BASELINE: Update Chromium to 80.0.3987.136

Change-Id: I98e1649aafae85ba3a83e67af00bb27ef301db7b Reviewed-by: Jüri Valdmann <juri.valdmann@qt.io>
author: Allan Sandfeld Jensen <allan.jensen@qt.io> 2020-03-11 11:32:04 +0100
committer: Allan Sandfeld Jensen <allan.jensen@qt.io> 2020-03-18 13:40:17 +0000
commit: 31ccca0778db85c159634478b4ec7997f6704860 (patch)
tree: 3d33fc3afd9d5ec95541e1bbe074a9cf8da12a0e /chromium/third_party/devtools-frontend/src/node_modules/mocha
parent: 248b70b82a40964d5594eb04feca0fa36716185d (diff)
download: qtwebengine-chromium-31ccca0778db85c159634478b4ec7997f6704860.tar.gz
128 files changed, 47067 insertions, 0 deletions
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/CHANGELOG.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/CHANGELOG.md
new file mode 100644
index 00000000000..f61ff11537e
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/CHANGELOG.md
@@ -0,0 +1,1816 @@
+# 6.2.0 / 2019-07-18
+
+## :tada: Enhancements
+
+- [#3827](https://github.com/mochajs/mocha/issues/3827): Do not fork child-process if no Node flags are present ([**@boneskull**](https://github.com/boneskull))
+- [#3725](https://github.com/mochajs/mocha/issues/3725): Base reporter store ref to console.log, see [mocha/wiki](https://github.com/mochajs/mocha/wiki/HOW-TO:-Correctly-stub-stdout) ([**@craigtaub**](https://github.com/craigtaub))
+
+## :bug: Fixes
+
+- [#3942](https://github.com/mochajs/mocha/issues/3942): Fix "No test files found" Error when file is passed via `--file` ([**@gabegorelick**](https://github.com/gabegorelick))
+- [#3914](https://github.com/mochajs/mocha/issues/3914): Modify Mocha constructor to accept options `global` or `globals` ([**@pascalpp**](https://github.com/pascalpp))
+- [#3894](https://github.com/mochajs/mocha/issues/3894): Fix parsing of config files with `_mocha` binary ([**@juergba**](https://github.com/juergba))
+- [#3834](https://github.com/mochajs/mocha/issues/3834): Fix CLI parsing with default values ([**@boneskull**](https://github.com/boneskull), [**@juergba**](https://github.com/juergba))
+- [#3831](https://github.com/mochajs/mocha/issues/3831): Fix `--timeout`/`--slow` string values and duplicate arguments ([**@boneskull**](https://github.com/boneskull), [**@juergba**](https://github.com/juergba))
+
+## :book: Documentation
+
+- [#3906](https://github.com/mochajs/mocha/issues/3906): Document option to define custom report name for XUnit reporter ([**@pkuczynski**](https://github.com/pkuczynski))
+- [#3889](https://github.com/mochajs/mocha/issues/3889): Adds doc links for mocha-examples ([**@craigtaub**](https://github.com/craigtaub))
+- [#3887](https://github.com/mochajs/mocha/issues/3887): Fix broken links ([**@toyjhlee**](https://github.com/toyjhlee))
+- [#3841](https://github.com/mochajs/mocha/issues/3841): Fix anchors to configuration section ([**@trescube**](https://github.com/trescube))
+
+## :mag: Coverage
+
+- [#3915](https://github.com/mochajs/mocha/issues/3915), [#3929](https://github.com/mochajs/mocha/issues/3929): Increase tests coverage for `--watch` options ([**@geigerzaehler**](https://github.com/geigerzaehler))
+
+## :nut_and_bolt: Other
+
+- [#3953](https://github.com/mochajs/mocha/issues/3953): Collect test files later, prepares improvements to the `--watch` mode behavior ([**@geigerzaehler**](https://github.com/geigerzaehler))
+- [#3939](https://github.com/mochajs/mocha/issues/3939): Upgrade for npm audit ([**@boneskull**](https://github.com/boneskull))
+- [#3930](https://github.com/mochajs/mocha/issues/3930): Extract `runWatch` into separate module ([**@geigerzaehler**](https://github.com/geigerzaehler))
+- [#3922](https://github.com/mochajs/mocha/issues/3922): Add `mocha.min.js` file to stacktrace filter ([**@brian-lagerman**](https://github.com/brian-lagerman))
+- [#3919](https://github.com/mochajs/mocha/issues/3919): Update CI config files to use Node-12.x ([**@plroebuck**](https://github.com/plroebuck))
+- [#3892](https://github.com/mochajs/mocha/issues/3892): Rework reporter tests ([**@plroebuck**](https://github.com/plroebuck))
+- [#3872](https://github.com/mochajs/mocha/issues/3872): Rename `--exclude` to `--ignore` and create alias ([**@boneskull**](https://github.com/boneskull))
+- [#3963](https://github.com/mochajs/mocha/issues/3963): Hide stacktrace when cli args are missing ([**@outsideris**](https://github.com/outsideris))
+- [#3956](https://github.com/mochajs/mocha/issues/3956): Do not redeclare variable in docs array example ([**@DanielRuf**](https://github.com/DanielRuf))
+- [#3957](https://github.com/mochajs/mocha/issues/3957): Remove duplicate line-height property in `mocha.css` ([**@DanielRuf**](https://github.com/DanielRuf))
+- [#3960](https://github.com/mochajs/mocha/issues/3960): Don't re-initialize grep option on watch re-run ([**@geigerzaehler**](https://github.com/geigerzaehler))
+
+# 6.1.4 / 2019-04-18
+
+## :lock: Security Fixes
+
+- [#3877](https://github.com/mochajs/mocha/issues/3877): Upgrade [js-yaml](https://npm.im/js-yaml), addressing [code injection vulnerability](https://www.npmjs.com/advisories/813) ([**@bjornstar**](https://github.com/bjornstar))
+
+# 6.1.3 / 2019-04-11
+
+## :bug: Fixes
+
+- [#3863](https://github.com/mochajs/mocha/issues/3863): Fix `yargs`-related global scope pollution ([**@inukshuk**](https://github.com/inukshuk))
+- [#3869](https://github.com/mochajs/mocha/issues/3869): Fix failure when installed w/ `pnpm` ([**@boneskull**](https://github.com/boneskull))
+
+# 6.1.2 / 2019-04-08
+
+## :bug: Fixes
+
+- [#3867](https://github.com/mochajs/mocha/issues/3867): Re-publish v6.1.1 from POSIX OS to avoid dropped executable flags ([**@boneskull**](https://github.com/boneskull))
+
+# 6.1.1 / 2019-04-07
+
+## :bug: Fixes
+
+- [#3866](https://github.com/mochajs/mocha/issues/3866): Fix Windows End-of-Line publishing issue ([**@juergba**](https://github.com/juergba) & [**@cspotcode**](https://github.com/cspotcode))
+
+# 6.1.0 / 2019-04-07
+
+## :lock: Security Fixes
+
+- [#3845](https://github.com/mochajs/mocha/issues/3845): Update dependency "js-yaml" to v3.13.0 per npm security advisory ([**@plroebuck**](https://github.com/plroebuck))
+
+## :tada: Enhancements
+
+- [#3766](https://github.com/mochajs/mocha/issues/3766): Make reporter constructor support optional `options` parameter ([**@plroebuck**](https://github.com/plroebuck))
+- [#3760](https://github.com/mochajs/mocha/issues/3760): Add support for config files with `.jsonc` extension ([**@sstephant**](https://github.com/sstephant))
+
+## :fax: Deprecations
+
+These are _soft_-deprecated, and will emit a warning upon use. Support will be removed in (likely) the next major version of Mocha:
+
+- [#3719](https://github.com/mochajs/mocha/issues/3719): Deprecate `this.skip()` for "after all" hooks ([**@juergba**](https://github.com/juergba))
+
+## :bug: Fixes
+
+- [#3829](https://github.com/mochajs/mocha/issues/3829): Use cwd-relative pathname to load config file ([**@plroebuck**](https://github.com/plroebuck))
+- [#3745](https://github.com/mochajs/mocha/issues/3745): Fix async calls of `this.skip()` in "before each" hooks ([**@juergba**](https://github.com/juergba))
+- [#3669](https://github.com/mochajs/mocha/issues/3669): Enable `--allow-uncaught` for uncaught exceptions thrown inside hooks ([**@givanse**](https://github.com/givanse))
+
+and some regressions:
+
+- [#3848](https://github.com/mochajs/mocha/issues/3848): Fix `Suite` cloning by copying `root` property ([**@fatso83**](https://github.com/fatso83))
+- [#3816](https://github.com/mochajs/mocha/issues/3816): Guard against undefined timeout option ([**@boneskull**](https://github.com/boneskull))
+- [#3814](https://github.com/mochajs/mocha/issues/3814): Update "yargs" in order to avoid deprecation message ([**@boneskull**](https://github.com/boneskull))
+- [#3788](https://github.com/mochajs/mocha/issues/3788): Fix support for multiple node flags ([**@aginzberg**](https://github.com/aginzberg))
+
+## :book: Documentation
+
+- [mochajs/mocha-examples](https://github.com/mochajs/mocha-examples): New repository of working examples of common configurations using mocha ([**@craigtaub**](https://github.com/craigtaub))
+- [#3850](https://github.com/mochajs/mocha/issues/3850): Remove pound icon showing on header hover on docs ([**@jd2rogers2**](https://github.com/jd2rogers2))
+- [#3812](https://github.com/mochajs/mocha/issues/3812): Add autoprefixer to documentation page CSS ([**@Munter**](https://github.com/Munter))
+- [#3811](https://github.com/mochajs/mocha/issues/3811): Update doc examples "tests.html" ([**@DavidLi119**](https://github.com/DavidLi119))
+- [#3807](https://github.com/mochajs/mocha/issues/3807): Mocha website HTML tweaks ([**@plroebuck**](https://github.com/plroebuck))
+- [#3793](https://github.com/mochajs/mocha/issues/3793): Update config file example ".mocharc.yml" ([**@cspotcode**](https://github.com/cspotcode))
+
+## :nut_and_bolt: Other
+
+- [#3830](https://github.com/mochajs/mocha/issues/3830): Replace dependency "findup-sync" with "find-up" for faster startup ([**@cspotcode**](https://github.com/cspotcode))
+- [#3799](https://github.com/mochajs/mocha/issues/3799): Update devDependencies to fix many npm vulnerabilities ([**@XhmikosR**](https://github.com/XhmikosR))
+
+# 6.0.2 / 2019-02-25
+
+## :bug: Fixes
+
+Two more regressions fixed:
+
+- [#3768](https://github.com/mochajs/mocha/issues/3768): Test file paths no longer dropped from `mocha.opts` ([**@boneskull**](https://github.com/boneskull))
+- [#3767](https://github.com/mochajs/mocha/issues/3767): `--require` does not break on module names that look like certain `node` flags ([**@boneskull**](https://github.com/boneskull))
+
+# 6.0.1 / 2019-02-21
+
+The obligatory round of post-major-release bugfixes.
+
+## :bug: Fixes
+
+These issues were regressions.
+
+- [#3754](https://github.com/mochajs/mocha/issues/3754): Mocha again finds `test.js` when run without arguments ([**@plroebuck**](https://github.com/plroebuck))
+- [#3756](https://github.com/mochajs/mocha/issues/3756): Mocha again supports third-party interfaces via `--ui` ([**@boneskull**](https://github.com/boneskull))
+- [#3755](https://github.com/mochajs/mocha/issues/3755): Fix broken `--watch` ([**@boneskull**](https://github.com/boneskull))
+- [#3759](https://github.com/mochajs/mocha/issues/3759): Fix unwelcome deprecation notice when Mocha run against languages (CoffeeScript) with implicit return statements; _returning a non-`undefined` value from a `describe` callback is no longer considered deprecated_ ([**@boneskull**](https://github.com/boneskull))
+
+## :book: Documentation
+
+- [#3738](https://github.com/mochajs/mocha/issues/3738): Upgrade to `@mocha/docdash@2` ([**@tendonstrength**](https://github.com/tendonstrength))
+- [#3751](https://github.com/mochajs/mocha/issues/3751): Use preferred names for example config files ([**@Szauka**](https://github.com/Szauka))
+
+# 6.0.0 / 2019-02-18
+
+## :tada: Enhancements
+
+- [#3726](https://github.com/mochajs/mocha/issues/3726): Add ability to unload files from `require` cache ([**@plroebuck**](https://github.com/plroebuck))
+
+## :bug: Fixes
+
+- [#3737](https://github.com/mochajs/mocha/issues/3737): Fix falsy values from options globals ([**@plroebuck**](https://github.com/plroebuck))
+- [#3707](https://github.com/mochajs/mocha/issues/3707): Fix encapsulation issues for `Suite#_onlyTests` and `Suite#_onlySuites` ([**@vkarpov15**](https://github.com/vkarpov15))
+- [#3711](https://github.com/mochajs/mocha/issues/3711): Fix diagnostic messages dealing with plurality and markup of output ([**@plroebuck**](https://github.com/plroebuck))
+- [#3723](https://github.com/mochajs/mocha/issues/3723): Fix "reporter-option" to allow comma-separated options ([**@boneskull**](https://github.com/boneskull))
+- [#3722](https://github.com/mochajs/mocha/issues/3722): Fix code quality and performance of `lookupFiles` and `files` ([**@plroebuck**](https://github.com/plroebuck))
+- [#3650](https://github.com/mochajs/mocha/issues/3650), [#3654](https://github.com/mochajs/mocha/issues/3654): Fix noisy error message when no files found ([**@craigtaub**](https://github.com/craigtaub))
+- [#3632](https://github.com/mochajs/mocha/issues/3632): Tests having an empty title are no longer confused with the "root" suite ([**@juergba**](https://github.com/juergba))
+- [#3666](https://github.com/mochajs/mocha/issues/3666): Fix missing error codes ([**@vkarpov15**](https://github.com/vkarpov15))
+- [#3684](https://github.com/mochajs/mocha/issues/3684): Fix exiting problem in Node.js v11.7.0+ ([**@addaleax**](https://github.com/addaleax))
+- [#3691](https://github.com/mochajs/mocha/issues/3691): Fix `--delay` (and other boolean options) not working in all cases ([**@boneskull**](https://github.com/boneskull))
+- [#3692](https://github.com/mochajs/mocha/issues/3692): Fix invalid command-line argument usage not causing actual errors ([**@boneskull**](https://github.com/boneskull))
+- [#3698](https://github.com/mochajs/mocha/issues/3698), [#3699](https://github.com/mochajs/mocha/issues/3699): Fix debug-related Node.js options not working in all cases ([**@boneskull**](https://github.com/boneskull))
+- [#3700](https://github.com/mochajs/mocha/issues/3700): Growl notifications now show the correct number of tests run ([**@outsideris**](https://github.com/outsideris))
+- [#3686](https://github.com/mochajs/mocha/issues/3686): Avoid potential ReDoS when diffing large objects ([**@cyjake**](https://github.com/cyjake))
+- [#3715](https://github.com/mochajs/mocha/issues/3715): Fix incorrect order of emitted events when used programmatically ([**@boneskull**](https://github.com/boneskull))
+- [#3706](https://github.com/mochajs/mocha/issues/3706): Fix regression wherein `--reporter-option`/`--reporter-options` did not support comma-separated key/value pairs ([**@boneskull**](https://github.com/boneskull))
+
+## :book: Documentation
+
+- [#3652](https://github.com/mochajs/mocha/issues/3652): Switch from Jekyll to Eleventy ([**@Munter**](https://github.com/Munter))
+
+## :nut_and_bolt: Other
+
+- [#3677](https://github.com/mochajs/mocha/issues/3677): Add error objects for createUnsupportedError and createInvalidExceptionError ([**@boneskull**](https://github.com/boneskull))
+- [#3733](https://github.com/mochajs/mocha/issues/3733): Removed unnecessary processing in post-processing hook ([**@wanseob**](https://github.com/wanseob))
+- [#3730](https://github.com/mochajs/mocha/issues/3730): Update nyc to latest version ([**@coreyfarrell**](https://github.com/coreyfarrell))
+- [#3648](https://github.com/mochajs/mocha/issues/3648), [#3680](https://github.com/mochajs/mocha/issues/3680): Fixes to support latest versions of [unexpected](https://npm.im/unexpected) and [unexpected-sinon](https://npm.im/unexpected-sinon) ([**@sunesimonsen**](https://github.com/sunesimonsen))
+- [#3638](https://github.com/mochajs/mocha/issues/3638): Add meta tag to site ([**@MartijnCuppens**](https://github.com/MartijnCuppens))
+- [#3653](https://github.com/mochajs/mocha/issues/3653): Fix parts of test suite failing to run on Windows ([**@boneskull**](https://github.com/boneskull))
+
+# 6.0.0-1 / 2019-01-02
+
+## :bug: Fixes
+
+- Fix missing `mocharc.json` in published package ([**@boneskull**](https://github.com/boneskull))
+
+# 6.0.0-0 / 2019-01-01
+
+**Documentation for this release can be found at [next.mochajs.org](https://next.mochajs.org)**!
+
+Welcome [**@plroebuck**](https://github.com/plroebuck), [**@craigtaub**](https://github.com/craigtaub), & [**@markowsiak**](https://github.com/markowsiak) to the team!
+
+## :boom: Breaking Changes
+
+- [#3149](https://github.com/mochajs/mocha/issues/3149): **Drop Node.js v4.x support** ([**@outsideris**](https://github.com/outsideris))
+- [#3556](https://github.com/mochajs/mocha/issues/3556): Changes to command-line options ([**@boneskull**](https://github.com/boneskull)):
+  - `--grep` and `--fgrep` are now mutually exclusive; attempting to use both will cause Mocha to fail instead of simply ignoring `--grep`
+  - `--compilers` is no longer supported; attempting to use will cause Mocha to fail with a link to more information
+  - `-d` is no longer an alias for `--debug`; `-d` is currently ignored
+  - [#3275](https://github.com/mochajs/mocha/issues/3275): `--watch-extensions` no longer implies `js`; it must be explicitly added ([**@TheDancingCode**](https://github.com/TheDancingCode))
+- [#2908](https://github.com/mochajs/mocha/issues/2908): `tap` reporter emits error messages ([**@chrmod**](https://github.com/chrmod))
+- [#2819](https://github.com/mochajs/mocha/issues/2819): When conditionally skipping in a `before` hook, subsequent `before` hooks _and_ tests in nested suites are now skipped ([**@bannmoore**](https://github.com/bannmoore))
+- [#627](https://github.com/mochajs/mocha/issues/627): Emit filepath in "timeout exceeded" exceptions where applicable ([**@boneskull**](https://github.com/boneskull))
+- [#3556](https://github.com/mochajs/mocha/issues/3556): `lib/template.html` has moved to `lib/browser/template.html` ([**@boneskull**](https://github.com/boneskull))
+- [#2576](https://github.com/mochajs/mocha/issues/2576): An exception is now thrown if Mocha fails to parse or find a `mocha.opts` at a user-specified path ([**@plroebuck**](https://github.com/plroebuck))
+- [#3458](https://github.com/mochajs/mocha/issues/3458): Instantiating a `Base`-extending reporter without a `Runner` parameter will throw an exception ([**@craigtaub**](https://github.com/craigtaub))
+- [#3125](https://github.com/mochajs/mocha/issues/3125): For consumers of Mocha's programmatic API, all exceptions thrown from Mocha now have a `code` property (and some will have additional metadata). Some `Error` messages have changed. **Please use the `code` property to check `Error` types instead of the `message` property**; these descriptions will be localized in the future. ([**@craigtaub**](https://github.com/craigtaub))
+
+## :fax: Deprecations
+
+These are _soft_-deprecated, and will emit a warning upon use. Support will be removed in (likely) the next major version of Mocha:
+
+- `-gc` users should use `--gc-global` instead
+- Consumers of the function exported by `bin/options` should now use the `loadMochaOpts` or `loadOptions` (preferred) functions exported by the `lib/cli/options` module
+
+Regarding the `Mocha` class constructor (from `lib/mocha`):
+
+- Use property `color: false` instead of `useColors: false`
+- Use property `timeout: false` instead of `enableTimeouts: false`
+
+All of the above deprecations were introduced by [#3556](https://github.com/mochajs/mocha/issues/3556).
+
+`mocha.opts` is now considered "legacy"; please prefer RC file or `package.json` over `mocha.opts`.
+
+## :tada: Enhancements
+
+Enhancements introduced in [#3556](https://github.com/mochajs/mocha/issues/3556):
+
+- Mocha now supports "RC" files in JS, JSON, YAML, or `package.json`-based (using `mocha` property) format
+
+  - `.mocharc.js`, `.mocharc.json`, `.mocharc.yaml` or `.mocharc.yml` are valid "rc" file names and will be automatically loaded
+  - Use `--config /path/to/rc/file` to specify an explicit path
+  - Use `--package /path/to/package.json` to specify an explicit `package.json` to read the `mocha` prop from
+  - Use `--no-config` or `--no-package` to completely disable loading of configuration via RC file and `package.json`, respectively
+  - Configurations are merged as applicable using the priority list:
+    1. Command-line arguments
+    1. RC file
+    1. `package.json`
+    1. `mocha.opts`
+    1. Mocha's own defaults
+  - Check out these [example config files](https://github.com/mochajs/mocha/tree/master/example/config)
+
+- Node/V8 flag support in `mocha` executable:
+
+  - Support all allowed `node` flags as supported by the running version of `node` (also thanks to [**@demurgos**](https://github.com/demurgos))
+  - Support any V8 flag by prepending `--v8-` to the flag name
+  - All flags are also supported via config files, `package.json` properties, or `mocha.opts`
+  - Debug-related flags (e.g., `--inspect`) now _imply_ `--no-timeouts`
+  - Use of e.g., `--debug` will automatically invoke `--inspect` if supported by running version of `node`
+
+- Support negation of any Mocha-specific command-line flag by prepending `--no-` to the flag name
+
+- Interfaces now have descriptions when listed using `--interfaces` flag
+
+- `Mocha` constructor supports all options
+
+- `--extension` is now an alias for `--watch-extensions` and affects _non-watch-mode_ test runs as well. For example, to run _only_ `test/*.coffee` (not `test/*.js`), you can do `mocha --require coffee-script/register --extensions coffee`.
+
+- [#3552](https://github.com/mochajs/mocha/issues/3552): `tap` reporter is now TAP13-capable ([**@plroebuck**](https://github.com/plroebuck) & [**@mollstam**](https://github.com/mollstam))
+
+- [#3535](https://github.com/mochajs/mocha/issues/3535): Mocha's version can now be queried programmatically via public property `Mocha.prototype.version` ([**@plroebuck**](https://github.com/plroebuck))
+
+- [#3428](https://github.com/mochajs/mocha/issues/3428): `xunit` reporter shows diffs ([**@mlucool**](https://github.com/mlucool))
+
+- [#2529](https://github.com/mochajs/mocha/issues/2529): `Runner` now emits a `retry` event when tests are retried (reporters can listen for this) ([**@catdad**](https://github.com/catdad))
+
+- [#2962](https://github.com/mochajs/mocha/issues/2962), [#3111](https://github.com/mochajs/mocha/issues/3111): In-browser notification support; warn about missing prereqs when `--growl` supplied ([**@plroebuck**](https://github.com/plroebuck))
+
+## :bug: Fixes
+
+- [#3356](https://github.com/mochajs/mocha/issues/3356): `--no-timeouts` and `--timeout 0` now does what you'd expect ([**@boneskull**](https://github.com/boneskull))
+- [#3475](https://github.com/mochajs/mocha/issues/3475): Restore `--no-exit` option ([**@boneskull**](https://github.com/boneskull))
+- [#3570](https://github.com/mochajs/mocha/issues/3570): Long-running tests now respect `SIGINT` ([**@boneskull**](https://github.com/boneskull))
+- [#2944](https://github.com/mochajs/mocha/issues/2944): `--forbid-only` and `--forbid-pending` now "fail fast" when encountered on a suite ([**@outsideris**](https://github.com/outsideris))
+- [#1652](https://github.com/mochajs/mocha/issues/1652), [#2951](https://github.com/mochajs/mocha/issues/2951): Fix broken clamping of timeout values ([**@plroebuck**](https://github.com/plroebuck))
+- [#2095](https://github.com/mochajs/mocha/issues/2095), [#3521](https://github.com/mochajs/mocha/issues/3521): Do not log `stdout:` prefix in browser console ([**@Bamieh**](https://github.com/Bamieh))
+- [#3595](https://github.com/mochajs/mocha/issues/3595): Fix mochajs.org deployment problems ([**@papandreou**](https://github.com/papandreou))
+- [#3518](https://github.com/mochajs/mocha/issues/3518): Improve `utils.isPromise()` ([**@fabiosantoscode**](https://github.com/fabiosantoscode))
+- [#3320](https://github.com/mochajs/mocha/issues/3320): Fail gracefully when non-extensible objects are thrown in async tests ([**@fargies**](https://github.com/fargies))
+- [#2475](https://github.com/mochajs/mocha/issues/2475): XUnit does not duplicate test result numbers in "errors" and "failures"; "failures" will **always** be zero ([**@mlucool**](https://github.com/mlucool))
+- [#3398](https://github.com/mochajs/mocha/issues/3398), [#3598](https://github.com/mochajs/mocha/issues/3598), [#3457](https://github.com/mochajs/mocha/issues/3457), [#3617](https://github.com/mochajs/mocha/issues/3617): Fix regression wherein `--bail` would not execute "after" nor "after each" hooks ([**@juergba**](https://github.com/juergba))
+- [#3580](https://github.com/mochajs/mocha/issues/3580): Fix potential exception when using XUnit reporter programmatically ([**@Lana-Light**](https://github.com/Lana-Light))
+- [#1304](https://github.com/mochajs/mocha/issues/1304): Do not output color to `TERM=dumb` ([**@plroebuck**](https://github.com/plroebuck))
+
+## :book: Documentation
+
+- [#3525](https://github.com/mochajs/mocha/issues/3525): Improvements to `.github/CONTRIBUTING.md` ([**@markowsiak**](https://github.com/markowsiak))
+- [#3466](https://github.com/mochajs/mocha/issues/3466): Update description of `slow` option ([**@finfin**](https://github.com/finfin))
+- [#3405](https://github.com/mochajs/mocha/issues/3405): Remove references to bower installations ([**@goteamtim**](https://github.com/goteamtim))
+- [#3361](https://github.com/mochajs/mocha/issues/3361): Improvements to `--watch` docs ([**@benglass**](https://github.com/benglass))
+- [#3136](https://github.com/mochajs/mocha/issues/3136): Improve docs around globbing and shell expansion ([**@akrawchyk**](https://github.com/akrawchyk))
+- [#2819](https://github.com/mochajs/mocha/issues/2819): Update docs around skips and hooks ([**@bannmoore**](https://github.com/bannmoore))
+- Many improvements by [**@outsideris**](https://github.com/outsideris)
+
+## :nut_and_bolt: Other
+
+- [#3557](https://github.com/mochajs/mocha/issues/3557): Use `ms` userland module instead of hand-rolled solution ([**@gizemkeser**](https://github.com/gizemkeser))
+- Many CI fixes and other refactors by [**@plroebuck**](https://github.com/plroebuck)
+- Test refactors by [**@outsideris**](https://github.com/outsideris)
+
+# 5.2.0 / 2018-05-18
+
+## :tada: Enhancements
+
+- [#3375](https://github.com/mochajs/mocha/pull/3375): Add support for comments in `mocha.opts` ([@plroebuck](https://github.com/plroebuck))
+
+## :bug: Fixes
+
+- [#3346](https://github.com/mochajs/mocha/pull/3346): Exit correctly from `before` hooks when using `--bail` ([@outsideris](https://github.com/outsideris))
+
+## :book: Documentation
+
+- [#3328](https://github.com/mochajs/mocha/pull/3328): Mocha-flavored [API docs](https://mochajs.org/api/)! ([@Munter](https://github.com/munter))
+
+## :nut_and_bolt: Other
+
+- [#3330](https://github.com/mochajs/mocha/pull/3330): Use `Buffer.from()` ([@harrysarson](https://github.com/harrysarson))
+- [#3295](https://github.com/mochajs/mocha/pull/3295): Remove redundant folder ([@DavNej](https://github.com/DajNev))
+- [#3356](https://github.com/mochajs/mocha/pull/3356): Refactoring ([@plroebuck](https://github.com/plroebuck))
+
+# 5.1.1 / 2018-04-18
+
+## :bug: Fixes
+
+- [#3325](https://github.com/mochajs/mocha/issues/3325): Revert change which broke `--watch` ([@boneskull](https://github.com/boneskull))
+
+# 5.1.0 / 2018-04-12
+
+## :tada: Enhancements
+
+- [#3210](https://github.com/mochajs/mocha/pull/3210): Add `--exclude` option ([@metalex9](https://github.com/metalex9))
+
+## :bug: Fixes
+
+- [#3318](https://github.com/mochajs/mocha/pull/3318): Fix failures in circular objects in JSON reporter ([@jeversmann](https://github.com/jeversmann), [@boneskull](https://github.com/boneskull))
+
+## :book: Documentation
+
+- [#3323](https://github.com/mochajs/mocha/pull/3323): Publish actual [API documentation](https://mochajs.org/api/)! ([@dfberry](https://github.com/dfberry), [@Munter](https://github.com/munter))
+- [#3299](https://github.com/mochajs/mocha/pull/3299): Improve docs around exclusive tests ([@nicgirault](https://github.com/nicgirault))
+
+## :nut_and_bolt: Other
+
+- [#3302](https://github.com/mochajs/mocha/pull/3302), [#3308](https://github.com/mochajs/mocha/pull/3308), [#3310](https://github.com/mochajs/mocha/pull/3310), [#3315](https://github.com/mochajs/mocha/pull/3315), [#3316](https://github.com/mochajs/mocha/pull/3316): Build matrix improvements ([more info](https://boneskull.com/mocha-and-travis-ci-build-stages/)) ([@outsideris](https://github.com/outsideris), [@boneskull](https://github.com/boneskull))
+- [#3272](https://github.com/mochajs/mocha/pull/3272): Refactor reporter tests ([@jMuzsik](https://github.com/jMuzsik))
+
+# 5.0.5 / 2018-03-22
+
+Welcome [@outsideris](https://github.com/outsideris) to the team!
+
+## :bug: Fixes
+
+- [#3096](https://github.com/mochajs/mocha/issues/3096): Fix `--bail` failing to bail within hooks ([@outsideris](https://github.com/outsideris))
+- [#3184](https://github.com/mochajs/mocha/issues/3184): Don't skip too many suites (using `describe.skip()`) ([@outsideris](https://github.com/outsideris))
+
+## :book: Documentation
+
+- [#3133](https://github.com/mochajs/mocha/issues/3133): Improve docs regarding "pending" behavior ([@ematicipo](https://github.com/ematicipo))
+- [#3276](https://github.com/mochajs/mocha/pull/3276), [#3274](https://github.com/mochajs/mocha/pull/3274): Fix broken stuff in `CHANGELOG.md` ([@tagoro9](https://github.com/tagoro9), [@honzajavorek](https://github.com/honzajavorek))
+
+## :nut_and_bolt: Other
+
+- [#3208](https://github.com/mochajs/mocha/issues/3208): Improve test coverage for AMD users ([@outsideris](https://github.com/outsideris))
+- [#3267](https://github.com/mochajs/mocha/pull/3267): Remove vestiges of PhantomJS from CI ([@anishkny](https://github.com/anishkny))
+- [#2952](https://github.com/mochajs/mocha/issues/2952): Fix a debug message ([@boneskull](https://github.com/boneskull))
+
+# 5.0.4 / 2018-03-07
+
+## :bug: Fixes
+
+- [#3265](https://github.com/mochajs/mocha/issues/3265): Fixes regression in "watch" functionality introduced in v5.0.2 ([@outsideris](https://github.com/outsideris))
+
+# 5.0.3 / 2018-03-06
+
+This patch features a fix to address a potential "low severity" [ReDoS vulnerability](https://snyk.io/vuln/npm:diff:20180305) in the [diff](https://npm.im/diff) package (a dependency of Mocha).
+
+## :lock: Security Fixes
+
+- [#3266](https://github.com/mochajs/mocha/pull/3266): Bump `diff` to v3.5.0 ([@anishkny](https://github.com/anishkny))
+
+## :nut_and_bolt: Other
+
+- [#3011](https://github.com/mochajs/mocha/issues/3011): Expose `generateDiff()` in `Base` reporter ([@harrysarson](https://github.com/harrysarson))
+
+# 5.0.2 / 2018-03-05
+
+This release fixes a class of tests which report as _false positives_. **Certain tests will now break**, though they would have previously been reported as passing. Details below. Sorry for the inconvenience!
+
+## :bug: Fixes
+
+- [#3226](https://github.com/mochajs/mocha/issues/3226): Do not swallow errors that are thrown asynchronously from passing tests ([@boneskull](https://github.com/boneskull)). Example:
+
+  \```js
+  it('should actually fail, sorry!', function (done) {
+  // passing assertion
+  assert(true === true);
+
+  // test complete & is marked as passing
+  done();
+
+  // ...but something evil lurks within
+  setTimeout(() => {
+  throw new Error('chaos!');
+  }, 100);
+  });
+  \```
+
+  Previously to this version, Mocha would have _silently swallowed_ the `chaos!` exception, and you wouldn't know. Well, _now you know_. Mocha cannot recover from this gracefully, so it will exit with a nonzero code.
+
+  **Maintainers of external reporters**: _If_ a test of this class is encountered, the `Runner` instance will emit the `end` event _twice_; you _may_ need to change your reporter to use `runner.once('end')` intead of `runner.on('end')`.
+
+- [#3093](https://github.com/mochajs/mocha/issues/3093): Fix stack trace reformatting problem ([@outsideris](https://github.com/outsideris))
+
+## :nut_and_bolt: Other
+
+- [#3248](https://github.com/mochajs/mocha/issues/3248): Update `browser-stdout` to v1.3.1 ([@honzajavorek](https://github.com/honzajavorek))
+
+# 5.0.1 / 2018-02-07
+
+...your garden-variety patch release.
+
+Special thanks to [Wallaby.js](https://wallabyjs.com) for their continued support! :heart:
+
+## :bug: Fixes
+
+- [#1838](https://github.com/mochajs/mocha/issues/1838): `--delay` now works with `.only()` ([@silviom](https://github.com/silviom))
+- [#3119](https://github.com/mochajs/mocha/issues/3119): Plug memory leak present in v8 ([@boneskull](https://github.com/boneskull))
+
+## :book: Documentation
+
+- [#3132](https://github.com/mochajs/mocha/issues/3132), [#3098](https://github.com/mochajs/mocha/issues/3098): Update `--glob` docs ([@outsideris](https://github.com/outsideris))
+- [#3212](https://github.com/mochajs/mocha/pull/3212): Update [Wallaby.js](https://wallabyjs.com)-related docs ([@ArtemGovorov](https://github.com/ArtemGovorov))
+- [#3205](https://github.com/mochajs/mocha/pull/3205): Remove outdated cruft ([@boneskull](https://github.com/boneskull))
+
+## :nut_and_bolt: Other
+
+- [#3224](https://github.com/mochajs/mocha/pull/3224): Add proper Wallaby.js config ([@ArtemGovorov](https://github.com/ArtemGovorov))
+- [#3230](https://github.com/mochajs/mocha/pull/3230): Update copyright year ([@josephlin55555](https://github.com/josephlin55555))
+
+# 5.0.0 / 2018-01-17
+
+Mocha starts off 2018 right by again dropping support for _unmaintained rubbish_.
+
+Welcome [@vkarpov15](https://github.com/vkarpov15) to the team!
+
+## :boom: Breaking Changes
+
+- **[#3148](https://github.com/mochajs/mocha/issues/3148): Drop support for IE9 and IE10** ([@Bamieh](https://github.com/Bamieh))
+  Practically speaking, only code which consumes (through bundling or otherwise) the userland [buffer](https://npm.im/buffer) module should be affected. However, Mocha will no longer test against these browsers, nor apply fixes for them.
+
+## :tada: Enhancements
+
+- [#3181](https://github.com/mochajs/mocha/issues/3181): Add useful new `--file` command line argument ([documentation](https://mochajs.org/#--file-file)) ([@hswolff](https://github.com/hswolff))
+
+## :bug: Fixes
+
+- [#3187](https://github.com/mochajs/mocha/issues/3187): Fix inaccurate test duration reporting ([@FND](https://github.com/FND))
+- [#3202](https://github.com/mochajs/mocha/pull/3202): Fix bad markup in HTML reporter ([@DanielRuf](https://github.com/DanielRuf))
+
+## :sunglasses: Developer Experience
+
+- [#2352](https://github.com/mochajs/mocha/issues/2352): Ditch GNU Make for [nps](https://npm.im/nps) to manage scripts ([@TedYav](https://github.com/TedYav))
+
+## :book: Documentation
+
+- [#3137](https://github.com/mochajs/mocha/issues/3137): Add missing `--no-timeouts` docs ([@dfberry](https://github.com/dfberry))
+- [#3134](https://github.com/mochajs/mocha/issues/3134): Improve `done()` callback docs ([@maraisr](https://github.com/maraisr))
+- [#3135](https://github.com/mochajs/mocha/issues/3135): Fix cross-references ([@vkarpov15](https://github.com/vkarpov15))
+- [#3163](https://github.com/mochajs/mocha/pull/3163): Fix tpyos ([@tbroadley](https://github.com/tbroadley))
+- [#3177](https://github.com/mochajs/mocha/pull/3177): Tweak `README.md` organization ([@xxczaki](https://github.com/xxczaki))
+- Misc updates ([@boneskull](https://github.com/boneskull))
+
+## :nut_and_bolt: Other
+
+- [#3118](https://github.com/mochajs/mocha/issues/3118): Move TextMate Integration to [its own repo](https://github.com/mochajs/mocha.tmbundle) ([@Bamieh](https://github.com/Bamieh))
+- [#3185](https://github.com/mochajs/mocha/issues/3185): Add Node.js v9 to build matrix; remove v7 ([@xxczaki](https://github.com/xxczaki))
+- [#3172](https://github.com/mochajs/mocha/issues/3172): Markdown linting ([@boneskull](https://github.com/boneskull))
+- Test & Netlify updates ([@Munter](https://github.com/munter), [@boneskull](https://github.com/boneskull))
+
+# 4.1.0 / 2017-12-28
+
+This is mainly a "housekeeping" release.
+
+Welcome [@Bamieh](https://github.com/Bamieh) and [@xxczaki](https://github.com/xxczaki) to the team!
+
+## :bug: Fixes
+
+- [#2661](https://github.com/mochajs/mocha/issues/2661): `progress` reporter now accepts reporter options ([@canoztokmak](https://github.com/canoztokmak))
+- [#3142](https://github.com/mochajs/mocha/issues/3142): `xit` in `bdd` interface now properly returns its `Test` object ([@Bamieh](https://github.com/Bamieh))
+- [#3075](https://github.com/mochajs/mocha/pull/3075): Diffs now computed eagerly to avoid misinformation when reported ([@abrady0](https://github.com/abrady0))
+- [#2745](https://github.com/mochajs/mocha/issues/2745): `--help` will now help you even if you have a `mocha.opts` ([@Zarel](https://github.com/Zarel))
+
+## :tada: Enhancements
+
+- [#2514](https://github.com/mochajs/mocha/issues/2514): The `--no-diff` flag will completely disable diff output ([@CapacitorSet](https://github.com/CapacitorSet))
+- [#3058](https://github.com/mochajs/mocha/issues/3058): All "setters" in Mocha's API are now also "getters" if called without arguments ([@makepanic](https://github.com/makepanic))
+
+## :book: Documentation
+
+- [#3170](https://github.com/mochajs/mocha/pull/3170): Optimization and site speed improvements ([@Munter](https://github.com/munter))
+- [#2987](https://github.com/mochajs/mocha/issues/2987): Moved the old [site repo](https://github.com/mochajs/mochajs.github.io) into the main repo under `docs/` ([@boneskull](https://github.com/boneskull))
+- [#2896](https://github.com/mochajs/mocha/issues/2896): Add [maintainer guide](https://github.com/mochajs/mocha/blob/master/MAINTAINERS.md) ([@boneskull](https://github.com/boneskull))
+- Various fixes and updates ([@xxczaki](https://github.com/xxczaki), [@maty21](https://github.com/maty21), [@leedm777](https://github.com/leedm777))
+
+## :nut_and_bolt: Other
+
+- Test improvements and fixes ([@eugenet8k](https://github.com/eugenet8k), [@ngeor](https://github.com/ngeor), [@38elements](https://github.com/38elements), [@Gerhut](https://github.com/Gerhut), [@ScottFreeCode](https://github.com/ScottFreeCode), [@boneskull](https://github.com/boneskull))
+- Refactoring and cruft excision ([@38elements](https://github.com/38elements), [@Bamieh](https://github.com/Bamieh), [@finnigantime](https://github.com/finnigantime), [@boneskull](https://github.com/boneskull))
+
+# 4.0.1 / 2017-10-05
+
+## :bug: Fixes
+
+- [#3051](https://github.com/mochajs/mocha/pull/3051): Upgrade Growl to v1.10.3 to fix its [peer dep problems](https://github.com/tj/node-growl/pull/68) ([@dpogue](https://github.com/dpogue))
+
+# 4.0.0 / 2017-10-02
+
+You might want to read this before filing a new bug! :stuck_out_tongue_closed_eyes:
+
+## :boom: Breaking Changes
+
+For more info, please [read this article](https://boneskull.com/mocha-v4-nears-release/).
+
+### Compatibility
+
+- [#3016](https://github.com/mochajs/mocha/issues/3016): Drop support for unmaintained versions of Node.js ([@boneskull](https://github.com/boneskull)):
+  - 0.10.x
+  - 0.11.x
+  - 0.12.x
+  - iojs (any)
+  - 5.x.x
+- [#2979](https://github.com/mochajs/mocha/issues/2979): Drop support for non-ES5-compliant browsers ([@boneskull](https://github.com/boneskull)):
+  - IE7
+  - IE8
+  - PhantomJS 1.x
+- [#2615](https://github.com/mochajs/mocha/issues/2615): Drop Bower support; old versions (3.x, etc.) will remain available ([@ScottFreeCode](https://github.com/ScottFreeCode), [@boneskull](https://github.com/boneskull))
+
+### Default Behavior
+
+- [#2879](https://github.com/mochajs/mocha/issues/2879): By default, Mocha will no longer force the process to exit once all tests complete. This means any test code (or code under test) which would normally prevent `node` from exiting will do so when run in Mocha. Supply the `--exit` flag to revert to pre-v4.0.0 behavior ([@ScottFreeCode](https://github.com/ScottFreeCode), [@boneskull](https://github.com/boneskull))
+
+### Reporter Output
+
+- [#2095](https://github.com/mochajs/mocha/issues/2095): Remove `stdout:` prefix from browser reporter logs ([@skeggse](https://github.com/skeggse))
+- [#2295](https://github.com/mochajs/mocha/issues/2295): Add separator in "unified diff" output ([@olsonpm](https://github.com/olsonpm))
+- [#2686](https://github.com/mochajs/mocha/issues/2686): Print failure message when `--forbid-pending` or `--forbid-only` is specified ([@ScottFreeCode](https://github.com/ScottFreeCode))
+- [#2814](https://github.com/mochajs/mocha/pull/2814): Indent contexts for better readability when reporting failures ([@charlierudolph](https://github.com/charlierudolph))
+
+## :-1: Deprecations
+
+- [#2493](https://github.com/mochajs/mocha/issues/2493): The `--compilers` command-line option is now soft-deprecated and will emit a warning on `STDERR`. Read [this](https://github.com/mochajs/mocha/wiki/compilers-deprecation) for more info and workarounds ([@ScottFreeCode](https://github.com/ScottFreeCode), [@boneskull](https://github.com/boneskull))
+
+## :tada: Enhancements
+
+- [#2628](https://github.com/mochajs/mocha/issues/2628): Allow override of default test suite name in XUnit reporter ([@ngeor](https://github.com/ngeor))
+
+## :book: Documentation
+
+- [#3020](https://github.com/mochajs/mocha/pull/3020): Link to CLA in `README.md` and `CONTRIBUTING.md` ([@skeggse](https://github.com/skeggse))
+
+## :nut_and_bolt: Other
+
+- [#2890](https://github.com/mochajs/mocha/issues/2890): Speed up build by (re-)consolidating SauceLabs tests ([@boneskull](https://github.com/boneskull))
+
+# 3.5.3 / 2017-09-11
+
+## :bug: Fixes
+
+- [#3003](https://github.com/mochajs/mocha/pull/3003): Fix invalid entities in xUnit reporter first appearing in v3.5.1 ([@jkrems](https://github.com/jkrems))
+
+# 3.5.2 / 2017-09-10
+
+## :bug: Fixes
+
+- [#3001](https://github.com/mochajs/mocha/pull/3001): Fix AMD-related failures first appearing in v3.5.1 ([@boneskull](https://github.com/boneskull))
+
+# 3.5.1 / 2017-09-09
+
+## :newspaper: News
+
+- :mega: Mocha is now sponsoring [PDXNode](http://pdxnode.org)! If you're in the [Portland](https://wikipedia.org/wiki/Portland,_Oregon) area, come check out the monthly talks and hack nights!
