */
+
+  /* Some more punctuation. */
+  { ISFUNC, rl_insert },	/* [ */
+  { ISFUNC, rl_insert },	/* \ */
+#if defined (PAREN_MATCHING)
+  { ISFUNC, rl_insert_close },	/* ] */
+#else
+  { ISFUNC, rl_insert },	/* ] */
+#endif /* !PAREN_MATCHING */
+  { ISFUNC, rl_insert },	/* ^ */
+  { ISFUNC, rl_insert },	/* _ */
+  { ISFUNC, rl_insert },	/* ` */
+
+  /* Lowercase alphabet. */
+  { ISFUNC, rl_insert },	/* a */
+  { ISFUNC, rl_insert },	/* b */
+  { ISFUNC, rl_insert },	/* c */
+  { ISFUNC, rl_insert },	/* d */
+  { ISFUNC, rl_insert },	/* e */
+  { ISFUNC, rl_insert },	/* f */
+  { ISFUNC, rl_insert },	/* g */
+  { ISFUNC, rl_insert },	/* h */
+  { ISFUNC, rl_insert },	/* i */
+  { ISFUNC, rl_insert },	/* j */
+  { ISFUNC, rl_insert },	/* k */
+  { ISFUNC, rl_insert },	/* l */
+  { ISFUNC, rl_insert },	/* m */
+  { ISFUNC, rl_insert },	/* n */
+  { ISFUNC, rl_insert },	/* o */
+  { ISFUNC, rl_insert },	/* p */
+  { ISFUNC, rl_insert },	/* q */
+  { ISFUNC, rl_insert },	/* r */
+  { ISFUNC, rl_insert },	/* s */
+  { ISFUNC, rl_insert },	/* t */
+  { ISFUNC, rl_insert },	/* u */
+  { ISFUNC, rl_insert },	/* v */
+  { ISFUNC, rl_insert },	/* w */
+  { ISFUNC, rl_insert },	/* x */
+  { ISFUNC, rl_insert },	/* y */
+  { ISFUNC, rl_insert },	/* z */
+
+  /* Final punctuation. */
+  { ISFUNC, rl_insert },	/* { */
+  { ISFUNC, rl_insert },	/* | */
+#if defined (PAREN_MATCHING)
+  { ISFUNC, rl_insert_close },	/* } */
+#else
+  { ISFUNC, rl_insert },	/* } */
+#endif /* !PAREN_MATCHING */
+  { ISFUNC, rl_insert },	/* ~ */
+  { ISFUNC, rl_rubout },	/* RUBOUT */
+
+#if KEYMAP_SIZE > 128
+  /* Pure 8-bit characters (128 - 159).
+     These might be used in some
+     character sets. */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+
+  /* ISO Latin-1 characters (160 - 255) */
+  { ISFUNC, rl_insert },	/* No-break space */
+  { ISFUNC, rl_insert },	/* Inverted exclamation mark */
+  { ISFUNC, rl_insert },	/* Cent sign */
+  { ISFUNC, rl_insert },	/* Pound sign */
+  { ISFUNC, rl_insert },	/* Currency sign */
+  { ISFUNC, rl_insert },	/* Yen sign */
+  { ISFUNC, rl_insert },	/* Broken bar */
+  { ISFUNC, rl_insert },	/* Section sign */
+  { ISFUNC, rl_insert },	/* Diaeresis */
+  { ISFUNC, rl_insert },	/* Copyright sign */
+  { ISFUNC, rl_insert },	/* Feminine ordinal indicator */
+  { ISFUNC, rl_insert },	/* Left pointing double angle quotation mark */
+  { ISFUNC, rl_insert },	/* Not sign */
+  { ISFUNC, rl_insert },	/* Soft hyphen */
+  { ISFUNC, rl_insert },	/* Registered sign */
+  { ISFUNC, rl_insert },	/* Macron */
+  { ISFUNC, rl_insert },	/* Degree sign */
+  { ISFUNC, rl_insert },	/* Plus-minus sign */
+  { ISFUNC, rl_insert },	/* Superscript two */
+  { ISFUNC, rl_insert },	/* Superscript three */
+  { ISFUNC, rl_insert },	/* Acute accent */
+  { ISFUNC, rl_insert },	/* Micro sign */
+  { ISFUNC, rl_insert },	/* Pilcrow sign */
+  { ISFUNC, rl_insert },	/* Middle dot */
+  { ISFUNC, rl_insert },	/* Cedilla */
+  { ISFUNC, rl_insert },	/* Superscript one */
+  { ISFUNC, rl_insert },	/* Masculine ordinal indicator */
+  { ISFUNC, rl_insert },	/* Right pointing double angle quotation mark */
+  { ISFUNC, rl_insert },	/* Vulgar fraction one quarter */
+  { ISFUNC, rl_insert },	/* Vulgar fraction one half */
+  { ISFUNC, rl_insert },	/* Vulgar fraction three quarters */
+  { ISFUNC, rl_insert },	/* Inverted questionk mark */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with tilde */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with ring above */
+  { ISFUNC, rl_insert },	/* Latin capital letter ae */
+  { ISFUNC, rl_insert },	/* Latin capital letter c with cedilla */
+  { ISFUNC, rl_insert },	/* Latin capital letter e with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter e with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter e with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter e with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin capital letter i with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter i with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter i with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter i with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin capital letter eth (Icelandic) */
+  { ISFUNC, rl_insert },	/* Latin capital letter n with tilde */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with tilde */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with diaeresis */
+  { ISFUNC, rl_insert },	/* Multiplication sign */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with stroke */
+  { ISFUNC, rl_insert },	/* Latin capital letter u with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter u with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter u with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter u with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin capital letter Y with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter thorn (Icelandic) */
+  { ISFUNC, rl_insert },	/* Latin small letter sharp s (German) */
+  { ISFUNC, rl_insert },	/* Latin small letter a with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter a with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter a with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter a with tilde */
+  { ISFUNC, rl_insert },	/* Latin small letter a with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin small letter a with ring above */
+  { ISFUNC, rl_insert },	/* Latin small letter ae */
+  { ISFUNC, rl_insert },	/* Latin small letter c with cedilla */
+  { ISFUNC, rl_insert },	/* Latin small letter e with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter e with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter e with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter e with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin small letter i with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter i with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter i with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter i with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin small letter eth (Icelandic) */
+  { ISFUNC, rl_insert },	/* Latin small letter n with tilde */
+  { ISFUNC, rl_insert },	/* Latin small letter o with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter o with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter o with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter o with tilde */
+  { ISFUNC, rl_insert },	/* Latin small letter o with diaeresis */
+  { ISFUNC, rl_insert },	/* Division sign */
+  { ISFUNC, rl_insert },	/* Latin small letter o with stroke */
+  { ISFUNC, rl_insert },	/* Latin small letter u with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter u with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter u with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter u with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin small letter y with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter thorn (Icelandic) */
+  { ISFUNC, rl_insert }		/* Latin small letter y with diaeresis */
+#endif /* KEYMAP_SIZE > 128 */
+};
+
+KEYMAP_ENTRY_ARRAY emacs_meta_keymap = {
+
+  /* Meta keys.  Just like above, but the high bit is set. */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-@ */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-a */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-b */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-c */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-d */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-e */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-f */
+  { ISFUNC, rl_abort },		/* Meta-Control-g */
+  { ISFUNC, rl_backward_kill_word },	/* Meta-Control-h */
+  { ISFUNC, rl_tab_insert },	/* Meta-Control-i */
+  { ISFUNC, rl_vi_editing_mode }, /* Meta-Control-j */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-k */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-l */
+  { ISFUNC, rl_vi_editing_mode }, /* Meta-Control-m */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-n */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-o */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-p */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-q */
+  { ISFUNC, rl_revert_line },	/* Meta-Control-r */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-s */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-t */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-u */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-v */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-w */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-x */
+  { ISFUNC, rl_yank_nth_arg },	/* Meta-Control-y */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-z */
+
+  { ISFUNC, rl_complete },	/* Meta-Control-[ */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-\ */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-] */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-^ */
+  { ISFUNC, (Function *)0x0 },	/* Meta-Control-_ */
+
+  /* The start of printing characters. */
+  { ISFUNC, (Function *)0x0 },	/* Meta-SPACE */
+  { ISFUNC, (Function *)0x0 },	/* Meta-! */
+  { ISFUNC, (Function *)0x0 },	/* Meta-" */
+  { ISFUNC, (Function *)0x0 },	/* Meta-# */
+  { ISFUNC, (Function *)0x0 },	/* Meta-$ */
+  { ISFUNC, (Function *)0x0 },	/* Meta-% */
+  { ISFUNC, rl_tilde_expand },	/* Meta-& */
+  { ISFUNC, (Function *)0x0 },	/* Meta-' */
+  { ISFUNC, (Function *)0x0 },	/* Meta-( */
+  { ISFUNC, (Function *)0x0 },	/* Meta-) */
+  { ISFUNC, (Function *)0x0 },	/* Meta-* */
+  { ISFUNC, (Function *)0x0 },	/* Meta-+ */
+  { ISFUNC, (Function *)0x0 },	/* Meta-, */
+  { ISFUNC, rl_digit_argument }, /* Meta-- */
+  { ISFUNC, rl_yank_last_arg},	/* Meta-. */
+  { ISFUNC, (Function *)0x0 },	/* Meta-/ */
+
+  /* Regular digits. */
+  { ISFUNC, rl_digit_argument }, /* Meta-0 */
+  { ISFUNC, rl_digit_argument }, /* Meta-1 */
+  { ISFUNC, rl_digit_argument }, /* Meta-2 */
+  { ISFUNC, rl_digit_argument }, /* Meta-3 */
+  { ISFUNC, rl_digit_argument }, /* Meta-4 */
+  { ISFUNC, rl_digit_argument }, /* Meta-5 */
+  { ISFUNC, rl_digit_argument }, /* Meta-6 */
+  { ISFUNC, rl_digit_argument }, /* Meta-7 */
+  { ISFUNC, rl_digit_argument }, /* Meta-8 */
+  { ISFUNC, rl_digit_argument }, /* Meta-9 */
+
+  /* A little more punctuation. */
+  { ISFUNC, (Function *)0x0 },		/* Meta-: */
+  { ISFUNC, (Function *)0x0 },		/* Meta-; */
+  { ISFUNC, rl_beginning_of_history },	/* Meta-< */
+  { ISFUNC, (Function *)0x0 },		/* Meta-= */
+  { ISFUNC, rl_end_of_history },	/* Meta-> */
+  { ISFUNC, rl_possible_completions },	/* Meta-? */
+  { ISFUNC, (Function *)0x0 },		/* Meta-@ */
+
+  /* Uppercase alphabet. */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-A */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-B */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-C */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-D */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-E */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-F */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-G */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-H */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-I */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-J */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-K */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-L */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-M */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-N */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-O */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-P */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-Q */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-R */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-S */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-T */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-U */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-V */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-W */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-X */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-Y */
+  { ISFUNC, rl_do_lowercase_version },	/* Meta-Z */
+
+  /* Some more punctuation. */
+  { ISFUNC, (Function *)0x0 },		/* Meta-[ */	/* was rl_arrow_keys */
+  { ISFUNC, rl_delete_horizontal_space },	/* Meta-\ */
+  { ISFUNC, (Function *)0x0 },		/* Meta-] */
+  { ISFUNC, (Function *)0x0 },		/* Meta-^ */
+  { ISFUNC, rl_yank_last_arg },		/* Meta-_ */
+  { ISFUNC, (Function *)0x0 },		/* Meta-` */
+
+  /* Lowercase alphabet. */
+  { ISFUNC, (Function *)0x0 },	/* Meta-a */
+  { ISFUNC, rl_backward_word },	/* Meta-b */
+  { ISFUNC, rl_capitalize_word }, /* Meta-c */
+  { ISFUNC, rl_kill_word },	/* Meta-d */
+  { ISFUNC, (Function *)0x0 },	/* Meta-e */
+  { ISFUNC, rl_forward_word },	/* Meta-f */
+  { ISFUNC, (Function *)0x0 },	/* Meta-g */
+  { ISFUNC, (Function *)0x0 },	/* Meta-h */
+  { ISFUNC, (Function *)0x0 },	/* Meta-i */
+  { ISFUNC, (Function *)0x0 },	/* Meta-j */
+  { ISFUNC, (Function *)0x0 },	/* Meta-k */
+  { ISFUNC, rl_downcase_word },	/* Meta-l */
+  { ISFUNC, (Function *)0x0 },	/* Meta-m */
+  { ISFUNC, rl_noninc_forward_search },	/* Meta-n */
+  { ISFUNC, (Function *)0x0 },	/* Meta-o */	/* was rl_arrow_keys */
+  { ISFUNC, rl_noninc_reverse_search },	/* Meta-p */
+  { ISFUNC, (Function *)0x0 },	/* Meta-q */
+  { ISFUNC, rl_revert_line },	/* Meta-r */
+  { ISFUNC, (Function *)0x0 },	/* Meta-s */
+  { ISFUNC, rl_transpose_words }, /* Meta-t */
+  { ISFUNC, rl_upcase_word },	/* Meta-u */
+  { ISFUNC, (Function *)0x0 },	/* Meta-v */
+  { ISFUNC, (Function *)0x0 },	/* Meta-w */
+  { ISFUNC, (Function *)0x0 },	/* Meta-x */
+  { ISFUNC, rl_yank_pop },	/* Meta-y */
+  { ISFUNC, (Function *)0x0 },	/* Meta-z */
+
+  /* Final punctuation. */
+  { ISFUNC, (Function *)0x0 },	/* Meta-{ */
+  { ISFUNC, (Function *)0x0 },	/* Meta-| */
+  { ISFUNC, (Function *)0x0 },	/* Meta-} */
+  { ISFUNC, rl_tilde_expand },	/* Meta-~ */
+  { ISFUNC, rl_backward_kill_word }, /* Meta-rubout */
+
+#if KEYMAP_SIZE > 128
+  /* Undefined keys. */
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 }
+#endif /* KEYMAP_SIZE > 128 */
+};
+
+KEYMAP_ENTRY_ARRAY emacs_ctlx_keymap = {
+
+  /* Control keys. */
+  { ISFUNC, (Function *)0x0 },		/* Control-@ */
+  { ISFUNC, (Function *)0x0 },		/* Control-a */
+  { ISFUNC, (Function *)0x0 },		/* Control-b */
+  { ISFUNC, (Function *)0x0 },		/* Control-c */
+  { ISFUNC, (Function *)0x0 },		/* Control-d */
+  { ISFUNC, (Function *)0x0 },		/* Control-e */
+  { ISFUNC, (Function *)0x0 },		/* Control-f */
+  { ISFUNC, rl_abort },			/* Control-g */
+  { ISFUNC, (Function *)0x0 },		/* Control-h */
+  { ISFUNC, (Function *)0x0 },		/* Control-i */
+  { ISFUNC, (Function *)0x0 },		/* Control-j */
+  { ISFUNC, (Function *)0x0 },		/* Control-k */
+  { ISFUNC, (Function *)0x0 },		/* Control-l */
+  { ISFUNC, (Function *)0x0 },		/* Control-m */
+  { ISFUNC, (Function *)0x0 },		/* Control-n */
+  { ISFUNC, (Function *)0x0 },		/* Control-o */
+  { ISFUNC, (Function *)0x0 },		/* Control-p */
+  { ISFUNC, (Function *)0x0 },		/* Control-q */
+  { ISFUNC, rl_re_read_init_file },	/* Control-r */
+  { ISFUNC, (Function *)0x0 },		/* Control-s */
+  { ISFUNC, (Function *)0x0 },		/* Control-t */
+  { ISFUNC, rl_undo_command },		/* Control-u */
+  { ISFUNC, (Function *)0x0 },		/* Control-v */
+  { ISFUNC, (Function *)0x0 },		/* Control-w */
+  { ISFUNC, (Function *)0x0 },		/* Control-x */
+  { ISFUNC, (Function *)0x0 },		/* Control-y */
+  { ISFUNC, (Function *)0x0 },		/* Control-z */
+  { ISFUNC, (Function *)0x0 },		/* Control-[ */
+  { ISFUNC, (Function *)0x0 },		/* Control-\ */
+  { ISFUNC, (Function *)0x0 },		/* Control-] */
+  { ISFUNC, (Function *)0x0 },		/* Control-^ */
+  { ISFUNC, (Function *)0x0 },		/* Control-_ */
+
+  /* The start of printing characters. */
+  { ISFUNC, (Function *)0x0 },		/* SPACE */
+  { ISFUNC, (Function *)0x0 },		/* ! */
+  { ISFUNC, (Function *)0x0 },		/* " */
+  { ISFUNC, (Function *)0x0 },		/* # */
+  { ISFUNC, (Function *)0x0 },		/* $ */
+  { ISFUNC, (Function *)0x0 },		/* % */
+  { ISFUNC, (Function *)0x0 },		/* & */
+  { ISFUNC, (Function *)0x0 },		/* ' */
+  { ISFUNC, rl_start_kbd_macro },	/* ( */
+  { ISFUNC, rl_end_kbd_macro  },	/* ) */
+  { ISFUNC, (Function *)0x0 },		/* * */
+  { ISFUNC, (Function *)0x0 },		/* + */
+  { ISFUNC, (Function *)0x0 },		/* , */
+  { ISFUNC, (Function *)0x0 },		/* - */
+  { ISFUNC, (Function *)0x0 },		/* . */
+  { ISFUNC, (Function *)0x0 },		/* / */
+
+  /* Regular digits. */
+  { ISFUNC, (Function *)0x0 },		/* 0 */
+  { ISFUNC, (Function *)0x0 },		/* 1 */
+  { ISFUNC, (Function *)0x0 },		/* 2 */
+  { ISFUNC, (Function *)0x0 },		/* 3 */
+  { ISFUNC, (Function *)0x0 },		/* 4 */
+  { ISFUNC, (Function *)0x0 },		/* 5 */
+  { ISFUNC, (Function *)0x0 },		/* 6 */
+  { ISFUNC, (Function *)0x0 },		/* 7 */
+  { ISFUNC, (Function *)0x0 },		/* 8 */
+  { ISFUNC, (Function *)0x0 },		/* 9 */
+
+  /* A little more punctuation. */
+  { ISFUNC, (Function *)0x0 },	/* : */
+  { ISFUNC, (Function *)0x0 },	/* ; */
+  { ISFUNC, (Function *)0x0 },	/* < */
+  { ISFUNC, (Function *)0x0 },	/* = */
+  { ISFUNC, (Function *)0x0 },	/* > */
+  { ISFUNC, (Function *)0x0 },	/* ? */
+  { ISFUNC, (Function *)0x0 },	/* @ */
+
+  /* Uppercase alphabet. */
+  { ISFUNC, rl_do_lowercase_version },	/* A */
+  { ISFUNC, rl_do_lowercase_version },	/* B */
+  { ISFUNC, rl_do_lowercase_version },	/* C */
+  { ISFUNC, rl_do_lowercase_version },	/* D */
+  { ISFUNC, rl_do_lowercase_version },	/* E */
+  { ISFUNC, rl_do_lowercase_version },	/* F */
+  { ISFUNC, rl_do_lowercase_version },	/* G */
+  { ISFUNC, rl_do_lowercase_version },	/* H */
+  { ISFUNC, rl_do_lowercase_version },	/* I */
+  { ISFUNC, rl_do_lowercase_version },	/* J */
+  { ISFUNC, rl_do_lowercase_version },	/* K */
+  { ISFUNC, rl_do_lowercase_version },	/* L */
+  { ISFUNC, rl_do_lowercase_version },	/* M */
+  { ISFUNC, rl_do_lowercase_version },	/* N */
+  { ISFUNC, rl_do_lowercase_version },	/* O */
+  { ISFUNC, rl_do_lowercase_version },	/* P */
+  { ISFUNC, rl_do_lowercase_version },	/* Q */
+  { ISFUNC, rl_do_lowercase_version },	/* R */
+  { ISFUNC, rl_do_lowercase_version },	/* S */
+  { ISFUNC, rl_do_lowercase_version },	/* T */
+  { ISFUNC, rl_do_lowercase_version },	/* U */
+  { ISFUNC, rl_do_lowercase_version },	/* V */
+  { ISFUNC, rl_do_lowercase_version },	/* W */
+  { ISFUNC, rl_do_lowercase_version },	/* X */
+  { ISFUNC, rl_do_lowercase_version },	/* Y */
+  { ISFUNC, rl_do_lowercase_version },	/* Z */
+
+  /* Some more punctuation. */
+  { ISFUNC, (Function *)0x0 },		/* [ */
+  { ISFUNC, (Function *)0x0 },		/* \ */
+  { ISFUNC, (Function *)0x0 },		/* ] */
+  { ISFUNC, (Function *)0x0 },		/* ^ */
+  { ISFUNC, (Function *)0x0 },		/* _ */
+  { ISFUNC, (Function *)0x0 },		/* ` */
+
+  /* Lowercase alphabet. */
+  { ISFUNC, (Function *)0x0 },		/* a */
+  { ISFUNC, (Function *)0x0 },		/* b */
+  { ISFUNC, (Function *)0x0 },		/* c */
+  { ISFUNC, (Function *)0x0 },		/* d */
+  { ISFUNC, rl_call_last_kbd_macro },	/* e */
+  { ISFUNC, (Function *)0x0 },		/* f */
+  { ISFUNC, (Function *)0x0 },		/* g */
+  { ISFUNC, (Function *)0x0 },		/* h */
+  { ISFUNC, (Function *)0x0 },		/* i */
+  { ISFUNC, (Function *)0x0 },		/* j */
+  { ISFUNC, (Function *)0x0 },		/* k */
+  { ISFUNC, (Function *)0x0 },		/* l */
+  { ISFUNC, (Function *)0x0 },		/* m */
+  { ISFUNC, (Function *)0x0 },		/* n */
+  { ISFUNC, (Function *)0x0 },		/* o */
+  { ISFUNC, (Function *)0x0 },		/* p */
+  { ISFUNC, (Function *)0x0 },		/* q */
+  { ISFUNC, (Function *)0x0 },		/* r */
+  { ISFUNC, (Function *)0x0 },		/* s */
+  { ISFUNC, (Function *)0x0 },		/* t */
+  { ISFUNC, (Function *)0x0 },		/* u */
+  { ISFUNC, (Function *)0x0 },		/* v */
+  { ISFUNC, (Function *)0x0 },		/* w */
+  { ISFUNC, (Function *)0x0 },		/* x */
+  { ISFUNC, (Function *)0x0 },		/* y */
+  { ISFUNC, (Function *)0x0 },		/* z */
+
+  /* Final punctuation. */
+  { ISFUNC, (Function *)0x0 },		/* { */
+  { ISFUNC, (Function *)0x0 },		/* | */
+  { ISFUNC, (Function *)0x0 },		/* } */
+  { ISFUNC, (Function *)0x0 },		/* ~ */
+  { ISFUNC, rl_backward_kill_line },	/* RUBOUT */
+
+#if KEYMAP_SIZE > 128
+  /* Undefined keys. */
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 }
+#endif /* KEYMAP_SIZE > 128 */
+};
diff --git a/examples/Inputrc b/examples/Inputrc
new file mode 100644
index 0000000..5b71bd7
--- /dev/null
+++ b/examples/Inputrc
@@ -0,0 +1,65 @@
+# My ~/.inputrc file is in -*- text -*- for easy editing with Emacs.
+#
+# Notice the various bindings which are conditionalized depending
+# on which program is running, or what terminal is active.
+#
+
+# In all programs, all terminals, make sure this is bound.
+"\C-x\C-r": re-read-init-file
+
+# Hp terminals (and some others) have ugly default behaviour for C-h.
+"\C-h": backward-delete-char
+"\e\C-h": backward-kill-word
+"\C-xd": dump-functions
+
+# In xterm windows, make the arrow keys do the right thing.
+$if TERM=xterm
+"\e[A": previous-history
+"\e[B": next-history
+"\e[C": forward-char
+"\e[D": backward-char
+
+# alternate arrow key prefix
+"\eOA": previous-history
+"\eOB": next-history
+"\eOC": forward-char
+"\eOD": backward-char
+
+# Under Xterm in Bash, we bind local Function keys to do something useful.
+$if Bash
+"\e[11~": "Function Key 1"
+"\e[12~": "Function Key 2"
+"\e[13~": "Function Key 3"
+"\e[14~": "Function Key 4"
+"\e[15~": "Function Key 5"
+
+# I know the following escape sequence numbers are 1 greater than
+# the function key.  Don't ask me why, I didn't design the xterm terminal.
+"\e[17~": "Function Key 6"
+"\e[18~": "Function Key 7"
+"\e[19~": "Function Key 8"
+"\e[20~": "Function Key 9"
+"\e[21~": "Function Key 10"
+$endif
+$endif
+
+# For Bash, all terminals, add some Bash specific hacks.
+$if Bash
+"\C-xv": show-bash-version
+"\C-x\C-e": shell-expand-line
+
+# Here is one for editing my path.
+"\C-xp": "$PATH\C-x\C-e\C-e\"\C-aPATH=\":\C-b"
+
+# Make C-x r read my mail in emacs.
+# "\C-xr": "emacs -f rmail\C-j"
+$endif
+
+# For FTP, different hacks:
+$if Ftp
+"\C-xg": "get \M-?"
+"\C-xt": "put \M-?"
+"\M-.": yank-last-arg
+$endif
+
+" ": self-insert
diff --git a/examples/Makefile b/examples/Makefile
new file mode 100644
index 0000000..55ebffc
--- /dev/null
+++ b/examples/Makefile
@@ -0,0 +1,12 @@
+# This is the Makefile for the examples subdirectory of readline. -*- text -*-
+#
+
+EXECUTABLES = fileman
+CFLAGS  = -g -I..
+LDFLAGS = -g -L..
+
+fileman: fileman.o
+	$(CC) $(LDFLAGS) -o fileman fileman.o -lreadline -ltermcap
+
+fileman.o: fileman.c
+  
diff --git a/examples/fileman.c b/examples/fileman.c
new file mode 100644
index 0000000..3ecb9f1
--- /dev/null
+++ b/examples/fileman.c
@@ -0,0 +1,425 @@
+/* fileman.c -- A tiny application which demonstrates how to use the
+   GNU Readline library.  This application interactively allows users
+   to manipulate files and their modes. */
+
+#include <stdio.h>
+#include <sys/types.h>
+#include <sys/file.h>
+#include <sys/stat.h>
+#include <sys/errno.h>
+
+#include <readline/readline.h>
+#include <readline/history.h>
+
+extern char *getwd ();
+extern char *xmalloc ();
+
+/* The names of functions that actually do the manipulation. */
+int com_list (), com_view (), com_rename (), com_stat (), com_pwd ();
+int com_delete (), com_help (), com_cd (), com_quit ();
+
+/* A structure which contains information on the commands this program
+   can understand. */
+
+typedef struct {
+  char *name;			/* User printable name of the function. */
+  Function *func;		/* Function to call to do the job. */
+  char *doc;			/* Documentation for this function.  */
+} COMMAND;
+
+COMMAND commands[] = {
+  { "cd", com_cd, "Change to directory DIR" },
+  { "delete", com_delete, "Delete FILE" },
+  { "help", com_help, "Display this text" },
+  { "?", com_help, "Synonym for `help'" },
+  { "list", com_list, "List files in DIR" },
+  { "ls", com_list, "Synonym for `list'" },
+  { "pwd", com_pwd, "Print the current working directory" },
+  { "quit", com_quit, "Quit using Fileman" },
+  { "rename", com_rename, "Rename FILE to NEWNAME" },
+  { "stat", com_stat, "Print out statistics on FILE" },
+  { "view", com_view, "View the contents of FILE" },
+  { (char *)NULL, (Function *)NULL, (char *)NULL }
+};
+
+/* Forward declarations. */
+char *stripwhite ();
+COMMAND *find_command ();
+
+/* The name of this program, as taken from argv[0]. */
+char *progname;
+
+/* When non-zero, this global means the user is done using this program. */
+int done;
+
+char *
+dupstr (s)
+     int s;
+{
+  char *r;
+
+  r = xmalloc (strlen (s) + 1);
+  strcpy (r, s);
+  return (r);
+}
+
+main (argc, argv)
+     int argc;
+     char **argv;
+{
+  char *line, *s;
+
+  progname = argv[0];
+
+  initialize_readline ();	/* Bind our completer. */
+
+  /* Loop reading and executing lines until the user quits. */
+  for ( ; done == 0; )
+    {
+      line = readline ("FileMan: ");
+
+      if (!line)
+        break;
+
+      /* Remove leading and trailing whitespace from the line.
+         Then, if there is anything left, add it to the history list
+         and execute it. */
+      s = stripwhite (line);
+
+      if (*s)
+        {
+          add_history (s);
+          execute_line (s);
+        }
+
+      free (line);
+    }
+  exit (0);
+}
+
+/* Execute a command line. */
+int
+execute_line (line)
+     char *line;
+{
+  register int i;
+  COMMAND *command;
+  char *word;
+
+  /* Isolate the command word. */
+  i = 0;
+  while (line[i] && whitespace (line[i]))
+    i++;
+  word = line + i;
+
+  while (line[i] && !whitespace (line[i]))
+    i++;
+
+  if (line[i])
+    line[i++] = '\0';
+
+  command = find_command (word);
+
+  if (!command)
+    {
+      fprintf (stderr, "%s: No such command for FileMan.\n", word);
+      return (-1);
+    }
+
+  /* Get argument to command, if any. */
+  while (whitespace (line[i]))
+    i++;
+
+  word = line + i;
+
+  /* Call the function. */
+  return ((*(command->func)) (word));
+}
+
+/* Look up NAME as the name of a command, and return a pointer to that
+   command.  Return a NULL pointer if NAME isn't a command name. */
+COMMAND *
+find_command (name)
+     char *name;
+{
+  register int i;
+
+  for (i = 0; commands[i].name; i++)
+    if (strcmp (name, commands[i].name) == 0)
+      return (&commands[i]);
+
+  return ((COMMAND *)NULL);
+}
+
+/* Strip whitespace from the start and end of STRING.  Return a pointer
+   into STRING. */
+char *
+stripwhite (string)
+     char *string;
+{
+  register char *s, *t;
+
+  for (s = string; whitespace (*s); s++)
+    ;
+    
+  if (*s == 0)
+    return (s);
+
+  t = s + strlen (s) - 1;
+  while (t > s && whitespace (*t))
+    t--;
+  *++t = '\0';
+
+  return s;
+}
+
+/* **************************************************************** */
+/*                                                                  */
+/*                  Interface to Readline Completion                */
+/*                                                                  */
+/* **************************************************************** */
+
+char *command_generator ();
+char **fileman_completion ();
+
+/* Tell the GNU Readline library how to complete.  We want to try to complete
+   on command names if this is the first word in the line, or on filenames
+   if not. */
+initialize_readline ()
+{
+  /* Allow conditional parsing of the ~/.inputrc file. */
+  rl_readline_name = "FileMan";
+
+  /* Tell the completer that we want a crack first. */
+  rl_attempted_completion_function = (CPPFunction *)fileman_completion;
+}
+
+/* Attempt to complete on the contents of TEXT.  START and END show the
+   region of TEXT that contains the word to complete.  We can use the
+   entire line in case we want to do some simple parsing.  Return the
+   array of matches, or NULL if there aren't any. */
+char **
+fileman_completion (text, start, end)
+     char *text;
+     int start, end;
+{
+  char **matches;
+
+  matches = (char **)NULL;
+
+  /* If this word is at the start of the line, then it is a command
+     to complete.  Otherwise it is the name of a file in the current
+     directory. */
+  if (start == 0)
+    matches = completion_matches (text, command_generator);
+
+  return (matches);
+}
+
+/* Generator function for command completion.  STATE lets us know whether
+   to start from scratch; without any state (i.e. STATE == 0), then we
+   start at the top of the list. */
+char *
+command_generator (text, state)
+     char *text;
+     int state;
+{
+  static int list_index, len;
+  char *name;
+
+  /* If this is a new word to complete, initialize now.  This includes
+     saving the length of TEXT for efficiency, and initializing the index
+     variable to 0. */
+  if (!state)
+    {
+      list_index = 0;
+      len = strlen (text);
+    }
+
+  /* Return the next name which partially matches from the command list. */
+  while (name = commands[list_index].name)
+    {
+      list_index++;
+
+      if (strncmp (name, text, len) == 0)
+        return (dupstr(name));
+    }
+
+  /* If no names matched, then return NULL. */
+  return ((char *)NULL);
+}
+
+/* **************************************************************** */
+/*                                                                  */
+/*                       FileMan Commands                           */
+/*                                                                  */
+/* **************************************************************** */
+
+/* String to pass to system ().  This is for the LIST, VIEW and RENAME
+   commands. */
+static char syscom[1024];
+
+/* List the file(s) named in arg. */
+com_list (arg)
+     char *arg;
+{
+  if (!arg)
+    arg = "";
+
+  sprintf (syscom, "ls -FClg %s", arg);
+  return (system (syscom));
+}
+
+com_view (arg)
+     char *arg;
+{
+  if (!valid_argument ("view", arg))
+    return 1;
+
+  sprintf (syscom, "more %s", arg);
+  return (system (syscom));
+}
+
+com_rename (arg)
+     char *arg;
+{
+  too_dangerous ("rename");
+  return (1);
+}
+
+com_stat (arg)
+     char *arg;
+{
+  struct stat finfo;
+
+  if (!valid_argument ("stat", arg))
+    return (1);
+
+  if (stat (arg, &finfo) == -1)
+    {
+      perror (arg);
+      return (1);
+    }
+
+  printf ("Statistics for `%s':\n", arg);
+
+  printf ("%s has %d link%s, and is %d byte%s in length.\n", arg,
+          finfo.st_nlink,
+          (finfo.st_nlink == 1) ? "" : "s",
+          finfo.st_size,
+          (finfo.st_size == 1) ? "" : "s");
+  printf ("Inode Last Change at: %s", ctime (&finfo.st_ctime));
+  printf ("      Last access at: %s", ctime (&finfo.st_atime));
+  printf ("    Last modified at: %s", ctime (&finfo.st_mtime));
+  return (0);
+}
+
+com_delete (arg)
+     char *arg;
+{
+  too_dangerous ("delete");
+  return (1);
+}
+
+/* Print out help for ARG, or for all of the commands if ARG is
+   not present. */
+com_help (arg)
+     char *arg;
+{
+  register int i;
+  int printed = 0;
+
+  for (i = 0; commands[i].name; i++)
+    {
+      if (!*arg || (strcmp (arg, commands[i].name) == 0))
+        {
+          printf ("%s\t\t%s.\n", commands[i].name, commands[i].doc);
+          printed++;
+        }
+    }
+
+  if (!printed)
+    {
+      printf ("No commands match `%s'.  Possibilties are:\n", arg);
+
+      for (i = 0; commands[i].name; i++)
+        {
+          /* Print in six columns. */
+          if (printed == 6)
+            {
+              printed = 0;
+              printf ("\n");
+            }
+
+          printf ("%s\t", commands[i].name);
+          printed++;
+        }
+
+      if (printed)
+        printf ("\n");
+    }
+  return (0);
+}
+
+/* Change to the directory ARG. */
+com_cd (arg)
+     char *arg;
+{
+  if (chdir (arg) == -1)
+    {
+      perror (arg);
+      return 1;
+    }
+
+  com_pwd ("");
+  return (0);
+}
+
+/* Print out the current working directory. */
+com_pwd (ignore)
+     char *ignore;
+{
+  char dir[1024], *s;
+
+  s = getwd (dir);
+  if (s == 0)
+    {
+      printf ("Error getting pwd: %s\n", dir);
+      return 1;
+    }
+
+  printf ("Current directory is %s\n", dir);
+  return 0;
+}
+
+/* The user wishes to quit using this program.  Just set DONE non-zero. */
+com_quit (arg)
+     char *arg;
+{
+  done = 1;
+  return (0);
+}
+
+/* Function which tells you that you can't do this. */
+too_dangerous (caller)
+     char *caller;
+{
+  fprintf (stderr,
+           "%s: Too dangerous for me to distribute.  Write it yourself.\n",
+           caller);
+}
+
+/* Return non-zero if ARG is a valid argument for CALLER, else print
+   an error message and return zero. */
+int
+valid_argument (caller, arg)
+     char *caller, *arg;
+{
+  if (!arg || !*arg)
+    {
+      fprintf (stderr, "%s: Argument required.\n", caller);
+      return (0);
+    }
+
+  return (1);
+}
diff --git a/examples/histexamp.c b/examples/histexamp.c
new file mode 100644
index 0000000..eceb66d
--- /dev/null
+++ b/examples/histexamp.c
@@ -0,0 +1,82 @@
+main ()
+{
+  char line[1024], *t;
+  int len, done = 0;
+
+  line[0] = 0;
+
+  using_history ();
+  while (!done)
+    {
+      printf ("history$ ");
+      fflush (stdout);
+      t = fgets (line, sizeof (line) - 1, stdin);
+      if (t && *t)
+        {
+          len = strlen (t);
+          if (t[len - 1] == '\n')
+            t[len - 1] = '\0';
+        }
+
+      if (!t)
+        strcpy (line, "quit");
+
+      if (line[0])
+        {
+          char *expansion;
+          int result;
+
+          using_history ();
+
+          result = history_expand (line, &expansion);
+          if (result)
+            fprintf (stderr, "%s\n", expansion);
+
+          if (result < 0 || result == 2)
+            {
+              free (expansion);
+              continue;
+            }
+
+          add_history (expansion);
+          strncpy (line, expansion, sizeof (line) - 1);
+          free (expansion);
+        }
+
+      if (strcmp (line, "quit") == 0)
+        done = 1;
+      else if (strcmp (line, "save") == 0)
+        write_history ("history_file");
+      else if (strcmp (line, "read") == 0)
+        read_history ("history_file");
+      else if (strcmp (line, "list") == 0)
+        {
+          register HIST_ENTRY **the_list;
+          register int i;
+
+          the_list = history_list ();
+          if (the_list)
+            for (i = 0; the_list[i]; i++)
+              printf ("%d: %s\n", i + history_base, the_list[i]->line);
+        }
+      else if (strncmp (line, "delete", 6) == 0)
+        {
+          int which;
+          if ((sscanf (line + 6, "%d", &which)) == 1)
+            {
+              HIST_ENTRY *entry = remove_history (which);
+              if (!entry)
+                fprintf (stderr, "No such entry %d\n", which);
+              else
+                {
+                  free (entry->line);
+                  free (entry);
+                }
+            }
+          else
+            {
+              fprintf (stderr, "non-numeric arg given to `delete'\n");
+            }
+        }
+    }
+}
diff --git a/examples/manexamp.c b/examples/manexamp.c
new file mode 100644
index 0000000..3496efa
--- /dev/null
+++ b/examples/manexamp.c
@@ -0,0 +1,94 @@
+/* manexamp.c -- The examples which appear in the documentation are here. */
+
+#include <stdio.h>
+#include <readline/readline.h>
+
+
+/* **************************************************************** */
+/*                                                                  */
+*   			How to Emulate gets ()			    */
+/*                                                                  */
+/* **************************************************************** */
+
+/* A static variable for holding the line. */
+static char *line_read = (char *)NULL;
+
+/* Read a string, and return a pointer to it.  Returns NULL on EOF. */
+char *
+rl_gets ()
+{
+  /* If the buffer has already been allocated, return the memory
+     to the free pool. */
+  if (line_read)
+    {
+      free (line_read);
+      line_read = (char *)NULL;
+    }
+
+  /* Get a line from the user. */
+  line_read = readline ("");
+
+  /* If the line has any text in it, save it on the history. */
+  if (line_read && *line_read)
+    add_history (line_read);
+
+  return (line_read);
+}
+
+/* **************************************************************** */
+/*                                                                  */
+/*        Writing a Function to be Called by Readline.              */
+/*                                                                  */
+/* **************************************************************** */
+
+/* Invert the case of the COUNT following characters. */
+invert_case_line (count, key)
+     int count, key;
+{
+  register int start, end;
+
+  start = rl_point;
+
+  if (count < 0)
+    {
+      direction = -1;
+      count = -count;
+    }
+  else
+    direction = 1;
+      
+  /* Find the end of the range to modify. */
+  end = start + (count * direction);
+
+  /* Force it to be within range. */
+  if (end > rl_end)
+    end = rl_end;
+  else if (end < 0)
+    end = -1;
+
+  if (start > end)
+    {
+      int temp = start;
+      start = end;
+      end = temp;
+    }
+
+  if (start == end)
+    return;
+
+  /* Tell readline that we are modifying the line, so save the undo
+     information. */
+  rl_modifying (start, end);
+
+  for (; start != end; start += direction)
+    {
+      if (uppercase_p (rl_line_buffer[start]))
+	rl_line_buffer[start] = to_lower (rl_line_buffer[start]);
+      else if (lowercase_p (rl_line_buffer[start]))
+	rl_line_buffer[start] = to_upper (rl_line_buffer[start]);
+    }
+
+  /* Move point to on top of the last character changed. */
+  rl_point = end - direction;
+}
+
diff --git a/funmap.c b/funmap.c
new file mode 100644
index 0000000..9255974
--- /dev/null
+++ b/funmap.c
@@ -0,0 +1,299 @@
+/* funmap.c -- attach names to functions. */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#if defined (STATIC_MALLOC)
+static char *xmalloc (), *xrealloc ();
+#else
+extern char *xmalloc (), *xrealloc ();
+#endif /* STATIC_MALLOC */
+
+#if !defined (BUFSIZ)
+#include <stdio.h>
+#endif /* BUFSIZ */
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+#include "rlconf.h"
+#include "readline.h"
+
+static int qsort_string_compare ();
+
+FUNMAP **funmap = (FUNMAP **)NULL;
+static int funmap_size = 0;
+static int funmap_entry = 0;
+
+/* After initializing the function map, this is the index of the first
+   program specific function. */
+int funmap_program_specific_entry_start;
+
+static FUNMAP default_funmap[] = {
+
+  { "abort", rl_abort },
+  { "accept-line", rl_newline },
+  { "arrow-key-prefix", rl_arrow_keys },
+  { "backward-char", rl_backward },
+  { "backward-delete-char", rl_rubout },
+  { "backward-kill-line", rl_backward_kill_line },
+  { "backward-kill-word", rl_backward_kill_word },
+  { "backward-word", rl_backward_word },
+  { "beginning-of-history", rl_beginning_of_history },
+  { "beginning-of-line", rl_beg_of_line },
+  { "call-last-kbd-macro", rl_call_last_kbd_macro },
+  { "capitalize-word", rl_capitalize_word },
+  { "clear-screen", rl_clear_screen },
+  { "complete", rl_complete },
+  { "delete-char", rl_delete },
+  { "delete-horizontal-space", rl_delete_horizontal_space },
+  { "digit-argument", rl_digit_argument },
+  { "do-lowercase-version", rl_do_lowercase_version },
+  { "downcase-word", rl_downcase_word },
+  { "dump-functions", rl_dump_functions },
+  { "emacs-editing-mode", rl_emacs_editing_mode },
+  { "end-kbd-macro", rl_end_kbd_macro },
+  { "end-of-history", rl_end_of_history },
+  { "end-of-line", rl_end_of_line },
+  { "forward-char", rl_forward },
+  { "forward-search-history", rl_forward_search_history },
+  { "forward-word", rl_forward_word },
+  { "history-search-backward", rl_history_search_backward },
+  { "history-search-forward", rl_history_search_forward },
+  { "insert-completions", rl_insert_completions },
+  { "kill-whole-line", rl_kill_full_line },
+  { "kill-line", rl_kill_line },
+  { "kill-word", rl_kill_word },
+  { "next-history", rl_get_next_history },
+  { "non-incremental-forward-search-history", rl_noninc_forward_search },
+  { "non-incremental-reverse-search-history", rl_noninc_reverse_search },
+  { "non-incremental-forward-search-history-again", rl_noninc_forward_search_again },
+  { "non-incremental-reverse-search-history-again", rl_noninc_reverse_search_again },
+  { "possible-completions", rl_possible_completions },
+  { "previous-history", rl_get_previous_history },
+  { "quoted-insert", rl_quoted_insert },
+  { "re-read-init-file", rl_re_read_init_file },
+  { "redraw-current-line", rl_refresh_line},
+  { "reverse-search-history", rl_reverse_search_history },
+  { "revert-line", rl_revert_line },
+  { "self-insert", rl_insert },
+  { "start-kbd-macro", rl_start_kbd_macro },
+  { "tab-insert", rl_tab_insert },
+  { "tilde-expand", rl_tilde_expand },
+  { "transpose-chars", rl_transpose_chars },
+  { "transpose-words", rl_transpose_words },
+  { "tty-status", rl_tty_status },
+  { "undo", rl_undo_command },
+  { "universal-argument", rl_universal_argument },
+  { "unix-line-discard", rl_unix_line_discard },
+  { "unix-word-rubout", rl_unix_word_rubout },
+  { "upcase-word", rl_upcase_word },
+  { "yank", rl_yank },
+  { "yank-last-arg", rl_yank_last_arg },
+  { "yank-nth-arg", rl_yank_nth_arg },
+  { "yank-pop", rl_yank_pop },
+
+#if defined (VI_MODE)
+  { "vi-append-eol", rl_vi_append_eol },
+  { "vi-append-mode", rl_vi_append_mode },
+  { "vi-arg-digit", rl_vi_arg_digit },
+  { "vi-bWord", rl_vi_bWord },
+  { "vi-bracktype", rl_vi_bracktype },
+  { "vi-bword", rl_vi_bword },
+  { "vi-change-case", rl_vi_change_case },
+  { "vi-change-char", rl_vi_change_char },
+  { "vi-change-to", rl_vi_change_to },
+  { "vi-char-search", rl_vi_char_search },
+  { "vi-column", rl_vi_column },
+  { "vi-comment", rl_vi_comment },
+  { "vi-complete", rl_vi_complete },
+  { "vi-delete", rl_vi_delete },
+  { "vi-delete-to", rl_vi_delete_to },
+  { "vi-eWord", rl_vi_eWord },
+  { "vi-editing-mode", rl_vi_editing_mode },
+  { "vi-end-word", rl_vi_end_word },
+  { "vi-eof-maybe", rl_vi_eof_maybe },
+  { "vi-eword", rl_vi_eword },
+  { "vi-fWord", rl_vi_fWord },
+  { "vi-first-print", rl_vi_first_print },
+  { "vi-fword", rl_vi_fword },
+  { "vi-insert-beg", rl_vi_insert_beg },
+  { "vi-insertion-mode", rl_vi_insertion_mode },
+  { "vi-match", rl_vi_match },
+  { "vi-movement-mode", rl_vi_movement_mode },
+  { "vi-next-word", rl_vi_next_word },
+  { "vi-overstrike", rl_vi_overstrike },
+  { "vi-overstrike-delete", rl_vi_overstrike_delete },
+  { "vi-prev-word", rl_vi_prev_word },
+  { "vi-put", rl_vi_put },
+  { "vi-redo", rl_vi_redo },
+  { "vi-replace", rl_vi_replace },
+  { "vi-search", rl_vi_search },
+  { "vi-search-again", rl_vi_search_again },
+  { "vi-subst", rl_vi_subst },
+  { "vi-tilde-expand", rl_vi_tilde_expand },
+  { "vi-yank-arg", rl_vi_yank_arg },
+  { "vi-yank-to", rl_vi_yank_to },
+#endif /* VI_MODE */
+
+ {(char *)NULL, (Function *)NULL }
+};
+
+rl_add_funmap_entry (name, function)
+     char *name;
+     Function *function;
+{
+  if (funmap_entry + 2 >= funmap_size)
+    if (!funmap)
+      funmap = (FUNMAP **)xmalloc ((funmap_size = 80) * sizeof (FUNMAP *));
+    else
+      funmap =
+	(FUNMAP **)xrealloc (funmap, (funmap_size += 80) * sizeof (FUNMAP *));
+  
+  funmap[funmap_entry] = (FUNMAP *)xmalloc (sizeof (FUNMAP));
+  funmap[funmap_entry]->name = name;
+  funmap[funmap_entry]->function = function;
+
+  funmap[++funmap_entry] = (FUNMAP *)NULL;
+  return funmap_entry;
+}
+
+static int funmap_initialized = 0;
+
+/* Make the funmap contain all of the default entries. */
+void
+rl_initialize_funmap ()
+{
+  register int i;
+
+  if (funmap_initialized)
+    return;
+
+  for (i = 0; default_funmap[i].name; i++)
+    rl_add_funmap_entry (default_funmap[i].name, default_funmap[i].function);
+
+  funmap_initialized = 1;
+  funmap_program_specific_entry_start = i;
+}
+
+/* Produce a NULL terminated array of known function names.  The array
+   is sorted.  The array itself is allocated, but not the strings inside.