+
+## :bug: Fixes
+
+- [#2997](https://github.com/mochajs/mocha/pull/2997): Fix missing `xit` export for "require" interface ([@solodynamo](https://github.com/solodynamo))
+- [#2957](https://github.com/mochajs/mocha/pull/2957): Fix unicode character handling in XUnit reporter failures ([@jkrems](https://github.com/jkrems))
+
+## :nut_and_bolt: Other
+
+- [#2986](https://github.com/mochajs/mocha/pull/2986): Add issue and PR templates ([@kungapal](https://github.com/kungapal))
+- [#2918](https://github.com/mochajs/mocha/pull/2918): Drop bash dependency for glob-related tests ([@ScottFreeCode](https://github.com/ScottFreeCode))
+- [#2922](https://github.com/mochajs/mocha/pull/2922): Improve `--compilers` coverage ([@ScottFreeCode](https://github.com/ScottFreeCode))
+- [#2981](https://github.com/mochajs/mocha/pull/2981): Fix tpyos and spelling errors ([@jsoref](https://github.com/jsoref))
+
+# 3.5.0 / 2017-07-31
+
+## :newspaper: News
+
+- Mocha now has a [code of conduct](https://github.com/mochajs/mocha/blob/master/.github/CODE_OF_CONDUCT.md) (thanks [@kungapal](https://github.com/kungapal)!).
+- Old issues and PRs are now being marked "stale" by [Probot's "Stale" plugin](https://github.com/probot/stale). If an issue is marked as such, and you would like to see it remain open, simply add a new comment to the ticket or PR.
+- **WARNING**: Support for non-ES5-compliant environments will be dropped starting with version 4.0.0 of Mocha!
+
+## :lock: Security Fixes
+
+- [#2860](https://github.com/mochajs/mocha/pull/2860): Address [CVE-2015-8315](https://nodesecurity.io/advisories/46) via upgrade of [debug](https://npm.im/debug) ([@boneskull](https://github.com/boneskull))
+
+## :tada: Enhancements
+
+- [#2696](https://github.com/mochajs/mocha/pull/2696): Add `--forbid-only` and `--forbid-pending` flags. Use these in CI or hooks to ensure tests aren't accidentally being skipped! ([@charlierudolph](https://github.com/charlierudolph))
+- [#2813](https://github.com/mochajs/mocha/pull/2813): Support Node.js 8's `--napi-modules` flag ([@jupp0r](https://github.com/jupp0r))
+
+## :nut_and_bolt: Other
+
+- Various CI-and-test-related fixes and improvements ([@boneskull](https://github.com/boneskull), [@dasilvacontin](https://github.com/dasilvacontin), [@PopradiArpad](https://github.com/PopradiArpad), [@Munter](https://github.com/munter), [@ScottFreeCode](https://github.com/ScottFreeCode))
+- "Officially" support Node.js 8 ([@elergy](https://github.com/elergy))
+
+# 3.4.2 / 2017-05-24
+
+## :bug: Fixes
+
+- [#2802](https://github.com/mochajs/mocha/issues/2802): Remove call to deprecated `os.tmpDir` ([@makepanic](https://github.com/makepanic))
+- [#2820](https://github.com/mochajs/mocha/pull/2820): Eagerly set `process.exitCode` ([@chrisleck](https://github.com/chrisleck))
+
+## :nut_and_bolt: Other
+
+- [#2807](https://github.com/mochajs/mocha/pull/2807): Move linting into an npm script ([@Munter](https://github.com/munter))
+
+# 3.4.1 / 2017-05-14
+
+Fixed a publishing mishap with git's autocrlf settings.
+
+# 3.4.0 / 2017-05-14
+
+Mocha is now moving to a quicker release schedule: when non-breaking changes are merged, a release should happen that week.
+
+This week's highlights:
+
+- `allowUncaught` added to commandline as `--allow-uncaught` (and bugfixed)
+- warning-related Node flags
+
+## :tada: Enhancements
+
+- [#2793](https://github.com/mochajs/mocha/pull/2793), [#2697](https://github.com/mochajs/mocha/pull/2697): add --allowUncaught to Node.js ([@lrowe](https://github.com/lrowe))
+- [#2733](https://github.com/mochajs/mocha/pull/2733): Add `--no-warnings` and `--trace-warnings` flags ([@sonicdoe](https://github.com/sonicdoe))
+
+## :bug: Fixes
+
+- [#2793](https://github.com/mochajs/mocha/pull/2793), [#2697](https://github.com/mochajs/mocha/pull/2697): fix broken allowUncaught ([@lrowe](https://github.com/lrowe))
+
+## :nut_and_bolt: Other
+
+- [#2778](https://github.com/mochajs/mocha/pull/2778): Add license report and scan status ([@xizhao](https://github.com/xizhao))
+- [#2794](https://github.com/mochajs/mocha/pull/2794): no special case for macOS running Karma locally ([@boneskull](https://github.com/boneskull))
+- [#2795](https://github.com/mochajs/mocha/pull/2795): reverts use of semistandard directly ([#2648](https://github.com/mochajs/mocha/pull/2648)) ([@boneskull](https://github.com/boneskull))
+
+# 3.3.0 / 2017-04-24
+
+Thanks to all our contributors, maintainers, sponsors, and users! ❤️
+
+As highlights:
+
+- We've got coverage now!
+- Testing is looking less flaky \\o/.
+- No more nitpicking about "mocha.js" build on PRs.
+
+## :tada: Enhancements
+
+- [#2659](https://github.com/mochajs/mocha/pull/2659): Adds support for loading reporter from an absolute or relative path ([@sul4bh](https://github.com/sul4bh))
+- [#2769](https://github.com/mochajs/mocha/pull/2769): Support `--inspect-brk` on command-line ([@igwejk](https://github.com/igwejk))
+
+## :bug: Fixes
+
+- [#2662](https://github.com/mochajs/mocha/pull/2662): Replace unicode chars w/ hex codes in HTML reporter ([@rotemdan](https://github.com/rotemdan))
+
+## :mag: Coverage
+
+- [#2672](https://github.com/mochajs/mocha/pull/2672): Add coverage for node tests ([@c089](https://github.com/c089), [@Munter](https://github.com/munter))
+- [#2680](https://github.com/mochajs/mocha/pull/2680): Increase tests coverage for base reporter ([@epallerols](https://github.com/epallerols))
+- [#2690](https://github.com/mochajs/mocha/pull/2690): Increase tests coverage for doc reporter ([@craigtaub](https://github.com/craigtaub))
+- [#2701](https://github.com/mochajs/mocha/pull/2701): Increase tests coverage for landing, min, tap and list reporters ([@craigtaub](https://github.com/craigtaub))
+- [#2691](https://github.com/mochajs/mocha/pull/2691): Increase tests coverage for spec + dot reporters ([@craigtaub](https://github.com/craigtaub))
+- [#2698](https://github.com/mochajs/mocha/pull/2698): Increase tests coverage for xunit reporter ([@craigtaub](https://github.com/craigtaub))
+- [#2699](https://github.com/mochajs/mocha/pull/2699): Increase tests coverage for json-stream, markdown and progress reporters ([@craigtaub](https://github.com/craigtaub))
+- [#2703](https://github.com/mochajs/mocha/pull/2703): Cover .some() function in utils.js with tests ([@seppevs](https://github.com/seppevs))
+- [#2773](https://github.com/mochajs/mocha/pull/2773): Add tests for loading reporters w/ relative/absolute paths ([@sul4bh](https://github.com/sul4bh))
+
+## :nut_and_bolt: Other
+
+- Remove bin/.eslintrc; ensure execs are linted ([@boneskull](https://github.com/boneskull))
+- [#2542](https://github.com/mochajs/mocha/issues/2542): Expand CONTRIBUTING.md ([@boneskull](https://github.com/boneskull))
+- [#2660](https://github.com/mochajs/mocha/pull/2660): Double timeouts on integration tests ([@Munter](https://github.com/munter))
+- [#2653](https://github.com/mochajs/mocha/pull/2653): Update copyright year ([@Scottkao85], [@Munter](https://github.com/munter))
+- [#2621](https://github.com/mochajs/mocha/pull/2621): Update dependencies to enable Greenkeeper ([@boneskull](https://github.com/boneskull), [@greenkeeper](https://github.com/greenkeeper))
+- [#2625](https://github.com/mochajs/mocha/pull/2625): Use trusty container in travis-ci; use "artifacts" addon ([@boneskull](https://github.com/boneskull))
+- [#2670](https://github.com/mochajs/mocha/pull/2670): doc(CONTRIBUTING): fix link to org members ([@coderbyheart](https://github.com/coderbyheart))
+- Add Mocha propaganda to README.md ([@boneskull](https://github.com/boneskull))
+- [#2470](https://github.com/mochajs/mocha/pull/2470): Avoid test flake in "delay" test ([@boneskull](https://github.com/boneskull))
+- [#2675](https://github.com/mochajs/mocha/pull/2675): Limit browser concurrency on sauce ([@boneskull](https://github.com/boneskull))
+- [#2669](https://github.com/mochajs/mocha/pull/2669): Use temporary test-only build of mocha.js for browsers tests ([@Munter](https://github.com/munter))
+- Fix "projects" link in README.md ([@boneskull](https://github.com/boneskull))
+- [#2678](https://github.com/mochajs/mocha/pull/2678): Chore(Saucelabs): test on IE9, IE10 and IE11 ([@coderbyheart](https://github.com/coderbyheart))
+- [#2648](https://github.com/mochajs/mocha/pull/2648): Use `semistandard` directly ([@kt3k](https://github.com/kt3k))
+- [#2727](https://github.com/mochajs/mocha/pull/2727): Make the build reproducible ([@lamby](https://github.com/lamby))
+
+# 3.2.0 / 2016-11-24
+
+## :newspaper: News
+
+### Mocha is now a JS Foundation Project!
+
+Mocha is proud to have joined the [JS Foundation](https://js.foundation). For more information, [read the announcement](https://js.foundation/announcements/2016/10/17/Linux-Foundation-Unites-JavaScript-Community-Open-Web-Development/).
+
+### Contributor License Agreement
+
+Under the foundation, all contributors to Mocha must sign the [JS Foundation CLA](https://js.foundation/CLA/) before their code can be merged. When sending a PR--if you have not already signed the CLA--a friendly bot will ask you to do so.
+
+Mocha remains licensed under the [MIT license](https://github.com/mochajs/mocha/blob/master/LICENSE).
+
+## :bug: Bug Fix
+
+- [#2535](https://github.com/mochajs/mocha/issues/2535): Fix crash when `--watch` encounters broken symlinks ([@villesau](https://github.com/villesau))
+- [#2593](https://github.com/mochajs/mocha/pull/2593): Fix (old) regression; incorrect symbol shown in `list` reporter ([@Aldaviva](https://github.com/Aldaviva))
+- [#2584](https://github.com/mochajs/mocha/issues/2584): Fix potential error when running XUnit reporter ([@vobujs](https://github.com/vobujs))
+
+## :tada: Enhancement
+
+- [#2294](https://github.com/mochajs/mocha/issues/2294): Improve timeout error messaging ([@jeversmann](https://github.com/jeversmann), [@boneskull](https://github.com/boneskull))
+- [#2520](https://github.com/mochajs/mocha/pull/2520): Add info about `--inspect` flag to CLI help ([@ughitsaaron](https://github.com/ughitsaaron))
+
+## :nut_and_bolt: Other
+
+- [#2570](https://github.com/mochajs/mocha/issues/2570): Use [karma-mocha](https://npmjs.com/package/karma-mocha) proper ([@boneskull](https://github.com/boneskull))
+- Licenses updated to reflect new copyright, add link to license and browser matrix to `README.md` ([@boneskull](https://github.com/boneskull), [@ScottFreeCode](https://github.com/ScottFreeCode), [@dasilvacontin](https://github.com/dasilvacontin))
+
+Thanks to all our contributors, sponsors and backers! Keep on the lookout for a public roadmap and new contribution guide coming soon.
+
+# 3.1.2 / 2016-10-10
+
+## :bug: Bug Fix
+
+- [#2528](https://github.com/mochajs/mocha/issues/2528): Recovery gracefully if an `Error`'s `stack` property isn't writable ([@boneskull](https://github.com/boneskull))
+
+# 3.1.1 / 2016-10-09
+
+## :bug: Bug Fix
+
+- [#1417](https://github.com/mochajs/mocha/issues/1417): Don't report `done()` was called multiple times when it wasn't ([@frankleonrose](https://github.com/frankleonrose))
+
+## :nut_and_bolt: Other
+
+- [#2490](https://github.com/mochajs/mocha/issues/2490): Lint with [semistandard](https://npmjs.com/package/semistandard) config ([@makepanic](https://github.com/makepanic))
+- [#2525](https://github.com/mochajs/mocha/issues/2525): Lint all `.js` files ([@boneskull](https://github.com/boneskull))
+- [#2524](https://github.com/mochajs/mocha/issues/2524): Provide workaround for developers unable to run browser tests on macOS Sierra ([@boneskull](https://github.com/boneskull))
+
+# 3.1.0 / 2016-09-27
+
+## :tada: Enhancement
+
+- [#2357](https://github.com/mochajs/mocha/issues/2357): Support `--inspect` on command-line ([@simov](https://github.com/simov))
+- [#2194](https://github.com/mochajs/mocha/issues/2194): Human-friendly error if no files are matched on command-line ([@Munter](https://github.com/munter))
+- [#1744](https://github.com/mochajs/mocha/issues/1744): Human-friendly error if a Suite has no callback (BDD/TDD only) ([@anton](https://github.com/anton))
+
+## :bug: Bug Fix
+
+- [#2488](https://github.com/mochajs/mocha/issues/2488): Fix case in which _variables beginning with lowercase "D"_ may not have been reported properly as global leaks ([@JustATrick](https://github.com/JustATrick)) :laughing:
+- [#2465](https://github.com/mochajs/mocha/issues/2465): Always halt execution in async function when `this.skip()` is called ([@boneskull](https://github.com/boneskull))
+- [#2445](https://github.com/mochajs/mocha/pull/2445): Exits with expected code 130 when `SIGINT` encountered; exit code can no longer rollover at 256 ([@Munter](https://github.com/munter))
+- [#2315](https://github.com/mochajs/mocha/issues/2315): Fix uncaught TypeError thrown from callback stack ([@1999](https://github.com/1999))
+- Fix broken `only()`/`skip()` in IE7/IE8 ([@boneskull](https://github.com/boneskull))
+- [#2502](https://github.com/mochajs/mocha/issues/2502): Fix broken stack trace filter on Node.js under Windows ([@boneskull](https://github.com/boneskull))
+- [#2496](https://github.com/mochajs/mocha/issues/2496): Fix diff output for objects instantiated with `String` constructor ([more](https://youtrack.jetbrains.com/issue/WEB-23383)) ([@boneskull](https://github.com/boneskull))
+
+# 3.0.2 / 2016-08-08
+
+## :bug: Bug Fix
+
+- [#2424](https://github.com/mochajs/mocha/issues/2424): Fix error loading Mocha via Require.js ([@boneskull](https://github.com/boneskull))
+- [#2417](https://github.com/mochajs/mocha/issues/2417): Fix execution of _deeply_ nested `describe.only()` suites ([@not-an-aardvark](https://github.com/not-an-aardvark))
+- Remove references to `json-cov` and `html-cov` reporters in CLI ([@boneskull](https://github.com/boneskull))
+
+# 3.0.1 / 2016-08-03
+
+## :bug: Bug Fix
+
+- [#2406](https://github.com/mochajs/mocha/issues/2406): Restore execution of nested `describe.only()` suites ([@not-an-aardvark](https://github.com/not-an-aardvark))
+
+# 3.0.0 / 2016-07-31
+
+## :boom: Breaking Changes
+
+- :warning: Due to the increasing difficulty of applying security patches made within its dependency tree, as well as looming incompatibilities with Node.js v7.0, **Mocha no longer supports Node.js v0.8**.
+
+- :warning: **Mocha may no longer be installed by versions of `npm` less than `1.4.0`.** Previously, this requirement only affected Mocha's development dependencies. In short, this allows Mocha to depend on packages which have dependencies fixed to major versions (`^`).
+
+- `.only()` is no longer "fuzzy", can be used multiple times, and generally just works like you think it should. :joy:
+
+- To avoid common bugs, when a test injects a callback function (suggesting asynchronous execution), calls it, _and_ returns a `Promise`, Mocha will now throw an exception:
+
+  \```js
+  const assert = require('assert');
+
+  it('should complete this test', function (done) {
+  return new Promise(function (resolve) {
+  assert.ok(true);
+  resolve();
+  })
+  .then(done);
+  });
+  \```
+
+  The above test will fail with `Error: Resolution method is overspecified. Specify a callback *or* return a Promise; not both.`.
+
+- When a test timeout value _greater than_ `2147483648` is specified in any context (`--timeout`, `mocha.setup()`, per-suite, per-test, etc.), the timeout will be _disabled_ and the test(s) will be allowed to run indefinitely. This is equivalent to specifying a timeout value of `0`. See [MDN](https://developer.mozilla.org/docs/Web/API/WindowTimers/setTimeout#Maximum_delay_value) for reasoning.
+
+- The `dot` reporter now uses more visually distinctive characters when indicating "pending" and "failed" tests.
+
+- Mocha no longer supports [component](https://www.npmjs.com/package/component).
+
+- The long-forsaken `HTMLCov` and `JSONCov` reporters--and any relationship to the "node-jscoverage" project--have been removed.
+
+- `spec` reporter now omits leading carriage returns (`\r`) in non-TTY environment.
+
+## :tada: Enhancements
+
+- [#808](https://github.com/mochajs/mocha/issues/808): Allow regular-expression-like strings in `--grep` and browser's `grep` querystring; enables flags such as `i` for case-insensitive matches and `u` for unicode. ([@a8m](https://github.com/a8m))
+- [#2000](https://github.com/mochajs/mocha/pull/2000): Use distinctive characters in `dot` reporter; `,` will denote a "pending" test and `!` will denote a "failing" test. ([@elliottcable](https://github.com/elliottcable))
+- [#1632](https://github.com/mochajs/mocha/issues/1632): Throw a useful exception when a suite or test lacks a title. ([@a8m](https://github.com/a8m))
+- [#1481](https://github.com/mochajs/mocha/issues/1481): Better `.only()` behavior. ([@a8m](https://github.com/a8m))
+- [#2334](https://github.com/mochajs/mocha/issues/2334): Allow `this.skip()` in async tests and hooks. ([@boneskull](https://github.com/boneskull))
+- [#1320](https://github.com/mochajs/mocha/pull/1320): Throw a useful exception when test resolution method is overspecified. ([@jugglinmike](https://github.com/jugglinmike))
+- [#2364](https://github.com/mochajs/mocha/pull/2364): Support `--preserve-symlinks`. ([@rosswarren](https://github.com/rosswarren))
+
+## :bug: Bug Fixes
+
+- [#2259](https://github.com/mochajs/mocha/pull/2259): Restore ES3 compatibility. Specifically, support an environment lacking `Date.prototype.toISOString()`, `JSON`, or has a non-standard implementation of `JSON`. ([@ndhoule](https://github.com/ndhoule), [@boneskull](https://github.com/boneskull))
+- [#2286](https://github.com/mochajs/mocha/issues/2286): Fix `after()` failing to execute if test skipped using `this.skip()` in `beforeEach()`; no longer marks the entire suite as "pending". ([@dasilvacontin](https://github.com/dasilvacontin), [@boneskull](https://github.com/boneskull))
+- [#2208](https://github.com/mochajs/mocha/pull/2208): Fix function name display in `markdown` and `html` (browser) reporters. ([@ScottFreeCode](https://github.com/ScottFreeCode))
+- [#2299](https://github.com/mochajs/mocha/pull/2299): Fix progress bar in `html` (browser) reporter. ([@AviVahl](https://github.com/avivahl))
+- [#2307](https://github.com/mochajs/mocha/pull/2307): Fix `doc` reporter crashing when test fails. ([@jleyba](https://github.com/jleyba))
+- [#2323](https://github.com/mochajs/mocha/issues/2323): Ensure browser entry point (`browser-entry.js`) is published to npm (for use with bundlers). ([@boneskull](https://github.com/boneskull))
+- [#2310](https://github.com/mochajs/mocha/issues/2310): Ensure custom reporter with an absolute path works in Windows. ([@silentcloud](https://github.com/silentcloud))
+- [#2311](https://github.com/mochajs/mocha/issues/2311): Fix problem wherein calling `this.slow()` without a value would blast any previously set value. ([@boneskull](https://github.com/boneskull))
+- [#1813](https://github.com/mochajs/mocha/issues/1813): Ensure Mocha's own test suite will run in Windows. ([@tswaters](https://github.com/tswaters), [@TimothyGu](https://github.com/timothygu), [@boneskull](https://github.com/boneskull))
+- [#2317](https://github.com/mochajs/mocha/issues/2317): Ensure all interfaces are displayed in `--help` on CLI. ([@ScottFreeCode](https://github.com/ScottFreeCode))
+- [#1644](https://github.com/mochajs/mocha/issues/1644): Don't exhibit undefined behavior when calling `this.timeout()` with very large values ([@callumacrae](https://github.com/callumacrae), [@boneskull](https://github.com/boneskull))
+- [#2361](https://github.com/mochajs/mocha/pull/2361): Don't truncate name of thrown anonymous exception. ([@boneskull](https://github.com/boneskull))
+- [#2367](https://github.com/mochajs/mocha/pull/2367): Fix invalid CSS. ([@bensontrent](https://github.com/bensontrent))
+- [#2401](https://github.com/mochajs/mocha/pull/2401): Remove carriage return before each test line in spec reporter. ([@Munter](https://github.com/munter))
+
+## :nut_and_bolt: Other
+
+- Upgrade production dependencies to address security advisories (and because now we can): `glob`, `commander`, `escape-string-regexp`, and `supports-color`. ([@boneskull](https://github.com/boneskull), [@RobLoach](https://github.com/robloach))
+- Add Windows to CI. ([@boneskull](https://github.com/boneskull), [@TimothyGu](https://github.com/timothygu))
+- Ensure appropriate `engines` field in `package.json`. ([@shinnn](https://github.com/shinnn), [@boneskull](https://github.com/boneskull))
+- [#2348](https://github.com/mochajs/mocha/issues/2348): Upgrade ESLint to v2 ([@anthony-redfox](https://github.com/anthony-redfox))
+
+We :heart: our [backers and sponsors](https://opencollective.com/mochajs)!
+
+:shipit:
+
+# 2.5.3 / 2016-05-25
+
+- [#2112](https://github.com/mochajs/mocha/pull/2112) - Fix HTML reporter regression causing duplicate error output ([@danielstjules](https://github.com/danielstjules) via [`6d24063`](https://github.com/mochajs/mocha/commit/6d24063))
+- [#2119](https://github.com/mochajs/mocha/pull/2119) - Make HTML reporter failure/passed links preventDefault to avoid SPA's hash navigation ([@jimenglish81](https://github.com/jimenglish81) via [`9e93efc`](https://github.com/mochajs/mocha/commit/9e93efc))
+
+# 2.5.2 / 2016-05-24
+
+- [#2178](https://github.com/mochajs/mocha/pull/2178) - Avoid double and triple xUnit XML escaping ([@graingert](https://github.com/graingert) via [`49b5ff1`](https://github.com/mochajs/mocha/commit/49b5ff1))
+
+# 2.5.1 / 2016-05-23
+
+- Fix [to-iso-string](https://npmjs.com/package/to-iso-string) dependency ([@boneskull](https://github.com/boneskull) via [`bd9450b`](https://github.com/mochajs/mocha/commit/bd9450b))
+
+Thanks [**@entertainyou**](https://github.com/entertainyou), [**@SimenB**](https://github.com/SimenB), [**@just-paja**](https://github.com/just-paja) for the heads-up.
+
+# 2.5.0 / 2016-05-23
+
+This has been awhile coming! We needed to feel confident that the next release wouldn't break browser compatibility (e.g. the last few patch releases).
+
+## Browser Tests in CI
+
+We now run unit tests against PhantomJS v1.x and an assortment of browsers on [SauceLabs](https://saucelabs.com), including:
+
+- Internet Explorer v8.0
+- Chrome (latest)
+- Firefox (latest)
+- Safari (latest)
+- Microsoft Edge (latest)
+
+To accomplish this, we now run Mocha's unit tests (and a handful of integration tests) via [Karma](https://npmjs.com/package/karma) and a modified [karma-mocha](https://npmjs.com/package/karma-mocha). Along the way, we had to solve issue [#880](https://github.com/mochajs/mocha/issues/880) (apologies to [**@mderijcke**](https://github.com/mderijcke) and [**@sukima**](https://github.com/sukima) who had PRs addressing this), as well as replace most usages of [should](https://npmjs.com/package/should) with [expect.js](https://npmjs.com/package/expect.js) for IE8.
+
+Going forward, when sending PRs, your code will _only_ run against PhantomJS v1.x (and not hit SauceLabs) [because security](https://docs.travis-ci.com/user/pull-requests/#Security-Restrictions-when-testing-Pull-Requests).
+
+## Node.js 6.x
+
+Node.js 6.x "just worked" before, but now it's in the CI matrix, so it's "officially" supported. Mocha _still retains support_ for Node.js 0.8.x.
+
+## "Minor" Release
+
+You'll see mostly bug fixes below, but also a couple features--as such, it's a "minor" release.
+
+## TYVM
+
+Thanks to everyone who contributed, and our fabulous [sponsors and backers](https://opencollective.com/mochajs)!
+
+- [#2079](https://github.com/mochajs/mocha/issues/2079) - Add browser checks to CI; update [browserify](https://npmjs.com/package/browserify) to v13.0.0 ([@dasilvacontin](https://github.com/dasilvacontin), [@ScottFreeCode](https://github.com/ScottFreeCode), [@boneskull](https://github.com/boneskull) via [`c04c1d7`](https://github.com/mochajs/mocha/commit/c04c1d7), [`0b1e9b3`](https://github.com/mochajs/mocha/commit/0b1e9b3), [`0dde0fa`](https://github.com/mochajs/mocha/commit/0dde0fa), [`f8a3d86`](https://github.com/mochajs/mocha/commit/f8a3d86), [`9e8cbaa`](https://github.com/mochajs/mocha/commit/9e8cbaa))
+- [#880](https://github.com/mochajs/mocha/issues/880) - Make Mocha browserifyable ([@boneskull](https://github.com/boneskull) via [`524862b`](https://github.com/mochajs/mocha/commit/524862b))
+- [#2121](https://github.com/mochajs/mocha/issues/2121) - Update [glob](https://npmjs.com/package/glob) to v3.2.11 ([@astorije](https://github.com/astorije) via [`7920fc4`](https://github.com/mochajs/mocha/commit/7920fc4))
+- [#2126](https://github.com/mochajs/mocha/issues/2126) - Fix dupe error messages in stack trace filter ([@Turbo87](https://github.com/Turbo87) via [`4301caa`](https://github.com/mochajs/mocha/commit/4301caa))
+- [#2109](https://github.com/mochajs/mocha/issues/2109) - Fix certain diffs when objects cannot be coerced into primitives ([@joshlory](https://github.com/joshlory) via [`61fbb7f`](https://github.com/mochajs/mocha/commit/61fbb7f))
+- [#1827](https://github.com/mochajs/mocha/pull/1827) - Fix TWBS/`mocha.css` collisions ([@irnc](https://github.com/irnc) via [`0543798`](https://github.com/mochajs/mocha/commit/0543798))
+- [#1760](https://github.com/mochajs/mocha/issues/1760), [#1936](https://github.com/mochajs/mocha/issues/1936) - Fix `this.skip()` in HTML reporter ([@mislav](https://github.com/mislav) via [`cb4248b`](https://github.com/mochajs/mocha/commit/cb4248b))
+- [#2115](https://github.com/mochajs/mocha/pull/2115) - Fix exceptions thrown from hooks in HTML reporter ([@danielstjules](https://github.com/danielstjules) via [`e290bc0`](https://github.com/mochajs/mocha/commit/e290bc0))
+- [#2089](https://github.com/mochajs/mocha/issues/2089) - Handle Symbol values in `util.stringify()` ([@ryym](https://github.com/ryym) via [`ea61d05`](https://github.com/mochajs/mocha/commit/ea61d05))
+- [#2097](https://github.com/mochajs/mocha/pull/2097) - Fix diff for objects overriding `Object.prototype.hasOwnProperty` ([@mantoni](https://github.com/mantoni) via [`b20fdfe`](https://github.com/mochajs/mocha/commit/b20fdfe))
+- [#2101](https://github.com/mochajs/mocha/pull/2101) - Properly handle non-string "messages" thrown from assertion libraries ([@jkimbo](https://github.com/jkimbo) via [`9c41051`](https://github.com/mochajs/mocha/commit/9c41051))
+- [#2124](https://github.com/mochajs/mocha/pull/2124) - Update [growl](https://npmjs.com/package/growl) ([@benjamine](https://github.com/benjamine) via [`9ae6a85`](https://github.com/mochajs/mocha/commit/9ae6a85))
+- [#2162](https://github.com/mochajs/mocha/pull/2162), [#2205](https://github.com/mochajs/mocha/pull/2205) - JSDoc fixes ([@OlegTsyba](https://github.com/OlegTsyba) via [`8031f20`](https://github.com/mochajs/mocha/commit/8031f20), [@ScottFreeCode](https://github.com/ScottFreeCode) via [`f83b1d9`](https://github.com/mochajs/mocha/commit/f83b1d9))
+- [#2132](https://github.com/mochajs/mocha/issues/2132) - Remove Growl-related cruft ([@julienw](https://github.com/julienw) via [`00d6469`](https://github.com/mochajs/mocha/commit/00d6469))
+- [#2172](https://github.com/mochajs/mocha/pull/2172) - Add [OpenCollective](https://opencollective.com) badge, sponsors & backers ([@xdamman](https://github.com/xdamman), [@boneskull](https://github.com/boneskull) via [`caee94f`](https://github.com/mochajs/mocha/commit/caee94f))
+- [#1841](https://github.com/mochajs/mocha/pull/1841) - Add new logo, banner assets ([@dasilvacontin](https://github.com/dasilvacontin) via [`00fd0e1`](https://github.com/mochajs/mocha/commit/00fd0e1))
+- [#2214](https://github.com/mochajs/mocha/pull/2214) - Update `README.md` header ([@dasilvacontin](https://github.com/dasilvacontin) via [`c0f9be2`](https://github.com/mochajs/mocha/commit/c0f9be2))
+- [#2236](https://github.com/mochajs/mocha/pull/2236) - Better checks for Node.js v0.8 compatibility in CI ([@dasilvacontin](https://github.com/dasilvacontin) via [`ba5637d`](https://github.com/mochajs/mocha/commit/ba5637d))
+- [#2239](https://github.com/mochajs/mocha/issues/2239) - Add Node.js v6.x to CI matrix ([@boneskull](https://github.com/boneskull) via [`3904da4`](https://github.com/mochajs/mocha/commit/3904da4))
+
+# 2.4.5 / 2016-01-28
+
+- [#2080](https://github.com/mochajs/mocha/issues/2080), [#2078](https://github.com/mochajs/mocha/issues/2078), [#2072](https://github.com/mochajs/mocha/pull/2072), [#2073](https://github.com/mochajs/mocha/pull/2073), [#1200](https://github.com/mochajs/mocha/issues/1200) - Revert changes to console colors in changeset [1192914](https://github.com/mochajs/mocha/commit/119291449cd03a11cdeda9e37cf718a69a012896) and subsequent related changes thereafter. Restores compatibility with IE8 & PhantomJS. See also [mantoni/mochify.js#129](https://github.com/mantoni/mochify.js/issues/129) and [openlayers/ol3#4746](https://github.com/openlayers/ol3/pull/4746) ([@boneskull](https://github.com/boneskull))
+- [#2082](https://github.com/mochajs/mocha/pull/2082) - Fix several test assertions ([@mislav](https://github.com/mislav))
+
+# 2.4.4 / 2016-01-27
+
+- [#2080](https://github.com/mochajs/mocha/issues/2080) - Fix broken RequireJS compatibility ([@boneskull](https://github.com/boneskull))
+
+# 2.4.3 / 2016-01-27
+
+- [#2078](https://github.com/mochajs/mocha/issues/2078) - Fix broken IE8 ([@boneskull](https://github.com/boneskull))
+
+# 2.4.2 / 2016-01-26
+
+- [#2053](https://github.com/mochajs/mocha/pull/2053) - Fix web worker compatibility ([@mislav](https://github.com/mislav))
+- [#2072](https://github.com/mochajs/mocha/pull/2072) - Fix Windows color output ([@thedark1337](https://github.com/thedark1337))
+- [#2073](https://github.com/mochajs/mocha/pull/2073) - Fix colors in `progress` and `landing` reporters ([@gyandeeps](https://github.com/gyandeeps))
+
+# 2.4.1 / 2016-01-26
+
+- [#2067](https://github.com/mochajs/mocha/pull/2067) - Fix HTML/doc reporter regressions ([@danielstjules](https://github.com/danielstjules))
+
+# 2.4.0 / 2016-01-25
+
+- [#1945](https://github.com/mochajs/mocha/pull/1945) - Correctly skip tests when skipping in suite's before() ([@ryanshawty](https://github.com/ryanshawty))
+- [#2056](https://github.com/mochajs/mocha/pull/2056) - chore(license): update license year to 2016 ([@pra85](https://github.com/pra85))
+- [#2048](https://github.com/mochajs/mocha/pull/2048) - Fix `this.skip` from spec with HTML reporter ([@mislav](https://github.com/mislav))
+- [#2033](https://github.com/mochajs/mocha/pull/2033) - Update tests for newer versions of should.js ([@tomhughes](https://github.com/tomhughes))
+- [#2037](https://github.com/mochajs/mocha/pull/2037) - Fix for memory leak caused by referenced to deferred test ([@bd82](https://github.com/bd82))
+- [#2038](https://github.com/mochajs/mocha/pull/2038) - Also run Travis-CI on node.js 4 & 5 ([@bd82](https://github.com/bd82))
+- [#2028](https://github.com/mochajs/mocha/pull/2028) - Remove reference to test before afterAll hook runs ([@stonelgh](https://github.com/stonelgh))
+- Bump mkdirp to 0.5.1 to support strict mode ([@danielstjules](https://github.com/danielstjules))
+- [#1977](https://github.com/mochajs/mocha/pull/1977) - safely stringify PhantomJS undefined value ([@ahamid](https://github.com/ahamid))
+- Add the ability to retry tests ([@@longlho])
+- [#1982](https://github.com/mochajs/mocha/pull/1982) - Enable --log-timer-events option [@Alaneor](https://github.com/Alaneor)
+- Fix [#1980](https://github.com/mochajs/mocha/issues/1980): Load mocha.opts from bin/mocha and bin/\_mocha ([@danielstjules](https://github.com/danielstjules))
+- [#1976](https://github.com/mochajs/mocha/pull/1976) - Simplify function call ([@iclanzan](https://github.com/iclanzan))
+- [#1963](https://github.com/mochajs/mocha/pull/1963) - Add support --perf-basic-prof ([@robraux](https://github.com/robraux))
+- [#1981](https://github.com/mochajs/mocha/pull/1981) - Fix HTML reporter handling of done and exceptions ([@Standard8](https://github.com/Standard8))
+- [#1993](https://github.com/mochajs/mocha/pull/1993) - propagate "file" property for "exports" interface ([@segrey](https://github.com/segrey))
+- [#1999](https://github.com/mochajs/mocha/pull/1999) - Add support for strict mode ([@tmont](https://github.com/tmont))
+- [#2005](https://github.com/mochajs/mocha/pull/2005) - XUnit Reporter Writes to stdout, falls back to console.log ([@jonnyreeves](https://github.com/jonnyreeves))
+- [#2021](https://github.com/mochajs/mocha/pull/2021) - Fix non ES5 compliant regexp ([@zetaben](https://github.com/zetaben))
+- [#1965] - Don't double install BDD UI ([@cowboyd](https://github.com/cowboyd))
+- [#1995](https://github.com/mochajs/mocha/pull/1995) - Make sure the xunit output dir exists before writing to it ([@ianwremmel](https://github.com/ianwremmel))
+- Use chalk for the base reporter colors; closes [#1200](https://github.com/mochajs/mocha/issues/1200) ([@boneskull](https://github.com/boneskull))
+- Fix requiring custom interfaces ([@jgkim](https://github.com/jgkim))
+- [#1967](https://github.com/mochajs/mocha/pull/1967) Silence Bluebird js warnings ([@krisr](https://github.com/krisr))
+
+# 2.3.4 / 2015-11-15
+
+- Update debug dependency to 2.2.0
+- remove duplication of mocha.opts on process.argv
+- Fix typo in test/reporters/nyan.js
+
+# 2.3.3 / 2015-09-19
+
+- [#1875](https://github.com/mochajs/mocha/issues/1875) - Fix Markdown reporter exceeds maximum call stack size ([@danielstjules](https://github.com/danielstjules))
+- [#1864](https://github.com/mochajs/mocha/issues/1864) - Fix xunit missing output with --reporter-options output ([@danielstjules](https://github.com/danielstjules))
+- [#1846](https://github.com/mochajs/mocha/issues/1846) - Support all harmony flags ([@danielstjules](https://github.com/danielstjules))
+- Fix fragile xunit reporter spec ([@danielstjules](https://github.com/danielstjules))
+- [#1669](https://github.com/mochajs/mocha/issues/1669) - Fix catch uncaught errors outside test suite execution ([@danielstjules](https://github.com/danielstjules))
+- [#1868](https://github.com/mochajs/mocha/issues/1868) - Revert jade to support npm &lt; v1.3.7 ([@danielstjules](https://github.com/danielstjules))
+- [#1766](https://github.com/mochajs/mocha/issues/1766) - Don't remove modules/components from stack trace in the browser ([@danielstjules](https://github.com/danielstjules))
+- [#1798](https://github.com/mochajs/mocha/issues/1798) - Fix correctly attribute mutiple done err with hooks ([@danielstjules](https://github.com/danielstjules))
+- Fix use utils.reduce for IE8 compatibility ([@wsw0108](https://github.com/wsw0108))
+- Some linting errors fixed by [@danielstjules](https://github.com/danielstjules)
+- Call the inspect() function if message is not set ([@kevinburke](https://github.com/kevinburke))
+
+# 2.3.2 / 2015-09-07
+
+- [#1868](https://github.com/mochajs/mocha/issues/1868) - Fix compatibility with older versions of NPM ([@boneskull](https://github.com/boneskull))
+
+# 2.3.1 / 2015-09-06
+
+- [#1812](https://github.com/mochajs/mocha/issues/1812) - Fix: Bail flag causes before() hooks to be run even after a failure ([@aaroncrows])
+
+# 2.3.0 / 2015-08-30
+
+- [#553](https://github.com/mochajs/mocha/issues/553) - added --allowUncaught option ([@amsul](https://github.com/amsul))
+- [#1490](https://github.com/mochajs/mocha/issues/1490) - Allow --async-only to be satisfied by returning a promise ([@jlai](https://github.com/jlai))
+- [#1829](https://github.com/mochajs/mocha/issues/1829) - support --max-old-space-size ([@gigadude](https://github.com/gigadude))
+- [#1811](https://github.com/mochajs/mocha/issues/1811) - upgrade Jade dependency ([@outsideris](https://github.com/outsideris))
+- [#1769](https://github.com/mochajs/mocha/issues/1769) - Fix async hook error handling ([@ajaykodali](https://github.com/ajaykodali))
+- [#1230](https://github.com/mochajs/mocha/issues/1230) - More descriptive beforeEach/afterEach messages ([@duncanbeevers](https://github.com/duncanbeevers))
+- [#1787](https://github.com/mochajs/mocha/issues/1787) - Scope loading behaviour instead of using early return ([@aryeguy](https://github.com/aryeguy))
+- [#1789](https://github.com/mochajs/mocha/issues/1789) - Fix: html-runner crashing ([@sunesimonsen](https://github.com/sunesimonsen))
+- [#1749](https://github.com/mochajs/mocha/issues/1749) - Fix maximum call stack error on large amount of tests ([@tinganho](https://github.com/tinganho))
+- [#1230](https://github.com/mochajs/mocha/issues/1230) - Decorate failed hook titles with test title ([@duncanbeevers](https://github.com/duncanbeevers))
+- [#1260](https://github.com/mochajs/mocha/issues/1260) - Build using Browserify ([@ndhoule](https://github.com/ndhoule))
+- [#1728](https://github.com/mochajs/mocha/issues/1728) - Don't use `__proto__` ([@ndhoule](https://github.com/ndhoule))
+- [#1781](https://github.com/mochajs/mocha/issues/1781) - Fix hook error tests ([@glenjamin](https://github.com/glenjamin))
+- [#1754](https://github.com/mochajs/mocha/issues/1754) - Allow boolean --reporter-options ([@papandreou](https://github.com/papandreou))
+- [#1766](https://github.com/mochajs/mocha/issues/1766) - Fix overly aggressive stack suppression ([@moll](https://github.com/moll))
+- [#1752](https://github.com/mochajs/mocha/issues/1752) - Avoid potential infinite loop ([@gsilk](https://github.com/gsilk))
+- [#1761](https://github.com/mochajs/mocha/issues/1761) - Fix problems running under PhantomJS ([@chromakode](https://github.com/chromakode))
+- [#1700](https://github.com/mochajs/mocha/issues/1700) - Fix more problems running under PhantomJS ([@jbnicolai](https://github.com/jbnicolai))
+- [#1774](https://github.com/mochajs/mocha/issues/1774) - Support escaped spaces in CLI options ([@adamgruber](https://github.com/adamgruber))
+- [#1687](https://github.com/mochajs/mocha/issues/1687) - Fix HTML reporter links with special chars ([@benvinegar](https://github.com/benvinegar))
+- [#1359](https://github.com/mochajs/mocha/issues/1359) - Adopt code style and enforce it using ESLint ([@ndhoule](https://github.com/ndhoule) w/ assist from [@jbnicolai](https://github.com/jbnicolai) & [@boneskull](https://github.com/boneskull))
+- various refactors ([@jbnicolai](https://github.com/jbnicolai))
+- [#1758](https://github.com/mochajs/mocha/issues/1758) - Add cross-frame compatible Error checking ([@outdooricon](https://github.com/outdooricon))
+- [#1741](https://github.com/mochajs/mocha/issues/1741) - Remove moot `version` property from bower.json ([@kkirsche](https://github.com/kkirsche))
+- [#1739](https://github.com/mochajs/mocha/issues/1739) - Improve `HISTORY.md` ([@rstacruz](https://github.com/rstacruz))
+- [#1730](https://github.com/mochajs/mocha/issues/1730) - Support more io.js flags ([@ryedog](https://github.com/ryedog))
+- [#1349](https://github.com/mochajs/mocha/issues/1349) - Allow HTML in HTML reporter errors ([@papandreou](https://github.com/papandreou) / [@sunesimonsen](https://github.com/sunesimonsen))
+- [#1572](https://github.com/mochajs/mocha/issues/1572) - Prevent default browser behavior for failure/pass links ([@jschilli](https://github.com/jschilli))
+- [#1630](https://github.com/mochajs/mocha/issues/1630) - Support underscored harmony flags ([@dominicbarnes](https://github.com/dominicbarnes))
+- [#1718](https://github.com/mochajs/mocha/issues/1718) - Support more harmony flags ([@slyg](https://github.com/slyg))
+- [#1689](https://github.com/mochajs/mocha/issues/1689) - Add stack to JSON-stream reporter ([@jonathandelgado](https://github.com/jonathandelgado))
+- [#1654](https://github.com/mochajs/mocha/issues/1654) - Fix `ReferenceError` "location is not defined" ([@jakemmarsh](https://github.com/jakemmarsh))
+
+# 2.2.5 / 2015-05-14
+
+- [#1699](https://github.com/mochajs/mocha/issues/1699) - Upgrade jsdiff to v1.4.0 ([@nylen](https://github.com/nylen))
+- [#1648](https://github.com/mochajs/mocha/issues/1648) - fix diff background colors in the console ([@nylen](https://github.com/nylen))
+- [#1327](https://github.com/mochajs/mocha/issues/1327) - fix tests running twice, a regression issue. ([#1686](https://github.com/mochajs/mocha/issues/1686), [@danielstjules](https://github.com/danielstjules))
+- [#1675](https://github.com/mochajs/mocha/issues/1675) - add integration tests ([@danielstjules](https://github.com/danielstjules))
+- [#1682](https://github.com/mochajs/mocha/issues/1682) - use a valid SPDX license identifier in package.json ([@kemitchell](https://github.com/kemitchell))
+- [#1660](https://github.com/mochajs/mocha/issues/1660) - fix assertion of invalid dates ([#1661](https://github.com/mochajs/mocha/issues/1661), [@a8m](https://github.com/a8m))
+- [#1241](https://github.com/mochajs/mocha/issues/1241) - fix issue with multiline diffs appearing as single line ([#1655](https://github.com/mochajs/mocha/issues/1655), [@a8m](https://github.com/a8m))
+
+# 2.2.4 / 2015-04-08
+
+- Load mocha.opts in \_mocha for now (close [#1645](https://github.com/mochajs/mocha/issues/1645))
+
+# 2.2.3 / 2015-04-07
+
+- fix(reporter/base): string diff - issue [#1241](https://github.com/mochajs/mocha/issues/1241)
+- fix(reporter/base): string diff - issue [#1241](https://github.com/mochajs/mocha/issues/1241)
+- fix(reporter/base): don't show diffs for errors without expectation
+- fix(reporter/base): don't assume error message is first line of stack
+- improve: dry up reporter/base test
+- fix(reporter/base): explicitly ignore showDiff [#1614](https://github.com/mochajs/mocha/issues/1614)
+- Add iojs to travis build
+- Pass `--allow-natives-syntax` flag to node.