+   You should free () the array when you done, but not the pointrs. */
+char **
+rl_funmap_names ()
+{
+  char **result = (char **)NULL;
+  int result_size, result_index;
+
+  result_size = result_index = 0;
+
+  /* Make sure that the function map has been initialized. */
+  rl_initialize_funmap ();
+
+  for (result_index = 0; funmap[result_index]; result_index++)
+    {
+      if (result_index + 2 > result_size)
+	{
+	  if (!result)
+	    result = (char **)xmalloc ((result_size = 20) * sizeof (char *));
+	  else
+	    result = (char **)
+	      xrealloc (result, (result_size += 20) * sizeof (char *));
+	}
+
+      result[result_index] = funmap[result_index]->name;
+      result[result_index + 1] = (char *)NULL;
+    }
+
+  qsort (result, result_index, sizeof (char *), qsort_string_compare);
+  return (result);
+}
+
+/* Stupid comparison routine for qsort () ing strings. */
+static int
+qsort_string_compare (s1, s2)
+     register char **s1, **s2;
+{
+  int r;
+
+  r = **s1 - **s2;
+  if (r == 0)
+    r = strcmp (*s1, *s2);
+  return r;
+}
+
+/* Things that mean `Control'. */
+char *possible_control_prefixes[] = {
+  "Control-", "C-", "CTRL-", (char *)NULL
+};
+
+char *possible_meta_prefixes[] = {
+  "Meta", "M-", (char *)NULL
+};
+
+#if defined (STATIC_MALLOC)
+
+/* **************************************************************** */
+/*								    */
+/*			xmalloc and xrealloc ()		     	    */
+/*								    */
+/* **************************************************************** */
+
+static void memory_error_and_abort ();
+
+static char *
+xmalloc (bytes)
+     int bytes;
+{
+  char *temp = (char *)malloc (bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+  return (temp);
+}
+
+static char *
+xrealloc (pointer, bytes)
+     char *pointer;
+     int bytes;
+{
+  char *temp;
+
+  if (!pointer)
+    temp = (char *)malloc (bytes);
+  else
+    temp = (char *)realloc (pointer, bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+  return (temp);
+}
+
+static void
+memory_error_and_abort ()
+{
+  fprintf (stderr, "history: Out of virtual memory!\n");
+  abort ();
+}
+#endif /* STATIC_MALLOC */
diff --git a/history.c b/history.c
new file mode 100644
index 0000000..68e99cf
--- /dev/null
+++ b/history.c
@@ -0,0 +1,2171 @@
+/* History.c -- standalone history library */
+
+/* Copyright (C) 1989, 1992 Free Software Foundation, Inc.
+
+   This file contains the GNU History Library (the Library), a set of
+   routines for managing the text of previously typed lines.
+
+   The Library is free software; you can redistribute it and/or modify
+   it under the terms of the GNU General Public License as published by
+   the Free Software Foundation; either version 1, or (at your option)
+   any later version.
+
+   The Library is distributed in the hope that it will be useful, but
+   WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+
+/* The goal is to make the implementation transparent, so that you
+   don't have to know what data types are used, just what functions
+   you can call.  I think I have done that. */
+#define READLINE_LIBRARY
+
+#if defined (HAVE_CONFIG_H)
+#  include "config.h"
+#endif
+
+#include <stdio.h>
+#include <sys/types.h>
+#include <sys/file.h>
+#include <sys/stat.h>
+#include <fcntl.h>
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif
+#if defined (HAVE_STRING_H)
+#  include <string.h>
+#else
+#  include <strings.h>
+#endif /* !HAVE_STRING_H */
+#include <errno.h>
+
+/* Not all systems declare ERRNO in errno.h... and some systems #define it! */
+#if !defined (errno)
+extern int errno;
+#endif /* !errno */
+
+#include "memalloc.h"
+#include "history.h"
+
+#if defined (STATIC_MALLOC)
+static char *xmalloc (), *xrealloc ();
+#else
+extern char *xmalloc (), *xrealloc ();
+#endif /* STATIC_MALLOC */
+
+#define STREQ(a, b)	(((a)[0] == (b)[0]) && (strcmp ((a), (b)) == 0))
+#define STREQN(a, b, n)	(((a)[0] == (b)[0]) && (strncmp ((a), (b), (n)) == 0))
+
+#ifndef savestring
+#  ifndef strcpy
+extern char *strcpy ();
+#  endif
+#define savestring(x) strcpy (xmalloc (1 + strlen (x)), (x))
+#endif
+
+#ifndef whitespace
+#define whitespace(c) (((c) == ' ') || ((c) == '\t'))
+#endif
+
+#ifndef digit_p
+#define digit_p(c)  ((c) >= '0' && (c) <= '9')
+#endif
+
+#ifndef digit_value
+#define digit_value(c) ((c) - '0')
+#endif
+
+#ifndef member
+#  ifndef strchr
+extern char *strchr ();
+#  endif
+#define member(c, s) ((c) ? ((char *)strchr ((s), (c)) != (char *)NULL) : 0)
+#endif
+
+/* Possible history errors passed to hist_error. */
+#define EVENT_NOT_FOUND 0
+#define BAD_WORD_SPEC	1
+#define SUBST_FAILED	2
+#define BAD_MODIFIER	3
+
+static char error_pointer;
+
+static char *subst_lhs;
+static char *subst_rhs;
+static int subst_lhs_len = 0;
+static int subst_rhs_len = 0;
+
+static char *get_history_word_specifier ();
+
+#if defined (SHELL)
+extern char *single_quote ();
+#endif
+
+/* **************************************************************** */
+/*								    */
+/*			History Functions			    */
+/*								    */
+/* **************************************************************** */
+
+/* An array of HIST_ENTRY.  This is where we store the history. */
+static HIST_ENTRY **the_history = (HIST_ENTRY **)NULL;
+
+/* Non-zero means that we have enforced a limit on the amount of
+   history that we save. */
+static int history_stifled = 0;
+
+/* If HISTORY_STIFLED is non-zero, then this is the maximum number of
+   entries to remember. */
+int max_input_history;
+
+/* The current location of the interactive history pointer.  Just makes
+   life easier for outside callers. */
+static int history_offset = 0;
+
+/* The number of strings currently stored in the input_history list. */
+int history_length = 0;
+
+/* The current number of slots allocated to the input_history. */
+static int history_size = 0;
+
+/* The number of slots to increase the_history by. */
+#define DEFAULT_HISTORY_GROW_SIZE 50
+
+/* The character that represents the start of a history expansion
+   request.  This is usually `!'. */
+char history_expansion_char = '!';
+
+/* The character that invokes word substitution if found at the start of
+   a line.  This is usually `^'. */
+char history_subst_char = '^';
+
+/* During tokenization, if this character is seen as the first character
+   of a word, then it, and all subsequent characters upto a newline are
+   ignored.  For a Bourne shell, this should be '#'.  Bash special cases
+   the interactive comment character to not be a comment delimiter. */
+char history_comment_char = '\0';
+
+/* The list of characters which inhibit the expansion of text if found
+   immediately following history_expansion_char. */
+char *history_no_expand_chars = " \t\n\r=";
+
+/* The logical `base' of the history array.  It defaults to 1. */
+int history_base = 1;
+
+/* Return the current HISTORY_STATE of the history. */
+HISTORY_STATE *
+history_get_history_state ()
+{
+  HISTORY_STATE *state;
+
+  state = (HISTORY_STATE *)xmalloc (sizeof (HISTORY_STATE));
+  state->entries = the_history;
+  state->offset = history_offset;
+  state->length = history_length;
+  state->size = history_size;
+  state->flags = 0;
+  if (history_stifled)
+    state->flags |= HS_STIFLED;
+
+  return (state);
+}
+
+/* Set the state of the current history array to STATE. */
+void
+history_set_history_state (state)
+     HISTORY_STATE *state;
+{
+  the_history = state->entries;
+  history_offset = state->offset;
+  history_length = state->length;
+  history_size = state->size;
+  if (state->flags & HS_STIFLED)
+    history_stifled = 1;
+}
+
+/* Begin a session in which the history functions might be used.  This
+   initializes interactive variables. */
+void
+using_history ()
+{
+  history_offset = history_length;
+}
+
+/* Return the number of bytes that the primary history entries are using.
+   This just adds up the lengths of the_history->lines. */
+int
+history_total_bytes ()
+{
+  register int i, result;
+
+  result = 0;
+
+  for (i = 0; the_history && the_history[i]; i++)
+    result += strlen (the_history[i]->line);
+
+  return (result);
+}
+
+/* Place STRING at the end of the history list.  The data field
+   is  set to NULL. */
+void
+add_history (string)
+     char *string;
+{
+  HIST_ENTRY *temp;
+
+  if (history_stifled && (history_length == max_input_history))
+    {
+      register int i;
+
+      /* If the history is stifled, and history_length is zero,
+	 and it equals max_input_history, we don't save items. */
+      if (history_length == 0)
+	return;
+
+      /* If there is something in the slot, then remove it. */
+      if (the_history[0])
+	{
+	  free (the_history[0]->line);
+	  free (the_history[0]);
+	}
+
+      /* Copy the rest of the entries, moving down one slot. */
+      for (i = 0; i < history_length; i++)
+	the_history[i] = the_history[i + 1];
+
+      history_base++;
+
+    }
+  else
+    {
+      if (!history_size)
+	{
+	  history_size = DEFAULT_HISTORY_GROW_SIZE;
+	  the_history = (HIST_ENTRY **)xmalloc (history_size * sizeof (HIST_ENTRY *));
+	  history_length = 1;
+
+	}
+      else
+	{
+	  if (history_length == (history_size - 1))
+	    {
+	      history_size += DEFAULT_HISTORY_GROW_SIZE;
+	      the_history = (HIST_ENTRY **)
+		xrealloc (the_history, history_size * sizeof (HIST_ENTRY *));
+	    }
+	  history_length++;
+	}
+    }
+
+  temp = (HIST_ENTRY *)xmalloc (sizeof (HIST_ENTRY));
+  temp->line = savestring (string);
+  temp->data = (char *)NULL;
+
+  the_history[history_length] = (HIST_ENTRY *)NULL;
+  the_history[history_length - 1] = temp;
+}
+
+/* Make the history entry at WHICH have LINE and DATA.  This returns
+   the old entry so you can dispose of the data.  In the case of an
+   invalid WHICH, a NULL pointer is returned. */
+HIST_ENTRY *
+replace_history_entry (which, line, data)
+     int which;
+     char *line;
+     char *data;
+{
+  HIST_ENTRY *temp = (HIST_ENTRY *)xmalloc (sizeof (HIST_ENTRY));
+  HIST_ENTRY *old_value;
+
+  if (which >= history_length)
+    return ((HIST_ENTRY *)NULL);
+
+  old_value = the_history[which];
+
+  temp->line = savestring (line);
+  temp->data = data;
+  the_history[which] = temp;
+
+  return (old_value);
+}
+
+/* Returns the magic number which says what history element we are
+   looking at now.  In this implementation, it returns history_offset. */
+int
+where_history ()
+{
+  return (history_offset);
+}
+
+/* Search the history for STRING, starting at history_offset.
+   If DIRECTION < 0, then the search is through previous entries, else
+   through subsequent.  If ANCHORED is non-zero, the string must
+   appear at the beginning of a history line, otherwise, the string
+   may appear anywhere in the line.  If the string is found, then
+   current_history () is the history entry, and the value of this
+   function is the offset in the line of that history entry that the
+   string was found in.  Otherwise, nothing is changed, and a -1 is
+   returned. */
+
+#define ANCHORED_SEARCH 1
+#define NON_ANCHORED_SEARCH 0
+
+static int
+history_search_internal (string, direction, anchored)
+     char *string;
+     int direction, anchored;
+{
+  register int i, reverse;
+  register char *line;
+  register int line_index;
+  int string_len;
+
+  i = history_offset;
+  reverse = (direction < 0);
+
+  /* Take care of trivial cases first. */
+
+  if (!history_length || ((i == history_length) && !reverse))
+    return (-1);
+
+  if (reverse && (i == history_length))
+    i--;
+
+#define NEXT_LINE() do { if (reverse) i--; else i++; } while (0)
+
+  string_len = strlen (string);
+  while (1)
+    {
+      /* Search each line in the history list for STRING. */
+
+      /* At limit for direction? */
+      if ((reverse && i < 0) || (!reverse && i == history_length))
+	return (-1);
+
+      line = the_history[i]->line;
+      line_index = strlen (line);
+
+      /* If STRING is longer than line, no match. */
+      if (string_len > line_index)
+	{
+	  NEXT_LINE ();
+	  continue;
+	}
+
+      /* Handle anchored searches first. */
+      if (anchored == ANCHORED_SEARCH)
+	{
+	  if (STREQN (string, line, string_len))
+	    {
+	      history_offset = i;
+	      return (0);
+	    }
+
+	  NEXT_LINE ();
+	  continue;
+	}
+
+      /* Do substring search. */
+      if (reverse)
+	{
+	  line_index -= string_len;
+
+	  while (line_index >= 0)
+	    {
+	      if (STREQN (string, line + line_index, string_len))
+		{
+		  history_offset = i;
+		  return (line_index);
+		}
+	      line_index--;
+	    }
+	}
+      else
+	{
+	  register int limit = line_index - string_len + 1;
+	  line_index = 0;
+
+	  while (line_index < limit)
+	    {
+	      if (STREQN (string, line + line_index, string_len))
+		{
+		  history_offset = i;
+		  return (line_index);
+		}
+	      line_index++;
+	    }
+	}
+      NEXT_LINE ();
+    }
+}
+
+/* Do a non-anchored search for STRING through the history in DIRECTION. */
+int
+history_search (string, direction)
+     char *string;
+     int direction;
+{
+  return (history_search_internal (string, direction, NON_ANCHORED_SEARCH));
+}
+
+/* Do an anchored search for string through the history in DIRECTION. */
+int
+history_search_prefix (string, direction)
+     char *string;
+     int direction;
+{
+  return (history_search_internal (string, direction, ANCHORED_SEARCH));
+}
+
+/* Remove history element WHICH from the history.  The removed
+   element is returned to you so you can free the line, data,
+   and containing structure. */
+HIST_ENTRY *
+remove_history (which)
+     int which;
+{
+  HIST_ENTRY *return_value;
+
+  if (which >= history_length || !history_length)
+    return_value = (HIST_ENTRY *)NULL;
+  else
+    {
+      register int i;
+      return_value = the_history[which];
+
+      for (i = which; i < history_length; i++)
+	the_history[i] = the_history[i + 1];
+
+      history_length--;
+    }
+
+  return (return_value);
+}
+
+/* Stifle the history list, remembering only MAX number of lines. */
+void
+stifle_history (max)
+     int max;
+{
+  if (max < 0)
+    max = 0;
+
+  if (history_length > max)
+    {
+      register int i, j;
+
+      /* This loses because we cannot free the data. */
+      for (i = 0; i < (history_length - max); i++)
+	{
+	  free (the_history[i]->line);
+	  free (the_history[i]);
+	}
+
+      history_base = i;
+      for (j = 0, i = history_length - max; j < max; i++, j++)
+	the_history[j] = the_history[i];
+      the_history[j] = (HIST_ENTRY *)NULL;
+      history_length = j;
+    }
+
+  history_stifled = 1;
+  max_input_history = max;
+}
+
+/* Stop stifling the history.  This returns the previous amount the history
+ was stifled by.  The value is positive if the history was stifled, negative
+ if it wasn't. */
+int
+unstifle_history ()
+{
+  int result = max_input_history;
+
+  if (history_stifled)
+    {
+      result = -result;
+      history_stifled = 0;
+    }
+
+  return (result);
+}
+
+int
+history_is_stifled ()
+{
+  return (history_stifled);
+}
+
+/* Return the string that should be used in the place of this
+   filename.  This only matters when you don't specify the
+   filename to read_history (), or write_history (). */
+static char *
+history_filename (filename)
+     char *filename;
+{
+  char *return_val = filename ? savestring (filename) : (char *)NULL;
+
+  if (!return_val)
+    {
+      char *home;
+      int home_len;
+
+      home = getenv ("HOME");
+
+      if (!home)
+	home = ".";
+
+      home_len = strlen (home);
+      /* strlen(".history") == 8 */
+      return_val = xmalloc (2 + home_len + 8);
+
+      strcpy (return_val, home);
+      return_val[home_len] = '/';
+      strcpy (return_val + home_len + 1, ".history");
+    }
+
+  return (return_val);
+}
+
+/* Add the contents of FILENAME to the history list, a line at a time.
+   If FILENAME is NULL, then read from ~/.history.  Returns 0 if
+   successful, or errno if not. */
+int
+read_history (filename)
+     char *filename;
+{
+  return (read_history_range (filename, 0, -1));
+}
+
+/* Read a range of lines from FILENAME, adding them to the history list.
+   Start reading at the FROM'th line and end at the TO'th.  If FROM
+   is zero, start at the beginning.  If TO is less than FROM, read
+   until the end of the file.  If FILENAME is NULL, then read from
+   ~/.history.  Returns 0 if successful, or errno if not. */
+int
+read_history_range (filename, from, to)
+     char *filename;
+     int from, to;
+{
+  register int line_start, line_end;
+  char *input, *buffer = (char *)NULL;
+  int file, current_line;
+  struct stat finfo;
+
+  input = history_filename (filename);
+  file = open (input, O_RDONLY, 0666);
+
+  if ((file < 0) || (fstat (file, &finfo) == -1))
+    goto error_and_exit;
+
+  buffer = xmalloc ((int)finfo.st_size + 1);
+
+  if (read (file, buffer, finfo.st_size) != finfo.st_size)
+    {
+  error_and_exit:
+      if (file >= 0)
+	close (file);
+
+      if (input)
+	free (input);
+
+      if (buffer)
+	free (buffer);
+
+      return (errno);
+    }
+
+  close (file);
+
+  /* Set TO to larger than end of file if negative. */
+  if (to < 0)
+    to = finfo.st_size;
+
+  /* Start at beginning of file, work to end. */
+  line_start = line_end = current_line = 0;
+
+  /* Skip lines until we are at FROM. */
+  while (line_start < finfo.st_size && current_line < from)
+    {
+      for (line_end = line_start; line_end < finfo.st_size; line_end++)
+	if (buffer[line_end] == '\n')
+	  {
+	    current_line++;
+	    line_start = line_end + 1;
+	    if (current_line == from)
+	      break;
+	  }
+    }
+
+  /* If there are lines left to gobble, then gobble them now. */
+  for (line_end = line_start; line_end < finfo.st_size; line_end++)
+    if (buffer[line_end] == '\n')
+      {
+	buffer[line_end] = '\0';
+
+	if (buffer[line_start])
+	  add_history (buffer + line_start);
+
+	current_line++;
+
+	if (current_line >= to)
+	  break;
+
+	line_start = line_end + 1;
+      }
+
+  if (input)
+    free (input);
+
+  if (buffer)
+    free (buffer);
+
+  return (0);
+}
+
+/* Truncate the history file FNAME, leaving only LINES trailing lines.
+   If FNAME is NULL, then use ~/.history. */
+int
+history_truncate_file (fname, lines)
+     char *fname;
+     register int lines;
+{
+  register int i;
+  int file, chars_read;
+  char *buffer = (char *)NULL, *filename;
+  struct stat finfo;
+
+  filename = history_filename (fname);
+  file = open (filename, O_RDONLY, 0666);
+
+  if (file == -1 || fstat (file, &finfo) == -1)
+    goto truncate_exit;
+
+  buffer = xmalloc ((int)finfo.st_size + 1);
+  chars_read = read (file, buffer, finfo.st_size);
+  close (file);
+
+  if (chars_read <= 0)
+    goto truncate_exit;
+
+  /* Count backwards from the end of buffer until we have passed
+     LINES lines. */
+  for (i = chars_read - 1; lines && i; i--)
+    {
+      if (buffer[i] == '\n')
+	lines--;
+    }
+
+  /* If this is the first line, then the file contains exactly the
+     number of lines we want to truncate to, so we don't need to do
+     anything.  It's the first line if we don't find a newline between
+     the current value of i and 0.  Otherwise, write from the start of
+     this line until the end of the buffer. */
+  for ( ; i; i--)
+    if (buffer[i] == '\n')
+      {
+	i++;
+	break;
+      }
+
+  /* Write only if there are more lines in the file than we want to
+     truncate to. */
+  if (i && ((file = open (filename, O_WRONLY|O_TRUNC, 0666)) != -1))
+    {
+      write (file, buffer + i, finfo.st_size - i);
+      close (file);
+    }
+
+ truncate_exit:
+  if (buffer)
+    free (buffer);
+
+  free (filename);
+  return 0;
+}
+
+#define HISTORY_APPEND 0
+#define HISTORY_OVERWRITE 1
+
+/* Workhorse function for writing history.  Writes NELEMENT entries
+   from the history list to FILENAME.  OVERWRITE is non-zero if you
+   wish to replace FILENAME with the entries. */
+static int
+history_do_write (filename, nelements, overwrite)
+     char *filename;
+     int nelements, overwrite;
+{
+  register int i;
+  char *output = history_filename (filename);
+  int file, mode;
+
+  mode = overwrite ? O_WRONLY | O_CREAT | O_TRUNC : O_WRONLY | O_APPEND;
+
+  if ((file = open (output, mode, 0666)) == -1)
+    {
+      if (output)
+	free (output);
+
+      return (errno);
+    }
+
+  if (nelements > history_length)
+    nelements = history_length;
+
+  /* Build a buffer of all the lines to write, and write them in one syscall.
+     Suggested by Peter Ho (peter@robosts.oxford.ac.uk). */
+  {
+    register int j = 0;
+    int buffer_size = 0;
+    char *buffer;
+
+    /* Calculate the total number of bytes to write. */
+    for (i = history_length - nelements; i < history_length; i++)
+      buffer_size += 1 + strlen (the_history[i]->line);
+
+    /* Allocate the buffer, and fill it. */
+    buffer = xmalloc (buffer_size);
+
+    for (i = history_length - nelements; i < history_length; i++)
+      {
+	strcpy (buffer + j, the_history[i]->line);
+	j += strlen (the_history[i]->line);
+	buffer[j++] = '\n';
+      }
+
+    write (file, buffer, buffer_size);
+    free (buffer);
+  }
+
+  close (file);
+
+  if (output)
+    free (output);
+
+  return (0);
+}
+
+/* Append NELEMENT entries to FILENAME.  The entries appended are from
+   the end of the list minus NELEMENTs up to the end of the list. */
+int
+append_history (nelements, filename)
+     int nelements;
+     char *filename;
+{
+  return (history_do_write (filename, nelements, HISTORY_APPEND));
+}
+
+/* Overwrite FILENAME with the current history.  If FILENAME is NULL,
+   then write the history list to ~/.history.  Values returned
+   are as in read_history ().*/
+int
+write_history (filename)
+     char *filename;
+{
+  return (history_do_write (filename, history_length, HISTORY_OVERWRITE));
+}
+
+/* Return the history entry at the current position, as determined by
+   history_offset.  If there is no entry there, return a NULL pointer. */
+HIST_ENTRY *
+current_history ()
+{
+  if ((history_offset == history_length) || !the_history)
+    return ((HIST_ENTRY *)NULL);
+  else
+    return (the_history[history_offset]);
+}
+
+/* Back up history_offset to the previous history entry, and return
+   a pointer to that entry.  If there is no previous entry then return
+   a NULL pointer. */
+HIST_ENTRY *
+previous_history ()
+{
+  if (!history_offset)
+    return ((HIST_ENTRY *)NULL);
+  else
+    return (the_history[--history_offset]);
+}
+
+/* Move history_offset forward to the next history entry, and return
+   a pointer to that entry.  If there is no next entry then return a
+   NULL pointer. */
+HIST_ENTRY *
+next_history ()
+{
+  if (history_offset == history_length)
+    return ((HIST_ENTRY *)NULL);
+  else
+    return (the_history[++history_offset]);
+}
+
+/* Return the current history array.  The caller has to be carefull, since this
+   is the actual array of data, and could be bashed or made corrupt easily.
+   The array is terminated with a NULL pointer. */
+HIST_ENTRY **
+history_list ()
+{
+  return (the_history);
+}
+
+/* Return the history entry which is logically at OFFSET in the history array.
+   OFFSET is relative to history_base. */
+HIST_ENTRY *
+history_get (offset)
+     int offset;
+{
+  int local_index = offset - history_base;
+
+  if (local_index >= history_length ||
+      local_index < 0 ||
+      !the_history)
+    return ((HIST_ENTRY *)NULL);
+  return (the_history[local_index]);
+}
+
+/* Search for STRING in the history list.  DIR is < 0 for searching
+   backwards.  POS is an absolute index into the history list at
+   which point to begin searching. */
+int
+history_search_pos (string, dir, pos)
+     char *string;
+     int dir, pos;
+{
+  int ret, old = where_history ();
+  history_set_pos (pos);
+  if (history_search (string, dir) == -1)
+    {
+      history_set_pos (old);
+      return (-1);
+    }
+  ret = where_history ();
+  history_set_pos (old);
+  return ret;
+}
+
+/* Make the current history item be the one at POS, an absolute index.
+   Returns zero if POS is out of range, else non-zero. */
+int
+history_set_pos (pos)
+     int pos;
+{
+  if (pos > history_length || pos < 0 || !the_history)
+    return (0);
+  history_offset = pos;
+  return (1);
+}
+ 
+
+/* **************************************************************** */
+/*								    */
+/*			History Expansion			    */
+/*								    */
+/* **************************************************************** */
+
+/* Hairy history expansion on text, not tokens.  This is of general
+   use, and thus belongs in this library. */
+
+/* The last string searched for in a !?string? search. */
+static char *search_string = (char *)NULL;
+
+/* Return the event specified at TEXT + OFFSET modifying OFFSET to
+   point to after the event specifier.  Just a pointer to the history
+   line is returned; NULL is returned in the event of a bad specifier.
+   You pass STRING with *INDEX equal to the history_expansion_char that
+   begins this specification.
+   DELIMITING_QUOTE is a character that is allowed to end the string
+   specification for what to search for in addition to the normal
+   characters `:', ` ', `\t', `\n', and sometimes `?'.
+   So you might call this function like:
+   line = get_history_event ("!echo:p", &index, 0);  */
+char *
+get_history_event (string, caller_index, delimiting_quote)
+     char *string;
+     int *caller_index;
+     int delimiting_quote;
+{
+  register int i = *caller_index;
+  register char c;
+  HIST_ENTRY *entry;
+  int which, sign = 1;
+  int local_index, search_mode, substring_okay = 0;
+  char *temp;
+
+  /* The event can be specified in a number of ways.
+
+     !!   the previous command
+     !n   command line N
+     !-n  current command-line minus N
+     !str the most recent command starting with STR
+     !?str[?]
+	  the most recent command containing STR
+
+     All values N are determined via HISTORY_BASE. */
+
+  if (string[i] != history_expansion_char)
+    return ((char *)NULL);
+
+  /* Move on to the specification. */
+  i++;
+
+#define RETURN_ENTRY(e, w) \
+	return ((e = history_get (w)) ? e->line : (char *)NULL)
+
+  /* Handle !! case. */
+  if (string[i] == history_expansion_char)
+    {
+      i++;
+      which = history_base + (history_length - 1);
+      *caller_index = i;
+      RETURN_ENTRY (entry, which);
+    }
+
+  /* Hack case of numeric line specification. */
+  if (string[i] == '-')
+    {
+      sign = -1;
+      i++;
+    }
+
+  if (digit_p (string[i]))
+    {
+      /* Get the extent of the digits and compute the value. */
+      for (which = 0; digit_p (string[i]); i++)
+	which = (which * 10) + digit_value (string[i]);
+
+      *caller_index = i;
+
+      if (sign < 0)
+	which = (history_length + history_base) - which;
+
+      RETURN_ENTRY (entry, which);
+    }
+
+  /* This must be something to search for.  If the spec begins with
+     a '?', then the string may be anywhere on the line.  Otherwise,
+     the string must be found at the start of a line. */
+  if (string[i] == '?')
+    {
+      substring_okay++;
+      i++;
+    }
+
+  /* Only a closing `?' or a newline delimit a substring search string. */
+  for (local_index = i; c = string[i]; i++)
+    if ((!substring_okay && (whitespace (c) || c == ':' ||
+#if defined (SHELL)
+	  member (c, ";&()|<>") ||
+#endif /* SHELL */
+	  string[i] == delimiting_quote)) ||
+	string[i] == '\n' ||
+	(substring_okay && string[i] == '?'))
+      break;
+
+  temp = xmalloc (1 + (i - local_index));
+  strncpy (temp, &string[local_index], (i - local_index));
+  temp[i - local_index] = '\0';
+
+  if (substring_okay && string[i] == '?')
+    i++;
+
+  *caller_index = i;
+
+#define FAIL_SEARCH() \
+  do { history_offset = history_length; free (temp) ; return (char *)NULL; } while (0)
+
+  search_mode = substring_okay ? NON_ANCHORED_SEARCH : ANCHORED_SEARCH;
+  while (1)
+    {
+      local_index = history_search_internal (temp, -1, search_mode);
+
+      if (local_index < 0)
+	FAIL_SEARCH ();
+
+      if (local_index == 0 || substring_okay)
+	{
+	  entry = current_history ();
+	  history_offset = history_length;
+	
+	  /* If this was a substring search, then remember the
+	     string that we matched for word substitution. */
+	  if (substring_okay)
+	    {
+	      if (search_string)
+		free (search_string);
+	      search_string = temp;
+	    }
+	  else
+	    free (temp);
+	  return (entry->line);
+	}
+
+      if (history_offset)
+	history_offset--;
+      else
+	FAIL_SEARCH ();
+    }
+#undef FAIL_SEARCH
+#undef RETURN_ENTRY
+}
+#if defined (SHELL)
+/* Function for extracting single-quoted strings.  Used for inhibiting
+   history expansion within single quotes. */
+
+/* Extract the contents of STRING as if it is enclosed in single quotes.
+   SINDEX, when passed in, is the offset of the character immediately
+   following the opening single quote; on exit, SINDEX is left pointing
+   to the closing single quote. */
+static void
+rl_string_extract_single_quoted (string, sindex)
+     char *string;
+     int *sindex;
+{
+  register int i = *sindex;
+
+  while (string[i] && string[i] != '\'')
+    i++;
+
+  *sindex = i;
+}
+
+static char *
+quote_breaks (s)
+     char *s;
+{
+  register char *p, *r;
+  char *ret;
+  int len = 3;
+
+  for (p = s; p && *p; p++, len++)
+    {
+      if (*p == '\'')
+	len += 3;
+      else if (whitespace (*p) || *p == '\n')
+	len += 2;
+    }
+
+  r = ret = xmalloc (len);
+  *r++ = '\'';
+  for (p = s; p && *p; )
+    {
+      if (*p == '\'')
+	{
+	  *r++ = '\'';
+	  *r++ = '\\';
+	  *r++ = '\'';
+	  *r++ = '\'';
+	  p++;
+	}
+      else if (whitespace (*p) || *p == '\n')
+	{
+	  *r++ = '\'';
+	  *r++ = *p++;
+	  *r++ = '\'';
+	}
+      else
+	*r++ = *p++;
+    }
+  *r++ = '\'';
+  *r = '\0';
+  return ret;
+}
+#endif /* SHELL */
+
+static char *
+hist_error(s, start, current, errtype)
+      char *s;
+      int start, current, errtype;
+{
+  char *temp, *emsg;
+  int ll, elen;
+
+  ll = current - start;
+
+  switch (errtype)
+    {
+    case EVENT_NOT_FOUND:
+      emsg = "event not found";
+      elen = 15;
+      break;
+    case BAD_WORD_SPEC:
+      emsg = "bad word specifier";
+      elen = 18;
+      break;
+    case SUBST_FAILED:
+      emsg = "substitution failed";
+      elen = 19;
+      break;
+    case BAD_MODIFIER:
+      emsg = "unrecognized history modifier";
+      elen = 29;
+      break;
+    default:
+      emsg = "unknown expansion error";
+      elen = 23;
+      break;
+    }
+
+  temp = xmalloc (ll + elen + 3);
+  strncpy (temp, s + start, ll);
+  temp[ll] = ':';
+  temp[ll + 1] = ' ';
+  strcpy (temp + ll + 2, emsg);
+  return (temp);
+}
+
+/* Get a history substitution string from STR starting at *IPTR
+   and return it.  The length is returned in LENPTR.
+
+   A backslash can quote the delimiter.  If the string is the
+   empty string, the previous pattern is used.  If there is
+   no previous pattern for the lhs, the last history search
+   string is used.
+
+   If IS_RHS is 1, we ignore empty strings and set the pattern
+   to "" anyway.  subst_lhs is not changed if the lhs is empty;
+   subst_rhs is allowed to be set to the empty string. */
+
+static char *
+get_subst_pattern (str, iptr, delimiter, is_rhs, lenptr)
+     char *str;
+     int *iptr, delimiter, is_rhs, *lenptr;
+{
+  register int si, i, j, k;
+  char *s = (char *) NULL;
+
+  i = *iptr;
+
+  for (si = i; str[si] && str[si] != delimiter; si++)
+    if (str[si] == '\\' && str[si + 1] == delimiter)
+      si++;
+
+  if (si > i || is_rhs)
+    {
+      s = xmalloc (si - i + 1);
+      for (j = 0, k = i; k < si; j++, k++)
+	{
+	  /* Remove a backslash quoting the search string delimiter. */
+	  if (str[k] == '\\' && str[k + 1] == delimiter)
+	    k++;
+	  s[j] = str[k];
+	}
+      s[j] = '\0';
+      if (lenptr)
+        *lenptr = j;
+    }
+
+  i = si;
+  if (str[i])
+    i++;
+  *iptr = i;
+
+  return s;
+}
+
+static void
+postproc_subst_rhs ()
+{
+  char *new;
+  int i, j, new_size;
+
+  new = xmalloc (new_size = subst_rhs_len + subst_lhs_len);
+  for (i = j = 0; i < subst_rhs_len; i++)
+    {
+      if (subst_rhs[i] == '&')
+	{
+	  if (j + subst_lhs_len >= new_size)
+	    new = xrealloc (new, (new_size = new_size * 2 + subst_lhs_len));
+	  strcpy (new + j, subst_lhs);
+	  j += subst_lhs_len;
+	}
+      else
+	{
+	  /* a single backslash protects the `&' from lhs interpolation */
+	  if (subst_rhs[i] == '\\' && subst_rhs[i + 1] == '&')
+	    i++;
+	  if (j >= new_size)
+	    new = xrealloc (new, new_size *= 2);
+	  new[j++] = subst_rhs[i];
+	}
+    }
+  new[j] = '\0';
+  free (subst_rhs);
+  subst_rhs = new;
+  subst_rhs_len = j;
+}
+
+/* Expand the bulk of a history specifier starting at STRING[START].
+   Returns 0 if everything is OK, -1 if an error occurred, and 1
+   if the `p' modifier was supplied and the caller should just print
+   the returned string.  Returns the new index into string in
+   *END_INDEX_PTR, and the expanded specifier in *RET_STRING. */
+static int
+history_expand_internal (string, start, end_index_ptr, ret_string, current_line)
+     char *string;
+     int start, *end_index_ptr;
+     char **ret_string;
+     char *current_line;	/* for !# */
+{
+  int i, n, starting_index;
+  int substitute_globally, want_quotes, print_only;
+  char *event, *temp, *result, *tstr, *t, c, *word_spec;
+  int result_len;
+
+  result = xmalloc (result_len = 128);
+
+  i = start;
+
+  /* If it is followed by something that starts a word specifier,
+     then !! is implied as the event specifier. */
+
+  if (member (string[i + 1], ":$*%^"))
+    {
+      char fake_s[3];
+      int fake_i = 0;
+      i++;
+      fake_s[0] = fake_s[1] = history_expansion_char;
+      fake_s[2] = '\0';
+      event = get_history_event (fake_s, &fake_i, 0);
+    }
+  else if (string[i + 1] == '#')
+    {
+      i += 2;
+      event = current_line;
+    }
+  else
+    {
+      int quoted_search_delimiter = 0;
+
+      /* If the character before this `!' is a double or single
+	 quote, then this expansion takes place inside of the
+	 quoted string.  If we have to search for some text ("!foo"),
+	 allow the delimiter to end the search string. */
+      if (i && (string[i - 1] == '\'' || string[i - 1] == '"'))
+	quoted_search_delimiter = string[i - 1];
+      event = get_history_event (string, &i, quoted_search_delimiter);
+    }
+	  
+  if (!event)
+    {
+      *ret_string = hist_error (string, start, i, EVENT_NOT_FOUND);
+      free (result);
+      return (-1);
+    }
+
+  /* If a word specifier is found, then do what that requires. */
+  starting_index = i;
+  word_spec = get_history_word_specifier (string, event, &i);
+
+  /* There is no such thing as a `malformed word specifier'.  However,
+     it is possible for a specifier that has no match.  In that case,
+     we complain. */
+  if (word_spec == (char *)&error_pointer)
+    {
+      *ret_string = hist_error (string, starting_index, i, BAD_WORD_SPEC);
+      free (result);
+      return (-1);
+    }
+
+  /* If no word specifier, than the thing of interest was the event. */
+  if (!word_spec)
+    temp = savestring (event);
+  else
+    {
+      temp = savestring (word_spec);
+      free (word_spec);
+    }
+
+  /* Perhaps there are other modifiers involved.  Do what they say. */
+  want_quotes = substitute_globally = print_only = 0;
+  starting_index = i;
+
+  while (string[i] == ':')
+    {
+      c = string[i + 1];
+
+      if (c == 'g')
+	{
+	  substitute_globally = 1;
+	  i++;
+	  c = string[i + 1];
+	}
+
+      switch (c)
+	{
+	default:
+	  *ret_string = hist_error (string, i+1, i+2, BAD_MODIFIER);
+	  free (result);
+	  free (temp);
+	  return -1;
+
+#if defined (SHELL)
+	case 'q':
+	  want_quotes = 'q';
+	  break;
+
+	case 'x':
+	  want_quotes = 'x';
+	  break;
+#endif /* SHELL */
+
+	  /* :p means make this the last executed line.  So we
+	     return an error state after adding this line to the
+	     history. */
+	case 'p':
+	  print_only++;
+	  break;
+
+	  /* :t discards all but the last part of the pathname. */
+	case 't':
+	  tstr = strrchr (temp, '/');
+	  if (tstr)
+	    {
+	      tstr++;
+	      t = savestring (tstr);
+	      free (temp);
+	      temp = t;
+	    }
+	  break;
+
+	  /* :h discards the last part of a pathname. */
+	case 'h':
+	  tstr = strrchr (temp, '/');
+	  if (tstr)
+	    *tstr = '\0';
+	  break;
+
+	  /* :r discards the suffix. */
+	case 'r':
+	  tstr = strrchr (temp, '.');
+	  if (tstr)
+	    *tstr = '\0';
+	  break;
+
+	  /* :e discards everything but the suffix. */
+	case 'e':
+	  tstr = strrchr (temp, '.');
+	  if (tstr)
+	    {
+	      t = savestring (tstr);
+	      free (temp);
+	      temp = t;
+	    }
+	  break;
+
+	/* :s/this/that substitutes `that' for the first
+	   occurrence of `this'.  :gs/this/that substitutes `that'
+	   for each occurrence of `this'.  :& repeats the last
+	   substitution.  :g& repeats the last substitution
+	   globally. */
+
+	case '&':
+	case 's':
+	  {
+	    char *new_event, *t;
+	    int delimiter, failed, si, l_temp;
+
+	    if (c == 's')
+	      {
+		if (i + 2 < (int)strlen (string))
+		  delimiter = string[i + 2];
+		else
+		  break;	/* no search delimiter */
+
+		i += 3;
+
+		t = get_subst_pattern (string, &i, delimiter, 0, &subst_lhs_len);
+		/* An empty substitution lhs with no previous substitution
+		   uses the last search string as the lhs. */
+		if (t)
+		  {
+		    if (subst_lhs)
+		      free (subst_lhs);
+		    subst_lhs = t;
+		  }
+		else if (!subst_lhs)
+		  {
+		    if (search_string && *search_string)
+		      {
+			subst_lhs = savestring (search_string);
+			subst_lhs_len = strlen (subst_lhs);
+		      }
+		    else
+		      {
+		        subst_lhs = (char *) NULL;
+		        subst_lhs_len = 0;
+		      }
+		  }
+
+		/* If there is no lhs, the substitution can't succeed. */
+		if (subst_lhs_len == 0)
+		  {
+		    *ret_string = hist_error (string, starting_index, i, SUBST_FAILED);
+		    free (result);
+		    free (temp);
+		    return -1;
+		  }
+
+		if (subst_rhs)
+		  free (subst_rhs);
+		subst_rhs = get_subst_pattern (string, &i, delimiter, 1, &subst_rhs_len);
+
+		/* If `&' appears in the rhs, it's supposed to be replaced
+		   with the lhs. */
+		if (member ('&', subst_rhs))
+		  postproc_subst_rhs ();
+	      }
+	    else
+	      i += 2;
+
+	    l_temp = strlen (temp);
+	    /* Ignore impossible cases. */
+	    if (subst_lhs_len > l_temp)
+	      {
+		*ret_string = hist_error (string, starting_index, i, SUBST_FAILED);
+		free (result);
+		free (temp);
+		return (-1);
+	      }
+
+	    /* Find the first occurrence of THIS in TEMP. */
+	    si = 0;
+	    for (failed = 1; (si + subst_lhs_len) <= l_temp; si++)
+	      if (STREQN (temp+si, subst_lhs, subst_lhs_len))
+		{
+		  int len = subst_rhs_len - subst_lhs_len + l_temp;
+		  new_event = xmalloc (1 + len);
+		  strncpy (new_event, temp, si);
+		  strncpy (new_event + si, subst_rhs, subst_rhs_len);
+		  strncpy (new_event + si + subst_rhs_len,
+			   temp + si + subst_lhs_len,
+			   l_temp - (si + subst_lhs_len));
+		  new_event[len] = '\0';
+		  free (temp);
+		  temp = new_event;
+
+		  failed = 0;
+
+		  if (substitute_globally)
+		    {
+		      si += subst_rhs_len;
+		      l_temp = strlen (temp);
+		      substitute_globally++;
+		      continue;
+		    }
+		  else
+		    break;
+		}
+
+	    if (substitute_globally > 1)
+	      {
+		substitute_globally = 0;
+		continue;	/* don't want to increment i */
+	      }
+
+	    if (failed == 0)
+	      continue;		/* don't want to increment i */
+
+	    *ret_string = hist_error (string, starting_index, i, SUBST_FAILED);
+	    free (result);
+	    free (temp);
+	    return (-1);
+	  }
+	}
+      i += 2;
+    }
+  /* Done with modfiers. */
+  /* Believe it or not, we have to back the pointer up by one. */
+  --i;
+
+#if defined (SHELL)
+  if (want_quotes)
+    {
+      char *x;
+
+      if (want_quotes == 'q')
+	x = single_quote (temp);
+      else if (want_quotes == 'x')
+	x = quote_breaks (temp);
+      else
+	x = savestring (temp);
+
+      free (temp);
+      temp = x;
+    }
+#endif /* SHELL */
+
+  n = strlen (temp);
+  if (n > result_len)
+    result = xrealloc (result, n + 2);
+  strcpy (result, temp);
+  free (temp);
+
+  *end_index_ptr = i;
+  *ret_string = result;
+  return (print_only);
+}
+
+/* Expand the string STRING, placing the result into OUTPUT, a pointer
+   to a string.  Returns:
+
+  -1) If there was an error in expansion.
+   0) If no expansions took place (or, if the only change in
+      the text was the de-slashifying of the history expansion
+      character)
+   1) If expansions did take place
+   2) If the `p' modifier was given and the caller should print the result
+
+  If an error ocurred in expansion, then OUTPUT contains a descriptive
+  error message. */
+
+#define ADD_STRING(s) \
+	do \
+	  { \
+	    int sl = strlen (s); \
+	    j += sl; \
+	    if (j >= result_len) \
+	      { \
+	        while (j >= result_len) \
+	          result_len += 128; \
+	        result = xrealloc (result, result_len); \
+	      } \
+	    strcpy (result + j - sl, s); \
+	  } \
+	while (0)
+
+#define ADD_CHAR(c) \
+	do \
+	  { \
+	    if (j >= result_len - 1) \
+	      result = xrealloc (result, result_len += 64); \
+	    result[j++] = c; \
+	    result[j] = '\0'; \
+	  } \
+	while (0)
+
+int
+history_expand (hstring, output)
+     char *hstring;
+     char **output;
+{
+  register int j;
+  int i, r, l, passc, cc, modified, eindex, only_printing;
+  char *string;
+
+  /* The output string, and its length. */
+  int result_len;
+  char *result;
+
+  /* Used when adding the string. */
+  char *temp;
+
+  /* Setting the history expansion character to 0 inhibits all
+     history expansion. */
+  if (history_expansion_char == 0)
+    {
+      *output = savestring (hstring);
+      return (0);
+    }
+    
+  /* Prepare the buffer for printing error messages. */
+  result = xmalloc (result_len = 256);
+  result[0] = '\0';
+
+  only_printing = modified = 0;
+  l = strlen (hstring);
+
+  /* Grovel the string.  Only backslash can quote the history escape
+     character.  We also handle arg specifiers. */
+
+  /* Before we grovel forever, see if the history_expansion_char appears
+     anywhere within the text. */
+
+  /* The quick substitution character is a history expansion all right.  That
+     is to say, "^this^that^" is equivalent to "!!:s^this^that^", and in fact,
+     that is the substitution that we do. */
+  if (hstring[0] == history_subst_char)
+    {
+      string = xmalloc (l + 5);
+
+      string[0] = string[1] = history_expansion_char;
+      string[2] = ':';
+      string[3] = 's';
+      strcpy (string + 4, hstring);
+      l += 4;
+    }
+  else
+    {
+      string = hstring;
+      /* If not quick substitution, still maybe have to do expansion. */
+
+      /* `!' followed by one of the characters in history_no_expand_chars
+	 is NOT an expansion. */
+      for (i = 0; string[i]; i++)
+	{
+	  cc = string[i + 1];
+          if (string[i] == history_expansion_char)
+	    {
+	      if (!cc || member (cc, history_no_expand_chars))
+		continue;
+#if defined (SHELL)
+	      /* The shell uses ! as a pattern negation character
+	         in globbing [...] expressions, so let those pass
+	         without expansion. */
+	      else if (i > 0 && (string[i - 1] == '[') &&
+		       member (']', string + i + 1))
+		continue;
+#endif /* SHELL */
+	      else
+		break;
+	    }
+#if defined (SHELL)
+	  else if (string[i] == '\'')
+	    {
+	      /* If this is bash, single quotes inhibit history expansion. */
+	      i++;
+	      rl_string_extract_single_quoted (string, &i);
+	    }
+	  else if (string[i] == '\\')
+	    {
+	      /* If this is bash, allow backslashes to quote single
+		 quotes and
+		 the history expansion character. */
+	      if (cc == '\'' || cc == history_expansion_char)
+		i++;
+	    }
+#endif /* SHELL */
+	}
+	  
+      if (string[i] != history_expansion_char)
+	{
+	  free (result);
+	  *output = savestring (string);
+	  return (0);
+	}
+    }
+
+  /* Extract and perform the substitution. */
+  for (passc = i = j = 0; i < l; i++)
+    {
+      int tchar = string[i];
+
+      if (passc)
+	{
+	  passc = 0;
+	  ADD_CHAR (tchar);
+	  continue;
+	}
+
+      if (tchar == history_expansion_char)
+	tchar = -3;
+
+      switch (tchar)
+	{
+	default:
+	  ADD_CHAR (string[i]);
+	  break;
+
+	case '\\':
+	  passc++;
+	  ADD_CHAR (tchar);
+	  break;
+
+#if defined (SHELL)
+	case '\'':
+	  {
+	    /* If this is bash, single quotes inhibit history expansion. */
+	    int quote, slen;
+
+	    quote = i++;
+	    rl_string_extract_single_quoted (string, &i);
+
+	    slen = i - quote + 2;
+	    temp = xmalloc (slen);
+	    strncpy (temp, string + quote, slen);
+	    temp[slen - 1] = '\0';
+	    ADD_STRING (temp);
+	    free (temp);
+	    break;
+	  }
+#endif /* SHELL */
+
+	case -3:		/* history_expansion_char */
+	  cc = string[i + 1];
+
+	  /* If the history_expansion_char is followed by one of the
+	     characters in history_no_expand_chars, then it is not a
+	     candidate for expansion of any kind. */
+	  if (member (cc, history_no_expand_chars))
+	    {
+	      ADD_CHAR (string[i]);
+	      break;
+	    }
+
+#if defined (NO_BANG_HASH_MODIFIERS)
+	  /* There is something that is listed as a `word specifier' in csh
+	     documentation which means `the expanded text to this point'.