+- Support --harmony_classes flag for io.js
+- Fix 1556: Update utils.clean to handle newlines in func declarations
+- Fix 1606: fix err handling in IE &lt;= 8 and non-ES5 browsers
+- Fix 1585: make \_mocha executable again
+- chore(package.json): add a8m as a contributor
+- Fixed broken link on html-cov reporter
+- support --es_staging flag
+- fix issue where menu overlaps content.
+- update contributors in package.json
+- Remove trailing whitespace from reporter output
+- Remove contributors list from readme
+- log third-party reporter errors
+- [Fix] Exclude not own properties when looping on options
+- fix: support node args in mocha.opts (close [#1573](https://github.com/mochajs/mocha/issues/1573))
+- fix(reporter/base): string diff - issue [#1241](https://github.com/mochajs/mocha/issues/1241)
+
+# 2.2.1 / 2015-03-09
+
+- Fix passing of args intended for node/iojs.
+
+# 2.2.0 / 2015-03-06
+
+- Update mocha.js
+- Add --fgrep. Use grep for RegExp, fgrep for str
+- Ignore async global errors after spec resolution
+- Fixing errors that prevent mocha.js from loading in the browser - fixes [#1558](https://github.com/mochajs/mocha/issues/1558)
+- fix(utils): issue [#1558](https://github.com/mochajs/mocha/issues/1558) + make
+- add ability to delay root suite; closes [#362](https://github.com/mochajs/mocha/issues/362), closes [#1124](https://github.com/mochajs/mocha/issues/1124)
+- fix insanity in http tests
+- update travis: add node 0.12, add gitter, remove slack
+- building
+- resolve [#1548](https://github.com/mochajs/mocha/issues/1548): ensure the environment's "node" executable is used
+- reporters/base: use supports-color to detect colorable term
+- travis: use docker containers
+- small fix: commander option for --expose-gc
+- Ignore asynchronous errors after global failure
+- Improve error output when a test fails with a non-error
+- updated travis badge, uses svg instead of img
+- Allow skip from test context for [#332](https://github.com/mochajs/mocha/issues/332)
+- [JSHINT] Unnecessary semicolon fixed in bin/\_mocha
+- Added a reminder about the done() callback to test timeout error messages
+- fixes [#1496](https://github.com/mochajs/mocha/issues/1496), in Mocha.run(fn), check if fn exists before executing it, added tests too
+- Add Harmony Proxy flag for iojs
+- test(utils|ms|\*): test existing units
+- add support for some iojs flags
+- fix(utils.stringify): issue [#1229](https://github.com/mochajs/mocha/issues/1229), diff viewer
+- Remove slack link
+- Prevent multiple 'grep=' querystring params in html reporter
+- Use grep as regexp (close [#1381](https://github.com/mochajs/mocha/issues/1381))
+- utils.stringify should handle objects without an Object prototype
+- in runnable test, comparing to undefined error's message rather than a literal
+- Fix test running output truncation on async STDIO
+- amended for deprecated customFds option in child_process
+
+# 2.1.0 / 2014-12-23
+
+- showDiff: don’t stringify strings
+- Clean up unused module dependencies.
+- Filter zero-length strings from mocha.opts
+- only write to stdout in reporters
+- Revert "only write to stdout in reporters"
+- Print colored output only to a tty
+- update summary in README.md
+- rename Readme.md/History.md to README.md/HISTORY.md because neurotic
+- add .mailmap to fix "git shortlog" or "git summary" output
+- fixes [#1461](https://github.com/mochajs/mocha/issues/1461): nyan-reporter now respects Base.useColors, fixed bug where Base.color would not return a string when str wasn't a string.
+- Use existing test URL builder in failed replay links
+- modify .travis.yml: use travis_retry; closes [#1449](https://github.com/mochajs/mocha/issues/1449)
+- fix -t 0 behavior; closes [#1446](https://github.com/mochajs/mocha/issues/1446)
+- fix tests (whoops)
+- improve diff behavior
+- Preserve pathname when linking to individual tests
+- Fix test
+- Tiny typo in comments fixed
+- after hooks now being called on failed tests when using bail, fixes [#1093](https://github.com/mochajs/mocha/issues/1093)
+- fix throwing undefined/null now makes tests fail, fixes [#1395](https://github.com/mochajs/mocha/issues/1395)
+- compiler extensions are added as watched extensions, removed non-standard extensions from watch regex, resolves [#1221](https://github.com/mochajs/mocha/issues/1221)
+- prefix/namespace for suite titles in markdown reporter, fixes [#554](https://github.com/mochajs/mocha/issues/554)
+- fix more bad markdown in CONTRIBUTING.md
+- fix bad markdown in CONTRIBUTING.md
+- add setImmediate/clearImmediate to globals; closes [#1435](https://github.com/mochajs/mocha/issues/1435)
+- Fix buffer diffs (closes [#1132](https://github.com/mochajs/mocha/issues/1132), closes [#1433](https://github.com/mochajs/mocha/issues/1433))
+- add a CONTRIBUTING.md. closes [#882](https://github.com/mochajs/mocha/issues/882)
+- fix intermittent build failures (maybe). closes [#1407](https://github.com/mochajs/mocha/issues/1407)
+- add Slack notification to .travis.yml
+- Fix slack link
+- Add slack room to readme
+- Update maintainers
+- update maintainers and contributors
+- resolves [#1393](https://github.com/mochajs/mocha/issues/1393): kill children with more effort on SIGINT
+- xunit reporter support for optionally writing to a file
+- if a reporter has a .done method, call it before exiting
+- add support for reporter options
+- only write to stdout in reporters
+
+# 2.0.0 / 2014-10-21
+
+- remove: support for node 0.6.x, 0.4.x
+- fix: landing reporter with non ansi characters ([#211](https://github.com/mochajs/mocha/issues/211))
+- fix: html reporter - preserve query params when navigating to suites/tests ([#1358](https://github.com/mochajs/mocha/issues/1358))
+- fix: json stream reporter add error message to failed test
+- fix: fixes for visionmedia -> mochajs
+- fix: use stdio, fixes node deprecation warnings ([#1391](https://github.com/mochajs/mocha/issues/1391))
+
+# 1.21.5 / 2014-10-11
+
+- fix: build for NodeJS v0.6.x
+- fix: do not attempt to highlight syntax when non-HTML reporter is used
+- update: escape-string-regexp to 1.0.2.
+- fix: botched indentation in canonicalize()
+- fix: .gitignore: ignore .patch and .diff files
+- fix: changed 'Catched' to 'Caught' in uncaught exception error handler messages
+- add: `pending` field for json reporter
+- fix: Runner.prototype.uncaught: don't double-end runnables that already have a state.
+- fix: --recursive, broken by [`f0facd2`](https://github.com/mochajs/mocha/commit/f0facd2e)
+- update: replaces escapeRegexp with the escape-string-regexp package.
+- update: commander to 2.3.0.
+- update: diff to 1.0.8.
+- fix: ability to disable syntax highlighting ([#1329](https://github.com/mochajs/mocha/issues/1329))
+- fix: added empty object to errorJSON() call to catch when no error is present
+- fix: never time out after calling enableTimeouts(false)
+- fix: timeout(0) will work at suite level ([#1300](https://github.com/mochajs/mocha/issues/1300))
+- Fix for --watch+only() issue ([#888](https://github.com/mochajs/mocha/issues/888) )
+- fix: respect err.showDiff, add Base reporter test ([#810](https://github.com/mochajs/mocha/issues/810))
+
+# 1.22.1-3 / 2014-07-27
+
+- fix: disabling timeouts with this.timeout(0) ([#1301](https://github.com/mochajs/mocha/issues/1301))
+
+# 1.22.1-3 / 2014-07-27
+
+- fix: local uis and reporters ([#1288](https://github.com/mochajs/mocha/issues/1288))
+- fix: building 1.21.0's changes in the browser ([#1284](https://github.com/mochajs/mocha/issues/1284))
+
+# 1.21.0 / 2014-07-23
+
+- add: --no-timeouts option ([#1262](https://github.com/mochajs/mocha/issues/1262), [#1268](https://github.com/mochajs/mocha/issues/1268))
+- add: --\*- deprecation node flags ([#1217](https://github.com/mochajs/mocha/issues/1217))
+- add: --watch-extensions argument ([#1247](https://github.com/mochajs/mocha/issues/1247))
+- change: spec reporter is default ([#1228](https://github.com/mochajs/mocha/issues/1228))
+- fix: diff output showing incorrect +/- ([#1182](https://github.com/mochajs/mocha/issues/1182))
+- fix: diffs of circular structures ([#1179](https://github.com/mochajs/mocha/issues/1179))
+- fix: re-render the progress bar when progress has changed only ([#1151](https://github.com/mochajs/mocha/issues/1151))
+- fix support for environments with global and window ([#1159](https://github.com/mochajs/mocha/issues/1159))
+- fix: reverting to previously defined onerror handler ([#1178](https://github.com/mochajs/mocha/issues/1178))
+- fix: stringify non error objects passed to done() ([#1270](https://github.com/mochajs/mocha/issues/1270))
+- fix: using local ui, reporters ([#1267](https://github.com/mochajs/mocha/issues/1267))
+- fix: cleaning es6 arrows ([#1176](https://github.com/mochajs/mocha/issues/1176))
+- fix: don't include attrs in failure tag for xunit ([#1244](https://github.com/mochajs/mocha/issues/1244))
+- fix: fail tests that return a promise if promise is rejected w/o a reason ([#1224](https://github.com/mochajs/mocha/issues/1224))
+- fix: showing failed tests in doc reporter ([#1117](https://github.com/mochajs/mocha/issues/1117))
+- fix: dot reporter dots being off ([#1204](https://github.com/mochajs/mocha/issues/1204))
+- fix: catch empty throws ([#1219](https://github.com/mochajs/mocha/issues/1219))
+- fix: honoring timeout for sync operations ([#1242](https://github.com/mochajs/mocha/issues/1242))
+- update: growl to 1.8.0
+
+# 1.20.1 / 2014-06-03
+
+- update: should dev dependency to ~4.0.0 ([#1231](https://github.com/mochajs/mocha/issues/1231))
+
+# 1.20.0 / 2014-05-28
+
+- add: filenames to suite objects ([#1222](https://github.com/mochajs/mocha/issues/1222))
+
+# 1.19.0 / 2014-05-17
+
+- add: browser script option to package.json
+- add: export file in Mocha.Test objects ([#1174](https://github.com/mochajs/mocha/issues/1174))
+- add: add docs for wrapped node flags
+- fix: mocha.run() to return error status in browser ([#1216](https://github.com/mochajs/mocha/issues/1216))
+- fix: clean() to show failure details ([#1205](https://github.com/mochajs/mocha/issues/1205))
+- fix: regex that generates html for new keyword ([#1201](https://github.com/mochajs/mocha/issues/1201))
+- fix: sibling suites have inherited but separate contexts ([#1164](https://github.com/mochajs/mocha/issues/1164))
+
+# 1.18.2 / 2014-03-18
+
+- fix: html runner was prevented from using #mocha as the default root el ([#1162](https://github.com/mochajs/mocha/issues/1162))
+
+# 1.18.1 / 2014-03-18
+
+- fix: named before/after hooks in bdd, tdd, qunit interfaces ([#1161](https://github.com/mochajs/mocha/issues/1161))
+
+# 1.18.0 / 2014-03-13
+
+- add: promise support ([#329](https://github.com/mochajs/mocha/issues/329))
+- add: named before/after hooks ([#966](https://github.com/mochajs/mocha/issues/966))
+
+# 1.17.1 / 2014-01-22
+
+- fix: expected messages in should.js (should.js#168)
+- fix: expect errno global in node versions &lt; v0.9.11 ([#1111](https://github.com/mochajs/mocha/issues/1111))
+- fix: unreliable checkGlobals optimization ([#1110](https://github.com/mochajs/mocha/issues/1110))
+
+# 1.17.0 / 2014-01-09
+
+- add: able to require globals (describe, it, etc.) through mocha ([#1077](https://github.com/mochajs/mocha/issues/1077))
+- fix: abort previous run on --watch change ([#1100](https://github.com/mochajs/mocha/issues/1100))
+- fix: reset context for each --watch triggered run ([#1099](https://github.com/mochajs/mocha/issues/1099))
+- fix: error when cli can't resolve path or pattern ([#799](https://github.com/mochajs/mocha/issues/799))
+- fix: canonicalize objects before stringifying and diffing them ([#1079](https://github.com/mochajs/mocha/issues/1079))
+- fix: make CR call behave like carriage return for non tty ([#1087](https://github.com/mochajs/mocha/issues/1087))
+
+# 1.16.2 / 2013-12-23
+
+- fix: couple issues with ie 8 ([#1082](https://github.com/mochajs/mocha/issues/1082), [#1081](https://github.com/mochajs/mocha/issues/1081))
+- fix: issue running the xunit reporter in browsers ([#1068](https://github.com/mochajs/mocha/issues/1068))
+- fix: issue with firefox &lt; 3.5 ([#725](https://github.com/mochajs/mocha/issues/725))
+
+# 1.16.1 / 2013-12-19
+
+- fix: recompiled for missed changes from the last release
+
+# 1.16.0 / 2013-12-19
+
+- add: Runnable.globals(arr) for per test global whitelist ([#1046](https://github.com/mochajs/mocha/issues/1046))
+- add: mocha.throwError(err) for assertion libs to call ([#985](https://github.com/mochajs/mocha/issues/985))
+- remove: --watch's spinner ([#806](https://github.com/mochajs/mocha/issues/806))
+- fix: duplicate test output for multi-line specs in spec reporter ([#1006](https://github.com/mochajs/mocha/issues/1006))
+- fix: gracefully exit on SIGINT ([#1063](https://github.com/mochajs/mocha/issues/1063))
+- fix expose the specified ui only in the browser ([#984](https://github.com/mochajs/mocha/issues/984))
+- fix: ensure process exit code is preserved when using --no-exit ([#1059](https://github.com/mochajs/mocha/issues/1059))
+- fix: return true from window.onerror handler ([#868](https://github.com/mochajs/mocha/issues/868))
+- fix: xunit reporter to use process.stdout.write ([#1068](https://github.com/mochajs/mocha/issues/1068))
+- fix: utils.clean(str) indentation ([#761](https://github.com/mochajs/mocha/issues/761))
+- fix: xunit reporter returning test duration a NaN ([#1039](https://github.com/mochajs/mocha/issues/1039))
+
+# 1.15.1 / 2013-12-03
+
+- fix: recompiled for missed changes from the last release
+
+# 1.15.0 / 2013-12-02
+
+- add: `--no-exit` to prevent `process.exit()` ([#1018](https://github.com/mochajs/mocha/issues/1018))
+- fix: using inline diffs ([#1044](https://github.com/mochajs/mocha/issues/1044))
+- fix: show pending test details in xunit reporter ([#1051](https://github.com/mochajs/mocha/issues/1051))
+- fix: faster global leak detection ([#1024](https://github.com/mochajs/mocha/issues/1024))
+- fix: yui compression ([#1035](https://github.com/mochajs/mocha/issues/1035))
+- fix: wrapping long lines in test results ([#1030](https://github.com/mochajs/mocha/issues/1030), [#1031](https://github.com/mochajs/mocha/issues/1031))
+- fix: handle errors in hooks ([#1043](https://github.com/mochajs/mocha/issues/1043))
+
+# 1.14.0 / 2013-11-02
+
+- add: unified diff ([#862](https://github.com/mochajs/mocha/issues/862))
+- add: set MOCHA_COLORS env var to use colors ([#965](https://github.com/mochajs/mocha/issues/965))
+- add: able to override tests links in html reporters ([#776](https://github.com/mochajs/mocha/issues/776))
+- remove: teamcity reporter ([#954](https://github.com/mochajs/mocha/issues/954))
+- update: commander dependency to 2.0.0 ([#1010](https://github.com/mochajs/mocha/issues/1010))
+- fix: mocha --ui will try to require the ui if not built in, as --reporter does ([#1022](https://github.com/mochajs/mocha/issues/1022))
+- fix: send cursor commands only if isatty ([#184](https://github.com/mochajs/mocha/issues/184), [#1003](https://github.com/mochajs/mocha/issues/1003))
+- fix: include assertion message in base reporter ([#993](https://github.com/mochajs/mocha/issues/993), [#991](https://github.com/mochajs/mocha/issues/991))
+- fix: consistent return of it, it.only, and describe, describe.only ([#840](https://github.com/mochajs/mocha/issues/840))
+
+# 1.13.0 / 2013-09-15
+
+- add: sort test files with --sort ([#813](https://github.com/mochajs/mocha/issues/813))
+- update: diff dependency to 1.0.7
+- update: glob dependency to 3.2.3 ([#927](https://github.com/mochajs/mocha/issues/927))
+- fix: diffs show whitespace differences ([#976](https://github.com/mochajs/mocha/issues/976))
+- fix: improve global leaks ([#783](https://github.com/mochajs/mocha/issues/783))
+- fix: firefox window.getInterface leak
+- fix: accessing iframe via window[iframeIndex] leak
+- fix: faster global leak checking
+- fix: reporter pending css selector ([#970](https://github.com/mochajs/mocha/issues/970))
+
+# 1.12.1 / 2013-08-29
+
+- remove test.js from .gitignore
+- update included version of ms.js
+
+# 1.12.0 / 2013-07-01
+
+- add: prevent diffs for differing types. Closes [#900](https://github.com/mochajs/mocha/issues/900)
+- add `Mocha.process` hack for phantomjs
+- fix: use compilers with requires
+- fix regexps in diffs. Closes [#890](https://github.com/mochajs/mocha/issues/890)
+- fix xunit NaN on failure. Closes [#894](https://github.com/mochajs/mocha/issues/894)
+- fix: strip tab indentation in `clean` utility method
+- fix: textmate bundle installation
+
+# 1.11.0 / 2013-06-12
+
+- add --prof support
+- add --harmony support
+- add --harmony-generators support
+- add "Uncaught " prefix to uncaught exceptions
+- add web workers support
+- add `suite.skip()`
+- change to output # of pending / passing even on failures. Closes [#872](https://github.com/mochajs/mocha/issues/872)
+- fix: prevent hooks from being called if we are bailing
+- fix `this.timeout(0)`
+
+# 1.10.0 / 2013-05-21
+
+- add add better globbing support for windows via `glob` module
+- add support to pass through flags such as --debug-brk=1234. Closes [#852](https://github.com/mochajs/mocha/issues/852)
+- add test.only, test.skip to qunit interface
+- change to always use word-based diffs for now. Closes [#733](https://github.com/mochajs/mocha/issues/733)
+- change `mocha init` tests.html to index.html
+- fix `process` global leak in the browser
+- fix: use resolve() instead of join() for --require
+- fix: filterLeaks() condition to not consider indices in global object as leaks
+- fix: restrict mocha.css styling to #mocha id
+- fix: save timer references to avoid Sinon interfering in the browser build.
+
+# 1.9.0 / 2013-04-03
+
+- add improved setImmediate implementation
+- replace --ignore-leaks with --check-leaks
+- change default of ignoreLeaks to true. Closes [#791](https://github.com/mochajs/mocha/issues/791)
+- remove scrolling for HTML reporter
+- fix retina support
+- fix tmbundle, restrict to js scope
+
+# 1.8.2 / 2013-03-11
+
+- add `setImmediate` support for 0.10.x
+- fix mocha -w spinner on windows
+
+# 1.8.1 / 2013-01-09
+
+- fix .bail() arity check causing it to default to true
+
+# 1.8.0 / 2013-01-08
+
+- add Mocha() options bail support
+- add `Mocha#bail()` method
+- add instanceof check back for inheriting from Error
+- add component.json
+- add diff.js to browser build
+- update growl
+- fix TAP reporter failures comment :D
+
+# 1.7.4 / 2012-12-06
+
+- add total number of passes and failures to TAP
+- remove .bind() calls. re [#680](https://github.com/mochajs/mocha/issues/680)
+- fix indexOf. Closes [#680](https://github.com/mochajs/mocha/issues/680)
+
+# 1.7.3 / 2012-11-30
+
+- fix uncaught error support for the browser
+- revert uncaught "fix" which breaks node
+
+# 1.7.2 / 2012-11-28
+
+- fix uncaught errors to expose the original error message
+
+# 1.7.0 / 2012-11-07
+
+- add `--async-only` support to prevent false positives for missing `done()`
+- add sorting by filename in code coverage
+- add HTML 5 doctype to browser template.
+- add play button to html reporter to rerun a single test
+- add `this.timeout(ms)` as Suite#timeout(ms). Closes [#599](https://github.com/mochajs/mocha/issues/599)
+- update growl dependency to 1.6.x
+- fix encoding of test-case ?grep. Closes [#637](https://github.com/mochajs/mocha/issues/637)
+- fix unicode chars on windows
+- fix dom globals in Opera/IE. Closes [#243](https://github.com/mochajs/mocha/issues/243)
+- fix markdown reporter a tags
+- fix `this.timeout("5s")` support
+
+# 1.6.0 / 2012-10-02
+
+- add object diffs when `err.showDiff` is present
+- add hiding of empty suites when pass/failures are toggled
+- add faster `.length` checks to `checkGlobals()` before performing the filter
+
+# 1.5.0 / 2012-09-21
+
+- add `ms()` to `.slow()` and `.timeout()`
+- add `Mocha#checkLeaks()` to re-enable global leak checks
+- add `this.slow()` option [aheckmann]
+- add tab, CR, LF to error diffs for now
+- add faster `.checkGlobals()` solution [guille]
+- remove `fn.call()` from reduce util
+- remove `fn.call()` from filter util
+- fix forEach. Closes [#582](https://github.com/mochajs/mocha/issues/582)
+- fix relaying of signals [TooTallNate]
+- fix TAP reporter grep number
+
+# 1.4.2 / 2012-09-01
+
+- add support to multiple `Mocha#globals()` calls, and strings
+- add `mocha.reporter()` constructor support [jfirebaugh]
+- add `mocha.timeout()`
+- move query-string parser to utils.js
+- move highlight code to utils.js
+- fix third-party reporter support [exogen]
+- fix client-side API to match node-side [jfirebaugh]
+- fix mocha in iframe [joliss]
+
+# 1.4.1 / 2012-08-28
+
+- add missing `Markdown` export
+- fix `Mocha#grep()`, escape regexp strings
+- fix reference error when `devicePixelRatio` is not defined. Closes [#549](https://github.com/mochajs/mocha/issues/549)
+
+# 1.4.0 / 2012-08-22
+
+- add mkdir -p to `mocha init`. Closes [#539](https://github.com/mochajs/mocha/issues/539)
+- add `.only()`. Closes [#524](https://github.com/mochajs/mocha/issues/524)
+- add `.skip()`. Closes [#524](https://github.com/mochajs/mocha/issues/524)
+- change str.trim() to use utils.trim(). Closes [#533](https://github.com/mochajs/mocha/issues/533)
+- fix HTML progress indicator retina display
+- fix url-encoding of click-to-grep HTML functionality
+
+# 1.3.2 / 2012-08-01
+
+- fix exports double-execution regression. Closes [#531](https://github.com/mochajs/mocha/issues/531)
+
+# 1.3.1 / 2012-08-01
+
+- add passes/failures toggling to HTML reporter
+- add pending state to `xit()` and `xdescribe()` [Brian Moore]
+- add the [**@charset**](https://github.com/charset) "UTF-8"; to fix [#522](https://github.com/mochajs/mocha/issues/522) with FireFox. [Jonathan Creamer]
+- add border-bottom to #stats links
+- add check for runnable in `Runner#uncaught()`. Closes [#494](https://github.com/mochajs/mocha/issues/494)
+- add 0.4 and 0.6 back to travis.yml
+- add `-E, --growl-errors` to growl on failures only
+- add prefixes to debug() names. Closes [#497](https://github.com/mochajs/mocha/issues/497)
+- add `Mocha#invert()` to js api
+- change dot reporter to use sexy unicode dots
+- fix error when clicking pending test in HTML reporter
+- fix `make tm`
+
+# 1.3.0 / 2012-07-05
+
+- add window scrolling to `HTML` reporter
+- add v8 `--trace-*` option support
+- add support for custom reports via `--reporter MODULE`
+- add `--invert` switch to invert `--grep` matches
+- fix export of `Nyan` reporter. Closes [#495](https://github.com/mochajs/mocha/issues/495)
+- fix escaping of `HTML` suite titles. Closes [#486](https://github.com/mochajs/mocha/issues/486)
+- fix `done()` called multiple times with an error test
+- change `--grep` - regexp escape the input
+
+# 1.2.2 / 2012-06-28
+
+- Added 0.8.0 support
+
+# 1.2.1 / 2012-06-25
+
+- Added `this.test.error(err)` support to after each hooks. Closes [#287](https://github.com/mochajs/mocha/issues/287)
+- Added: export top-level suite on global mocha object (mocha.suite). Closes [#448](https://github.com/mochajs/mocha/issues/448)
+- Fixed `js` code block format error in markdown reporter
+- Fixed deprecation warning when using `path.existsSync`
+- Fixed --globals with wildcard
+- Fixed chars in nyan when his head moves back
+- Remove `--growl` from test/mocha.opts. Closes [#289](https://github.com/mochajs/mocha/issues/289)
+
+# 1.2.0 / 2012-06-17
+
+- Added `nyan` reporter [Atsuya Takagi]
+- Added `mocha init <path>` to copy client files
+- Added "specify" synonym for "it" [domenic]
+- Added global leak wildcard support [nathanbowser]
+- Fixed runner emitter leak. closes [#432](https://github.com/mochajs/mocha/issues/432)
+- Fixed omission of .js extension. Closes [#454](https://github.com/mochajs/mocha/issues/454)
+
+# 1.1.0 / 2012-05-30
+
+- Added: check each `mocha(1)` arg for directories to walk
+- Added `--recursive` [tricknotes]
+- Added `context` for BDD [hokaccha]
+- Added styling for new clickable titles
+- Added clickable suite titles to HTML reporter
+- Added warning when strings are thrown as errors
+- Changed: green arrows again in HTML reporter styling
+- Changed ul/li elements instead of divs for better copy-and-pasting [joliss]
+- Fixed issue [#325](https://github.com/mochajs/mocha/issues/325) - add better grep support to js api
+- Fixed: save timer references to avoid Sinon interfering.
+
+# 1.0.3 / 2012-04-30
+
+- Fixed string diff newlines
+- Fixed: removed mocha.css target. Closes [#401](https://github.com/mochajs/mocha/issues/401)
+
+# 1.0.2 / 2012-04-25
+
+- Added HTML reporter duration. Closes [#47](https://github.com/mochajs/mocha/issues/47)
+- Fixed: one postMessage event listener [exogen]
+- Fixed: allow --globals to be used multiple times. Closes [#100](https://github.com/mochajs/mocha/issues/100) [brendannee]
+- Fixed [#158](https://github.com/mochajs/mocha/issues/158): removes jquery include from browser tests
+- Fixed grep. Closes [#372](https://github.com/mochajs/mocha/issues/372) [brendannee]
+- Fixed [#166](https://github.com/mochajs/mocha/issues/166) - When grepping don't display the empty suites
+- Removed test/browser/style.css. Closes [#385](https://github.com/mochajs/mocha/issues/385)
+
+# 1.0.1 / 2012-04-04
+
+- Fixed `.timeout()` in hooks
+- Fixed: allow callback for `mocha.run()` in client version
+- Fixed browser hook error display. Closes [#361](https://github.com/mochajs/mocha/issues/361)
+
+# 1.0.0 / 2012-03-24
+
+- Added js API. Closes [#265](https://github.com/mochajs/mocha/issues/265)
+- Added: initial run of tests with `--watch`. Closes [#345](https://github.com/mochajs/mocha/issues/345)
+- Added: mark `location` as a global on the CS. Closes [#311](https://github.com/mochajs/mocha/issues/311)
+- Added `markdown` reporter (github flavour)
+- Added: scrolling menu to coverage.html. Closes [#335](https://github.com/mochajs/mocha/issues/335)
+- Added source line to html report for Safari [Tyson Tate]
+- Added "min" reporter, useful for `--watch` [Jakub Nešetřil]
+- Added support for arbitrary compilers via . Closes [#338](https://github.com/mochajs/mocha/issues/338) [Ian Young]
+- Added Teamcity export to lib/reporters/index [Michael Riley]
+- Fixed chopping of first char in error reporting. Closes [#334](https://github.com/mochajs/mocha/issues/334) [reported by topfunky]
+- Fixed terrible FF / Opera stack traces
+
+# 0.14.1 / 2012-03-06
+
+- Added lib-cov to _.npmignore_
+- Added reporter to `mocha.run([reporter])` as argument
+- Added some margin-top to the HTML reporter
+- Removed jQuery dependency
+- Fixed `--watch`: purge require cache. Closes [#266](https://github.com/mochajs/mocha/issues/266)
+
+# 0.14.0 / 2012-03-01
+
+- Added string diff support for terminal reporters
+
+# 0.13.0 / 2012-02-23
+
+- Added preliminary test coverage support. Closes [#5](https://github.com/mochajs/mocha/issues/5)
+- Added `HTMLCov` reporter
+- Added `JSONCov` reporter [kunklejr]
+- Added `xdescribe()` and `xit()` to the BDD interface. Closes [#263](https://github.com/mochajs/mocha/issues/263) (docs \* Changed: make json reporter output pretty json
+- Fixed node-inspector support, swapped `--debug` for `debug` to match node. Closes [#247](https://github.com/mochajs/mocha/issues/247)
+
+# 0.12.1 / 2012-02-14
+
+- Added `npm docs mocha` support [TooTallNate]
+- Added a `Context` object used for hook and test-case this. Closes [#253](https://github.com/mochajs/mocha/issues/253)
+- Fixed `Suite#clone()` `.ctx` reference. Closes [#262](https://github.com/mochajs/mocha/issues/262)
+
+# 0.12.0 / 2012-02-02
+
+- Added .coffee `--watch` support. Closes [#242](https://github.com/mochajs/mocha/issues/242)
+- Added support to `--require` files relative to the CWD. Closes [#241](https://github.com/mochajs/mocha/issues/241)
+- Added quick n dirty syntax highlighting. Closes [#248](https://github.com/mochajs/mocha/issues/248)
+- Changed: made HTML progress indicator smaller
+- Fixed xunit errors attribute [dhendo]
+
+# 0.10.2 / 2012-01-21
+
+- Fixed suite count in reporter stats. Closes [#222](https://github.com/mochajs/mocha/issues/222)
+- Fixed `done()` after timeout error reporting [Phil Sung]
+- Changed the 0-based errors to 1
+
+# 0.10.1 / 2012-01-17
+
+- Added support for node 0.7.x
+- Fixed absolute path support. Closes [#215](https://github.com/mochajs/mocha/issues/215) [kompiro]
+- Fixed `--no-colors` option [Jussi Virtanen]
+- Fixed Arial CSS typo in the correct file
+
+# 0.10.0 / 2012-01-13
+
+- Added `-b, --bail` to exit on first exception [guillermo]
+- Added support for `-gc` / `--expose-gc` [TooTallNate]
+- Added `qunit`-inspired interface
+- Added MIT LICENSE. Closes [#194](https://github.com/mochajs/mocha/issues/194)
+- Added: `--watch` all .js in the CWD. Closes [#139](https://github.com/mochajs/mocha/issues/139)
+- Fixed `self.test` reference in runner. Closes [#189](https://github.com/mochajs/mocha/issues/189)
+- Fixed double reporting of uncaught exceptions after timeout. Closes [#195](https://github.com/mochajs/mocha/issues/195)
+
+# 0.8.2 / 2012-01-05
+
+- Added test-case context support. Closes [#113](https://github.com/mochajs/mocha/issues/113)
+- Fixed exit status. Closes [#187](https://github.com/mochajs/mocha/issues/187)
+- Update commander. Closes [#190](https://github.com/mochajs/mocha/issues/190)
+
+# 0.8.1 / 2011-12-30
+
+- Fixed reporting of uncaught exceptions. Closes [#183](https://github.com/mochajs/mocha/issues/183)
+- Fixed error message defaulting [indutny]
+- Changed mocha(1) from bash to node for windows [Nathan Rajlich]
+
+# 0.8.0 / 2011-12-28
+
+- Added `XUnit` reporter [FeeFighters/visionmedia]
+- Added `say(1)` notification support [Maciej Małecki]
+- Changed: fail when done() is invoked with a non-Error. Closes [#171](https://github.com/mochajs/mocha/issues/171)
+- Fixed `err.stack`, defaulting to message. Closes [#180](https://github.com/mochajs/mocha/issues/180)
+- Fixed: `make tm` mkdir -p the dest. Closes [#137](https://github.com/mochajs/mocha/issues/137)
+- Fixed mocha(1) --help bin name
+- Fixed `-d` for `--debug` support
+
+# 0.7.1 / 2011-12-22
+
+- Removed `mocha-debug(1)`, use `mocha --debug`
+- Fixed CWD relative requires
+- Fixed growl issue on windows [Raynos]
+- Fixed: platform specific line endings [TooTallNate]
+- Fixed: escape strings in HTML reporter. Closes [#164](https://github.com/mochajs/mocha/issues/164)
+
+# 0.7.0 / 2011-12-18
+
+- Added support for IE{7,8} [guille]
+- Changed: better browser nextTick implementation [guille]
+
+# 0.6.0 / 2011-12-18
+
+- Added setZeroTimeout timeout for browser (nicer stack traces). Closes [#153](https://github.com/mochajs/mocha/issues/153)
+- Added "view source" on hover for HTML reporter to make it obvious
+- Changed: replace custom growl with growl lib
+- Fixed duplicate reporting for HTML reporter. Closes [#154](https://github.com/mochajs/mocha/issues/154)
+- Fixed silent hook errors in the HTML reporter. Closes [#150](https://github.com/mochajs/mocha/issues/150)
+
+# 0.5.0 / 2011-12-14
+
+- Added: push node_modules directory onto module.paths for relative require Closes [#93](https://github.com/mochajs/mocha/issues/93)
+- Added teamcity reporter [blindsey]
+- Fixed: recover from uncaught exceptions for tests. Closes [#94](https://github.com/mochajs/mocha/issues/94)
+- Fixed: only emit "test end" for uncaught within test, not hook
+
+# 0.4.0 / 2011-12-14
+
+- Added support for test-specific timeouts via `this.timeout(0)`. Closes [#134](https://github.com/mochajs/mocha/issues/134)
+- Added guillermo's client-side EventEmitter. Closes [#132](https://github.com/mochajs/mocha/issues/132)
+- Added progress indicator to the HTML reporter
+- Fixed slow browser tests. Closes [#135](https://github.com/mochajs/mocha/issues/135)
+- Fixed "suite" color for light terminals
+- Fixed `require()` leak spotted by [guillermo]
+
+# 0.3.6 / 2011-12-09
+
+- Removed suite merging (for now)
+
+# 0.3.5 / 2011-12-08
+
+- Added support for `window.onerror` [guillermo]
+- Fixed: clear timeout on uncaught exceptions. Closes [#131](https://github.com/mochajs/mocha/issues/131) [guillermo]
+- Added `mocha.css` to PHONY list.
+- Added `mocha.js` to PHONY list.
+
+# 0.3.4 / 2011-12-08
+
+- Added: allow `done()` to be called with non-Error
+- Added: return Runner from `mocha.run()`. Closes [#126](https://github.com/mochajs/mocha/issues/126)
+- Fixed: run afterEach even on failures. Closes [#125](https://github.com/mochajs/mocha/issues/125)
+- Fixed clobbering of current runnable. Closes [#121](https://github.com/mochajs/mocha/issues/121)
+
+# 0.3.3 / 2011-12-08
+
+- Fixed hook timeouts. Closes [#120](https://github.com/mochajs/mocha/issues/120)
+- Fixed uncaught exceptions in hooks
+
+# 0.3.2 / 2011-12-05
+
+- Fixed weird reporting when `err.message` is not present
+
+# 0.3.1 / 2011-12-04
+
+- Fixed hook event emitter leak. Closes [#117](https://github.com/mochajs/mocha/issues/117)
+- Fixed: export `Spec` constructor. Closes [#116](https://github.com/mochajs/mocha/issues/116)
+
+# 0.3.0 / 2011-12-04
+
+- Added `-w, --watch`. Closes [#72](https://github.com/mochajs/mocha/issues/72)
+- Added `--ignore-leaks` to ignore global leak checking
+- Added browser `?grep=pattern` support
+- Added `--globals <names>` to specify accepted globals. Closes [#99](https://github.com/mochajs/mocha/issues/99)
+- Fixed `mocha-debug(1)` on some systems. Closes [#232](https://github.com/mochajs/mocha/issues/232)
+- Fixed growl total, use `runner.total`
+
+# 0.2.0 / 2011-11-30
+
+- Added `--globals <names>` to specify accepted globals. Closes [#99](https://github.com/mochajs/mocha/issues/99)
+- Fixed funky highlighting of messages. Closes [#97](https://github.com/mochajs/mocha/issues/97)
+- Fixed `mocha-debug(1)`. Closes [#232](https://github.com/mochajs/mocha/issues/232)
+- Fixed growl total, use runner.total
+
+# 0.1.0 / 2011-11-29
+
+- Added `suiteSetup` and `suiteTeardown` to TDD interface [David Henderson]
+- Added growl icons. Closes [#84](https://github.com/mochajs/mocha/issues/84)
+- Fixed coffee-script support
+
+# 0.0.8 / 2011-11-25
+
+- Fixed: use `Runner#total` for accurate reporting
+
+# 0.0.7 / 2011-11-25
+
+- Added `Hook`
+- Added `Runnable`
+- Changed: `Test` is `Runnable`
+- Fixed global leak reporting in hooks
+- Fixed: > 2 calls to done() only report the error once
+- Fixed: clear timer on failure. Closes [#80](https://github.com/mochajs/mocha/issues/80)
+
+# 0.0.6 / 2011-11-25
+
+- Fixed return on immediate async error. Closes [#80](https://github.com/mochajs/mocha/issues/80)
+
+# 0.0.5 / 2011-11-24
+
+- Fixed: make mocha.opts whitespace less picky [kkaefer]
+
+# 0.0.4 / 2011-11-24
+
+- Added `--interfaces`
+- Added `--reporters`
+- Added `-c, --colors`. Closes [#69](https://github.com/mochajs/mocha/issues/69)
+- Fixed hook timeouts
+
+# 0.0.3 / 2011-11-23
+
+- Added `-C, --no-colors` to explicitly disable
+- Added coffee-script support
+
+# 0.0.2 / 2011-11-22
+
+- Fixed global leak detection due to Safari bind() change
+- Fixed: escape html entities in Doc reporter
+- Fixed: escape html entities in HTML reporter
+- Fixed pending test support for HTML reporter. Closes [#66](https://github.com/mochajs/mocha/issues/66)
+
+# 0.0.1 / 2011-11-22
+
+- Added `--timeout` second shorthand support, ex `--timeout 3s`.
+- Fixed "test end" event for uncaughtExceptions. Closes [#61](https://github.com/mochajs/mocha/issues/61)
+
+# 0.0.1-alpha6 / 2011-11-19
+
+- Added travis CI support (needs enabling when public)
+- Added preliminary browser support
+- Added `make mocha.css` target. Closes [#45](https://github.com/mochajs/mocha/issues/45)
+- Added stack trace to TAP errors. Closes [#52](https://github.com/mochajs/mocha/issues/52)
+- Renamed tearDown to teardown. Closes [#49](https://github.com/mochajs/mocha/issues/49)
+- Fixed: cascading hooksc. Closes [#30](https://github.com/mochajs/mocha/issues/30)
+- Fixed some colors for non-tty
+- Fixed errors thrown in sync test-cases due to nextTick
+- Fixed Base.window.width... again give precedence to 0.6.x
+
+# 0.0.1-alpha5 / 2011-11-17
+
+- Added `doc` reporter. Closes [#33](https://github.com/mochajs/mocha/issues/33)
+- Added suite merging. Closes [#28](https://github.com/mochajs/mocha/issues/28)
+- Added TextMate bundle and `make tm`. Closes [#20](https://github.com/mochajs/mocha/issues/20)
+
+# 0.0.1-alpha4 / 2011-11-15
+
+- Fixed getWindowSize() for 0.4.x
+
+# 0.0.1-alpha3 / 2011-11-15
+
+- Added `-s, --slow <ms>` to specify "slow" test threshold
+- Added `mocha-debug(1)`
+- Added `mocha.opts` support. Closes [#31](https://github.com/mochajs/mocha/issues/31)
+- Added: default [files] to _test/\*.js_
+- Added protection against multiple calls to `done()`. Closes [#35](https://github.com/mochajs/mocha/issues/35)
+- Changed: bright yellow for slow Dot reporter tests
+
+# 0.0.1-alpha2 / 2011-11-08
+
+- Missed this one :)
+
+# 0.0.1-alpha1 / 2011-11-08
+
+- Initial release
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/LICENSE b/chromium/third_party/devtools-frontend/src/node_modules/mocha/LICENSE
new file mode 100644
index 00000000000..9ab23f6873a
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2011-2018 JS Foundation and contributors, https://js.foundation
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/README.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/README.md
new file mode 100644
index 00000000000..81285196914
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/README.md
@@ -0,0 +1,105 @@
+<p align="center">
+  <img src="https://cldup.com/xFVFxOioAU.svg" alt="Mocha test framework"/>
+</p>
+
+<p align="center">:coffee: Simple, flexible, fun JavaScript test framework for Node.js & The Browser :coffee:</p>
+
+<p align="center"><a href="http://travis-ci.org/mochajs/mocha"><img src="https://api.travis-ci.org/mochajs/mocha.svg?branch=master" alt="Build Status"></a>  <a href="https://coveralls.io/github/mochajs/mocha"><img src="https://coveralls.io/repos/github/mochajs/mocha/badge.svg" alt="Coverage Status"></a>  <a href="https://app.fossa.io/projects/git%2Bhttps%3A%2F%2Fgithub.com%2Fmochajs%2Fmocha?ref=badge_shield"><img src="https://app.fossa.io/api/projects/git%2Bhttps%3A%2F%2Fgithub.com%2Fmochajs%2Fmocha.svg?type=shield" alt="FOSSA Status"></a>  <a href="https://gitter.im/mochajs/mocha?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge"><img src="https://badges.gitter.im/Join%20Chat.svg" alt="Gitter"></a>  <a href="https://github.com/mochajs/mocha#backers"><img src="https://opencollective.com/mochajs/backers/badge.svg" alt="OpenCollective"></a>  <a href="https://github.com/mochajs/mocha#sponsors"><img src="https://opencollective.com/mochajs/sponsors/badge.svg" alt="OpenCollective"></a>
+</p>
+
+<p align="center"><br><img alt="Mocha Browser Support h/t SauceLabs" src="https://saucelabs.com/browser-matrix/mochajs.svg" width="354"></p>
+
+## Links
+
+- **[Documentation](https://mochajs.org/)**
+- **[Release Notes / History / Changes](https://github.com/mochajs/mocha/blob/master/CHANGELOG.md)**
+- [Code of Conduct](https://github.com/mochajs/mocha/blob/master/.github/CODE_OF_CONDUCT.md)
+- [Contributing](https://github.com/mochajs/mocha/blob/master/.github/CONTRIBUTING.md)
+- [Gitter Chatroom](https://gitter.im/mochajs/mocha) (ask questions here!)
+- [Google Group](https://groups.google.com/group/mochajs)
+- [Issue Tracker](https://github.com/mochajs/mocha/issues)
+
+## Backers
+
+[Become a backer](https://opencollective.com/mochajs#backer) and show your support to our open source project.