+	     That is not a word specifier, it is an event specifier.  If we
+	     don't want to allow modifiers with `!#', just stick the current
+	     output line in again. */
+	  if (cc == '#')
+	    {
+	      if (result)
+		{
+		  temp = xmalloc (1 + strlen (result));
+		  strcpy (temp, result);
+		  ADD_STRING (temp);
+		  free (temp);
+		}
+	      i++;
+	      break;
+	    }
+#endif
+
+	  r = history_expand_internal (string, i, &eindex, &temp, result);
+	  if (r < 0)
+	    {
+	      *output = temp;
+	      free (result);
+	      if (string != hstring)
+		free (string);
+	      return -1;
+	    }
+	  else
+	    {
+	      if (temp)
+		{
+		  modified++;
+		  if (*temp)
+		    ADD_STRING (temp);
+		  free (temp);
+		}
+	      only_printing = r == 1;
+	      i = eindex;
+	    }
+	  break;
+	}
+    }
+
+  *output = result;
+  if (string != hstring)
+    free (string);
+
+  if (only_printing)
+    {
+      add_history (result);
+      return (2);
+    }
+
+  return (modified != 0);
+}
+
+/* Return a consed string which is the word specified in SPEC, and found
+   in FROM.  NULL is returned if there is no spec.  The address of
+   ERROR_POINTER is returned if the word specified cannot be found.
+   CALLER_INDEX is the offset in SPEC to start looking; it is updated
+   to point to just after the last character parsed. */
+static char *
+get_history_word_specifier (spec, from, caller_index)
+     char *spec, *from;
+     int *caller_index;
+{
+  register int i = *caller_index;
+  int first, last;
+  int expecting_word_spec = 0;
+  char *result;
+
+  /* The range of words to return doesn't exist yet. */
+  first = last = 0;
+  result = (char *)NULL;
+
+  /* If we found a colon, then this *must* be a word specification.  If
+     it isn't, then it is an error. */
+  if (spec[i] == ':')
+    {
+      i++;
+      expecting_word_spec++;
+    }
+
+  /* Handle special cases first. */
+
+  /* `%' is the word last searched for. */
+  if (spec[i] == '%')
+    {
+      *caller_index = i + 1;
+      return (search_string ? savestring (search_string) : savestring (""));
+    }
+
+  /* `*' matches all of the arguments, but not the command. */
+  if (spec[i] == '*')
+    {
+      *caller_index = i + 1;
+      result = history_arg_extract (1, '$', from);
+      return (result ? result : savestring (""));
+    }
+
+  /* `$' is last arg. */
+  if (spec[i] == '$')
+    {
+      *caller_index = i + 1;
+      return (history_arg_extract ('$', '$', from));
+    }
+
+  /* Try to get FIRST and LAST figured out. */
+
+  if (spec[i] == '-')
+    first = 0;
+  else if (spec[i] == '^')
+    first = 1;
+  else if (digit_p (spec[i]) && expecting_word_spec)
+    {
+      for (first = 0; digit_p (spec[i]); i++)
+	first = (first * 10) + digit_value (spec[i]);
+    }
+  else
+    return ((char *)NULL);	/* no valid `first' for word specifier */
+
+  if (spec[i] == '^' || spec[i] == '*')
+    {
+      last = (spec[i] == '^') ? 1 : '$';	/* x* abbreviates x-$ */
+      i++;
+    }
+  else if (spec[i] != '-')
+    last = first;
+  else
+    {
+      i++;
+
+      if (digit_p (spec[i]))
+	{
+	  for (last = 0; digit_p (spec[i]); i++)
+	    last = (last * 10) + digit_value (spec[i]);
+	}
+      else if (spec[i] == '$')
+	{
+	  i++;
+	  last = '$';
+	}
+      else if (!spec[i] || spec[i] == ':')  /* could be modifier separator */
+	last = -1;		/* x- abbreviates x-$ omitting word `$' */
+    }
+
+  *caller_index = i;
+
+  if (last >= first || last == '$' || last < 0)
+    result = history_arg_extract (first, last, from);
+
+  return (result ? result : (char *)&error_pointer);
+}
+
+/* Extract the args specified, starting at FIRST, and ending at LAST.
+   The args are taken from STRING.  If either FIRST or LAST is < 0,
+   then make that arg count from the right (subtract from the number of
+   tokens, so that FIRST = -1 means the next to last token on the line).
+   If LAST is `$' the last arg from STRING is used. */
+char *
+history_arg_extract (first, last, string)
+     int first, last;
+     char *string;
+{
+  register int i, len;
+  char *result = (char *)NULL;
+  int size = 0, offset = 0;
+  char **list;
+
+  /* XXX - think about making history_tokenize return a struct array,
+     each struct in array being a string and a length to avoid the
+     calls to strlen below. */
+  if ((list = history_tokenize (string)) == NULL)
+    return ((char *)NULL);
+
+  for (len = 0; list[len]; len++)
+    ;
+
+  if (last < 0)
+    last = len + last - 1;
+
+  if (first < 0)
+    first = len + first - 1;
+
+  if (last == '$')
+    last = len - 1;
+
+  if (first == '$')
+    first = len - 1;
+
+  last++;
+
+  if (first > len || last > len || first < 0 || last < 0)
+    result = ((char *)NULL);
+  else
+    {
+      for (size = 0, i = first; i < last; i++)
+	size += strlen (list[i]) + 1;
+      result = xmalloc (size + 1);
+
+      for (i = first; i < last; i++)
+	{
+	  strcpy (result + offset, list[i]);
+	  offset += strlen (list[i]);
+	  if (i + 1 < last)
+	    {
+      	      result[offset++] = ' ';
+	      result[offset] = 0;
+	    }
+	}
+    }
+
+  for (i = 0; i < len; i++)
+    free (list[i]);
+  free (list);
+
+  return (result);
+}
+
+#define slashify_in_quotes "\\`\"$"
+
+/* Return an array of tokens, much as the shell might.  The tokens are
+   parsed out of STRING. */
+char **
+history_tokenize (string)
+     char *string;
+{
+  char **result = (char **)NULL;
+  register int i, start, result_index, size;
+  int len;
+
+  i = result_index = size = 0;
+
+  /* Get a token, and stuff it into RESULT.  The tokens are split
+     exactly where the shell would split them. */
+  while (string[i])
+    {
+      int delimiter = 0;
+
+      /* Skip leading whitespace. */
+      for (; string[i] && whitespace (string[i]); i++)
+	;
+      if (!string[i] || string[i] == history_comment_char)
+	return (result);
+
+      start = i;
+      
+      if (member (string[i], "()\n"))
+	{
+	  i++;
+	  goto got_token;
+	}
+
+      if (member (string[i], "<>;&|$"))
+	{
+	  int peek = string[i + 1];
+
+	  if (peek == string[i] && peek != '$')
+	    {
+	      if (peek == '<' && string[i + 2] == '-')
+		i++;
+	      i += 2;
+	      goto got_token;
+	    }
+	  else
+	    {
+	      if ((peek == '&' && (string[i] == '>' || string[i] == '<')) ||
+		  ((peek == '>') && (string[i] == '&')) ||
+		  ((peek == '(') && (string[i] == '$')))
+		{
+		  i += 2;
+		  goto got_token;
+		}
+	    }
+	  if (string[i] != '$')
+	    {
+	      i++;
+	      goto got_token;
+	    }
+	}
+
+      /* Get word from string + i; */
+
+      if (member (string[i], "\"'`"))
+	delimiter = string[i++];
+
+      for (; string[i]; i++)
+	{
+	  if (string[i] == '\\' && string[i + 1] == '\n')
+	    {
+	      i++;
+	      continue;
+	    }
+
+	  if (string[i] == '\\' && delimiter != '\'' &&
+	      (delimiter != '"' || member (string[i], slashify_in_quotes)))
+	    {
+	      i++;
+	      continue;
+	    }
+
+	  if (delimiter && string[i] == delimiter)
+	    {
+	      delimiter = 0;
+	      continue;
+	    }
+
+	  if (!delimiter && (member (string[i], " \t\n;&()|<>")))
+	    break;
+
+	  if (!delimiter && member (string[i], "\"'`"))
+	    delimiter = string[i];
+	}
+    got_token:
+
+      len = i - start;
+      if (result_index + 2 >= size)
+	result = (char **)xrealloc (result, ((size += 10) * sizeof (char *)));
+      result[result_index] = xmalloc (1 + len);
+      strncpy (result[result_index], string + start, len);
+      result[result_index][len] = '\0';
+      result[++result_index] = (char *)NULL;
+    }
+
+  return (result);
+}
+
+#if defined (STATIC_MALLOC)
+
+/* **************************************************************** */
+/*								    */
+/*			xmalloc and xrealloc ()		     	    */
+/*								    */
+/* **************************************************************** */
+
+static void memory_error_and_abort ();
+
+static char *
+xmalloc (bytes)
+     int bytes;
+{
+  char *temp = (char *)malloc (bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+  return (temp);
+}
+
+static char *
+xrealloc (pointer, bytes)
+     char *pointer;
+     int bytes;
+{
+  char *temp;
+
+  if (!pointer)
+    temp = (char *)xmalloc (bytes);
+  else
+    temp = (char *)realloc (pointer, bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+
+  return (temp);
+}
+
+static void
+memory_error_and_abort ()
+{
+  fprintf (stderr, "history: Out of virtual memory!\n");
+  abort ();
+}
+#endif /* STATIC_MALLOC */
+
+/* **************************************************************** */
+/*								    */
+/*				Test Code			    */
+/*								    */
+/* **************************************************************** */
+#ifdef TEST
+main ()
+{
+  char line[1024], *t;
+  int done = 0;
+
+  line[0] = 0;
+
+  while (!done)
+    {
+      fprintf (stdout, "history%% ");
+      t = gets (line);
+
+      if (!t)
+	strcpy (line, "quit");
+
+      if (line[0])
+	{
+	  char *expansion;
+	  int result;
+
+	  using_history ();
+
+	  result = history_expand (line, &expansion);
+	  strcpy (line, expansion);
+	  free (expansion);
+	  if (result)
+	    fprintf (stderr, "%s\n", line);
+
+	  if (result < 0)
+	    continue;
+
+	  add_history (line);
+	}
+
+      if (strcmp (line, "quit") == 0) done = 1;
+      if (strcmp (line, "save") == 0) write_history (0);
+      if (strcmp (line, "read") == 0) read_history (0);
+      if (strcmp (line, "list") == 0)
+	{
+	  register HIST_ENTRY **the_list = history_list ();
+	  register int i;
+
+	  if (the_list)
+	    for (i = 0; the_list[i]; i++)
+	      fprintf (stdout, "%d: %s\n", i + history_base, the_list[i]->line);
+	}
+      if (strncmp (line, "delete", strlen ("delete")) == 0)
+	{
+	  int which;
+	  if ((sscanf (line + strlen ("delete"), "%d", &which)) == 1)
+	    {
+	      HIST_ENTRY *entry = remove_history (which);
+	      if (!entry)
+		fprintf (stderr, "No such entry %d\n", which);
+	      else
+		{
+		  free (entry->line);
+		  free (entry);
+		}
+	    }
+	  else
+	    {
+	      fprintf (stderr, "non-numeric arg given to `delete'\n");
+	    }
+	}
+    }
+}
+
+#endif /* TEST */
+
+/*
+* Local variables:
+* compile-command: "gcc -g -DTEST -o history history.c"
+* end:
+*/
diff --git a/history.h b/history.h
new file mode 100644
index 0000000..745e61c
--- /dev/null
+++ b/history.h
@@ -0,0 +1,180 @@
+/* History.h -- the names of functions that you can call in history. */
+
+/* The structure used to store a history entry. */
+typedef struct _hist_entry {
+  char *line;
+  char *data;
+} HIST_ENTRY;
+
+/* A structure used to pass the current state of the history stuff around. */
+typedef struct _hist_state {
+  HIST_ENTRY **entries;		/* Pointer to the entries themselves. */
+  int offset;			/* The location pointer within this array. */
+  int length;			/* Number of elements within this array. */
+  int size;			/* Number of slots allocated to this array. */
+  int flags;
+} HISTORY_STATE;
+
+/* Flag values for the `flags' member of HISTORY_STATE. */
+#define HS_STIFLED	0x01
+
+/* Initialization and state management. */
+
+/* Begin a session in which the history functions might be used.  This
+   just initializes the interactive variables. */
+extern void using_history ();
+
+/* Return the current HISTORY_STATE of the history. */
+extern HISTORY_STATE *history_get_history_state ();
+
+/* Set the state of the current history array to STATE. */
+extern void history_set_history_state ();
+
+/* Manage the history list. */
+
+/* Place STRING at the end of the history list.
+   The associated data field (if any) is set to NULL. */
+extern void add_history ();
+
+/* A reasonably useless function, only here for completeness.  WHICH
+   is the magic number that tells us which element to delete.  The
+   elements are numbered from 0. */
+extern HIST_ENTRY *remove_history ();
+
+/* Make the history entry at WHICH have LINE and DATA.  This returns
+   the old entry so you can dispose of the data.  In the case of an
+   invalid WHICH, a NULL pointer is returned. */
+extern HIST_ENTRY *replace_history_entry ();
+
+/* Stifle the history list, remembering only MAX number of entries. */
+extern void stifle_history ();
+
+/* Stop stifling the history.  This returns the previous amount the
+   history was stifled by.  The value is positive if the history was
+   stifled, negative if it wasn't. */
+extern int unstifle_history ();
+
+/* Return 1 if the history is stifled, 0 if it is not. */
+extern int history_is_stifled ();
+
+/* Information about the history list. */
+
+/* Return a NULL terminated array of HIST_ENTRY which is the current input
+   history.  Element 0 of this list is the beginning of time.  If there
+   is no history, return NULL. */
+extern HIST_ENTRY **history_list ();
+
+/* Returns the number which says what history element we are now
+   looking at.  */
+extern int where_history ();
+  
+/* Return the history entry at the current position, as determined by
+   history_offset.  If there is no entry there, return a NULL pointer. */
+HIST_ENTRY *current_history ();
+
+/* Return the history entry which is logically at OFFSET in the history
+   array.  OFFSET is relative to history_base. */
+extern HIST_ENTRY *history_get ();
+
+/* Return the number of bytes that the primary history entries are using.
+   This just adds up the lengths of the_history->lines. */
+extern int history_total_bytes ();
+
+/* Moving around the history list. */
+
+/* Set the position in the history list to POS. */
+int history_set_pos ();
+
+/* Back up history_offset to the previous history entry, and return
+   a pointer to that entry.  If there is no previous entry, return
+   a NULL pointer. */
+extern HIST_ENTRY *previous_history ();
+
+/* Move history_offset forward to the next item in the input_history,
+   and return the a pointer to that entry.  If there is no next entry,
+   return a NULL pointer. */
+extern HIST_ENTRY *next_history ();
+
+/* Searching the history list. */
+
+/* Search the history for STRING, starting at history_offset.
+   If DIRECTION < 0, then the search is through previous entries,
+   else through subsequent.  If the string is found, then
+   current_history () is the history entry, and the value of this function
+   is the offset in the line of that history entry that the string was
+   found in.  Otherwise, nothing is changed, and a -1 is returned. */
+extern int history_search ();
+
+extern int history_search_prefix ();
+/* Search the history for @var{string}, starting at history_offset.
+   The search is anchored: matching lines must begin with string. */
+/* Search for STRING in the history list, starting at POS, an
+   absolute index into the list.  DIR, if negative, says to search
+   backwards from POS, else forwards.
+   Returns the absolute index of the history element where STRING
+   was found, or -1 otherwise. */
+extern int history_search_pos ();
+
+/* Managing the history file. */
+
+/* Add the contents of FILENAME to the history list, a line at a time.
+   If FILENAME is NULL, then read from ~/.history.  Returns 0 if
+   successful, or errno if not. */
+extern int read_history ();
+
+/* Read a range of lines from FILENAME, adding them to the history list.
+   Start reading at the FROM'th line and end at the TO'th.  If FROM
+   is zero, start at the beginning.  If TO is less than FROM, read
+   until the end of the file.  If FILENAME is NULL, then read from
+   ~/.history.  Returns 0 if successful, or errno if not. */
+extern int read_history_range ();
+
+/* Write the current history to FILENAME.  If FILENAME is NULL,
+   then write the history list to ~/.history.  Values returned
+   are as in read_history ().  */
+extern int write_history ();
+
+/* Append NELEMENT entries to FILENAME.  The entries appended are from
+   the end of the list minus NELEMENTs up to the end of the list. */
+int append_history ();
+
+/* Truncate the history file, leaving only the last NLINES lines. */
+extern int history_truncate_file ();
+
+/* History expansion. */
+
+/* Expand the string STRING, placing the result into OUTPUT, a pointer
+   to a string.  Returns:
+
+   0) If no expansions took place (or, if the only change in
+      the text was the de-slashifying of the history expansion
+      character)
+   1) If expansions did take place
+  -1) If there was an error in expansion.
+   2) If the returned line should just be printed.
+
+  If an error ocurred in expansion, then OUTPUT contains a descriptive
+  error message. */
+extern int history_expand ();
+
+/* Extract a string segment consisting of the FIRST through LAST
+   arguments present in STRING.  Arguments are broken up as in
+   the shell. */
+extern char *history_arg_extract ();
+
+/* Return the text of the history event beginning at the current
+   offset into STRING. */
+extern char *get_history_event ();
+
+/* Return an array of tokens, much as the shell might.  The tokens are
+   parsed out of STRING. */
+extern char **history_tokenize ();
+
+/* Exported history variables. */
+extern int history_base;
+extern int history_length;
+extern int max_input_history;
+extern char history_expansion_char;
+extern char history_subst_char;
+extern char history_comment_char;
+extern char *history_no_expand_chars;
diff --git a/isearch.c b/isearch.c
new file mode 100644
index 0000000..1a0193f
--- /dev/null
+++ b/isearch.c
@@ -0,0 +1,378 @@
+/* **************************************************************** */
+/*								    */
+/*			I-Search and Searching			    */
+/*								    */
+/* **************************************************************** */
+
+/* Copyright (C) 1987,1989 Free Software Foundation, Inc.
+
+   This file contains the Readline Library (the Library), a set of
+   routines for providing Emacs style line input to programs that ask
+   for it.
+
+   The Library is free software; you can redistribute it and/or modify
+   it under the terms of the GNU General Public License as published by
+   the Free Software Foundation; either version 1, or (at your option)
+   any later version.
+
+   The Library is distributed in the hope that it will be useful, but
+   WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#include <stdio.h>
+
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif
+
+#include "memalloc.h"
+#include "readline.h"
+#include "history.h"
+
+#define STREQ(a, b)	(((a)[0] == (b)[0]) && (strcmp ((a), (b)) == 0))
+#define STREQN(a, b, n)	(((a)[0] == (b)[0]) && (strncmp ((a), (b), (n)) == 0))
+
+/* Variables imported from other files in the readline library. */
+extern Keymap _rl_keymap;
+extern HIST_ENTRY *saved_line_for_history;
+extern int rl_line_buffer_len;
+extern int rl_point, rl_end;
+extern char *rl_line_buffer;
+
+extern char *xmalloc (), *xrealloc ();
+
+static int rl_search_history ();
+
+/* Last line found by the current incremental search, so we don't `find'
+   identical lines many times in a row. */
+static char *prev_line_found;
+
+/* Search backwards through the history looking for a string which is typed
+   interactively.  Start with the current line. */
+rl_reverse_search_history (sign, key)
+     int sign;
+     int key;
+{
+  return (rl_search_history (-sign, key));
+}
+
+/* Search forwards through the history looking for a string which is typed
+   interactively.  Start with the current line. */
+rl_forward_search_history (sign, key)
+     int sign;
+     int key;
+{
+  return (rl_search_history (sign, key));
+}
+
+/* Display the current state of the search in the echo-area.
+   SEARCH_STRING contains the string that is being searched for,
+   DIRECTION is zero for forward, or 1 for reverse,
+   WHERE is the history list number of the current line.  If it is
+   -1, then this line is the starting one. */
+static void
+rl_display_search (search_string, reverse_p, where)
+     char *search_string;
+     int reverse_p, where;
+{
+  char *message;
+
+  message = xmalloc (1 + (search_string ? strlen (search_string) : 0) + 30);
+  *message = '\0';
+
+#if defined (NOTDEF)
+  if (where != -1)
+    sprintf (message, "[%d]", where + history_base);
+#endif /* NOTDEF */
+
+  strcat (message, "(");
+
+  if (reverse_p)
+    strcat (message, "reverse-");
+
+  strcat (message, "i-search)`");
+
+  if (search_string)
+    strcat (message, search_string);
+
+  strcat (message, "': ");
+  rl_message ("%s", message, 0);
+  free (message);
+  rl_redisplay ();
+}
+
+/* Search through the history looking for an interactively typed string.
+   This is analogous to i-search.  We start the search in the current line.
+   DIRECTION is which direction to search; >= 0 means forward, < 0 means
+   backwards. */
+static int
+rl_search_history (direction, invoking_key)
+     int direction;
+     int invoking_key;
+{
+  /* The string that the user types in to search for. */
+  char *search_string;
+
+  /* The current length of SEARCH_STRING. */
+  int search_string_index;
+
+  /* The amount of space that SEARCH_STRING has allocated to it. */
+  int search_string_size;
+
+  /* The list of lines to search through. */
+  char **lines, *allocated_line = (char *)NULL;
+
+  /* The length of LINES. */
+  int hlen;
+
+  /* Where we get LINES from. */
+  HIST_ENTRY **hlist = history_list ();
+
+  register int i = 0;
+  int orig_point = rl_point;
+  int orig_line = where_history ();
+  int last_found_line = orig_line;
+  int c, done = 0, found, failed, sline_len;
+
+  /* The line currently being searched. */
+  char *sline;
+
+  /* Offset in that line. */
+  int line_index;
+
+  /* Non-zero if we are doing a reverse search. */
+  int reverse = (direction < 0);
+
+  /* Create an arrary of pointers to the lines that we want to search. */
+  maybe_replace_line ();
+  if (hlist)
+    for (i = 0; hlist[i]; i++);
+
+  /* Allocate space for this many lines, +1 for the current input line,
+     and remember those lines. */
+  lines = (char **)xmalloc ((1 + (hlen = i)) * sizeof (char *));
+  for (i = 0; i < hlen; i++)
+    lines[i] = hlist[i]->line;
+
+  if (saved_line_for_history)
+    lines[i] = saved_line_for_history->line;
+  else
+    {
+      /* Keep track of this so we can free it. */
+      allocated_line = xmalloc (1 + strlen (rl_line_buffer));
+      strcpy (allocated_line, &rl_line_buffer[0]);
+      lines[i] = allocated_line;
+    }
+
+  hlen++;
+
+  /* The line where we start the search. */
+  i = orig_line;
+
+  /* Initialize search parameters. */
+  search_string = xmalloc (search_string_size = 128);
+  *search_string = '\0';
+  search_string_index = 0;
+  prev_line_found = (char *)0;		/* XXX */
+
+  /* Normalize DIRECTION into 1 or -1. */
+  direction = (direction >= 0) ? 1 : -1;
+
+  rl_display_search (search_string, reverse, -1);
+
+  sline = rl_line_buffer;
+  sline_len = strlen (sline);
+  line_index = rl_point;
+
+  found = failed = 0;
+  while (!done)
+    {
+      Function *f = (Function *)NULL;
+
+      /* Read a key and decide how to proceed. */
+      c = rl_read_key ();
+
+      /* Hack C to Do What I Mean. */
+      if (_rl_keymap[c].type == ISFUNC)
+	{
+	  f = _rl_keymap[c].function;
+
+	  if (f == rl_reverse_search_history)
+	    c = reverse ? -1 : -2;
+	  else if (f == rl_forward_search_history)
+	    c =  !reverse ? -1 : -2;
+	}
+
+      switch (c)
+	{
+	case ESC:
+	  done = 1;
+	  continue;
+
+	case -1:
+	  if (!search_string_index)
+	    continue;
+	  else
+	    {
+	      if (reverse)
+		--line_index;
+	      else
+		{
+		  if (line_index != sline_len)
+		    ++line_index;
+		  else
+		    ding ();
+		}
+	    }
+	  break;
+
+	  /* switch directions */
+	case -2:
+	  direction = -direction;
+	  reverse = (direction < 0);
+	  break;
+
+	case CTRL ('G'):
+	  strcpy (rl_line_buffer, lines[orig_line]);
+	  rl_point = orig_point;
+	  rl_end = strlen (rl_line_buffer);
+	  rl_clear_message ();
+	  free (allocated_line);
+	  free (lines);
+	  return 0;
+
+	default:
+	  if (CTRL_CHAR (c) || META_CHAR (c) || c == RUBOUT)
+	    {
+	      rl_execute_next (c);
+	      done = 1;
+	      continue;
+	    }
+	  else
+	    {
+	      /* Add character to search string and continue search. */
+	      if (search_string_index + 2 >= search_string_size)
+		{
+		  search_string_size += 128;
+		  search_string = xrealloc (search_string, search_string_size);
+		}
+	      search_string[search_string_index++] = c;
+	      search_string[search_string_index] = '\0';
+	      break;
+	    }
+	}
+
+      found = failed = 0;
+      while (1)
+	{
+	  int limit = sline_len - search_string_index + 1;
+
+	  /* Search the current line. */
+	  while (reverse ? (line_index >= 0) : (line_index < limit))
+	    {
+	      if (STREQN(search_string, sline + line_index, search_string_index))
+		  {
+		    found++;
+		    break;
+		  }
+	      else
+		line_index += direction;
+	    }
+	  if (found)
+	    break;
+
+	  /* Move to the next line, but skip new copies of the line
+	     we just found and lines shorter than the string we're
+	     searching for. */
+	  do
+	    {
+	      /* Move to the next line. */
+	      i += direction;
+
+	      /* At limit for direction? */
+	      if (reverse ? (i < 0) : (i == hlen))
+		{
+		  failed++;
+		  break;
+		}
+
+	      /* We will need these later. */
+	      sline = lines[i];
+	      sline_len = strlen (sline);
+	    }
+	  while ((prev_line_found && STREQ (prev_line_found, lines[i])) ||
+		 (search_string_index > sline_len));
+
+	  if (failed)
+	    break;
+
+	  /* Now set up the line for searching... */
+	  if (reverse)
+	    line_index = sline_len - search_string_index;
+	  else
+	    line_index = 0;
+	}
+
+      if (failed)
+	{
+	  /* We cannot find the search string.  Ding the bell. */
+	  ding ();
+	  i = last_found_line;
+	  continue; 		/* XXX - was break */
+	}
+
+      /* We have found the search string.  Just display it.  But don't
+	 actually move there in the history list until the user accepts
+	 the location. */
+      if (found)
+	{
+	  int line_len;
+
+	  prev_line_found = lines[i];
+	  line_len = strlen (lines[i]);
+
+	  if (line_len >= rl_line_buffer_len)
+	    rl_extend_line_buffer (line_len);
+
+	  strcpy (rl_line_buffer, lines[i]);
+	  rl_point = line_index;
+	  rl_end = line_len;
+	  last_found_line = i;
+	  rl_display_search (search_string, reverse, (i == orig_line) ? -1 : i);
+	}
+    }
+
+  /* The searching is over.  The user may have found the string that she
+     was looking for, or else she may have exited a failing search.  If
+     LINE_INDEX is -1, then that shows that the string searched for was
+     not found.  We use this to determine where to place rl_point. */
+
+  /* First put back the original state. */
+  strcpy (rl_line_buffer, lines[orig_line]);
+
+  /* Free the search string. */
+  free (search_string);
+
+  if (last_found_line < orig_line)
+    rl_get_previous_history (orig_line - last_found_line);
+  else
+    rl_get_next_history (last_found_line - orig_line);
+
+  /* If the string was not found, put point at the end of the line. */
+  if (line_index < 0)
+    line_index = strlen (rl_line_buffer);
+  rl_point = line_index;
+  rl_clear_message ();
+
+  free (allocated_line);
+  free (lines);
+
+  return 0;
+}
diff --git a/keymaps.c b/keymaps.c
new file mode 100644
index 0000000..da59b69
--- /dev/null
+++ b/keymaps.c
@@ -0,0 +1,196 @@
+/* keymaps.c -- Functions and keymaps for the GNU Readline library. */
+
+/* Copyright (C) 1988,1989 Free Software Foundation, Inc.
+
+   This file is part of GNU Readline, a library for reading lines
+   of text with interactive input and history editing.
+
+   Readline is free software; you can redistribute it and/or modify it
+   under the terms of the GNU General Public License as published by the
+   Free Software Foundation; either version 1, or (at your option) any
+   later version.
+
+   Readline is distributed in the hope that it will be useful, but
+   WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   General Public License for more details.
+
+   You should have received a copy of the GNU General Public License
+   along with Readline; see the file COPYING.  If not, write to the Free
+   Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+#include "rlconf.h"
+#include "keymaps.h"
+#include "emacs_keymap.c"
+
+#if defined (VI_MODE)
+#include "vi_keymap.c"
+#endif
+
+extern int rl_do_lowercase_version ();
+extern int rl_rubout (), rl_insert ();
+
+#if defined (STATIC_MALLOC)
+static char *xmalloc (), *xrealloc ();
+#else
+extern char *xmalloc (), *xrealloc ();
+#endif /* STATIC_MALLOC */
+
+/* **************************************************************** */
+/*								    */
+/*		      Functions for manipulating Keymaps.	    */
+/*								    */
+/* **************************************************************** */
+
+
+/* Return a new, empty keymap.
+   Free it with free() when you are done. */
+Keymap
+rl_make_bare_keymap ()
+{
+  register int i;
+  Keymap keymap = (Keymap)xmalloc (KEYMAP_SIZE * sizeof (KEYMAP_ENTRY));
+
+  for (i = 0; i < KEYMAP_SIZE; i++)
+    {
+      keymap[i].type = ISFUNC;
+      keymap[i].function = (Function *)NULL;
+    }
+
+  for (i = 'A'; i < ('Z' + 1); i++)
+    {
+      keymap[i].type = ISFUNC;
+      keymap[i].function = rl_do_lowercase_version;
+    }
+
+  return (keymap);
+}
+
+/* Return a new keymap which is a copy of MAP. */
+Keymap
+rl_copy_keymap (map)
+     Keymap map;
+{
+  register int i;
+  Keymap temp = rl_make_bare_keymap ();
+
+  for (i = 0; i < KEYMAP_SIZE; i++)
+    {
+      temp[i].type = map[i].type;
+      temp[i].function = map[i].function;
+    }
+  return (temp);
+}
+
+/* Return a new keymap with the printing characters bound to rl_insert,
+   the uppercase Meta characters bound to run their lowercase equivalents,
+   and the Meta digits bound to produce numeric arguments. */
+Keymap
+rl_make_keymap ()
+{
+  register int i;
+  Keymap newmap;
+
+  newmap = rl_make_bare_keymap ();
+
+  /* All ASCII printing characters are self-inserting. */
+  for (i = ' '; i < 126; i++)
+    newmap[i].function = rl_insert;
+
+  newmap[TAB].function = rl_insert;
+  newmap[RUBOUT].function = rl_rubout;
+  newmap[CTRL('H')].function = rl_rubout;
+
+#if KEYMAP_SIZE > 128
+  /* Printing characters in some 8-bit character sets. */
+  for (i = 128; i < 160; i++)
+    newmap[i].function = rl_insert;
+
+  /* ISO Latin-1 printing characters should self-insert. */
+  for (i = 160; i < 256; i++)
+    newmap[i].function = rl_insert;
+#endif /* KEYMAP_SIZE > 128 */
+
+  return (newmap);
+}
+
+/* Free the storage associated with MAP. */
+void
+rl_discard_keymap (map)
+     Keymap (map);
+{
+  int i;
+
+  if (!map)
+    return;
+
+  for (i = 0; i < KEYMAP_SIZE; i++)
+    {
+      switch (map[i].type)
+	{
+	case ISFUNC:
+	  break;
+
+	case ISKMAP:
+	  rl_discard_keymap ((Keymap)map[i].function);
+	  break;
+
+	case ISMACR:
+	  free ((char *)map[i].function);
+	  break;
+	}
+    }
+}
+
+#if defined (STATIC_MALLOC)
+
+/* **************************************************************** */
+/*								    */
+/*			xmalloc and xrealloc ()		     	    */
+/*								    */
+/* **************************************************************** */
+
+static void memory_error_and_abort ();
+
+static char *
+xmalloc (bytes)
+     int bytes;
+{
+  char *temp = (char *)malloc (bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+  return (temp);
+}
+
+static char *
+xrealloc (pointer, bytes)
+     char *pointer;
+     int bytes;
+{
+  char *temp;
+
+  if (!pointer)
+    temp = (char *)malloc (bytes);
+  else
+    temp = (char *)realloc (pointer, bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+  return (temp);
+}
+
+static void
+memory_error_and_abort ()
+{
+  fprintf (stderr, "readline: Out of virtual memory!\n");
+  abort ();
+}
+#endif /* STATIC_MALLOC */
diff --git a/keymaps.h b/keymaps.h
new file mode 100644
index 0000000..f0eda3d
--- /dev/null
+++ b/keymaps.h
@@ -0,0 +1,95 @@
+/* keymaps.h -- Manipulation of readline keymaps. */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#ifndef _KEYMAPS_H_
+#define _KEYMAPS_H_
+
+#if defined (READLINE_LIBRARY)
+#  include "chardefs.h"
+#else
+#  include <readline/chardefs.h>
+#endif
+
+#if !defined (__FUNCTION_DEF)
+#  define __FUNCTION_DEF
+typedef int Function ();
+typedef void VFunction ();
+typedef char *CPFunction ();
+typedef char **CPPFunction ();
+#endif
+
+/* A keymap contains one entry for each key in the ASCII set.
+   Each entry consists of a type and a pointer.
+   POINTER is the address of a function to run, or the
+   address of a keymap to indirect through.
+   TYPE says which kind of thing POINTER is. */
+typedef struct _keymap_entry {
+  char type;
+  Function *function;
+} KEYMAP_ENTRY;
+
+/* This must be large enough to hold bindings for all of the characters
+   in a desired character set (e.g, 128 for ASCII, 256 for ISO Latin-x,
+   and so on). */
+#define KEYMAP_SIZE 256
+
+/* I wanted to make the above structure contain a union of:
+   union { Function *function; struct _keymap_entry *keymap; } value;
+   but this made it impossible for me to create a static array.
+   Maybe I need C lessons. */
+
+typedef KEYMAP_ENTRY KEYMAP_ENTRY_ARRAY[KEYMAP_SIZE];
+typedef KEYMAP_ENTRY *Keymap;
+
+/* The values that TYPE can have in a keymap entry. */
+#define ISFUNC 0
+#define ISKMAP 1
+#define ISMACR 2
+
+extern KEYMAP_ENTRY_ARRAY emacs_standard_keymap, emacs_meta_keymap, emacs_ctlx_keymap;
+extern KEYMAP_ENTRY_ARRAY vi_insertion_keymap, vi_movement_keymap;
+
+/* Return a new, empty keymap.
+   Free it with free() when you are done. */
+extern Keymap rl_make_bare_keymap ();
+
+/* Return a new keymap which is a copy of MAP. */
+extern Keymap rl_copy_keymap ();
+
+/* Return a new keymap with the printing characters bound to rl_insert,
+   the lowercase Meta characters bound to run their equivalents, and
+   the Meta digits bound to produce numeric arguments. */
+extern Keymap rl_make_keymap ();
+
+extern void rl_discard_keymap ();
+
+/* Return the keymap corresponding to a given name.  Names look like
+   `emacs' or `emacs-meta' or `vi-insert'. */
+extern Keymap rl_get_keymap_by_name ();
+
+/* Return the current keymap. */
+extern Keymap rl_get_keymap ();
+
+/* Set the current keymap to MAP. */
+extern void rl_set_keymap ();
+
+#endif /* _KEYMAPS_H_ */
diff --git a/memalloc.h b/memalloc.h
new file mode 100644
index 0000000..750d53d
--- /dev/null
+++ b/memalloc.h
@@ -0,0 +1,56 @@
+/* memalloc.h -- consolidate code for including alloca.h or malloc.h and
+   defining alloca. */
+
+/* Copyright (C) 1993 Free Software Foundation, Inc.
+
+   This file is part of GNU Bash, the Bourne Again SHell.
+
+   Bash is free software; you can redistribute it and/or modify it under
+   the terms of the GNU General Public License as published by the Free
+   Software Foundation; either version 2, or (at your option) any later
+   version.
+
+   Bash is distributed in the hope that it will be useful, but WITHOUT ANY
+   WARRANTY; without even the implied warranty of MERCHANTABILITY or
+   FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+   for more details.
+
+   You should have received a copy of the GNU General Public License along
+   with Bash; see the file COPYING.  If not, write to the Free Software
+   Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#if !defined (__MEMALLOC_H__)
+#  define __MEMALLOC_H__
+
+#if defined (sparc) && defined (sun) && !defined (HAVE_ALLOCA_H)
+#  define HAVE_ALLOCA_H
+#endif
+
+#if defined (__GNUC__) && !defined (HAVE_ALLOCA)
+#  define HAVE_ALLOCA
+#endif
+
+#if defined (HAVE_ALLOCA_H) && !defined (HAVE_ALLOCA)
+#  define HAVE_ALLOCA
+#endif /* HAVE_ALLOCA_H && !HAVE_ALLOCA */
+
+#if !defined (BUILDING_MAKEFILE)
+
+#if defined (__GNUC__)
+#  undef alloca
+#  define alloca __builtin_alloca
+#else /* !__GNUC__ */
+#  if defined (HAVE_ALLOCA_H)
+#    if defined (IBMESA)
+#      include <malloc.h>
+#    else /* !IBMESA */
+#      include <alloca.h>
+#    endif /* !IBMESA */
+#  else
+extern char *alloca ();
+#  endif /* !HAVE_ALLOCA_H */
+#endif /* !__GNUC__ */
+
+#endif /* !BUILDING_MAKEFILE */
+
+#endif /* __MEMALLOC_H__ */
diff --git a/parens.c b/parens.c
new file mode 100644
index 0000000..57a9777
--- /dev/null
+++ b/parens.c
@@ -0,0 +1,130 @@
+/* parens.c -- Implemenation of matching parenthesis feature. */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#include "rlconf.h"
+
+#if !defined (PAREN_MATCHING)
+
+rl_insert_close (count, invoking_key)
+     int count, invoking_key;
+{
+  return (rl_insert (count, invoking_key));
+}
+
+#else /* PAREN_MATCHING */
+
+#include <stdio.h>
+#include <sys/types.h>
+#if defined (FD_SET)
+#  include <sys/time.h>
+#endif /* FD_SET */
+#include "readline.h"
+
+extern int rl_explicit_arg;
+
+/* Non-zero means try to blink the matching open parenthesis when the
+   close parenthesis is inserted. */
+#if defined (FD_SET)
+int rl_blink_matching_paren = 1;
+#else /* !FD_SET */
+int rl_blink_matching_paren = 0;
+#endif /* !FD_SET */
+
+static int find_matching_open ();
+
+rl_insert_close (count, invoking_key)
+     int count, invoking_key;
+{
+  if (rl_explicit_arg || !rl_blink_matching_paren)
+    rl_insert (count, invoking_key);
+  else
+    {
+#if defined (FD_SET)
+      int orig_point, match_point, ready;
+      struct timeval timer;
+      fd_set readfds;
+
+      rl_insert (1, invoking_key);
+      rl_redisplay ();
+      match_point =
+	find_matching_open (rl_line_buffer, rl_point - 2, invoking_key);
+
+      /* Emacs might message or ring the bell here, but I don't. */
+      if (match_point < 0)
+	return -1;
+
+      FD_ZERO (&readfds);
+      FD_SET (fileno (rl_instream), &readfds);
+      timer.tv_sec = 1;
+      timer.tv_usec = 500;
+
+      orig_point = rl_point;
+      rl_point = match_point;
+      rl_redisplay ();
+      ready = select (1, &readfds, (fd_set *)NULL, (fd_set *)NULL, &timer);
+      rl_point = orig_point;
+#else /* !FD_SET */
+      rl_insert (count, invoking_key);
+#endif /* !FD_SET */
+    }
+  return 0;
+}
+
+static int
+find_matching_open (string, from, closer)
+     char *string;
+     int from, closer;
+{
+  register int i;
+  int opener, level, delimiter;
+
+  switch (closer)
+    {
+    case ']': opener = '['; break;
+    case '}': opener = '{'; break;
+    case ')': opener = '('; break;
+    default:
+      return (-1);
+    }
+
+  level = 1;			/* The closer passed in counts as 1. */
+  delimiter = 0;		/* Delimited state unknown. */
+
+  for (i = from; i > -1; i--)
+    {
+      if (delimiter && (string[i] == delimiter))
+	delimiter = 0;
+      else if ((string[i] == '\'') || (string[i] == '"'))
+	delimiter = rl_line_buffer[i];
+      else if (!delimiter && (string[i] == closer))
+	level++;
+      else if (!delimiter && (string[i] == opener))
+	level--;
+
+      if (!level)
+	break;
+    }
+  return (i);
+}
+
+#endif /* PAREN_MATCHING */
diff --git a/posixstat.h b/posixstat.h
new file mode 100644
index 0000000..7d1cece
--- /dev/null
+++ b/posixstat.h
@@ -0,0 +1,149 @@
+/* posixstat.h -- Posix stat(2) definitions for systems that
+   don't have them. */
+
+/* Copyright (C) 1987,1991 Free Software Foundation, Inc.
+
+   This file is part of GNU Bash, the Bourne Again SHell.
+
+   Bash is free software; you can redistribute it and/or modify it
+   under the terms of the GNU General Public License as published by
+   the Free Software Foundation; either version 1, or (at your option)
+   any later version.
+
+   Bash is distributed in the hope that it will be useful, but WITHOUT
+   ANY WARRANTY; without even the implied warranty of MERCHANTABILITY
+   or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public
+   License for more details.
+
+   You should have received a copy of the GNU General Public License
+   along with Bash; see the file COPYING.  If not, write to the Free
+   Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+/* This file should be included instead of <sys/stat.h>.
+   It relies on the local sys/stat.h to work though. */
+#if !defined (_POSIXSTAT_H)
+#define _POSIXSTAT_H
+
+#include <sys/stat.h>
+
+#if defined (isc386)
+#  if !defined (S_IFDIR)
+#    define S_IFDIR 0040000
+#  endif /* !S_IFDIR */
+#  if !defined (S_IFMT)
+#    define S_IFMT  0170000
+#  endif /* !S_IFMT */
+#endif /* isc386 */
+
+/* This text is taken directly from the Cadmus I was trying to
+   compile on:
+    the following MACROs are defined for X/OPEN compatibility
+    however, is the param correct ??