+
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/0/avatar)](https://opencollective.com/mochajs/backer/0/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/1/avatar)](https://opencollective.com/mochajs/backer/1/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/2/avatar)](https://opencollective.com/mochajs/backer/2/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/3/avatar)](https://opencollective.com/mochajs/backer/3/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/4/avatar)](https://opencollective.com/mochajs/backer/4/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/5/avatar)](https://opencollective.com/mochajs/backer/5/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/6/avatar)](https://opencollective.com/mochajs/backer/6/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/7/avatar)](https://opencollective.com/mochajs/backer/7/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/8/avatar)](https://opencollective.com/mochajs/backer/8/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/9/avatar)](https://opencollective.com/mochajs/backer/9/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/10/avatar)](https://opencollective.com/mochajs/backer/10/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/11/avatar)](https://opencollective.com/mochajs/backer/11/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/12/avatar)](https://opencollective.com/mochajs/backer/12/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/13/avatar)](https://opencollective.com/mochajs/backer/13/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/14/avatar)](https://opencollective.com/mochajs/backer/14/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/15/avatar)](https://opencollective.com/mochajs/backer/15/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/16/avatar)](https://opencollective.com/mochajs/backer/16/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/17/avatar)](https://opencollective.com/mochajs/backer/17/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/18/avatar)](https://opencollective.com/mochajs/backer/18/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/19/avatar)](https://opencollective.com/mochajs/backer/19/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/20/avatar)](https://opencollective.com/mochajs/backer/20/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/21/avatar)](https://opencollective.com/mochajs/backer/21/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/22/avatar)](https://opencollective.com/mochajs/backer/22/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/23/avatar)](https://opencollective.com/mochajs/backer/23/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/24/avatar)](https://opencollective.com/mochajs/backer/24/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/25/avatar)](https://opencollective.com/mochajs/backer/25/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/26/avatar)](https://opencollective.com/mochajs/backer/26/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/27/avatar)](https://opencollective.com/mochajs/backer/27/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/28/avatar)](https://opencollective.com/mochajs/backer/28/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/backer/29/avatar)](https://opencollective.com/mochajs/backer/29/website)
+
+## Sponsors
+
+Does your company use Mocha?  Ask your manager or marketing team if your company would be interested in supporting our project.  Support will allow the maintainers to dedicate more time for maintenance and new features for everyone.  Also, your company's logo will show [on GitHub](https://github.com/mochajs/mocha#readme) and on [our site](https://mochajs.org) - who doesn't want a little extra exposure?  [Here's the info](https://opencollective.com/mochajs#sponsor).
+
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/0/avatar)](https://opencollective.com/mochajs/sponsor/0/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/1/avatar)](https://opencollective.com/mochajs/sponsor/1/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/2/avatar)](https://opencollective.com/mochajs/sponsor/2/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/3/avatar)](https://opencollective.com/mochajs/sponsor/3/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/4/avatar)](https://opencollective.com/mochajs/sponsor/4/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/5/avatar)](https://opencollective.com/mochajs/sponsor/5/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/6/avatar)](https://opencollective.com/mochajs/sponsor/6/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/7/avatar)](https://opencollective.com/mochajs/sponsor/7/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/8/avatar)](https://opencollective.com/mochajs/sponsor/8/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/9/avatar)](https://opencollective.com/mochajs/sponsor/9/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/10/avatar)](https://opencollective.com/mochajs/sponsor/10/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/11/avatar)](https://opencollective.com/mochajs/sponsor/11/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/12/avatar)](https://opencollective.com/mochajs/sponsor/12/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/13/avatar)](https://opencollective.com/mochajs/sponsor/13/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/14/avatar)](https://opencollective.com/mochajs/sponsor/14/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/15/avatar)](https://opencollective.com/mochajs/sponsor/15/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/16/avatar)](https://opencollective.com/mochajs/sponsor/16/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/17/avatar)](https://opencollective.com/mochajs/sponsor/17/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/18/avatar)](https://opencollective.com/mochajs/sponsor/18/website)
+[![MochaJS Backer](https://opencollective.com/mochajs/sponsor/19/avatar)](https://opencollective.com/mochajs/sponsor/19/website)
+
+## Development
+
+You might want to know that:
+
+- Mocha is the *most-depended-upon* module on npm (source: [libraries.io](https://libraries.io/search?order=desc&platforms=NPM&sort=dependents_count)), and
+- Mocha is an *independent* open-source project, maintained exclusively by volunteers.
+
+You might want to help:
+
+- New to contributing to Mocha?  Check out this list of [good first issues](https://github.com/mochajs/mocha/issues?q=is%3Aissue+is%3Aopen+label%3Agood-first-issue)
+- Mocha could use a hand with [these issues](https://github.com/mochajs/mocha/issues?q=is%3Aissue+is%3Aopen+label%3A%22help+wanted%22)
+- The [maintainer's handbook](https://github.com/mochajs/mocha/blob/master/MAINTAINERS.md) explains how things get done
+
+Finally, come [chat with the maintainers](https://gitter.im/mochajs/contributors) on Gitter if you want to help with:
+
+- Triaging issues, answering questions
+- Review, merging, and closing pull requests
+- Other project-maintenance-y things
+
+## License
+
+[MIT](LICENSE)
+
+[![FOSSA Status](https://app.fossa.io/api/projects/git%2Bhttps%3A%2F%2Fgithub.com%2Fmochajs%2Fmocha.svg?type=large)](https://app.fossa.io/projects/git%2Bhttps%3A%2F%2Fgithub.com%2Fmochajs%2Fmocha?ref=badge_large)
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/assets/growl/error.png b/chromium/third_party/devtools-frontend/src/node_modules/mocha/assets/growl/error.png
new file mode 100644
index 00000000000..a07a1ba5efe
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/assets/growl/error.png
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/assets/growl/ok.png b/chromium/third_party/devtools-frontend/src/node_modules/mocha/assets/growl/ok.png
new file mode 100644
index 00000000000..b3623a59946
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/assets/growl/ok.png
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/bin/_mocha b/chromium/third_party/devtools-frontend/src/node_modules/mocha/bin/_mocha
new file mode 100755
index 00000000000..2ea83174672
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/bin/_mocha
@@ -0,0 +1,10 @@
+#!/usr/bin/env node
+'use strict';
+
+/**
+ * This file remains for backwards compatibility only.
+ * Don't put stuff in this file.
+ * @see module:lib/cli
+ */
+
+require('../lib/cli').main();
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/bin/mocha b/chromium/third_party/devtools-frontend/src/node_modules/mocha/bin/mocha
new file mode 100755
index 00000000000..df7cf48ca30
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/bin/mocha
@@ -0,0 +1,155 @@
+#!/usr/bin/env node
+
+'use strict';
+
+/**
+ * This wrapper executable checks for known node flags and appends them when found,
+ * before invoking the "real" executable (`lib/cli/cli.js`)
+ *
+ * @module bin/mocha
+ * @private
+ */
+
+const {deprecate, warn} = require('../lib/utils');
+const {loadOptions} = require('../lib/cli/options');
+const {
+  unparseNodeFlags,
+  isNodeFlag,
+  impliesNoTimeouts
+} = require('../lib/cli/node-flags');
+const unparse = require('yargs-unparser');
+const debug = require('debug')('mocha:cli:mocha');
+const {aliases} = require('../lib/cli/run-option-metadata');
+const nodeEnv = require('node-environment-flags');
+
+const mochaArgs = {};
+const nodeArgs = {};
+
+const opts = loadOptions(process.argv.slice(2));
+debug('loaded opts', opts);
+
+/**
+ * Given option/command `value`, disable timeouts if applicable
+ * @param {string} [value] - Value to check
+ * @ignore
+ */
+const disableTimeouts = value => {
+  if (impliesNoTimeouts(value)) {
+    debug(`option "${value}" disabled timeouts`);
+    mochaArgs.timeout = 0;
+    delete mochaArgs.timeouts;
+    delete mochaArgs.t;
+  }
+};
+
+/**
+ * If `value` begins with `v8-` and is not explicitly `v8-options`, remove prefix
+ * @param {string} [value] - Value to check
+ * @returns {string} `value` with prefix (maybe) removed
+ * @ignore
+ */
+const trimV8Option = value =>
+  value !== 'v8-options' && /^v8-/.test(value) ? value.slice(3) : value;
+
+// sort options into "node" and "mocha" buckets
+Object.keys(opts).forEach(opt => {
+  if (isNodeFlag(opt)) {
+    nodeArgs[trimV8Option(opt)] = opts[opt];
+    disableTimeouts(opt);
+  } else {
+    mochaArgs[opt] = opts[opt];
+  }
+});
+
+// Native debugger handling
+// see https://nodejs.org/api/debugger.html#debugger_debugger
+// look for 'debug' or 'inspect' that would launch this debugger,
+// remove it from Mocha's opts and prepend it to Node's opts.
+// also coerce depending on Node.js version.
+// A deprecation warning will be printed by node, if applicable.
+// (mochaArgs._ are "positional" arguments, not prefixed with - or --)
+if (/^(debug|inspect)$/.test(mochaArgs._[0])) {
+  const command = mochaArgs._.shift();
+  disableTimeouts(command);
+  // don't conflict with inspector
+  ['debug', 'inspect', 'debug-brk', 'inspect-brk']
+    .filter(opt => opt in nodeArgs || opt in mochaArgs)
+    .forEach(opt => {
+      warn(`command "${command}" provided; --${opt} ignored`);
+      delete nodeArgs[opt];
+      delete mochaArgs[opt];
+    });
+  nodeArgs._ = [
+    parseInt(
+      process.version
+        .slice(1)
+        .split('.')
+        .shift(),
+      10
+    ) >= 8
+      ? 'inspect'
+      : 'debug'
+  ];
+}
+
+// allow --debug to invoke --inspect on Node.js v8 or newer.
+['debug', 'debug-brk']
+  .filter(opt => opt in nodeArgs && !nodeEnv.has(opt))
+  .forEach(opt => {
+    const newOpt = opt === 'debug' ? 'inspect' : 'inspect-brk';
+    warn(
+      `"--${opt}" is not available in Node.js ${
+        process.version
+      }; use "--${newOpt}" instead.`
+    );
+    nodeArgs[newOpt] = nodeArgs[opt];
+    mochaArgs.timeout = false;
+    debug(`--${opt} -> ${newOpt}`);
+    delete nodeArgs[opt];
+  });
+
+// historical
+if (nodeArgs.gc) {
+  deprecate(
+    '"-gc" is deprecated and will be removed from a future version of Mocha.  Use "--gc-global" instead.'
+  );
+  nodeArgs['gc-global'] = nodeArgs.gc;
+  delete nodeArgs.gc;
+}
+
+if (Object.keys(nodeArgs).length) {
+  const {spawn} = require('child_process');
+  const mochaPath = require.resolve('../lib/cli/cli.js');
+
+  debug('final node args', nodeArgs);
+
+  const args = [].concat(
+    unparseNodeFlags(nodeArgs),
+    mochaPath,
+    unparse(mochaArgs, {alias: aliases})
+  );
+
+  debug(`exec ${process.execPath} w/ args:`, args);
+
+  const proc = spawn(process.execPath, args, {
+    stdio: 'inherit'
+  });
+
+  proc.on('exit', (code, signal) => {
+    process.on('exit', () => {
+      if (signal) {
+        process.kill(process.pid, signal);
+      } else {
+        process.exit(code);
+      }
+    });
+  });
+
+  // terminate children.
+  process.on('SIGINT', () => {
+    proc.kill('SIGINT'); // calls runner.abort()
+    proc.kill('SIGTERM'); // if that didn't work, we're probably in an infinite loop, so make it die.
+  });
+} else {
+  require('../lib/cli/cli').main(unparse(mochaArgs, {alias: aliases}));
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/bin/options.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/bin/options.js
new file mode 100644
index 00000000000..102fd5a9c1f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/bin/options.js
@@ -0,0 +1,10 @@
+'use strict';
+
+/*
+ * This module is deprecated and will be removed in a future version of Mocha.
+ * @deprecated Deprecated in v6.0.0; source moved into {@link module:lib/cli/options lib/cli/options module}.
+ * @module
+ * @exports module:lib/cli/options
+ */
+
+module.exports = require('../lib/cli/options');
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/browser-entry.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/browser-entry.js
new file mode 100644
index 00000000000..fd891177556
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/browser-entry.js
@@ -0,0 +1,191 @@
+'use strict';
+
+/* eslint no-unused-vars: off */
+/* eslint-env commonjs */
+
+/**
+ * Shim process.stdout.
+ */
+
+process.stdout = require('browser-stdout')({label: false});
+
+var Mocha = require('./lib/mocha');
+
+/**
+ * Create a Mocha instance.
+ *
+ * @return {undefined}
+ */
+
+var mocha = new Mocha({reporter: 'html'});
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var setInterval = global.setInterval;
+var clearTimeout = global.clearTimeout;
+var clearInterval = global.clearInterval;
+
+var uncaughtExceptionHandlers = [];
+
+var originalOnerrorHandler = global.onerror;
+
+/**
+ * Remove uncaughtException listener.
+ * Revert to original onerror handler if previously defined.
+ */
+
+process.removeListener = function(e, fn) {
+  if (e === 'uncaughtException') {
+    if (originalOnerrorHandler) {
+      global.onerror = originalOnerrorHandler;
+    } else {
+      global.onerror = function() {};
+    }
+    var i = uncaughtExceptionHandlers.indexOf(fn);
+    if (i !== -1) {
+      uncaughtExceptionHandlers.splice(i, 1);
+    }
+  }
+};
+
+/**
+ * Implements uncaughtException listener.
+ */
+
+process.on = function(e, fn) {
+  if (e === 'uncaughtException') {
+    global.onerror = function(err, url, line) {
+      fn(new Error(err + ' (' + url + ':' + line + ')'));
+      return !mocha.allowUncaught;
+    };
+    uncaughtExceptionHandlers.push(fn);
+  }
+};
+
+// The BDD UI is registered by default, but no UI will be functional in the
+// browser without an explicit call to the overridden `mocha.ui` (see below).
+// Ensure that this default UI does not expose its methods to the global scope.
+mocha.suite.removeAllListeners('pre-require');
+
+var immediateQueue = [];
+var immediateTimeout;
+
+function timeslice() {
+  var immediateStart = new Date().getTime();
+  while (immediateQueue.length && new Date().getTime() - immediateStart < 100) {
+    immediateQueue.shift()();
+  }
+  if (immediateQueue.length) {
+    immediateTimeout = setTimeout(timeslice, 0);
+  } else {
+    immediateTimeout = null;
+  }
+}
+
+/**
+ * High-performance override of Runner.immediately.
+ */
+
+Mocha.Runner.immediately = function(callback) {
+  immediateQueue.push(callback);
+  if (!immediateTimeout) {
+    immediateTimeout = setTimeout(timeslice, 0);
+  }
+};
+
+/**
+ * Function to allow assertion libraries to throw errors directly into mocha.
+ * This is useful when running tests in a browser because window.onerror will
+ * only receive the 'message' attribute of the Error.
+ */
+mocha.throwError = function(err) {
+  uncaughtExceptionHandlers.forEach(function(fn) {
+    fn(err);
+  });
+  throw err;
+};
+
+/**
+ * Override ui to ensure that the ui functions are initialized.
+ * Normally this would happen in Mocha.prototype.loadFiles.
+ */
+
+mocha.ui = function(ui) {
+  Mocha.prototype.ui.call(this, ui);
+  this.suite.emit('pre-require', global, null, this);
+  return this;
+};
+
+/**
+ * Setup mocha with the given setting options.
+ */
+
+mocha.setup = function(opts) {
+  if (typeof opts === 'string') {
+    opts = {ui: opts};
+  }
+  for (var opt in opts) {
+    if (opts.hasOwnProperty(opt)) {
+      this[opt](opts[opt]);
+    }
+  }
+  return this;
+};
+
+/**
+ * Run mocha, returning the Runner.
+ */
+
+mocha.run = function(fn) {
+  var options = mocha.options;
+  mocha.globals('location');
+
+  var query = Mocha.utils.parseQuery(global.location.search || '');
+  if (query.grep) {
+    mocha.grep(query.grep);
+  }
+  if (query.fgrep) {
+    mocha.fgrep(query.fgrep);
+  }
+  if (query.invert) {
+    mocha.invert();
+  }
+
+  return Mocha.prototype.run.call(mocha, function(err) {
+    // The DOM Document is not available in Web Workers.
+    var document = global.document;
+    if (
+      document &&
+      document.getElementById('mocha') &&
+      options.noHighlighting !== true
+    ) {
+      Mocha.utils.highlightTags('code');
+    }
+    if (fn) {
+      fn(err);
+    }
+  });
+};
+
+/**
+ * Expose the process shim.
+ * https://github.com/mochajs/mocha/pull/916
+ */
+
+Mocha.process = process;
+
+/**
+ * Expose mocha.
+ */
+
+global.Mocha = Mocha;
+global.mocha = mocha;
+
+// this allows test/acceptance/required-tokens.js to pass; thus,
+// you can now do `const describe = require('mocha').describe` in a
+// browser context (assuming browserification).  should fix #880
+module.exports = global;
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/index.js
new file mode 100644
index 00000000000..d2b7d196097
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/index.js
@@ -0,0 +1,3 @@
+'use strict';
+
+module.exports = require('./lib/mocha');
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/growl.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/growl.js
new file mode 100644
index 00000000000..016798501ac
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/growl.js
@@ -0,0 +1,168 @@
+'use strict';
+
+/**
+ * Web Notifications module.
+ * @module Growl
+ */
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var EVENT_RUN_END = require('../runner').constants.EVENT_RUN_END;
+
+/**
+ * Checks if browser notification support exists.
+ *
+ * @public
+ * @see {@link https://caniuse.com/#feat=notifications|Browser support (notifications)}
+ * @see {@link https://caniuse.com/#feat=promises|Browser support (promises)}
+ * @see {@link Mocha#growl}
+ * @see {@link Mocha#isGrowlCapable}
+ * @return {boolean} whether browser notification support exists
+ */
+exports.isCapable = function() {
+  var hasNotificationSupport = 'Notification' in window;
+  var hasPromiseSupport = typeof Promise === 'function';
+  return process.browser && hasNotificationSupport && hasPromiseSupport;
+};
+
+/**
+ * Implements browser notifications as a pseudo-reporter.
+ *
+ * @public
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/API/notification|Notification API}
+ * @see {@link https://developers.google.com/web/fundamentals/push-notifications/display-a-notification|Displaying a Notification}
+ * @see {@link Growl#isPermitted}
+ * @see {@link Mocha#_growl}
+ * @param {Runner} runner - Runner instance.
+ */
+exports.notify = function(runner) {
+  var promise = isPermitted();
+
+  /**
+   * Attempt notification.
+   */
+  var sendNotification = function() {
+    // If user hasn't responded yet... "No notification for you!" (Seinfeld)
+    Promise.race([promise, Promise.resolve(undefined)])
+      .then(canNotify)
+      .then(function() {
+        display(runner);
+      })
+      .catch(notPermitted);
+  };
+
+  runner.once(EVENT_RUN_END, sendNotification);
+};
+
+/**
+ * Checks if browser notification is permitted by user.
+ *
+ * @private
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/API/Notification/permission|Notification.permission}
+ * @see {@link Mocha#growl}
+ * @see {@link Mocha#isGrowlPermitted}
+ * @returns {Promise<boolean>} promise determining if browser notification
+ *     permissible when fulfilled.
+ */
+function isPermitted() {
+  var permitted = {
+    granted: function allow() {
+      return Promise.resolve(true);
+    },
+    denied: function deny() {
+      return Promise.resolve(false);
+    },
+    default: function ask() {
+      return Notification.requestPermission().then(function(permission) {
+        return permission === 'granted';
+      });
+    }
+  };
+
+  return permitted[Notification.permission]();
+}
+
+/**
+ * @summary
+ * Determines if notification should proceed.
+ *
+ * @description
+ * Notification shall <strong>not</strong> proceed unless `value` is true.
+ *
+ * `value` will equal one of:
+ * <ul>
+ *   <li><code>true</code> (from `isPermitted`)</li>
+ *   <li><code>false</code> (from `isPermitted`)</li>
+ *   <li><code>undefined</code> (from `Promise.race`)</li>
+ * </ul>
+ *
+ * @private
+ * @param {boolean|undefined} value - Determines if notification permissible.
+ * @returns {Promise<undefined>} Notification can proceed
+ */
+function canNotify(value) {
+  if (!value) {
+    var why = value === false ? 'blocked' : 'unacknowledged';
+    var reason = 'not permitted by user (' + why + ')';
+    return Promise.reject(new Error(reason));
+  }
+  return Promise.resolve();
+}
+
+/**
+ * Displays the notification.
+ *
+ * @private
+ * @param {Runner} runner - Runner instance.
+ */
+function display(runner) {
+  var stats = runner.stats;
+  var symbol = {
+    cross: '\u274C',
+    tick: '\u2705'
+  };
+  var logo = require('../../package').notifyLogo;
+  var _message;
+  var message;
+  var title;
+
+  if (stats.failures) {
+    _message = stats.failures + ' of ' + stats.tests + ' tests failed';
+    message = symbol.cross + ' ' + _message;
+    title = 'Failed';
+  } else {
+    _message = stats.passes + ' tests passed in ' + stats.duration + 'ms';
+    message = symbol.tick + ' ' + _message;
+    title = 'Passed';
+  }
+
+  // Send notification
+  var options = {
+    badge: logo,
+    body: message,
+    dir: 'ltr',
+    icon: logo,
+    lang: 'en-US',
+    name: 'mocha',
+    requireInteraction: false,
+    timestamp: Date.now()
+  };
+  var notification = new Notification(title, options);
+
+  // Autoclose after brief delay (makes various browsers act same)
+  var FORCE_DURATION = 4000;
+  setTimeout(notification.close.bind(notification), FORCE_DURATION);
+}
+
+/**
+ * As notifications are tangential to our purpose, just log the error.
+ *
+ * @private
+ * @param {Error} err - Why notification didn't happen.
+ */
+function notPermitted(err) {
+  console.error('notification error:', err.message);
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/progress.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/progress.js
new file mode 100644
index 00000000000..553fc6eb56f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/progress.js
@@ -0,0 +1,119 @@
+'use strict';
+
+/**
+ * Expose `Progress`.
+ */
+
+module.exports = Progress;
+
+/**
+ * Initialize a new `Progress` indicator.
+ */
+function Progress() {
+  this.percent = 0;
+  this.size(0);
+  this.fontSize(11);
+  this.font('helvetica, arial, sans-serif');
+}
+
+/**
+ * Set progress size to `size`.
+ *
+ * @public
+ * @param {number} size
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.size = function(size) {
+  this._size = size;
+  return this;
+};
+
+/**
+ * Set text to `text`.
+ *
+ * @public
+ * @param {string} text
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.text = function(text) {
+  this._text = text;
+  return this;
+};
+
+/**
+ * Set font size to `size`.
+ *
+ * @public
+ * @param {number} size
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.fontSize = function(size) {
+  this._fontSize = size;
+  return this;
+};
+
+/**
+ * Set font to `family`.
+ *
+ * @param {string} family
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.font = function(family) {
+  this._font = family;
+  return this;
+};
+
+/**
+ * Update percentage to `n`.
+ *
+ * @param {number} n
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.update = function(n) {
+  this.percent = n;
+  return this;
+};
+
+/**
+ * Draw on `ctx`.
+ *
+ * @param {CanvasRenderingContext2d} ctx
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.draw = function(ctx) {
+  try {
+    var percent = Math.min(this.percent, 100);
+    var size = this._size;
+    var half = size / 2;
+    var x = half;
+    var y = half;
+    var rad = half - 1;
+    var fontSize = this._fontSize;
+
+    ctx.font = fontSize + 'px ' + this._font;
+
+    var angle = Math.PI * 2 * (percent / 100);
+    ctx.clearRect(0, 0, size, size);
+
+    // outer circle
+    ctx.strokeStyle = '#9f9f9f';
+    ctx.beginPath();
+    ctx.arc(x, y, rad, 0, angle, false);
+    ctx.stroke();
+
+    // inner circle
+    ctx.strokeStyle = '#eee';
+    ctx.beginPath();
+    ctx.arc(x, y, rad - 1, 0, angle, true);
+    ctx.stroke();
+
+    // text
+    var text = this._text || (percent | 0) + '%';
+    var w = ctx.measureText(text).width;
+
+    ctx.fillText(text, x - w / 2 + 1, y + fontSize / 2 - 1);
+  } catch (ignore) {
+    // don't fail if we can't render progress
+  }
+  return this;
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/template.html b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/template.html
new file mode 100644
index 00000000000..af4d3e4f423
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/template.html
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html lang="en">
+  <head>
+    <meta charset="utf-8">
+    <title>Mocha</title>
+    <meta name="viewport" content="width=device-width, initial-scale=1.0">
+    <link rel="stylesheet" href="mocha.css">
+  </head>
+  <body>
+    <div id="mocha"></div>
+    <script src="mocha.js"></script>
+    <script>mocha.setup('bdd');</script>
+    <script src="tests.js"></script>
+    <script>
+      mocha.run();
+    </script>
+  </body>
+</html>
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/tty.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/tty.js
new file mode 100644
index 00000000000..e903365023f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/browser/tty.js
@@ -0,0 +1,13 @@
+'use strict';
+
+exports.isatty = function isatty() {
+  return true;
+};
+
+exports.getWindowSize = function getWindowSize() {
+  if ('innerHeight' in global) {
+    return [global.innerHeight, global.innerWidth];
+  }
+  // In a Web Worker, the DOM Window is not available.
+  return [640, 480];
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/cli.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/cli.js
new file mode 100755
index 00000000000..dee8e70dd4a
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/cli.js
@@ -0,0 +1,74 @@
+#!/usr/bin/env node
+
+'use strict';
+
+/**
+ * This is where we finally parse and handle arguments passed to the `mocha` executable.
+ * Option parsing is handled by {@link https://npm.im/yargs yargs}.
+ * If executed via `node`, this module will run {@linkcode module:lib/cli/cli.main main()}.
+ *
+ * @private
+ * @module
+ */
+
+const debug = require('debug')('mocha:cli:cli');
+const symbols = require('log-symbols');
+const yargs = require('yargs/yargs');
+const path = require('path');
+const {loadOptions, YARGS_PARSER_CONFIG} = require('./options');
+const commands = require('./commands');
+const ansi = require('ansi-colors');
+const {repository, homepage, version, gitter} = require('../../package.json');
+
+/**
+ * - Accepts an `Array` of arguments
+ * - Modifies {@link https://nodejs.org/api/modules.html#modules_module_paths Node.js' search path} for easy loading of consumer modules
+ * - Sets {@linkcode https://nodejs.org/api/errors.html#errors_error_stacktracelimit Error.stackTraceLimit} to `Infinity`
+ * @summary Mocha's main entry point from the command-line.
+ * @param {string[]} argv - Array of arguments to parse, or by default the lovely `process.argv.slice(2)`
+ */
+exports.main = (argv = process.argv.slice(2)) => {
+  debug('entered main with raw args', argv);
+  // ensure we can require() from current working directory
+  module.paths.push(process.cwd(), path.resolve('node_modules'));
+
+  Error.stackTraceLimit = Infinity; // configurable via --stack-trace-limit?
+
+  var args = loadOptions(argv);
+
+  yargs()
+    .scriptName('mocha')
+    .command(commands.run)
+    .command(commands.init)
+    .updateStrings({
+      'Positionals:': 'Positional Arguments',
+      'Options:': 'Other Options',
+      'Commands:': 'Commands'
+    })
+    .fail((msg, err, yargs) => {
+      debug(err);
+      yargs.showHelp();
+      console.error(`\n${symbols.error} ${ansi.red('ERROR:')} ${msg}`);
+      process.exit(1);
+    })
+    .help('help', 'Show usage information & exit')
+    .alias('help', 'h')
+    .version('version', 'Show version number & exit', version)
+    .alias('version', 'V')
+    .wrap(process.stdout.columns ? Math.min(process.stdout.columns, 80) : 80)
+    .epilog(
+      `Mocha Resources
+    Chat: ${ansi.magenta(gitter)}
+  GitHub: ${ansi.blue(repository.url)}
+    Docs: ${ansi.yellow(homepage)}
+      `
+    )
+    .parserConfiguration(YARGS_PARSER_CONFIG)
+    .config(args)
+    .parse(args._);
+};
+
+// allow direct execution
+if (require.main === module) {
+  exports.main();
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/collect-files.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/collect-files.js
new file mode 100644
index 00000000000..61d54ac4b32
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/collect-files.js
@@ -0,0 +1,85 @@
+'use strict';
+
+const path = require('path');
+const ansi = require('ansi-colors');
+const debug = require('debug')('mocha:cli:run:helpers');
+const minimatch = require('minimatch');
+const utils = require('../utils');
+
+/**
+ * Exports a function that collects test files from CLI parameters.
+ * @see module:lib/cli/run-helpers
+ * @see module:lib/cli/watch-run
+ * @module
+ * @private
+ */
+
+/**
+ * Smash together an array of test files in the correct order
+ * @param {Object} opts - Options
+ * @param {string[]} opts.extension - File extensions to use
+ * @param {string[]} opts.spec - Files, dirs, globs to run
+ * @param {string[]} opts.ignore - Files, dirs, globs to ignore
+ * @param {string[]} opts.file - List of additional files to include
+ * @param {boolean} opts.recursive - Find files recursively
+ * @param {boolean} opts.sort - Sort test files
+ * @returns {string[]} List of files to test
+ * @private
+ */
+module.exports = ({ignore, extension, file, recursive, sort, spec} = {}) => {
+  let files = [];
+  const unmatched = [];
+  spec.forEach(arg => {
+    let newFiles;
+    try {
+      newFiles = utils.lookupFiles(arg, extension, recursive);
+    } catch (err) {
+      if (err.code === 'ERR_MOCHA_NO_FILES_MATCH_PATTERN') {
+        unmatched.push({message: err.message, pattern: err.pattern});
+        return;
+      }
+
+      throw err;
+    }
+
+    if (typeof newFiles !== 'undefined') {
+      if (typeof newFiles === 'string') {
+        newFiles = [newFiles];
+      }
+      newFiles = newFiles.filter(fileName =>
+        ignore.every(pattern => !minimatch(fileName, pattern))
+      );
+    }
+
+    files = files.concat(newFiles);
+  });
+
+  const fileArgs = file.map(filepath => path.resolve(filepath));
+  files = files.map(filepath => path.resolve(filepath));
+
+  // ensure we don't sort the stuff from fileArgs; order is important!
+  if (sort) {
+    files.sort();
+  }
+
+  // add files given through --file to be ran first
+  files = fileArgs.concat(files);
+  debug('files (in order): ', files);
+
+  if (!files.length) {
+    // give full message details when only 1 file is missing
+    const noneFoundMsg =
+      unmatched.length === 1
+        ? `Error: No test files found: ${JSON.stringify(unmatched[0].pattern)}` // stringify to print escaped characters raw
+        : 'Error: No test files found';
+    console.error(ansi.red(noneFoundMsg));
+    process.exit(1);
+  } else {
+    // print messages as an warning
+    unmatched.forEach(warning => {
+      console.warn(ansi.yellow(`Warning: ${warning.message}`));
+    });
+  }
+
+  return files;
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/commands.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/commands.js
new file mode 100644
index 00000000000..eb10c6833aa
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/commands.js
@@ -0,0 +1,13 @@
+'use strict';
+
+/**
+ * Exports Yargs commands
+ * @see https://git.io/fpJ0G
+ * @private
+ * @module
+ */
+
+exports.init = require('./init');
+
+// default command
+exports.run = require('./run');
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/config.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/config.js
new file mode 100644
index 00000000000..6fa4e2dbca6
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/config.js
@@ -0,0 +1,101 @@
+'use strict';
+
+/**
+ * Responsible for loading / finding Mocha's "rc" files.
+ * This doesn't have anything to do with `mocha.opts`.
+ *
+ * @private
+ * @module
+ */
+
+const fs = require('fs');
+const path = require('path');
+const debug = require('debug')('mocha:cli:config');
+const findUp = require('find-up');
+
+/**
+ * These are the valid config files, in order of precedence;
+ * e.g., if `.mocharc.js` is present, then `.mocharc.yaml` and the rest
+ * will be ignored.
+ * The user should still be able to explicitly specify a file.
+ * @private
+ */
+exports.CONFIG_FILES = [
+  '.mocharc.js',
+  '.mocharc.yaml',
+  '.mocharc.yml',
+  '.mocharc.jsonc',
+  '.mocharc.json'
+];
+
+const isModuleNotFoundError = err =>
+  err.code !== 'MODULE_NOT_FOUND' ||
+  err.message.indexOf('Cannot find module') !== -1;
+
+/**
+ * Parsers for various config filetypes. Each accepts a filepath and
+ * returns an object (but could throw)
+ */
+const parsers = (exports.parsers = {
+  yaml: filepath =>
+    require('js-yaml').safeLoad(fs.readFileSync(filepath, 'utf8')),
+  js: filepath => {
+    const cwdFilepath = path.resolve(filepath);
+    try {
+      debug(`parsers: load using cwd-relative path: "${cwdFilepath}"`);
+      return require(cwdFilepath);
+    } catch (err) {
+      if (isModuleNotFoundError(err)) {
+        debug(`parsers: retry load as module-relative path: "${filepath}"`);
+        return require(filepath);
+      } else {
+        throw err; // rethrow
+      }
+    }
+  },
+  json: filepath =>
+    JSON.parse(
+      require('strip-json-comments')(fs.readFileSync(filepath, 'utf8'))
+    )
+});
+
+/**
+ * Loads and parses, based on file extension, a config file.
+ * "JSON" files may have comments.
+ *
+ * @private
+ * @param {string} filepath - Config file path to load
+ * @returns {Object} Parsed config object
+ */
+exports.loadConfig = filepath => {
+  let config = {};
+  debug(`loadConfig: "${filepath}"`);
+
+  const ext = path.extname(filepath);
+  try {
+    if (ext === '.yml' || ext === '.yaml') {
+      config = parsers.yaml(filepath);
+    } else if (ext === '.js') {
+      config = parsers.js(filepath);
+    } else {
+      config = parsers.json(filepath);
+    }
+  } catch (err) {
+    throw new Error(`failed to parse config "${filepath}": ${err}`);
+  }
+  return config;
+};
+
+/**
+ * Find ("find up") config file starting at `cwd`
+ *
+ * @param {string} [cwd] - Current working directory
+ * @returns {string|null} Filepath to config, if found
+ */
+exports.findConfig = (cwd = process.cwd()) => {
+  const filepath = findUp.sync(exports.CONFIG_FILES, {cwd});
+  if (filepath) {
+    debug(`findConfig: found "${filepath}"`);
+  }
+  return filepath;
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/index.js
new file mode 100644
index 00000000000..d792f0c9dea
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/index.js
@@ -0,0 +1,9 @@
+'use strict';
+
+/**
+ * Just exports {@link module:lib/cli/cli} for convenience.
+ * @private
+ * @module lib/cli
+ * @exports module:lib/cli/cli
+ */
+module.exports = require('./cli');
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/init.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/init.js
new file mode 100644
index 00000000000..ca847c6f1eb
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/init.js
@@ -0,0 +1,37 @@
+'use strict';
+
+/**
+ * Command module for "init" command
+ *
+ * @private
+ * @module
+ */
+
+const fs = require('fs');
+const path = require('path');
+const mkdirp = require('mkdirp');
+
+exports.command = 'init <path>';
+
+exports.description = 'create a client-side Mocha setup at <path>';
+
+exports.builder = yargs =>
+  yargs.positional('path', {
+    type: 'string',
+    normalize: true
+  });
+
+exports.handler = argv => {
+  const destdir = argv.path;
+  const srcdir = path.join(__dirname, '..', '..');
+  mkdirp.sync(destdir);
+  const css = fs.readFileSync(path.join(srcdir, 'mocha.css'));
+  const js = fs.readFileSync(path.join(srcdir, 'mocha.js'));
+  const tmpl = fs.readFileSync(
+    path.join(srcdir, 'lib', 'browser', 'template.html')
+  );
+  fs.writeFileSync(path.join(destdir, 'mocha.css'), css);
+  fs.writeFileSync(path.join(destdir, 'mocha.js'), js);
+  fs.writeFileSync(path.join(destdir, 'tests.spec.js'), '');
+  fs.writeFileSync(path.join(destdir, 'index.html'), tmpl);
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/node-flags.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/node-flags.js
new file mode 100644
index 00000000000..feffaa93e2d
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/node-flags.js
@@ -0,0 +1,86 @@
+'use strict';
+
+/**
+ * Some settings and code related to Mocha's handling of Node.js/V8 flags.
+ * @private
+ * @module
+ */
+
+const nodeFlags = require('node-environment-flags');
+const unparse = require('yargs-unparser');
+
+/**
+ * These flags are considered "debug" flags.
+ * @see {@link impliesNoTimeouts}
+ * @private
+ */
+const debugFlags = new Set(['debug', 'debug-brk', 'inspect', 'inspect-brk']);
+
+/**
+ * Mocha has historical support for various `node` and V8 flags which might not
+ * appear in `process.allowedNodeEnvironmentFlags`.
+ * These include:
+ *   - `--preserve-symlinks`
+ *   - `--harmony-*`
+ *   - `--gc-global`
+ *   - `--trace-*`
+ *   - `--es-staging`
+ *   - `--use-strict`
+ *   - `--v8-*` (but *not* `--v8-options`)
+ * @summary Whether or not to pass a flag along to the `node` executable.
+ * @param {string} flag - Flag to test
+ * @param {boolean} [bareword=true] - If `false`, we expect `flag` to have one or two leading dashes.
+ * @returns {boolean} If the flag is considered a "Node" flag.
+ * @private
+ */
+exports.isNodeFlag = (flag, bareword = true) => {
+  if (!bareword) {
+    // check if the flag begins with dashes; if not, not a node flag.
+    if (!/^--?/.test(flag)) {
+      return false;
+    }
+    // strip the leading dashes to match against subsequent checks
+    flag = flag.replace(/^--?/, '');
+  }
+  return (
+    // treat --require/-r as Mocha flag even though it's also a node flag
+    !(flag === 'require' || flag === 'r') &&
+    // check actual node flags from `process.allowedNodeEnvironmentFlags`,
+    // then historical support for various V8 and non-`NODE_OPTIONS` flags
+    // and also any V8 flags with `--v8-` prefix
+    (nodeFlags.has(flag) ||
+      debugFlags.has(flag) ||
+      /(?:preserve-symlinks(?:-main)?|harmony(?:[_-]|$)|(?:trace[_-].+$)|gc(?:[_-]global)?$|es[_-]staging$|use[_-]strict$|v8[_-](?!options).+?$)/.test(
+        flag
+      ))
+  );
+};
+
+/**
+ * Returns `true` if the flag is a "debug-like" flag.  These require timeouts
+ * to be suppressed, or pausing the debugger on breakpoints will cause test failures.
+ * @param {string} flag - Flag to test
+ * @returns {boolean}
+ * @private
+ */
+exports.impliesNoTimeouts = flag => debugFlags.has(flag);
+
+/**
+ * All non-strictly-boolean arguments to node--those with values--must specify those values using `=`, e.g., `--inspect=0.0.0.0`.
+ * Unparse these arguments using `yargs-unparser` (which would result in `--inspect 0.0.0.0`), then supply `=` where we have values.
+ * There's probably an easier or more robust way to do this; fixes welcome
+ * @param {Object} opts - Arguments object
+ * @returns {string[]} Unparsed arguments using `=` to specify values
+ * @private
+ */
+exports.unparseNodeFlags = opts => {
+  var args = unparse(opts);
+  return args.length
+    ? args
+        .join(' ')
+        .split(/\b/)
+        .map(arg => (arg === ' ' ? '=' : arg))
+        .join('')
+        .split(' ')
+    : [];
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/one-and-dones.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/one-and-dones.js
new file mode 100644
index 00000000000..c981b4bbb14
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/one-and-dones.js
@@ -0,0 +1,70 @@
+'use strict';
+
+/**
+ * Contains "command" code for "one-and-dones"--options passed
+ * to Mocha which cause it to just dump some info and exit.
+ * See {@link module:lib/cli/one-and-dones.ONE_AND_DONE_ARGS ONE_AND_DONE_ARGS} for more info.
+ * @module
+ * @private
+ */
+
+const align = require('wide-align');
+const Mocha = require('../mocha');
+
+/**
+ * Dumps a sorted list of the enumerable, lower-case keys of some object
+ * to `STDOUT`.
+ * @param {Object} obj - Object, ostensibly having some enumerable keys
+ * @ignore
+ * @private
+ */
+const showKeys = obj => {
+  console.log();
+  const keys = Object.keys(obj);
+  const maxKeyLength = keys.reduce((max, key) => Math.max(max, key.length), 0);
+  keys
+    .filter(
+      key => /^[a-z]/.test(key) && !obj[key].browserOnly && !obj[key].abstract
+    )
+    .sort()
+    .forEach(key => {
+      const description = obj[key].description;
+      console.log(
+        `    ${align.left(key, maxKeyLength + 1)}${
+          description ? `- ${description}` : ''
+        }`
+      );
+    });
+  console.log();
+};
+
+/**
+ * Handlers for one-and-done options
+ * @namespace
+ * @private
+ */
+exports.ONE_AND_DONES = {
+  /**
+   * Dump list of built-in interfaces
+   * @private
+   */
+  interfaces: () => {
+    showKeys(Mocha.interfaces);
+  },
+  /**
+   * Dump list of built-in reporters
+   * @private
+   */
+  reporters: () => {
+    showKeys(Mocha.reporters);
+  }
+};
+
+/**
+ * A Set of all one-and-done options
+ * @type Set<string>
+ * @private
+ */
+exports.ONE_AND_DONE_ARGS = new Set(
+  ['help', 'h', 'version', 'V'].concat(Object.keys(exports.ONE_AND_DONES))
+);
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/options.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/options.js
new file mode 100644
index 00000000000..a88dbfbf173
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/options.js
@@ -0,0 +1,361 @@
+'use strict';
+
+/**
+ * Main entry point for handling filesystem-based configuration,
+ * whether that's `mocha.opts` or a config file or `package.json` or whatever.
+ * @module
+ */
+
+const fs = require('fs');
+const ansi = require('ansi-colors');
+const yargsParser = require('yargs-parser');
+const {types, aliases} = require('./run-option-metadata');
+const {ONE_AND_DONE_ARGS} = require('./one-and-dones');
+const mocharc = require('../mocharc.json');
+const {list} = require('./run-helpers');
+const {loadConfig, findConfig} = require('./config');
+const findUp = require('find-up');
+const {deprecate} = require('../utils');
+const debug = require('debug')('mocha:cli:options');
+const {isNodeFlag} = require('./node-flags');
+
+/**
+ * The `yargs-parser` namespace
+ * @external yargsParser
+ * @see {@link https://npm.im/yargs-parser}
+ */
+
+/**
+ * An object returned by a configured `yargs-parser` representing arguments
+ * @memberof external:yargsParser
+ * @interface Arguments
+ */
+
+/**
+ * Base yargs parser configuration
+ * @private
+ */
+const YARGS_PARSER_CONFIG = {
+  'combine-arrays': true,
+  'short-option-groups': false,
+  'dot-notation': false
+};
+
+/**
+ * This is the config pulled from the `yargs` property of Mocha's
+ * `package.json`, but it also disables camel case expansion as to
+ * avoid outputting non-canonical keynames, as we need to do some
+ * lookups.
+ * @private
+ * @ignore
+ */
+const configuration = Object.assign({}, YARGS_PARSER_CONFIG, {
+  'camel-case-expansion': false
+});
+
+/**
+ * This is a really fancy way to:
+ * - ensure unique values for `array`-type options
+ * - use its array's last element for `boolean`/`number`/`string`- options given multiple times
+ * This is passed as the `coerce` option to `yargs-parser`
+ * @private
+ * @ignore
+ */
+const coerceOpts = Object.assign(
+  types.array.reduce(
+    (acc, arg) =>
+      Object.assign(acc, {[arg]: v => Array.from(new Set(list(v)))}),
+    {}
+  ),
+  types.boolean
+    .concat(types.string, types.number)
+    .reduce(
+      (acc, arg) =>
+        Object.assign(acc, {[arg]: v => (Array.isArray(v) ? v.pop() : v)}),
+      {}
+    )
+);
+
+/**
+ * We do not have a case when multiple arguments are ever allowed after a flag
+ * (e.g., `--foo bar baz quux`), so we fix the number of arguments to 1 across
+ * the board of non-boolean options.
+ * This is passed as the `narg` option to `yargs-parser`
+ * @private
+ * @ignore
+ */
+const nargOpts = types.array
+  .concat(types.string, types.number)
+  .reduce((acc, arg) => Object.assign(acc, {[arg]: 1}), {});
+
+/**
+ * Wrapper around `yargs-parser` which applies our settings
+ * @param {string|string[]} args - Arguments to parse
+ * @param {Object} defaultValues - Default values of mocharc.json
+ * @param  {...Object} configObjects - `configObjects` for yargs-parser
+ * @private
+ * @ignore
+ */
+const parse = (args = [], defaultValues = {}, ...configObjects) => {
+  // save node-specific args for special handling.