+   #define S_ISBLK(s) ((s.st_mode & S_IFMT) == S_IFBLK)
+
+  Well, the answer is no.  Thus... */
+#if defined (BrainDeath)
+#  undef S_ISBLK
+#  undef S_ISCHR
+#  undef S_ISDIR
+#  undef S_ISFIFO
+#  undef S_ISREG
+#endif /* BrainDeath */
+
+/* Posix 1003.1 5.6.1.1 <sys/stat.h> file types */
+
+/* Some Posix-wannabe systems define _S_IF* macros instead of S_IF*, but
+   do not provide the S_IS* macros that Posix requires. */
+
+#if defined (_S_IFMT) && !defined (S_IFMT)
+#define S_IFMT _S_IFMT
+#endif
+#if defined (_S_IFIFO) && !defined (S_IFIFO)
+#define S_IFIFO _S_IFIFO
+#endif
+#if defined (_S_IFCHR) && !defined (S_IFCHR)
+#define S_IFCHR _S_IFCHR
+#endif
+#if defined (_S_IFDIR) && !defined (S_IFDIR)
+#define S_IFDIR _S_IFDIR
+#endif
+#if defined (_S_IFBLK) && !defined (S_IFBLK)
+#define S_IFBLK _S_IFBLK
+#endif
+#if defined (_S_IFREG) && !defined (S_IFREG)
+#define S_IFREG _S_IFREG
+#endif
+#if defined (_S_IFLNK) && !defined (S_IFLNK)
+#define S_IFLNK _S_IFLNK
+#endif
+#if defined (_S_IFSOCK) && !defined (S_IFSOCK)
+#define S_IFSOCK _S_IFSOCK
+#endif
+
+/* Test for each symbol individually and define the ones necessary (some
+   systems claiming Posix compatibility define some but not all). */
+
+#if defined (S_IFBLK) && !defined (S_ISBLK)
+#define	S_ISBLK(m)	(((m)&S_IFMT) == S_IFBLK)	/* block device */
+#endif
+
+#if defined (S_IFCHR) && !defined (S_ISCHR)
+#define	S_ISCHR(m)	(((m)&S_IFMT) == S_IFCHR)	/* character device */
+#endif
+
+#if defined (S_IFDIR) && !defined (S_ISDIR)
+#define	S_ISDIR(m)	(((m)&S_IFMT) == S_IFDIR)	/* directory */
+#endif
+
+#if defined (S_IFREG) && !defined (S_ISREG)
+#define	S_ISREG(m)	(((m)&S_IFMT) == S_IFREG)	/* file */
+#endif
+
+#if defined (S_IFIFO) && !defined (S_ISFIFO)
+#define	S_ISFIFO(m)	(((m)&S_IFMT) == S_IFIFO)	/* fifo - named pipe */
+#endif
+
+#if defined (S_IFLNK) && !defined (S_ISLNK)
+#define	S_ISLNK(m)	(((m)&S_IFMT) == S_IFLNK)	/* symbolic link */
+#endif
+
+#if defined (S_IFSOCK) && !defined (S_ISSOCK)
+#define	S_ISSOCK(m)	(((m)&S_IFMT) == S_IFSOCK)	/* socket */
+#endif
+
+/*
+ * POSIX 1003.1 5.6.1.2 <sys/stat.h> File Modes
+ */
+ 
+#if !defined (S_IRWXU)
+#  if !defined (S_IREAD)
+#    define S_IREAD	00400
+#    define S_IWRITE	00200
+#    define S_IEXEC	00100
+#  endif /* S_IREAD */
+
+#  if !defined (S_IRUSR)
+#    define S_IRUSR	S_IREAD			/* read, owner */
+#    define S_IWUSR	S_IWRITE		/* write, owner */
+#    define S_IXUSR	S_IEXEC			/* execute, owner */
+
+#    define S_IRGRP	(S_IREAD  >> 3)		/* read, group */
+#    define S_IWGRP	(S_IWRITE >> 3)		/* write, group */
+#    define S_IXGRP	(S_IEXEC  >> 3)		/* execute, group */
+
+#    define S_IROTH	(S_IREAD  >> 6)		/* read, other */
+#    define S_IWOTH	(S_IWRITE >> 6)		/* write, other */
+#    define S_IXOTH	(S_IEXEC  >> 6)		/* execute, other */
+#  endif /* !S_IRUSR */
+
+#  define S_IRWXU	(S_IRUSR | S_IWUSR | S_IXUSR)
+#  define S_IRWXG	(S_IRGRP | S_IWGRP | S_IXGRP)
+#  define S_IRWXO	(S_IROTH | S_IWOTH | S_IXOTH)
+#endif /* !S_IRWXU */
+
+/* These are non-standard, but are used in builtins.c$symbolic_umask() */
+#define S_IRUGO		(S_IRUSR | S_IRGRP | S_IROTH)
+#define S_IWUGO		(S_IWUSR | S_IWGRP | S_IWOTH)
+#define S_IXUGO		(S_IXUSR | S_IXGRP | S_IXOTH)
+
+#endif /* _POSIXSTAT_H */
diff --git a/readline.c b/readline.c
new file mode 100644
index 0000000..e15a037
--- /dev/null
+++ b/readline.c
@@ -0,0 +1,3527 @@
+/* readline.c -- a general facility for reading lines of input
+   with emacs style editing and completion. */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#include <stdio.h>
+#include <sys/types.h>
+#include <fcntl.h>
+#if !defined (NO_SYS_FILE)
+#  include <sys/file.h>
+#endif /* !NO_SYS_FILE */
+#include <signal.h>
+
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif /* HAVE_UNISTD_H */
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+#include <errno.h>
+/* Not all systems declare ERRNO in errno.h... and some systems #define it! */
+#if !defined (errno)
+extern int errno;
+#endif /* !errno */
+
+#include <setjmp.h>
+
+#include "posixstat.h"
+
+/* System-specific feature definitions and include files. */
+#include "rldefs.h"
+
+#if defined (GWINSZ_IN_SYS_IOCTL) || (defined (VSTATUS) && !defined (SunOS4))
+#  include <sys/ioctl.h>
+#endif /* GWINSZ_IN_SYS_IOCTL || VSTATUS */
+
+/* Some standard library routines. */
+#include "readline.h"
+#include "history.h"
+
+/* NOTE: Functions and variables prefixed with `_rl_' are
+   pseudo-global: they are global so they can be shared
+   between files in the readline library, but are not intended
+   to be visible to readline callers. */
+
+/* Functions imported from other files in the library. */
+extern char *tgetstr ();
+extern void rl_prep_terminal (), rl_deprep_terminal ();
+
+extern void _rl_bind_if_unbound ();
+
+/* External redisplay functions and variables from display.c */
+extern void _rl_move_vert ();
+extern void _rl_update_final ();
+
+extern void _rl_erase_at_end_of_line ();
+extern void _rl_move_cursor_relative ();
+
+extern int _rl_vis_botlin;
+extern int _rl_last_c_pos;
+extern int _rl_horizontal_scroll_mode;
+extern int rl_display_fixed;
+extern char *rl_display_prompt;
+
+/* Variables imported from complete.c. */
+extern char *rl_completer_word_break_characters;
+extern char *rl_basic_word_break_characters;
+extern int rl_completion_query_items;
+extern int rl_complete_with_tilde_expansion;
+
+#if defined (VI_MODE)
+extern void _rl_vi_set_last ();
+extern void _rl_vi_reset_last ();
+extern void _rl_vi_done_inserting ();
+#endif /* VI_MODE */
+
+/* Forward declarations used in this file. */
+void _rl_free_history_entry ();
+
+int _rl_dispatch ();
+void _rl_set_screen_size ();
+int _rl_output_character_function ();
+
+static char *readline_internal ();
+static void readline_initialize_everything ();
+static int init_terminal_io ();
+static void start_using_history ();
+static void bind_arrow_keys ();
+
+#if !defined (__GO32__)
+static void readline_default_bindings ();
+#endif /* !__GO32__ */
+
+#if defined (__GO32__)
+#  include <sys/pc.h>
+#  undef HANDLE_SIGNALS
+#endif /* __GO32__ */
+
+#if defined (STATIC_MALLOC)
+static char *xmalloc (), *xrealloc ();
+#else
+extern char *xmalloc (), *xrealloc ();
+#endif /* STATIC_MALLOC */
+
+
+/* **************************************************************** */
+/*								    */
+/*			Line editing input utility		    */
+/*								    */
+/* **************************************************************** */
+
+static char *LibraryVersion = "2.0";
+
+/* A pointer to the keymap that is currently in use.
+   By default, it is the standard emacs keymap. */
+Keymap _rl_keymap = emacs_standard_keymap;
+
+/* The current style of editing. */
+int rl_editing_mode = emacs_mode;
+
+/* Non-zero if the previous command was a kill command. */
+static int last_command_was_kill = 0;
+
+/* The current value of the numeric argument specified by the user. */
+int rl_numeric_arg = 1;
+
+/* Non-zero if an argument was typed. */
+int rl_explicit_arg = 0;
+
+/* Temporary value used while generating the argument. */
+int rl_arg_sign = 1;
+
+/* Non-zero means we have been called at least once before. */
+static int rl_initialized = 0;
+
+/* If non-zero, this program is running in an EMACS buffer. */
+static int running_in_emacs = 0;
+
+/* The current offset in the current input line. */
+int rl_point;
+
+/* Mark in the current input line. */
+int rl_mark;
+
+/* Length of the current input line. */
+int rl_end;
+
+/* Make this non-zero to return the current input_line. */
+int rl_done;
+
+/* The last function executed by readline. */
+Function *rl_last_func = (Function *)NULL;
+
+/* Top level environment for readline_internal (). */
+static jmp_buf readline_top_level;
+
+/* The streams we interact with. */
+static FILE *in_stream, *out_stream;
+
+/* The names of the streams that we do input and output to. */
+FILE *rl_instream = (FILE *)NULL;
+FILE *rl_outstream = (FILE *)NULL;
+
+/* Non-zero means echo characters as they are read. */
+int readline_echoing_p = 1;
+
+/* Current prompt. */
+char *rl_prompt;
+int rl_visible_prompt_length = 0;
+
+/* The number of characters read in order to type this complete command. */
+int rl_key_sequence_length = 0;
+
+/* If non-zero, then this is the address of a function to call just
+   before readline_internal () prints the first prompt. */
+Function *rl_startup_hook = (Function *)NULL;
+
+/* What we use internally.  You should always refer to RL_LINE_BUFFER. */
+static char *the_line;
+
+/* The character that can generate an EOF.  Really read from
+   the terminal driver... just defaulted here. */
+int _rl_eof_char = CTRL ('D');
+
+/* Non-zero makes this the next keystroke to read. */
+int rl_pending_input = 0;
+
+/* Pointer to a useful terminal name. */
+char *rl_terminal_name = (char *)NULL;
+
+/* Non-zero means to always use horizontal scrolling in line display. */
+int _rl_horizontal_scroll_mode = 0;
+
+/* Non-zero means to display an asterisk at the starts of history lines
+   which have been modified. */
+int _rl_mark_modified_lines = 0;  
+
+/* The style of `bell' notification preferred.  This can be set to NO_BELL,
+   AUDIBLE_BELL, or VISIBLE_BELL. */
+int _rl_bell_preference = AUDIBLE_BELL;
+     
+/* Line buffer and maintenence. */
+char *rl_line_buffer = (char *)NULL;
+int rl_line_buffer_len = 0;
+#define DEFAULT_BUFFER_SIZE 256
+
+/* Forward declarations used by the display and termcap code. */
+int term_xn;
+int screenwidth, screenheight, screenchars;
+
+
+/* **************************************************************** */
+/*								    */
+/*			`Forward' declarations  		    */
+/*								    */
+/* **************************************************************** */
+
+/* Non-zero means do not parse any lines other than comments and
+   parser directives. */
+unsigned char _rl_parsing_conditionalized_out = 0;
+
+/* Non-zero means to save keys that we dispatch on in a kbd macro. */
+static int defining_kbd_macro = 0;
+
+/* Non-zero means to convert characters with the meta bit set to
+   escape-prefixed characters so we can indirect through
+   emacs_meta_keymap or vi_escape_keymap. */
+int _rl_convert_meta_chars_to_ascii = 1;
+
+/* Non-zero means to output characters with the meta bit set directly
+   rather than as a meta-prefixed escape sequence. */
+int _rl_output_meta_chars = 0;
+
+/* Non-zero tells rl_delete_text and rl_insert_text to not add to
+   the undo list. */
+static int doing_an_undo = 0;
+
+/* **************************************************************** */
+/*								    */
+/*			Top Level Functions			    */
+/*								    */
+/* **************************************************************** */
+
+/* Non-zero means treat 0200 bit in terminal input as Meta bit. */
+int _rl_meta_flag = 0;	/* Forward declaration */
+
+/* Read a line of input.  Prompt with PROMPT.  A NULL PROMPT means
+   none.  A return value of NULL means that EOF was encountered. */
+char *
+readline (prompt)
+     char *prompt;
+{
+  char *value;
+
+  rl_prompt = prompt;
+
+  /* If we are at EOF return a NULL string. */
+  if (rl_pending_input == EOF)
+    {
+      rl_pending_input = 0;
+      return ((char *)NULL);
+    }
+
+  rl_visible_prompt_length = rl_expand_prompt (rl_prompt);
+
+  rl_initialize ();
+  rl_prep_terminal (_rl_meta_flag);
+
+#if defined (HANDLE_SIGNALS)
+  rl_set_signals ();
+#endif
+
+  value = readline_internal ();
+  rl_deprep_terminal ();
+
+#if defined (HANDLE_SIGNALS)
+  rl_clear_signals ();
+#endif
+
+  return (value);
+}
+
+/* Read a line of input from the global rl_instream, doing output on
+   the global rl_outstream.
+   If rl_prompt is non-null, then that is our prompt. */
+static char *
+readline_internal ()
+{
+  int lastc, c, eof_found;
+
+  in_stream  = rl_instream;
+  out_stream = rl_outstream;
+
+  lastc = -1;
+  eof_found = 0;
+
+  if (rl_startup_hook)
+    (*rl_startup_hook) ();
+
+  if (!readline_echoing_p)
+    {
+      if (rl_prompt)
+	{
+	  fprintf (out_stream, "%s", rl_prompt);
+	  fflush (out_stream);
+	}
+    }
+  else
+    {
+      rl_on_new_line ();
+      rl_redisplay ();
+#if defined (VI_MODE)
+      if (rl_editing_mode == vi_mode)
+	rl_vi_insertion_mode ();
+#endif /* VI_MODE */
+    }
+
+  while (!rl_done)
+    {
+      int lk = last_command_was_kill;
+      int code;
+
+      code = setjmp (readline_top_level);
+
+      if (code)
+	rl_redisplay ();
+
+      if (!rl_pending_input)
+	{
+	  /* Then initialize the argument and number of keys read. */
+	  rl_init_argument ();
+	  rl_key_sequence_length = 0;
+	}
+
+      c = rl_read_key ();
+
+      /* EOF typed to a non-blank line is a <NL>. */
+      if (c == EOF && rl_end)
+	c = NEWLINE;
+
+      /* The character _rl_eof_char typed to blank line, and not as the
+	 previous character is interpreted as EOF. */
+      if (((c == _rl_eof_char && lastc != c) || c == EOF) && !rl_end)
+	{
+	  eof_found = 1;
+	  break;
+	}
+
+      lastc = c;
+      _rl_dispatch (c, _rl_keymap);
+
+      /* If there was no change in last_command_was_kill, then no kill
+	 has taken place.  Note that if input is pending we are reading
+	 a prefix command, so nothing has changed yet. */
+      if (!rl_pending_input)
+	{
+	  if (lk == last_command_was_kill)
+	    last_command_was_kill = 0;
+	}
+
+#if defined (VI_MODE)
+      /* In vi mode, when you exit insert mode, the cursor moves back
+	 over the previous character.  We explicitly check for that here. */
+      if (rl_editing_mode == vi_mode && _rl_keymap == vi_movement_keymap)
+	rl_vi_check ();
+#endif /* VI_MODE */
+
+      if (!rl_done)
+	rl_redisplay ();
+    }
+
+  /* Restore the original of this history line, iff the line that we
+     are editing was originally in the history, AND the line has changed. */
+  {
+    HIST_ENTRY *entry = current_history ();
+
+    if (entry && rl_undo_list)
+      {
+	char *temp = savestring (the_line);
+	rl_revert_line ();
+	entry = replace_history_entry (where_history (), the_line,
+				       (HIST_ENTRY *)NULL);
+	_rl_free_history_entry (entry);
+
+	strcpy (the_line, temp);
+	free (temp);
+      }
+  }
+
+  /* At any rate, it is highly likely that this line has an undo list.  Get
+     rid of it now. */
+  if (rl_undo_list)
+    free_undo_list ();
+
+  if (eof_found)
+    return (char *)NULL;
+  else
+    return (savestring (the_line));
+}
+
+/* **************************************************************** */
+/*								    */
+/*			Character Input Buffering       	    */
+/*								    */
+/* **************************************************************** */
+
+static int pop_index = 0, push_index = 0, ibuffer_len = 511;
+static unsigned char ibuffer[512];
+
+/* Non-null means it is a pointer to a function to run while waiting for
+   character input. */
+Function *rl_event_hook = (Function *)NULL;
+
+#define any_typein (push_index != pop_index)
+
+/* Add KEY to the buffer of characters to be read. */
+rl_stuff_char (key)
+     int key;
+{
+  if (key == EOF)
+    {
+      key = NEWLINE;
+      rl_pending_input = EOF;
+    }
+  ibuffer[push_index++] = key;
+  if (push_index >= ibuffer_len)
+    push_index = 0;
+  return push_index;
+}
+
+/* Return the amount of space available in the
+   buffer for stuffing characters. */
+int
+ibuffer_space ()
+{
+  if (pop_index > push_index)
+    return (pop_index - push_index);
+  else
+    return (ibuffer_len - (push_index - pop_index));
+}
+
+/* Get a key from the buffer of characters to be read.
+   Return the key in KEY.
+   Result is KEY if there was a key, or 0 if there wasn't. */
+int
+rl_get_char (key)
+     int *key;
+{
+  if (push_index == pop_index)
+    return (0);
+
+  *key = ibuffer[pop_index++];
+
+  if (pop_index >= ibuffer_len)
+    pop_index = 0;
+
+  return (1);
+}
+
+/* Stuff KEY into the *front* of the input buffer.
+   Returns non-zero if successful, zero if there is
+   no space left in the buffer. */
+int
+rl_unget_char (key)
+     int key;
+{
+  if (ibuffer_space ())
+    {
+      pop_index--;
+      if (pop_index < 0)
+	pop_index = ibuffer_len - 1;
+      ibuffer[pop_index] = key;
+      return (1);
+    }
+  return (0);
+}
+
+/* If a character is available to be read, then read it
+   and stuff it into IBUFFER.  Otherwise, just return. */
+void
+rl_gather_tyi ()
+{
+#if defined (__GO32__)
+  char input;
+
+  if (isatty (0))
+    {
+      int i = rl_getc ();
+
+      if (i != EOF)
+	rl_stuff_char (i);
+    }
+  else if (kbhit () && ibuffer_space ())
+    rl_stuff_char (getkey ());
+#else /* !__GO32__ */
+
+  int tty = fileno (in_stream);
+  register int tem, result = -1;
+  int chars_avail;
+  char input;
+
+#if defined (FIONREAD)
+  result = ioctl (tty, FIONREAD, &chars_avail);
+#endif
+
+#if defined (O_NDELAY)
+  if (result == -1)
+    {
+      int flags;
+
+      flags = fcntl (tty, F_GETFL, 0);
+
+      fcntl (tty, F_SETFL, (flags | O_NDELAY));
+      chars_avail = read (tty, &input, 1);
+
+      fcntl (tty, F_SETFL, flags);
+      if (chars_avail == -1 && errno == EAGAIN)
+	return;
+    }
+#endif /* O_NDELAY */
+
+  /* If there's nothing available, don't waste time trying to read
+     something. */
+  if (chars_avail == 0)
+    return;
+
+  tem = ibuffer_space ();
+
+  if (chars_avail > tem)
+    chars_avail = tem;
+
+  /* One cannot read all of the available input.  I can only read a single
+     character at a time, or else programs which require input can be
+     thwarted.  If the buffer is larger than one character, I lose.
+     Damn! */
+  if (tem < ibuffer_len)
+    chars_avail = 0;
+
+  if (result != -1)
+    {
+      while (chars_avail--)
+	rl_stuff_char (rl_getc (in_stream));
+    }
+  else
+    {
+      if (chars_avail)
+	rl_stuff_char (input);
+    }
+#endif /* !__GO32__ */
+}
+
+static int next_macro_key ();
+/* Read a key, including pending input. */
+int
+rl_read_key ()
+{
+  int c;
+
+  rl_key_sequence_length++;
+
+  if (rl_pending_input)
+    {
+      c = rl_pending_input;
+      rl_pending_input = 0;
+    }
+  else
+    {
+      /* If input is coming from a macro, then use that. */
+      if (c = next_macro_key ())
+	return (c);
+
+      /* If the user has an event function, then call it periodically. */
+      if (rl_event_hook)
+	{
+	  while (rl_event_hook && !rl_get_char (&c))
+	    {
+	      (*rl_event_hook) ();
+	      rl_gather_tyi ();
+	    }
+	}
+      else
+	{
+	  if (!rl_get_char (&c))
+	    c = rl_getc (in_stream);
+	}
+    }
+
+  return (c);
+}
+
+/* Found later in this file. */
+static void add_macro_char (), with_macro_input ();
+
+/* Do the command associated with KEY in MAP.
+   If the associated command is really a keymap, then read
+   another key, and dispatch into that map. */
+int
+_rl_dispatch (key, map)
+     register int key;
+     Keymap map;
+{
+  int r = 0;
+
+  if (defining_kbd_macro)
+    add_macro_char (key);
+
+  if (META_CHAR (key) && _rl_convert_meta_chars_to_ascii)
+    {
+      if (map[ESC].type == ISKMAP)
+	{
+	  map = FUNCTION_TO_KEYMAP (map, ESC);
+	  key = UNMETA (key);
+	  rl_key_sequence_length += 2;
+	  return (_rl_dispatch (key, map));
+	}
+      else
+	ding ();
+      return 0;
+    }
+
+  switch (map[key].type)
+    {
+    case ISFUNC:
+      {
+	Function *func = map[key].function;
+
+	if (func != (Function *)NULL)
+	  {
+	    /* Special case rl_do_lowercase_version (). */
+	    if (func == rl_do_lowercase_version)
+	      return (_rl_dispatch (to_lower (key), map));
+
+	    r = (*map[key].function)(rl_numeric_arg * rl_arg_sign, key);
+
+	    /* If we have input pending, then the last command was a prefix
+	       command.  Don't change the state of rl_last_func.  Otherwise,
+	       remember the last command executed in this variable. */
+	    if (!rl_pending_input)
+	      rl_last_func = map[key].function;
+	  }
+	else
+	  {
+	    rl_abort ();
+	    return -1;
+	  }
+      }
+      break;
+
+    case ISKMAP:
+      if (map[key].function != (Function *)NULL)
+	{
+	  int newkey;
+
+	  rl_key_sequence_length++;
+	  newkey = rl_read_key ();
+	  r = _rl_dispatch (newkey, FUNCTION_TO_KEYMAP (map, key));
+	}
+      else
+	{
+	  rl_abort ();
+	  return -1;
+	}
+      break;
+
+    case ISMACR:
+      if (map[key].function != (Function *)NULL)
+	{
+	  char *macro;
+
+	  macro = savestring ((char *)map[key].function);
+	  with_macro_input (macro);
+	  return 0;
+	}
+      break;
+    }
+#if defined (VI_MODE)
+  if (rl_editing_mode == vi_mode && _rl_keymap == vi_movement_keymap &&
+      rl_vi_textmod_command (key))
+    _rl_vi_set_last (key, rl_numeric_arg, rl_arg_sign);
+#endif
+  return (r);
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			Hacking Keyboard Macros 		    */
+/*								    */
+/* **************************************************************** */
+
+/* The currently executing macro string.  If this is non-zero,
+   then it is a malloc ()'ed string where input is coming from. */
+static char *executing_macro = (char *)NULL;
+
+/* The offset in the above string to the next character to be read. */
+static int executing_macro_index = 0;
+
+/* The current macro string being built.  Characters get stuffed
+   in here by add_macro_char (). */
+static char *current_macro = (char *)NULL;
+
+/* The size of the buffer allocated to current_macro. */
+static int current_macro_size = 0;
+
+/* The index at which characters are being added to current_macro. */
+static int current_macro_index = 0;
+
+/* A structure used to save nested macro strings.
+   It is a linked list of string/index for each saved macro. */
+struct saved_macro {
+  struct saved_macro *next;
+  char *string;
+  int sindex;
+};
+
+/* The list of saved macros. */
+struct saved_macro *macro_list = (struct saved_macro *)NULL;
+
+/* Forward declarations of static functions.  Thank you C. */
+static void push_executing_macro (), pop_executing_macro ();
+
+/* This one has to be declared earlier in the file. */
+/* static void add_macro_char (); */
+
+/* Set up to read subsequent input from STRING.
+   STRING is free ()'ed when we are done with it. */
+static void
+with_macro_input (string)
+     char *string;
+{
+  push_executing_macro ();
+  executing_macro = string;
+  executing_macro_index = 0;
+}
+
+/* Return the next character available from a macro, or 0 if
+   there are no macro characters. */
+static int
+next_macro_key ()
+{
+  if (!executing_macro)
+    return (0);
+
+  if (!executing_macro[executing_macro_index])
+    {
+      pop_executing_macro ();
+      return (next_macro_key ());
+    }
+
+  return (executing_macro[executing_macro_index++]);
+}
+
+/* Save the currently executing macro on a stack of saved macros. */
+static void
+push_executing_macro ()
+{
+  struct saved_macro *saver;
+
+  saver = (struct saved_macro *)xmalloc (sizeof (struct saved_macro));
+  saver->next = macro_list;
+  saver->sindex = executing_macro_index;
+  saver->string = executing_macro;
+
+  macro_list = saver;
+}
+
+/* Discard the current macro, replacing it with the one
+   on the top of the stack of saved macros. */
+static void
+pop_executing_macro ()
+{
+  if (executing_macro)
+    free (executing_macro);
+
+  executing_macro = (char *)NULL;
+  executing_macro_index = 0;
+
+  if (macro_list)
+    {
+      struct saved_macro *disposer = macro_list;
+      executing_macro = macro_list->string;
+      executing_macro_index = macro_list->sindex;
+      macro_list = macro_list->next;
+      free (disposer);
+    }
+}
+
+/* Add a character to the macro being built. */
+static void
+add_macro_char (c)
+     int c;
+{
+  if (current_macro_index + 1 >= current_macro_size)
+    {
+      if (!current_macro)
+	current_macro = xmalloc (current_macro_size = 25);
+      else
+	current_macro = xrealloc (current_macro, current_macro_size += 25);
+    }
+
+  current_macro[current_macro_index++] = c;
+  current_macro[current_macro_index] = '\0';
+}
+
+/* Begin defining a keyboard macro.
+   Keystrokes are recorded as they are executed.
+   End the definition with rl_end_kbd_macro ().
+   If a numeric argument was explicitly typed, then append this
+   definition to the end of the existing macro, and start by
+   re-executing the existing macro. */
+rl_start_kbd_macro (ignore1, ignore2)
+     int ignore1, ignore2;
+{
+  if (defining_kbd_macro)
+    {
+      rl_abort ();
+      return -1;
+    }
+
+  if (rl_explicit_arg)
+    {
+      if (current_macro)
+	with_macro_input (savestring (current_macro));
+    }
+  else
+    current_macro_index = 0;
+
+  defining_kbd_macro = 1;
+  return 0;
+}
+
+/* Stop defining a keyboard macro.
+   A numeric argument says to execute the macro right now,
+   that many times, counting the definition as the first time. */
+rl_end_kbd_macro (count, ignore)
+     int count, ignore;
+{
+  if (!defining_kbd_macro)
+    {
+      rl_abort ();
+      return -1;
+    }
+
+  current_macro_index -= (rl_key_sequence_length - 1);
+  current_macro[current_macro_index] = '\0';
+
+  defining_kbd_macro = 0;
+
+  return (rl_call_last_kbd_macro (--count, 0));
+}
+
+/* Execute the most recently defined keyboard macro.
+   COUNT says how many times to execute it. */
+rl_call_last_kbd_macro (count, ignore)
+     int count, ignore;
+{
+  if (!current_macro)
+    rl_abort ();
+
+  if (defining_kbd_macro)
+    {
+      ding ();		/* no recursive macros */
+      current_macro[--current_macro_index] = '\0';	/* erase this char */
+      return 0;
+    }
+
+  while (count--)
+    with_macro_input (savestring (current_macro));
+  return 0;
+}
+
+void
+_rl_kill_kbd_macro ()
+{
+  if (current_macro)
+    {
+      free (current_macro);
+      current_macro = (char *) NULL;
+    }
+  current_macro_size = current_macro_index = 0;
+
+  if (executing_macro)
+    {
+      free (executing_macro);
+      executing_macro = (char *) NULL;
+    }
+  executing_macro_index = 0;
+
+  defining_kbd_macro = 0;
+}
+
+/* **************************************************************** */
+/*								    */
+/*			Initializations 			    */
+/*								    */
+/* **************************************************************** */
+
+/* Initliaze readline (and terminal if not already). */
+rl_initialize ()
+{
+  char *t;
+
+  /* If we have never been called before, initialize the
+     terminal and data structures. */
+  if (!rl_initialized)
+    {
+      readline_initialize_everything ();
+      rl_initialized++;
+    }
+
+  /* Initalize the current line information. */
+  rl_point = rl_end = 0;
+  the_line = rl_line_buffer;
+  the_line[0] = 0;
+
+  /* We aren't done yet.  We haven't even gotten started yet! */
+  rl_done = 0;
+
+  /* Check for LC_CTYPE and use its value to decide the defaults for
+     8-bit character input and output. */
+  t = getenv ("LC_CTYPE");
+  if (t && (strcmp (t, "iso-8859-1") == 0 || strcmp (t, "iso_8859_1") == 0))
+    {
+      _rl_meta_flag = 1;
+      _rl_convert_meta_chars_to_ascii = 0;
+      _rl_output_meta_chars = 1;
+    }
+      
+  /* Tell the history routines what is going on. */
+  start_using_history ();
+
+  /* Make the display buffer match the state of the line. */
+  rl_reset_line_state ();
+
+  /* No such function typed yet. */
+  rl_last_func = (Function *)NULL;
+
+  /* Parsing of key-bindings begins in an enabled state. */
+  _rl_parsing_conditionalized_out = 0;
+
+  return 0;
+}
+
+/* Initialize the entire state of the world. */
+static void
+readline_initialize_everything ()
+{
+  /* Find out if we are running in Emacs. */
+  running_in_emacs = getenv ("EMACS") != (char *)0;
+
+  /* Set up input and output if they are not already set up. */
+  if (!rl_instream)
+    rl_instream = stdin;
+
+  if (!rl_outstream)
+    rl_outstream = stdout;
+
+  /* Bind in_stream and out_stream immediately.  These values may change,
+     but they may also be used before readline_internal () is called. */
+  in_stream = rl_instream;
+  out_stream = rl_outstream;
+
+  /* Allocate data structures. */
+  if (!rl_line_buffer)
+    rl_line_buffer = xmalloc (rl_line_buffer_len = DEFAULT_BUFFER_SIZE);
+
+  /* Initialize the terminal interface. */
+  init_terminal_io ((char *)NULL);
+
+#if !defined (__GO32__)
+  /* Bind tty characters to readline functions. */
+  readline_default_bindings ();
+#endif /* !__GO32__ */
+
+  /* Initialize the function names. */
+  rl_initialize_funmap ();
+
+  /* Read in the init file. */
+  rl_read_init_file ((char *)NULL);
+
+  /* XXX */
+  if (_rl_horizontal_scroll_mode && term_xn)
+    {
+      screenwidth--;
+      screenchars -= screenheight;
+    }
+
+  /* Override the effect of any `set keymap' assignments in the
+     inputrc file. */
+  rl_set_keymap_from_edit_mode ();
+
+  /* Try to bind a common arrow key prefix, if not already bound. */
+  bind_arrow_keys ();
+
+  /* If the completion parser's default word break characters haven't
+     been set yet, then do so now. */
+  if (rl_completer_word_break_characters == (char *)NULL)
+    rl_completer_word_break_characters = rl_basic_word_break_characters;
+}
+
+/* If this system allows us to look at the values of the regular
+   input editing characters, then bind them to their readline
+   equivalents, iff the characters are not bound to keymaps. */
+static void
+readline_default_bindings ()
+{
+  rltty_set_default_bindings (_rl_keymap);
+}
+
+static void
+bind_arrow_keys_internal ()
+{
+  Function *f;
+
+  f = rl_function_of_keyseq ("\033[A", _rl_keymap, (int *)NULL);
+  if (!f || f == rl_do_lowercase_version)
+    {
+      _rl_bind_if_unbound ("\033[A", rl_get_previous_history);
+      _rl_bind_if_unbound ("\033[B", rl_get_next_history);
+      _rl_bind_if_unbound ("\033[C", rl_forward);
+      _rl_bind_if_unbound ("\033[D", rl_backward);
+    }
+
+  f = rl_function_of_keyseq ("\033OA", _rl_keymap, (int *)NULL);
+  if (!f || f == rl_do_lowercase_version)
+    {
+      _rl_bind_if_unbound ("\033OA", rl_get_previous_history);
+      _rl_bind_if_unbound ("\033OB", rl_get_next_history);
+      _rl_bind_if_unbound ("\033OC", rl_forward);
+      _rl_bind_if_unbound ("\033OD", rl_backward);
+    }
+}
+
+/* Try and bind the common arrow key prefix after giving termcap and
+   the inputrc file a chance to bind them and create `real' keymaps
+   for the arrow key prefix. */
+static void
+bind_arrow_keys ()
+{
+  Keymap xkeymap;
+
+  xkeymap = _rl_keymap;
+
+  _rl_keymap = emacs_standard_keymap;
+  bind_arrow_keys_internal ();
+
+#if defined (VI_MODE)
+  _rl_keymap = vi_movement_keymap;
+  bind_arrow_keys_internal ();
+#endif
+
+  _rl_keymap = xkeymap;
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			Numeric Arguments			    */
+/*								    */
+/* **************************************************************** */
+
+/* Handle C-u style numeric args, as well as M--, and M-digits. */
+static int
+rl_digit_loop ()
+{
+  int key, c;
+
+  while (1)
+    {
+      rl_message ("(arg: %d) ", rl_arg_sign * rl_numeric_arg);
+      key = c = rl_read_key ();
+
+      if (_rl_keymap[c].type == ISFUNC &&
+	  _rl_keymap[c].function == rl_universal_argument)
+	{
+	  rl_numeric_arg *= 4;
+	  continue;
+	}
+      c = UNMETA (c);
+      if (digit_p (c))
+	{
+	  if (rl_explicit_arg)
+	    rl_numeric_arg = (rl_numeric_arg * 10) + (c - '0');
+	  else
+	    rl_numeric_arg = (c - '0');
+	  rl_explicit_arg = 1;
+	}
+      else
+	{
+	  if (c == '-' && !rl_explicit_arg)
+	    {
+	      rl_numeric_arg = 1;
+	      rl_arg_sign = -1;
+	    }
+	  else
+	    {
+	      rl_clear_message ();
+	      return (_rl_dispatch (key, _rl_keymap));
+	    }
+	}
+    }
+  return 0;
+}
+
+/* Add the current digit to the argument in progress. */
+rl_digit_argument (ignore, key)
+     int ignore, key;
+{
+  rl_pending_input = key;
+  return (rl_digit_loop ());
+}
+
+/* What to do when you abort reading an argument. */
+rl_discard_argument ()
+{
+  ding ();
+  rl_clear_message ();
+  rl_init_argument ();
+  return 0;
+}
+
+/* Create a default argument. */
+rl_init_argument ()
+{
+  rl_numeric_arg = rl_arg_sign = 1;
+  rl_explicit_arg = 0;
+  return 0;
+}
+
+/* C-u, universal argument.  Multiply the current argument by 4.
+   Read a key.  If the key has nothing to do with arguments, then
+   dispatch on it.  If the key is the abort character then abort. */
+rl_universal_argument ()
+{
+  rl_numeric_arg *= 4;
+  return (rl_digit_loop ());
+}
+
+/* **************************************************************** */
+/*								    */
+/*			Terminal and Termcap			    */
+/*								    */
+/* **************************************************************** */
+
+static char *term_buffer = (char *)NULL;
+static char *term_string_buffer = (char *)NULL;
+
+static int tcap_initialized = 0;
+
+/* Non-zero means this terminal can't really do anything. */
+int dumb_term = 0;
+/* On Solaris2, sys/types.h #includes sys/reg.h, which #defines PC.
+   Unfortunately, PC is a global variable used by the termcap library. */
+#undef PC
+
+#if !defined (__linux__)
+/* If this causes problems, remove the `extern'. */
+extern char PC, *BC, *UP;
+#endif /* __linux__ */
+
+/* Some strings to control terminal actions.  These are output by tputs (). */
+char *term_goto, *term_clreol, *term_cr, *term_clrpag, *term_backspace;
+char *term_pc;
+
+/* Non-zero if we determine that the terminal can do character insertion. */
+int terminal_can_insert = 0;
+
+/* How to insert characters. */
+char *term_im, *term_ei, *term_ic, *term_ip, *term_IC;
+
+/* How to delete characters. */
+char *term_dc, *term_DC;
+
+#if defined (HACK_TERMCAP_MOTION)
+char *term_forward_char;
+#endif  /* HACK_TERMCAP_MOTION */
+
+/* How to go up a line. */
+char *term_up;
+
+/* A visible bell, if the terminal can be made to flash the screen. */
+char *visible_bell;
+
+/* Non-zero means that this terminal has a meta key. */
+int term_has_meta;
+
+/* The string to write to turn on the meta key, if this term has one. */
+char *term_mm;
+
+/* The string to write to turn off the meta key, if this term has one. */
+char *term_mo;
+
+/* The key sequences output by the arrow keys, if this terminal has any. */
+char *term_ku, *term_kd, *term_kr, *term_kl;
+
+/* How to initialize and reset the arrow keys, if this terminal has any. */
+char *term_ks, *term_ke;
+
+/* Re-initialize the terminal considering that the TERM/TERMCAP variable
+   has changed. */
+rl_reset_terminal (terminal_name)
+     char *terminal_name;
+{
+  init_terminal_io (terminal_name);
+  return 0;
+}
+
+/* Set readline's idea of the screen size.  TTY is a file descriptor open
+   to the terminal.  If IGNORE_ENV is true, we do not pay attention to the
+   values of $LINES and $COLUMNS.  The tests for TERM_STRING_BUFFER being
+   non-null serve to check whether or not we have initialized termcap. */
+void
+_rl_set_screen_size (tty, ignore_env)
+     int tty, ignore_env;
+{
+#if defined (TIOCGWINSZ)
+  struct winsize window_size;
+#endif /* TIOCGWINSZ */
+
+#if defined (TIOCGWINSZ)
+  if (ioctl (tty, TIOCGWINSZ, &window_size) == 0)
+    {
+      screenwidth = (int) window_size.ws_col;
+      screenheight = (int) window_size.ws_row;
+    }
+#endif /* TIOCGWINSZ */
+
+  /* Environment variable COLUMNS overrides setting of "co" if IGNORE_ENV
+     is unset. */
+  if (screenwidth <= 0)
+    {
+      char *sw;
+
+      if (!ignore_env && (sw = getenv ("COLUMNS")))
+	screenwidth = atoi (sw);
+
+      if (screenwidth <= 0 && term_string_buffer)
+	screenwidth = tgetnum ("co");
+    }
+
+  /* Environment variable LINES overrides setting of "li" if IGNORE_ENV
+     is unset. */
+  if (screenheight <= 0)
+    {
+      char *sh;
+
+      if (!ignore_env && (sh = getenv ("LINES")))
+	screenheight = atoi (sh);
+
+      if (screenheight <= 0 && term_string_buffer)
+	screenheight = tgetnum ("li");
+    }
+
+  /* If all else fails, default to 80x24 terminal. */
+  if (screenwidth <= 1)
+    screenwidth = 80;
+
+  if (screenheight <= 0)
+    screenheight = 24;
+
+#if defined (SHELL)
+  /* If we're being compiled as part of bash, set the environment
+     variables $LINES and $COLUMNS to new values. */
+  set_lines_and_columns (screenheight, screenwidth);
+#endif
+
+  if (!term_xn)
+    screenwidth--;
+
+  screenchars = screenwidth * screenheight;
+}
+
+struct _tc_string {
+     char *tc_var;
+     char **tc_value;
+};
+
+/* This should be kept sorted, just in case we decide to change the
+   search algorithm to something smarter. */
+static struct _tc_string tc_strings[] =
+{
+  "DC", &term_DC,
+  "IC", &term_IC,
+  "ce", &term_clreol,
+  "cl", &term_clrpag,
+  "cr", &term_cr,
+  "dc", &term_dc,
+  "ei", &term_ei,
+  "ic", &term_ic,
+  "im", &term_im,
+  "kd", &term_kd,
+  "kl", &term_kl,
+  "kr", &term_kr,
+  "ku", &term_ku,
+  "ks", &term_ks,
+  "ke", &term_ke,
+  "le", &term_backspace,
+  "mm", &term_mm,
+  "mo", &term_mo,
+#if defined (HACK_TERMCAP_MOTION)
+  "nd", &term_forward_char,
+#endif
+  "pc", &term_pc,
+  "up", &term_up,
+  "vb", &visible_bell,
+};
+
+#define NUM_TC_STRINGS (sizeof (tc_strings) / sizeof (struct _tc_string))
+
+/* Read the desired terminal capability strings into BP.  The capabilities
+   are described in the TC_STRINGS table. */
+static void
+get_term_capabilities (bp)
+     char **bp;
+{
+  register int i;
+
+  for (i = 0; i < NUM_TC_STRINGS; i++)
+    *(tc_strings[i].tc_value) = tgetstr (tc_strings[i].tc_var, bp);
+  tcap_initialized = 1;
+}
+
+static int
+init_terminal_io (terminal_name)
+     char *terminal_name;
+{
+#if defined (__GO32__)
+  screenwidth = ScreenCols ();
+  screenheight = ScreenRows ();
+  screenchars = screenwidth * screenheight;
+  term_cr = "\r";
+  term_im = term_ei = term_ic = term_IC = (char *)NULL;
+  term_up = term_dc = term_DC = visible_bell = (char *)NULL;
+
+  /* Does the __GO32__ have a meta key?  I don't know. */
+  term_has_meta = 0;
+  term_mm = term_mo = (char *)NULL;
+
+  /* It probably has arrow keys, but I don't know what they are. */
+  term_ku = term_kd = term_kr = term_kl = (char *)NULL;
+
+#if defined (HACK_TERMCAP_MOTION)
+  term_forward_char = (char *)NULL;
+#endif /* HACK_TERMCAP_MOTION */
+  terminal_can_insert = term_xn = 0;
+  return;
+#else /* !__GO32__ */
+
+  char *term, *buffer;
+  int tty;
+  Keymap xkeymap;
+
+  term = terminal_name ? terminal_name : getenv ("TERM");
+
+  if (!term_string_buffer)
+    term_string_buffer = xmalloc (2048);
+
+  if (!term_buffer)
+    term_buffer = xmalloc (2048);
+
+  buffer = term_string_buffer;
+
+  term_clrpag = term_cr = term_clreol = (char *)NULL;
+
+  if (!term)
+    term = "dumb";
+
+  if (tgetent (term_buffer, term) <= 0)
+    {
+      dumb_term = 1;
+      screenwidth = 79;
+      screenheight = 24;
+      screenchars = 79 * 24;
+      term_cr = "\r";
+      term_im = term_ei = term_ic = term_IC = (char *)NULL;
+      term_up = term_dc = term_DC = visible_bell = (char *)NULL;
+      term_ku = term_kd = term_kl = term_kr = (char *)NULL;
+#if defined (HACK_TERMCAP_MOTION)
+      term_forward_char = (char *)NULL;
+#endif
+      terminal_can_insert = 0;
+      return 0;
+    }
+
+  get_term_capabilities (&buffer);
+
+  /* Set up the variables that the termcap library expects the application
+     to provide. */
+  PC = term_pc ? *term_pc : 0;
+  BC = term_backspace;
+  UP = term_up;
+
+  if (!term_cr)
+    term_cr =  "\r";
+
+  if (rl_instream)
+    tty = fileno (rl_instream);
+  else
+    tty = 0;
+
+  screenwidth = screenheight = 0;
+
+  term_xn = tgetflag ("am") && tgetflag ("xn");
+
+  _rl_set_screen_size (tty, 0);
+
+  /* "An application program can assume that the terminal can do
+      character insertion if *any one of* the capabilities `IC',
+      `im', `ic' or `ip' is provided."  But we can't do anything if
+      only `ip' is provided, so... */
+  terminal_can_insert = (term_IC || term_im || term_ic);
+
+  /* Check to see if this terminal has a meta key and clear the capability
+     variables if there is none. */
+  term_has_meta = (tgetflag ("km") || tgetflag ("MT"));
+  if (!term_has_meta)
+    {
+      term_mm = (char *)NULL;
+      term_mo = (char *)NULL;
+    }
+
+  /* Attempt to find and bind the arrow keys.  Do not override already
+     bound keys in an overzealous attempt, however. */
+  xkeymap = _rl_keymap;
+
+  _rl_keymap = emacs_standard_keymap;
+  _rl_bind_if_unbound (term_ku, rl_get_previous_history);
+  _rl_bind_if_unbound (term_kd, rl_get_next_history);
+  _rl_bind_if_unbound (term_kr, rl_forward);
+  _rl_bind_if_unbound (term_kl, rl_backward);
+
+#if defined (VI_MODE)
+  _rl_keymap = vi_movement_keymap;
+  _rl_bind_if_unbound (term_ku, rl_get_previous_history);
+  _rl_bind_if_unbound (term_kd, rl_get_next_history);
+  _rl_bind_if_unbound (term_kr, rl_forward);
+  _rl_bind_if_unbound (term_kl, rl_backward);
+#endif /* VI_MODE */
+
+  _rl_keymap = xkeymap;
+
+#endif /* !__GO32__ */
+  return 0;
+}
+
+char *
+rl_get_termcap (cap)
+     char *cap;
+{
+  register int i;
+
+  if (tcap_initialized == 0)
+    return ((char *)NULL);
+  for (i = 0; i < NUM_TC_STRINGS; i++)
+    {
+      if (tc_strings[i].tc_var[0] == cap[0] && strcmp (tc_strings[i].tc_var, cap) == 0)
+        return *(tc_strings[i].tc_value);
+    }
+  return ((char *)NULL);
+}
+
+/* A function for the use of tputs () */
+int
+_rl_output_character_function (c)
+     int c;
+{
+  return putc (c, out_stream);
+}
+
+/* Write COUNT characters from STRING to the output stream. */
+void
+_rl_output_some_chars (string, count)
+     char *string;
+     int count;
+{
+  fwrite (string, 1, count, out_stream);
+}
+
+/* Move the cursor back. */
+backspace (count)
+     int count;
+{
+  register int i;
+
+#if !defined (__GO32__)
+  if (term_backspace)
+    for (i = 0; i < count; i++)
+      tputs (term_backspace, 1, _rl_output_character_function);
+  else
+#endif /* !__GO32__ */
+    for (i = 0; i < count; i++)
+      putc ('\b', out_stream);
+  return 0;
+}
+
+/* Move to the start of the next line. */
+crlf ()
+{
+#if defined (NEW_TTY_DRIVER)
+  tputs (term_cr, 1, _rl_output_character_function);
+#endif /* NEW_TTY_DRIVER */
+  putc ('\n', out_stream);
+  return 0;
+}
+
+rl_tty_status (count, key)
+     int count, key;
+{
+#if defined (TIOCSTAT)
+  ioctl (1, TIOCSTAT, (char *)0);
+  rl_refresh_line ();
+#else
+  ding ();
+#endif
+  return 0;
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			Utility Functions			    */
+/*								    */
+/* **************************************************************** */
+
+/* Return 0 if C is not a member of the class of characters that belong
+   in words, or 1 if it is. */
+
+int allow_pathname_alphabetic_chars = 0;
+char *pathname_alphabetic_chars = "/-_=~.#$";
+
+int
+alphabetic (c)
+     int c;
+{
+  if (pure_alphabetic (c) || (digit_p (c)))
+    return (1);
+
+  if (allow_pathname_alphabetic_chars)
+    return (strchr (pathname_alphabetic_chars, c) != NULL);
+  else
+    return (0);
+}
+
+/* Ring the terminal bell. */
+int
+ding ()
+{
+  if (readline_echoing_p)
+    {
+#if !defined (__GO32__)
+      switch (_rl_bell_preference)
+        {
+	case NO_BELL:
+	default:
+	  break;
+	case VISIBLE_BELL:
+	  if (visible_bell)
+	    {
+	      tputs (visible_bell, 1, _rl_output_character_function);
+	      break;
+	    }
+	  /* FALLTHROUGH */
+	case AUDIBLE_BELL:
+	  fprintf (stderr, "\007");
+	  fflush (stderr);
+	  break;
+        }
+#else /* __GO32__ */
+      fprintf (stderr, "\007");
+      fflush (stderr);
+#endif /* __GO32__ */
+      return (0);
+    }
+  return (-1);
+}
+
+/* How to abort things. */
+rl_abort (count, key)
+     int count, key;
+{
+  ding ();
+  rl_clear_message ();
+  rl_init_argument ();
+  rl_pending_input = 0;
+
+  defining_kbd_macro = 0;
+  while (executing_macro)
+    pop_executing_macro ();
+
+  rl_last_func = (Function *)NULL;
+  longjmp (readline_top_level, 1);
+}
+
+/* Return a copy of the string between FROM and TO.