+  // 1. when these args have a "=" they should be considered to have values
+  // 2. if they don't, they just boolean flags
+  // 3. to avoid explicitly defining the set of them, we tell yargs-parser they
+  //    are ALL boolean flags.
+  // 4. we can then reapply the values after yargs-parser is done.
+  const nodeArgs = (Array.isArray(args) ? args : args.split(' ')).reduce(
+    (acc, arg) => {
+      const pair = arg.split('=');
+      let flag = pair[0];
+      if (isNodeFlag(flag, false)) {
+        flag = flag.replace(/^--?/, '');
+        return arg.includes('=')
+          ? acc.concat([[flag, pair[1]]])
+          : acc.concat([[flag, true]]);
+      }
+      return acc;
+    },
+    []
+  );
+
+  const result = yargsParser.detailed(args, {
+    configuration,
+    configObjects,
+    default: defaultValues,
+    coerce: coerceOpts,
+    narg: nargOpts,
+    alias: aliases,
+    string: types.string,
+    array: types.array,
+    number: types.number,
+    boolean: types.boolean.concat(nodeArgs.map(pair => pair[0]))
+  });
+  if (result.error) {
+    console.error(ansi.red(`Error: ${result.error.message}`));
+    process.exit(1);
+  }
+
+  // reapply "=" arg values from above
+  nodeArgs.forEach(([key, value]) => {
+    result.argv[key] = value;
+  });
+
+  return result.argv;
+};
+
+/**
+ * - Replaces comments with empty strings
+ * - Replaces escaped spaces (e.g., 'xxx\ yyy') with HTML space
+ * - Splits on whitespace, creating array of substrings
+ * - Filters empty string elements from array
+ * - Replaces any HTML space with space
+ * @summary Parses options read from run-control file.
+ * @private
+ * @param {string} content - Content read from run-control file.
+ * @returns {string[]} cmdline options (and associated arguments)
+ * @ignore
+ */
+const parseMochaOpts = content =>
+  content
+    .replace(/^#.*$/gm, '')
+    .replace(/\\\s/g, '%20')
+    .split(/\s/)
+    .filter(Boolean)
+    .map(value => value.replace(/%20/g, ' '));
+
+/**
+ * Prepends options from run-control file to the command line arguments.
+ *
+ * @deprecated Deprecated in v6.0.0; This function is no longer used internally and will be removed in a future version.
+ * @public
+ * @alias module:lib/cli/options
+ * @see {@link https://mochajs.org/#mochaopts|mocha.opts}
+ */
+module.exports = function getOptions() {
+  deprecate(
+    'getOptions() is DEPRECATED and will be removed from a future version of Mocha.  Use loadOptions() instead'
+  );
+  if (process.argv.length === 3 && ONE_AND_DONE_ARGS.has(process.argv[2])) {
+    return;
+  }
+
+  const optsPath =
+    process.argv.indexOf('--opts') === -1
+      ? mocharc.opts
+      : process.argv[process.argv.indexOf('--opts') + 1];
+
+  try {
+    const options = parseMochaOpts(fs.readFileSync(optsPath, 'utf8'));
+
+    process.argv = process.argv
+      .slice(0, 2)
+      .concat(options.concat(process.argv.slice(2)));
+  } catch (ignore) {
+    // NOTE: should console.error() and throw the error
+  }
+
+  process.env.LOADED_MOCHA_OPTS = true;
+};
+
+/**
+ * Given filepath in `args.opts`, attempt to load and parse a `mocha.opts` file.
+ * @param {Object} [args] - Arguments object
+ * @param {string|boolean} [args.opts] - Filepath to mocha.opts; defaults to whatever's in `mocharc.opts`, or `false` to skip
+ * @returns {external:yargsParser.Arguments|void} If read, object containing parsed arguments
+ * @memberof module:lib/cli/options
+ * @public
+ */
+const loadMochaOpts = (args = {}) => {
+  let result;
+  let filepath = args.opts;
+  // /dev/null is backwards compat
+  if (filepath === false || filepath === '/dev/null') {
+    return result;
+  }
+  filepath = filepath || mocharc.opts;
+  result = {};
+  let mochaOpts;
+  try {
+    mochaOpts = fs.readFileSync(filepath, 'utf8');
+    debug(`read ${filepath}`);
+  } catch (err) {
+    if (args.opts) {
+      throw new Error(`Unable to read ${filepath}: ${err}`);
+    }
+    // ignore otherwise.  we tried
+    debug(`No mocha.opts found at ${filepath}`);
+  }
+
+  // real args should override `mocha.opts` which should override defaults.
+  // if there's an exception to catch here, I'm not sure what it is.
+  // by attaching the `no-opts` arg, we avoid re-parsing of `mocha.opts`.
+  if (mochaOpts) {
+    result = parse(parseMochaOpts(mochaOpts));
+    debug(`${filepath} parsed succesfully`);
+  }
+  return result;
+};
+
+module.exports.loadMochaOpts = loadMochaOpts;
+
+/**
+ * Given path to config file in `args.config`, attempt to load & parse config file.
+ * @param {Object} [args] - Arguments object
+ * @param {string|boolean} [args.config] - Path to config file or `false` to skip
+ * @public
+ * @memberof module:lib/cli/options
+ * @returns {external:yargsParser.Arguments|void} Parsed config, or nothing if `args.config` is `false`
+ */
+const loadRc = (args = {}) => {
+  if (args.config !== false) {
+    const config = args.config || findConfig();
+    return config ? loadConfig(config) : {};
+  }
+};
+
+module.exports.loadRc = loadRc;
+
+/**
+ * Given path to `package.json` in `args.package`, attempt to load config from `mocha` prop.
+ * @param {Object} [args] - Arguments object
+ * @param {string|boolean} [args.config] - Path to `package.json` or `false` to skip
+ * @public
+ * @memberof module:lib/cli/options
+ * @returns {external:yargsParser.Arguments|void} Parsed config, or nothing if `args.package` is `false`
+ */
+const loadPkgRc = (args = {}) => {
+  let result;
+  if (args.package === false) {
+    return result;
+  }
+  result = {};
+  const filepath = args.package || findUp.sync(mocharc.package);
+  if (filepath) {
+    try {
+      const pkg = JSON.parse(fs.readFileSync(filepath, 'utf8'));
+      if (pkg.mocha) {
+        debug(`'mocha' prop of package.json parsed:`, pkg.mocha);
+        result = pkg.mocha;
+      } else {
+        debug(`no config found in ${filepath}`);
+      }
+    } catch (err) {
+      if (args.package) {
+        throw new Error(`Unable to read/parse ${filepath}: ${err}`);
+      }
+      debug(`failed to read default package.json at ${filepath}; ignoring`);
+    }
+  }
+  return result;
+};
+
+module.exports.loadPkgRc = loadPkgRc;
+
+/**
+ * Priority list:
+ *
+ * 1. Command-line args
+ * 2. RC file (`.mocharc.js`, `.mocharc.ya?ml`, `mocharc.json`)
+ * 3. `mocha` prop of `package.json`
+ * 4. `mocha.opts`
+ * 5. default configuration (`lib/mocharc.json`)
+ *
+ * If a {@link module:lib/cli/one-and-dones.ONE_AND_DONE_ARGS "one-and-done" option} is present in the `argv` array, no external config files will be read.
+ * @summary Parses options read from `mocha.opts`, `.mocharc.*` and `package.json`.
+ * @param {string|string[]} [argv] - Arguments to parse
+ * @public
+ * @memberof module:lib/cli/options
+ * @returns {external:yargsParser.Arguments} Parsed args from everything
+ */
+const loadOptions = (argv = []) => {
+  let args = parse(argv);
+  // short-circuit: look for a flag that would abort loading of mocha.opts
+  if (
+    Array.from(ONE_AND_DONE_ARGS).reduce(
+      (acc, arg) => acc || arg in args,
+      false
+    )
+  ) {
+    return args;
+  }
+
+  const rcConfig = loadRc(args);
+  const pkgConfig = loadPkgRc(args);
+  const optsConfig = loadMochaOpts(args);
+
+  if (rcConfig) {
+    args.config = false;
+    args._ = args._.concat(rcConfig._ || []);
+  }
+  if (pkgConfig) {
+    args.package = false;
+    args._ = args._.concat(pkgConfig._ || []);
+  }
+  if (optsConfig) {
+    args.opts = false;
+    args._ = args._.concat(optsConfig._ || []);
+  }
+
+  args = parse(
+    args._,
+    mocharc,
+    args,
+    rcConfig || {},
+    pkgConfig || {},
+    optsConfig || {}
+  );
+
+  // recombine positional arguments and "spec"
+  if (args.spec) {
+    args._ = args._.concat(args.spec);
+    delete args.spec;
+  }
+
+  // make unique
+  args._ = Array.from(new Set(args._));
+
+  return args;
+};
+
+module.exports.loadOptions = loadOptions;
+module.exports.YARGS_PARSER_CONFIG = YARGS_PARSER_CONFIG;
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/run-helpers.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/run-helpers.js
new file mode 100644
index 00000000000..7b3c7aa4fe3
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/run-helpers.js
@@ -0,0 +1,179 @@
+'use strict';
+
+/**
+ * Helper scripts for the `run` command
+ * @see module:lib/cli/run
+ * @module
+ * @private
+ */
+
+const fs = require('fs');
+const path = require('path');
+const debug = require('debug')('mocha:cli:run:helpers');
+const watchRun = require('./watch-run');
+const collectFiles = require('./collect-files');
+
+const cwd = (exports.cwd = process.cwd());
+
+exports.watchRun = watchRun;
+
+/**
+ * Exits Mocha when tests + code under test has finished execution (default)
+ * @param {number} code - Exit code; typically # of failures
+ * @ignore
+ * @private
+ */
+const exitMochaLater = code => {
+  process.on('exit', () => {
+    process.exitCode = Math.min(code, 255);
+  });
+};
+
+/**
+ * Exits Mocha when Mocha itself has finished execution, regardless of
+ * what the tests or code under test is doing.
+ * @param {number} code - Exit code; typically # of failures
+ * @ignore
+ * @private
+ */
+const exitMocha = code => {
+  const clampedCode = Math.min(code, 255);
+  let draining = 0;
+
+  // Eagerly set the process's exit code in case stream.write doesn't
+  // execute its callback before the process terminates.
+  process.exitCode = clampedCode;
+
+  // flush output for Node.js Windows pipe bug
+  // https://github.com/joyent/node/issues/6247 is just one bug example
+  // https://github.com/visionmedia/mocha/issues/333 has a good discussion
+  const done = () => {
+    if (!draining--) {
+      process.exit(clampedCode);
+    }
+  };
+
+  const streams = [process.stdout, process.stderr];
+
+  streams.forEach(stream => {
+    // submit empty write request and wait for completion
+    draining += 1;
+    stream.write('', done);
+  });
+
+  done();
+};
+
+/**
+ * Coerce a comma-delimited string (or array thereof) into a flattened array of
+ * strings
+ * @param {string|string[]} str - Value to coerce
+ * @returns {string[]} Array of strings
+ * @private
+ */
+exports.list = str =>
+  Array.isArray(str) ? exports.list(str.join(',')) : str.split(/ *, */);
+
+/**
+ * `require()` the modules as required by `--require <require>`
+ * @param {string[]} requires - Modules to require
+ * @private
+ */
+exports.handleRequires = (requires = []) => {
+  requires.forEach(mod => {
+    let modpath = mod;
+    if (fs.existsSync(mod, {cwd}) || fs.existsSync(`${mod}.js`, {cwd})) {
+      modpath = path.resolve(mod);
+      debug(`resolved ${mod} to ${modpath}`);
+    }
+    require(modpath);
+    debug(`loaded require "${mod}"`);
+  });
+};
+
+/**
+ * Collect test files and run mocha instance.
+ * @param {Mocha} mocha - Mocha instance
+ * @param {Options} [opts] - Command line options
+ * @param {boolean} [opts.exit] - Whether or not to force-exit after tests are complete
+ * @param {Object} fileCollectParams - Parameters that control test
+ *   file collection. See `lib/cli/collect-files.js`.
+ * @returns {Runner}
+ * @private
+ */
+exports.singleRun = (mocha, {exit}, fileCollectParams) => {
+  const files = collectFiles(fileCollectParams);
+  debug('running tests with files', files);
+  mocha.files = files;
+  return mocha.run(exit ? exitMocha : exitMochaLater);
+};
+
+/**
+ * Actually run tests
+ * @param {Mocha} mocha - Mocha instance
+ * @param {Object} opts - Command line options
+ * @private
+ */
+exports.runMocha = (mocha, options) => {
+  const {
+    watch = false,
+    extension = [],
+    ui = 'bdd',
+    exit = false,
+    ignore = [],
+    file = [],
+    recursive = false,
+    sort = false,
+    spec = []
+  } = options;
+
+  const fileCollectParams = {
+    ignore,
+    extension,
+    file,
+    recursive,
+    sort,
+    spec
+  };
+
+  if (watch) {
+    watchRun(mocha, {ui}, fileCollectParams);
+  } else {
+    exports.singleRun(mocha, {exit}, fileCollectParams);
+  }
+};
+
+/**
+ * Used for `--reporter` and `--ui`.  Ensures there's only one, and asserts
+ * that it actually exists.
+ * @todo XXX This must get run after requires are processed, as it'll prevent
+ * interfaces from loading.
+ * @param {Object} opts - Options object
+ * @param {string} key - Resolvable module name or path
+ * @param {Object} [map] - An object perhaps having key `key`
+ * @private
+ */
+exports.validatePlugin = (opts, key, map = {}) => {
+  if (Array.isArray(opts[key])) {
+    throw new TypeError(`"--${key} <${key}>" can only be specified once`);
+  }
+
+  const unknownError = () => new Error(`Unknown "${key}": ${opts[key]}`);
+
+  if (!map[opts[key]]) {
+    try {
+      opts[key] = require(opts[key]);
+    } catch (err) {
+      if (err.code === 'MODULE_NOT_FOUND') {
+        // Try to load reporters from a path (absolute or relative)
+        try {
+          opts[key] = require(path.resolve(process.cwd(), opts[key]));
+        } catch (err) {
+          throw unknownError();
+        }
+      } else {
+        throw unknownError();
+      }
+    }
+  }
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/run-option-metadata.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/run-option-metadata.js
new file mode 100644
index 00000000000..fbc4ea90723
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/run-option-metadata.js
@@ -0,0 +1,87 @@
+'use strict';
+
+/**
+ * Metadata about various options of the `run` command
+ * @see module:lib/cli/run
+ * @module
+ * @private
+ */
+
+/**
+ * Dictionary of yargs option types to list of options having said type
+ * @type {{string:string[]}}
+ * @private
+ */
+exports.types = {
+  array: [
+    'extension',
+    'file',
+    'global',
+    'ignore',
+    'require',
+    'reporter-option',
+    'spec'
+  ],
+  boolean: [
+    'allow-uncaught',
+    'async-only',
+    'bail',
+    'check-leaks',
+    'color',
+    'delay',
+    'diff',
+    'exit',
+    'forbid-only',
+    'forbid-pending',
+    'full-trace',
+    'growl',
+    'inline-diffs',
+    'interfaces',
+    'invert',
+    'no-colors',
+    'recursive',
+    'reporters',
+    'sort',
+    'watch'
+  ],
+  number: ['retries'],
+  string: [
+    'config',
+    'fgrep',
+    'grep',
+    'opts',
+    'package',
+    'reporter',
+    'ui',
+    'slow',
+    'timeout'
+  ]
+};
+
+/**
+ * Option aliases keyed by canonical option name.
+ * Arrays used to reduce
+ * @type {{string:string[]}}
+ * @private
+ */
+exports.aliases = {
+  'async-only': ['A'],
+  bail: ['b'],
+  color: ['c', 'colors'],
+  extension: ['watch-extensions'],
+  fgrep: ['f'],
+  global: ['globals'],
+  grep: ['g'],
+  growl: ['G'],
+  ignore: ['exclude'],
+  invert: ['i'],
+  'no-colors': ['C'],
+  reporter: ['R'],
+  'reporter-option': ['reporter-options', 'O'],
+  require: ['r'],
+  slow: ['s'],
+  sort: ['S'],
+  timeout: ['t', 'timeouts'],
+  ui: ['u'],
+  watch: ['w']
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/run.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/run.js
new file mode 100644
index 00000000000..bb7c021998e
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/run.js
@@ -0,0 +1,293 @@
+'use strict';
+
+/**
+ * Definition for Mocha's default ("run tests") command
+ *
+ * @module
+ * @private
+ */
+
+const Mocha = require('../mocha');
+const {
+  createUnsupportedError,
+  createInvalidArgumentValueError,
+  createMissingArgumentError
+} = require('../errors');
+
+const {
+  list,
+  handleRequires,
+  validatePlugin,
+  runMocha
+} = require('./run-helpers');
+const {ONE_AND_DONES, ONE_AND_DONE_ARGS} = require('./one-and-dones');
+const debug = require('debug')('mocha:cli:run');
+const defaults = require('../mocharc');
+const {types, aliases} = require('./run-option-metadata');
+
+/**
+ * Logical option groups
+ * @constant
+ */
+const GROUPS = {
+  FILES: 'File Handling',
+  FILTERS: 'Test Filters',
+  NODEJS: 'Node.js & V8',
+  OUTPUT: 'Reporting & Output',
+  RULES: 'Rules & Behavior',
+  CONFIG: 'Configuration'
+};
+
+exports.command = ['$0 [spec..]', 'debug [spec..]'];
+
+exports.describe = 'Run tests with Mocha';
+
+exports.builder = yargs =>
+  yargs
+    .options({
+      'allow-uncaught': {
+        description: 'Allow uncaught errors to propagate',
+        group: GROUPS.RULES
+      },
+      'async-only': {
+        description:
+          'Require all tests to use a callback (async) or return a Promise',
+        group: GROUPS.RULES
+      },
+      bail: {
+        description: 'Abort ("bail") after first test failure',
+        group: GROUPS.RULES
+      },
+      'check-leaks': {
+        description: 'Check for global variable leaks',
+        group: GROUPS.RULES
+      },
+      color: {
+        description: 'Force-enable color output',
+        group: GROUPS.OUTPUT
+      },
+      config: {
+        config: true,
+        defaultDescription: '(nearest rc file)',
+        description: 'Path to config file',
+        group: GROUPS.CONFIG
+      },
+      delay: {
+        description: 'Delay initial execution of root suite',
+        group: GROUPS.RULES
+      },
+      diff: {
+        default: true,
+        description: 'Show diff on failure',
+        group: GROUPS.OUTPUT
+      },
+      exit: {
+        description: 'Force Mocha to quit after tests complete',
+        group: GROUPS.RULES
+      },
+      extension: {
+        default: defaults.extension,
+        defaultDescription: 'js',
+        description: 'File extension(s) to load and/or watch',
+        group: GROUPS.FILES,
+        requiresArg: true,
+        coerce: list
+      },
+      fgrep: {
+        conflicts: 'grep',
+        description: 'Only run tests containing this string',
+        group: GROUPS.FILTERS,
+        requiresArg: true
+      },
+      file: {
+        defaultDescription: '(none)',
+        description:
+          'Specify file(s) to be loaded prior to root suite execution',
+        group: GROUPS.FILES,
+        normalize: true,
+        requiresArg: true
+      },
+      'forbid-only': {
+        description: 'Fail if exclusive test(s) encountered',
+        group: GROUPS.RULES
+      },
+      'forbid-pending': {
+        description: 'Fail if pending test(s) encountered',
+        group: GROUPS.RULES
+      },
+      'full-trace': {
+        description: 'Display full stack traces',
+        group: GROUPS.OUTPUT
+      },
+      global: {
+        coerce: list,
+        description: 'List of allowed global variables',
+        group: GROUPS.RULES,
+        requiresArg: true
+      },
+      grep: {
+        coerce: value => (!value ? null : value),
+        conflicts: 'fgrep',
+        description: 'Only run tests matching this string or regexp',
+        group: GROUPS.FILTERS,
+        requiresArg: true
+      },
+      growl: {
+        description: 'Enable Growl notifications',
+        group: GROUPS.OUTPUT
+      },
+      ignore: {
+        defaultDescription: '(none)',
+        description: 'Ignore file(s) or glob pattern(s)',
+        group: GROUPS.FILES,
+        requiresArg: true
+      },
+      'inline-diffs': {
+        description:
+          'Display actual/expected differences inline within each string',
+        group: GROUPS.OUTPUT
+      },
+      interfaces: {
+        conflicts: Array.from(ONE_AND_DONE_ARGS),
+        description: 'List built-in user interfaces & exit'
+      },
+      invert: {
+        description: 'Inverts --grep and --fgrep matches',
+        group: GROUPS.FILTERS
+      },
+      'no-colors': {
+        description: 'Force-disable color output',
+        group: GROUPS.OUTPUT,
+        hidden: true
+      },
+      opts: {
+        default: defaults.opts,
+        description: 'Path to `mocha.opts`',
+        group: GROUPS.CONFIG,
+        normalize: true,
+        requiresArg: true
+      },
+      package: {
+        description: 'Path to package.json for config',
+        group: GROUPS.CONFIG,
+        normalize: true,
+        requiresArg: true
+      },
+      recursive: {
+        description: 'Look for tests in subdirectories',
+        group: GROUPS.FILES
+      },
+      reporter: {
+        default: defaults.reporter,
+        description: 'Specify reporter to use',
+        group: GROUPS.OUTPUT,
+        requiresArg: true
+      },
+      reporters: {
+        conflicts: Array.from(ONE_AND_DONE_ARGS),
+        description: 'List built-in reporters & exit'
+      },
+      'reporter-option': {
+        coerce: opts =>
+          list(opts).reduce((acc, opt) => {
+            const pair = opt.split('=');
+
+            if (pair.length > 2 || !pair.length) {
+              throw createInvalidArgumentValueError(
+                `invalid reporter option '${opt}'`,
+                '--reporter-option',
+                opt,
+                'expected "key=value" format'
+              );
+            }
+
+            acc[pair[0]] = pair.length === 2 ? pair[1] : true;
+            return acc;
+          }, {}),
+        description: 'Reporter-specific options (<k=v,[k1=v1,..]>)',
+        group: GROUPS.OUTPUT,
+        requiresArg: true
+      },
+      require: {
+        defaultDescription: '(none)',
+        description: 'Require module',
+        group: GROUPS.FILES,
+        requiresArg: true
+      },
+      retries: {
+        description: 'Retry failed tests this many times',
+        group: GROUPS.RULES
+      },
+      slow: {
+        default: defaults.slow,
+        description: 'Specify "slow" test threshold (in milliseconds)',
+        group: GROUPS.RULES
+      },
+      sort: {
+        description: 'Sort test files',
+        group: GROUPS.FILES
+      },
+      timeout: {
+        default: defaults.timeout,
+        description: 'Specify test timeout threshold (in milliseconds)',
+        group: GROUPS.RULES
+      },
+      ui: {
+        default: defaults.ui,
+        description: 'Specify user interface',
+        group: GROUPS.RULES,
+        requiresArg: true
+      },
+      watch: {
+        description: 'Watch files in the current working directory for changes',
+        group: GROUPS.FILES
+      }
+    })
+    .positional('spec', {
+      default: ['test'],
+      description: 'One or more files, directories, or globs to test',
+      type: 'array'
+    })
+    .check(argv => {
+      // "one-and-dones"; let yargs handle help and version
+      Object.keys(ONE_AND_DONES).forEach(opt => {
+        if (argv[opt]) {
+          ONE_AND_DONES[opt].call(null, yargs);
+          process.exit();
+        }
+      });
+
+      // yargs.implies() isn't flexible enough to handle this
+      if (argv.invert && !('fgrep' in argv || 'grep' in argv)) {
+        throw createMissingArgumentError(
+          '"--invert" requires one of "--fgrep <str>" or "--grep <regexp>"',
+          '--fgrep|--grep',
+          'string|regexp'
+        );
+      }
+
+      if (argv.compilers) {
+        throw createUnsupportedError(
+          `--compilers is DEPRECATED and no longer supported.
+          See https://git.io/vdcSr for migration information.`
+        );
+      }
+
+      // load requires first, because it can impact "plugin" validation
+      handleRequires(argv.require);
+      validatePlugin(argv, 'reporter', Mocha.reporters);
+      validatePlugin(argv, 'ui', Mocha.interfaces);
+
+      return true;
+    })
+    .array(types.array)
+    .boolean(types.boolean)
+    .string(types.string)
+    .number(types.number)
+    .alias(aliases);
+
+exports.handler = argv => {
+  debug('post-yargs config', argv);
+  const mocha = new Mocha(argv);
+  runMocha(mocha, argv);
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/watch-run.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/watch-run.js
new file mode 100644
index 00000000000..e7ef34c6329
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/cli/watch-run.js
@@ -0,0 +1,106 @@
+'use strict';
+
+const utils = require('../utils');
+const Context = require('../context');
+const Mocha = require('../mocha');
+const collectFiles = require('./collect-files');
+
+/**
+ * Exports the `watchRun` function that runs mocha in "watch" mode.
+ * @see module:lib/cli/run-helpers
+ * @module
+ * @private
+ */
+
+/**
+ * Run Mocha in "watch" mode
+ * @param {Mocha} mocha - Mocha instance
+ * @param {Object} opts - Options
+ * @param {string} opts.ui - User interface
+ * @param {Object} fileCollectParams - Parameters that control test
+ *   file collection. See `lib/cli/collect-files.js`.
+ * @param {string[]} fileCollectParams.extension - List of extensions to watch
+ * @private
+ */
+module.exports = (mocha, {ui}, fileCollectParams) => {
+  let runner;
+  const files = collectFiles(fileCollectParams);
+
+  console.log();
+  hideCursor();
+  process.on('SIGINT', () => {
+    showCursor();
+    console.log('\n');
+    // By UNIX/Posix convention this indicates that the process was
+    // killed by SIGINT which has portable number 2.
+    process.exit(128 + 2);
+  });
+
+  const watchFiles = utils.files(process.cwd(), fileCollectParams.extension);
+  let runAgain = false;
+
+  const loadAndRun = () => {
+    try {
+      mocha.files = files;
+      runAgain = false;
+      runner = mocha.run(() => {
+        runner = null;
+        if (runAgain) {
+          rerun();
+        }
+      });
+    } catch (e) {
+      console.log(e.stack);
+    }
+  };
+
+  const purge = () => {
+    watchFiles.forEach(Mocha.unloadFile);
+  };
+
+  loadAndRun();
+
+  const rerun = () => {
+    purge();
+    eraseLine();
+    mocha.suite = mocha.suite.clone();
+    mocha.suite.ctx = new Context();
+    mocha.ui(ui);
+    loadAndRun();
+  };
+
+  utils.watch(watchFiles, () => {
+    runAgain = true;
+    if (runner) {
+      runner.abort();
+    } else {
+      rerun();
+    }
+  });
+};
+
+/**
+ * Hide the cursor.
+ * @ignore
+ * @private
+ */
+const hideCursor = () => {
+  process.stdout.write('\u001b[?25l');
+};
+
+/**
+ * Show the cursor.
+ * @ignore
+ * @private
+ */
+const showCursor = () => {
+  process.stdout.write('\u001b[?25h');
+};
+
+/**
+ * Erases the line on stdout
+ * @private
+ */
+const eraseLine = () => {
+  process.stdout.write('\u001b[2K');
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/context.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/context.js
new file mode 100644
index 00000000000..4c6b0c23e5f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/context.js
@@ -0,0 +1,101 @@
+'use strict';
+/**
+ * @module Context
+ */
+/**
+ * Expose `Context`.
+ */
+
+module.exports = Context;
+
+/**
+ * Initialize a new `Context`.
+ *
+ * @private
+ */
+function Context() {}
+
+/**
+ * Set or get the context `Runnable` to `runnable`.
+ *
+ * @private
+ * @param {Runnable} runnable
+ * @return {Context} context
+ */
+Context.prototype.runnable = function(runnable) {
+  if (!arguments.length) {
+    return this._runnable;
+  }
+  this.test = this._runnable = runnable;
+  return this;
+};
+
+/**
+ * Set or get test timeout `ms`.
+ *
+ * @private
+ * @param {number} ms
+ * @return {Context} self
+ */
+Context.prototype.timeout = function(ms) {
+  if (!arguments.length) {
+    return this.runnable().timeout();
+  }
+  this.runnable().timeout(ms);
+  return this;
+};
+
+/**
+ * Set test timeout `enabled`.
+ *
+ * @private
+ * @param {boolean} enabled
+ * @return {Context} self
+ */
+Context.prototype.enableTimeouts = function(enabled) {
+  if (!arguments.length) {
+    return this.runnable().enableTimeouts();
+  }
+  this.runnable().enableTimeouts(enabled);
+  return this;
+};
+
+/**
+ * Set or get test slowness threshold `ms`.
+ *
+ * @private
+ * @param {number} ms
+ * @return {Context} self
+ */
+Context.prototype.slow = function(ms) {
+  if (!arguments.length) {
+    return this.runnable().slow();
+  }
+  this.runnable().slow(ms);
+  return this;
+};
+
+/**
+ * Mark a test as skipped.
+ *
+ * @private
+ * @throws Pending
+ */
+Context.prototype.skip = function() {
+  this.runnable().skip();
+};
+
+/**
+ * Set or get a number of allowed retries on failed tests
+ *
+ * @private
+ * @param {number} n
+ * @return {Context} self
+ */
+Context.prototype.retries = function(n) {
+  if (!arguments.length) {
+    return this.runnable().retries();
+  }
+  this.runnable().retries(n);
+  return this;
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/errors.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/errors.js
new file mode 100644
index 00000000000..fafee70eee8
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/errors.js
@@ -0,0 +1,141 @@
+'use strict';
+/**
+ * @module Errors
+ */
+/**
+ * Factory functions to create throwable error objects
+ */
+
+/**
+ * Creates an error object to be thrown when no files to be tested could be found using specified pattern.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} pattern - User-specified argument value.
+ * @returns {Error} instance detailing the error condition
+ */
+function createNoFilesMatchPatternError(message, pattern) {
+  var err = new Error(message);
+  err.code = 'ERR_MOCHA_NO_FILES_MATCH_PATTERN';
+  err.pattern = pattern;
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when the reporter specified in the options was not found.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} reporter - User-specified reporter value.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidReporterError(message, reporter) {
+  var err = new TypeError(message);
+  err.code = 'ERR_MOCHA_INVALID_REPORTER';
+  err.reporter = reporter;
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when the interface specified in the options was not found.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} ui - User-specified interface value.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidInterfaceError(message, ui) {
+  var err = new Error(message);
+  err.code = 'ERR_MOCHA_INVALID_INTERFACE';
+  err.interface = ui;
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when a behavior, option, or parameter is unsupported.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @returns {Error} instance detailing the error condition
+ */
+function createUnsupportedError(message) {
+  var err = new Error(message);
+  err.code = 'ERR_MOCHA_UNSUPPORTED';
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when an argument is missing.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} argument - Argument name.
+ * @param {string} expected - Expected argument datatype.
+ * @returns {Error} instance detailing the error condition
+ */
+function createMissingArgumentError(message, argument, expected) {
+  return createInvalidArgumentTypeError(message, argument, expected);
+}
+
+/**
+ * Creates an error object to be thrown when an argument did not use the supported type
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} argument - Argument name.
+ * @param {string} expected - Expected argument datatype.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidArgumentTypeError(message, argument, expected) {
+  var err = new TypeError(message);
+  err.code = 'ERR_MOCHA_INVALID_ARG_TYPE';
+  err.argument = argument;
+  err.expected = expected;
+  err.actual = typeof argument;
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when an argument did not use the supported value
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} argument - Argument name.
+ * @param {string} value - Argument value.
+ * @param {string} [reason] - Why value is invalid.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidArgumentValueError(message, argument, value, reason) {
+  var err = new TypeError(message);
+  err.code = 'ERR_MOCHA_INVALID_ARG_VALUE';
+  err.argument = argument;
+  err.value = value;
+  err.reason = typeof reason !== 'undefined' ? reason : 'is invalid';
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when an exception was caught, but the `Error` is falsy or undefined.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidExceptionError(message, value) {
+  var err = new Error(message);
+  err.code = 'ERR_MOCHA_INVALID_EXCEPTION';
+  err.valueType = typeof value;
+  err.value = value;
+  return err;
+}
+
+module.exports = {
+  createInvalidArgumentTypeError: createInvalidArgumentTypeError,
+  createInvalidArgumentValueError: createInvalidArgumentValueError,
+  createInvalidExceptionError: createInvalidExceptionError,
+  createInvalidInterfaceError: createInvalidInterfaceError,
+  createInvalidReporterError: createInvalidReporterError,
+  createMissingArgumentError: createMissingArgumentError,
+  createNoFilesMatchPatternError: createNoFilesMatchPatternError,
+  createUnsupportedError: createUnsupportedError
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/growl.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/growl.js
new file mode 100644
index 00000000000..53164563bb5
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/growl.js
@@ -0,0 +1,136 @@
+'use strict';
+
+/**
+ * Desktop Notifications module.
+ * @module Growl
+ */
+
+const os = require('os');
+const path = require('path');
+const {sync: which} = require('which');
+const {EVENT_RUN_END} = require('./runner').constants;
+
+/**
+ * @summary
+ * Checks if Growl notification support seems likely.
+ *
+ * @description
+ * Glosses over the distinction between an unsupported platform
+ * and one that lacks prerequisite software installations.
+ *
+ * @public
+ * @see {@link https://github.com/tj/node-growl/blob/master/README.md|Prerequisite Installs}
+ * @see {@link Mocha#growl}
+ * @see {@link Mocha#isGrowlCapable}
+ * @return {boolean} whether Growl notification support can be expected
+ */
+exports.isCapable = () => {
+  if (!process.browser) {
+    return getSupportBinaries().reduce(
+      (acc, binary) => acc || Boolean(which(binary, {nothrow: true})),
+      false
+    );
+  }
+  return false;
+};
+
+/**
+ * Implements desktop notifications as a pseudo-reporter.
+ *
+ * @public
+ * @see {@link Mocha#_growl}
+ * @param {Runner} runner - Runner instance.
+ */
+exports.notify = runner => {
+  runner.once(EVENT_RUN_END, () => {
+    display(runner);
+  });
+};
+
+/**
+ * Displays the notification.
+ *
+ * @private
+ * @param {Runner} runner - Runner instance.
+ */
+const display = runner => {
+  const growl = require('growl');
+  const stats = runner.stats;
+  const symbol = {
+    cross: '\u274C',
+    tick: '\u2705'
+  };
+  let _message;
+  let message;
+  let title;
+
+  if (stats.failures) {
+    _message = `${stats.failures} of ${stats.tests} tests failed`;
+    message = `${symbol.cross} ${_message}`;
+    title = 'Failed';
+  } else {
+    _message = `${stats.passes} tests passed in ${stats.duration}ms`;
+    message = `${symbol.tick} ${_message}`;
+    title = 'Passed';
+  }
+
+  // Send notification
+  const options = {
+    image: logo(),
+    name: 'mocha',
+    title
+  };
+  growl(message, options, onCompletion);
+};
+
+/**
+ * @summary
+ * Callback for result of attempted Growl notification.
+ *
+ * @description
+ * Despite its appearance, this is <strong>not</strong> an Error-first
+ * callback -- all parameters are populated regardless of success.
+ *
+ * @private
+ * @callback Growl~growlCB
+ * @param {*} err - Error object, or <code>null</code> if successful.
+ */
+function onCompletion(err) {
+  if (err) {
+    // As notifications are tangential to our purpose, just log the error.
+    const message =
+      err.code === 'ENOENT' ? 'prerequisite software not found' : err.message;
+    console.error('notification error:', message);
+  }
+}
+
+/**
+ * Returns Mocha logo image path.
+ *
+ * @private
+ * @return {string} Pathname of Mocha logo
+ */
+const logo = () => {
+  return path.join(__dirname, '..', 'assets', 'mocha-logo-96.png');
+};
+
+/**
+ * @summary
+ * Gets platform-specific Growl support binaries.
+ *
+ * @description
+ * Somewhat brittle dependency on `growl` package implementation, but it
+ * rarely changes.
+ *
+ * @private
+ * @see {@link https://github.com/tj/node-growl/blob/master/lib/growl.js#L28-L126|setupCmd}
+ * @return {string[]} names of Growl support binaries
+ */
+const getSupportBinaries = () => {
+  const binaries = {
+    Darwin: ['terminal-notifier', 'growlnotify'],
+    Linux: ['notify-send', 'growl'],
+    Windows_NT: ['growlnotify.exe']
+  };
+  return binaries[os.type()] || [];
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/hook.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/hook.js
new file mode 100644
index 00000000000..71440d23d05
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/hook.js
@@ -0,0 +1,46 @@
+'use strict';
+
+var Runnable = require('./runnable');
+var inherits = require('./utils').inherits;
+
+/**
+ * Expose `Hook`.
+ */
+
+module.exports = Hook;
+
+/**
+ * Initialize a new `Hook` with the given `title` and callback `fn`
+ *
+ * @class
+ * @extends Runnable
+ * @param {String} title
+ * @param {Function} fn
+ */
+function Hook(title, fn) {
+  Runnable.call(this, title, fn);
+  this.type = 'hook';
+}
+
+/**
+ * Inherit from `Runnable.prototype`.
+ */
+inherits(Hook, Runnable);
+
+/**
+ * Get or set the test `err`.
+ *
+ * @memberof Hook
+ * @public
+ * @param {Error} err
+ * @return {Error}
+ */
+Hook.prototype.error = function(err) {
+  if (!arguments.length) {
+    err = this._error;
+    this._error = null;
+    return err;
+  }
+
+  this._error = err;
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/bdd.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/bdd.js
new file mode 100644
index 00000000000..ef8d281e17c
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/bdd.js
@@ -0,0 +1,118 @@
+'use strict';
+
+var Test = require('../test');
+var EVENT_FILE_PRE_REQUIRE = require('../suite').constants
+  .EVENT_FILE_PRE_REQUIRE;
+
+/**
+ * BDD-style interface:
+ *
+ *      describe('Array', function() {
+ *        describe('#indexOf()', function() {
+ *          it('should return -1 when not present', function() {
+ *            // ...
+ *          });
+ *
+ *          it('should return the index when present', function() {
+ *            // ...
+ *          });
+ *        });
+ *      });
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function bddInterface(suite) {
+  var suites = [suite];
+
+  suite.on(EVENT_FILE_PRE_REQUIRE, function(context, file, mocha) {
+    var common = require('./common')(suites, context, mocha);
+
+    context.before = common.before;
+    context.after = common.after;
+    context.beforeEach = common.beforeEach;
+    context.afterEach = common.afterEach;
+    context.run = mocha.options.delay && common.runWithSuite(suite);
+    /**
+     * Describe a "suite" with the given `title`
+     * and callback `fn` containing nested suites
+     * and/or tests.
+     */
+
+    context.describe = context.context = function(title, fn) {
+      return common.suite.create({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Pending describe.
+     */
+
+    context.xdescribe = context.xcontext = context.describe.skip = function(
+      title,
+      fn
+    ) {
+      return common.suite.skip({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Exclusive suite.
+     */
+
+    context.describe.only = function(title, fn) {
+      return common.suite.only({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Describe a specification or test-case
+     * with the given `title` and callback `fn`
+     * acting as a thunk.
+     */
+
+    context.it = context.specify = function(title, fn) {
+      var suite = suites[0];
+      if (suite.isPending()) {
+        fn = null;
+      }
+      var test = new Test(title, fn);
+      test.file = file;
+      suite.addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.it.only = function(title, fn) {
+      return common.test.only(mocha, context.it(title, fn));
+    };
+
+    /**
+     * Pending test case.
+     */
+
+    context.xit = context.xspecify = context.it.skip = function(title) {
+      return context.it(title);
+    };
+
+    /**
+     * Number of attempts to retry.
+     */
+    context.it.retries = function(n) {
+      context.retries(n);
+    };
+  });
+};
+
+module.exports.description = 'BDD or RSpec style [default]';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/common.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/common.js
new file mode 100644
index 00000000000..1802fcc9dc3
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/common.js
@@ -0,0 +1,191 @@
+'use strict';
+
+var Suite = require('../suite');
+var errors = require('../errors');
+var createMissingArgumentError = errors.createMissingArgumentError;
+
+/**
+ * Functions common to more than one interface.
+ *
+ * @param {Suite[]} suites
+ * @param {Context} context
+ * @param {Mocha} mocha
+ * @return {Object} An object containing common functions.
+ */
+module.exports = function(suites, context, mocha) {
+  /**
+   * Check if the suite should be tested.
+   *
+   * @private
+   * @param {Suite} suite - suite to check
+   * @returns {boolean}
+   */
+  function shouldBeTested(suite) {
+    return (
+      !mocha.options.grep ||
+      (mocha.options.grep &&
+        mocha.options.grep.test(suite.fullTitle()) &&
+        !mocha.options.invert)
+    );
+  }
+
+  return {
+    /**
+     * This is only present if flag --delay is passed into Mocha. It triggers
+     * root suite execution.
+     *
+     * @param {Suite} suite The root suite.
+     * @return {Function} A function which runs the root suite
+     */
+    runWithSuite: function runWithSuite(suite) {
+      return function run() {
+        suite.run();
+      };
+    },
+
+    /**
+     * Execute before running tests.
+     *
+     * @param {string} name
+     * @param {Function} fn
+     */
+    before: function(name, fn) {
+      suites[0].beforeAll(name, fn);
+    },
+
+    /**
+     * Execute after running tests.
+     *
+     * @param {string} name
+     * @param {Function} fn
+     */
+    after: function(name, fn) {
+      suites[0].afterAll(name, fn);
+    },
+
+    /**
+     * Execute before each test case.
+     *
+     * @param {string} name
+     * @param {Function} fn
+     */
+    beforeEach: function(name, fn) {
+      suites[0].beforeEach(name, fn);
+    },
+
+    /**
+     * Execute after each test case.
+     *
+     * @param {string} name
+     * @param {Function} fn
+     */
+    afterEach: function(name, fn) {
+      suites[0].afterEach(name, fn);
+    },
+
+    suite: {
+      /**
+       * Create an exclusive Suite; convenience function
+       * See docstring for create() below.
+       *
+       * @param {Object} opts
+       * @returns {Suite}
+       */
+      only: function only(opts) {
+        opts.isOnly = true;
+        return this.create(opts);
+      },
+
+      /**
+       * Create a Suite, but skip it; convenience function
+       * See docstring for create() below.
+       *
+       * @param {Object} opts
+       * @returns {Suite}
+       */
+      skip: function skip(opts) {
+        opts.pending = true;
+        return this.create(opts);
+      },
+
+      /**
+       * Creates a suite.
+       *
+       * @param {Object} opts Options
+       * @param {string} opts.title Title of Suite
+       * @param {Function} [opts.fn] Suite Function (not always applicable)
+       * @param {boolean} [opts.pending] Is Suite pending?
+       * @param {string} [opts.file] Filepath where this Suite resides
+       * @param {boolean} [opts.isOnly] Is Suite exclusive?
+       * @returns {Suite}
+       */
+      create: function create(opts) {
+        var suite = Suite.create(suites[0], opts.title);
+        suite.pending = Boolean(opts.pending);
+        suite.file = opts.file;
+        suites.unshift(suite);
+        if (opts.isOnly) {
+          if (mocha.options.forbidOnly && shouldBeTested(suite)) {
+            throw new Error('`.only` forbidden');
+          }
+
+          suite.parent.appendOnlySuite(suite);
+        }
+        if (suite.pending) {
+          if (mocha.options.forbidPending && shouldBeTested(suite)) {
+            throw new Error('Pending test forbidden');
+          }
+        }
+        if (typeof opts.fn === 'function') {
+          opts.fn.call(suite);
+          suites.shift();
+        } else if (typeof opts.fn === 'undefined' && !suite.pending) {
+          throw createMissingArgumentError(
+            'Suite "' +
+              suite.fullTitle() +
+              '" was defined but no callback was supplied. ' +
+              'Supply a callback or explicitly skip the suite.',
+            'callback',
+            'function'
+          );
+        } else if (!opts.fn && suite.pending) {
+          suites.shift();
+        }
+
+        return suite;
+      }
+    },
+
+    test: {
+      /**
+       * Exclusive test-case.
+       *
+       * @param {Object} mocha
+       * @param {Function} test
+       * @returns {*}
+       */
+      only: function(mocha, test) {
+        test.parent.appendOnlyTest(test);
+        return test;
+      },
+
+      /**
+       * Pending test case.