+   FROM is inclusive, TO is not. */
+char *
+rl_copy_text (from, to)
+     int from, to;
+{
+  register int length;
+  char *copy;
+
+  /* Fix it if the caller is confused. */
+  if (from > to)
+    {
+      int t = from;
+      from = to;
+      to = t;
+    }
+
+  length = to - from;
+  copy = xmalloc (1 + length);
+  strncpy (copy, the_line + from, length);
+  copy[length] = '\0';
+  return (copy);
+}
+
+/* Increase the size of RL_LINE_BUFFER until it has enough space to hold
+   LEN characters. */
+void
+rl_extend_line_buffer (len)
+     int len;
+{
+  while (len >= rl_line_buffer_len)
+    {
+      rl_line_buffer_len += DEFAULT_BUFFER_SIZE;
+      rl_line_buffer = xrealloc (rl_line_buffer, rl_line_buffer_len);
+    }
+
+  the_line = rl_line_buffer;
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			Insert and Delete			    */
+/*								    */
+/* **************************************************************** */
+
+/* Insert a string of text into the line at point.  This is the only
+   way that you should do insertion.  rl_insert () calls this
+   function. */
+rl_insert_text (string)
+     char *string;
+{
+  register int i, l = strlen (string);
+
+  if (rl_end + l >= rl_line_buffer_len)
+    rl_extend_line_buffer (rl_end + l);
+
+  for (i = rl_end; i >= rl_point; i--)
+    the_line[i + l] = the_line[i];
+  strncpy (the_line + rl_point, string, l);
+
+  /* Remember how to undo this if we aren't undoing something. */
+  if (!doing_an_undo)
+    {
+      /* If possible and desirable, concatenate the undos. */
+      if ((l == 1) &&
+	  rl_undo_list &&
+	  (rl_undo_list->what == UNDO_INSERT) &&
+	  (rl_undo_list->end == rl_point) &&
+	  (rl_undo_list->end - rl_undo_list->start < 20))
+	rl_undo_list->end++;
+      else
+	rl_add_undo (UNDO_INSERT, rl_point, rl_point + l, (char *)NULL);
+    }
+  rl_point += l;
+  rl_end += l;
+  the_line[rl_end] = '\0';
+  return l;
+}
+
+/* Delete the string between FROM and TO.  FROM is
+   inclusive, TO is not. */
+rl_delete_text (from, to)
+     int from, to;
+{
+  register char *text;
+  register int diff, i;
+
+  /* Fix it if the caller is confused. */
+  if (from > to)
+    {
+      int t = from;
+      from = to;
+      to = t;
+    }
+  text = rl_copy_text (from, to);
+
+  /* Some versions of strncpy() can't handle overlapping arguments. */
+  diff = to - from;
+  for (i = from; i < rl_end - diff; i++)
+    the_line[i] = the_line[i + diff];
+
+  /* Remember how to undo this delete. */
+  if (!doing_an_undo)
+    rl_add_undo (UNDO_DELETE, from, to, text);
+  else
+    free (text);
+
+  rl_end -= diff;
+  the_line[rl_end] = '\0';
+  return (diff);
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			Readline character functions		    */
+/*								    */
+/* **************************************************************** */
+
+/* This is not a gap editor, just a stupid line input routine.  No hair
+   is involved in writing any of the functions, and none should be. */
+
+/* Note that:
+
+   rl_end is the place in the string that we would place '\0';
+   i.e., it is always safe to place '\0' there.
+
+   rl_point is the place in the string where the cursor is.  Sometimes
+   this is the same as rl_end.
+
+   Any command that is called interactively receives two arguments.
+   The first is a count: the numeric arg pased to this command.
+   The second is the key which invoked this command.
+*/
+
+
+/* **************************************************************** */
+/*								    */
+/*			Movement Commands			    */
+/*								    */
+/* **************************************************************** */
+
+/* Note that if you `optimize' the display for these functions, you cannot
+   use said functions in other functions which do not do optimizing display.
+   I.e., you will have to update the data base for rl_redisplay, and you
+   might as well let rl_redisplay do that job. */
+
+/* Move forward COUNT characters. */
+rl_forward (count, key)
+     int count, key;
+{
+  if (count < 0)
+    rl_backward (-count);
+  else if (count > 0)
+    {
+      int end = rl_point + count;
+#if defined (VI_MODE)
+      int lend = rl_end - (rl_editing_mode == vi_mode);
+#else
+      int lend = rl_end;
+#endif
+
+      if (end > lend)
+	{
+	  rl_point = lend;
+	  ding ();
+	}
+      else
+	rl_point = end;
+    }
+  return 0;
+}
+
+/* Move backward COUNT characters. */
+rl_backward (count, key)
+     int count, key;
+{
+  if (count < 0)
+    rl_forward (-count);
+  else if (count > 0)
+    {
+      if (rl_point < count)
+	{
+	  rl_point = 0;
+	  ding ();
+	}
+      else
+        rl_point -= count;
+    }
+  return 0;
+}
+
+/* Move to the beginning of the line. */
+rl_beg_of_line (count, key)
+     int count, key;
+{
+  rl_point = 0;
+  return 0;
+}
+
+/* Move to the end of the line. */
+rl_end_of_line (count, key)
+     int count, key;
+{
+  rl_point = rl_end;
+  return 0;
+}
+
+/* Move forward a word.  We do what Emacs does. */
+rl_forward_word (count, key)
+     int count, key;
+{
+  int c;
+
+  if (count < 0)
+    {
+      rl_backward_word (-count);
+      return 0;
+    }
+
+  while (count)
+    {
+      if (rl_point == rl_end)
+	return 0;
+
+      /* If we are not in a word, move forward until we are in one.
+	 Then, move forward until we hit a non-alphabetic character. */
+      c = the_line[rl_point];
+      if (!alphabetic (c))
+	{
+	  while (++rl_point < rl_end)
+	    {
+	      c = the_line[rl_point];
+	      if (alphabetic (c))
+		break;
+	    }
+	}
+      if (rl_point == rl_end)
+	return 0;
+      while (++rl_point < rl_end)
+	{
+	  c = the_line[rl_point];
+	  if (!alphabetic (c))
+	    break;
+	}
+      --count;
+    }
+  return 0;
+}
+
+/* Move backward a word.  We do what Emacs does. */
+rl_backward_word (count, key)
+     int count, key;
+{
+  int c;
+
+  if (count < 0)
+    {
+      rl_forward_word (-count);
+      return 0;
+    }
+
+  while (count)
+    {
+      if (!rl_point)
+	return 0;
+
+      /* Like rl_forward_word (), except that we look at the characters
+	 just before point. */
+
+      c = the_line[rl_point - 1];
+      if (!alphabetic (c))
+	{
+	  while (--rl_point)
+	    {
+	      c = the_line[rl_point - 1];
+	      if (alphabetic (c))
+		break;
+	    }
+	}
+
+      while (rl_point)
+	{
+	  c = the_line[rl_point - 1];
+	  if (!alphabetic (c))
+	    break;
+	  else
+	    --rl_point;
+	}
+      --count;
+    }
+  return 0;
+}
+
+/* Clear the current line.  Numeric argument to C-l does this. */
+rl_refresh_line ()
+{
+  int curr_line, nleft;
+
+  /* Find out whether or not there might be invisible characters in the
+     editing buffer. */
+  if (rl_display_prompt == rl_prompt)
+    nleft = _rl_last_c_pos - screenwidth - rl_visible_prompt_length;
+  else
+    nleft = _rl_last_c_pos - screenwidth;
+
+  if (nleft > 0)
+    curr_line = 1 + nleft / screenwidth;
+  else
+    curr_line = 0;
+
+  _rl_move_vert (curr_line);
+  _rl_move_cursor_relative (0, the_line);   /* XXX is this right */
+
+#if defined (__GO32__)
+  {
+    int row, col, width, row_start;
+
+    ScreenGetCursor (&row, &col);
+    width = ScreenCols ();
+    row_start = ScreenPrimary + (row * width);
+    memset (row_start + col, 0, (width - col) * 2);
+  }
+#else /* !__GO32__ */
+  if (term_clreol)
+    tputs (term_clreol, 1, _rl_output_character_function);
+#endif /* !__GO32__ */
+
+  rl_forced_update_display ();
+  rl_display_fixed = 1;
+
+  return 0;
+}
+
+/* C-l typed to a line without quoting clears the screen, and then reprints
+   the prompt and the current input line.  Given a numeric arg, redraw only
+   the current line. */
+rl_clear_screen (count, key)
+     int count, key;
+{
+  if (rl_explicit_arg)
+    {
+      rl_refresh_line ();
+      return 0;
+    }
+
+#if !defined (__GO32__)
+  if (term_clrpag)
+    tputs (term_clrpag, 1, _rl_output_character_function);
+  else
+#endif /* !__GO32__ */
+    crlf ();
+
+  rl_forced_update_display ();
+  rl_display_fixed = 1;
+
+  return 0;
+}
+
+rl_arrow_keys (count, c)
+     int count, c;
+{
+  int ch;
+
+  ch = rl_read_key ();
+
+  switch (to_upper (ch))
+    {
+    case 'A':
+      rl_get_previous_history (count);
+      break;
+
+    case 'B':
+      rl_get_next_history (count);
+      break;
+
+    case 'C':
+      rl_forward (count);
+      break;
+
+    case 'D':
+      rl_backward (count);
+      break;
+
+    default:
+      ding ();
+    }
+  return 0;
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			Text commands				    */
+/*								    */
+/* **************************************************************** */
+
+/* Insert the character C at the current location, moving point forward. */
+rl_insert (count, c)
+     int count, c;
+{
+  register int i;
+  char *string;
+
+  if (count <= 0)
+    return 0;
+
+  /* If we can optimize, then do it.  But don't let people crash
+     readline because of extra large arguments. */
+  if (count > 1 && count < 1024)
+    {
+      string = xmalloc (1 + count);
+
+      for (i = 0; i < count; i++)
+	string[i] = c;
+
+      string[i] = '\0';
+      rl_insert_text (string);
+      free (string);
+
+      return 0;
+    }
+
+  if (count > 1024)
+    {
+      int decreaser;
+      char str[1024+1];
+
+      for (i = 0; i < 1024; i++)
+	str[i] = c;
+
+      while (count)
+	{
+	  decreaser = (count > 1024 ? 1024 : count);
+	  str[decreaser] = '\0';
+	  rl_insert_text (str);
+	  count -= decreaser;
+	}
+
+      return 0;
+    }
+
+  /* We are inserting a single character.
+     If there is pending input, then make a string of all of the
+     pending characters that are bound to rl_insert, and insert
+     them all. */
+  if (any_typein)
+    {
+      int key = 0, t;
+
+      i = 0;
+      string = xmalloc (ibuffer_len + 1);
+      string[i++] = c;
+
+      while ((t = rl_get_char (&key)) &&
+	     (_rl_keymap[key].type == ISFUNC &&
+	      _rl_keymap[key].function == rl_insert))
+	string[i++] = key;
+
+      if (t)
+	rl_unget_char (key);
+
+      string[i] = '\0';
+      rl_insert_text (string);
+      free (string);
+    }
+  else
+    {
+      /* Inserting a single character. */
+      char str[2];
+
+      str[1] = '\0';
+      str[0] = c;
+      rl_insert_text (str);
+    }
+  return 0;
+}
+
+/* Insert the next typed character verbatim. */
+rl_quoted_insert (count, key)
+     int count, key;
+{
+  int c;
+
+  c = rl_read_key ();
+  return (rl_insert (count, c));  
+}
+
+/* Insert a tab character. */
+rl_tab_insert (count, key)
+     int count, key;
+{
+  return (rl_insert (count, '\t'));
+}
+
+/* What to do when a NEWLINE is pressed.  We accept the whole line.
+   KEY is the key that invoked this command.  I guess it could have
+   meaning in the future. */
+rl_newline (count, key)
+     int count, key;
+{
+  rl_done = 1;
+
+#if defined (VI_MODE)
+  _rl_vi_done_inserting ();
+  _rl_vi_reset_last ();
+
+#endif /* VI_MODE */
+
+  if (readline_echoing_p)
+    _rl_update_final ();
+  return 0;
+}
+
+rl_clean_up_for_exit ()
+{
+  if (readline_echoing_p)
+    {
+      _rl_move_vert (_rl_vis_botlin);
+      _rl_vis_botlin = 0;
+      fflush (out_stream);
+      rl_restart_output ();
+    }
+  return 0;
+}
+
+/* What to do for some uppercase characters, like meta characters,
+   and some characters appearing in emacs_ctlx_keymap.  This function
+   is just a stub, you bind keys to it and the code in _rl_dispatch ()
+   is special cased. */
+rl_do_lowercase_version (ignore1, ignore2)
+     int ignore1, ignore2;
+{
+  return 0;
+}
+
+/* Rubout the character behind point. */
+rl_rubout (count, key)
+     int count, key;
+{
+  if (count < 0)
+    {
+      rl_delete (-count);
+      return 0;
+    }
+
+  if (!rl_point)
+    {
+      ding ();
+      return -1;
+    }
+
+  if (count > 1 || rl_explicit_arg)
+    {
+      int orig_point = rl_point;
+      rl_backward (count);
+      rl_kill_text (orig_point, rl_point);
+    }
+  else
+    {
+      int c = the_line[--rl_point];
+      rl_delete_text (rl_point, rl_point + 1);
+
+      if (rl_point == rl_end && isprint (c) && _rl_last_c_pos)
+	{
+	  int l;
+	  l = rl_character_len (c, rl_point);
+	  _rl_erase_at_end_of_line (l);
+	}
+    }
+  return 0;
+}
+
+/* Delete the character under the cursor.  Given a numeric argument,
+   kill that many characters instead. */
+rl_delete (count, invoking_key)
+     int count, invoking_key;
+{
+  if (count < 0)
+    {
+      return (rl_rubout (-count));
+    }
+
+  if (rl_point == rl_end)
+    {
+      ding ();
+      return -1;
+    }
+
+  if (count > 1 || rl_explicit_arg)
+    {
+      int orig_point = rl_point;
+      rl_forward (count);
+      rl_kill_text (orig_point, rl_point);
+      rl_point = orig_point;
+      return 0;
+    }
+  else
+    return (rl_delete_text (rl_point, rl_point + 1));
+  
+}
+
+/* Delete all spaces and tabs around point. */
+rl_delete_horizontal_space (count, ignore)
+     int count, ignore;
+{
+  int start = rl_point;
+
+  while (rl_point && whitespace (the_line[rl_point - 1]))
+    rl_point--;
+
+  start = rl_point;
+
+  while (rl_point < rl_end && whitespace (the_line[rl_point]))
+    rl_point++;
+
+  if (start != rl_point)
+    {
+      rl_delete_text (start, rl_point);
+      rl_point = start;
+    }
+  return 0;
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			Kill commands				    */
+/*								    */
+/* **************************************************************** */
+
+/* The next two functions mimic unix line editing behaviour, except they
+   save the deleted text on the kill ring.  This is safer than not saving
+   it, and since we have a ring, nobody should get screwed. */
+
+/* This does what C-w does in Unix.  We can't prevent people from
+   using behaviour that they expect. */
+rl_unix_word_rubout (count, key)
+     int count, key;
+{
+  if (!rl_point)
+    ding ();
+  else
+    {
+      int orig_point = rl_point;
+
+      while (rl_point && whitespace (the_line[rl_point - 1]))
+	rl_point--;
+
+      while (rl_point && !whitespace (the_line[rl_point - 1]))
+	rl_point--;
+
+      rl_kill_text (orig_point, rl_point);
+    }
+  return 0;
+}
+
+/* Here is C-u doing what Unix does.  You don't *have* to use these
+   key-bindings.  We have a choice of killing the entire line, or
+   killing from where we are to the start of the line.  We choose the
+   latter, because if you are a Unix weenie, then you haven't backspaced
+   into the line at all, and if you aren't, then you know what you are
+   doing. */
+rl_unix_line_discard (count, key)
+     int count, key;
+{
+  if (!rl_point)
+    ding ();
+  else
+    {
+      rl_kill_text (rl_point, 0);
+      rl_point = 0;
+    }
+  return 0;
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			Commands For Typos			    */
+/*								    */
+/* **************************************************************** */
+
+/* Random and interesting things in here.  */
+
+/* **************************************************************** */
+/*								    */
+/*			Changing Case				    */
+/*								    */
+/* **************************************************************** */
+
+/* The three kinds of things that we know how to do. */
+#define UpCase 1
+#define DownCase 2
+#define CapCase 3
+
+static int rl_change_case ();
+
+/* Uppercase the word at point. */
+rl_upcase_word (count, key)
+     int count, key;
+{
+  return (rl_change_case (count, UpCase));
+}
+
+/* Lowercase the word at point. */
+rl_downcase_word (count, key)
+     int count, key;
+{
+  return (rl_change_case (count, DownCase));
+}
+
+/* Upcase the first letter, downcase the rest. */
+rl_capitalize_word (count, key)
+     int count, key;
+{
+ return (rl_change_case (count, CapCase));
+}
+
+/* The meaty function.
+   Change the case of COUNT words, performing OP on them.
+   OP is one of UpCase, DownCase, or CapCase.
+   If a negative argument is given, leave point where it started,
+   otherwise, leave it where it moves to. */
+static int
+rl_change_case (count, op)
+     int count, op;
+{
+  register int start = rl_point, end;
+  int state = 0;
+
+  rl_forward_word (count);
+  end = rl_point;
+
+  if (count < 0)
+    {
+      int temp = start;
+      start = end;
+      end = temp;
+    }
+
+  /* We are going to modify some text, so let's prepare to undo it. */
+  rl_modifying (start, end);
+
+  for (; start < end; start++)
+    {
+      switch (op)
+	{
+	case UpCase:
+	  the_line[start] = to_upper (the_line[start]);
+	  break;
+
+	case DownCase:
+	  the_line[start] = to_lower (the_line[start]);
+	  break;
+
+	case CapCase:
+	  if (state == 0)
+	    {
+	      the_line[start] = to_upper (the_line[start]);
+	      state = 1;
+	    }
+	  else
+	    {
+	      the_line[start] = to_lower (the_line[start]);
+	    }
+	  if (!pure_alphabetic (the_line[start]))
+	    state = 0;
+	  break;
+
+	default:
+	  abort ();
+	  return -1;
+	}
+    }
+  rl_point = end;
+  return 0;
+}
+
+/* **************************************************************** */
+/*								    */
+/*			Transposition				    */
+/*								    */
+/* **************************************************************** */
+
+/* Transpose the words at point. */
+rl_transpose_words (count, key)
+     int count, key;
+{
+  char *word1, *word2;
+  int w1_beg, w1_end, w2_beg, w2_end;
+  int orig_point = rl_point;
+
+  if (!count)
+    return 0;
+
+  /* Find the two words. */
+  rl_forward_word (count);
+  w2_end = rl_point;
+  rl_backward_word (1);
+  w2_beg = rl_point;
+  rl_backward_word (count);
+  w1_beg = rl_point;
+  rl_forward_word (1);
+  w1_end = rl_point;
+
+  /* Do some check to make sure that there really are two words. */
+  if ((w1_beg == w2_beg) || (w2_beg < w1_end))
+    {
+      ding ();
+      rl_point = orig_point;
+      return -1;
+    }
+
+  /* Get the text of the words. */
+  word1 = rl_copy_text (w1_beg, w1_end);
+  word2 = rl_copy_text (w2_beg, w2_end);
+
+  /* We are about to do many insertions and deletions.  Remember them
+     as one operation. */
+  rl_begin_undo_group ();
+
+  /* Do the stuff at word2 first, so that we don't have to worry
+     about word1 moving. */
+  rl_point = w2_beg;
+  rl_delete_text (w2_beg, w2_end);
+  rl_insert_text (word1);
+
+  rl_point = w1_beg;
+  rl_delete_text (w1_beg, w1_end);
+  rl_insert_text (word2);
+
+  /* This is exactly correct since the text before this point has not
+     changed in length. */
+  rl_point = w2_end;
+
+  /* I think that does it. */
+  rl_end_undo_group ();
+  free (word1);
+  free (word2);
+
+  return 0;
+}
+
+/* Transpose the characters at point.  If point is at the end of the line,
+   then transpose the characters before point. */
+rl_transpose_chars (count, key)
+     int count, key;
+{
+  char dummy[2];
+
+  if (!count)
+    return 0;
+
+  if (!rl_point || rl_end < 2)
+    {
+      ding ();
+      return -1;
+    }
+
+  rl_begin_undo_group ();
+
+  if (rl_point == rl_end)
+    {
+      --rl_point;
+      count = 1;
+    }
+  rl_point--;
+
+  dummy[0] = the_line[rl_point];
+  dummy[1] = '\0';
+
+  rl_delete_text (rl_point, rl_point + 1);
+
+  rl_point += count;
+  if (rl_point > rl_end)
+    rl_point = rl_end;
+  else if (rl_point < 0)
+    rl_point = 0;
+  rl_insert_text (dummy);
+
+  rl_end_undo_group ();
+  return 0;
+}
+
+/* **************************************************************** */
+/*								    */
+/*			Undo, and Undoing			    */
+/*								    */
+/* **************************************************************** */
+
+/* The current undo list for THE_LINE. */
+UNDO_LIST *rl_undo_list = (UNDO_LIST *)NULL;
+
+/* Remember how to undo something.  Concatenate some undos if that
+   seems right. */
+void
+rl_add_undo (what, start, end, text)
+     enum undo_code what;
+     int start, end;
+     char *text;
+{
+  UNDO_LIST *temp = (UNDO_LIST *)xmalloc (sizeof (UNDO_LIST));
+  temp->what = what;
+  temp->start = start;
+  temp->end = end;
+  temp->text = text;
+  temp->next = rl_undo_list;
+  rl_undo_list = temp;
+}
+
+/* Free the existing undo list. */
+void
+free_undo_list ()
+{
+  while (rl_undo_list)
+    {
+      UNDO_LIST *release = rl_undo_list;
+      rl_undo_list = rl_undo_list->next;
+
+      if (release->what == UNDO_DELETE)
+	free (release->text);
+
+      free (release);
+    }
+  rl_undo_list = (UNDO_LIST *)NULL;
+}
+
+/* Undo the next thing in the list.  Return 0 if there
+   is nothing to undo, or non-zero if there was. */
+int
+rl_do_undo ()
+{
+  UNDO_LIST *release;
+  int waiting_for_begin = 0;
+
+undo_thing:
+  if (!rl_undo_list)
+    return (0);
+
+  doing_an_undo = 1;
+
+  switch (rl_undo_list->what) {
+
+    /* Undoing deletes means inserting some text. */
+  case UNDO_DELETE:
+    rl_point = rl_undo_list->start;
+    rl_insert_text (rl_undo_list->text);
+    free (rl_undo_list->text);
+    break;
+
+    /* Undoing inserts means deleting some text. */
+  case UNDO_INSERT:
+    rl_delete_text (rl_undo_list->start, rl_undo_list->end);
+    rl_point = rl_undo_list->start;
+    break;
+
+    /* Undoing an END means undoing everything 'til we get to
+       a BEGIN. */
+  case UNDO_END:
+    waiting_for_begin++;
+    break;
+
+    /* Undoing a BEGIN means that we are done with this group. */
+  case UNDO_BEGIN:
+    if (waiting_for_begin)
+      waiting_for_begin--;
+    else
+      ding ();
+    break;
+  }
+
+  doing_an_undo = 0;
+
+  release = rl_undo_list;
+  rl_undo_list = rl_undo_list->next;
+  free (release);
+
+  if (waiting_for_begin)
+    goto undo_thing;
+
+  return (1);
+}
+
+/* Begin a group.  Subsequent undos are undone as an atomic operation. */
+int
+rl_begin_undo_group ()
+{
+  rl_add_undo (UNDO_BEGIN, 0, 0, 0);
+  return 0;
+}
+
+/* End an undo group started with rl_begin_undo_group (). */
+int
+rl_end_undo_group ()
+{
+  rl_add_undo (UNDO_END, 0, 0, 0);
+  return 0;
+}
+
+/* Save an undo entry for the text from START to END. */
+rl_modifying (start, end)
+     int start, end;
+{
+  if (start > end)
+    {
+      int t = start;
+      start = end;
+      end = t;
+    }
+
+  if (start != end)
+    {
+      char *temp = rl_copy_text (start, end);
+      rl_begin_undo_group ();
+      rl_add_undo (UNDO_DELETE, start, end, temp);
+      rl_add_undo (UNDO_INSERT, start, end, (char *)NULL);
+      rl_end_undo_group ();
+    }
+  return 0;
+}
+
+/* Revert the current line to its previous state. */
+int
+rl_revert_line (count, key)
+     int count, key;
+{
+  if (!rl_undo_list)
+    ding ();
+  else
+    {
+      while (rl_undo_list)
+	rl_do_undo ();
+    }
+  return 0;
+}
+
+/* Do some undoing of things that were done. */
+int
+rl_undo_command (count, key)
+     int count, key;
+{
+  if (count < 0)
+    return 0;	/* Nothing to do. */
+
+  while (count)
+    {
+      if (rl_do_undo ())
+	count--;
+      else
+	{
+	  ding ();
+	  break;
+	}
+    }
+  return 0;
+}
+
+/* **************************************************************** */
+/*								    */
+/*			History Utilities			    */
+/*								    */
+/* **************************************************************** */
+
+/* We already have a history library, and that is what we use to control
+   the history features of readline.  However, this is our local interface
+   to the history mechanism. */
+
+/* While we are editing the history, this is the saved
+   version of the original line. */
+HIST_ENTRY *saved_line_for_history = (HIST_ENTRY *)NULL;
+
+/* Set the history pointer back to the last entry in the history. */
+static void
+start_using_history ()
+{
+  using_history ();
+  if (saved_line_for_history)
+    _rl_free_history_entry (saved_line_for_history);
+
+  saved_line_for_history = (HIST_ENTRY *)NULL;
+}
+
+/* Free the contents (and containing structure) of a HIST_ENTRY. */
+void
+_rl_free_history_entry (entry)
+     HIST_ENTRY *entry;
+{
+  if (!entry)
+    return;
+  if (entry->line)
+    free (entry->line);
+  free (entry);
+}
+
+/* Perhaps put back the current line if it has changed. */
+maybe_replace_line ()
+{
+  HIST_ENTRY *temp = current_history ();
+
+  /* If the current line has changed, save the changes. */
+  if (temp && ((UNDO_LIST *)(temp->data) != rl_undo_list))
+    {
+      temp = replace_history_entry (where_history (), the_line, rl_undo_list);
+      free (temp->line);
+      free (temp);
+    }
+  return 0;
+}
+
+/* Put back the saved_line_for_history if there is one. */
+maybe_unsave_line ()
+{
+  if (saved_line_for_history)
+    {
+      int line_len;
+
+      line_len = strlen (saved_line_for_history->line);
+
+      if (line_len >= rl_line_buffer_len)
+	rl_extend_line_buffer (line_len);
+
+      strcpy (the_line, saved_line_for_history->line);
+      rl_undo_list = (UNDO_LIST *)saved_line_for_history->data;
+      _rl_free_history_entry (saved_line_for_history);
+      saved_line_for_history = (HIST_ENTRY *)NULL;
+      rl_end = rl_point = strlen (the_line);
+    }
+  else
+    ding ();
+  return 0;
+}
+
+/* Save the current line in saved_line_for_history. */
+maybe_save_line ()
+{
+  if (!saved_line_for_history)
+    {
+      saved_line_for_history = (HIST_ENTRY *)xmalloc (sizeof (HIST_ENTRY));
+      saved_line_for_history->line = savestring (the_line);
+      saved_line_for_history->data = (char *)rl_undo_list;
+    }
+  return 0;
+}
+
+/* **************************************************************** */
+/*								    */
+/*			History Commands			    */
+/*								    */
+/* **************************************************************** */
+
+/* Meta-< goes to the start of the history. */
+rl_beginning_of_history (count, key)
+     int count, key;
+{
+  return (rl_get_previous_history (1 + where_history ()));
+}
+
+/* Meta-> goes to the end of the history.  (The current line). */
+rl_end_of_history (count, key)
+     int count, key;
+{
+  maybe_replace_line ();
+  using_history ();
+  maybe_unsave_line ();
+  return 0;
+}
+
+/* Move down to the next history line. */
+rl_get_next_history (count, key)
+     int count, key;
+{
+  HIST_ENTRY *temp = (HIST_ENTRY *)NULL;
+
+  if (count < 0)
+    return (rl_get_previous_history (-count));
+
+  if (!count)
+    return 0;
+
+  maybe_replace_line ();
+
+  while (count)
+    {
+      temp = next_history ();
+      if (!temp)
+	break;
+      --count;
+    }
+
+  if (!temp)
+    maybe_unsave_line ();
+  else
+    {
+      int line_len;
+
+      line_len = strlen (temp->line);
+
+      if (line_len >= rl_line_buffer_len)
+	rl_extend_line_buffer (line_len);
+
+      strcpy (the_line, temp->line);
+      rl_undo_list = (UNDO_LIST *)temp->data;
+      rl_end = rl_point = strlen (the_line);
+#if defined (VI_MODE)
+      if (rl_editing_mode == vi_mode)
+	rl_point = 0;
+#endif /* VI_MODE */
+    }
+  return 0;
+}
+
+/* Get the previous item out of our interactive history, making it the current
+   line.  If there is no previous history, just ding. */
+rl_get_previous_history (count, key)
+     int count, key;
+{
+  HIST_ENTRY *old_temp = (HIST_ENTRY *)NULL;
+  HIST_ENTRY *temp = (HIST_ENTRY *)NULL;
+
+  if (count < 0)
+    return (rl_get_next_history (-count));
+
+  if (!count)
+    return 0;
+
+  /* If we don't have a line saved, then save this one. */
+  maybe_save_line ();
+
+  /* If the current line has changed, save the changes. */
+  maybe_replace_line ();
+
+  while (count)
+    {
+      temp = previous_history ();
+      if (!temp)
+	break;
+      else
+	old_temp = temp;
+      --count;
+    }
+
+  /* If there was a large argument, and we moved back to the start of the
+     history, that is not an error.  So use the last value found. */
+  if (!temp && old_temp)
+    temp = old_temp;
+
+  if (!temp)
+    ding ();
+  else
+    {
+      int line_len;
+
+      line_len = strlen (temp->line);
+
+      if (line_len >= rl_line_buffer_len)
+	rl_extend_line_buffer (line_len);
+
+      strcpy (the_line, temp->line);
+      rl_undo_list = (UNDO_LIST *)temp->data;
+      rl_end = rl_point = line_len;
+
+#if defined (VI_MODE)
+      if (rl_editing_mode == vi_mode)
+	rl_point = 0;
+#endif /* VI_MODE */
+    }
+  return 0;
+}
+
+/* Make C be the next command to be executed. */
+rl_execute_next (c)
+     int c;
+{
+  rl_pending_input = c;
+  return 0;
+}
+
+/* **************************************************************** */
+/*								    */
+/*		   The Mark and the Region.			    */
+/*								    */
+/* **************************************************************** */
+
+/* Set the mark at POSITION. */
+rl_set_mark (position)
+     int position;
+{
+  if (position > rl_end)
+    return -1;
+
+  rl_mark = position;
+  return 0;
+}
+
+/* Exchange the position of mark and point. */
+rl_exchange_mark_and_point (count, key)
+     int count, key;
+{
+  if (rl_mark > rl_end)
+    rl_mark = -1;
+
+  if (rl_mark == -1)
+    {
+      ding ();
+      return -1;
+    }
+  else
+    {
+      int temp = rl_point;
+
+      rl_point = rl_mark;
+      rl_mark = temp;
+    }
+  return 0;
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			Killing Mechanism			    */
+/*								    */
+/* **************************************************************** */
+
+/* What we assume for a max number of kills. */
+#define DEFAULT_MAX_KILLS 10
+
+/* The real variable to look at to find out when to flush kills. */
+int rl_max_kills =  DEFAULT_MAX_KILLS;
+
+/* Where to store killed text. */
+char **rl_kill_ring = (char **)NULL;
+
+/* Where we are in the kill ring. */
+int rl_kill_index = 0;
+
+/* How many slots we have in the kill ring. */
+int rl_kill_ring_length = 0;
+
+/* How to say that you only want to save a certain amount
+   of kill material. */
+rl_set_retained_kills (num)
+     int num;
+{
+  return 0;
+}
+
+/* The way to kill something.  This appends or prepends to the last
+   kill, if the last command was a kill command.  if FROM is less
+   than TO, then the text is appended, otherwise prepended.  If the
+   last command was not a kill command, then a new slot is made for
+   this kill. */
+rl_kill_text (from, to)
+     int from, to;
+{
+  int slot;
+  char *text;
+
+  /* Is there anything to kill? */
+  if (from == to)
+    {
+      last_command_was_kill++;
+      return 0;
+    }
+
+  text = rl_copy_text (from, to);
+
+  /* Delete the copied text from the line. */
+  rl_delete_text (from, to);
+
+  /* First, find the slot to work with. */
+  if (!last_command_was_kill)
+    {
+      /* Get a new slot.  */
+      if (!rl_kill_ring)
+	{
+	  /* If we don't have any defined, then make one. */
+	  rl_kill_ring = (char **)
+	    xmalloc (((rl_kill_ring_length = 1) + 1) * sizeof (char *));
+	  rl_kill_ring[slot = 0] = (char *)NULL;
+	}
+      else
+	{
+	  /* We have to add a new slot on the end, unless we have
+	     exceeded the max limit for remembering kills. */
+	  slot = rl_kill_ring_length;
+	  if (slot == rl_max_kills)
+	    {
+	      register int i;
+	      free (rl_kill_ring[0]);
+	      for (i = 0; i < slot; i++)
+		rl_kill_ring[i] = rl_kill_ring[i + 1];
+	    }
+	  else
+	    {
+	      slot = rl_kill_ring_length += 1;
+	      rl_kill_ring = (char **)xrealloc (rl_kill_ring, slot * sizeof (char *));
+	    }
+	  rl_kill_ring[--slot] = (char *)NULL;
+	}
+    }
+  else
+    slot = rl_kill_ring_length - 1;
+
+  /* If the last command was a kill, prepend or append. */
+  if (last_command_was_kill && rl_editing_mode != vi_mode)
+    {
+      char *old = rl_kill_ring[slot];
+      char *new = xmalloc (1 + strlen (old) + strlen (text));
+
+      if (from < to)
+	{
+	  strcpy (new, old);
+	  strcat (new, text);
+	}
+      else
+	{
+	  strcpy (new, text);
+	  strcat (new, old);
+	}
+      free (old);
+      free (text);
+      rl_kill_ring[slot] = new;
+    }
+  else
+    {
+      rl_kill_ring[slot] = text;
+    }
+  rl_kill_index = slot;
+  last_command_was_kill++;
+  return 0;
+}
+
+/* Now REMEMBER!  In order to do prepending or appending correctly, kill
+   commands always make rl_point's original position be the FROM argument,
+   and rl_point's extent be the TO argument. */
+
+/* **************************************************************** */
+/*								    */
+/*			Killing Commands			    */
+/*								    */
+/* **************************************************************** */
+
+/* Delete the word at point, saving the text in the kill ring. */
+rl_kill_word (count, key)
+     int count, key;
+{
+  int orig_point = rl_point;
+
+  if (count < 0)
+    return (rl_backward_kill_word (-count));
+  else
+    {
+      rl_forward_word (count);
+
+      if (rl_point != orig_point)
+	rl_kill_text (orig_point, rl_point);
+
+      rl_point = orig_point;
+    }
+  return 0;
+}
+
+/* Rubout the word before point, placing it on the kill ring. */
+rl_backward_kill_word (count, ignore)
+     int count, ignore;
+{
+  int orig_point = rl_point;
+
+  if (count < 0)
+    return (rl_kill_word (-count));
+  else
+    {
+      rl_backward_word (count);
+
+      if (rl_point != orig_point)
+	rl_kill_text (orig_point, rl_point);
+    }
+  return 0;
+}
+
+/* Kill from here to the end of the line.  If DIRECTION is negative, kill
+   back to the line start instead. */
+rl_kill_line (direction, ignore)
+     int direction, ignore;
+{
+  int orig_point = rl_point;
+
+  if (direction < 0)
+    return (rl_backward_kill_line (1));
+  else
+    {
+      rl_end_of_line ();
+      if (orig_point != rl_point)
+	rl_kill_text (orig_point, rl_point);
+      rl_point = orig_point;
+    }
+  return 0;
+}
+
+/* Kill backwards to the start of the line.  If DIRECTION is negative, kill
+   forwards to the line end instead. */
+rl_backward_kill_line (direction, ignore)
+     int direction, ignore;
+{
+  int orig_point = rl_point;
+
+  if (direction < 0)
+    return (rl_kill_line (1));
+  else
+    {
+      if (!rl_point)
+	ding ();
+      else
+	{
+	  rl_beg_of_line ();
+	  rl_kill_text (orig_point, rl_point);
+	}
+    }
+  return 0;
+}
+
+/* Kill the whole line, no matter where point is. */
+rl_kill_full_line (count, ignore)
+     int count, ignore;
+{
+  rl_begin_undo_group ();
+  rl_point = 0;
+  rl_kill_text (rl_point, rl_end);
+  rl_end_undo_group ();
+  return 0;
+}
+
+/* Yank back the last killed text.  This ignores arguments. */
+rl_yank (count, ignore)
+     int count, ignore;
+{
+  if (!rl_kill_ring)
+    {
+      rl_abort ();
+      return -1;
+    }
+
+  rl_set_mark (rl_point);
+  rl_insert_text (rl_kill_ring[rl_kill_index]);
+  return 0;
+}
+
+/* If the last command was yank, or yank_pop, and the text just
+   before point is identical to the current kill item, then
+   delete that text from the line, rotate the index down, and
+   yank back some other text. */
+rl_yank_pop (count, key)
+     int count, key;
+{
+  int l;
+
+  if (((rl_last_func != rl_yank_pop) && (rl_last_func != rl_yank)) ||
+      !rl_kill_ring)
+    {
+      rl_abort ();
+      return -1;
+    }
+
+  l = strlen (rl_kill_ring[rl_kill_index]);
+  if (((rl_point - l) >= 0) &&
+      (strncmp (the_line + (rl_point - l),
+		rl_kill_ring[rl_kill_index], l) == 0))
+    {
+      rl_delete_text ((rl_point - l), rl_point);
+      rl_point -= l;
+      rl_kill_index--;
+      if (rl_kill_index < 0)
+	rl_kill_index = rl_kill_ring_length - 1;
+      rl_yank (1, 0);
+      return 0;
+    }
+  else
+    {
+      rl_abort ();
+      return -1;
+    }
+}
+
+/* Yank the COUNTth argument from the previous history line. */
+rl_yank_nth_arg (count, ignore)
+     int count, ignore;
+{
+  register HIST_ENTRY *entry = previous_history ();
+  char *arg;
+
+  if (entry)
+    next_history ();
+  else
+    {
+      ding ();
+      return -1;
+    }
+
+  arg = history_arg_extract (count, count, entry->line);
+  if (!arg || !*arg)
+    {
+      ding ();
+      return -1;
+    }
+
+  rl_begin_undo_group ();
+
+#if defined (VI_MODE)
+  /* Vi mode always inserts a space before yanking the argument, and it
+     inserts it right *after* rl_point. */
+  if (rl_editing_mode == vi_mode)
+    {
+      rl_vi_append_mode ();
+      rl_insert_text (" ");
+    }
+#endif /* VI_MODE */
+
+  rl_insert_text (arg);
+  free (arg);
+
+  rl_end_undo_group ();
+  return 0;
+}
+
+/* Yank the last argument from the previous history line.  This `knows'
+   how rl_yank_nth_arg treats a count of `$'.  With an argument, this
+   behaves the same as rl_yank_nth_arg. */
+int
+rl_yank_last_arg (count, key)
+     int count, key;
+{
+  if (rl_explicit_arg)
+    return (rl_yank_nth_arg (count, key));
+  else
+    return (rl_yank_nth_arg ('$', key));
+}
+
+/* How to toggle back and forth between editing modes. */
+rl_vi_editing_mode (count, key)
+     int count, key;
+{
+#if defined (VI_MODE)
+  rl_editing_mode = vi_mode;
+  rl_vi_insertion_mode ();
+  return 0;
+#endif /* VI_MODE */
+}
+
+rl_emacs_editing_mode (count, key)
+     int count, key;
+{
+  rl_editing_mode = emacs_mode;
+  _rl_keymap = emacs_standard_keymap;
+  return 0;
+}
+
+
+/* **************************************************************** */
+/*								    */
+/*			USG (System V) Support			    */
+/*								    */
+/* **************************************************************** */
+
+int
+rl_getc (stream)
+     FILE *stream;
+{
+  int result;
+  unsigned char c;
+
+#if defined (__GO32__)
+  if (isatty (0))
+    return (getkey () & 0x7F);
+#endif /* __GO32__ */
+
+  while (1)
+    {
+      result = read (fileno (stream), &c, sizeof (unsigned char));
+
+      if (result == sizeof (unsigned char))
+	return (c);
+
+      /* If zero characters are returned, then the file that we are
+	 reading from is empty!  Return EOF in that case. */
+      if (result == 0)
+	return (EOF);
+
+#if defined (EWOULDBLOCK)
+      if (errno == EWOULDBLOCK)
+	{
+	  int flags;
+
+	  if ((flags = fcntl (fileno (stream), F_GETFL, 0)) < 0)
+	    return (EOF);
+	  if (flags & O_NDELAY)
+	    {
+	      flags &= ~O_NDELAY;
+	      fcntl (fileno (stream), F_SETFL, flags);
+	      continue;
+	    }
+	  continue;
+	}
+#endif /* EWOULDBLOCK */
+
+#if defined (_POSIX_VERSION) && defined (EAGAIN) && defined (O_NONBLOCK)
+      if (errno == EAGAIN)
+	{
+	  int flags;
+
+	  if ((flags = fcntl (fileno (stream), F_GETFL, 0)) < 0)
+	    return (EOF);
+	  if (flags & O_NONBLOCK)
+	    {
+	      flags &= ~O_NONBLOCK;
+	      fcntl (fileno (stream), F_SETFL, flags);
+	      continue;
+	    }
+	}
+#endif /* _POSIX_VERSION && EAGAIN && O_NONBLOCK */
+
+#if !defined (__GO32__)
+      /* If the error that we received was SIGINT, then try again,
+	 this is simply an interrupted system call to read ().
+	 Otherwise, some error ocurred, also signifying EOF. */
+      if (errno != EINTR)
+	return (EOF);
+#endif /* !__GO32__ */
+    }
+}
+
+#if !defined (SHELL)
+#ifdef savestring
+#undef savestring
+#endif
+/* Backwards compatibilty, now that savestring has been removed from
+   all `public' readline header files. */
+char *
+savestring (s)
+     char *s;
+{
+  return ((char *)strcpy (xmalloc (1 + (int)strlen (s)), (s)));
+}
+#endif
+
+/* Function equivalents for the macros defined in chartypes.h. */
+#undef uppercase_p
+int
+uppercase_p (c)
+     int c;
+{
+  return (isupper (c));
+}
+
+#undef lowercase_p
+int
+lowercase_p (c)
+     int c;
+{
+  return (islower (c));
+}
+
+#undef pure_alphabetic
+int
+pure_alphabetic (c)
+     int c;
+{
+  return (isupper (c) || islower (c));
+}
+
+#undef digit_p
+int
+digit_p (c)
+     int c;
+{
+  return (isdigit (c));
+}
+
+#undef to_lower
+int
+to_lower (c)
+     int c;
+{
+  return (isupper (c) ? tolower (c) : c);
+}
+
+#undef to_upper
+int
+to_upper (c)
+     int c;
+{
+  return (islower (c) ? toupper (c) : c);
+}
+
+#undef digit_value
+int
+digit_value (c)
+     int c;
+{
+  return (isdigit (c) ? c - '0' : c);
+}
+
+#if defined (STATIC_MALLOC)
+
+/* **************************************************************** */
+/*								    */
+/*			xmalloc and xrealloc ()		     	    */
+/*								    */
+/* **************************************************************** */
+
+static void memory_error_and_abort ();
+
+static char *
+xmalloc (bytes)
+     int bytes;
+{
+  char *temp = (char *)malloc (bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+  return (temp);
+}
+
+static char *
+xrealloc (pointer, bytes)
+     char *pointer;
+     int bytes;
+{
+  char *temp;
+
+  if (!pointer)
+    temp = (char *)malloc (bytes);
+  else
+    temp = (char *)realloc (pointer, bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+
+  return (temp);
+}
+
+static void
+memory_error_and_abort ()
+{
+  fprintf (stderr, "readline: Out of virtual memory!\n");
+  abort ();
+}
+#endif /* STATIC_MALLOC */
+
+
+/* **************************************************************** */
+/*								    */
+/*			Testing Readline			    */
+/*								    */
+/* **************************************************************** */
+
+#if defined (TEST)
+
+main ()
+{
+  HIST_ENTRY **history_list ();
+  char *temp = (char *)NULL;
+  char *prompt = "readline% ";
+  int done = 0;
+
+  while (!done)
+    {
+      temp = readline (prompt);
+
+      /* Test for EOF. */
+      if (!temp)
+	exit (1);
+
+      /* If there is anything on the line, print it and remember it. */
+      if (*temp)
+	{
+	  fprintf (stderr, "%s\r\n", temp);
+	  add_history (temp);
+	}
+
+      /* Check for `command' that we handle. */
+      if (strcmp (temp, "quit") == 0)
+	done = 1;
+
+      if (strcmp (temp, "list") == 0)
+	{
+	  HIST_ENTRY **list = history_list ();
+	  register int i;
+	  if (list)
+	    {
+	      for (i = 0; list[i]; i++)
+		{
+		  fprintf (stderr, "%d: %s\r\n", i, list[i]->line);
+		  free (list[i]->line);
+		}
+	      free (list);
+	    }
+	}
+      free (temp);
+    }
+}
+
+#endif /* TEST */
+
+
+/*
+ * Local variables:
+ * compile-command: "gcc -g -traditional -I. -I.. -DTEST -o readline readline.c keymaps.o funmap.o history.o -ltermcap"
+ * end:
+ */
diff --git a/readline.h b/readline.h
new file mode 100644
index 0000000..b397177
--- /dev/null
+++ b/readline.h
@@ -0,0 +1,289 @@
+/* Readline.h -- the names of functions callable from within readline. */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#if !defined (_READLINE_H_)
+#define _READLINE_H_
+
+#if defined (READLINE_LIBRARY)
+#  include "keymaps.h"
+#  include "tilde.h"
+#else
+#  include <readline/keymaps.h>
+#  include <readline/tilde.h>
+#endif
+
+/* The functions for manipulating the text of the line within readline.
+Most of these functions are bound to keys by default. */
+extern int
+  rl_tilde_expand (),
+  rl_beg_of_line (), rl_backward (), rl_delete (), rl_end_of_line (),
+  rl_forward (), ding (), rl_backward (), rl_newline (), rl_kill_line (),
+  rl_clear_screen (), rl_get_next_history (), rl_get_previous_history (),
+  rl_quoted_insert (), rl_reverse_search_history (), rl_transpose_chars (),
+  rl_unix_line_discard (), rl_quoted_insert (), rl_unix_word_rubout (),
+  rl_yank (), rl_rubout (), rl_backward_word (), rl_kill_word (),
+  rl_forward_word (), rl_tab_insert (), rl_yank_pop (), rl_yank_nth_arg (),
+  rl_backward_kill_word (), rl_backward_kill_line (), rl_transpose_words (),
+  rl_complete (), rl_possible_completions (), rl_insert_completions (),
+  rl_do_lowercase_version (), rl_kill_full_line (),
+  rl_digit_argument (), rl_universal_argument (), rl_abort (),
+  rl_undo_command (), rl_revert_line (), rl_beginning_of_history (),
+  rl_end_of_history (), rl_forward_search_history (), rl_insert (),
+  rl_upcase_word (), rl_downcase_word (), rl_capitalize_word (),
+  rl_restart_output (), rl_re_read_init_file (), rl_dump_functions (),
+  rl_delete_horizontal_space (), rl_history_search_forward (),
+  rl_history_search_backward (), rl_tty_status (), rl_yank_last_arg ();
+
+/* `Public' utility functions. */
+extern int rl_insert_text (), rl_delete_text (), rl_kill_text ();
+extern int rl_complete_internal ();
+extern int rl_expand_prompt ();
+extern int rl_initialize ();
+extern int rl_set_signals (), rl_clear_signals ();
+extern int rl_init_argument (), rl_digit_argument ();
+extern int rl_read_key (), rl_getc (), rl_stuff_char ();
+extern int maybe_save_line (), maybe_unsave_line (), maybe_replace_line ();
+extern int rl_modifying ();
+
+extern int rl_begin_undo_group (), rl_end_undo_group ();
+extern void rl_add_undo (), free_undo_list ();
+extern int rl_do_undo ();
+
+/* Not available unless readline is compiled -DPAREN_MATCHING. */
+extern int rl_insert_close ();
+
+/* These are *both* defined even when VI_MODE is not. */
+extern int rl_vi_editing_mode (), rl_emacs_editing_mode ();
+
+/* Non incremental history searching. */
+extern int
+  rl_noninc_forward_search (), rl_noninc_reverse_search (),
+  rl_noninc_forward_search_again (), rl_noninc_reverse_search_again ();
+
+/* Things for vi mode. Not available unless readline is compiled -DVI_MODE. */
+extern int rl_vi_check (), rl_vi_textmod_command ();
+extern int
+  rl_vi_redo (), rl_vi_tilde_expand (),
+  rl_vi_movement_mode (), rl_vi_insertion_mode (), rl_vi_arg_digit (),
+  rl_vi_prev_word (), rl_vi_next_word (), rl_vi_char_search (),
+  rl_vi_eof_maybe (), rl_vi_append_mode (), rl_vi_put (),
+  rl_vi_append_eol (), rl_vi_insert_beg (), rl_vi_delete (), rl_vi_comment (),
+  rl_vi_first_print (), rl_vi_fword (), rl_vi_fWord (), rl_vi_bword (),
+  rl_vi_bWord (), rl_vi_eword (), rl_vi_eWord (), rl_vi_end_word (),
+  rl_vi_change_case (), rl_vi_match (), rl_vi_bracktype (),
+  rl_vi_change_char (), rl_vi_yank_arg (), rl_vi_search (),
+  rl_vi_search_again (),  rl_vi_subst (), rl_vi_overstrike (),
+  rl_vi_overstrike_delete (), rl_vi_replace(), rl_vi_column (),
+  rl_vi_delete_to (), rl_vi_change_to (), rl_vi_yank_to (),
+  rl_vi_complete (), rl_vi_fetch_history ();
+
+/* Keyboard macro commands. */
+extern int rl_start_kbd_macro (), rl_end_kbd_macro ();
+extern int rl_call_last_kbd_macro ();
+
+extern int rl_arrow_keys(), rl_refresh_line ();
+
+/* Maintaining the state of undo.  We remember individual deletes and inserts
+   on a chain of things to do. */
+
+/* The actions that undo knows how to undo.  Notice that UNDO_DELETE means
+   to insert some text, and UNDO_INSERT means to delete some text.   I.e.,
+   the code tells undo what to undo, not how to undo it. */
+enum undo_code { UNDO_DELETE, UNDO_INSERT, UNDO_BEGIN, UNDO_END };
+
+/* What an element of THE_UNDO_LIST looks like. */
+typedef struct undo_list {
+  struct undo_list *next;
+  int start, end;		/* Where the change took place. */
+  char *text;			/* The text to insert, if undoing a delete. */
+  enum undo_code what;		/* Delete, Insert, Begin, End. */
+} UNDO_LIST;
+
+/* The current undo list for RL_LINE_BUFFER. */
+extern UNDO_LIST *rl_undo_list;
+
+/* The data structure for mapping textual names to code addresses. */
+typedef struct {
+  char *name;
+  Function *function;
+} FUNMAP;
+
+extern FUNMAP **funmap;
+
+/* **************************************************************** */
+/*								    */
+/*			Well Published Variables		    */
+/*								    */
+/* **************************************************************** */
+
+/* The name of the calling program.  You should initialize this to
+   whatever was in argv[0].  It is used when parsing conditionals. */
+extern char *rl_readline_name;
+
+/* The line buffer that is in use. */
+extern char *rl_line_buffer;
+
+/* The location of point, and end. */
+extern int rl_point, rl_end;
+
+/* The name of the terminal to use. */
+extern char *rl_terminal_name;
+
+/* The input and output streams. */
+extern FILE *rl_instream, *rl_outstream;
+
+/* The basic list of characters that signal a break between words for the
+   completer routine.  The initial contents of this variable is what
+   breaks words in the shell, i.e. "n\"\\'`@$>". */
+extern char *rl_basic_word_break_characters;
+
+/* The list of characters that signal a break between words for
+   rl_complete_internal.  The default list is the contents of
+   rl_basic_word_break_characters.  */
+extern char *rl_completer_word_break_characters;
+
+/* List of characters which can be used to quote a substring of the line.
+   Completion occurs on the entire substring, and within the substring   
+   rl_completer_word_break_characters are treated as any other character,
+   unless they also appear within this list. */
+extern char *rl_completer_quote_characters;
+
+/* List of characters that are word break characters, but should be left
+   in TEXT when it is passed to the completion function.  The shell uses
+   this to help determine what kind of completing to do. */
+extern char *rl_special_prefixes;
+
+/* Pointer to the generator function for completion_matches ().
+   NULL means to use filename_entry_function (), the default filename
+   completer. */
+extern Function *rl_completion_entry_function;
+
+/* If rl_ignore_some_completions_function is non-NULL it is the address
+   of a function to call after all of the possible matches have been
+   generated, but before the actual completion is done to the input line.
+   The function is called with one argument; a NULL terminated array
+   of (char *).  If your function removes any of the elements, they
+   must be free()'ed. */
+extern Function *rl_ignore_some_completions_function;
+
+/* Pointer to alternative function to create matches.
+   Function is called with TEXT, START, and END.
+   START and END are indices in RL_LINE_BUFFER saying what the boundaries
+   of TEXT are.
+   If this function exists and returns NULL then call the value of
+   rl_completion_entry_function to try to match, otherwise use the
+   array of strings returned. */
+extern CPPFunction *rl_attempted_completion_function;
+
+/* If non-zero, then this is the address of a function to call just
+   before readline_internal () prints the first prompt. */
+extern Function *rl_startup_hook;
+
+/* If non-zero, then this is the address of a function to call when
+   completing on a directory name.  The function is called with
+   the address of a string (the current directory name) as an arg. */
+extern Function *rl_directory_completion_hook;
+
+/* Backwards compatibility with previous versions of readline. */
+#define rl_symbolic_link_hook rl_directory_completion_hook
+
+/* The address of a function to call periodically while Readline is
+   awaiting character input, or NULL, for no event handling. */
+extern Function *rl_event_hook;
+
+/* Non-zero means that modified history lines are preceded
+   with an asterisk. */
+extern int rl_show_star;
+
+/* Non-zero means that the results of the matches are to be treated
+   as filenames.  This is ALWAYS zero on entry, and can only be changed
+   within a completion entry finder function. */
+extern int rl_filename_completion_desired;
+
+/* Non-zero means that the results of the matches are to be quoted using
+   double quotes (or an application-specific quoting mechanism) if the
+   filename contains any characters in rl_word_break_chars.  This is
+   ALWAYS non-zero on entry, and can only be changed within a completion
+   entry finder function. */
+extern int rl_filename_quoting_desired;
+
+/* Non-zero means to suppress normal filename completion after the
+   user-specified completion function has been called. */
+extern int rl_attempted_completion_over;
+
+/* **************************************************************** */
+/*								    */
+/*			Well Published Functions		    */
+/*								    */
+/* **************************************************************** */
+
+/* Read a line of input.  Prompt with PROMPT.  A NULL PROMPT means none. */
+extern char *readline ();
+
+/* These functions are from complete.c. */
+/* Return an array of strings which are the result of repeatadly calling
+   FUNC with TEXT. */
+extern char **completion_matches ();
+extern char *username_completion_function ();
+extern char *filename_completion_function ();
+
+/* These functions are from bind.c. */
+/* rl_add_defun (char *name, Function *function, int key)
+   Add NAME to the list of named functions.  Make FUNCTION
+   be the function that gets called.
+   If KEY is not -1, then bind it. */
+extern int rl_add_defun ();
+extern int rl_bind_key (), rl_bind_key_in_map ();
+extern int rl_unbind_key (), rl_unbind_key_in_map ();
+extern int rl_set_key ();
+extern int rl_macro_bind (), rl_generic_bind (), rl_variable_bind ();
+extern int rl_translate_keyseq ();
+extern Function *rl_named_function (), *rl_function_of_keyseq ();
+extern int rl_parse_and_bind ();
+extern Keymap rl_get_keymap (), rl_get_keymap_by_name ();
+extern void rl_set_keymap ();
+extern char **rl_invoking_keyseqs (), **rl_invoking_keyseqs_in_map ();
+extern void rl_function_dumper ();
+extern int rl_read_init_file ();
+
+/* Functions in funmap.c */
+extern void rl_list_funmap_names ();
+extern void rl_initialize_funmap ();
+
+/* Functions in display.c */
+extern void rl_redisplay ();
+extern int rl_message (), rl_clear_message ();
+extern int rl_reset_line_state ();
+extern int rl_character_len ();
+extern int rl_show_char ();
+extern int crlf (), rl_on_new_line ();
+extern int rl_forced_update_display ();
+
+/* Definitions available for use by readline clients. */
+#define RL_PROMPT_START_IGNORE	'\001'
+#define RL_PROMPT_END_IGNORE	'\002'
+
+#if !defined (savestring)
+extern char *savestring ();	/* XXX backwards compatibility */
+#endif
+
+#endif /* _READLINE_H_ */
diff --git a/rlconf.h b/rlconf.h
new file mode 100644
index 0000000..0035b93
--- /dev/null
+++ b/rlconf.h
@@ -0,0 +1,57 @@
+/* rlconf.h -- readline configuration definitions */
+
+/* Copyright (C) 1994 Free Software Foundation, Inc.
+
+   This file contains the Readline Library (the Library), a set of
+   routines for providing Emacs style line input to programs that ask
+   for it.
+
+   The Library is free software; you can redistribute it and/or modify
+   it under the terms of the GNU General Public License as published by
+   the Free Software Foundation; either version 1, or (at your option)
+   any later version.
+
+   The Library is distributed in the hope that it will be useful, but
+   WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#if !defined (_RLCONF_H_)
+#define _RLCONF_H_
+
+/* Define this if you want the vi-mode editing available. */
+#define VI_MODE
+
+/* Define this to get an indication of file type when listing completions. */
+#define VISIBLE_STATS
+
+/* If defined, readline shows opening parens and braces when closing
+   paren or brace entered. */
+/* #define PAREN_MATCHING */
+
+/* This definition is needed by readline.c, rltty.c, and signals.c. */
+/* If on, then readline handles signals in a way that doesn't screw. */
+#define HANDLE_SIGNALS
+
+/* Ugly but working hack for binding prefix meta. */
+#define PREFIX_META_HACK
+
+/* The final, last-ditch effort file name for an init file. */
+#define DEFAULT_INPUTRC "~/.inputrc"
+
+/* If defined, expand tabs to spaces. */
+#define DISPLAY_TABS
+
+/* If defined, use the terminal escape sequence to move the cursor forward
+   over a character when updating the line rather than rewriting it. */
+/* #define HACK_TERMCAP_MOTION */
+
+/* The string inserted by the vi-mode `insert comment' command. */
+#define VI_COMMENT_BEGIN_DEFAULT "#"
+
+#endif /* _RLCONF_H_ */
diff --git a/rldefs.h b/rldefs.h
new file mode 100644
index 0000000..249c927
--- /dev/null
+++ b/rldefs.h
@@ -0,0 +1,207 @@
+/* rldefs.h -- an attempt to isolate some of the system-specific defines
+   for readline.  This should be included after any files that define
+   system-specific constants like _POSIX_VERSION or USG. */
+
+/* Copyright (C) 1987,1989 Free Software Foundation, Inc.
+
+   This file contains the Readline Library (the Library), a set of
+   routines for providing Emacs style line input to programs that ask
+   for it.
+
+   The Library is free software; you can redistribute it and/or modify
+   it under the terms of the GNU General Public License as published by
+   the Free Software Foundation; either version 1, or (at your option)
+   any later version.
+
+   The Library is distributed in the hope that it will be useful, but
+   WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#if !defined (_RLDEFS_H)
+#define _RLDEFS_H
+
+#if defined (HAVE_CONFIG_H)
+#  include "config.h"
+#endif
+
+#if !defined (PRAGMA_ALLOCA)
+#  include "memalloc.h"
+#endif
+
+#define NEW_TTY_DRIVER
+#define HAVE_BSD_SIGNALS
+/* #define USE_XON_XOFF */
+
+#if defined (__linux__) || defined (HAVE_TERMCAP_H)
+#  include <termcap.h>
+#endif /* __linux__ || HAVE_TERMCAP_H */
+
+/* Some USG machines have BSD signal handling (sigblock, sigsetmask, etc.) */
+#if defined (USG) && !defined (hpux)
+#  undef HAVE_BSD_SIGNALS
+#endif
+
+/* System V machines use termio. */
+#if !defined (_POSIX_VERSION)
+#  if defined (USG) || defined (hpux) || defined (Xenix) || defined (sgi) || \
+      defined (DGUX) || defined (HAVE_TERMIO_H)
+#    undef NEW_TTY_DRIVER
+#    define TERMIO_TTY_DRIVER
+#    include <termio.h>
+#    if !defined (TCOON)
+#      define TCOON 1
+#    endif
+#  endif /* USG || hpux || Xenix || sgi || DUGX || HAVE_TERMIO_H */
+#endif /* !_POSIX_VERSION */
+
+/* Posix systems use termios and the Posix signal functions. */
+#if defined (_POSIX_VERSION)
+#  if !defined (TERMIOS_MISSING)
+#    undef NEW_TTY_DRIVER
+#    define TERMIOS_TTY_DRIVER
+#    include <termios.h>
+#  endif /* !TERMIOS_MISSING */
+#  define HAVE_POSIX_SIGNALS
+#  if !defined (O_NDELAY)
+#    define O_NDELAY O_NONBLOCK	/* Posix-style non-blocking i/o */
+#  endif /* O_NDELAY */
+#endif /* _POSIX_VERSION */
+
+/* System V.3 machines have the old 4.1 BSD `reliable' signal interface. */
+#if !defined (HAVE_BSD_SIGNALS) && !defined (HAVE_POSIX_SIGNALS)
+#  if defined (USGr3) && !defined (XENIX_22)
+#    if !defined (HAVE_USG_SIGHOLD)
+#      define HAVE_USG_SIGHOLD
+#    endif /* !HAVE_USG_SIGHOLD */
+#  endif /* USGr3 && !XENIX_22 */
+#endif /* !HAVE_BSD_SIGNALS && !HAVE_POSIX_SIGNALS */
+
+/* Other (BSD) machines use sgtty. */
+#if defined (NEW_TTY_DRIVER)
+#  include <sgtty.h>
+#endif
+
+/* Define _POSIX_VDISABLE if we are not using the `new' tty driver and
+   it is not already defined.  It is used both to determine if a
+   special character is disabled and to disable certain special
+   characters.  Posix systems should set to 0, USG systems to -1. */
+#if !defined (NEW_TTY_DRIVER) && !defined (_POSIX_VDISABLE)
+#  if defined (_POSIX_VERSION)
+#    define _POSIX_VDISABLE 0
+#  else /* !_POSIX_VERSION */
+#    define _POSIX_VDISABLE -1
+#  endif /* !_POSIX_VERSION */
+#endif /* !NEW_TTY_DRIVER && !_POSIX_VDISABLE */
+
+#if !defined (SHELL) && (defined (_POSIX_VERSION) || defined (USGr3))
+#  if !defined (HAVE_DIRENT_H)
+#    define HAVE_DIRENT_H
+#  endif /* !HAVE_DIRENT_H */
+#endif /* !SHELL && (_POSIX_VERSION || USGr3) */
+
+#if defined (HAVE_DIRENT_H)
+#  include <dirent.h>
+#  define D_NAMLEN(d) strlen ((d)->d_name)
+#else /* !HAVE_DIRENT_H */
+#  define D_NAMLEN(d) ((d)->d_namlen)
+#  if defined (USG)
+#    if defined (Xenix)
+#      include <sys/ndir.h>
+#    else /* !Xenix (but USG...) */
+#      include "ndir.h"
+#    endif /* !Xenix */
+#  else /* !USG */
+#    include <sys/dir.h>
+#  endif /* !USG */
+#  if !defined (dirent)
+#    define dirent direct
+#  endif /* !dirent */
+#endif /* !HAVE_DIRENT_H */
+
+#if defined (USG) && defined (TIOCGWINSZ) && !defined (Linux)
+#  if defined (HAVE_SYS_STREAM_H)
+#    include <sys/stream.h>
+#  endif /* HAVE_SYS_STREAM_H */
+#  if defined (HAVE_SYS_PTEM_H)
+#    include <sys/ptem.h>
+#  endif /* HAVE_SYS_PTEM_H */
+#  if defined (HAVE_SYS_PTE_H)
+#    include <sys/pte.h>
+#  endif /* HAVE_SYS_PTE_H */
+#endif /* USG && TIOCGWINSZ && !Linux */
+
+/* Posix macro to check file in statbuf for directory-ness.
+   This requires that <sys/stat.h> be included before this test. */
+#if defined (S_IFDIR) && !defined (S_ISDIR)
+#  define S_ISDIR(m) (((m)&S_IFMT) == S_IFDIR)
+#endif
+
+/* Decide which flavor of the header file describing the C library
+   string functions to include and include it. */
+
+#if defined (USG) || defined (NeXT)
+#  if !defined (HAVE_STRING_H)
+#    define HAVE_STRING_H
+#  endif /* !HAVE_STRING_H */
+#endif /* USG || NeXT */
+
+#if defined (HAVE_STRING_H)
+#  include <string.h>
+#else /* !HAVE_STRING_H */
+#  include <strings.h>
+#endif /* !HAVE_STRING_H */
+
+#if !defined (strchr) && !defined (__STDC__)
+extern char *strchr (), *strrchr ();
+#endif /* !strchr && !__STDC__ */
+
+#if defined (HAVE_VARARGS_H)
+#  include <varargs.h>
+#endif /* HAVE_VARARGS_H */
+
+/* This is needed to include support for TIOCGWINSZ and window resizing. */
+#if defined (OSF1) || defined (BSD386) || defined (NetBSD) || \
+    defined (__BSD_4_4__) || defined (FreeBSD) || defined (_386BSD) || \
+    defined (AIX)
+#  define GWINSZ_IN_SYS_IOCTL
+#endif
+
+#if !defined (emacs_mode)
+#  define no_mode -1
+#  define vi_mode 0
+#  define emacs_mode 1
+#endif
+
+/* If you cast map[key].function to type (Keymap) on a Cray,
+   the compiler takes the value of map[key].function and
+   divides it by 4 to convert between pointer types (pointers
+   to functions and pointers to structs are different sizes).
+   This is not what is wanted. */
+#if defined (CRAY)
+#  define FUNCTION_TO_KEYMAP(map, key)	(Keymap)((int)map[key].function)
+#  define KEYMAP_TO_FUNCTION(data)	(Function *)((int)(data))
+#else
+#  define FUNCTION_TO_KEYMAP(map, key)	(Keymap)(map[key].function)
+#  define KEYMAP_TO_FUNCTION(data)	(Function *)(data)
+#endif
+
+#ifndef savestring
+extern char *xmalloc ();
+#define savestring(x) strcpy (xmalloc (1 + strlen (x)), (x))
+#endif
+
+/* Possible values for _rl_bell_preference. */
+#define NO_BELL 0
+#define AUDIBLE_BELL 1
+#define VISIBLE_BELL 2
+
+/* CONFIGURATION SECTION */
+#include "rlconf.h"
+
+#endif /* !_RLDEFS_H */
diff --git a/rltty.c b/rltty.c
new file mode 100644
index 0000000..ebb8413
--- /dev/null
+++ b/rltty.c
@@ -0,0 +1,697 @@
+/* rltty.c -- functions to prepare and restore the terminal for readline's
+   use. */
+
+/* Copyright (C) 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#include <sys/types.h>
+#include <signal.h>
+#include <errno.h>
+#include <stdio.h>
+
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif /* HAVE_UNISTD_H */
+
+#include "rldefs.h"
+#include "readline.h"
+
+#if !defined (errno)
+extern int errno;
+#endif /* !errno */
+
+extern int readline_echoing_p;
+extern int _rl_eof_char;
+
+#if defined (__GO32__)
+#  include <sys/pc.h>
+#  undef HANDLE_SIGNALS
+#endif /* __GO32__ */
+
+static int output_was_flushed;
+
+/* **************************************************************** */
+/*								    */
+/*			   Signal Management			    */
+/*								    */
+/* **************************************************************** */
+
+#if defined (HAVE_POSIX_SIGNALS)
+static sigset_t sigint_set, sigint_oset;
+#else /* !HAVE_POSIX_SIGNALS */
+#  if defined (HAVE_BSD_SIGNALS)
+static int sigint_oldmask;
+#  endif /* HAVE_BSD_SIGNALS */
+#endif /* !HAVE_POSIX_SIGNALS */
+
+static int sigint_blocked = 0;
+
+/* Cause SIGINT to not be delivered until the corresponding call to
+   release_sigint(). */
+static void
+block_sigint ()
+{
+  if (sigint_blocked)
+    return;
+
+#if defined (HAVE_POSIX_SIGNALS)
+  sigemptyset (&sigint_set);
+  sigemptyset (&sigint_oset);
+  sigaddset (&sigint_set, SIGINT);
+  sigprocmask (SIG_BLOCK, &sigint_set, &sigint_oset);
+#else /* !HAVE_POSIX_SIGNALS */
+#  if defined (HAVE_BSD_SIGNALS)
+  sigint_oldmask = sigblock (sigmask (SIGINT));
+#  else /* !HAVE_BSD_SIGNALS */
+#    if defined (HAVE_USG_SIGHOLD)
+  sighold (SIGINT);
+#    endif /* HAVE_USG_SIGHOLD */
+#  endif /* !HAVE_BSD_SIGNALS */
+#endif /* !HAVE_POSIX_SIGNALS */
+  sigint_blocked = 1;
+}
+
+/* Allow SIGINT to be delivered. */
+static void
+release_sigint ()
+{
+  if (!sigint_blocked)
+    return;
+
+#if defined (HAVE_POSIX_SIGNALS)
+  sigprocmask (SIG_SETMASK, &sigint_oset, (sigset_t *)NULL);
+#else
+#  if defined (HAVE_BSD_SIGNALS)
+  sigsetmask (sigint_oldmask);
+#  else /* !HAVE_BSD_SIGNALS */
+#    if defined (HAVE_USG_SIGHOLD)
+  sigrelse (SIGINT);
+#    endif /* HAVE_USG_SIGHOLD */
+#  endif /* !HAVE_BSD_SIGNALS */
+#endif /* !HAVE_POSIX_SIGNALS */
+
+  sigint_blocked = 0;
+}
+
+/* **************************************************************** */
+/*								    */
+/*	 	Controlling the Meta Key and Keypad		    */
+/*								    */
+/* **************************************************************** */
+
+extern int term_has_meta;
+extern char *term_mm;
+extern char *term_mo;
+
+extern char *term_ks;
+extern char *term_ke;
+
+static int
+outchar (c)
+     int c;
+{
+  return putc (c, rl_outstream);
+}
+
+/* Turn on/off the meta key depending on ON. */
+static void
+control_meta_key (on)
+     int on;
+{
+  if (term_has_meta)
+    {
+      if (on && term_mm)
+	tputs (term_mm, 1, outchar);
+      else if (!on && term_mo)
+	tputs (term_mo, 1, outchar);
+    }
+}
+
+static void
+control_keypad (on)
+     int on;
+{
+  if (on && term_ks)
+    tputs (term_ks, 1, outchar);
+  else if (!on && term_ke)
+    tputs (term_ke, 1, outchar);
+}
+
+/* **************************************************************** */
+/*								    */
+/*		      Saving and Restoring the TTY	    	    */
+/*								    */
+/* **************************************************************** */
+
+/* Non-zero means that the terminal is in a prepped state. */
+static int terminal_prepped = 0;
+
+/* If non-zero, means that this process has called tcflow(fd, TCOOFF)
+   and output is suspended. */
+#if defined (__ksr1__)
+static int ksrflow = 0;
+#endif
+#if defined (NEW_TTY_DRIVER)
+
+/* Values for the `flags' field of a struct bsdtty.  This tells which
+   elements of the struct bsdtty have been fetched from the system and
+   are valid. */
+#define SGTTY_SET	0x01
+#define LFLAG_SET	0x02
+#define TCHARS_SET	0x04
+#define LTCHARS_SET	0x08
+
+struct bsdtty {
+  struct sgttyb sgttyb;	/* Basic BSD tty driver information. */
+  int lflag;		/* Local mode flags, like LPASS8. */
+#if defined (TIOCGETC)
+  struct tchars tchars;	/* Terminal special characters, including ^S and ^Q. */
+#endif
+#if defined (TIOCGLTC)
+  struct ltchars ltchars; /* 4.2 BSD editing characters */
+#endif
+  int flags;		/* Bitmap saying which parts of the struct are valid. */
+};
+
+#define TIOTYPE struct bsdtty
+
+static TIOTYPE otio;
+
+static int
+get_tty_settings (tty, tiop)
+     int tty;
+     TIOTYPE *tiop;
+{
+#if !defined (SHELL) && defined (TIOCGWINSZ)
+  struct winsize w;
+
+  if (ioctl (tty, TIOCGWINSZ, &w) == 0)
+      (void) ioctl (tty, TIOCSWINSZ, &w);
+#endif
+
+  tiop->flags = tiop->lflag = 0;
+
+  ioctl (tty, TIOCGETP, &(tiop->sgttyb));
+  tiop->flags |= SGTTY_SET;
+
+#if defined (TIOCLGET)
+  ioctl (tty, TIOCLGET, &(tiop->lflag));
+  tiop->flags |= LFLAG_SET;
+#endif
+
+#if defined (TIOCGETC)
+  ioctl (tty, TIOCGETC, &(tiop->tchars));
+  tiop->flags |= TCHARS_SET;
+#endif
+
+#if defined (TIOCGLTC)
+  ioctl (tty, TIOCGLTC, &(tiop->ltchars));
+  tiop->flags |= LTCHARS_SET;
+#endif
+
+  return 0;
+}
+
+set_tty_settings (tty, tiop)
+     int tty;
+     TIOTYPE *tiop;
+{
+  if (tiop->flags & SGTTY_SET)
+    {
+      ioctl (tty, TIOCSETN, &(tiop->sgttyb));
+      tiop->flags &= ~SGTTY_SET;
+    }
+  readline_echoing_p = 1;
+
+#if defined (TIOCLSET)
+  if (tiop->flags & LFLAG_SET)
+    {
+      ioctl (tty, TIOCLSET, &(tiop->lflag));
+      tiop->flags &= ~LFLAG_SET;
+    }
+#endif
+
+#if defined (TIOCSETC)
+  if (tiop->flags & TCHARS_SET)
+    {
+      ioctl (tty, TIOCSETC, &(tiop->tchars));
+      tiop->flags &= ~TCHARS_SET;
+    }
+#endif
+
+#if defined (TIOCSLTC)
+  if (tiop->flags & LTCHARS_SET)
+    {
+      ioctl (tty, TIOCSLTC, &(tiop->ltchars));
+      tiop->flags &= ~LTCHARS_SET;
+    }
+#endif
+
+  return 0;
+}
+
+static void
+prepare_terminal_settings (meta_flag, otio, tiop)
+     int meta_flag;
+     TIOTYPE otio, *tiop;
+{
+#if !defined (__GO32__)
+  readline_echoing_p = (otio.sgttyb.sg_flags & ECHO);
+
+  /* Copy the original settings to the structure we're going to use for
+     our settings. */
+  tiop->sgttyb = otio.sgttyb;
+  tiop->lflag = otio.lflag;
+#if defined (TIOCGETC)
+  tiop->tchars = otio.tchars;
+#endif
+#if defined (TIOCGLTC)
+  tiop->ltchars = otio.ltchars;
+#endif
+  tiop->flags = otio.flags;
+
+  /* First, the basic settings to put us into character-at-a-time, no-echo
+     input mode. */
+  tiop->sgttyb.sg_flags &= ~(ECHO | CRMOD);
+  tiop->sgttyb.sg_flags |= CBREAK;
+
+  /* If this terminal doesn't care how the 8th bit is used, then we can
+     use it for the meta-key.  If only one of even or odd parity is
+     specified, then the terminal is using parity, and we cannot. */
+#if !defined (ANYP)
+#  define ANYP (EVENP | ODDP)
+#endif
+  if (((otio.sgttyb.sg_flags & ANYP) == ANYP) ||
+      ((otio.sgttyb.sg_flags & ANYP) == 0))
+    {
+      tiop->sgttyb.sg_flags |= ANYP;
+
+      /* Hack on local mode flags if we can. */
+#if defined (TIOCLGET)
+#  if defined (LPASS8)
+      tiop->lflag |= LPASS8;
+#  endif /* LPASS8 */
+#endif /* TIOCLGET */
+    }
+
+#if defined (TIOCGETC)
+#  if defined (USE_XON_XOFF)
+  /* Get rid of terminal output start and stop characters. */
+  tiop->tchars.t_stopc = -1; /* C-s */
+  tiop->tchars.t_startc = -1; /* C-q */
+
+  /* If there is an XON character, bind it to restart the output. */
+  if (otio.tchars.t_startc != -1)
+    rl_bind_key (otio.tchars.t_startc, rl_restart_output);
+#  endif /* USE_XON_XOFF */
+
+  /* If there is an EOF char, bind _rl_eof_char to it. */
+  if (otio.tchars.t_eofc != -1)
+    _rl_eof_char = otio.tchars.t_eofc;
+
+#  if defined (NO_KILL_INTR)
+  /* Get rid of terminal-generated SIGQUIT and SIGINT. */
+  tiop->tchars.t_quitc = -1; /* C-\ */
+  tiop->tchars.t_intrc = -1; /* C-c */
+#  endif /* NO_KILL_INTR */
+#endif /* TIOCGETC */
+
+#if defined (TIOCGLTC)
+  /* Make the interrupt keys go away.  Just enough to make people happy. */
+  tiop->ltchars.t_dsuspc = -1;	/* C-y */
+  tiop->ltchars.t_lnextc = -1;	/* C-v */
+#endif /* TIOCGLTC */
+#endif /* !__GO32__ */
+}
+
+#else  /* !defined (NEW_TTY_DRIVER) */
+
+#if !defined (VMIN)
+#  define VMIN VEOF
+#endif
+
+#if !defined (VTIME)
+#  define VTIME VEOL
+#endif
+
+#if defined (TERMIOS_TTY_DRIVER)
+#  define TIOTYPE struct termios
+#  define DRAIN_OUTPUT(fd)	tcdrain (fd)
+#  define GETATTR(tty, tiop)	(tcgetattr (tty, tiop))
+#  define SETATTR(tty, tiop)	(tcsetattr (tty, TCSANOW, tiop))
+#else
+#  define TIOTYPE struct termio
+#  define DRAIN_OUTPUT(fd)
+#  define GETATTR(tty, tiop)	(ioctl (tty, TCGETA, tiop))
+#  define SETATTR(tty, tiop)	(ioctl (tty, TCSETA, tiop))
+#endif /* !TERMIOS_TTY_DRIVER */
+
+static TIOTYPE otio;
+
+#if defined (FLUSHO)
+#  define OUTPUT_BEING_FLUSHED(tp)  (tp->c_lflag & FLUSHO)
+#else
+#  define OUTPUT_BEING_FLUSHED(tp)  0
+#endif
+
+static int
+get_tty_settings (tty, tiop)
+     int tty;
+     TIOTYPE *tiop;
+{
+#if !defined (SHELL) && defined (TIOCGWINSZ)
+  struct winsize w;
+
+  if (ioctl (tty, TIOCGWINSZ, &w) == 0)
+      (void) ioctl (tty, TIOCSWINSZ, &w);
+#endif
+
+  /* Keep looping if output is being flushed after a ^O (or whatever
+     the flush character is). */
+  while (GETATTR (tty, tiop) < 0 || OUTPUT_BEING_FLUSHED (tiop))
+    {
+      if (OUTPUT_BEING_FLUSHED (tiop))
+        continue;
+      if (errno != EINTR)
+	return -1;
+      errno = 0;
+    }
+  return 0;
+}
+
+static int
+set_tty_settings (tty, tiop)
+     int tty;
+     TIOTYPE *tiop;
+{
+  while (SETATTR (tty, tiop) < 0)
+    {
+      if (errno != EINTR)
+	return -1;
+      errno = 0;
+    }
+
+#if 0
+
+#if defined (TERMIOS_TTY_DRIVER)
+#  if defined (__ksr1__)
+  if (ksrflow)
+    {
+      ksrflow = 0;
+      tcflow (tty, TCOON);
+    }
+#  else /* !ksr1 */
+  tcflow (tty, TCOON);		/* Simulate a ^Q. */
+#  endif /* !ksr1 */
+#else
+  ioctl (tty, TCXONC, 1);	/* Simulate a ^Q. */
+#endif /* !TERMIOS_TTY_DRIVER */
+
+#endif
+
+  return 0;
+}
+
+static void
+prepare_terminal_settings (meta_flag, otio, tiop)
+     int meta_flag;
+     TIOTYPE otio, *tiop;
+{
+  readline_echoing_p = (otio.c_lflag & ECHO);
+
+  tiop->c_lflag &= ~(ICANON | ECHO);
+
+  if ((unsigned char) otio.c_cc[VEOF] != (unsigned char) _POSIX_VDISABLE)
+    _rl_eof_char = otio.c_cc[VEOF];
+
+#if defined (USE_XON_XOFF)
+#if defined (IXANY)
+  tiop->c_iflag &= ~(IXON | IXOFF | IXANY);
+#else
+  /* `strict' Posix systems do not define IXANY. */
+  tiop->c_iflag &= ~(IXON | IXOFF);
+#endif /* IXANY */
+#endif /* USE_XON_XOFF */
+
+  /* Only turn this off if we are using all 8 bits. */
+  if (((tiop->c_cflag & CSIZE) == CS8) || meta_flag)
+    tiop->c_iflag &= ~(ISTRIP | INPCK);
+
+  /* Make sure we differentiate between CR and NL on input. */
+  tiop->c_iflag &= ~(ICRNL | INLCR);
+
+#if !defined (HANDLE_SIGNALS)
+  tiop->c_lflag &= ~ISIG;
+#else
+  tiop->c_lflag |= ISIG;
+#endif
+
+  tiop->c_cc[VMIN] = 1;
+  tiop->c_cc[VTIME] = 0;
+
+  if (tiop->c_lflag & FLUSHO)
+    {
+      output_was_flushed = 1;
+      tiop->c_lflag &= ~FLUSHO;
+      otio.c_lflag &= ~FLUSHO;
+    }
+
+  /* Turn off characters that we need on Posix systems with job control,
+     just to be sure.  This includes ^Y and ^V.  This should not really
+     be necessary.  */
+#if defined (TERMIOS_TTY_DRIVER) && defined (_POSIX_VDISABLE)
+
+#if defined (VLNEXT)
+  tiop->c_cc[VLNEXT] = _POSIX_VDISABLE;
+#endif
+
+#if defined (VDSUSP)
+  tiop->c_cc[VDSUSP] = _POSIX_VDISABLE;
+#endif
+
+#endif /* TERMIOS_TTY_DRIVER && _POSIX_VDISABLE */
+}
+#endif  /* NEW_TTY_DRIVER */
+
+/* Put the terminal in CBREAK mode so that we can detect key presses. */
+void
+rl_prep_terminal (meta_flag)
+     int meta_flag;
+{
+#if !defined (__GO32__)
+  int tty = fileno (rl_instream);
+  TIOTYPE tio;
+
+  if (terminal_prepped)
+    return;
+
+  /* Try to keep this function from being INTerrupted. */
+  block_sigint ();
+
+  if (get_tty_settings (tty, &tio) < 0)
+    {
+      release_sigint ();
+      return;
+    }
+
+  otio = tio;
+
+  prepare_terminal_settings (meta_flag, otio, &tio);
+
+  if (set_tty_settings (tty, &tio) < 0)
+    {
+      release_sigint ();
+      return;
+    }
+
+  if (output_was_flushed)
+    output_was_flushed = 0;
+
+  control_meta_key (1);
+  control_keypad (1);
+  fflush (rl_outstream);
+  terminal_prepped = 1;
+
+  release_sigint ();
+#endif /* !__GO32__ */
+}
+
+/* Restore the terminal's normal settings and modes. */
+void
+rl_deprep_terminal ()
+{
+#if !defined (__GO32__)
+  int tty = fileno (rl_instream);
+
+  if (!terminal_prepped)
+    return;
+
+  /* Try to keep this function from being INTerrupted. */
+  block_sigint ();
+
+  if (set_tty_settings (tty, &otio) < 0)
+    {
+      release_sigint ();
+      return;
+    }
+
+  control_meta_key (0);
+  control_keypad (0);
+  fflush (rl_outstream);
+  terminal_prepped = 0;
+
+  release_sigint ();
+#endif /* !__GO32__ */
+}
+
+/* **************************************************************** */
+/*								    */
+/*			Bogus Flow Control      		    */
+/*								    */
+/* **************************************************************** */
+
+rl_restart_output (count, key)
+     int count, key;
+{
+  int fildes = fileno (rl_outstream);
+#if defined (TIOCSTART)
+#if defined (apollo)
+  ioctl (&fildes, TIOCSTART, 0);
+#else
+  ioctl (fildes, TIOCSTART, 0);
+#endif /* apollo */
+
+#else /* !TIOCSTART */
+#  if defined (TERMIOS_TTY_DRIVER)
+#    if defined (__ksr1__)
+  if (ksrflow)
+    {
+      ksrflow = 0;
+      tcflow (fildes, TCOON);
+    }
+#    else /* !ksr1 */
+  tcflow (fildes, TCOON);		/* Simulate a ^Q. */
+#    endif /* !ksr1 */
+#  else /* !TERMIOS_TTY_DRIVER */
+#    if defined (TCXONC)
+  ioctl (fildes, TCXONC, TCOON);
+#    endif /* TCXONC */
+#  endif /* !TERMIOS_TTY_DRIVER */
+#endif /* !TIOCSTART */
+
+  return 0;
+}
+
+rl_stop_output (count, key)
+     int count, key;
+{
+  int fildes = fileno (rl_instream);
+
+#if defined (TIOCSTOP)
+# if defined (apollo)
+  ioctl (&fildes, TIOCSTOP, 0);
+# else
+  ioctl (fildes, TIOCSTOP, 0);
+# endif /* apollo */
+#else /* !TIOCSTOP */
+# if defined (TERMIOS_TTY_DRIVER)
+#  if defined (__ksr1__)
+  ksrflow = 1;
+#  endif /* ksr1 */
+  tcflow (fildes, TCOOFF);
+# else
+#   if defined (TCXONC)
+  ioctl (fildes, TCXONC, TCOON);
+#   endif /* TCXONC */
+# endif /* !TERMIOS_TTY_DRIVER */
+#endif /* !TIOCSTOP */
+
+  return 0;
+}
+
+/* **************************************************************** */
+/*								    */
+/*			Default Key Bindings			    */
+/*								    */
+/* **************************************************************** */
+void
+rltty_set_default_bindings (kmap)
+     Keymap kmap;
+{
+  TIOTYPE ttybuff;
+  int tty = fileno (rl_instream);
+
+#if defined (NEW_TTY_DRIVER)
+
+#define SET_SPECIAL(sc, func) \
+  do \
+    { \
+      int ic; \
+      ic = sc; \
+      if (ic != -1 && kmap[ic].type == ISFUNC) \
+	kmap[ic].function = func; \
+    } \
+  while (0)
+
+  if (get_tty_settings (tty, &ttybuff) == 0)
+    {
+      if (ttybuff.flags & SGTTY_SET)
+	{
+	  SET_SPECIAL (ttybuff.sgttyb.sg_erase, rl_rubout);
+	  SET_SPECIAL (ttybuff.sgttyb.sg_kill, rl_unix_line_discard);
+	}
+
+#  if defined (TIOCGLTC)
+      if (ttybuff.flags & LTCHARS_SET)
+	{
+	  SET_SPECIAL (ttybuff.ltchars.t_werasc, rl_unix_word_rubout);
+	  SET_SPECIAL (ttybuff.ltchars.t_lnextc, rl_quoted_insert);
+	}
+#  endif /* TIOCGLTC */
+    }
+
+#else /* !NEW_TTY_DRIVER */
+
+#define SET_SPECIAL(sc, func) \
+  do \
+    { \
+      unsigned char uc; \
+      uc = ttybuff.c_cc[sc]; \
+      if (uc != (unsigned char)_POSIX_VDISABLE && kmap[uc].type == ISFUNC) \
+	kmap[uc].function = func; \
+    } \
+  while (0)
+
+  if (get_tty_settings (tty, &ttybuff) == 0)
+    {
+      SET_SPECIAL (VERASE, rl_rubout);
+      SET_SPECIAL (VKILL, rl_unix_line_discard);
+
+#  if defined (VLNEXT) && defined (TERMIOS_TTY_DRIVER)
+      SET_SPECIAL (VLNEXT, rl_quoted_insert);
+#  endif /* VLNEXT && TERMIOS_TTY_DRIVER */
+
+#  if defined (VWERASE) && defined (TERMIOS_TTY_DRIVER)
+      SET_SPECIAL (VWERASE, rl_unix_word_rubout);
+#  endif /* VWERASE && TERMIOS_TTY_DRIVER */
+    }
+#endif /* !NEW_TTY_DRIVER */
+}
diff --git a/search.c b/search.c
new file mode 100644
index 0000000..a2b8c5e
--- /dev/null
+++ b/search.c
@@ -0,0 +1,367 @@
+/* search.c - code for non-incremental searching in emacs and vi modes. */
+
+/* Copyright (C) 1992 Free Software Foundation, Inc.
+
+   This file is part of the Readline Library (the Library), a set of
+   routines for providing Emacs style line input to programs that ask
+   for it.
+
+   The Library is free software; you can redistribute it and/or modify
+   it under the terms of the GNU General Public License as published by
+   the Free Software Foundation; either version 1, or (at your option)
+   any later version.
+
+   The Library is distributed in the hope that it will be useful, but
+   WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#include <sys/types.h>
+#include <stdio.h>
+
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif
+
+#include "memalloc.h"
+#include "rldefs.h"
+#include "readline.h"
+#include "history.h"
+
+#define STREQ(a, b)	(((a)[0] == (b)[0]) && (strcmp ((a), (b)) == 0))
+#define STREQN(a, b, n)	(((a)[0] == (b)[0]) && (strncmp ((a), (b), (n)) == 0))
+
+#define abs(x)		(((x) > 0) ? (x) : -(x))
+
+extern char *xmalloc (), *xrealloc ();
+
+/* Variables imported from readline.c */
+extern int rl_point, rl_end, rl_line_buffer_len;
+extern Keymap _rl_keymap;
+extern char *rl_prompt;
+extern char *rl_line_buffer;
+extern HIST_ENTRY *saved_line_for_history;
+extern Function *rl_last_func;
+
+/* Functions imported from the rest of the library. */
+extern int _rl_free_history_entry ();
+
+static char *noninc_search_string = (char *) NULL;
+static int noninc_history_pos = 0;
+static char *prev_line_found = (char *) NULL;
+
+/* Search the history list for STRING starting at absolute history position
+   POS.  If STRING begins with `^', the search must match STRING at the
+   beginning of a history line, otherwise a full substring match is performed
+   for STRING.  DIR < 0 means to search backwards through the history list,
+   DIR >= 0 means to search forward. */
+static int
+noninc_search_from_pos (string, pos, dir)
+     char *string;
+     int pos, dir;
+{
+  int ret, old;
+
+  old = where_history ();
+  history_set_pos (pos);
+
+  if (*string == '^')
+    ret = history_search_prefix (string + 1, dir);
+  else
+    ret = history_search (string, dir);
+
+  if (ret != -1)
+    ret = where_history ();
+
+  history_set_pos (old);
+  return (ret);
+}
+
+/* Search for a line in the history containing STRING.  If DIR is < 0, the
+   search is backwards through previous entries, else through subsequent
+   entries. */
+static void
+noninc_dosearch (string, dir)
+     char *string;
+     int dir;
+{
+  int oldpos, pos;
+  HIST_ENTRY *entry;
+
+  if (string == 0 || *string == 0 || noninc_history_pos < 0)
+    {
+      ding ();
+      return;
+    }
+
+  pos = noninc_search_from_pos (string, noninc_history_pos + dir, dir);
+  if (pos == -1)
+    {
+      /* Search failed, current history position unchanged. */
+      maybe_unsave_line ();
+      rl_clear_message ();
+      rl_point = 0;
+      ding ();
+      return;
+    }
+
+  noninc_history_pos = pos;
+
+  oldpos = where_history ();
+  history_set_pos (noninc_history_pos);
+  entry = current_history ();
+  history_set_pos (oldpos);
+
+  {
+    int line_len;
+
+    line_len = strlen (entry->line);
+    if (line_len >= rl_line_buffer_len)
+      rl_extend_line_buffer (line_len);
+    strcpy (rl_line_buffer, entry->line);
+  }
+
+  rl_undo_list = (UNDO_LIST *)entry->data;
+  rl_end = strlen (rl_line_buffer);
+  rl_point = 0;
+  rl_clear_message ();
+
+  if (saved_line_for_history)
+    _rl_free_history_entry (saved_line_for_history);
+  saved_line_for_history = (HIST_ENTRY *)NULL;
+}
+
+/* Search non-interactively through the history list.  DIR < 0 means to
+   search backwards through the history of previous commands; otherwise
+   the search is for commands subsequent to the current position in the
+   history list.  PCHAR is the character to use for prompting when reading
+   the search string; if not specified (0), it defaults to `:'. */
+static void
+noninc_search (dir, pchar)
+     int dir;
+     int pchar;
+{
+  int saved_point, c, pmtlen;
+  char *p;
+
+  maybe_save_line ();
+  saved_point = rl_point;
+
+  /* Use the line buffer to read the search string. */
+  rl_line_buffer[0] = 0;
+  rl_end = rl_point = 0;
+
+  /* XXX - this needs fixing to work with the prompt expansion stuff - XXX */
+  pmtlen = (rl_prompt && *rl_prompt) ? strlen (rl_prompt) : 0;
+  p = xmalloc (2 + pmtlen);
+  if (pmtlen)
+    strcpy (p, rl_prompt);
+  p[pmtlen] = pchar ? pchar : ':';
+  p[pmtlen + 1]  = '\0';
+
+  rl_message (p, 0, 0);
+  free (p);
+
+  /* Read the search string. */
+  while (c = rl_read_key ())
+    {
+      switch (c)
+	{
+	case CTRL('H'):
+	case RUBOUT:
+	  if (rl_point == 0)
+	    {
+	      maybe_unsave_line ();
+	      rl_clear_message ();
+	      rl_point = saved_point;
+	      return;
+	    }
+	  rl_rubout (1);
+	  break;
+
+	case CTRL('W'):
+	  rl_unix_word_rubout ();
+	  break;
+
+	case CTRL('U'):
+	  rl_unix_line_discard ();
+	  break;
+
+	case RETURN:
+	case NEWLINE:
+	  goto dosearch;
+	  /* NOTREACHED */
+	  break;
+
+	case CTRL('C'):
+	case CTRL('G'):
+	  maybe_unsave_line ();
+	  rl_clear_message ();
+	  rl_point = saved_point;
+	  ding ();
+	  return;
+
+	default:
+	  rl_insert (1, c);
+	  break;
+	}
+      rl_redisplay ();
+    }
+
+ dosearch:
+  /* If rl_point == 0, we want to re-use the previous search string and
+     start from the saved history position.  If there's no previous search
+     string, punt. */
+  if (rl_point == 0)
+    {
+      if (!noninc_search_string)
+	{
+	  ding ();
+	  return;
+	}
+    }
+  else
+    {
+      /* We want to start the search from the current history position. */
+      noninc_history_pos = where_history ();
+      if (noninc_search_string)
+	free (noninc_search_string);
+      noninc_search_string = savestring (rl_line_buffer);
+    }
+
+  noninc_dosearch (noninc_search_string, dir);
+}
+
+/* Search forward through the history list for a string.  If the vi-mode
+   code calls this, KEY will be `?'. */
+rl_noninc_forward_search (count, key)
+     int count, key;
+{
+  if (key == '?')