+       *
+       * @param {string} title
+       */
+      skip: function(title) {
+        context.test(title);
+      },
+
+      /**
+       * Number of retry attempts
+       *
+       * @param {number} n
+       */
+      retries: function(n) {
+        context.retries(n);
+      }
+    }
+  };
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/exports.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/exports.js
new file mode 100644
index 00000000000..5b4c7bd6f48
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/exports.js
@@ -0,0 +1,60 @@
+'use strict';
+var Suite = require('../suite');
+var Test = require('../test');
+
+/**
+ * Exports-style (as Node.js module) interface:
+ *
+ *     exports.Array = {
+ *       '#indexOf()': {
+ *         'should return -1 when the value is not present': function() {
+ *
+ *         },
+ *
+ *         'should return the correct index when the value is present': function() {
+ *
+ *         }
+ *       }
+ *     };
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function(suite) {
+  var suites = [suite];
+
+  suite.on(Suite.constants.EVENT_FILE_REQUIRE, visit);
+
+  function visit(obj, file) {
+    var suite;
+    for (var key in obj) {
+      if (typeof obj[key] === 'function') {
+        var fn = obj[key];
+        switch (key) {
+          case 'before':
+            suites[0].beforeAll(fn);
+            break;
+          case 'after':
+            suites[0].afterAll(fn);
+            break;
+          case 'beforeEach':
+            suites[0].beforeEach(fn);
+            break;
+          case 'afterEach':
+            suites[0].afterEach(fn);
+            break;
+          default:
+            var test = new Test(key, fn);
+            test.file = file;
+            suites[0].addTest(test);
+        }
+      } else {
+        suite = Suite.create(suites[0], key);
+        suites.unshift(suite);
+        visit(obj[key], file);
+        suites.shift();
+      }
+    }
+  }
+};
+
+module.exports.description = 'Node.js module ("exports") style';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/index.js
new file mode 100644
index 00000000000..0bd810abb7c
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/index.js
@@ -0,0 +1,6 @@
+'use strict';
+
+exports.bdd = require('./bdd');
+exports.tdd = require('./tdd');
+exports.qunit = require('./qunit');
+exports.exports = require('./exports');
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/qunit.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/qunit.js
new file mode 100644
index 00000000000..a2dc332030e
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/qunit.js
@@ -0,0 +1,99 @@
+'use strict';
+
+var Test = require('../test');
+var EVENT_FILE_PRE_REQUIRE = require('../suite').constants
+  .EVENT_FILE_PRE_REQUIRE;
+
+/**
+ * QUnit-style interface:
+ *
+ *     suite('Array');
+ *
+ *     test('#length', function() {
+ *       var arr = [1,2,3];
+ *       ok(arr.length == 3);
+ *     });
+ *
+ *     test('#indexOf()', function() {
+ *       var arr = [1,2,3];
+ *       ok(arr.indexOf(1) == 0);
+ *       ok(arr.indexOf(2) == 1);
+ *       ok(arr.indexOf(3) == 2);
+ *     });
+ *
+ *     suite('String');
+ *
+ *     test('#length', function() {
+ *       ok('foo'.length == 3);
+ *     });
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function qUnitInterface(suite) {
+  var suites = [suite];
+
+  suite.on(EVENT_FILE_PRE_REQUIRE, function(context, file, mocha) {
+    var common = require('./common')(suites, context, mocha);
+
+    context.before = common.before;
+    context.after = common.after;
+    context.beforeEach = common.beforeEach;
+    context.afterEach = common.afterEach;
+    context.run = mocha.options.delay && common.runWithSuite(suite);
+    /**
+     * Describe a "suite" with the given `title`.
+     */
+
+    context.suite = function(title) {
+      if (suites.length > 1) {
+        suites.shift();
+      }
+      return common.suite.create({
+        title: title,
+        file: file,
+        fn: false
+      });
+    };
+
+    /**
+     * Exclusive Suite.
+     */
+
+    context.suite.only = function(title) {
+      if (suites.length > 1) {
+        suites.shift();
+      }
+      return common.suite.only({
+        title: title,
+        file: file,
+        fn: false
+      });
+    };
+
+    /**
+     * Describe a specification or test-case
+     * with the given `title` and callback `fn`
+     * acting as a thunk.
+     */
+
+    context.test = function(title, fn) {
+      var test = new Test(title, fn);
+      test.file = file;
+      suites[0].addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.test.only = function(title, fn) {
+      return common.test.only(mocha, context.test(title, fn));
+    };
+
+    context.test.skip = common.test.skip;
+    context.test.retries = common.test.retries;
+  });
+};
+
+module.exports.description = 'QUnit style';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/tdd.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/tdd.js
new file mode 100644
index 00000000000..a44c7fe27d0
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/interfaces/tdd.js
@@ -0,0 +1,107 @@
+'use strict';
+
+var Test = require('../test');
+var EVENT_FILE_PRE_REQUIRE = require('../suite').constants
+  .EVENT_FILE_PRE_REQUIRE;
+
+/**
+ * TDD-style interface:
+ *
+ *      suite('Array', function() {
+ *        suite('#indexOf()', function() {
+ *          suiteSetup(function() {
+ *
+ *          });
+ *
+ *          test('should return -1 when not present', function() {
+ *
+ *          });
+ *
+ *          test('should return the index when present', function() {
+ *
+ *          });
+ *
+ *          suiteTeardown(function() {
+ *
+ *          });
+ *        });
+ *      });
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function(suite) {
+  var suites = [suite];
+
+  suite.on(EVENT_FILE_PRE_REQUIRE, function(context, file, mocha) {
+    var common = require('./common')(suites, context, mocha);
+
+    context.setup = common.beforeEach;
+    context.teardown = common.afterEach;
+    context.suiteSetup = common.before;
+    context.suiteTeardown = common.after;
+    context.run = mocha.options.delay && common.runWithSuite(suite);
+
+    /**
+     * Describe a "suite" with the given `title` and callback `fn` containing
+     * nested suites and/or tests.
+     */
+    context.suite = function(title, fn) {
+      return common.suite.create({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Pending suite.
+     */
+    context.suite.skip = function(title, fn) {
+      return common.suite.skip({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+    context.suite.only = function(title, fn) {
+      return common.suite.only({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Describe a specification or test-case with the given `title` and
+     * callback `fn` acting as a thunk.
+     */
+    context.test = function(title, fn) {
+      var suite = suites[0];
+      if (suite.isPending()) {
+        fn = null;
+      }
+      var test = new Test(title, fn);
+      test.file = file;
+      suite.addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.test.only = function(title, fn) {
+      return common.test.only(mocha, context.test(title, fn));
+    };
+
+    context.test.skip = common.test.skip;
+    context.test.retries = common.test.retries;
+  });
+};
+
+module.exports.description =
+  'traditional "suite"/"test" instead of BDD\'s "describe"/"it"';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/mocha.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/mocha.js
new file mode 100644
index 00000000000..c0a5aa6dd95
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/mocha.js
@@ -0,0 +1,850 @@
+'use strict';
+
+/*!
+ * mocha
+ * Copyright(c) 2011 TJ Holowaychuk <tj@vision-media.ca>
+ * MIT Licensed
+ */
+
+var escapeRe = require('escape-string-regexp');
+var path = require('path');
+var builtinReporters = require('./reporters');
+var growl = require('./growl');
+var utils = require('./utils');
+var mocharc = require('./mocharc.json');
+var errors = require('./errors');
+var Suite = require('./suite');
+var createStatsCollector = require('./stats-collector');
+var createInvalidReporterError = errors.createInvalidReporterError;
+var createInvalidInterfaceError = errors.createInvalidInterfaceError;
+var EVENT_FILE_PRE_REQUIRE = Suite.constants.EVENT_FILE_PRE_REQUIRE;
+var EVENT_FILE_POST_REQUIRE = Suite.constants.EVENT_FILE_POST_REQUIRE;
+var EVENT_FILE_REQUIRE = Suite.constants.EVENT_FILE_REQUIRE;
+var sQuote = utils.sQuote;
+
+exports = module.exports = Mocha;
+
+/**
+ * To require local UIs and reporters when running in node.
+ */
+
+if (!process.browser) {
+  var cwd = process.cwd();
+  module.paths.push(cwd, path.join(cwd, 'node_modules'));
+}
+
+/**
+ * Expose internals.
+ */
+
+/**
+ * @public
+ * @class utils
+ * @memberof Mocha
+ */
+exports.utils = utils;
+exports.interfaces = require('./interfaces');
+/**
+ * @public
+ * @memberof Mocha
+ */
+exports.reporters = builtinReporters;
+exports.Runnable = require('./runnable');
+exports.Context = require('./context');
+/**
+ *
+ * @memberof Mocha
+ */
+exports.Runner = require('./runner');
+exports.Suite = Suite;
+exports.Hook = require('./hook');
+exports.Test = require('./test');
+
+/**
+ * Constructs a new Mocha instance with `options`.
+ *
+ * @public
+ * @class Mocha
+ * @param {Object} [options] - Settings object.
+ * @param {boolean} [options.allowUncaught] - Propagate uncaught errors?
+ * @param {boolean} [options.asyncOnly] - Force `done` callback or promise?
+ * @param {boolean} [options.bail] - Bail after first test failure?
+ * @param {boolean} [options.checkLeaks] - If true, check leaks.
+ * @param {boolean} [options.delay] - Delay root suite execution?
+ * @param {boolean} [options.enableTimeouts] - Enable timeouts?
+ * @param {string} [options.fgrep] - Test filter given string.
+ * @param {boolean} [options.forbidOnly] - Tests marked `only` fail the suite?
+ * @param {boolean} [options.forbidPending] - Pending tests fail the suite?
+ * @param {boolean} [options.fullStackTrace] - Full stacktrace upon failure?
+ * @param {string[]} [options.global] - Variables expected in global scope.
+ * @param {RegExp|string} [options.grep] - Test filter given regular expression.
+ * @param {boolean} [options.growl] - Enable desktop notifications?
+ * @param {boolean} [options.hideDiff] - Suppress diffs from failures?
+ * @param {boolean} [options.ignoreLeaks] - Ignore global leaks?
+ * @param {boolean} [options.invert] - Invert test filter matches?
+ * @param {boolean} [options.noHighlighting] - Disable syntax highlighting?
+ * @param {string} [options.reporter] - Reporter name.
+ * @param {Object} [options.reporterOption] - Reporter settings object.
+ * @param {number} [options.retries] - Number of times to retry failed tests.
+ * @param {number} [options.slow] - Slow threshold value.
+ * @param {number|string} [options.timeout] - Timeout threshold value.
+ * @param {string} [options.ui] - Interface name.
+ * @param {boolean} [options.color] - Color TTY output from reporter?
+ * @param {boolean} [options.useInlineDiffs] - Use inline diffs?
+ */
+function Mocha(options) {
+  options = utils.assign({}, mocharc, options || {});
+  this.files = [];
+  this.options = options;
+  // root suite
+  this.suite = new exports.Suite('', new exports.Context(), true);
+
+  if ('useColors' in options) {
+    utils.deprecate(
+      'useColors is DEPRECATED and will be removed from a future version of Mocha. Instead, use the "color" option'
+    );
+    options.color = 'color' in options ? options.color : options.useColors;
+  }
+
+  // Globals are passed in as options.global, with options.globals for backward compatibility.
+  options.globals = options.global || options.globals || [];
+  delete options.global;
+
+  this.grep(options.grep)
+    .fgrep(options.fgrep)
+    .ui(options.ui)
+    .bail(options.bail)
+    .reporter(options.reporter, options.reporterOptions)
+    .useColors(options.color)
+    .slow(options.slow)
+    .useInlineDiffs(options.inlineDiffs)
+    .globals(options.globals);
+
+  if ('enableTimeouts' in options) {
+    utils.deprecate(
+      'enableTimeouts is DEPRECATED and will be removed from a future version of Mocha. Instead, use "timeout: false" to disable timeouts.'
+    );
+    if (options.enableTimeouts === false) {
+      this.timeout(0);
+    }
+  }
+
+  // this guard exists because Suite#timeout does not consider `undefined` to be valid input
+  if (typeof options.timeout !== 'undefined') {
+    this.timeout(options.timeout === false ? 0 : options.timeout);
+  }
+
+  if ('retries' in options) {
+    this.retries(options.retries);
+  }
+
+  if ('diff' in options) {
+    this.hideDiff(!options.diff);
+  }
+
+  [
+    'allowUncaught',
+    'asyncOnly',
+    'checkLeaks',
+    'delay',
+    'forbidOnly',
+    'forbidPending',
+    'fullTrace',
+    'growl',
+    'invert'
+  ].forEach(function(opt) {
+    if (options[opt]) {
+      this[opt]();
+    }
+  }, this);
+}
+
+/**
+ * Enables or disables bailing on the first failure.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-b---bail|CLI option}
+ * @param {boolean} [bail=true] - Whether to bail on first error.
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.bail = function(bail) {
+  if (!arguments.length) {
+    bail = true;
+  }
+  this.suite.bail(bail);
+  return this;
+};
+
+/**
+ * @summary
+ * Adds `file` to be loaded for execution.
+ *
+ * @description
+ * Useful for generic setup code that must be included within test suite.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#--file-file|CLI option}
+ * @param {string} file - Pathname of file to be loaded.
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.addFile = function(file) {
+  this.files.push(file);
+  return this;
+};
+
+/**
+ * Sets reporter to `reporter`, defaults to "spec".
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-r---reporter-name|CLI option}
+ * @see {@link https://mochajs.org/#reporters|Reporters}
+ * @param {String|Function} reporter - Reporter name or constructor.
+ * @param {Object} [reporterOptions] - Options used to configure the reporter.
+ * @returns {Mocha} this
+ * @chainable
+ * @throws {Error} if requested reporter cannot be loaded
+ * @example
+ *
+ * // Use XUnit reporter and direct its output to file
+ * mocha.reporter('xunit', { output: '/path/to/testspec.xunit.xml' });
+ */
+Mocha.prototype.reporter = function(reporter, reporterOptions) {
+  if (typeof reporter === 'function') {
+    this._reporter = reporter;
+  } else {
+    reporter = reporter || 'spec';
+    var _reporter;
+    // Try to load a built-in reporter.
+    if (builtinReporters[reporter]) {
+      _reporter = builtinReporters[reporter];
+    }
+    // Try to load reporters from process.cwd() and node_modules
+    if (!_reporter) {
+      try {
+        _reporter = require(reporter);
+      } catch (err) {
+        if (
+          err.code !== 'MODULE_NOT_FOUND' ||
+          err.message.indexOf('Cannot find module') !== -1
+        ) {
+          // Try to load reporters from a path (absolute or relative)
+          try {
+            _reporter = require(path.resolve(process.cwd(), reporter));
+          } catch (_err) {
+            _err.code !== 'MODULE_NOT_FOUND' ||
+            _err.message.indexOf('Cannot find module') !== -1
+              ? console.warn(sQuote(reporter) + ' reporter not found')
+              : console.warn(
+                  sQuote(reporter) +
+                    ' reporter blew up with error:\n' +
+                    err.stack
+                );
+          }
+        } else {
+          console.warn(
+            sQuote(reporter) + ' reporter blew up with error:\n' + err.stack
+          );
+        }
+      }
+    }
+    if (!_reporter) {
+      throw createInvalidReporterError(
+        'invalid reporter ' + sQuote(reporter),
+        reporter
+      );
+    }
+    this._reporter = _reporter;
+  }
+  this.options.reporterOptions = reporterOptions;
+  return this;
+};
+
+/**
+ * Sets test UI `name`, defaults to "bdd".
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-u---ui-name|CLI option}
+ * @see {@link https://mochajs.org/#interfaces|Interface DSLs}
+ * @param {string|Function} [ui=bdd] - Interface name or class.
+ * @returns {Mocha} this
+ * @chainable
+ * @throws {Error} if requested interface cannot be loaded
+ */
+Mocha.prototype.ui = function(ui) {
+  var bindInterface;
+  if (typeof ui === 'function') {
+    bindInterface = ui;
+  } else {
+    ui = ui || 'bdd';
+    bindInterface = exports.interfaces[ui];
+    if (!bindInterface) {
+      try {
+        bindInterface = require(ui);
+      } catch (err) {
+        throw createInvalidInterfaceError(
+          'invalid interface ' + sQuote(ui),
+          ui
+        );
+      }
+    }
+  }
+  bindInterface(this.suite);
+
+  this.suite.on(EVENT_FILE_PRE_REQUIRE, function(context) {
+    exports.afterEach = context.afterEach || context.teardown;
+    exports.after = context.after || context.suiteTeardown;
+    exports.beforeEach = context.beforeEach || context.setup;
+    exports.before = context.before || context.suiteSetup;
+    exports.describe = context.describe || context.suite;
+    exports.it = context.it || context.test;
+    exports.xit = context.xit || (context.test && context.test.skip);
+    exports.setup = context.setup || context.beforeEach;
+    exports.suiteSetup = context.suiteSetup || context.before;
+    exports.suiteTeardown = context.suiteTeardown || context.after;
+    exports.suite = context.suite || context.describe;
+    exports.teardown = context.teardown || context.afterEach;
+    exports.test = context.test || context.it;
+    exports.run = context.run;
+  });
+
+  return this;
+};
+
+/**
+ * Loads `files` prior to execution.
+ *
+ * @description
+ * The implementation relies on Node's `require` to execute
+ * the test interface functions and will be subject to its cache.
+ *
+ * @private
+ * @see {@link Mocha#addFile}
+ * @see {@link Mocha#run}
+ * @see {@link Mocha#unloadFiles}
+ * @param {Function} [fn] - Callback invoked upon completion.
+ */
+Mocha.prototype.loadFiles = function(fn) {
+  var self = this;
+  var suite = this.suite;
+  this.files.forEach(function(file) {
+    file = path.resolve(file);
+    suite.emit(EVENT_FILE_PRE_REQUIRE, global, file, self);
+    suite.emit(EVENT_FILE_REQUIRE, require(file), file, self);
+    suite.emit(EVENT_FILE_POST_REQUIRE, global, file, self);
+  });
+  fn && fn();
+};
+
+/**
+ * Removes a previously loaded file from Node's `require` cache.
+ *
+ * @private
+ * @static
+ * @see {@link Mocha#unloadFiles}
+ * @param {string} file - Pathname of file to be unloaded.
+ */
+Mocha.unloadFile = function(file) {
+  delete require.cache[require.resolve(file)];
+};
+
+/**
+ * Unloads `files` from Node's `require` cache.
+ *
+ * @description
+ * This allows files to be "freshly" reloaded, providing the ability
+ * to reuse a Mocha instance programmatically.
+ *
+ * <strong>Intended for consumers &mdash; not used internally</strong>
+ *
+ * @public
+ * @see {@link Mocha.unloadFile}
+ * @see {@link Mocha#loadFiles}
+ * @see {@link Mocha#run}
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.unloadFiles = function() {
+  this.files.forEach(Mocha.unloadFile);
+  return this;
+};
+
+/**
+ * Sets `grep` filter after escaping RegExp special characters.
+ *
+ * @public
+ * @see {@link Mocha#grep}
+ * @param {string} str - Value to be converted to a regexp.
+ * @returns {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Select tests whose full title begins with `"foo"` followed by a period
+ * mocha.fgrep('foo.');
+ */
+Mocha.prototype.fgrep = function(str) {
+  if (!str) {
+    return this;
+  }
+  return this.grep(new RegExp(escapeRe(str)));
+};
+
+/**
+ * @summary
+ * Sets `grep` filter used to select specific tests for execution.
+ *
+ * @description
+ * If `re` is a regexp-like string, it will be converted to regexp.
+ * The regexp is tested against the full title of each test (i.e., the
+ * name of the test preceded by titles of each its ancestral suites).
+ * As such, using an <em>exact-match</em> fixed pattern against the
+ * test name itself will not yield any matches.
+ * <br>
+ * <strong>Previous filter value will be overwritten on each call!</strong>
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-g---grep-pattern|CLI option}
+ * @see {@link Mocha#fgrep}
+ * @see {@link Mocha#invert}
+ * @param {RegExp|String} re - Regular expression used to select tests.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Select tests whose full title contains `"match"`, ignoring case
+ * mocha.grep(/match/i);
+ * @example
+ *
+ * // Same as above but with regexp-like string argument
+ * mocha.grep('/match/i');
+ * @example
+ *
+ * // ## Anti-example
+ * // Given embedded test `it('only-this-test')`...
+ * mocha.grep('/^only-this-test$/');    // NO! Use `.only()` to do this!
+ */
+Mocha.prototype.grep = function(re) {
+  if (utils.isString(re)) {
+    // extract args if it's regex-like, i.e: [string, pattern, flag]
+    var arg = re.match(/^\/(.*)\/(g|i|)$|.*/);
+    this.options.grep = new RegExp(arg[1] || arg[0], arg[2]);
+  } else {
+    this.options.grep = re;
+  }
+  return this;
+};
+
+/**
+ * Inverts `grep` matches.
+ *
+ * @public
+ * @see {@link Mocha#grep}
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Select tests whose full title does *not* contain `"match"`, ignoring case
+ * mocha.grep(/match/i).invert();
+ */
+Mocha.prototype.invert = function() {
+  this.options.invert = true;
+  return this;
+};
+
+/**
+ * Enables or disables ignoring global leaks.
+ *
+ * @public
+ * @see {@link Mocha#checkLeaks}
+ * @param {boolean} ignoreLeaks - Whether to ignore global leaks.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Ignore global leaks
+ * mocha.ignoreLeaks(true);
+ */
+Mocha.prototype.ignoreLeaks = function(ignoreLeaks) {
+  this.options.ignoreLeaks = Boolean(ignoreLeaks);
+  return this;
+};
+
+/**
+ * Enables checking for global variables leaked while running tests.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#--check-leaks|CLI option}
+ * @see {@link Mocha#ignoreLeaks}
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.checkLeaks = function() {
+  this.options.ignoreLeaks = false;
+  return this;
+};
+
+/**
+ * Displays full stack trace upon test failure.
+ *
+ * @public
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.fullTrace = function() {
+  this.options.fullStackTrace = true;
+  return this;
+};
+
+/**
+ * Enables desktop notification support if prerequisite software installed.
+ *
+ * @public
+ * @see {@link Mocha#isGrowlCapable}
+ * @see {@link Mocha#_growl}
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.growl = function() {
+  this.options.growl = this.isGrowlCapable();
+  if (!this.options.growl) {
+    var detail = process.browser
+      ? 'notification support not available in this browser...'
+      : 'notification support prerequisites not installed...';
+    console.error(detail + ' cannot enable!');
+  }
+  return this;
+};
+
+/**
+ * @summary
+ * Determines if Growl support seems likely.
+ *
+ * @description
+ * <strong>Not available when run in browser.</strong>
+ *
+ * @private
+ * @see {@link Growl#isCapable}
+ * @see {@link Mocha#growl}
+ * @return {boolean} whether Growl support can be expected
+ */
+Mocha.prototype.isGrowlCapable = growl.isCapable;
+
+/**
+ * Implements desktop notifications using a pseudo-reporter.
+ *
+ * @private
+ * @see {@link Mocha#growl}
+ * @see {@link Growl#notify}
+ * @param {Runner} runner - Runner instance.
+ */
+Mocha.prototype._growl = growl.notify;
+
+/**
+ * Specifies whitelist of variable names to be expected in global scope.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-global-variable-name|CLI option}
+ * @see {@link Mocha#checkLeaks}
+ * @param {String[]|String} globals - Accepted global variable name(s).
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Specify variables to be expected in global scope
+ * mocha.globals(['jQuery', 'MyLib']);
+ */
+Mocha.prototype.globals = function(globals) {
+  this.options.globals = this.options.globals
+    .concat(globals)
+    .filter(Boolean)
+    .filter(function(elt, idx, arr) {
+      return arr.indexOf(elt) === idx;
+    });
+  return this;
+};
+
+/**
+ * Enables or disables TTY color output by screen-oriented reporters.
+ *
+ * @public
+ * @param {boolean} colors - Whether to enable color output.
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.useColors = function(colors) {
+  if (colors !== undefined) {
+    this.options.useColors = colors;
+  }
+  return this;
+};
+
+/**
+ * Determines if reporter should use inline diffs (rather than +/-)
+ * in test failure output.
+ *
+ * @public
+ * @param {boolean} inlineDiffs - Whether to use inline diffs.
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.useInlineDiffs = function(inlineDiffs) {
+  this.options.useInlineDiffs = inlineDiffs !== undefined && inlineDiffs;
+  return this;
+};
+
+/**
+ * Determines if reporter should include diffs in test failure output.
+ *
+ * @public
+ * @param {boolean} hideDiff - Whether to hide diffs.
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.hideDiff = function(hideDiff) {
+  this.options.hideDiff = hideDiff !== undefined && hideDiff;
+  return this;
+};
+
+/**
+ * @summary
+ * Sets timeout threshold value.
+ *
+ * @description
+ * A string argument can use shorthand (such as "2s") and will be converted.
+ * If the value is `0`, timeouts will be disabled.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-t---timeout-ms|CLI option}
+ * @see {@link https://mochajs.org/#--no-timeouts|CLI option}
+ * @see {@link https://mochajs.org/#timeouts|Timeouts}
+ * @see {@link Mocha#enableTimeouts}
+ * @param {number|string} msecs - Timeout threshold value.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Sets timeout to one second
+ * mocha.timeout(1000);
+ * @example
+ *
+ * // Same as above but using string argument
+ * mocha.timeout('1s');
+ */
+Mocha.prototype.timeout = function(msecs) {
+  this.suite.timeout(msecs);
+  return this;
+};
+
+/**
+ * Sets the number of times to retry failed tests.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#retry-tests|Retry Tests}
+ * @param {number} retry - Number of times to retry failed tests.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Allow any failed test to retry one more time
+ * mocha.retries(1);
+ */
+Mocha.prototype.retries = function(n) {
+  this.suite.retries(n);
+  return this;
+};
+
+/**
+ * Sets slowness threshold value.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-s---slow-ms|CLI option}
+ * @param {number} msecs - Slowness threshold value.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Sets "slow" threshold to half a second
+ * mocha.slow(500);
+ * @example
+ *
+ * // Same as above but using string argument
+ * mocha.slow('0.5s');
+ */
+Mocha.prototype.slow = function(msecs) {
+  this.suite.slow(msecs);
+  return this;
+};
+
+/**
+ * Enables or disables timeouts.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-t---timeout-ms|CLI option}
+ * @see {@link https://mochajs.org/#--no-timeouts|CLI option}
+ * @param {boolean} enableTimeouts - Whether to enable timeouts.
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.enableTimeouts = function(enableTimeouts) {
+  this.suite.enableTimeouts(
+    arguments.length && enableTimeouts !== undefined ? enableTimeouts : true
+  );
+  return this;
+};
+
+/**
+ * Forces all tests to either accept a `done` callback or return a promise.
+ *
+ * @public
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.asyncOnly = function() {
+  this.options.asyncOnly = true;
+  return this;
+};
+
+/**
+ * Disables syntax highlighting (in browser).
+ *
+ * @public
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.noHighlighting = function() {
+  this.options.noHighlighting = true;
+  return this;
+};
+
+/**
+ * Enables uncaught errors to propagate (in browser).
+ *
+ * @public
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.allowUncaught = function() {
+  this.options.allowUncaught = true;
+  return this;
+};
+
+/**
+ * @summary
+ * Delays root suite execution.
+ *
+ * @description
+ * Used to perform asynch operations before any suites are run.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#delayed-root-suite|delayed root suite}
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.delay = function delay() {
+  this.options.delay = true;
+  return this;
+};
+
+/**
+ * Causes tests marked `only` to fail the suite.
+ *
+ * @public
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.forbidOnly = function() {
+  this.options.forbidOnly = true;
+  return this;
+};
+
+/**
+ * Causes pending tests and tests marked `skip` to fail the suite.
+ *
+ * @public
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.forbidPending = function() {
+  this.options.forbidPending = true;
+  return this;
+};
+
+/**
+ * Mocha version as specified by "package.json".
+ *
+ * @name Mocha#version
+ * @type string
+ * @readonly
+ */
+Object.defineProperty(Mocha.prototype, 'version', {
+  value: require('../package.json').version,
+  configurable: false,
+  enumerable: true,
+  writable: false
+});
+
+/**
+ * Callback to be invoked when test execution is complete.
+ *
+ * @callback DoneCB
+ * @param {number} failures - Number of failures that occurred.
+ */
+
+/**
+ * Runs root suite and invokes `fn()` when complete.
+ *
+ * @description
+ * To run tests multiple times (or to run tests in files that are
+ * already in the `require` cache), make sure to clear them from
+ * the cache first!
+ *
+ * @public
+ * @see {@link Mocha#loadFiles}
+ * @see {@link Mocha#unloadFiles}
+ * @see {@link Runner#run}
+ * @param {DoneCB} [fn] - Callback invoked when test execution completed.
+ * @return {Runner} runner instance
+ */
+Mocha.prototype.run = function(fn) {
+  if (this.files.length) {
+    this.loadFiles();
+  }
+  var suite = this.suite;
+  var options = this.options;
+  options.files = this.files;
+  var runner = new exports.Runner(suite, options.delay);
+  createStatsCollector(runner);
+  var reporter = new this._reporter(runner, options);
+  runner.ignoreLeaks = options.ignoreLeaks !== false;
+  runner.fullStackTrace = options.fullStackTrace;
+  runner.asyncOnly = options.asyncOnly;
+  runner.allowUncaught = options.allowUncaught;
+  runner.forbidOnly = options.forbidOnly;
+  runner.forbidPending = options.forbidPending;
+  if (options.grep) {
+    runner.grep(options.grep, options.invert);
+  }
+  if (options.globals) {
+    runner.globals(options.globals);
+  }
+  if (options.growl) {
+    this._growl(runner);
+  }
+  if (options.useColors !== undefined) {
+    exports.reporters.Base.useColors = options.useColors;
+  }
+  exports.reporters.Base.inlineDiffs = options.useInlineDiffs;
+  exports.reporters.Base.hideDiff = options.hideDiff;
+
+  function done(failures) {
+    fn = fn || utils.noop;
+    if (reporter.done) {
+      reporter.done(failures, fn);
+    } else {
+      fn(failures);
+    }
+  }
+
+  return runner.run(done);
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/mocharc.json b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/mocharc.json
new file mode 100644
index 00000000000..b0cd266714b
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/mocharc.json
@@ -0,0 +1,10 @@
+{
+  "diff": true,
+  "extension": ["js"],
+  "opts": "./test/mocha.opts",
+  "package": "./package.json",
+  "reporter": "spec",
+  "slow": 75,
+  "timeout": 2000,
+  "ui": "bdd"
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/pending.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/pending.js
new file mode 100644
index 00000000000..bb9a5053373
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/pending.js
@@ -0,0 +1,12 @@
+'use strict';
+
+module.exports = Pending;
+
+/**
+ * Initialize a new `Pending` error with the given message.
+ *
+ * @param {string} message
+ */
+function Pending(message) {
+  this.message = message;
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/base.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/base.js
new file mode 100644
index 00000000000..670a160fa8c
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/base.js
@@ -0,0 +1,498 @@
+'use strict';
+/**
+ * @module Base
+ */
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var diff = require('diff');
+var milliseconds = require('ms');
+var utils = require('../utils');
+var supportsColor = process.browser ? null : require('supports-color');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+
+/**
+ * Expose `Base`.
+ */
+
+exports = module.exports = Base;
+
+/**
+ * Check if both stdio streams are associated with a tty.
+ */
+
+var isatty = tty.isatty(1) && tty.isatty(2);
+
+/**
+ * Save log references to avoid tests interfering (see GH-3604).
+ */
+var consoleLog = console.log;
+
+/**
+ * Enable coloring by default, except in the browser interface.
+ */
+
+exports.useColors =
+  !process.browser &&
+  (supportsColor.stdout || process.env.MOCHA_COLORS !== undefined);
+
+/**
+ * Inline diffs instead of +/-
+ */
+
+exports.inlineDiffs = false;
+
+/**
+ * Default color map.
+ */
+
+exports.colors = {
+  pass: 90,
+  fail: 31,
+  'bright pass': 92,
+  'bright fail': 91,
+  'bright yellow': 93,
+  pending: 36,
+  suite: 0,
+  'error title': 0,
+  'error message': 31,
+  'error stack': 90,
+  checkmark: 32,
+  fast: 90,
+  medium: 33,
+  slow: 31,
+  green: 32,
+  light: 90,
+  'diff gutter': 90,
+  'diff added': 32,
+  'diff removed': 31
+};
+
+/**
+ * Default symbol map.
+ */
+
+exports.symbols = {
+  ok: '✓',
+  err: '✖',
+  dot: '․',
+  comma: ',',
+  bang: '!'
+};
+
+// With node.js on Windows: use symbols available in terminal default fonts
+if (process.platform === 'win32') {
+  exports.symbols.ok = '\u221A';
+  exports.symbols.err = '\u00D7';
+  exports.symbols.dot = '.';
+}
+
+/**
+ * Color `str` with the given `type`,
+ * allowing colors to be disabled,
+ * as well as user-defined color
+ * schemes.
+ *
+ * @private
+ * @param {string} type
+ * @param {string} str
+ * @return {string}
+ */
+var color = (exports.color = function(type, str) {
+  if (!exports.useColors) {
+    return String(str);
+  }
+  return '\u001b[' + exports.colors[type] + 'm' + str + '\u001b[0m';
+});
+
+/**
+ * Expose term window size, with some defaults for when stderr is not a tty.
+ */
+
+exports.window = {
+  width: 75
+};
+
+if (isatty) {
+  exports.window.width = process.stdout.getWindowSize
+    ? process.stdout.getWindowSize(1)[0]
+    : tty.getWindowSize()[1];
+}
+
+/**
+ * Expose some basic cursor interactions that are common among reporters.
+ */
+
+exports.cursor = {
+  hide: function() {
+    isatty && process.stdout.write('\u001b[?25l');
+  },
+
+  show: function() {
+    isatty && process.stdout.write('\u001b[?25h');
+  },
+
+  deleteLine: function() {
+    isatty && process.stdout.write('\u001b[2K');
+  },
+
+  beginningOfLine: function() {
+    isatty && process.stdout.write('\u001b[0G');
+  },
+
+  CR: function() {
+    if (isatty) {
+      exports.cursor.deleteLine();
+      exports.cursor.beginningOfLine();
+    } else {
+      process.stdout.write('\r');
+    }
+  }
+};
+
+function showDiff(err) {
+  return (
+    err &&
+    err.showDiff !== false &&
+    sameType(err.actual, err.expected) &&
+    err.expected !== undefined
+  );
+}
+
+function stringifyDiffObjs(err) {
+  if (!utils.isString(err.actual) || !utils.isString(err.expected)) {
+    err.actual = utils.stringify(err.actual);
+    err.expected = utils.stringify(err.expected);
+  }
+}
+
+/**
+ * Returns a diff between 2 strings with coloured ANSI output.
+ *
+ * @description
+ * The diff will be either inline or unified dependent on the value
+ * of `Base.inlineDiff`.
+ *
+ * @param {string} actual
+ * @param {string} expected
+ * @return {string} Diff
+ */
+var generateDiff = (exports.generateDiff = function(actual, expected) {
+  return exports.inlineDiffs
+    ? inlineDiff(actual, expected)
+    : unifiedDiff(actual, expected);
+});
+
+/**
+ * Outputs the given `failures` as a list.
+ *
+ * @public
+ * @memberof Mocha.reporters.Base
+ * @variation 1
+ * @param {Object[]} failures - Each is Test instance with corresponding
+ *     Error property
+ */
+exports.list = function(failures) {
+  Base.consoleLog();
+  failures.forEach(function(test, i) {
+    // format
+    var fmt =
+      color('error title', '  %s) %s:\n') +
+      color('error message', '     %s') +
+      color('error stack', '\n%s\n');
+
+    // msg
+    var msg;
+    var err = test.err;
+    var message;
+    if (err.message && typeof err.message.toString === 'function') {
+      message = err.message + '';
+    } else if (typeof err.inspect === 'function') {
+      message = err.inspect() + '';
+    } else {
+      message = '';
+    }
+    var stack = err.stack || message;
+    var index = message ? stack.indexOf(message) : -1;
+
+    if (index === -1) {
+      msg = message;
+    } else {
+      index += message.length;
+      msg = stack.slice(0, index);
+      // remove msg from stack
+      stack = stack.slice(index + 1);
+    }
+
+    // uncaught
+    if (err.uncaught) {
+      msg = 'Uncaught ' + msg;
+    }
+    // explicitly show diff
+    if (!exports.hideDiff && showDiff(err)) {
+      stringifyDiffObjs(err);
+      fmt =
+        color('error title', '  %s) %s:\n%s') + color('error stack', '\n%s\n');
+      var match = message.match(/^([^:]+): expected/);
+      msg = '\n      ' + color('error message', match ? match[1] : msg);
+
+      msg += generateDiff(err.actual, err.expected);
+    }
+
+    // indent stack trace
+    stack = stack.replace(/^/gm, '  ');
+
+    // indented test title
+    var testTitle = '';
+    test.titlePath().forEach(function(str, index) {
+      if (index !== 0) {
+        testTitle += '\n     ';
+      }
+      for (var i = 0; i < index; i++) {
+        testTitle += '  ';
+      }
+      testTitle += str;
+    });
+
+    Base.consoleLog(fmt, i + 1, testTitle, msg, stack);
+  });
+};
+
+/**
+ * Constructs a new `Base` reporter instance.
+ *
+ * @description
+ * All other reporters generally inherit from this reporter.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Base(runner, options) {
+  var failures = (this.failures = []);
+
+  if (!runner) {
+    throw new TypeError('Missing runner argument');
+  }
+  this.options = options || {};
+  this.runner = runner;
+  this.stats = runner.stats; // assigned so Reporters keep a closer reference
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    if (test.duration > test.slow()) {
+      test.speed = 'slow';
+    } else if (test.duration > test.slow() / 2) {
+      test.speed = 'medium';
+    } else {
+      test.speed = 'fast';
+    }
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test, err) {
+    if (showDiff(err)) {
+      stringifyDiffObjs(err);
+    }
+    test.err = err;
+    failures.push(test);
+  });
+}
+
+/**
+ * Outputs common epilogue used by many of the bundled reporters.
+ *
+ * @public
+ * @memberof Mocha.reporters.Base
+ */
+Base.prototype.epilogue = function() {
+  var stats = this.stats;
+  var fmt;
+
+  Base.consoleLog();
+
+  // passes
+  fmt =
+    color('bright pass', ' ') +
+    color('green', ' %d passing') +
+    color('light', ' (%s)');
+
+  Base.consoleLog(fmt, stats.passes || 0, milliseconds(stats.duration));
+
+  // pending
+  if (stats.pending) {
+    fmt = color('pending', ' ') + color('pending', ' %d pending');
+
+    Base.consoleLog(fmt, stats.pending);
+  }
+
+  // failures
+  if (stats.failures) {
+    fmt = color('fail', '  %d failing');
+
+    Base.consoleLog(fmt, stats.failures);
+
+    Base.list(this.failures);
+    Base.consoleLog();
+  }
+
+  Base.consoleLog();
+};
+
+/**
+ * Pads the given `str` to `len`.
+ *
+ * @private
+ * @param {string} str
+ * @param {string} len
+ * @return {string}
+ */
+function pad(str, len) {
+  str = String(str);
+  return Array(len - str.length + 1).join(' ') + str;
+}
+
+/**
+ * Returns inline diff between 2 strings with coloured ANSI output.
+ *
+ * @private
+ * @param {String} actual
+ * @param {String} expected
+ * @return {string} Diff
+ */
+function inlineDiff(actual, expected) {
+  var msg = errorDiff(actual, expected);
+
+  // linenos
+  var lines = msg.split('\n');
+  if (lines.length > 4) {
+    var width = String(lines.length).length;
+    msg = lines
+      .map(function(str, i) {
+        return pad(++i, width) + ' |' + ' ' + str;
+      })
+      .join('\n');
+  }
+
+  // legend
+  msg =
+    '\n' +
+    color('diff removed', 'actual') +
+    ' ' +
+    color('diff added', 'expected') +
+    '\n\n' +
+    msg +
+    '\n';
+
+  // indent
+  msg = msg.replace(/^/gm, '      ');
+  return msg;
+}
+
+/**
+ * Returns unified diff between two strings with coloured ANSI output.
+ *
+ * @private
+ * @param {String} actual
+ * @param {String} expected
+ * @return {string} The diff.
+ */
+function unifiedDiff(actual, expected) {
+  var indent = '      ';
+  function cleanUp(line) {
+    if (line[0] === '+') {
+      return indent + colorLines('diff added', line);
+    }
+    if (line[0] === '-') {
+      return indent + colorLines('diff removed', line);
+    }
+    if (line.match(/@@/)) {
+      return '--';
+    }
+    if (line.match(/\\ No newline/)) {
+      return null;
+    }
+    return indent + line;
+  }
+  function notBlank(line) {
+    return typeof line !== 'undefined' && line !== null;
+  }
+  var msg = diff.createPatch('string', actual, expected);
+  var lines = msg.split('\n').splice(5);
+  return (
+    '\n      ' +
+    colorLines('diff added', '+ expected') +
+    ' ' +
+    colorLines('diff removed', '- actual') +
+    '\n\n' +
+    lines
+      .map(cleanUp)
+      .filter(notBlank)
+      .join('\n')
+  );
+}
+
+/**
+ * Returns character diff for `err`.
+ *
+ * @private
+ * @param {String} actual
+ * @param {String} expected
+ * @return {string} the diff
+ */
+function errorDiff(actual, expected) {
+  return diff
+    .diffWordsWithSpace(actual, expected)
+    .map(function(str) {
+      if (str.added) {
+        return colorLines('diff added', str.value);
+      }
+      if (str.removed) {
+        return colorLines('diff removed', str.value);
+      }
+      return str.value;
+    })
+    .join('');
+}
+
+/**
+ * Colors lines for `str`, using the color `name`.
+ *
+ * @private
+ * @param {string} name
+ * @param {string} str
+ * @return {string}
+ */
+function colorLines(name, str) {
+  return str
+    .split('\n')
+    .map(function(str) {
+      return color(name, str);
+    })
+    .join('\n');
+}
+
+/**
+ * Object#toString reference.
+ */
+var objToString = Object.prototype.toString;
+
+/**
+ * Checks that a / b have the same type.
+ *
+ * @private
+ * @param {Object} a
+ * @param {Object} b
+ * @return {boolean}
+ */
+function sameType(a, b) {
+  return objToString.call(a) === objToString.call(b);
+}
+
+Base.consoleLog = consoleLog;
+
+Base.abstract = true;
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/doc.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/doc.js
new file mode 100644
index 00000000000..5a6af8fb426
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/doc.js
@@ -0,0 +1,89 @@
+'use strict';
+/**
+ * @module Doc
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_SUITE_END = constants.EVENT_SUITE_END;
+
+/**
+ * Expose `Doc`.
+ */
+
+exports = module.exports = Doc;
+
+/**
+ * Constructs a new `Doc` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Doc(runner, options) {
+  Base.call(this, runner, options);
+
+  var indents = 2;
+
+  function indent() {
+    return Array(indents).join('  ');
+  }
+
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    if (suite.root) {
+      return;
+    }
+    ++indents;
+    Base.consoleLog('%s<section class="suite">', indent());
+    ++indents;
+    Base.consoleLog('%s<h1>%s</h1>', indent(), utils.escape(suite.title));
+    Base.consoleLog('%s<dl>', indent());
+  });
+
+  runner.on(EVENT_SUITE_END, function(suite) {
+    if (suite.root) {
+      return;
+    }
+    Base.consoleLog('%s</dl>', indent());
+    --indents;
+    Base.consoleLog('%s</section>', indent());
+    --indents;
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    Base.consoleLog('%s  <dt>%s</dt>', indent(), utils.escape(test.title));
+    var code = utils.escape(utils.clean(test.body));
+    Base.consoleLog('%s  <dd><pre><code>%s</code></pre></dd>', indent(), code);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test, err) {
+    Base.consoleLog(
+      '%s  <dt class="error">%s</dt>',
+      indent(),
+      utils.escape(test.title)
+    );
+    var code = utils.escape(utils.clean(test.body));
+    Base.consoleLog(
+      '%s  <dd class="error"><pre><code>%s</code></pre></dd>',
+      indent(),
+      code
+    );
+    Base.consoleLog(
+      '%s  <dd class="error">%s</dd>',
+      indent(),
+      utils.escape(err)
+    );
+  });
+}
+
+Doc.description = 'HTML documentation';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/dot.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/dot.js
new file mode 100644
index 00000000000..3913f0c6796
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/dot.js
@@ -0,0 +1,81 @@
+'use strict';
+/**
+ * @module Dot
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+
+/**
+ * Expose `Dot`.
+ */
+
+exports = module.exports = Dot;
+
+/**
+ * Constructs a new `Dot` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Dot(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var width = (Base.window.width * 0.75) | 0;
+  var n = -1;
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    process.stdout.write('\n');
+  });
+
+  runner.on(EVENT_TEST_PENDING, function() {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    process.stdout.write(Base.color('pending', Base.symbols.comma));
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    if (test.speed === 'slow') {
+      process.stdout.write(Base.color('bright yellow', Base.symbols.dot));
+    } else {
+      process.stdout.write(Base.color(test.speed, Base.symbols.dot));
+    }
+  });
+
+  runner.on(EVENT_TEST_FAIL, function() {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    process.stdout.write(Base.color('fail', Base.symbols.bang));
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    process.stdout.write('\n');
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Dot, Base);
+
+Dot.description = 'dot matrix representation';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/html.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/html.js
new file mode 100644
index 00000000000..d3f488a9410
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/html.js
@@ -0,0 +1,390 @@
+'use strict';
+
+/* eslint-env browser */
+/**
+ * @module HTML
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var Progress = require('../browser/progress');
+var escapeRe = require('escape-string-regexp');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_SUITE_END = constants.EVENT_SUITE_END;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var escape = utils.escape;
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+
+var Date = global.Date;
+
+/**
+ * Expose `HTML`.
+ */
+
+exports = module.exports = HTML;
+
+/**
+ * Stats template.
+ */
+
+var statsTemplate =
+  '<ul id="mocha-stats">' +
+  '<li class="progress"><canvas width="40" height="40"></canvas></li>' +
+  '<li class="passes"><a href="javascript:void(0);">passes:</a> <em>0</em></li>' +
+  '<li class="failures"><a href="javascript:void(0);">failures:</a> <em>0</em></li>' +
+  '<li class="duration">duration: <em>0</em>s</li>' +
+  '</ul>';
+
+var playIcon = '&#x2023;';
+
+/**
+ * Constructs a new `HTML` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function HTML(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var stats = this.stats;
+  var stat = fragment(statsTemplate);
+  var items = stat.getElementsByTagName('li');
+  var passes = items[1].getElementsByTagName('em')[0];
+  var passesLink = items[1].getElementsByTagName('a')[0];
+  var failures = items[2].getElementsByTagName('em')[0];
+  var failuresLink = items[2].getElementsByTagName('a')[0];
+  var duration = items[3].getElementsByTagName('em')[0];
+  var canvas = stat.getElementsByTagName('canvas')[0];
+  var report = fragment('<ul id="mocha-report"></ul>');
+  var stack = [report];
+  var progress;
+  var ctx;
+  var root = document.getElementById('mocha');
+
+  if (canvas.getContext) {
+    var ratio = window.devicePixelRatio || 1;
+    canvas.style.width = canvas.width;
+    canvas.style.height = canvas.height;
+    canvas.width *= ratio;
+    canvas.height *= ratio;
+    ctx = canvas.getContext('2d');
+    ctx.scale(ratio, ratio);
+    progress = new Progress();
+  }
+
+  if (!root) {
+    return error('#mocha div missing, add it to your document');
+  }
+
+  // pass toggle
+  on(passesLink, 'click', function(evt) {
+    evt.preventDefault();
+    unhide();
+    var name = /pass/.test(report.className) ? '' : ' pass';
+    report.className = report.className.replace(/fail|pass/g, '') + name;
+    if (report.className.trim()) {
+      hideSuitesWithout('test pass');
+    }
+  });
+
+  // failure toggle
+  on(failuresLink, 'click', function(evt) {
+    evt.preventDefault();
+    unhide();
+    var name = /fail/.test(report.className) ? '' : ' fail';
+    report.className = report.className.replace(/fail|pass/g, '') + name;
+    if (report.className.trim()) {
+      hideSuitesWithout('test fail');
+    }
+  });
+
+  root.appendChild(stat);
+  root.appendChild(report);
+
+  if (progress) {
+    progress.size(40);
+  }
+
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    if (suite.root) {
+      return;
+    }
+
+    // suite
+    var url = self.suiteURL(suite);
+    var el = fragment(
+      '<li class="suite"><h1><a href="%s">%s</a></h1></li>',
+      url,
+      escape(suite.title)
+    );
+
+    // container
+    stack[0].appendChild(el);
+    stack.unshift(document.createElement('ul'));
+    el.appendChild(stack[0]);
+  });
+
+  runner.on(EVENT_SUITE_END, function(suite) {
+    if (suite.root) {
+      updateStats();
+      return;
+    }
+    stack.shift();
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    var url = self.testURL(test);
+    var markup =
+      '<li class="test pass %e"><h2>%e<span class="duration">%ems</span> ' +
+      '<a href="%s" class="replay">' +
+      playIcon +
+      '</a></h2></li>';
+    var el = fragment(markup, test.speed, test.title, test.duration, url);
+    self.addCodeToggle(el, test.body);
+    appendToStack(el);
+    updateStats();
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    var el = fragment(
+      '<li class="test fail"><h2>%e <a href="%e" class="replay">' +
+        playIcon +
+        '</a></h2></li>',
+      test.title,
+      self.testURL(test)
+    );
+    var stackString; // Note: Includes leading newline
+    var message = test.err.toString();
+
+    // <=IE7 stringifies to [Object Error]. Since it can be overloaded, we
+    // check for the result of the stringifying.
+    if (message === '[object Error]') {
+      message = test.err.message;
+    }
+
+    if (test.err.stack) {
+      var indexOfMessage = test.err.stack.indexOf(test.err.message);
+      if (indexOfMessage === -1) {
+        stackString = test.err.stack;
+      } else {
+        stackString = test.err.stack.substr(
+          test.err.message.length + indexOfMessage
+        );
+      }
+    } else if (test.err.sourceURL && test.err.line !== undefined) {
+      // Safari doesn't give you a stack. Let's at least provide a source line.
+      stackString = '\n(' + test.err.sourceURL + ':' + test.err.line + ')';
+    }
+
+    stackString = stackString || '';
+
+    if (test.err.htmlMessage && stackString) {
+      el.appendChild(
+        fragment(
+          '<div class="html-error">%s\n<pre class="error">%e</pre></div>',
+          test.err.htmlMessage,
+          stackString
+        )
+      );
+    } else if (test.err.htmlMessage) {
+      el.appendChild(
+        fragment('<div class="html-error">%s</div>', test.err.htmlMessage)
+      );
+    } else {
+      el.appendChild(
+        fragment('<pre class="error">%e%e</pre>', message, stackString)
+      );
+    }
+
+    self.addCodeToggle(el, test.body);
+    appendToStack(el);
+    updateStats();
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    var el = fragment(
+      '<li class="test pass pending"><h2>%e</h2></li>',
+      test.title
+    );
+    appendToStack(el);
+    updateStats();
+  });
+
+  function appendToStack(el) {
+    // Don't call .appendChild if #mocha-report was already .shift()'ed off the stack.
+    if (stack[0]) {
+      stack[0].appendChild(el);
+    }
+  }
+
+  function updateStats() {
+    // TODO: add to stats
+    var percent = ((stats.tests / runner.total) * 100) | 0;
+    if (progress) {
+      progress.update(percent).draw(ctx);
+    }
+
+    // update stats
+    var ms = new Date() - stats.start;
+    text(passes, stats.passes);
+    text(failures, stats.failures);
+    text(duration, (ms / 1000).toFixed(2));
+  }
+}
+
+/**
+ * Makes a URL, preserving querystring ("search") parameters.
+ *
+ * @param {string} s
+ * @return {string} A new URL.
+ */
+function makeUrl(s) {
+  var search = window.location.search;
+
+  // Remove previous grep query parameter if present
+  if (search) {
+    search = search.replace(/[?&]grep=[^&\s]*/g, '').replace(/^&/, '?');
+  }
+
+  return (
+    window.location.pathname +
+    (search ? search + '&' : '?') +
+    'grep=' +
+    encodeURIComponent(escapeRe(s))
+  );
+}
+
+/**
+ * Provide suite URL.
+ *
+ * @param {Object} [suite]
+ */
+HTML.prototype.suiteURL = function(suite) {
+  return makeUrl(suite.fullTitle());
+};
+
+/**
+ * Provide test URL.
+ *
+ * @param {Object} [test]
+ */
+HTML.prototype.testURL = function(test) {
+  return makeUrl(test.fullTitle());
+};
+
+/**
+ * Adds code toggle functionality for the provided test's list element.
+ *
+ * @param {HTMLLIElement} el
+ * @param {string} contents
+ */
+HTML.prototype.addCodeToggle = function(el, contents) {
+  var h2 = el.getElementsByTagName('h2')[0];
+
+  on(h2, 'click', function() {
+    pre.style.display = pre.style.display === 'none' ? 'block' : 'none';
+  });
+
+  var pre = fragment('<pre><code>%e</code></pre>', utils.clean(contents));
+  el.appendChild(pre);
+  pre.style.display = 'none';
+};
+
+/**
+ * Display error `msg`.
+ *
+ * @param {string} msg
+ */
+function error(msg) {
+  document.body.appendChild(fragment('<div id="mocha-error">%s</div>', msg));
+}
+
+/**
+ * Return a DOM fragment from `html`.
+ *
+ * @param {string} html
+ */
+function fragment(html) {
+  var args = arguments;
+  var div = document.createElement('div');
+  var i = 1;
+
+  div.innerHTML = html.replace(/%([se])/g, function(_, type) {
+    switch (type) {
+      case 's':
+        return String(args[i++]);
+      case 'e':
+        return escape(args[i++]);
+      // no default
+    }
+  });
+
+  return div.firstChild;
+}
+
+/**
+ * Check for suites that do not have elements
+ * with `classname`, and hide them.
+ *
+ * @param {text} classname
+ */
+function hideSuitesWithout(classname) {
+  var suites = document.getElementsByClassName('suite');
+  for (var i = 0; i < suites.length; i++) {
+    var els = suites[i].getElementsByClassName(classname);
+    if (!els.length) {
+      suites[i].className += ' hidden';
+    }
+  }
+}
+
+/**
+ * Unhide .hidden suites.
+ */
+function unhide() {
+  var els = document.getElementsByClassName('suite hidden');
+  for (var i = 0; i < els.length; ++i) {
+    els[i].className = els[i].className.replace('suite hidden', 'suite');
+  }
+}
+
+/**
+ * Set an element's text contents.
+ *
+ * @param {HTMLElement} el
+ * @param {string} contents
+ */
+function text(el, contents) {
+  if (el.textContent) {
+    el.textContent = contents;
+  } else {
+    el.innerText = contents;
+  }
+}
+
+/**
+ * Listen on `event` with callback `fn`.
+ */
+function on(el, event, fn) {
+  if (el.addEventListener) {
+    el.addEventListener(event, fn, false);
+  } else {
+    el.attachEvent('on' + event, fn);
+  }
+}
+
+HTML.browserOnly = true;
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/index.js
new file mode 100644
index 00000000000..d3b5481e41d
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/index.js
@@ -0,0 +1,19 @@
+'use strict';
+
+// Alias exports to a their normalized format Mocha#reporter to prevent a need
+// for dynamic (try/catch) requires, which Browserify doesn't handle.
+exports.Base = exports.base = require('./base');
+exports.Dot = exports.dot = require('./dot');
+exports.Doc = exports.doc = require('./doc');
+exports.TAP = exports.tap = require('./tap');
+exports.JSON = exports.json = require('./json');
+exports.HTML = exports.html = require('./html');
+exports.List = exports.list = require('./list');
+exports.Min = exports.min = require('./min');
+exports.Spec = exports.spec = require('./spec');
+exports.Nyan = exports.nyan = require('./nyan');
+exports.XUnit = exports.xunit = require('./xunit');
+exports.Markdown = exports.markdown = require('./markdown');
+exports.Progress = exports.progress = require('./progress');
+exports.Landing = exports.landing = require('./landing');
+exports.JSONStream = exports['json-stream'] = require('./json-stream');
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/json-stream.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/json-stream.js
new file mode 100644
index 00000000000..27282987ea8
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/json-stream.js
@@ -0,0 +1,90 @@
+'use strict';
+/**
+ * @module JSONStream
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+
+/**
+ * Expose `JSONStream`.
+ */
+
+exports = module.exports = JSONStream;
+
+/**
+ * Constructs a new `JSONStream` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function JSONStream(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var total = runner.total;
+
+  runner.once(EVENT_RUN_BEGIN, function() {
+    writeEvent(['start', {total: total}]);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    writeEvent(['pass', clean(test)]);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test, err) {
+    test = clean(test);
+    test.err = err.message;
+    test.stack = err.stack || null;
+    writeEvent(['fail', test]);
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    writeEvent(['end', self.stats]);
+  });
+}
+
+/**
+ * Mocha event to be written to the output stream.
+ * @typedef {Array} JSONStream~MochaEvent
+ */
+
+/**
+ * Writes Mocha event to reporter output stream.
+ *
+ * @private
+ * @param {JSONStream~MochaEvent} event - Mocha event to be output.
+ */
+function writeEvent(event) {
+  process.stdout.write(JSON.stringify(event) + '\n');
+}
+
+/**
+ * Returns an object literal representation of `test`
+ * free of cyclic properties, etc.
+ *
+ * @private
+ * @param {Test} test - Instance used as data source.
+ * @return {Object} object containing pared-down test instance data
+ */
+function clean(test) {
+  return {
+    title: test.title,
+    fullTitle: test.fullTitle(),
+    duration: test.duration,
+    currentRetry: test.currentRetry()
+  };
+}
+
+JSONStream.description = 'newline delimited JSON events';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/json.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/json.js
new file mode 100644
index 00000000000..12b6289cd7b
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/json.js
@@ -0,0 +1,135 @@
+'use strict';
+/**
+ * @module JSON
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+
+/**
+ * Expose `JSON`.
+ */
+
+exports = module.exports = JSONReporter;
+
+/**
+ * Constructs a new `JSON` reporter instance.
+ *
+ * @public
+ * @class JSON
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function JSONReporter(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var tests = [];
+  var pending = [];
+  var failures = [];
+  var passes = [];
+
+  runner.on(EVENT_TEST_END, function(test) {
+    tests.push(test);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    passes.push(test);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    failures.push(test);
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    pending.push(test);
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    var obj = {
+      stats: self.stats,
+      tests: tests.map(clean),
+      pending: pending.map(clean),
+      failures: failures.map(clean),
+      passes: passes.map(clean)
+    };
+
+    runner.testResults = obj;
+
+    process.stdout.write(JSON.stringify(obj, null, 2));
+  });
+}
+
+/**
+ * Return a plain-object representation of `test`
+ * free of cyclic properties etc.
+ *
+ * @private
+ * @param {Object} test
+ * @return {Object}
+ */
+function clean(test) {
+  var err = test.err || {};
+  if (err instanceof Error) {
+    err = errorJSON(err);
+  }
+
+  return {
+    title: test.title,
+    fullTitle: test.fullTitle(),
+    duration: test.duration,
+    currentRetry: test.currentRetry(),
+    err: cleanCycles(err)
+  };
+}
+
+/**
+ * Replaces any circular references inside `obj` with '[object Object]'
+ *
+ * @private
+ * @param {Object} obj
+ * @return {Object}
+ */
+function cleanCycles(obj) {
+  var cache = [];
+  return JSON.parse(
+    JSON.stringify(obj, function(key, value) {
+      if (typeof value === 'object' && value !== null) {
+        if (cache.indexOf(value) !== -1) {
+          // Instead of going in a circle, we'll print [object Object]
+          return '' + value;
+        }
+        cache.push(value);
+      }
+
+      return value;
+    })
+  );
+}
+
+/**
+ * Transform an Error object into a JSON object.
+ *
+ * @private
+ * @param {Error} err
+ * @return {Object}
+ */
+function errorJSON(err) {
+  var res = {};
+  Object.getOwnPropertyNames(err).forEach(function(key) {
+    res[key] = err[key];
+  }, err);
+  return res;
+}
+
+JSONReporter.description = 'single JSON object';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/landing.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/landing.js
new file mode 100644
index 00000000000..a6af946c42a
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/landing.js
@@ -0,0 +1,108 @@
+'use strict';
+/**
+ * @module Landing
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var constants = require('../runner').constants;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+var STATE_FAILED = require('../runnable').constants.STATE_FAILED;
+
+var cursor = Base.cursor;
+var color = Base.color;
+
+/**
+ * Expose `Landing`.
+ */
+
+exports = module.exports = Landing;
+
+/**
+ * Airplane color.
+ */
+
+Base.colors.plane = 0;
+
+/**
+ * Airplane crash color.
+ */
+
+Base.colors['plane crash'] = 31;
+
+/**
+ * Runway color.
+ */
+
+Base.colors.runway = 90;
+
+/**
+ * Constructs a new `Landing` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Landing(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var width = (Base.window.width * 0.75) | 0;
+  var total = runner.total;
+  var stream = process.stdout;
+  var plane = color('plane', '✈');
+  var crashed = -1;
+  var n = 0;
+
+  function runway() {
+    var buf = Array(width).join('-');
+    return '  ' + color('runway', buf);
+  }
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    stream.write('\n\n\n  ');
+    cursor.hide();
+  });
+
+  runner.on(EVENT_TEST_END, function(test) {
+    // check if the plane crashed
+    var col = crashed === -1 ? ((width * ++n) / total) | 0 : crashed;
+
+    // show the crash
+    if (test.state === STATE_FAILED) {
+      plane = color('plane crash', '✈');
+      crashed = col;
+    }
+
+    // render landing strip
+    stream.write('\u001b[' + (width + 1) + 'D\u001b[2A');
+    stream.write(runway());
+    stream.write('\n  ');
+    stream.write(color('runway', Array(col).join('⋅')));
+    stream.write(plane);
+    stream.write(color('runway', Array(width - col).join('⋅') + '\n'));
+    stream.write(runway());
+    stream.write('\u001b[0m');
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    cursor.show();
+    process.stdout.write('\n');
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Landing, Base);
+
+Landing.description = 'Unicode landing strip';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/list.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/list.js
new file mode 100644
index 00000000000..c7ff8c4ea81
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/list.js
@@ -0,0 +1,78 @@
+'use strict';
+/**
+ * @module List
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var constants = require('../runner').constants;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_BEGIN = constants.EVENT_TEST_BEGIN;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `List`.
+ */
+
+exports = module.exports = List;
+
+/**
+ * Constructs a new `List` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function List(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var n = 0;
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    Base.consoleLog();
+  });
+
+  runner.on(EVENT_TEST_BEGIN, function(test) {
+    process.stdout.write(color('pass', '    ' + test.fullTitle() + ': '));
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    var fmt = color('checkmark', '  -') + color('pending', ' %s');
+    Base.consoleLog(fmt, test.fullTitle());
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    var fmt =
+      color('checkmark', '  ' + Base.symbols.ok) +
+      color('pass', ' %s: ') +
+      color(test.speed, '%dms');
+    cursor.CR();
+    Base.consoleLog(fmt, test.fullTitle(), test.duration);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    cursor.CR();
+    Base.consoleLog(color('fail', '  %d) %s'), ++n, test.fullTitle());
+  });
+
+  runner.once(EVENT_RUN_END, self.epilogue.bind(self));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(List, Base);
+
+List.description = 'like "spec" reporter but flat';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/markdown.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/markdown.js
new file mode 100644
index 00000000000..460e2484050
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/markdown.js
@@ -0,0 +1,112 @@
+'use strict';
+/**
+ * @module Markdown
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var constants = require('../runner').constants;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_SUITE_END = constants.EVENT_SUITE_END;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+
+/**
+ * Constants
+ */
+
+var SUITE_PREFIX = '$';
+
+/**
+ * Expose `Markdown`.
+ */
+
+exports = module.exports = Markdown;
+
+/**
+ * Constructs a new `Markdown` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Markdown(runner, options) {
+  Base.call(this, runner, options);
+
+  var level = 0;
+  var buf = '';
+
+  function title(str) {
+    return Array(level).join('#') + ' ' + str;
+  }
+
+  function mapTOC(suite, obj) {
+    var ret = obj;
+    var key = SUITE_PREFIX + suite.title;
+
+    obj = obj[key] = obj[key] || {suite: suite};
+    suite.suites.forEach(function(suite) {
+      mapTOC(suite, obj);
+    });
+
+    return ret;
+  }
+
+  function stringifyTOC(obj, level) {
+    ++level;
+    var buf = '';
+    var link;
+    for (var key in obj) {
+      if (key === 'suite') {
+        continue;
+      }
+      if (key !== SUITE_PREFIX) {
+        link = ' - [' + key.substring(1) + ']';
+        link += '(#' + utils.slug(obj[key].suite.fullTitle()) + ')\n';
+        buf += Array(level).join('  ') + link;
+      }
+      buf += stringifyTOC(obj[key], level);
+    }
+    return buf;
+  }
+
+  function generateTOC(suite) {
+    var obj = mapTOC(suite, {});
+    return stringifyTOC(obj, 0);
+  }
+
+  generateTOC(runner.suite);
+
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    ++level;
+    var slug = utils.slug(suite.fullTitle());
+    buf += '<a name="' + slug + '"></a>' + '\n';
+    buf += title(suite.title) + '\n';
+  });
+
+  runner.on(EVENT_SUITE_END, function() {
+    --level;
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    var code = utils.clean(test.body);
+    buf += test.title + '.\n';
+    buf += '\n```js\n';
+    buf += code + '\n';
+    buf += '```\n\n';
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    process.stdout.write('# TOC\n');
+    process.stdout.write(generateTOC(runner.suite));
+    process.stdout.write(buf);
+  });
+}
+
+Markdown.description = 'GitHub Flavored Markdown';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/min.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/min.js
new file mode 100644
index 00000000000..019ffe595a5
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/min.js
@@ -0,0 +1,52 @@
+'use strict';
+/**
+ * @module Min
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var constants = require('../runner').constants;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+
+/**
+ * Expose `Min`.
+ */
+
+exports = module.exports = Min;
+
+/**
+ * Constructs a new `Min` reporter instance.
+ *
+ * @description
+ * This minimal test reporter is best used with '--watch'.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Min(runner, options) {
+  Base.call(this, runner, options);
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    // clear screen
+    process.stdout.write('\u001b[2J');
+    // set cursor position
+    process.stdout.write('\u001b[1;3H');
+  });
+
+  runner.once(EVENT_RUN_END, this.epilogue.bind(this));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Min, Base);
+
+Min.description = 'essentially just a summary';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/nyan.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/nyan.js
new file mode 100644
index 00000000000..4eda971e7c2
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/nyan.js
@@ -0,0 +1,276 @@
+'use strict';
+/**
+ * @module Nyan
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var inherits = require('../utils').inherits;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+
+/**
+ * Expose `Dot`.
+ */
+
+exports = module.exports = NyanCat;
+
+/**
+ * Constructs a new `Nyan` reporter instance.
+ *
+ * @public
+ * @class Nyan
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function NyanCat(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var width = (Base.window.width * 0.75) | 0;
+  var nyanCatWidth = (this.nyanCatWidth = 11);
+
+  this.colorIndex = 0;
+  this.numberOfLines = 4;
+  this.rainbowColors = self.generateColors();
+  this.scoreboardWidth = 5;
+  this.tick = 0;
+  this.trajectories = [[], [], [], []];
+  this.trajectoryWidthMax = width - nyanCatWidth;
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    Base.cursor.hide();
+    self.draw();
+  });
+
+  runner.on(EVENT_TEST_PENDING, function() {
+    self.draw();
+  });
+
+  runner.on(EVENT_TEST_PASS, function() {
+    self.draw();
+  });
+
+  runner.on(EVENT_TEST_FAIL, function() {
+    self.draw();
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    Base.cursor.show();
+    for (var i = 0; i < self.numberOfLines; i++) {
+      write('\n');
+    }
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(NyanCat, Base);
+
+/**
+ * Draw the nyan cat
+ *
+ * @private
+ */
+
+NyanCat.prototype.draw = function() {
+  this.appendRainbow();
+  this.drawScoreboard();
+  this.drawRainbow();
+  this.drawNyanCat();
+  this.tick = !this.tick;
+};
+
+/**
+ * Draw the "scoreboard" showing the number
+ * of passes, failures and pending tests.
+ *
+ * @private
+ */
+
+NyanCat.prototype.drawScoreboard = function() {
+  var stats = this.stats;
+
+  function draw(type, n) {
+    write(' ');
+    write(Base.color(type, n));
+    write('\n');
+  }
+
+  draw('green', stats.passes);
+  draw('fail', stats.failures);
+  draw('pending', stats.pending);
+  write('\n');
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Append the rainbow.
+ *
+ * @private
+ */
+
+NyanCat.prototype.appendRainbow = function() {
+  var segment = this.tick ? '_' : '-';
+  var rainbowified = this.rainbowify(segment);
+
+  for (var index = 0; index < this.numberOfLines; index++) {
+    var trajectory = this.trajectories[index];
+    if (trajectory.length >= this.trajectoryWidthMax) {
+      trajectory.shift();
+    }
+    trajectory.push(rainbowified);
+  }
+};
+
+/**
+ * Draw the rainbow.
+ *
+ * @private
+ */
+
+NyanCat.prototype.drawRainbow = function() {
+  var self = this;
+
+  this.trajectories.forEach(function(line) {
+    write('\u001b[' + self.scoreboardWidth + 'C');
+    write(line.join(''));
+    write('\n');
+  });
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Draw the nyan cat
+ *
+ * @private
+ */
+NyanCat.prototype.drawNyanCat = function() {
+  var self = this;
+  var startWidth = this.scoreboardWidth + this.trajectories[0].length;
+  var dist = '\u001b[' + startWidth + 'C';
+  var padding = '';
+
+  write(dist);
+  write('_,------,');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? '  ' : '   ';
+  write('_|' + padding + '/\\_/\\ ');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? '_' : '__';
+  var tail = self.tick ? '~' : '^';
+  write(tail + '|' + padding + this.face() + ' ');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? ' ' : '  ';
+  write(padding + '""  "" ');
+  write('\n');
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Draw nyan cat face.
+ *
+ * @private
+ * @return {string}
+ */
+
+NyanCat.prototype.face = function() {
+  var stats = this.stats;
+  if (stats.failures) {
+    return '( x .x)';
+  } else if (stats.pending) {
+    return '( o .o)';
+  } else if (stats.passes) {
+    return '( ^ .^)';
+  }
+  return '( - .-)';
+};
+
+/**
+ * Move cursor up `n`.
+ *
+ * @private
+ * @param {number} n
+ */
+
+NyanCat.prototype.cursorUp = function(n) {
+  write('\u001b[' + n + 'A');
+};
+
+/**
+ * Move cursor down `n`.
+ *
+ * @private
+ * @param {number} n
+ */
+
+NyanCat.prototype.cursorDown = function(n) {
+  write('\u001b[' + n + 'B');
+};
+
+/**
+ * Generate rainbow colors.
+ *
+ * @private
+ * @return {Array}
+ */
+NyanCat.prototype.generateColors = function() {
+  var colors = [];
+
+  for (var i = 0; i < 6 * 7; i++) {
+    var pi3 = Math.floor(Math.PI / 3);
+    var n = i * (1.0 / 6);
+    var r = Math.floor(3 * Math.sin(n) + 3);
+    var g = Math.floor(3 * Math.sin(n + 2 * pi3) + 3);
+    var b = Math.floor(3 * Math.sin(n + 4 * pi3) + 3);
+    colors.push(36 * r + 6 * g + b + 16);
+  }
+
+  return colors;
+};
+
+/**
+ * Apply rainbow to the given `str`.
+ *
+ * @private
+ * @param {string} str
+ * @return {string}
+ */
+NyanCat.prototype.rainbowify = function(str) {
+  if (!Base.useColors) {
+    return str;
+  }
+  var color = this.rainbowColors[this.colorIndex % this.rainbowColors.length];
+  this.colorIndex += 1;
+  return '\u001b[38;5;' + color + 'm' + str + '\u001b[0m';
+};
+
+/**
+ * Stdout helper.
+ *
+ * @param {string} string A message to write to stdout.
+ */
+function write(string) {
+  process.stdout.write(string);
+}
+
+NyanCat.description = '"nyan cat"';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/progress.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/progress.js
new file mode 100644
index 00000000000..0211122a9db
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/progress.js
@@ -0,0 +1,104 @@
+'use strict';
+/**
+ * @module Progress
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var inherits = require('../utils').inherits;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `Progress`.
+ */
+
+exports = module.exports = Progress;
+
+/**
+ * General progress bar color.
+ */
+
+Base.colors.progress = 90;
+
+/**
+ * Constructs a new `Progress` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Progress(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var width = (Base.window.width * 0.5) | 0;
+  var total = runner.total;
+  var complete = 0;
+  var lastN = -1;
+
+  // default chars
+  options = options || {};
+  var reporterOptions = options.reporterOptions || {};
+
+  options.open = reporterOptions.open || '[';
+  options.complete = reporterOptions.complete || '▬';
+  options.incomplete = reporterOptions.incomplete || Base.symbols.dot;
+  options.close = reporterOptions.close || ']';
+  options.verbose = reporterOptions.verbose || false;
+
+  // tests started
+  runner.on(EVENT_RUN_BEGIN, function() {
+    process.stdout.write('\n');
+    cursor.hide();
+  });
+
+  // tests complete
+  runner.on(EVENT_TEST_END, function() {
+    complete++;
+
+    var percent = complete / total;
+    var n = (width * percent) | 0;
+    var i = width - n;
+
+    if (n === lastN && !options.verbose) {
+      // Don't re-render the line if it hasn't changed
+      return;
+    }
+    lastN = n;
+
+    cursor.CR();
+    process.stdout.write('\u001b[J');
+    process.stdout.write(color('progress', '  ' + options.open));
+    process.stdout.write(Array(n).join(options.complete));
+    process.stdout.write(Array(i).join(options.incomplete));
+    process.stdout.write(color('progress', options.close));
+    if (options.verbose) {
+      process.stdout.write(color('progress', ' ' + complete + ' of ' + total));
+    }
+  });
+
+  // tests are complete, output some stats
+  // and the failures if any
+  runner.once(EVENT_RUN_END, function() {
+    cursor.show();
+    process.stdout.write('\n');
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Progress, Base);
+
+Progress.description = 'a progress bar';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/spec.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/spec.js
new file mode 100644
index 00000000000..e51ed80ac45
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/spec.js
@@ -0,0 +1,99 @@
+'use strict';
+/**
+ * @module Spec
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_SUITE_END = constants.EVENT_SUITE_END;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var inherits = require('../utils').inherits;
+var color = Base.color;
+
+/**
+ * Expose `Spec`.
+ */
+
+exports = module.exports = Spec;
+
+/**
+ * Constructs a new `Spec` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Spec(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var indents = 0;
+  var n = 0;
+
+  function indent() {
+    return Array(indents).join('  ');
+  }
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    Base.consoleLog();
+  });
+
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    ++indents;
+    Base.consoleLog(color('suite', '%s%s'), indent(), suite.title);
+  });
+
+  runner.on(EVENT_SUITE_END, function() {
+    --indents;
+    if (indents === 1) {
+      Base.consoleLog();
+    }
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    var fmt = indent() + color('pending', '  - %s');
+    Base.consoleLog(fmt, test.title);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    var fmt;
+    if (test.speed === 'fast') {
+      fmt =
+        indent() +
+        color('checkmark', '  ' + Base.symbols.ok) +
+        color('pass', ' %s');
+      Base.consoleLog(fmt, test.title);
+    } else {
+      fmt =
+        indent() +
+        color('checkmark', '  ' + Base.symbols.ok) +
+        color('pass', ' %s') +
+        color(test.speed, ' (%dms)');
+      Base.consoleLog(fmt, test.title, test.duration);
+    }
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    Base.consoleLog(indent() + color('fail', '  %d) %s'), ++n, test.title);
+  });
+
+  runner.once(EVENT_RUN_END, self.epilogue.bind(self));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Spec, Base);
+
+Spec.description = 'hierarchical & verbose [default]';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/tap.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/tap.js
new file mode 100644
index 00000000000..12257a745f3
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/tap.js
@@ -0,0 +1,294 @@
+'use strict';
+/**
+ * @module TAP
+ */
+/**
+ * Module dependencies.
+ */
+
+var util = require('util');
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+var inherits = require('../utils').inherits;
+var sprintf = util.format;
+
+/**
+ * Expose `TAP`.
+ */
+
+exports = module.exports = TAP;
+
+/**
+ * Constructs a new `TAP` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function TAP(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var n = 1;
+
+  var tapVersion = '12';
+  if (options && options.reporterOptions) {
+    if (options.reporterOptions.tapVersion) {
+      tapVersion = options.reporterOptions.tapVersion.toString();
+    }
+  }
+
+  this._producer = createProducer(tapVersion);
+
+  runner.once(EVENT_RUN_BEGIN, function() {
+    var ntests = runner.grepTotal(runner.suite);
+    self._producer.writeVersion();
+    self._producer.writePlan(ntests);
+  });
+
+  runner.on(EVENT_TEST_END, function() {
+    ++n;
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    self._producer.writePending(n, test);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    self._producer.writePass(n, test);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test, err) {
+    self._producer.writeFail(n, test, err);
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    self._producer.writeEpilogue(runner.stats);
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(TAP, Base);
+
+/**
+ * Returns a TAP-safe title of `test`.
+ *
+ * @private
+ * @param {Test} test - Test instance.
+ * @return {String} title with any hash character removed
+ */
+function title(test) {
+  return test.fullTitle().replace(/#/g, '');
+}
+
+/**
+ * Writes newline-terminated formatted string to reporter output stream.
+ *
+ * @private
+ * @param {string} format - `printf`-like format string
+ * @param {...*} [varArgs] - Format string arguments
+ */
+function println(format, varArgs) {
+  var vargs = Array.from(arguments);
+  vargs[0] += '\n';
+  process.stdout.write(sprintf.apply(null, vargs));
+}
+
+/**
+ * Returns a `tapVersion`-appropriate TAP producer instance, if possible.
+ *
+ * @private
+ * @param {string} tapVersion - Version of TAP specification to produce.
+ * @returns {TAPProducer} specification-appropriate instance
+ * @throws {Error} if specification version has no associated producer.
+ */
+function createProducer(tapVersion) {
+  var producers = {
+    '12': new TAP12Producer(),
+    '13': new TAP13Producer()
+  };
+  var producer = producers[tapVersion];
+
+  if (!producer) {
+    throw new Error(
+      'invalid or unsupported TAP version: ' + JSON.stringify(tapVersion)
+    );
+  }
+
+  return producer;
+}
+
+/**
+ * @summary
+ * Constructs a new TAPProducer.
+ *
+ * @description
+ * <em>Only</em> to be used as an abstract base class.
+ *
+ * @private
+ * @constructor
+ */
+function TAPProducer() {}
+
+/**
+ * Writes the TAP version to reporter output stream.
+ *
+ * @abstract
+ */
+TAPProducer.prototype.writeVersion = function() {};
+
+/**
+ * Writes the plan to reporter output stream.
+ *
+ * @abstract
+ * @param {number} ntests - Number of tests that are planned to run.
+ */
+TAPProducer.prototype.writePlan = function(ntests) {
+  println('%d..%d', 1, ntests);
+};
+
+/**
+ * Writes that test passed to reporter output stream.
+ *
+ * @abstract
+ * @param {number} n - Index of test that passed.
+ * @param {Test} test - Instance containing test information.
+ */
+TAPProducer.prototype.writePass = function(n, test) {
+  println('ok %d %s', n, title(test));
+};
+
+/**
+ * Writes that test was skipped to reporter output stream.
+ *
+ * @abstract
+ * @param {number} n - Index of test that was skipped.
+ * @param {Test} test - Instance containing test information.
+ */
+TAPProducer.prototype.writePending = function(n, test) {
+  println('ok %d %s # SKIP -', n, title(test));
+};
+
+/**
+ * Writes that test failed to reporter output stream.
+ *
+ * @abstract
+ * @param {number} n - Index of test that failed.
+ * @param {Test} test - Instance containing test information.
+ * @param {Error} err - Reason the test failed.
+ */
+TAPProducer.prototype.writeFail = function(n, test, err) {
+  println('not ok %d %s', n, title(test));
+};
+
+/**
+ * Writes the summary epilogue to reporter output stream.
+ *
+ * @abstract
+ * @param {Object} stats - Object containing run statistics.
+ */
+TAPProducer.prototype.writeEpilogue = function(stats) {
+  // :TBD: Why is this not counting pending tests?
+  println('# tests ' + (stats.passes + stats.failures));
+  println('# pass ' + stats.passes);
+  // :TBD: Why are we not showing pending results?
+  println('# fail ' + stats.failures);
+};
+
+/**
+ * @summary
+ * Constructs a new TAP12Producer.
+ *
+ * @description
+ * Produces output conforming to the TAP12 specification.
+ *
+ * @private
+ * @constructor
+ * @extends TAPProducer
+ * @see {@link https://testanything.org/tap-specification.html|Specification}
+ */
+function TAP12Producer() {
+  /**
+   * Writes that test failed to reporter output stream, with error formatting.
+   * @override
+   */
+  this.writeFail = function(n, test, err) {
+    TAPProducer.prototype.writeFail.call(this, n, test, err);
+    if (err.message) {
+      println(err.message.replace(/^/gm, '  '));
+    }
+    if (err.stack) {
+      println(err.stack.replace(/^/gm, '  '));
+    }
+  };
+}
+
+/**
+ * Inherit from `TAPProducer.prototype`.
+ */
+inherits(TAP12Producer, TAPProducer);
+
+/**
+ * @summary
+ * Constructs a new TAP13Producer.
+ *
+ * @description
+ * Produces output conforming to the TAP13 specification.
+ *
+ * @private
+ * @constructor
+ * @extends TAPProducer
+ * @see {@link https://testanything.org/tap-version-13-specification.html|Specification}
+ */
+function TAP13Producer() {
+  /**
+   * Writes the TAP version to reporter output stream.
+   * @override
+   */
+  this.writeVersion = function() {
+    println('TAP version 13');
+  };
+
+  /**
+   * Writes that test failed to reporter output stream, with error formatting.
+   * @override
+   */
+  this.writeFail = function(n, test, err) {
+    TAPProducer.prototype.writeFail.call(this, n, test, err);
+    var emitYamlBlock = err.message != null || err.stack != null;
+    if (emitYamlBlock) {
+      println(indent(1) + '---');
+      if (err.message) {
+        println(indent(2) + 'message: |-');
+        println(err.message.replace(/^/gm, indent(3)));
+      }
+      if (err.stack) {
+        println(indent(2) + 'stack: |-');
+        println(err.stack.replace(/^/gm, indent(3)));
+      }
+      println(indent(1) + '...');
+    }
+  };
+
+  function indent(level) {
+    return Array(level + 1).join('  ');
+  }
+}
+
+/**
+ * Inherit from `TAPProducer.prototype`.
+ */
+inherits(TAP13Producer, TAPProducer);
+
+TAP.description = 'TAP-compatible output';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/xunit.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/xunit.js
new file mode 100644
index 00000000000..6c9c937be89
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/reporters/xunit.js
@@ -0,0 +1,216 @@
+'use strict';
+/**
+ * @module XUnit
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var fs = require('fs');
+var mkdirp = require('mkdirp');
+var path = require('path');
+var errors = require('../errors');
+var createUnsupportedError = errors.createUnsupportedError;
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var STATE_FAILED = require('../runnable').constants.STATE_FAILED;
+var inherits = utils.inherits;
+var escape = utils.escape;
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+var Date = global.Date;
+
+/**
+ * Expose `XUnit`.
+ */
+
+exports = module.exports = XUnit;
+
+/**
+ * Constructs a new `XUnit` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function XUnit(runner, options) {
+  Base.call(this, runner, options);
+
+  var stats = this.stats;
+  var tests = [];
+  var self = this;
+
+  // the name of the test suite, as it will appear in the resulting XML file
+  var suiteName;
+
+  // the default name of the test suite if none is provided
+  var DEFAULT_SUITE_NAME = 'Mocha Tests';
+
+  if (options && options.reporterOptions) {
+    if (options.reporterOptions.output) {
+      if (!fs.createWriteStream) {
+        throw createUnsupportedError('file output not supported in browser');
+      }
+
+      mkdirp.sync(path.dirname(options.reporterOptions.output));
+      self.fileStream = fs.createWriteStream(options.reporterOptions.output);
+    }
+
+    // get the suite name from the reporter options (if provided)
+    suiteName = options.reporterOptions.suiteName;
+  }
+
+  // fall back to the default suite name
+  suiteName = suiteName || DEFAULT_SUITE_NAME;
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    tests.push(test);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    tests.push(test);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    tests.push(test);
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    self.write(
+      tag(
+        'testsuite',
+        {
+          name: suiteName,
+          tests: stats.tests,
+          failures: 0,
+          errors: stats.failures,
+          skipped: stats.tests - stats.failures - stats.passes,
+          timestamp: new Date().toUTCString(),
+          time: stats.duration / 1000 || 0
+        },
+        false
+      )
+    );
+
+    tests.forEach(function(t) {
+      self.test(t);
+    });
+
+    self.write('</testsuite>');
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(XUnit, Base);
+
+/**
+ * Override done to close the stream (if it's a file).
+ *
+ * @param failures
+ * @param {Function} fn
+ */
+XUnit.prototype.done = function(failures, fn) {
+  if (this.fileStream) {
+    this.fileStream.end(function() {
+      fn(failures);
+    });
+  } else {
+    fn(failures);
+  }
+};
+
+/**
+ * Write out the given line.
+ *
+ * @param {string} line
+ */
+XUnit.prototype.write = function(line) {
+  if (this.fileStream) {
+    this.fileStream.write(line + '\n');
+  } else if (typeof process === 'object' && process.stdout) {
+    process.stdout.write(line + '\n');
+  } else {
+    Base.consoleLog(line);
+  }
+};
+
+/**
+ * Output tag for the given `test.`
+ *
+ * @param {Test} test
+ */
+XUnit.prototype.test = function(test) {
+  Base.useColors = false;
+
+  var attrs = {
+    classname: test.parent.fullTitle(),
+    name: test.title,
+    time: test.duration / 1000 || 0
+  };
+
+  if (test.state === STATE_FAILED) {
+    var err = test.err;
+    var diff =
+      Base.hideDiff || !err.actual || !err.expected
+        ? ''
+        : '\n' + Base.generateDiff(err.actual, err.expected);
+    this.write(
+      tag(
+        'testcase',
+        attrs,
+        false,
+        tag(
+          'failure',
+          {},
+          false,
+          escape(err.message) + escape(diff) + '\n' + escape(err.stack)
+        )
+      )
+    );
+  } else if (test.isPending()) {
+    this.write(tag('testcase', attrs, false, tag('skipped', {}, true)));
+  } else {
+    this.write(tag('testcase', attrs, true));
+  }
+};
+
+/**
+ * HTML tag helper.
+ *
+ * @param name
+ * @param attrs
+ * @param close
+ * @param content
+ * @return {string}
+ */
+function tag(name, attrs, close, content) {
+  var end = close ? '/>' : '>';
+  var pairs = [];
+  var tag;
+
+  for (var key in attrs) {
+    if (Object.prototype.hasOwnProperty.call(attrs, key)) {
+      pairs.push(key + '="' + escape(attrs[key]) + '"');
+    }
+  }
+
+  tag = '<' + name + (pairs.length ? ' ' + pairs.join(' ') : '') + end;
+  if (content) {
+    tag += content + '</' + name + end;
+  }
+  return tag;
+}
+
+XUnit.description = 'XUnit-compatible XML output';
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/runnable.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/runnable.js
new file mode 100644
index 00000000000..026ab06b405
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/runnable.js
@@ -0,0 +1,496 @@
+'use strict';
+
+var EventEmitter = require('events').EventEmitter;
+var Pending = require('./pending');
+var debug = require('debug')('mocha:runnable');
+var milliseconds = require('ms');
+var utils = require('./utils');
+var createInvalidExceptionError = require('./errors')
+  .createInvalidExceptionError;
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var clearTimeout = global.clearTimeout;
+var toString = Object.prototype.toString;
+
+module.exports = Runnable;
+
+/**
+ * Initialize a new `Runnable` with the given `title` and callback `fn`.
+ *
+ * @class
+ * @extends external:EventEmitter
+ * @public
+ * @param {String} title
+ * @param {Function} fn
+ */
+function Runnable(title, fn) {
+  this.title = title;
+  this.fn = fn;
+  this.body = (fn || '').toString();
+  this.async = fn && fn.length;
+  this.sync = !this.async;
+  this._timeout = 2000;
+  this._slow = 75;
+  this._enableTimeouts = true;
+  this.timedOut = false;
+  this._retries = -1;
+  this._currentRetry = 0;
+  this.pending = false;
+}
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+utils.inherits(Runnable, EventEmitter);
+
+/**
+ * Get current timeout value in msecs.
+ *
+ * @private
+ * @returns {number} current timeout threshold value
+ */
+/**
+ * @summary
+ * Set timeout threshold value (msecs).
+ *
+ * @description
+ * A string argument can use shorthand (e.g., "2s") and will be converted.
+ * The value will be clamped to range [<code>0</code>, <code>2^<sup>31</sup>-1</code>].
+ * If clamped value matches either range endpoint, timeouts will be disabled.