+    noninc_search (1, '?');
+  else
+    noninc_search (1, 0);
+  return 0;
+}
+
+/* Reverse search the history list for a string.  If the vi-mode code
+   calls this, KEY will be `/'. */
+rl_noninc_reverse_search (count, key)
+     int count, key;
+{
+  if (key == '/')
+    noninc_search (-1, '/');
+  else
+    noninc_search (-1, 0);
+  return 0;
+}
+
+/* Search forward through the history list for the last string searched
+   for.  If there is no saved search string, abort. */
+rl_noninc_forward_search_again (count, key)
+     int count, key;
+{
+  if (!noninc_search_string)
+    {
+      ding ();
+      return (-1);
+    }
+  noninc_dosearch (noninc_search_string, 1);
+  return 0;
+}
+
+/* Reverse search in the history list for the last string searched
+   for.  If there is no saved search string, abort. */
+rl_noninc_reverse_search_again (count, key)
+     int count, key;
+{
+  if (!noninc_search_string)
+    {
+      ding ();
+      return (-1);
+    }
+  noninc_dosearch (noninc_search_string, -1);
+  return 0;
+}
+
+static int
+rl_history_search_internal (count, direction)
+     int count, direction;
+{
+  HIST_ENTRY *temp, *old_temp;
+  int line_len;
+
+  maybe_save_line ();
+
+  temp = old_temp = (HIST_ENTRY *)NULL;
+  while (count)
+    {
+      temp = (direction < 0) ? previous_history () : next_history ();
+      if (!temp)
+        break;
+      if (STREQN (rl_line_buffer, temp->line, rl_point))
+	{
+	  /* Don't find multiple instances of the same line. */
+	  if (prev_line_found && STREQ (prev_line_found, temp->line))
+	    continue;
+          if (direction < 0)
+            old_temp = temp;
+          prev_line_found = temp->line;
+          count--;
+	}
+    }
+
+  if (!temp)
+    {
+      if (direction < 0 && old_temp)
+	temp = old_temp;
+      else
+	{
+	  maybe_unsave_line ();
+	  ding ();
+	  return 1;
+	}
+    }
+
+  line_len = strlen (temp->line);
+  if (line_len >= rl_line_buffer_len)
+    rl_extend_line_buffer (line_len);
+  strcpy (rl_line_buffer, temp->line);
+  rl_undo_list = (UNDO_LIST *)temp->data;
+  rl_end = line_len;
+  return 0;
+}
+
+/* Search forward in the history for the string of characters
+   from the start of the line to rl_point.  This is a non-incremental
+   search. */
+int
+rl_history_search_forward (count, ignore)
+     int count, ignore;
+{
+  if (count == 0)
+    return (0);
+  if (rl_last_func != rl_history_search_forward)
+    prev_line_found = (char *)NULL;
+  return (rl_history_search_internal (abs (count), (count > 0) ? 1 : -1));
+}
+
+/* Search backward through the history for the string of characters
+   from the start of the line to rl_point.  This is a non-incremental
+   search. */
+int
+rl_history_search_backward (count, ignore)
+     int count, ignore;
+{
+  if (count == 0)
+    return (0);
+  if (rl_last_func != rl_history_search_backward)
+    prev_line_found = (char *)NULL;
+  return (rl_history_search_internal (abs (count), (count > 0) ? -1 : 1));
+}
diff --git a/signals.c b/signals.c
new file mode 100644
index 0000000..a9fda5c
--- /dev/null
+++ b/signals.c
@@ -0,0 +1,303 @@
+/* signals.c -- signal handling support for readline. */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+#include <stdio.h>
+#include <sys/types.h>
+#include <fcntl.h>
+#if !defined (NO_SYS_FILE)
+#  include <sys/file.h>
+#endif /* !NO_SYS_FILE */
+#include <signal.h>
+
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif /* HAVE_UNISTD_H */
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+#include <errno.h>
+/* Not all systems declare ERRNO in errno.h... and some systems #define it! */
+#if !defined (errno)
+extern int errno;
+#endif /* !errno */
+
+#include "posixstat.h"
+
+/* System-specific feature definitions and include files. */
+#include "rldefs.h"
+
+#if defined (GWINSZ_IN_SYS_IOCTL)
+#  include <sys/ioctl.h>
+#endif /* GWINSZ_IN_SYS_IOCTL */
+
+/* Some standard library routines. */
+#include "readline.h"
+#include "history.h"
+
+static void cr ();
+
+extern int readline_echoing_p;
+extern int rl_pending_input;
+extern char *term_cr;
+
+extern int _rl_meta_flag;
+
+extern int _rl_output_character_function ();
+
+extern void free_undo_list ();
+
+#if defined (VOID_SIGHANDLER)
+#  define sighandler void
+#else
+#  define sighandler int
+#endif /* VOID_SIGHANDLER */
+
+/* This typedef is equivalant to the one for Function; it allows us
+   to say SigHandler *foo = signal (SIGKILL, SIG_IGN); */
+typedef sighandler SigHandler ();
+
+#if defined (__GO32__)
+#  undef HANDLE_SIGNALS
+#endif /* __GO32__ */
+
+#if defined (STATIC_MALLOC)
+static char *xmalloc (), *xrealloc ();
+#else
+extern char *xmalloc (), *xrealloc ();
+#endif /* STATIC_MALLOC */
+
+
+/* **************************************************************** */
+/*					        		    */
+/*			   Signal Handling                          */
+/*								    */
+/* **************************************************************** */
+
+#if defined (SIGWINCH)
+static SigHandler *old_sigwinch = (SigHandler *)NULL;
+
+static sighandler
+rl_handle_sigwinch (sig)
+     int sig;
+{
+  if (readline_echoing_p)
+    {
+      _rl_set_screen_size (fileno (rl_instream), 1);
+
+      cr ();				/* was crlf () */
+      rl_forced_update_display ();
+    }
+
+  if (old_sigwinch &&
+      old_sigwinch != (SigHandler *)SIG_IGN &&
+      old_sigwinch != (SigHandler *)SIG_DFL)
+    (*old_sigwinch) (sig);
+#if !defined (VOID_SIGHANDLER)
+  return (0);
+#endif /* VOID_SIGHANDLER */
+}
+#endif  /* SIGWINCH */
+
+#if defined (HANDLE_SIGNALS)
+/* Interrupt handling. */
+static SigHandler
+  *old_int  = (SigHandler *)NULL,
+  *old_alrm = (SigHandler *)NULL;
+#if !defined (SHELL)
+static SigHandler
+  *old_tstp = (SigHandler *)NULL,
+  *old_ttou = (SigHandler *)NULL,
+  *old_ttin = (SigHandler *)NULL,
+  *old_cont = (SigHandler *)NULL;
+#endif /* !SHELL */
+
+/* Handle an interrupt character. */
+static sighandler
+rl_signal_handler (sig)
+     int sig;
+{
+#if defined (HAVE_POSIX_SIGNALS)
+  sigset_t set;
+#else /* !HAVE_POSIX_SIGNALS */
+#  if defined (HAVE_BSD_SIGNALS)
+  long omask;
+#  endif /* HAVE_BSD_SIGNALS */
+#endif /* !HAVE_POSIX_SIGNALS */
+
+#if !defined (HAVE_BSD_SIGNALS) && !defined (HAVE_POSIX_SIGNALS)
+  /* Since the signal will not be blocked while we are in the signal
+     handler, ignore it until rl_clear_signals resets the catcher. */
+  if (sig == SIGINT)
+    signal (sig, SIG_IGN);
+#endif /* !HAVE_BSD_SIGNALS */
+
+  switch (sig)
+    {
+    case SIGINT:
+      {
+	register HIST_ENTRY *entry;
+
+	free_undo_list ();
+
+	entry = current_history ();
+	if (entry)
+	  entry->data = (char *)NULL;
+      }
+      _rl_kill_kbd_macro ();
+      rl_clear_message ();
+      rl_init_argument ();
+
+#if defined (SIGTSTP)
+    case SIGTSTP:
+    case SIGTTOU:
+    case SIGTTIN:
+#endif /* SIGTSTP */
+    case SIGALRM:
+      rl_clean_up_for_exit ();
+      rl_deprep_terminal ();
+      rl_clear_signals ();
+      rl_pending_input = 0;
+
+#if defined (HAVE_POSIX_SIGNALS)
+      sigprocmask (SIG_BLOCK, (sigset_t *)NULL, &set);
+      sigdelset (&set, sig);
+#else /* !HAVE_POSIX_SIGNALS */
+#  if defined (HAVE_BSD_SIGNALS)
+      omask = sigblock (0);
+#  endif /* HAVE_BSD_SIGNALS */
+#endif /* !HAVE_POSIX_SIGNALS */
+
+      kill (getpid (), sig);
+
+      /* Let the signal that we just sent through.  */
+#if defined (HAVE_POSIX_SIGNALS)
+      sigprocmask (SIG_SETMASK, &set, (sigset_t *)NULL);
+#else /* !HAVE_POSIX_SIGNALS */
+#  if defined (HAVE_BSD_SIGNALS)
+      sigsetmask (omask & ~(sigmask (sig)));
+#  endif /* HAVE_BSD_SIGNALS */
+#endif /* !HAVE_POSIX_SIGNALS */
+
+      rl_prep_terminal (_rl_meta_flag);
+      rl_set_signals ();
+    }
+
+#if !defined (VOID_SIGHANDLER)
+  return (0);
+#endif /* !VOID_SIGHANDLER */
+}
+
+#if defined (HAVE_POSIX_SIGNALS)
+static SigHandler *
+rl_set_sighandler (sig, handler)
+     int sig;
+     SigHandler *handler;
+{
+  struct sigaction act, oact;
+
+  act.sa_handler = handler;
+  act.sa_flags = 0;
+  sigemptyset (&act.sa_mask);
+  sigemptyset (&oact.sa_mask);
+  sigaction (sig, &act, &oact);
+  return (oact.sa_handler);
+}
+
+#else /* !HAVE_POSIX_SIGNALS */
+#  define rl_set_sighandler(sig, handler) (SigHandler *)signal (sig, handler)
+#endif /* !HAVE_POSIX_SIGNALS */
+
+rl_set_signals ()
+{
+  old_int = (SigHandler *)rl_set_sighandler (SIGINT, rl_signal_handler);
+  if (old_int == (SigHandler *)SIG_IGN)
+    signal (SIGINT, SIG_IGN);
+
+  old_alrm = (SigHandler *)rl_set_sighandler (SIGALRM, rl_signal_handler);
+  if (old_alrm == (SigHandler *)SIG_IGN)
+    signal (SIGALRM, SIG_IGN);
+
+#if !defined (SHELL)
+
+#if defined (SIGTSTP)
+  old_tstp = (SigHandler *)rl_set_sighandler (SIGTSTP, rl_signal_handler);
+  if (old_tstp == (SigHandler *)SIG_IGN)
+    signal (SIGTSTP, SIG_IGN);
+#endif /* SIGTSTP */
+#if defined (SIGTTOU)
+  old_ttou = (SigHandler *)rl_set_sighandler (SIGTTOU, rl_signal_handler);
+  old_ttin = (SigHandler *)rl_set_sighandler (SIGTTIN, rl_signal_handler);
+
+  if (old_tstp == (SigHandler *)SIG_IGN)
+    {
+      signal (SIGTTOU, SIG_IGN);
+      signal (SIGTTIN, SIG_IGN);
+    }
+#endif /* SIGTTOU */
+
+#endif /* !SHELL */
+
+#if defined (SIGWINCH)
+  old_sigwinch =
+    (SigHandler *) rl_set_sighandler (SIGWINCH, rl_handle_sigwinch);
+#endif /* SIGWINCH */
+  return 0;
+}
+
+rl_clear_signals ()
+{
+  rl_set_sighandler (SIGINT, old_int);
+  rl_set_sighandler (SIGALRM, old_alrm);
+
+#if !defined (SHELL)
+
+#if defined (SIGTSTP)
+  signal (SIGTSTP, old_tstp);
+#endif
+
+#if defined (SIGTTOU)
+  signal (SIGTTOU, old_ttou);
+  signal (SIGTTIN, old_ttin);
+#endif /* SIGTTOU */
+
+#endif /* !SHELL */
+
+#if defined (SIGWINCH)
+  signal (SIGWINCH, old_sigwinch);
+#endif
+
+  return 0;
+}
+
+/* Move to the start of the current line. */
+static void
+cr ()
+{
+  if (term_cr)	
+    tputs (term_cr, 1, _rl_output_character_function);
+}
+#endif  /* HANDLE_SIGNALS */
diff --git a/stamp-config b/stamp-config
new file mode 100644
index 0000000..e69de29
--- /dev/null
+++ b/stamp-config
diff --git a/tilde.c b/tilde.c
new file mode 100644
index 0000000..89168a0
--- /dev/null
+++ b/tilde.c
@@ -0,0 +1,386 @@
+/* tilde.c -- Tilde expansion code (~/foo := $HOME/foo). */
+
+/* Copyright (C) 1988,1989 Free Software Foundation, Inc.
+
+   This file is part of GNU Readline, a library for reading lines
+   of text with interactive input and history editing.
+
+   Readline is free software; you can redistribute it and/or modify it
+   under the terms of the GNU General Public License as published by the
+   Free Software Foundation; either version 1, or (at your option) any
+   later version.
+
+   Readline is distributed in the hope that it will be useful, but
+   WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   General Public License for more details.
+
+   You should have received a copy of the GNU General Public License
+   along with Readline; see the file COPYING.  If not, write to the Free
+   Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#include "memalloc.h"
+
+#if defined (HAVE_STRING_H)
+#  include <string.h>
+#else /* !HAVE_STRING_H */
+#  include <strings.h>
+#endif /* !HAVE_STRING_H */  
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+#include "tilde.h"
+#include <pwd.h>
+
+#if defined (USG) && !defined (HAVE_GETPW_DECLS)
+extern struct passwd *getpwuid (), *getpwnam ();
+#endif /* USG && !defined (HAVE_GETPW_DECLS) */
+
+#if !defined (savestring)
+extern char *xmalloc ();
+#  ifndef strcpy
+extern char *strcpy ();
+#  endif
+#define savestring(x) strcpy (xmalloc (1 + strlen (x)), (x))
+#endif /* !savestring */
+
+#if !defined (NULL)
+#  if defined (__STDC__)
+#    define NULL ((void *) 0)
+#  else
+#    define NULL 0x0
+#  endif /* !__STDC__ */
+#endif /* !NULL */
+
+#if defined (TEST) || defined (STATIC_MALLOC)
+static char *xmalloc (), *xrealloc ();
+#else
+extern char *xmalloc (), *xrealloc ();
+#endif /* TEST || STATIC_MALLOC */
+
+/* The default value of tilde_additional_prefixes.  This is set to
+   whitespace preceding a tilde so that simple programs which do not
+   perform any word separation get desired behaviour. */
+static char *default_prefixes[] =
+  { " ~", "\t~", (char *)NULL };
+
+/* The default value of tilde_additional_suffixes.  This is set to
+   whitespace or newline so that simple programs which do not
+   perform any word separation get desired behaviour. */
+static char *default_suffixes[] =
+  { " ", "\n", (char *)NULL };
+
+/* If non-null, this contains the address of a function to call if the
+   standard meaning for expanding a tilde fails.  The function is called
+   with the text (sans tilde, as in "foo"), and returns a malloc()'ed string
+   which is the expansion, or a NULL pointer if there is no expansion. */
+CPFunction *tilde_expansion_failure_hook = (CPFunction *)NULL;
+
+/* When non-null, this is a NULL terminated array of strings which
+   are duplicates for a tilde prefix.  Bash uses this to expand
+   `=~' and `:~'. */
+char **tilde_additional_prefixes = default_prefixes;
+
+/* When non-null, this is a NULL terminated array of strings which match
+   the end of a username, instead of just "/".  Bash sets this to
+   `:' and `=~'. */
+char **tilde_additional_suffixes = default_suffixes;
+
+/* Find the start of a tilde expansion in STRING, and return the index of
+   the tilde which starts the expansion.  Place the length of the text
+   which identified this tilde starter in LEN, excluding the tilde itself. */
+static int
+tilde_find_prefix (string, len)
+     char *string;
+     int *len;
+{
+  register int i, j, string_len;
+  register char **prefixes = tilde_additional_prefixes;
+
+  string_len = strlen (string);
+  *len = 0;
+
+  if (!*string || *string == '~')
+    return (0);
+
+  if (prefixes)
+    {
+      for (i = 0; i < string_len; i++)
+	{
+	  for (j = 0; prefixes[j]; j++)
+	    {
+	      if (strncmp (string + i, prefixes[j], strlen (prefixes[j])) == 0)
+		{
+		  *len = strlen (prefixes[j]) - 1;
+		  return (i + *len);
+		}
+	    }
+	}
+    }
+  return (string_len);
+}
+
+/* Find the end of a tilde expansion in STRING, and return the index of
+   the character which ends the tilde definition.  */
+static int
+tilde_find_suffix (string)
+     char *string;
+{
+  register int i, j, string_len;
+  register char **suffixes = tilde_additional_suffixes;
+
+  string_len = strlen (string);
+
+  for (i = 0; i < string_len; i++)
+    {
+      if (string[i] == '/' || !string[i])
+	break;
+
+      for (j = 0; suffixes && suffixes[j]; j++)
+	{
+	  if (strncmp (string + i, suffixes[j], strlen (suffixes[j])) == 0)
+	    return (i);
+	}
+    }
+  return (i);
+}
+
+/* Return a new string which is the result of tilde expanding STRING. */
+char *
+tilde_expand (string)
+     char *string;
+{
+  char *result, *tilde_expand_word ();
+  int result_size, result_index;
+
+  result_size = result_index = 0;
+  result = (char *)NULL;
+
+  /* Scan through STRING expanding tildes as we come to them. */
+  while (1)
+    {
+      register int start, end;
+      char *tilde_word, *expansion;
+      int len;
+
+      /* Make START point to the tilde which starts the expansion. */
+      start = tilde_find_prefix (string, &len);
+
+      /* Copy the skipped text into the result. */
+      if ((result_index + start + 1) > result_size)
+	result = (char *)xrealloc (result, 1 + (result_size += (start + 20)));
+
+      strncpy (result + result_index, string, start);
+      result_index += start;
+
+      /* Advance STRING to the starting tilde. */
+      string += start;
+
+      /* Make END be the index of one after the last character of the
+	 username. */
+      end = tilde_find_suffix (string);
+
+      /* If both START and END are zero, we are all done. */
+      if (!start && !end)
+	break;
+
+      /* Expand the entire tilde word, and copy it into RESULT. */
+      tilde_word = (char *)xmalloc (1 + end);
+      strncpy (tilde_word, string, end);
+      tilde_word[end] = '\0';
+      string += end;
+
+      expansion = tilde_expand_word (tilde_word);
+      free (tilde_word);
+
+      len = strlen (expansion);
+      if ((result_index + len + 1) > result_size)
+	result = (char *)xrealloc (result, 1 + (result_size += (len + 20)));
+
+      strcpy (result + result_index, expansion);
+      result_index += len;
+      free (expansion);
+    }
+
+  result[result_index] = '\0';
+
+  return (result);
+}
+
+/* Do the work of tilde expansion on FILENAME.  FILENAME starts with a
+   tilde.  If there is no expansion, call tilde_expansion_failure_hook. */
+char *
+tilde_expand_word (filename)
+     char *filename;
+{
+  char *dirname;
+
+  dirname = filename ? savestring (filename) : (char *)NULL;
+
+  if (dirname && *dirname == '~')
+    {
+      char *temp_name;
+      if (!dirname[1] || dirname[1] == '/')
+	{
+	  /* Prepend $HOME to the rest of the string. */
+	  char *temp_home = (char *)getenv ("HOME");
+
+	  /* If there is no HOME variable, look up the directory in
+	     the password database. */
+	  if (!temp_home)
+	    {
+	      struct passwd *entry;
+
+	      entry = getpwuid (getuid ());
+	      if (entry)
+		temp_home = entry->pw_dir;
+	    }
+
+	  temp_name = xmalloc (1 + strlen (&dirname[1])
+				 + (temp_home ? strlen (temp_home) : 0));
+	  temp_name[0] = '\0';
+	  if (temp_home)
+	    strcpy (temp_name, temp_home);
+	  strcat (temp_name, dirname + 1);
+	  free (dirname);
+	  dirname = temp_name;
+	}
+      else
+	{
+	  char u_name[257];
+	  struct passwd *user_entry;
+	  char *username;
+	  int i, c;
+
+	  username = u_name;
+	  for (i = 1; c = dirname[i]; i++)
+	    {
+	      if (c == '/')
+		break;
+	      else
+		username[i - 1] = c;
+	    }
+	  username[i - 1] = '\0';
+
+	  if (!(user_entry = getpwnam (username)))
+	    {
+	      /* If the calling program has a special syntax for
+		 expanding tildes, and we couldn't find a standard
+		 expansion, then let them try. */
+	      if (tilde_expansion_failure_hook)
+		{
+		  char *expansion;
+
+		  expansion = (*tilde_expansion_failure_hook) (username);
+
+		  if (expansion)
+		    {
+		      temp_name = xmalloc (1 + strlen (expansion)
+						  + strlen (&dirname[i]));
+		      strcpy (temp_name, expansion);
+		      strcat (temp_name, &dirname[i]);
+		      free (expansion);
+		      free (dirname);
+		      dirname = temp_name;
+		    }
+		}
+	      /* We shouldn't report errors. */
+	    }
+	  else
+	    {
+	      temp_name = xmalloc (1 + strlen (user_entry->pw_dir)
+				     + strlen (&dirname[i]));
+	      strcpy (temp_name, user_entry->pw_dir);
+	      strcat (temp_name, &dirname[i]);
+	      free (dirname);
+	      dirname = temp_name;
+	    }
+	    endpwent ();
+	}
+    }
+  return (dirname);
+}
+
+
+#if defined (TEST)
+#undef NULL
+#include <stdio.h>
+
+main (argc, argv)
+     int argc;
+     char **argv;
+{
+  char *result, line[512];
+  int done = 0;
+
+  while (!done)
+    {
+      printf ("~expand: ");
+      fflush (stdout);
+
+      if (!gets (line))
+	strcpy (line, "done");
+
+      if ((strcmp (line, "done") == 0) ||
+	  (strcmp (line, "quit") == 0) ||
+	  (strcmp (line, "exit") == 0))
+	{
+	  done = 1;
+	  break;
+	}
+
+      result = tilde_expand (line);
+      printf ("  --> %s\n", result);
+      free (result);
+    }
+  exit (0);
+}
+
+static void memory_error_and_abort ();
+
+static char *
+xmalloc (bytes)
+     int bytes;
+{
+  char *temp = (char *)malloc (bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+  return (temp);
+}
+
+static char *
+xrealloc (pointer, bytes)
+     char *pointer;
+     int bytes;
+{
+  char *temp;
+
+  if (!pointer)
+    temp = (char *)malloc (bytes);
+  else
+    temp = (char *)realloc (pointer, bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+
+  return (temp);
+}
+
+static void
+memory_error_and_abort ()
+{
+  fprintf (stderr, "readline: Out of virtual memory!\n");
+  abort ();
+}
+
+/*
+ * Local variables:
+ * compile-command: "gcc -g -DTEST -o tilde tilde.c"
+ * end:
+ */
+#endif /* TEST */
diff --git a/tilde.h b/tilde.h
new file mode 100644
index 0000000..726d081
--- /dev/null
+++ b/tilde.h
@@ -0,0 +1,38 @@
+/* tilde.h: Externally available variables and function in libtilde.a. */
+
+#if !defined (__TILDE_H__)
+#  define __TILDE_H__
+
+/* Function pointers can be declared as (Function *)foo. */
+#if !defined (__FUNCTION_DEF)
+#  define __FUNCTION_DEF
+typedef int Function ();
+typedef void VFunction ();
+typedef char *CPFunction ();
+typedef char **CPPFunction ();
+#endif /* _FUNCTION_DEF */
+
+/* If non-null, this contains the address of a function to call if the
+   standard meaning for expanding a tilde fails.  The function is called
+   with the text (sans tilde, as in "foo"), and returns a malloc()'ed string
+   which is the expansion, or a NULL pointer if there is no expansion. */
+extern CPFunction *tilde_expansion_failure_hook;
+
+/* When non-null, this is a NULL terminated array of strings which
+   are duplicates for a tilde prefix.  Bash uses this to expand
+   `=~' and `:~'. */
+extern char **tilde_additional_prefixes;
+
+/* When non-null, this is a NULL terminated array of strings which match
+   the end of a username, instead of just "/".  Bash sets this to
+   `:' and `=~'. */
+extern char **tilde_additional_suffixes;
+
+/* Return a new string which is the result of tilde expanding STRING. */
+extern char *tilde_expand ();
+
+/* Do the work of tilde expansion on FILENAME.  FILENAME starts with a
+   tilde.  If there is no expansion, call tilde_expansion_failure_hook. */
+extern char *tilde_expand_word ();
+
+#endif /* __TILDE_H__ */
diff --git a/vi_keymap.c b/vi_keymap.c
new file mode 100644
index 0000000..b8b3123
--- /dev/null
+++ b/vi_keymap.c
@@ -0,0 +1,877 @@
+/* vi_keymap.c -- the keymap for vi_mode in readline (). */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#if !defined (BUFSIZ)
+#include <stdio.h>
+#endif /* !BUFSIZ */
+
+#include "readline.h"
+
+#if 0
+extern KEYMAP_ENTRY_ARRAY vi_escape_keymap;
+#endif
+
+/* The keymap arrays for handling vi mode. */
+KEYMAP_ENTRY_ARRAY vi_movement_keymap = {
+  /* The regular control keys come first. */
+  { ISFUNC, (Function *)0x0 },		/* Control-@ */
+  { ISFUNC, (Function *)0x0 },		/* Control-a */
+  { ISFUNC, (Function *)0x0 },		/* Control-b */
+  { ISFUNC, (Function *)0x0 },		/* Control-c */
+  { ISFUNC, rl_vi_eof_maybe },		/* Control-d */
+  { ISFUNC, rl_emacs_editing_mode },	/* Control-e */
+  { ISFUNC, (Function *)0x0 },		/* Control-f */
+  { ISFUNC, rl_abort },			/* Control-g */
+  { ISFUNC, rl_backward },		/* Control-h */
+  { ISFUNC, (Function *)0x0 },		/* Control-i */
+  { ISFUNC, rl_newline },		/* Control-j */
+  { ISFUNC, rl_kill_line },		/* Control-k */
+  { ISFUNC, rl_clear_screen },		/* Control-l */
+  { ISFUNC, rl_newline },		/* Control-m */
+  { ISFUNC, rl_get_next_history },	/* Control-n */
+  { ISFUNC, (Function *)0x0 },		/* Control-o */
+  { ISFUNC, rl_get_previous_history },	/* Control-p */
+  { ISFUNC, rl_quoted_insert },		/* Control-q */
+  { ISFUNC, rl_reverse_search_history }, /* Control-r */
+  { ISFUNC, rl_forward_search_history }, /* Control-s */
+  { ISFUNC, rl_transpose_chars },	/* Control-t */
+  { ISFUNC, rl_unix_line_discard },	/* Control-u */
+  { ISFUNC, rl_quoted_insert },		/* Control-v */
+  { ISFUNC, rl_unix_word_rubout },	/* Control-w */
+  { ISFUNC, (Function *)0x0 },		/* Control-x */
+  { ISFUNC, rl_yank },			/* Control-y */
+  { ISFUNC, (Function *)0x0 },		/* Control-z */
+
+  { ISFUNC, (Function *)0x0 },		/* Control-[ */	/* vi_escape_keymap */
+  { ISFUNC, (Function *)0x0 },		/* Control-\ */
+  { ISFUNC, (Function *)0x0 },		/* Control-] */
+  { ISFUNC, (Function *)0x0 },		/* Control-^ */
+  { ISFUNC, rl_undo_command },		/* Control-_ */
+
+  /* The start of printing characters. */
+  { ISFUNC, rl_forward },		/* SPACE */
+  { ISFUNC, (Function *)0x0 },		/* ! */
+  { ISFUNC, (Function *)0x0 },		/* " */
+  { ISFUNC, rl_vi_comment },		/* # */
+  { ISFUNC, rl_end_of_line },		/* $ */
+  { ISFUNC, rl_vi_match },		/* % */
+  { ISFUNC, rl_vi_tilde_expand },	/* & */
+  { ISFUNC, (Function *)0x0 },		/* ' */
+  { ISFUNC, (Function *)0x0 },		/* ( */
+  { ISFUNC, (Function *)0x0 },		/* ) */
+  { ISFUNC, rl_vi_complete },		/* * */
+  { ISFUNC, rl_get_next_history},	/* + */
+  { ISFUNC, rl_vi_char_search },	/* , */
+  { ISFUNC, rl_get_previous_history },	/* - */
+  { ISFUNC, rl_vi_redo },		/* . */
+  { ISFUNC, rl_vi_search },		/* / */
+
+  /* Regular digits. */
+  { ISFUNC, rl_beg_of_line },		/* 0 */
+  { ISFUNC, rl_vi_arg_digit },		/* 1 */
+  { ISFUNC, rl_vi_arg_digit },		/* 2 */
+  { ISFUNC, rl_vi_arg_digit },		/* 3 */
+  { ISFUNC, rl_vi_arg_digit },		/* 4 */
+  { ISFUNC, rl_vi_arg_digit },		/* 5 */
+  { ISFUNC, rl_vi_arg_digit },		/* 6 */
+  { ISFUNC, rl_vi_arg_digit },		/* 7 */
+  { ISFUNC, rl_vi_arg_digit },		/* 8 */
+  { ISFUNC, rl_vi_arg_digit },		/* 9 */
+
+  /* A little more punctuation. */
+  { ISFUNC, (Function *)0x0 },		/* : */
+  { ISFUNC, rl_vi_char_search },	/* ; */
+  { ISFUNC, (Function *)0x0 },		/* < */
+  { ISFUNC, rl_vi_complete },		/* = */
+  { ISFUNC, (Function *)0x0 },		/* > */
+  { ISFUNC, rl_vi_search },		/* ? */
+  { ISFUNC, (Function *)0x0 },		/* @ */
+
+  /* Uppercase alphabet. */
+  { ISFUNC, rl_vi_append_eol },		/* A */
+  { ISFUNC, rl_vi_prev_word},		/* B */
+  { ISFUNC, rl_vi_change_to },		/* C */
+  { ISFUNC, rl_vi_delete_to },		/* D */
+  { ISFUNC, rl_vi_end_word },		/* E */
+  { ISFUNC, rl_vi_char_search },	/* F */
+  { ISFUNC, rl_vi_fetch_history },	/* G */
+  { ISFUNC, (Function *)0x0 },		/* H */
+  { ISFUNC, rl_vi_insert_beg },		/* I */
+  { ISFUNC, (Function *)0x0 },		/* J */
+  { ISFUNC, (Function *)0x0 },		/* K */
+  { ISFUNC, (Function *)0x0 },		/* L */
+  { ISFUNC, (Function *)0x0 },		/* M */
+  { ISFUNC, rl_vi_search_again },	/* N */
+  { ISFUNC, (Function *)0x0 },		/* O */
+  { ISFUNC, rl_vi_put },		/* P */
+  { ISFUNC, (Function *)0x0 },		/* Q */
+  { ISFUNC, rl_vi_replace },		/* R */
+  { ISFUNC, rl_vi_subst },		/* S */
+  { ISFUNC, rl_vi_char_search },	/* T */
+  { ISFUNC, rl_revert_line },		/* U */
+  { ISFUNC, (Function *)0x0 },		/* V */
+  { ISFUNC, rl_vi_next_word },		/* W */
+  { ISFUNC, rl_rubout },		/* X */
+  { ISFUNC, rl_vi_yank_to },		/* Y */
+  { ISFUNC, (Function *)0x0 },		/* Z */
+
+  /* Some more punctuation. */
+  { ISFUNC, (Function *)0x0 },		/* [ */
+  { ISFUNC, rl_vi_complete },		/* \ */
+  { ISFUNC, (Function *)0x0 },		/* ] */
+  { ISFUNC, rl_vi_first_print },	/* ^ */
+  { ISFUNC, rl_vi_yank_arg },		/* _ */
+  { ISFUNC, (Function *)0x0 },		/* ` */
+
+  /* Lowercase alphabet. */
+  { ISFUNC, rl_vi_append_mode },	/* a */
+  { ISFUNC, rl_vi_prev_word },		/* b */
+  { ISFUNC, rl_vi_change_to },		/* c */
+  { ISFUNC, rl_vi_delete_to },		/* d */
+  { ISFUNC, rl_vi_end_word },		/* e */
+  { ISFUNC, rl_vi_char_search },	/* f */
+  { ISFUNC, (Function *)0x0 },		/* g */
+  { ISFUNC, rl_backward },		/* h */
+  { ISFUNC, rl_vi_insertion_mode },	/* i */
+  { ISFUNC, rl_get_next_history },	/* j */
+  { ISFUNC, rl_get_previous_history },	/* k */
+  { ISFUNC, rl_forward },		/* l */
+  { ISFUNC, (Function *)0x0 },		/* m */
+  { ISFUNC, rl_vi_search_again },	/* n */
+  { ISFUNC, (Function *)0x0 },		/* o */
+  { ISFUNC, rl_vi_put },		/* p */
+  { ISFUNC, (Function *)0x0 },		/* q */
+  { ISFUNC, rl_vi_change_char },	/* r */
+  { ISFUNC, rl_vi_subst },		/* s */
+  { ISFUNC, rl_vi_char_search },	/* t */
+  { ISFUNC, rl_undo_command },		/* u */
+  { ISFUNC, (Function *)0x0 },		/* v */
+  { ISFUNC, rl_vi_next_word },		/* w */
+  { ISFUNC, rl_vi_delete },		/* x */
+  { ISFUNC, rl_vi_yank_to },		/* y */
+  { ISFUNC, (Function *)0x0 },		/* z */
+
+  /* Final punctuation. */
+  { ISFUNC, (Function *)0x0 },		/* { */
+  { ISFUNC, rl_vi_column },		/* | */
+  { ISFUNC, (Function *)0x0 },		/* } */
+  { ISFUNC, rl_vi_change_case },	/* ~ */
+  { ISFUNC, (Function *)0x0 },		/* RUBOUT */
+
+#if KEYMAP_SIZE > 128
+  /* Undefined keys. */
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 }
+#endif /* KEYMAP_SIZE > 128 */
+};
+
+
+KEYMAP_ENTRY_ARRAY vi_insertion_keymap = {
+  /* The regular control keys come first. */
+  { ISFUNC, (Function *)0x0 },		/* Control-@ */
+  { ISFUNC, rl_insert },		/* Control-a */
+  { ISFUNC, rl_insert },		/* Control-b */
+  { ISFUNC, rl_insert },		/* Control-c */
+  { ISFUNC, rl_vi_eof_maybe },		/* Control-d */
+  { ISFUNC, rl_insert },		/* Control-e */
+  { ISFUNC, rl_insert },		/* Control-f */
+  { ISFUNC, rl_insert },		/* Control-g */
+  { ISFUNC, rl_rubout },		/* Control-h */
+  { ISFUNC, rl_complete },		/* Control-i */
+  { ISFUNC, rl_newline },		/* Control-j */
+  { ISFUNC, rl_insert },		/* Control-k */
+  { ISFUNC, rl_insert },		/* Control-l */
+  { ISFUNC, rl_newline },		/* Control-m */
+  { ISFUNC, rl_insert },		/* Control-n */
+  { ISFUNC, rl_insert },		/* Control-o */
+  { ISFUNC, rl_insert },		/* Control-p */
+  { ISFUNC, rl_insert },		/* Control-q */
+  { ISFUNC, rl_reverse_search_history }, /* Control-r */
+  { ISFUNC, rl_forward_search_history }, /* Control-s */
+  { ISFUNC, rl_transpose_chars },	/* Control-t */
+  { ISFUNC, rl_unix_line_discard },	/* Control-u */
+  { ISFUNC, rl_quoted_insert },		/* Control-v */
+  { ISFUNC, rl_unix_word_rubout },	/* Control-w */
+  { ISFUNC, rl_insert },		/* Control-x */
+  { ISFUNC, rl_yank },			/* Control-y */
+  { ISFUNC, rl_insert },		/* Control-z */
+
+  { ISFUNC, rl_vi_movement_mode },	/* Control-[ */
+  { ISFUNC, rl_insert },		/* Control-\ */
+  { ISFUNC, rl_insert },		/* Control-] */
+  { ISFUNC, rl_insert },		/* Control-^ */
+  { ISFUNC, rl_undo_command },		/* Control-_ */
+
+  /* The start of printing characters. */
+  { ISFUNC, rl_insert },		/* SPACE */
+  { ISFUNC, rl_insert },		/* ! */
+  { ISFUNC, rl_insert },		/* " */
+  { ISFUNC, rl_insert },		/* # */
+  { ISFUNC, rl_insert },		/* $ */
+  { ISFUNC, rl_insert },		/* % */
+  { ISFUNC, rl_insert },		/* & */
+  { ISFUNC, rl_insert },		/* ' */
+  { ISFUNC, rl_insert },		/* ( */
+  { ISFUNC, rl_insert },		/* ) */
+  { ISFUNC, rl_insert },		/* * */
+  { ISFUNC, rl_insert },		/* + */
+  { ISFUNC, rl_insert },		/* , */
+  { ISFUNC, rl_insert },		/* - */
+  { ISFUNC, rl_insert },		/* . */
+  { ISFUNC, rl_insert },		/* / */
+
+  /* Regular digits. */
+  { ISFUNC, rl_insert },		/* 0 */
+  { ISFUNC, rl_insert },		/* 1 */
+  { ISFUNC, rl_insert },		/* 2 */
+  { ISFUNC, rl_insert },		/* 3 */
+  { ISFUNC, rl_insert },		/* 4 */
+  { ISFUNC, rl_insert },		/* 5 */
+  { ISFUNC, rl_insert },		/* 6 */
+  { ISFUNC, rl_insert },		/* 7 */
+  { ISFUNC, rl_insert },		/* 8 */
+  { ISFUNC, rl_insert },		/* 9 */
+
+  /* A little more punctuation. */
+  { ISFUNC, rl_insert },		/* : */
+  { ISFUNC, rl_insert },		/* ; */
+  { ISFUNC, rl_insert },		/* < */
+  { ISFUNC, rl_insert },		/* = */
+  { ISFUNC, rl_insert },		/* > */
+  { ISFUNC, rl_insert },		/* ? */
+  { ISFUNC, rl_insert },		/* @ */
+
+  /* Uppercase alphabet. */
+  { ISFUNC, rl_insert },		/* A */
+  { ISFUNC, rl_insert },		/* B */
+  { ISFUNC, rl_insert },		/* C */
+  { ISFUNC, rl_insert },		/* D */
+  { ISFUNC, rl_insert },		/* E */
+  { ISFUNC, rl_insert },		/* F */
+  { ISFUNC, rl_insert },		/* G */
+  { ISFUNC, rl_insert },		/* H */
+  { ISFUNC, rl_insert },		/* I */
+  { ISFUNC, rl_insert },		/* J */
+  { ISFUNC, rl_insert },		/* K */
+  { ISFUNC, rl_insert },		/* L */
+  { ISFUNC, rl_insert },		/* M */
+  { ISFUNC, rl_insert },		/* N */
+  { ISFUNC, rl_insert },		/* O */
+  { ISFUNC, rl_insert },		/* P */
+  { ISFUNC, rl_insert },		/* Q */
+  { ISFUNC, rl_insert },		/* R */
+  { ISFUNC, rl_insert },		/* S */
+  { ISFUNC, rl_insert },		/* T */
+  { ISFUNC, rl_insert },		/* U */
+  { ISFUNC, rl_insert },		/* V */
+  { ISFUNC, rl_insert },		/* W */
+  { ISFUNC, rl_insert },		/* X */
+  { ISFUNC, rl_insert },		/* Y */
+  { ISFUNC, rl_insert },		/* Z */
+
+  /* Some more punctuation. */
+  { ISFUNC, rl_insert },		/* [ */
+  { ISFUNC, rl_insert },		/* \ */
+  { ISFUNC, rl_insert },		/* ] */
+  { ISFUNC, rl_insert },		/* ^ */
+  { ISFUNC, rl_insert },		/* _ */
+  { ISFUNC, rl_insert },		/* ` */
+
+  /* Lowercase alphabet. */
+  { ISFUNC, rl_insert },		/* a */
+  { ISFUNC, rl_insert },		/* b */
+  { ISFUNC, rl_insert },		/* c */
+  { ISFUNC, rl_insert },		/* d */
+  { ISFUNC, rl_insert },		/* e */
+  { ISFUNC, rl_insert },		/* f */
+  { ISFUNC, rl_insert },		/* g */
+  { ISFUNC, rl_insert },		/* h */
+  { ISFUNC, rl_insert },		/* i */
+  { ISFUNC, rl_insert },		/* j */
+  { ISFUNC, rl_insert },		/* k */
+  { ISFUNC, rl_insert },		/* l */
+  { ISFUNC, rl_insert },		/* m */
+  { ISFUNC, rl_insert },		/* n */
+  { ISFUNC, rl_insert },		/* o */
+  { ISFUNC, rl_insert },		/* p */
+  { ISFUNC, rl_insert },		/* q */
+  { ISFUNC, rl_insert },		/* r */
+  { ISFUNC, rl_insert },		/* s */
+  { ISFUNC, rl_insert },		/* t */
+  { ISFUNC, rl_insert },		/* u */
+  { ISFUNC, rl_insert },		/* v */
+  { ISFUNC, rl_insert },		/* w */
+  { ISFUNC, rl_insert },		/* x */
+  { ISFUNC, rl_insert },		/* y */
+  { ISFUNC, rl_insert },		/* z */
+
+  /* Final punctuation. */
+  { ISFUNC, rl_insert },		/* { */
+  { ISFUNC, rl_insert },		/* | */
+  { ISFUNC, rl_insert },		/* } */
+  { ISFUNC, rl_insert },		/* ~ */
+  { ISFUNC, rl_rubout },		/* RUBOUT */
+
+#if KEYMAP_SIZE > 128
+  /* Pure 8-bit characters (128 - 159).
+     These might be used in some
+     character sets. */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+  { ISFUNC, rl_insert },	/* ? */
+
+  /* ISO Latin-1 characters (160 - 255) */
+  { ISFUNC, rl_insert },	/* No-break space */
+  { ISFUNC, rl_insert },	/* Inverted exclamation mark */
+  { ISFUNC, rl_insert },	/* Cent sign */
+  { ISFUNC, rl_insert },	/* Pound sign */
+  { ISFUNC, rl_insert },	/* Currency sign */
+  { ISFUNC, rl_insert },	/* Yen sign */
+  { ISFUNC, rl_insert },	/* Broken bar */
+  { ISFUNC, rl_insert },	/* Section sign */
+  { ISFUNC, rl_insert },	/* Diaeresis */
+  { ISFUNC, rl_insert },	/* Copyright sign */
+  { ISFUNC, rl_insert },	/* Feminine ordinal indicator */
+  { ISFUNC, rl_insert },	/* Left pointing double angle quotation mark */
+  { ISFUNC, rl_insert },	/* Not sign */
+  { ISFUNC, rl_insert },	/* Soft hyphen */
+  { ISFUNC, rl_insert },	/* Registered sign */
+  { ISFUNC, rl_insert },	/* Macron */
+  { ISFUNC, rl_insert },	/* Degree sign */
+  { ISFUNC, rl_insert },	/* Plus-minus sign */
+  { ISFUNC, rl_insert },	/* Superscript two */
+  { ISFUNC, rl_insert },	/* Superscript three */
+  { ISFUNC, rl_insert },	/* Acute accent */
+  { ISFUNC, rl_insert },	/* Micro sign */
+  { ISFUNC, rl_insert },	/* Pilcrow sign */
+  { ISFUNC, rl_insert },	/* Middle dot */
+  { ISFUNC, rl_insert },	/* Cedilla */
+  { ISFUNC, rl_insert },	/* Superscript one */
+  { ISFUNC, rl_insert },	/* Masculine ordinal indicator */
+  { ISFUNC, rl_insert },	/* Right pointing double angle quotation mark */
+  { ISFUNC, rl_insert },	/* Vulgar fraction one quarter */
+  { ISFUNC, rl_insert },	/* Vulgar fraction one half */
+  { ISFUNC, rl_insert },	/* Vulgar fraction three quarters */
+  { ISFUNC, rl_insert },	/* Inverted questionk mark */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with tilde */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin capital letter a with ring above */
+  { ISFUNC, rl_insert },	/* Latin capital letter ae */
+  { ISFUNC, rl_insert },	/* Latin capital letter c with cedilla */
+  { ISFUNC, rl_insert },	/* Latin capital letter e with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter e with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter e with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter e with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin capital letter i with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter i with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter i with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter i with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin capital letter eth (Icelandic) */
+  { ISFUNC, rl_insert },	/* Latin capital letter n with tilde */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with tilde */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with diaeresis */
+  { ISFUNC, rl_insert },	/* Multiplication sign */
+  { ISFUNC, rl_insert },	/* Latin capital letter o with stroke */
+  { ISFUNC, rl_insert },	/* Latin capital letter u with grave */
+  { ISFUNC, rl_insert },	/* Latin capital letter u with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter u with circumflex */
+  { ISFUNC, rl_insert },	/* Latin capital letter u with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin capital letter Y with acute */
+  { ISFUNC, rl_insert },	/* Latin capital letter thorn (Icelandic) */
+  { ISFUNC, rl_insert },	/* Latin small letter sharp s (German) */
+  { ISFUNC, rl_insert },	/* Latin small letter a with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter a with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter a with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter a with tilde */
+  { ISFUNC, rl_insert },	/* Latin small letter a with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin small letter a with ring above */
+  { ISFUNC, rl_insert },	/* Latin small letter ae */
+  { ISFUNC, rl_insert },	/* Latin small letter c with cedilla */
+  { ISFUNC, rl_insert },	/* Latin small letter e with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter e with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter e with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter e with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin small letter i with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter i with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter i with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter i with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin small letter eth (Icelandic) */
+  { ISFUNC, rl_insert },	/* Latin small letter n with tilde */
+  { ISFUNC, rl_insert },	/* Latin small letter o with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter o with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter o with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter o with tilde */
+  { ISFUNC, rl_insert },	/* Latin small letter o with diaeresis */
+  { ISFUNC, rl_insert },	/* Division sign */
+  { ISFUNC, rl_insert },	/* Latin small letter o with stroke */
+  { ISFUNC, rl_insert },	/* Latin small letter u with grave */
+  { ISFUNC, rl_insert },	/* Latin small letter u with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter u with circumflex */
+  { ISFUNC, rl_insert },	/* Latin small letter u with diaeresis */
+  { ISFUNC, rl_insert },	/* Latin small letter y with acute */
+  { ISFUNC, rl_insert },	/* Latin small letter thorn (Icelandic) */
+  { ISFUNC, rl_insert }		/* Latin small letter y with diaeresis */
+#endif /* KEYMAP_SIZE > 128 */
+};
+
+/* Unused for the time being. */
+#if 0
+KEYMAP_ENTRY_ARRAY vi_escape_keymap = {
+  /* The regular control keys come first. */
+  { ISFUNC, (Function *)0x0 },		/* Control-@ */
+  { ISFUNC, (Function *)0x0 },		/* Control-a */
+  { ISFUNC, (Function *)0x0 },		/* Control-b */
+  { ISFUNC, (Function *)0x0 },		/* Control-c */
+  { ISFUNC, (Function *)0x0 },		/* Control-d */
+  { ISFUNC, (Function *)0x0 },		/* Control-e */
+  { ISFUNC, (Function *)0x0 },		/* Control-f */
+  { ISFUNC, (Function *)0x0 },		/* Control-g */
+  { ISFUNC, (Function *)0x0 },		/* Control-h */
+  { ISFUNC, rl_tab_insert},		/* Control-i */
+  { ISFUNC, rl_emacs_editing_mode},	/* Control-j */
+  { ISFUNC, rl_kill_line },		/* Control-k */
+  { ISFUNC, (Function *)0x0 },		/* Control-l */
+  { ISFUNC, rl_emacs_editing_mode},	/* Control-m */
+  { ISFUNC, (Function *)0x0 },		/* Control-n */
+  { ISFUNC, (Function *)0x0 },		/* Control-o */
+  { ISFUNC, (Function *)0x0 },		/* Control-p */
+  { ISFUNC, (Function *)0x0 },		/* Control-q */
+  { ISFUNC, (Function *)0x0 },		/* Control-r */
+  { ISFUNC, (Function *)0x0 },		/* Control-s */
+  { ISFUNC, (Function *)0x0 },		/* Control-t */
+  { ISFUNC, (Function *)0x0 },		/* Control-u */
+  { ISFUNC, (Function *)0x0 },		/* Control-v */
+  { ISFUNC, (Function *)0x0 },		/* Control-w */
+  { ISFUNC, (Function *)0x0 },		/* Control-x */
+  { ISFUNC, (Function *)0x0 },		/* Control-y */
+  { ISFUNC, (Function *)0x0 },		/* Control-z */
+
+  { ISFUNC, rl_vi_movement_mode },	/* Control-[ */
+  { ISFUNC, (Function *)0x0 },		/* Control-\ */
+  { ISFUNC, (Function *)0x0 },		/* Control-] */
+  { ISFUNC, (Function *)0x0 },		/* Control-^ */
+  { ISFUNC, rl_undo_command },		/* Control-_ */
+
+  /* The start of printing characters. */
+  { ISFUNC, (Function *)0x0 },		/* SPACE */
+  { ISFUNC, (Function *)0x0 },		/* ! */
+  { ISFUNC, (Function *)0x0 },		/* " */
+  { ISFUNC, (Function *)0x0 },		/* # */
+  { ISFUNC, (Function *)0x0 },		/* $ */
+  { ISFUNC, (Function *)0x0 },		/* % */
+  { ISFUNC, (Function *)0x0 },		/* & */
+  { ISFUNC, (Function *)0x0 },		/* ' */
+  { ISFUNC, (Function *)0x0 },		/* ( */
+  { ISFUNC, (Function *)0x0 },		/* ) */
+  { ISFUNC, (Function *)0x0 },		/* * */
+  { ISFUNC, (Function *)0x0 },		/* + */
+  { ISFUNC, (Function *)0x0 },		/* , */
+  { ISFUNC, (Function *)0x0 },		/* - */
+  { ISFUNC, (Function *)0x0 },		/* . */
+  { ISFUNC, (Function *)0x0 },		/* / */
+
+  /* Regular digits. */
+  { ISFUNC, rl_vi_arg_digit },		/* 0 */
+  { ISFUNC, rl_vi_arg_digit },		/* 1 */
+  { ISFUNC, rl_vi_arg_digit },		/* 2 */
+  { ISFUNC, rl_vi_arg_digit },		/* 3 */
+  { ISFUNC, rl_vi_arg_digit },		/* 4 */
+  { ISFUNC, rl_vi_arg_digit },		/* 5 */
+  { ISFUNC, rl_vi_arg_digit },		/* 6 */
+  { ISFUNC, rl_vi_arg_digit },		/* 7 */
+  { ISFUNC, rl_vi_arg_digit },		/* 8 */
+  { ISFUNC, rl_vi_arg_digit },		/* 9 */
+
+  /* A little more punctuation. */
+  { ISFUNC, (Function *)0x0 },		/* : */
+  { ISFUNC, (Function *)0x0 },		/* ; */
+  { ISFUNC, (Function *)0x0 },		/* < */
+  { ISFUNC, (Function *)0x0 },		/* = */
+  { ISFUNC, (Function *)0x0 },		/* > */
+  { ISFUNC, (Function *)0x0 },		/* ? */
+  { ISFUNC, (Function *)0x0 },		/* @ */
+
+  /* Uppercase alphabet. */
+  { ISFUNC, rl_do_lowercase_version },	/* A */
+  { ISFUNC, rl_do_lowercase_version },	/* B */
+  { ISFUNC, rl_do_lowercase_version },	/* C */
+  { ISFUNC, rl_do_lowercase_version },	/* D */
+  { ISFUNC, rl_do_lowercase_version },	/* E */
+  { ISFUNC, rl_do_lowercase_version },	/* F */
+  { ISFUNC, rl_do_lowercase_version },	/* G */
+  { ISFUNC, rl_do_lowercase_version },	/* H */
+  { ISFUNC, rl_do_lowercase_version },	/* I */
+  { ISFUNC, rl_do_lowercase_version },	/* J */
+  { ISFUNC, rl_do_lowercase_version },	/* K */
+  { ISFUNC, rl_do_lowercase_version },	/* L */
+  { ISFUNC, rl_do_lowercase_version },	/* M */
+  { ISFUNC, rl_do_lowercase_version },	/* N */
+  { ISFUNC, rl_do_lowercase_version },	/* O */
+  { ISFUNC, rl_do_lowercase_version },	/* P */
+  { ISFUNC, rl_do_lowercase_version },	/* Q */
+  { ISFUNC, rl_do_lowercase_version },	/* R */
+  { ISFUNC, rl_do_lowercase_version },	/* S */
+  { ISFUNC, rl_do_lowercase_version },	/* T */
+  { ISFUNC, rl_do_lowercase_version },	/* U */
+  { ISFUNC, rl_do_lowercase_version },	/* V */
+  { ISFUNC, rl_do_lowercase_version },	/* W */
+  { ISFUNC, rl_do_lowercase_version },	/* X */
+  { ISFUNC, rl_do_lowercase_version },	/* Y */
+  { ISFUNC, rl_do_lowercase_version },	/* Z */
+
+  /* Some more punctuation. */
+  { ISFUNC, rl_arrow_keys },		/* [ */
+  { ISFUNC, (Function *)0x0 },		/* \ */
+  { ISFUNC, (Function *)0x0 },		/* ] */
+  { ISFUNC, (Function *)0x0 },		/* ^ */
+  { ISFUNC, (Function *)0x0 },		/* _ */
+  { ISFUNC, (Function *)0x0 },		/* ` */
+
+  /* Lowercase alphabet. */
+  { ISFUNC, (Function *)0x0 },		/* a */
+  { ISFUNC, (Function *)0x0 },		/* b */
+  { ISFUNC, (Function *)0x0 },		/* c */
+  { ISFUNC, (Function *)0x0 },		/* d */
+  { ISFUNC, (Function *)0x0 },		/* e */
+  { ISFUNC, (Function *)0x0 },		/* f */
+  { ISFUNC, (Function *)0x0 },		/* g */
+  { ISFUNC, (Function *)0x0 },		/* h */
+  { ISFUNC, (Function *)0x0 },		/* i */
+  { ISFUNC, (Function *)0x0 },		/* j */
+  { ISFUNC, (Function *)0x0 },		/* k */
+  { ISFUNC, (Function *)0x0 },		/* l */
+  { ISFUNC, (Function *)0x0 },		/* m */
+  { ISFUNC, (Function *)0x0 },		/* n */
+  { ISFUNC, rl_arrow_keys },		/* o */
+  { ISFUNC, (Function *)0x0 },		/* p */
+  { ISFUNC, (Function *)0x0 },		/* q */
+  { ISFUNC, (Function *)0x0 },		/* r */
+  { ISFUNC, (Function *)0x0 },		/* s */
+  { ISFUNC, (Function *)0x0 },		/* t */
+  { ISFUNC, (Function *)0x0 },		/* u */
+  { ISFUNC, (Function *)0x0 },		/* v */
+  { ISFUNC, (Function *)0x0 },		/* w */
+  { ISFUNC, (Function *)0x0 },		/* x */
+  { ISFUNC, (Function *)0x0 },		/* y */
+  { ISFUNC, (Function *)0x0 },		/* z */
+
+  /* Final punctuation. */
+  { ISFUNC, (Function *)0x0 },		/* { */
+  { ISFUNC, (Function *)0x0 },		/* | */
+  { ISFUNC, (Function *)0x0 },		/* } */
+  { ISFUNC, (Function *)0x0 },		/* ~ */
+  { ISFUNC, rl_backward_kill_word },	/* RUBOUT */
+
+#if KEYMAP_SIZE > 128
+  /* Undefined keys. */
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 },
+  { ISFUNC, (Function *)0x0 }
+#endif /* KEYMAP_SIZE > 128 */
+};
+#endif
diff --git a/vi_mode.c b/vi_mode.c
new file mode 100644
index 0000000..f8975f7
--- /dev/null
+++ b/vi_mode.c
@@ -0,0 +1,1329 @@
+/* vi_mode.c -- A vi emulation mode for Bash.
+   Derived from code written by Jeff Sparkes (jsparkes@bnr.ca).  */
+
+/* Copyright (C) 1987, 1989, 1992 Free Software Foundation, Inc.
+
+   This file is part of the GNU Readline Library, a library for
+   reading lines of text with interactive input and history editing.
+
+   The GNU Readline Library is free software; you can redistribute it
+   and/or modify it under the terms of the GNU General Public License
+   as published by the Free Software Foundation; either version 1, or
+   (at your option) any later version.
+
+   The GNU Readline Library is distributed in the hope that it will be
+   useful, but WITHOUT ANY WARRANTY; without even the implied warranty
+   of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+   GNU General Public License for more details.
+
+   The GNU General Public License is often shipped with GNU software, and
+   is generally kept in a file called COPYING or LICENSE.  If you do not
+   have a copy of the license, write to the Free Software Foundation,
+   675 Mass Ave, Cambridge, MA 02139, USA. */
+#define READLINE_LIBRARY
+
+/* **************************************************************** */
+/*								    */
+/*			VI Emulation Mode			    */
+/*								    */
+/* **************************************************************** */
+#include "rlconf.h"
+
+#if defined (VI_MODE)
+
+#include <sys/types.h>
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+#if defined (HAVE_UNISTD_H)
+#  include <unistd.h>
+#endif
+
+#include <stdio.h>
+
+/* Some standard library routines. */
+#include "rldefs.h"
+#include "readline.h"
+#include "history.h"
+
+#ifndef digit_p
+#define digit_p(c)  ((c) >= '0' && (c) <= '9')
+#endif
+
+#ifndef digit_value
+#define digit_value(c) ((c) - '0')
+#endif
+
+#ifndef member
+#define member(c, s) ((c) ? (char *)strchr ((s), (c)) != (char *)NULL : 0)
+#endif
+
+#ifndef isident
+#define isident(c) ((pure_alphabetic (c) || digit_p (c) || c == '_'))
+#endif
+
+#ifndef exchange
+#define exchange(x, y) do {int temp = x; x = y; y = temp;} while (0)
+#endif
+
+#ifndef VI_COMMENT_BEGIN_DEFAULT
+#define VI_COMMENT_BEGIN_DEFAULT "#"
+#endif
+
+#if defined (STATIC_MALLOC)
+static char *xmalloc (), *xrealloc ();
+#else
+extern char *xmalloc (), *xrealloc ();
+#endif /* STATIC_MALLOC */
+
+/* Variables imported from readline.c */
+extern int rl_point, rl_end, rl_mark, rl_done;
+extern FILE *rl_instream;
+extern int rl_line_buffer_len, rl_explicit_arg, rl_numeric_arg;
+extern Keymap _rl_keymap;
+extern char *rl_prompt;
+extern char *rl_line_buffer;
+extern int rl_arg_sign;
+
+extern void _rl_dispatch ();
+
+extern void rl_extend_line_buffer ();
+extern int rl_vi_check ();
+
+/* Non-zero means enter insertion mode. */
+static int _rl_vi_doing_insert = 0;
+
+/* String inserted into the line by rl_vi_comment (). */
+char *rl_vi_comment_begin = (char *)NULL;
+
+/* *** UNCLEAN *** */
+/* Command keys which do movement for xxx_to commands. */
+static char *vi_motion = " hl^$0ftFt;,%wbeWBE|";
+
+/* Keymap used for vi replace characters.  Created dynamically since
+   rarely used. */
+static Keymap vi_replace_map = (Keymap)NULL;
+
+/* The number of characters inserted in the last replace operation. */
+static int vi_replace_count = 0;
+
+/* If non-zero, we have text inserted after a c[motion] command that put
+   us implicitly into insert mode.  Some people want this text to be
+   attached to the command so that it is `redoable' with `.'. */
+static int vi_continued_command = 0;
+
+static int _rl_vi_last_command = 'i';	/* default `.' puts you in insert mode */
+static int _rl_vi_last_repeat = 1;
+static int _rl_vi_last_arg_sign = 1;
+static int _rl_vi_last_motion = 0;
+static int _rl_vi_last_search_char = 0;
+static int _rl_vi_last_replacement = 0;
+
+static int vi_redoing = 0;
+
+/* Text modification commands.  These are the `redoable' commands. */
+static char *vi_textmod = "_*\\AaIiCcDdPpYyRrSsXx~";
+
+static int rl_digit_loop1 ();
+
+void
+_rl_vi_reset_last ()
+{
+  _rl_vi_last_command = 'i';
+  _rl_vi_last_repeat = 1;
+  _rl_vi_last_arg_sign = 1;
+  _rl_vi_last_motion = 0;
+}
+
+void
+_rl_vi_set_last (key, repeat, sign)
+     int key, repeat, sign;
+{
+  _rl_vi_last_command = key;
+  _rl_vi_last_repeat = repeat;
+  _rl_vi_last_arg_sign = sign;
+}
+
+/* Is the command C a VI mode text modification command? */
+int
+rl_vi_textmod_command (c)
+     int c;
+{
+  return (member (c, vi_textmod));
+}
+
+/* Bound to `.'.  Called from command mode, so we know that we have to
+   redo a text modification command.  The default for _rl_vi_last_command
+   puts you back into insert mode. */
+rl_vi_redo (count, c)
+     int count, c;
+{
+  if (!rl_explicit_arg)
+    {
+      rl_numeric_arg = _rl_vi_last_repeat;
+      rl_arg_sign = _rl_vi_last_arg_sign;
+    }
+
+  vi_redoing = 1;
+  _rl_dispatch (_rl_vi_last_command, _rl_keymap);
+  vi_redoing = 0;
+
+  return (0);
+}
+    
+/* Yank the nth arg from the previous line into this line at point. */
+rl_vi_yank_arg (count, key)
+     int count, key;
+{
+  /* Readline thinks that the first word on a line is the 0th, while vi
+     thinks the first word on a line is the 1st.  Compensate. */
+  if (rl_explicit_arg)
+    rl_yank_nth_arg (count - 1, 0);
+  else
+    rl_yank_nth_arg ('$', 0);
+
+  return (0);
+}
+
+/* With an argument, move back that many history lines, else move to the
+   beginning of history. */
+rl_vi_fetch_history (count, c)
+     int count, c;
+{
+  int current = where_history ();
+
+  /* Giving an argument of n means we want the nth command in the history
+     file.  The command number is interpreted the same way that the bash
+     `history' command does it -- that is, giving an argument count of 450
+     to this command would get the command listed as number 450 in the
+     output of `history'. */
+  if (rl_explicit_arg)
+    {
+      int wanted = history_base + current - count;
+      if (wanted <= 0)
+        rl_beginning_of_history (0, 0);
+      else
+        rl_get_previous_history (wanted);
+    }
+  else
+    rl_beginning_of_history (count, 0);
+  return (0);
+}
+
+/* Search again for the last thing searched for. */
+rl_vi_search_again (count, key)
+     int count, key;
+{
+  switch (key)
+    {
+    case 'n':
+      rl_noninc_reverse_search_again (count, key);
+      break;
+
+    case 'N':
+      rl_noninc_forward_search_again (count, key);
+      break;
+    }
+  return (0);
+}
+
+/* Do a vi style search. */
+rl_vi_search (count, key)
+     int count, key;
+{
+  switch (key)
+    {
+    case '?':
+      rl_noninc_forward_search (count, key);
+      break;
+
+    case '/':
+      rl_noninc_reverse_search (count, key);
+      break;
+
+    default:
+      ding ();
+      break;
+    }
+  return (0);
+}
+
+/* Completion, from vi's point of view. */
+rl_vi_complete (ignore, key)
+     int ignore, key;
+{
+  if ((rl_point < rl_end) && (!whitespace (rl_line_buffer[rl_point])))
+    {
+      if (!whitespace (rl_line_buffer[rl_point + 1]))
+	rl_vi_end_word (1, 'E');
+      rl_point++;
+    }
+
+  if (key == '*')
+    rl_complete_internal ('*');	/* Expansion and replacement. */
+  else if (key == '=')
+    rl_complete_internal ('?');	/* List possible completions. */
+  else if (key == '\\')
+    rl_complete_internal (TAB);	/* Standard Readline completion. */
+  else
+    rl_complete (0, key);
+
+  if (key == '*' || key == '\\')
+    {
+      _rl_vi_set_last (key, 1, rl_arg_sign);
+      rl_vi_insertion_mode ();
+    }
+  return (0);
+}
+
+/* Tilde expansion for vi mode. */
+rl_vi_tilde_expand (ignore, key)
+     int ignore, key;
+{
+  rl_tilde_expand (0, key);
+  _rl_vi_set_last (key, 1, rl_arg_sign);	/* XXX */
+  rl_vi_insertion_mode ();
+  return (0);
+}
+
+/* Previous word in vi mode. */
+rl_vi_prev_word (count, key)
+     int count, key;
+{
+  if (count < 0)
+    return (rl_vi_next_word (-count, key));
+
+  if (rl_point == 0)
+    {
+      ding ();
+      return (0);
+    }
+
+  if (uppercase_p (key))
+    rl_vi_bWord (count);
+  else
+    rl_vi_bword (count);
+
+  return (0);
+}
+
+/* Next word in vi mode. */
+rl_vi_next_word (count, key)
+     int count, key;
+{
+  if (count < 0)
+    return (rl_vi_prev_word (-count, key));
+
+  if (rl_point >= (rl_end - 1))
+    {
+      ding ();
+      return (0);
+    }
+
+  if (uppercase_p (key))
+    rl_vi_fWord (count);
+  else
+    rl_vi_fword (count);
+  return (0);
+}
+
+/* Move to the end of the ?next? word. */
+rl_vi_end_word (count, key)
+     int count, key;
+{
+  if (count < 0)
+    {
+      ding ();
+      return -1;
+    }
+
+  if (uppercase_p (key))
+    rl_vi_eWord (count);
+  else
+    rl_vi_eword (count);
+  return (0);
+}
+
+/* Move forward a word the way that 'W' does. */
+rl_vi_fWord (count)
+     int count;
+{
+  while (count-- && rl_point < (rl_end - 1))
+    {
+      /* Skip until whitespace. */
+      while (!whitespace (rl_line_buffer[rl_point]) && rl_point < rl_end)
+	rl_point++;
+
+      /* Now skip whitespace. */
+      while (whitespace (rl_line_buffer[rl_point]) && rl_point < rl_end)
+	rl_point++;
+    }
+  return (0);
+}
+
+rl_vi_bWord (count)
+     int count;
+{
+  while (count-- && rl_point > 0)
+    {
+      /* If we are at the start of a word, move back to whitespace so
+	 we will go back to the start of the previous word. */
+      if (!whitespace (rl_line_buffer[rl_point]) &&
+	  whitespace (rl_line_buffer[rl_point - 1]))
+	rl_point--;
+
+      while (rl_point > 0 && whitespace (rl_line_buffer[rl_point]))
+	rl_point--;
+
+      if (rl_point > 0)
+	{
+	  while (--rl_point >= 0 && !whitespace (rl_line_buffer[rl_point]));
+	  rl_point++;
+	}
+    }
+  return (0);
+}
+
+rl_vi_eWord (count)
+     int count;
+{
+  while (count-- && rl_point < (rl_end - 1))
+    {
+      if (!whitespace (rl_line_buffer[rl_point]))
+	rl_point++;
+
+      /* Move to the next non-whitespace character (to the start of the
+	 next word). */
+      while (++rl_point < rl_end && whitespace (rl_line_buffer[rl_point]));
+
+      if (rl_point && rl_point < rl_end)
+	{
+	  /* Skip whitespace. */
+	  while (rl_point < rl_end && whitespace (rl_line_buffer[rl_point]))
+	    rl_point++;
+
+	  /* Skip until whitespace. */
+	  while (rl_point < rl_end && !whitespace (rl_line_buffer[rl_point]))
+	    rl_point++;
+
+	  /* Move back to the last character of the word. */
+	  rl_point--;
+	}
+    }
+  return (0);
+}
+
+rl_vi_fword (count)
+     int count;
+{
+  while (count-- && rl_point < (rl_end - 1))
+    {
+      /* Move to white space (really non-identifer). */
+      if (isident (rl_line_buffer[rl_point]))
+	{
+	  while (isident (rl_line_buffer[rl_point]) && rl_point < rl_end)
+	    rl_point++;
+	}
+      else /* if (!whitespace (rl_line_buffer[rl_point])) */
+	{
+	  while (!isident (rl_line_buffer[rl_point]) &&
+		 !whitespace (rl_line_buffer[rl_point]) && rl_point < rl_end)
+	    rl_point++;
+	}
+
+      /* Move past whitespace. */
+      while (whitespace (rl_line_buffer[rl_point]) && rl_point < rl_end)
+	rl_point++;
+    }
+  return (0);
+}
+
+rl_vi_bword (count)
+     int count;
+{
+  while (count-- && rl_point > 0)
+    {
+      int last_is_ident;
+
+      /* If we are at the start of a word, move back to whitespace
+	 so we will go back to the start of the previous word. */
+      if (!whitespace (rl_line_buffer[rl_point]) &&
+	  whitespace (rl_line_buffer[rl_point - 1]))
+	rl_point--;
+
+      /* If this character and the previous character are `opposite', move
+	 back so we don't get messed up by the rl_point++ down there in
+	 the while loop.  Without this code, words like `l;' screw up the
+	 function. */
+      last_is_ident = isident (rl_line_buffer[rl_point - 1]);
+      if ((isident (rl_line_buffer[rl_point]) && !last_is_ident) ||
+	  (!isident (rl_line_buffer[rl_point]) && last_is_ident))
+	rl_point--;
+
+      while (rl_point > 0 && whitespace (rl_line_buffer[rl_point]))
+	rl_point--;
+
+      if (rl_point > 0)
+	{
+	  if (isident (rl_line_buffer[rl_point]))
+	    while (--rl_point >= 0 && isident (rl_line_buffer[rl_point]));
+	  else
+	    while (--rl_point >= 0 && !isident (rl_line_buffer[rl_point]) &&
+		   !whitespace (rl_line_buffer[rl_point]));
+	  rl_point++;
+	}
+    }
+  return (0);
+}
+
+rl_vi_eword (count)
+     int count;
+{
+  while (count-- && rl_point < rl_end - 1)
+    {
+      if (!whitespace (rl_line_buffer[rl_point]))
+	rl_point++;
+
+      while (rl_point < rl_end && whitespace (rl_line_buffer[rl_point]))
+	rl_point++;
+
+      if (rl_point < rl_end)
+	{
+	  if (isident (rl_line_buffer[rl_point]))
+	    while (++rl_point < rl_end && isident (rl_line_buffer[rl_point]));
+	  else
+	    while (++rl_point < rl_end && !isident (rl_line_buffer[rl_point])
+		   && !whitespace (rl_line_buffer[rl_point]));
+	}
+      rl_point--;
+    }
+  return (0);
+}
+
+rl_vi_insert_beg (count, key)
+     int count, key;
+{
+  rl_beg_of_line ();
+  rl_vi_insertion_mode ();
+  return (0);
+}
+
+rl_vi_append_mode (count, key)
+     int count, key;
+{
+  if (rl_point < rl_end)
+    rl_point++;
+  rl_vi_insertion_mode ();
+  return (0);
+}
+
+rl_vi_append_eol (count, key)
+     int count, key;
+{
+  rl_end_of_line ();
+  rl_vi_append_mode ();
+  return (0);
+}
+
+/* What to do in the case of C-d. */
+rl_vi_eof_maybe (count, c)
+     int count, c;
+{
+  return (rl_newline (1, '\n'));
+}
+
+/* Insertion mode stuff. */
+
+/* Switching from one mode to the other really just involves
+   switching keymaps. */
+rl_vi_insertion_mode (count, key)
+     int count, key;
+{
+  _rl_keymap = vi_insertion_keymap;
+  return (0);
+}
+
+void
+_rl_vi_done_inserting ()
+{
+  if (_rl_vi_doing_insert)
+    {
+      rl_end_undo_group ();
+      /* Now, the text between rl_undo_list->next->start and
+	 rl_undo_list->next->end is what was inserted while in insert
+	 mode. */
+      _rl_vi_doing_insert = 0;
+      vi_continued_command = 1;
+    }
+  else
+    vi_continued_command = 0;
+}
+
+rl_vi_movement_mode (count, key)
+     int count, key;
+{
+  if (rl_point > 0)
+    rl_backward (1);
+
+#if 0
+  _rl_vi_reset_last ();
+#endif
+
+  _rl_keymap = vi_movement_keymap;
+  _rl_vi_done_inserting ();
+  return (0);
+}
+
+rl_vi_arg_digit (count, c)
+     int count, c;
+{
+  if (c == '0' && rl_numeric_arg == 1 && !rl_explicit_arg)
+    return (rl_beg_of_line ());
+  else
+    return (rl_digit_argument (count, c));
+}
+
+rl_vi_change_case (count, ignore)
+     int count, ignore;
+{
+  char c = 0;
+
+  /* Don't try this on an empty line. */
+  if (rl_point >= rl_end)
+    return (0);
+
+  while (count-- && rl_point < rl_end)
+    {
+      if (uppercase_p (rl_line_buffer[rl_point]))
+	c = to_lower (rl_line_buffer[rl_point]);
+      else if (lowercase_p (rl_line_buffer[rl_point]))
+	c = to_upper (rl_line_buffer[rl_point]);
+      else
+	{
+	  /* Just skip over characters neither upper nor lower case. */
+	  rl_forward (1);
+	  continue;
+	}
+
+      /* Vi is kind of strange here. */
+      if (c)
+	{
+	  rl_begin_undo_group ();
+	  rl_delete (1, c);
+	  rl_insert (1, c);
+	  rl_end_undo_group ();
+	  rl_vi_check ();
+        }
+      else
+	rl_forward (1);
+    }
+  return (0);
+}
+
+rl_vi_put (count, key)
+     int count, key;
+{
+  if (!uppercase_p (key) && (rl_point + 1 <= rl_end))
+    rl_point++;
+
+  rl_yank ();
+  rl_backward (1);
+  return (0);
+}
+
+rl_vi_check ()
+{
+  if (rl_point && rl_point == rl_end)
+    rl_point--;
+  return (0);
+}
+
+rl_vi_column (count, key)
+     int count, key;
+{
+  if (count > rl_end)
+    rl_end_of_line ();
+  else
+    rl_point = count - 1;
+  return (0);
+}
+
+int
+rl_vi_domove (key, nextkey)
+     int key, *nextkey;
+{
+  int c, save;
+  int old_end;
+
+  rl_mark = rl_point;
+  c = rl_read_key ();
+  *nextkey = c;
+
+  if (!member (c, vi_motion))
+    {
+      if (digit_p (c))
+	{
+	  save = rl_numeric_arg;
+	  rl_numeric_arg = digit_value (c);
+	  rl_digit_loop1 ();
+	  rl_numeric_arg *= save;
+	  c = rl_read_key ();	/* real command */
+	  *nextkey = c;
+	}
+      else if (key == c && (key == 'd' || key == 'y' || key == 'c'))
+	{
+	  rl_mark = rl_end;
+	  rl_beg_of_line ();
+	  _rl_vi_last_motion = c;
+	  return (0);
+	}
+      else
+	return (-1);
+    }
+
+  _rl_vi_last_motion = c;
+
+  /* Append a blank character temporarily so that the motion routines
+     work right at the end of the line. */
+  old_end = rl_end;
+  rl_line_buffer[rl_end++] = ' ';
+  rl_line_buffer[rl_end] = '\0';
+
+  _rl_dispatch (c, _rl_keymap);
+
+  /* Remove the blank that we added. */
+  rl_end = old_end;
+  rl_line_buffer[rl_end] = '\0';
+  if (rl_point > rl_end)
+    rl_point = rl_end;
+
+  /* No change in position means the command failed. */
+  if (rl_mark == rl_point)
+    return (-1);
+
+  /* rl_vi_f[wW]ord () leaves the cursor on the first character of the next
+     word.  If we are not at the end of the line, and we are on a
+     non-whitespace character, move back one (presumably to whitespace). */
+  if ((to_upper (c) == 'W') && rl_point < rl_end && rl_point > rl_mark &&
+      !whitespace (rl_line_buffer[rl_point]))
+    rl_point--;
+
+  /* If cw or cW, back up to the end of a word, so the behaviour of ce
+     or cE is the actual result.  Brute-force, no subtlety. */
+  if (key == 'c' && rl_point >= rl_mark && (to_upper (c) == 'W'))
+    {
+      /* Don't move farther back than where we started. */
+      while (rl_point > rl_mark && whitespace (rl_line_buffer[rl_point]))
+	rl_point--;
+
+      /* Posix.2 says that if cw or cW moves the cursor towards the end of
+	 the line, the character under the cursor should be deleted. */
+      if (rl_point == rl_mark)
+        rl_point++;
+      else
+	{
+	  /* Move past the end of the word so that the kill doesn't
+	     remove the last letter of the previous word.  Only do this
+	     if we are not at the end of the line. */
+	  if (rl_point >= 0 && rl_point < (rl_end - 1) && !whitespace (rl_line_buffer[rl_point]))
+	    rl_point++;
+	}
+    }
+
+  if (rl_mark < rl_point)
+    exchange (rl_point, rl_mark);
+
+  return (0);
+}
+
+/* A simplified loop for vi. Don't dispatch key at end.
+   Don't recognize minus sign? */
+static int
+rl_digit_loop1 ()
+{
+  int key, c;
+
+  while (1)
+    {
+      rl_message ("(arg: %d) ", rl_arg_sign * rl_numeric_arg, 0);
+      key = c = rl_read_key ();
+
+      if (_rl_keymap[c].type == ISFUNC &&
+	  _rl_keymap[c].function == rl_universal_argument)
+	{
+	  rl_numeric_arg *= 4;
+	  continue;
+	}
+
+      c = UNMETA (c);
+      if (digit_p (c))
+	{
+	  if (rl_explicit_arg)
+	    rl_numeric_arg = (rl_numeric_arg * 10) + digit_value (c);
+	  else
+	    rl_numeric_arg = digit_value (c);
+	  rl_explicit_arg = 1;
+	}
+      else
+	{
+	  rl_clear_message ();
+	  rl_stuff_char (key);
+	  break;
+	}
+    }
+  return (0);
+}
+
+rl_vi_delete_to (count, key)
+     int count, key;
+{
+  int c;
+
+  if (uppercase_p (key))
+    rl_stuff_char ('$');
+  else if (vi_redoing)
+    rl_stuff_char (_rl_vi_last_motion);
+
+  if (rl_vi_domove (key, &c))
+    {
+      ding ();
+      return -1;
+    }
+
+  /* These are the motion commands that do not require adjusting the
+     mark. */
+  if ((strchr (" l|h^0%bB", c) == 0) && (rl_mark < rl_end))
+    rl_mark++;
+
+  rl_kill_text (rl_point, rl_mark);
+  return (0);
+}
+
+rl_vi_change_to (count, key)
+     int count, key;
+{
+  int c, start_pos;
+
+  if (uppercase_p (key))
+    rl_stuff_char ('$');
+  else if (vi_redoing)
+    rl_stuff_char (_rl_vi_last_motion);
+
+  start_pos = rl_point;
+
+  if (rl_vi_domove (key, &c))
+    {
+      ding ();
+      return -1;
+    }
+
+  /* These are the motion commands that do not require adjusting the
+     mark.  c[wW] are handled by special-case code in rl_vi_domove(),
+     and already leave the mark at the correct location. */
+  if ((strchr (" l|hwW^0%bB", c) == 0) && (rl_mark < rl_end))
+    rl_mark++;
+
+  /* The cursor never moves with c[wW]. */
+  if ((to_upper (c) == 'W') && rl_point < start_pos)
+    rl_point = start_pos;
+
+  rl_kill_text (rl_point, rl_mark);
+
+  rl_begin_undo_group ();
+  _rl_vi_doing_insert = 1;
+  _rl_vi_set_last (key, count, rl_arg_sign);
+  rl_vi_insertion_mode ();
+
+  return (0);
+}
+
+rl_vi_yank_to (count, key)
+     int count, key;
+{
+  int c, save = rl_point;
+
+  if (uppercase_p (key))
+    rl_stuff_char ('$');
+
+  if (rl_vi_domove (key, &c))
+    {
+      ding ();
+      return -1;
+    }
+
+  /* These are the motion commands that do not require adjusting the
+     mark. */
+  if ((strchr (" l|h^0%bB", c) == 0) && (rl_mark < rl_end))
+    rl_mark++;
+
+  rl_begin_undo_group ();
+  rl_kill_text (rl_point, rl_mark);
+  rl_end_undo_group ();
+  rl_do_undo ();
+  rl_point = save;
+
+  return (0);
+}
+
+rl_vi_delete (count, key)
+     int count, key;
+{
+  int end;
+
+  if (rl_end == 0)
+    {
+      ding ();
+      return -1;
+    }
+
+  end = rl_point + count;
+
+  if (end >= rl_end)
+    end = rl_end;
+
+  rl_kill_text (rl_point, end);
+  
+  if (rl_point > 0 && rl_point == rl_end)
+    rl_backward (1);
+  return (0);
+}
+
+/* Turn the current line into a comment in shell history.
+   A K*rn shell style function. */
+rl_vi_comment (count, key)
+     int count, key;
+{
+  rl_beg_of_line ();
+
+  if (rl_vi_comment_begin != (char *)NULL)
+    rl_insert_text (rl_vi_comment_begin);
+  else
+    rl_insert_text (VI_COMMENT_BEGIN_DEFAULT);	/* Default. */
+
+  rl_redisplay ();
+  rl_newline (1, '\010');
+  return (0);
+}
+
+rl_vi_first_print (count, key)
+     int count, key;
+{
+  return (rl_back_to_indent ());
+}
+
+rl_back_to_indent (ignore1, ignore2)
+     int ignore1, ignore2;
+{
+  rl_beg_of_line ();
+  while (rl_point < rl_end && whitespace (rl_line_buffer[rl_point]))
+    rl_point++;
+  return (0);
+}
+
+/* NOTE: it is necessary that opposite directions are inverses */
+#define	FTO	 1		/* forward to */
+#define BTO	-1		/* backward to */
+#define FFIND	 2		/* forward find */
+#define BFIND	-2		/* backward find */
+
+rl_vi_char_search (count, key)
+     int count, key;
+{
+  static char target;
+  static int orig_dir, dir;
+  int pos;
+
+  if (key == ';' || key == ',')
+    dir = (key == ';' ? orig_dir : -orig_dir);
+  else
+    {
+      if (vi_redoing)
+	target = _rl_vi_last_search_char;
+      else
+	_rl_vi_last_search_char = target = rl_getc (rl_instream);
+
+      switch (key)
+        {
+        case 't':
+          orig_dir = dir = FTO;
+          break;
+
+        case 'T':
+          orig_dir = dir = BTO;
+          break;
+
+        case 'f':
+          orig_dir = dir = FFIND;
+          break;
+
+        case 'F':
+          orig_dir = dir = BFIND;
+          break;
+        }
+    }
+
+  pos = rl_point;
+
+  while (count--)
+    {
+      if (dir < 0)
+	{
+	  if (pos == 0)
+	    {
+	      ding ();
+	      return -1;
+	    }
+
+	  pos--;
+	  do
+	    {
+	      if (rl_line_buffer[pos] == target)
+		{
+		  if (dir == BTO)
+		    rl_point = pos + 1;
+		  else
+		    rl_point = pos;
+		  break;
+		}
+	    }
+	  while (pos--);
+
+	  if (pos < 0)
+	    {
+	      ding ();
+	      return -1;
+	    }
+	}
+      else
+	{			/* dir > 0 */
+	  if (pos >= rl_end)
+	    {
+	      ding ();
+	      return -1;
+	    }
+
+	  pos++;
+	  do
+	    {
+	      if (rl_line_buffer[pos] == target)
+		{
+		  if (dir == FTO)
+		    rl_point = pos - 1;
+		  else
+		    rl_point = pos;
+		  break;
+		}
+	    }
+	  while (++pos < rl_end);
+
+	  if (pos >= (rl_end - 1))
+	    {
+	      ding ();
+	      return -1;
+	    }
+	}
+    }
+  return (0);
+}
+
+/* Match brackets */
+rl_vi_match (ignore, key)
+     int ignore, key;
+{
+  int count = 1, brack, pos;
+
+  pos = rl_point;
+  if ((brack = rl_vi_bracktype (rl_line_buffer[rl_point])) == 0)
+    {
+      while ((brack = rl_vi_bracktype (rl_line_buffer[rl_point])) == 0 &&
+	     rl_point < rl_end - 1)
+	rl_forward (1);
+
+      if (brack <= 0)
+	{
+	  rl_point = pos;
+	  ding ();
+	  return -1;
+	}
+    }
+
+  pos = rl_point;
+
+  if (brack < 0)
+    {
+      while (count)
+	{
+	  if (--pos >= 0)
+	    {
+	      int b = rl_vi_bracktype (rl_line_buffer[pos]);
+	      if (b == -brack)
+		count--;
+	      else if (b == brack)
+		count++;
+	    }
+	  else
+	    {
+	      ding ();
+	      return -1;
+	    }
+	}
+    }
+  else
+    {			/* brack > 0 */
+      while (count)
+	{
+	  if (++pos < rl_end)
+	    {
+	      int b = rl_vi_bracktype (rl_line_buffer[pos]);
+	      if (b == -brack)
+		count--;
+	      else if (b == brack)
+		count++;
+	    }
+	  else
+	    {
+	      ding ();
+	      return -1;
+	    }
+	}
+    }
+  rl_point = pos;
+  return (0);
+}
+
+int
+rl_vi_bracktype (c)
+     int c;
+{
+  switch (c)
+    {
+    case '(': return  1;
+    case ')': return -1;
+    case '[': return  2;
+    case ']': return -2;
+    case '{': return  3;
+    case '}': return -3;
+    default:  return  0;
+    }
+}
+
+rl_vi_change_char (count, key)
+     int count, key;
+{
+  int c;
+
+  if (vi_redoing)
+    c = _rl_vi_last_replacement;
+  else
+    _rl_vi_last_replacement = c = rl_getc (rl_instream);
+
+  if (c == '\033' || c == CTRL ('C'))
+    return -1;
+
+  while (count-- && rl_point < rl_end)
+    {
+      rl_begin_undo_group ();
+
+      rl_delete (1, c);
+      rl_insert (1, c);
+      if (count == 0)
+	rl_backward (1);
+
+      rl_end_undo_group ();
+    }
+  return (0);
+}
+
+rl_vi_subst (count, key)
+     int count, key;
+{
+  rl_begin_undo_group ();
+
+  if (uppercase_p (key))
+    {
+      rl_beg_of_line ();
+      rl_kill_line (1);
+    }
+  else
+    rl_delete (count, key);
+
+  rl_end_undo_group ();
+
+  _rl_vi_set_last (key, count, rl_arg_sign);
+
+  rl_begin_undo_group ();
+  _rl_vi_doing_insert = 1;
+  rl_vi_insertion_mode ();
+
+  return (0);
+}
+
+rl_vi_overstrike (count, key)
+     int count, key;
+{
+  int i;
+
+  if (_rl_vi_doing_insert == 0)
+    {
+      _rl_vi_doing_insert = 1;
+      rl_begin_undo_group ();
+    }
+
+  for (i = 0; i < count; i++)
+    {
+      vi_replace_count++;
+      rl_begin_undo_group ();
+
+      if (rl_point < rl_end)
+	{
+	  rl_delete (1, key);
+	  rl_insert (1, key);
+	}
+      else
+	rl_insert (1, key);
+
+      rl_end_undo_group ();
+    }
+  return (0);
+}
+
+rl_vi_overstrike_delete (count)
+     int count;
+{
+  int i, s;
+
+  for (i = 0; i < count; i++)
+    {
+      if (vi_replace_count == 0)
+	{
+	  ding ();
+	  break;
+	}
+      s = rl_point;
+
+      if (rl_do_undo ())
+	vi_replace_count--;
+
+      if (rl_point == s)
+	rl_backward (1);
+    }
+
+  if (vi_replace_count == 0 && _rl_vi_doing_insert)
+    {
+      rl_end_undo_group ();
+      rl_do_undo ();
+      _rl_vi_doing_insert = 0;
+    }
+  return (0);
+}
+
+rl_vi_replace (count, key)
+     int count, key;
+{
+  int i;
+
+  vi_replace_count = 0;
+
+  if (!vi_replace_map)
+    {
+      vi_replace_map = rl_make_bare_keymap ();
+
+      for (i = ' '; i < 127; i++)
+	vi_replace_map[i].function = rl_vi_overstrike;
+
+      vi_replace_map[RUBOUT].function = rl_vi_overstrike_delete;
+      vi_replace_map[ESC].function = rl_vi_movement_mode;
+      vi_replace_map[RETURN].function = rl_newline;
+      vi_replace_map[NEWLINE].function = rl_newline;
+
+      /* If the normal vi insertion keymap has ^H bound to erase, do the
+         same here.  Probably should remove the assignment to RUBOUT up
+         there, but I don't think it will make a difference in real life. */
+      if (vi_insertion_keymap[CTRL ('H')].type == ISFUNC &&
+	  vi_insertion_keymap[CTRL ('H')].function == rl_rubout)
+	vi_replace_map[CTRL ('H')].function = rl_vi_overstrike_delete;
+
+    }
+  _rl_keymap = vi_replace_map;
+  return (0);
+}
+
+#if 0
+/* Try to complete the word we are standing on or the word that ends with
+   the previous character.  A space matches everything.  Word delimiters are
+   space and ;. */
+rl_vi_possible_completions()
+{
+  int save_pos = rl_point;
+
+  if (rl_line_buffer[rl_point] != ' ' && rl_line_buffer[rl_point] != ';')
+    {
+      while (rl_point < rl_end && rl_line_buffer[rl_point] != ' ' &&
+	     rl_line_buffer[rl_point] != ';')
+	rl_point++;
+    }
+  else if (rl_line_buffer[rl_point - 1] == ';')
+    {
+      ding ();
+      return (0);
+    }
+
+  rl_possible_completions ();
+  rl_point = save_pos;
+
+  return (0);
+}
+#endif
+
+#if defined (STATIC_MALLOC)
+
+/* **************************************************************** */
+/*								    */
+/*			xmalloc and xrealloc ()		     	    */
+/*								    */
+/* **************************************************************** */
+
+static void memory_error_and_abort ();
+
+static char *
+xmalloc (bytes)
+     int bytes;
+{
+  char *temp = (char *)malloc (bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+  return (temp);
+}
+
+static char *
+xrealloc (pointer, bytes)
+     char *pointer;
+     int bytes;
+{
+  char *temp;
+
+  if (!pointer)
+    temp = (char *)xmalloc (bytes);
+  else
+    temp = (char *)realloc (pointer, bytes);
+
+  if (!temp)
+    memory_error_and_abort ();
+
+  return (temp);
+}
+
+static void
+memory_error_and_abort ()
+{
+  fprintf (stderr, "readline: Out of virtual memory!\n");
+  abort ();
+}
+#endif /* STATIC_MALLOC */
+
+#endif /* VI_MODE */
diff --git a/xmalloc.c b/xmalloc.c
new file mode 100644
index 0000000..4f6dc76
--- /dev/null
+++ b/xmalloc.c
@@ -0,0 +1,78 @@
+/* xmalloc.c -- safe versions of malloc and realloc */
+
+/* Copyright (C) 1991 Free Software Foundation, Inc.
+
+   This file is part of GNU Readline, a library for reading lines
+   of text with interactive input and history editing.
+
+   Readline is free software; you can redistribute it and/or modify it
+   under the terms of the GNU General Public License as published by the
+   Free Software Foundation; either version 1, or (at your option) any
+   later version.
+
+   Readline is distributed in the hope that it will be useful, but
+   WITHOUT ANY WARRANTY; without even the implied warranty of
+   MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+   General Public License for more details.
+
+   You should have received a copy of the GNU General Public License
+   along with Readline; see the file COPYING.  If not, write to the Free
+   Software Foundation, 675 Mass Ave, Cambridge, MA 02139, USA. */
+
+#if defined (ALREADY_HAVE_XMALLOC)
+#else
+#include <stdio.h>
+
+#if defined (HAVE_STDLIB_H)
+#  include <stdlib.h>
+#else
+#  include "ansi_stdlib.h"
+#endif /* HAVE_STDLIB_H */
+
+static void memory_error_and_abort ();
+
+/* **************************************************************** */
+/*								    */
+/*		   Memory Allocation and Deallocation.		    */
+/*								    */
+/* **************************************************************** */
+
+/* Return a pointer to free()able block of memory large enough
+   to hold BYTES number of bytes.  If the memory cannot be allocated,
+   print an error message and abort. */
+char *
+xmalloc (bytes)
+     int bytes;
+{
+  char *temp = (char *)malloc (bytes);
+
+  if (!temp)
+    memory_error_and_abort ("xmalloc");
+  return (temp);
+}
+
+char *
+xrealloc (pointer, bytes)
+     char *pointer;
+     int bytes;
+{
+  char *temp;
+
+  if (!pointer)
+    temp = (char *)malloc (bytes);
+  else
+    temp = (char *)realloc (pointer, bytes);
+
+  if (!temp)
+    memory_error_and_abort ("xrealloc");
+  return (temp);
+}
+
+static void
+memory_error_and_abort (fname)
+     char *fname;
+{
+  fprintf (stderr, "%s: Out of virtual memory!\n", fname);
+  abort ();
+}
+#endif /* !ALREADY_HAVE_XMALLOC */