+ *
+ * @private
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/API/WindowOrWorkerGlobalScope/setTimeout#Maximum_delay_value}
+ * @param {number|string} ms - Timeout threshold value.
+ * @returns {Runnable} this
+ * @chainable
+ */
+Runnable.prototype.timeout = function(ms) {
+  if (!arguments.length) {
+    return this._timeout;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+
+  // Clamp to range
+  var INT_MAX = Math.pow(2, 31) - 1;
+  var range = [0, INT_MAX];
+  ms = utils.clamp(ms, range);
+
+  // see #1652 for reasoning
+  if (ms === range[0] || ms === range[1]) {
+    this._enableTimeouts = false;
+  }
+  debug('timeout %d', ms);
+  this._timeout = ms;
+  if (this.timer) {
+    this.resetTimeout();
+  }
+  return this;
+};
+
+/**
+ * Set or get slow `ms`.
+ *
+ * @private
+ * @param {number|string} ms
+ * @return {Runnable|number} ms or Runnable instance.
+ */
+Runnable.prototype.slow = function(ms) {
+  if (!arguments.length || typeof ms === 'undefined') {
+    return this._slow;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('slow %d', ms);
+  this._slow = ms;
+  return this;
+};
+
+/**
+ * Set and get whether timeout is `enabled`.
+ *
+ * @private
+ * @param {boolean} enabled
+ * @return {Runnable|boolean} enabled or Runnable instance.
+ */
+Runnable.prototype.enableTimeouts = function(enabled) {
+  if (!arguments.length) {
+    return this._enableTimeouts;
+  }
+  debug('enableTimeouts %s', enabled);
+  this._enableTimeouts = enabled;
+  return this;
+};
+
+/**
+ * Halt and mark as pending.
+ *
+ * @memberof Mocha.Runnable
+ * @public
+ */
+Runnable.prototype.skip = function() {
+  throw new Pending('sync skip');
+};
+
+/**
+ * Check if this runnable or its parent suite is marked as pending.
+ *
+ * @private
+ */
+Runnable.prototype.isPending = function() {
+  return this.pending || (this.parent && this.parent.isPending());
+};
+
+/**
+ * Return `true` if this Runnable has failed.
+ * @return {boolean}
+ * @private
+ */
+Runnable.prototype.isFailed = function() {
+  return !this.isPending() && this.state === constants.STATE_FAILED;
+};
+
+/**
+ * Return `true` if this Runnable has passed.
+ * @return {boolean}
+ * @private
+ */
+Runnable.prototype.isPassed = function() {
+  return !this.isPending() && this.state === constants.STATE_PASSED;
+};
+
+/**
+ * Set or get number of retries.
+ *
+ * @private
+ */
+Runnable.prototype.retries = function(n) {
+  if (!arguments.length) {
+    return this._retries;
+  }
+  this._retries = n;
+};
+
+/**
+ * Set or get current retry
+ *
+ * @private
+ */
+Runnable.prototype.currentRetry = function(n) {
+  if (!arguments.length) {
+    return this._currentRetry;
+  }
+  this._currentRetry = n;
+};
+
+/**
+ * Return the full title generated by recursively concatenating the parent's
+ * full title.
+ *
+ * @memberof Mocha.Runnable
+ * @public
+ * @return {string}
+ */
+Runnable.prototype.fullTitle = function() {
+  return this.titlePath().join(' ');
+};
+
+/**
+ * Return the title path generated by concatenating the parent's title path with the title.
+ *
+ * @memberof Mocha.Runnable
+ * @public
+ * @return {string}
+ */
+Runnable.prototype.titlePath = function() {
+  return this.parent.titlePath().concat([this.title]);
+};
+
+/**
+ * Clear the timeout.
+ *
+ * @private
+ */
+Runnable.prototype.clearTimeout = function() {
+  clearTimeout(this.timer);
+};
+
+/**
+ * Inspect the runnable void of private properties.
+ *
+ * @private
+ * @return {string}
+ */
+Runnable.prototype.inspect = function() {
+  return JSON.stringify(
+    this,
+    function(key, val) {
+      if (key[0] === '_') {
+        return;
+      }
+      if (key === 'parent') {
+        return '#<Suite>';
+      }
+      if (key === 'ctx') {
+        return '#<Context>';
+      }
+      return val;
+    },
+    2
+  );
+};
+
+/**
+ * Reset the timeout.
+ *
+ * @private
+ */
+Runnable.prototype.resetTimeout = function() {
+  var self = this;
+  var ms = this.timeout() || 1e9;
+
+  if (!this._enableTimeouts) {
+    return;
+  }
+  this.clearTimeout();
+  this.timer = setTimeout(function() {
+    if (!self._enableTimeouts) {
+      return;
+    }
+    self.callback(self._timeoutError(ms));
+    self.timedOut = true;
+  }, ms);
+};
+
+/**
+ * Set or get a list of whitelisted globals for this test run.
+ *
+ * @private
+ * @param {string[]} globals
+ */
+Runnable.prototype.globals = function(globals) {
+  if (!arguments.length) {
+    return this._allowedGlobals;
+  }
+  this._allowedGlobals = globals;
+};
+
+/**
+ * Run the test and invoke `fn(err)`.
+ *
+ * @param {Function} fn
+ * @private
+ */
+Runnable.prototype.run = function(fn) {
+  var self = this;
+  var start = new Date();
+  var ctx = this.ctx;
+  var finished;
+  var emitted;
+
+  // Sometimes the ctx exists, but it is not runnable
+  if (ctx && ctx.runnable) {
+    ctx.runnable(this);
+  }
+
+  // called multiple times
+  function multiple(err) {
+    if (emitted) {
+      return;
+    }
+    emitted = true;
+    var msg = 'done() called multiple times';
+    if (err && err.message) {
+      err.message += " (and Mocha's " + msg + ')';
+      self.emit('error', err);
+    } else {
+      self.emit('error', new Error(msg));
+    }
+  }
+
+  // finished
+  function done(err) {
+    var ms = self.timeout();
+    if (self.timedOut) {
+      return;
+    }
+
+    if (finished) {
+      return multiple(err);
+    }
+
+    self.clearTimeout();
+    self.duration = new Date() - start;
+    finished = true;
+    if (!err && self.duration > ms && self._enableTimeouts) {
+      err = self._timeoutError(ms);
+    }
+    fn(err);
+  }
+
+  // for .resetTimeout()
+  this.callback = done;
+
+  // explicit async with `done` argument
+  if (this.async) {
+    this.resetTimeout();
+
+    // allows skip() to be used in an explicit async context
+    this.skip = function asyncSkip() {
+      done(new Pending('async skip call'));
+      // halt execution.  the Runnable will be marked pending
+      // by the previous call, and the uncaught handler will ignore
+      // the failure.
+      throw new Pending('async skip; aborting execution');
+    };
+
+    if (this.allowUncaught) {
+      return callFnAsync(this.fn);
+    }
+    try {
+      callFnAsync(this.fn);
+    } catch (err) {
+      emitted = true;
+      done(Runnable.toValueOrError(err));
+    }
+    return;
+  }
+
+  if (this.allowUncaught) {
+    if (this.isPending()) {
+      done();
+    } else {
+      callFn(this.fn);
+    }
+    return;
+  }
+
+  // sync or promise-returning
+  try {
+    if (this.isPending()) {
+      done();
+    } else {
+      callFn(this.fn);
+    }
+  } catch (err) {
+    emitted = true;
+    done(Runnable.toValueOrError(err));
+  }
+
+  function callFn(fn) {
+    var result = fn.call(ctx);
+    if (result && typeof result.then === 'function') {
+      self.resetTimeout();
+      result.then(
+        function() {
+          done();
+          // Return null so libraries like bluebird do not warn about
+          // subsequently constructed Promises.
+          return null;
+        },
+        function(reason) {
+          done(reason || new Error('Promise rejected with no or falsy reason'));
+        }
+      );
+    } else {
+      if (self.asyncOnly) {
+        return done(
+          new Error(
+            '--async-only option in use without declaring `done()` or returning a promise'
+          )
+        );
+      }
+
+      done();
+    }
+  }
+
+  function callFnAsync(fn) {
+    var result = fn.call(ctx, function(err) {
+      if (err instanceof Error || toString.call(err) === '[object Error]') {
+        return done(err);
+      }
+      if (err) {
+        if (Object.prototype.toString.call(err) === '[object Object]') {
+          return done(
+            new Error('done() invoked with non-Error: ' + JSON.stringify(err))
+          );
+        }
+        return done(new Error('done() invoked with non-Error: ' + err));
+      }
+      if (result && utils.isPromise(result)) {
+        return done(
+          new Error(
+            'Resolution method is overspecified. Specify a callback *or* return a Promise; not both.'
+          )
+        );
+      }
+
+      done();
+    });
+  }
+};
+
+/**
+ * Instantiates a "timeout" error
+ *
+ * @param {number} ms - Timeout (in milliseconds)
+ * @returns {Error} a "timeout" error
+ * @private
+ */
+Runnable.prototype._timeoutError = function(ms) {
+  var msg =
+    'Timeout of ' +
+    ms +
+    'ms exceeded. For async tests and hooks, ensure "done()" is called; if returning a Promise, ensure it resolves.';
+  if (this.file) {
+    msg += ' (' + this.file + ')';
+  }
+  return new Error(msg);
+};
+
+var constants = utils.defineConstants(
+  /**
+   * {@link Runnable}-related constants.
+   * @public
+   * @memberof Runnable
+   * @readonly
+   * @static
+   * @alias constants
+   * @enum {string}
+   */
+  {
+    /**
+     * Value of `state` prop when a `Runnable` has failed
+     */
+    STATE_FAILED: 'failed',
+    /**
+     * Value of `state` prop when a `Runnable` has passed
+     */
+    STATE_PASSED: 'passed'
+  }
+);
+
+/**
+ * Given `value`, return identity if truthy, otherwise create an "invalid exception" error and return that.
+ * @param {*} [value] - Value to return, if present
+ * @returns {*|Error} `value`, otherwise an `Error`
+ * @private
+ */
+Runnable.toValueOrError = function(value) {
+  return (
+    value ||
+    createInvalidExceptionError(
+      'Runnable failed with falsy or undefined exception. Please throw an Error instead.',
+      value
+    )
+  );
+};
+
+Runnable.constants = constants;
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/runner.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/runner.js
new file mode 100644
index 00000000000..e41f6c5f97f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/runner.js
@@ -0,0 +1,1049 @@
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+var util = require('util');
+var EventEmitter = require('events').EventEmitter;
+var Pending = require('./pending');
+var utils = require('./utils');
+var inherits = utils.inherits;
+var debug = require('debug')('mocha:runner');
+var Runnable = require('./runnable');
+var Suite = require('./suite');
+var HOOK_TYPE_BEFORE_EACH = Suite.constants.HOOK_TYPE_BEFORE_EACH;
+var HOOK_TYPE_AFTER_EACH = Suite.constants.HOOK_TYPE_AFTER_EACH;
+var HOOK_TYPE_AFTER_ALL = Suite.constants.HOOK_TYPE_AFTER_ALL;
+var HOOK_TYPE_BEFORE_ALL = Suite.constants.HOOK_TYPE_BEFORE_ALL;
+var EVENT_ROOT_SUITE_RUN = Suite.constants.EVENT_ROOT_SUITE_RUN;
+var STATE_FAILED = Runnable.constants.STATE_FAILED;
+var STATE_PASSED = Runnable.constants.STATE_PASSED;
+var dQuote = utils.dQuote;
+var ngettext = utils.ngettext;
+var sQuote = utils.sQuote;
+var stackFilter = utils.stackTraceFilter();
+var stringify = utils.stringify;
+var type = utils.type;
+var createInvalidExceptionError = require('./errors')
+  .createInvalidExceptionError;
+
+/**
+ * Non-enumerable globals.
+ * @readonly
+ */
+var globals = [
+  'setTimeout',
+  'clearTimeout',
+  'setInterval',
+  'clearInterval',
+  'XMLHttpRequest',
+  'Date',
+  'setImmediate',
+  'clearImmediate'
+];
+
+var constants = utils.defineConstants(
+  /**
+   * {@link Runner}-related constants.
+   * @public
+   * @memberof Runner
+   * @readonly
+   * @alias constants
+   * @static
+   * @enum {string}
+   */
+  {
+    /**
+     * Emitted when {@link Hook} execution begins
+     */
+    EVENT_HOOK_BEGIN: 'hook',
+    /**
+     * Emitted when {@link Hook} execution ends
+     */
+    EVENT_HOOK_END: 'hook end',
+    /**
+     * Emitted when Root {@link Suite} execution begins (all files have been parsed and hooks/tests are ready for execution)
+     */
+    EVENT_RUN_BEGIN: 'start',
+    /**
+     * Emitted when Root {@link Suite} execution has been delayed via `delay` option
+     */
+    EVENT_DELAY_BEGIN: 'waiting',
+    /**
+     * Emitted when delayed Root {@link Suite} execution is triggered by user via `global.run()`
+     */
+    EVENT_DELAY_END: 'ready',
+    /**
+     * Emitted when Root {@link Suite} execution ends
+     */
+    EVENT_RUN_END: 'end',
+    /**
+     * Emitted when {@link Suite} execution begins
+     */
+    EVENT_SUITE_BEGIN: 'suite',
+    /**
+     * Emitted when {@link Suite} execution ends
+     */
+    EVENT_SUITE_END: 'suite end',
+    /**
+     * Emitted when {@link Test} execution begins
+     */
+    EVENT_TEST_BEGIN: 'test',
+    /**
+     * Emitted when {@link Test} execution ends
+     */
+    EVENT_TEST_END: 'test end',
+    /**
+     * Emitted when {@link Test} execution fails
+     */
+    EVENT_TEST_FAIL: 'fail',
+    /**
+     * Emitted when {@link Test} execution succeeds
+     */
+    EVENT_TEST_PASS: 'pass',
+    /**
+     * Emitted when {@link Test} becomes pending
+     */
+    EVENT_TEST_PENDING: 'pending',
+    /**
+     * Emitted when {@link Test} execution has failed, but will retry
+     */
+    EVENT_TEST_RETRY: 'retry'
+  }
+);
+
+module.exports = Runner;
+
+/**
+ * Initialize a `Runner` at the Root {@link Suite}, which represents a hierarchy of {@link Suite|Suites} and {@link Test|Tests}.
+ *
+ * @extends external:EventEmitter
+ * @public
+ * @class
+ * @param {Suite} suite Root suite
+ * @param {boolean} [delay] Whether or not to delay execution of root suite
+ * until ready.
+ */
+function Runner(suite, delay) {
+  var self = this;
+  this._globals = [];
+  this._abort = false;
+  this._delay = delay;
+  this.suite = suite;
+  this.started = false;
+  this.total = suite.total();
+  this.failures = 0;
+  this.on(constants.EVENT_TEST_END, function(test) {
+    self.checkGlobals(test);
+  });
+  this.on(constants.EVENT_HOOK_END, function(hook) {
+    self.checkGlobals(hook);
+  });
+  this._defaultGrep = /.*/;
+  this.grep(this._defaultGrep);
+  this.globals(this.globalProps().concat(extraGlobals()));
+}
+
+/**
+ * Wrapper for setImmediate, process.nextTick, or browser polyfill.
+ *
+ * @param {Function} fn
+ * @private
+ */
+Runner.immediately = global.setImmediate || process.nextTick;
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+inherits(Runner, EventEmitter);
+
+/**
+ * Run tests with full titles matching `re`. Updates runner.total
+ * with number of tests matched.
+ *
+ * @public
+ * @memberof Runner
+ * @param {RegExp} re
+ * @param {boolean} invert
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.grep = function(re, invert) {
+  debug('grep %s', re);
+  this._grep = re;
+  this._invert = invert;
+  this.total = this.grepTotal(this.suite);
+  return this;
+};
+
+/**
+ * Returns the number of tests matching the grep search for the
+ * given suite.
+ *
+ * @memberof Runner
+ * @public
+ * @param {Suite} suite
+ * @return {number}
+ */
+Runner.prototype.grepTotal = function(suite) {
+  var self = this;
+  var total = 0;
+
+  suite.eachTest(function(test) {
+    var match = self._grep.test(test.fullTitle());
+    if (self._invert) {
+      match = !match;
+    }
+    if (match) {
+      total++;
+    }
+  });
+
+  return total;
+};
+
+/**
+ * Return a list of global properties.
+ *
+ * @return {Array}
+ * @private
+ */
+Runner.prototype.globalProps = function() {
+  var props = Object.keys(global);
+
+  // non-enumerables
+  for (var i = 0; i < globals.length; ++i) {
+    if (~props.indexOf(globals[i])) {
+      continue;
+    }
+    props.push(globals[i]);
+  }
+
+  return props;
+};
+
+/**
+ * Allow the given `arr` of globals.
+ *
+ * @public
+ * @memberof Runner
+ * @param {Array} arr
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.globals = function(arr) {
+  if (!arguments.length) {
+    return this._globals;
+  }
+  debug('globals %j', arr);
+  this._globals = this._globals.concat(arr);
+  return this;
+};
+
+/**
+ * Check for global variable leaks.
+ *
+ * @private
+ */
+Runner.prototype.checkGlobals = function(test) {
+  if (this.ignoreLeaks) {
+    return;
+  }
+  var ok = this._globals;
+
+  var globals = this.globalProps();
+  var leaks;
+
+  if (test) {
+    ok = ok.concat(test._allowedGlobals || []);
+  }
+
+  if (this.prevGlobalsLength === globals.length) {
+    return;
+  }
+  this.prevGlobalsLength = globals.length;
+
+  leaks = filterLeaks(ok, globals);
+  this._globals = this._globals.concat(leaks);
+
+  if (leaks.length) {
+    var format = ngettext(
+      leaks.length,
+      'global leak detected: %s',
+      'global leaks detected: %s'
+    );
+    var error = new Error(util.format(format, leaks.map(sQuote).join(', ')));
+    this.fail(test, error);
+  }
+};
+
+/**
+ * Fail the given `test`.
+ *
+ * @private
+ * @param {Test} test
+ * @param {Error} err
+ */
+Runner.prototype.fail = function(test, err) {
+  if (test.isPending()) {
+    return;
+  }
+
+  ++this.failures;
+  test.state = STATE_FAILED;
+
+  if (!isError(err)) {
+    err = thrown2Error(err);
+  }
+
+  try {
+    err.stack =
+      this.fullStackTrace || !err.stack ? err.stack : stackFilter(err.stack);
+  } catch (ignore) {
+    // some environments do not take kindly to monkeying with the stack
+  }
+
+  this.emit(constants.EVENT_TEST_FAIL, test, err);
+};
+
+/**
+ * Fail the given `hook` with `err`.
+ *
+ * Hook failures work in the following pattern:
+ * - If bail, run corresponding `after each` and `after` hooks,
+ *   then exit
+ * - Failed `before` hook skips all tests in a suite and subsuites,
+ *   but jumps to corresponding `after` hook
+ * - Failed `before each` hook skips remaining tests in a
+ *   suite and jumps to corresponding `after each` hook,
+ *   which is run only once
+ * - Failed `after` hook does not alter
+ *   execution order
+ * - Failed `after each` hook skips remaining tests in a
+ *   suite and subsuites, but executes other `after each`
+ *   hooks
+ *
+ * @private
+ * @param {Hook} hook
+ * @param {Error} err
+ */
+Runner.prototype.failHook = function(hook, err) {
+  hook.originalTitle = hook.originalTitle || hook.title;
+  if (hook.ctx && hook.ctx.currentTest) {
+    hook.title =
+      hook.originalTitle + ' for ' + dQuote(hook.ctx.currentTest.title);
+  } else {
+    var parentTitle;
+    if (hook.parent.title) {
+      parentTitle = hook.parent.title;
+    } else {
+      parentTitle = hook.parent.root ? '{root}' : '';
+    }
+    hook.title = hook.originalTitle + ' in ' + dQuote(parentTitle);
+  }
+
+  this.fail(hook, err);
+};
+
+/**
+ * Run hook `name` callbacks and then invoke `fn()`.
+ *
+ * @private
+ * @param {string} name
+ * @param {Function} fn
+ */
+
+Runner.prototype.hook = function(name, fn) {
+  var suite = this.suite;
+  var hooks = suite.getHooks(name);
+  var self = this;
+
+  function next(i) {
+    var hook = hooks[i];
+    if (!hook) {
+      return fn();
+    }
+    self.currentRunnable = hook;
+
+    if (name === HOOK_TYPE_BEFORE_ALL) {
+      hook.ctx.currentTest = hook.parent.tests[0];
+    } else if (name === HOOK_TYPE_AFTER_ALL) {
+      hook.ctx.currentTest = hook.parent.tests[hook.parent.tests.length - 1];
+    } else {
+      hook.ctx.currentTest = self.test;
+    }
+
+    hook.allowUncaught = self.allowUncaught;
+
+    self.emit(constants.EVENT_HOOK_BEGIN, hook);
+
+    if (!hook.listeners('error').length) {
+      hook.on('error', function(err) {
+        self.failHook(hook, err);
+      });
+    }
+
+    hook.run(function(err) {
+      var testError = hook.error();
+      if (testError) {
+        self.fail(self.test, testError);
+      }
+      if (err) {
+        if (err instanceof Pending) {
+          if (name === HOOK_TYPE_AFTER_ALL) {
+            utils.deprecate(
+              'Skipping a test within an "after all" hook is DEPRECATED and will throw an exception in a future version of Mocha. ' +
+                'Use a return statement or other means to abort hook execution.'
+            );
+          }
+          if (name === HOOK_TYPE_BEFORE_EACH || name === HOOK_TYPE_AFTER_EACH) {
+            if (self.test) {
+              self.test.pending = true;
+            }
+          } else {
+            suite.tests.forEach(function(test) {
+              test.pending = true;
+            });
+            suite.suites.forEach(function(suite) {
+              suite.pending = true;
+            });
+            // a pending hook won't be executed twice.
+            hook.pending = true;
+          }
+        } else {
+          self.failHook(hook, err);
+
+          // stop executing hooks, notify callee of hook err
+          return fn(err);
+        }
+      }
+      self.emit(constants.EVENT_HOOK_END, hook);
+      delete hook.ctx.currentTest;
+      next(++i);
+    });
+  }
+
+  Runner.immediately(function() {
+    next(0);
+  });
+};
+
+/**
+ * Run hook `name` for the given array of `suites`
+ * in order, and callback `fn(err, errSuite)`.
+ *
+ * @private
+ * @param {string} name
+ * @param {Array} suites
+ * @param {Function} fn
+ */
+Runner.prototype.hooks = function(name, suites, fn) {
+  var self = this;
+  var orig = this.suite;
+
+  function next(suite) {
+    self.suite = suite;
+
+    if (!suite) {
+      self.suite = orig;
+      return fn();
+    }
+
+    self.hook(name, function(err) {
+      if (err) {
+        var errSuite = self.suite;
+        self.suite = orig;
+        return fn(err, errSuite);
+      }
+
+      next(suites.pop());
+    });
+  }
+
+  next(suites.pop());
+};
+
+/**
+ * Run hooks from the top level down.
+ *
+ * @param {String} name
+ * @param {Function} fn
+ * @private
+ */
+Runner.prototype.hookUp = function(name, fn) {
+  var suites = [this.suite].concat(this.parents()).reverse();
+  this.hooks(name, suites, fn);
+};
+
+/**
+ * Run hooks from the bottom up.
+ *
+ * @param {String} name
+ * @param {Function} fn
+ * @private
+ */
+Runner.prototype.hookDown = function(name, fn) {
+  var suites = [this.suite].concat(this.parents());
+  this.hooks(name, suites, fn);
+};
+
+/**
+ * Return an array of parent Suites from
+ * closest to furthest.
+ *
+ * @return {Array}
+ * @private
+ */
+Runner.prototype.parents = function() {
+  var suite = this.suite;
+  var suites = [];
+  while (suite.parent) {
+    suite = suite.parent;
+    suites.push(suite);
+  }
+  return suites;
+};
+
+/**
+ * Run the current test and callback `fn(err)`.
+ *
+ * @param {Function} fn
+ * @private
+ */
+Runner.prototype.runTest = function(fn) {
+  var self = this;
+  var test = this.test;
+
+  if (!test) {
+    return;
+  }
+
+  var suite = this.parents().reverse()[0] || this.suite;
+  if (this.forbidOnly && suite.hasOnly()) {
+    fn(new Error('`.only` forbidden'));
+    return;
+  }
+  if (this.asyncOnly) {
+    test.asyncOnly = true;
+  }
+  test.on('error', function(err) {
+    self.fail(test, err);
+  });
+  if (this.allowUncaught) {
+    test.allowUncaught = true;
+    return test.run(fn);
+  }
+  try {
+    test.run(fn);
+  } catch (err) {
+    fn(err);
+  }
+};
+
+/**
+ * Run tests in the given `suite` and invoke the callback `fn()` when complete.
+ *
+ * @private
+ * @param {Suite} suite
+ * @param {Function} fn
+ */
+Runner.prototype.runTests = function(suite, fn) {
+  var self = this;
+  var tests = suite.tests.slice();
+  var test;
+
+  function hookErr(_, errSuite, after) {
+    // before/after Each hook for errSuite failed:
+    var orig = self.suite;
+
+    // for failed 'after each' hook start from errSuite parent,
+    // otherwise start from errSuite itself
+    self.suite = after ? errSuite.parent : errSuite;
+
+    if (self.suite) {
+      // call hookUp afterEach
+      self.hookUp(HOOK_TYPE_AFTER_EACH, function(err2, errSuite2) {
+        self.suite = orig;
+        // some hooks may fail even now
+        if (err2) {
+          return hookErr(err2, errSuite2, true);
+        }
+        // report error suite
+        fn(errSuite);
+      });
+    } else {
+      // there is no need calling other 'after each' hooks
+      self.suite = orig;
+      fn(errSuite);
+    }
+  }
+
+  function next(err, errSuite) {
+    // if we bail after first err
+    if (self.failures && suite._bail) {
+      tests = [];
+    }
+
+    if (self._abort) {
+      return fn();
+    }
+
+    if (err) {
+      return hookErr(err, errSuite, true);
+    }
+
+    // next test
+    test = tests.shift();
+
+    // all done
+    if (!test) {
+      return fn();
+    }
+
+    // grep
+    var match = self._grep.test(test.fullTitle());
+    if (self._invert) {
+      match = !match;
+    }
+    if (!match) {
+      // Run immediately only if we have defined a grep. When we
+      // define a grep — It can cause maximum callstack error if
+      // the grep is doing a large recursive loop by neglecting
+      // all tests. The run immediately function also comes with
+      // a performance cost. So we don't want to run immediately
+      // if we run the whole test suite, because running the whole
+      // test suite don't do any immediate recursive loops. Thus,
+      // allowing a JS runtime to breathe.
+      if (self._grep !== self._defaultGrep) {
+        Runner.immediately(next);
+      } else {
+        next();
+      }
+      return;
+    }
+
+    if (test.isPending()) {
+      if (self.forbidPending) {
+        test.isPending = alwaysFalse;
+        self.fail(test, new Error('Pending test forbidden'));
+        delete test.isPending;
+      } else {
+        self.emit(constants.EVENT_TEST_PENDING, test);
+      }
+      self.emit(constants.EVENT_TEST_END, test);
+      return next();
+    }
+
+    // execute test and hook(s)
+    self.emit(constants.EVENT_TEST_BEGIN, (self.test = test));
+    self.hookDown(HOOK_TYPE_BEFORE_EACH, function(err, errSuite) {
+      if (test.isPending()) {
+        if (self.forbidPending) {
+          test.isPending = alwaysFalse;
+          self.fail(test, new Error('Pending test forbidden'));
+          delete test.isPending;
+        } else {
+          self.emit(constants.EVENT_TEST_PENDING, test);
+        }
+        self.emit(constants.EVENT_TEST_END, test);
+        return next();
+      }
+      if (err) {
+        return hookErr(err, errSuite, false);
+      }
+      self.currentRunnable = self.test;
+      self.runTest(function(err) {
+        test = self.test;
+        if (err) {
+          var retry = test.currentRetry();
+          if (err instanceof Pending && self.forbidPending) {
+            self.fail(test, new Error('Pending test forbidden'));
+          } else if (err instanceof Pending) {
+            test.pending = true;
+            self.emit(constants.EVENT_TEST_PENDING, test);
+          } else if (retry < test.retries()) {
+            var clonedTest = test.clone();
+            clonedTest.currentRetry(retry + 1);
+            tests.unshift(clonedTest);
+
+            self.emit(constants.EVENT_TEST_RETRY, test, err);
+
+            // Early return + hook trigger so that it doesn't
+            // increment the count wrong
+            return self.hookUp(HOOK_TYPE_AFTER_EACH, next);
+          } else {
+            self.fail(test, err);
+          }
+          self.emit(constants.EVENT_TEST_END, test);
+
+          if (err instanceof Pending) {
+            return next();
+          }
+
+          return self.hookUp(HOOK_TYPE_AFTER_EACH, next);
+        }
+
+        test.state = STATE_PASSED;
+        self.emit(constants.EVENT_TEST_PASS, test);
+        self.emit(constants.EVENT_TEST_END, test);
+        self.hookUp(HOOK_TYPE_AFTER_EACH, next);
+      });
+    });
+  }
+
+  this.next = next;
+  this.hookErr = hookErr;
+  next();
+};
+
+function alwaysFalse() {
+  return false;
+}
+
+/**
+ * Run the given `suite` and invoke the callback `fn()` when complete.
+ *
+ * @private
+ * @param {Suite} suite
+ * @param {Function} fn
+ */
+Runner.prototype.runSuite = function(suite, fn) {
+  var i = 0;
+  var self = this;
+  var total = this.grepTotal(suite);
+  var afterAllHookCalled = false;
+
+  debug('run suite %s', suite.fullTitle());
+
+  if (!total || (self.failures && suite._bail)) {
+    return fn();
+  }
+
+  this.emit(constants.EVENT_SUITE_BEGIN, (this.suite = suite));
+
+  function next(errSuite) {
+    if (errSuite) {
+      // current suite failed on a hook from errSuite
+      if (errSuite === suite) {
+        // if errSuite is current suite
+        // continue to the next sibling suite
+        return done();
+      }
+      // errSuite is among the parents of current suite
+      // stop execution of errSuite and all sub-suites
+      return done(errSuite);
+    }
+
+    if (self._abort) {
+      return done();
+    }
+
+    var curr = suite.suites[i++];
+    if (!curr) {
+      return done();
+    }
+
+    // Avoid grep neglecting large number of tests causing a
+    // huge recursive loop and thus a maximum call stack error.
+    // See comment in `this.runTests()` for more information.
+    if (self._grep !== self._defaultGrep) {
+      Runner.immediately(function() {
+        self.runSuite(curr, next);
+      });
+    } else {
+      self.runSuite(curr, next);
+    }
+  }
+
+  function done(errSuite) {
+    self.suite = suite;
+    self.nextSuite = next;
+
+    if (afterAllHookCalled) {
+      fn(errSuite);
+    } else {
+      // mark that the afterAll block has been called once
+      // and so can be skipped if there is an error in it.
+      afterAllHookCalled = true;
+
+      // remove reference to test
+      delete self.test;
+
+      self.hook(HOOK_TYPE_AFTER_ALL, function() {
+        self.emit(constants.EVENT_SUITE_END, suite);
+        fn(errSuite);
+      });
+    }
+  }
+
+  this.nextSuite = next;
+
+  this.hook(HOOK_TYPE_BEFORE_ALL, function(err) {
+    if (err) {
+      return done();
+    }
+    self.runTests(suite, next);
+  });
+};
+
+/**
+ * Handle uncaught exceptions.
+ *
+ * @param {Error} err
+ * @private
+ */
+Runner.prototype.uncaught = function(err) {
+  if (err instanceof Pending) {
+    return;
+  }
+  if (err) {
+    debug('uncaught exception %O', err);
+  } else {
+    debug('uncaught undefined/falsy exception');
+    err = createInvalidExceptionError(
+      'Caught falsy/undefined exception which would otherwise be uncaught. No stack trace found; try a debugger',
+      err
+    );
+  }
+
+  if (!isError(err)) {
+    err = thrown2Error(err);
+  }
+  err.uncaught = true;
+
+  var runnable = this.currentRunnable;
+
+  if (!runnable) {
+    runnable = new Runnable('Uncaught error outside test suite');
+    runnable.parent = this.suite;
+
+    if (this.started) {
+      this.fail(runnable, err);
+    } else {
+      // Can't recover from this failure
+      this.emit(constants.EVENT_RUN_BEGIN);
+      this.fail(runnable, err);
+      this.emit(constants.EVENT_RUN_END);
+    }
+
+    return;
+  }
+
+  runnable.clearTimeout();
+
+  // Ignore errors if already failed or pending
+  // See #3226
+  if (runnable.isFailed() || runnable.isPending()) {
+    return;
+  }
+  // we cannot recover gracefully if a Runnable has already passed
+  // then fails asynchronously
+  var alreadyPassed = runnable.isPassed();
+  // this will change the state to "failed" regardless of the current value
+  this.fail(runnable, err);
+  if (!alreadyPassed) {
+    // recover from test
+    if (runnable.type === constants.EVENT_TEST_BEGIN) {
+      this.emit(constants.EVENT_TEST_END, runnable);
+      this.hookUp(HOOK_TYPE_AFTER_EACH, this.next);
+      return;
+    }
+    debug(runnable);
+
+    // recover from hooks
+    var errSuite = this.suite;
+
+    // XXX how about a less awful way to determine this?
+    // if hook failure is in afterEach block
+    if (runnable.fullTitle().indexOf('after each') > -1) {
+      return this.hookErr(err, errSuite, true);
+    }
+    // if hook failure is in beforeEach block
+    if (runnable.fullTitle().indexOf('before each') > -1) {
+      return this.hookErr(err, errSuite, false);
+    }
+    // if hook failure is in after or before blocks
+    return this.nextSuite(errSuite);
+  }
+
+  // bail
+  this.emit(constants.EVENT_RUN_END);
+};
+
+/**
+ * Run the root suite and invoke `fn(failures)`
+ * on completion.
+ *
+ * @public
+ * @memberof Runner
+ * @param {Function} fn
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.run = function(fn) {
+  var self = this;
+  var rootSuite = this.suite;
+
+  fn = fn || function() {};
+
+  function uncaught(err) {
+    self.uncaught(err);
+  }
+
+  function start() {
+    // If there is an `only` filter
+    if (rootSuite.hasOnly()) {
+      rootSuite.filterOnly();
+    }
+    self.started = true;
+    if (self._delay) {
+      self.emit(constants.EVENT_DELAY_END);
+    }
+    self.emit(constants.EVENT_RUN_BEGIN);
+
+    self.runSuite(rootSuite, function() {
+      debug('finished running');
+      self.emit(constants.EVENT_RUN_END);
+    });
+  }
+
+  debug(constants.EVENT_RUN_BEGIN);
+
+  // references cleanup to avoid memory leaks
+  this.on(constants.EVENT_SUITE_END, function(suite) {
+    suite.cleanReferences();
+  });
+
+  // callback
+  this.on(constants.EVENT_RUN_END, function() {
+    debug(constants.EVENT_RUN_END);
+    process.removeListener('uncaughtException', uncaught);
+    fn(self.failures);
+  });
+
+  // uncaught exception
+  process.on('uncaughtException', uncaught);
+
+  if (this._delay) {
+    // for reporters, I guess.
+    // might be nice to debounce some dots while we wait.
+    this.emit(constants.EVENT_DELAY_BEGIN, rootSuite);
+    rootSuite.once(EVENT_ROOT_SUITE_RUN, start);
+  } else {
+    start();
+  }
+
+  return this;
+};
+
+/**
+ * Cleanly abort execution.
+ *
+ * @memberof Runner
+ * @public
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.abort = function() {
+  debug('aborting');
+  this._abort = true;
+
+  return this;
+};
+
+/**
+ * Filter leaks with the given globals flagged as `ok`.
+ *
+ * @private
+ * @param {Array} ok
+ * @param {Array} globals
+ * @return {Array}
+ */
+function filterLeaks(ok, globals) {
+  return globals.filter(function(key) {
+    // Firefox and Chrome exposes iframes as index inside the window object
+    if (/^\d+/.test(key)) {
+      return false;
+    }
+
+    // in firefox
+    // if runner runs in an iframe, this iframe's window.getInterface method
+    // not init at first it is assigned in some seconds
+    if (global.navigator && /^getInterface/.test(key)) {
+      return false;
+    }
+
+    // an iframe could be approached by window[iframeIndex]
+    // in ie6,7,8 and opera, iframeIndex is enumerable, this could cause leak
+    if (global.navigator && /^\d+/.test(key)) {
+      return false;
+    }
+
+    // Opera and IE expose global variables for HTML element IDs (issue #243)
+    if (/^mocha-/.test(key)) {
+      return false;
+    }
+
+    var matched = ok.filter(function(ok) {
+      if (~ok.indexOf('*')) {
+        return key.indexOf(ok.split('*')[0]) === 0;
+      }
+      return key === ok;
+    });
+    return !matched.length && (!global.navigator || key !== 'onerror');
+  });
+}
+
+/**
+ * Check if argument is an instance of Error object or a duck-typed equivalent.
+ *
+ * @private
+ * @param {Object} err - object to check
+ * @param {string} err.message - error message
+ * @returns {boolean}
+ */
+function isError(err) {
+  return err instanceof Error || (err && typeof err.message === 'string');
+}
+
+/**
+ *
+ * Converts thrown non-extensible type into proper Error.
+ *
+ * @private
+ * @param {*} thrown - Non-extensible type thrown by code
+ * @return {Error}
+ */
+function thrown2Error(err) {
+  return new Error(
+    'the ' + type(err) + ' ' + stringify(err) + ' was thrown, throw an Error :)'
+  );
+}
+
+/**
+ * Array of globals dependent on the environment.
+ *
+ * @return {Array}
+ * @deprecated
+ * @todo remove; long since unsupported
+ * @private
+ */
+function extraGlobals() {
+  if (typeof process === 'object' && typeof process.version === 'string') {
+    var parts = process.version.split('.');
+    var nodeVersion = parts.reduce(function(a, v) {
+      return (a << 8) | v;
+    });
+
+    // 'errno' was renamed to process._errno in v0.9.11.
+    if (nodeVersion < 0x00090b) {
+      return ['errno'];
+    }
+  }
+
+  return [];
+}
+
+Runner.constants = constants;
+
+/**
+ * Node.js' `EventEmitter`
+ * @external EventEmitter
+ * @see {@link https://nodejs.org/api/events.html#events_class_eventemitter}
+ */
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/stats-collector.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/stats-collector.js
new file mode 100644
index 00000000000..938778fb0ed
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/stats-collector.js
@@ -0,0 +1,83 @@
+'use strict';
+
+/**
+ * Provides a factory function for a {@link StatsCollector} object.
+ * @module
+ */
+
+var constants = require('./runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+
+/**
+ * Test statistics collector.
+ *
+ * @public
+ * @typedef {Object} StatsCollector
+ * @property {number} suites - integer count of suites run.
+ * @property {number} tests - integer count of tests run.
+ * @property {number} passes - integer count of passing tests.
+ * @property {number} pending - integer count of pending tests.
+ * @property {number} failures - integer count of failed tests.
+ * @property {Date} start - time when testing began.
+ * @property {Date} end - time when testing concluded.
+ * @property {number} duration - number of msecs that testing took.
+ */
+
+var Date = global.Date;
+
+/**
+ * Provides stats such as test duration, number of tests passed / failed etc., by listening for events emitted by `runner`.
+ *
+ * @private
+ * @param {Runner} runner - Runner instance
+ * @throws {TypeError} If falsy `runner`
+ */
+function createStatsCollector(runner) {
+  /**
+   * @type StatsCollector
+   */
+  var stats = {
+    suites: 0,
+    tests: 0,
+    passes: 0,
+    pending: 0,
+    failures: 0
+  };
+
+  if (!runner) {
+    throw new TypeError('Missing runner argument');
+  }
+
+  runner.stats = stats;
+
+  runner.once(EVENT_RUN_BEGIN, function() {
+    stats.start = new Date();
+  });
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    suite.root || stats.suites++;
+  });
+  runner.on(EVENT_TEST_PASS, function() {
+    stats.passes++;
+  });
+  runner.on(EVENT_TEST_FAIL, function() {
+    stats.failures++;
+  });
+  runner.on(EVENT_TEST_PENDING, function() {
+    stats.pending++;
+  });
+  runner.on(EVENT_TEST_END, function() {
+    stats.tests++;
+  });
+  runner.once(EVENT_RUN_END, function() {
+    stats.end = new Date();
+    stats.duration = stats.end - stats.start;
+  });
+}
+
+module.exports = createStatsCollector;
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/suite.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/suite.js
new file mode 100644
index 00000000000..191d946b501
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/suite.js
@@ -0,0 +1,642 @@
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+var EventEmitter = require('events').EventEmitter;
+var Hook = require('./hook');
+var utils = require('./utils');
+var inherits = utils.inherits;
+var debug = require('debug')('mocha:suite');
+var milliseconds = require('ms');
+var errors = require('./errors');
+var createInvalidArgumentTypeError = errors.createInvalidArgumentTypeError;
+
+/**
+ * Expose `Suite`.
+ */
+
+exports = module.exports = Suite;
+
+/**
+ * Create a new `Suite` with the given `title` and parent `Suite`.
+ *
+ * @public
+ * @param {Suite} parent - Parent suite (required!)
+ * @param {string} title - Title
+ * @return {Suite}
+ */
+Suite.create = function(parent, title) {
+  var suite = new Suite(title, parent.ctx);
+  suite.parent = parent;
+  title = suite.fullTitle();
+  parent.addSuite(suite);
+  return suite;
+};
+
+/**
+ * Constructs a new `Suite` instance with the given `title`, `ctx`, and `isRoot`.
+ *
+ * @public
+ * @class
+ * @extends EventEmitter
+ * @see {@link https://nodejs.org/api/events.html#events_class_eventemitter|EventEmitter}
+ * @param {string} title - Suite title.
+ * @param {Context} parentContext - Parent context instance.
+ * @param {boolean} [isRoot=false] - Whether this is the root suite.
+ */
+function Suite(title, parentContext, isRoot) {
+  if (!utils.isString(title)) {
+    throw createInvalidArgumentTypeError(
+      'Suite argument "title" must be a string. Received type "' +
+        typeof title +
+        '"',
+      'title',
+      'string'
+    );
+  }
+  this.title = title;
+  function Context() {}
+  Context.prototype = parentContext;
+  this.ctx = new Context();
+  this.suites = [];
+  this.tests = [];
+  this.pending = false;
+  this._beforeEach = [];
+  this._beforeAll = [];
+  this._afterEach = [];
+  this._afterAll = [];
+  this.root = isRoot === true;
+  this._timeout = 2000;
+  this._enableTimeouts = true;
+  this._slow = 75;
+  this._bail = false;
+  this._retries = -1;
+  this._onlyTests = [];
+  this._onlySuites = [];
+  this.delayed = false;
+
+  this.on('newListener', function(event) {
+    if (deprecatedEvents[event]) {
+      utils.deprecate(
+        'Event "' +
+          event +
+          '" is deprecated.  Please let the Mocha team know about your use case: https://git.io/v6Lwm'
+      );
+    }
+  });
+}
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+inherits(Suite, EventEmitter);
+
+/**
+ * Return a clone of this `Suite`.
+ *
+ * @private
+ * @return {Suite}
+ */
+Suite.prototype.clone = function() {
+  var suite = new Suite(this.title);
+  debug('clone');
+  suite.ctx = this.ctx;
+  suite.root = this.root;
+  suite.timeout(this.timeout());
+  suite.retries(this.retries());
+  suite.enableTimeouts(this.enableTimeouts());
+  suite.slow(this.slow());
+  suite.bail(this.bail());
+  return suite;
+};
+
+/**
+ * Set or get timeout `ms` or short-hand such as "2s".
+ *
+ * @private
+ * @todo Do not attempt to set value if `ms` is undefined
+ * @param {number|string} ms
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.timeout = function(ms) {
+  if (!arguments.length) {
+    return this._timeout;
+  }
+  if (ms.toString() === '0') {
+    this._enableTimeouts = false;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('timeout %d', ms);
+  this._timeout = parseInt(ms, 10);
+  return this;
+};
+
+/**
+ * Set or get number of times to retry a failed test.
+ *
+ * @private
+ * @param {number|string} n
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.retries = function(n) {
+  if (!arguments.length) {
+    return this._retries;
+  }
+  debug('retries %d', n);
+  this._retries = parseInt(n, 10) || 0;
+  return this;
+};
+
+/**
+ * Set or get timeout to `enabled`.
+ *
+ * @private
+ * @param {boolean} enabled
+ * @return {Suite|boolean} self or enabled
+ */
+Suite.prototype.enableTimeouts = function(enabled) {
+  if (!arguments.length) {
+    return this._enableTimeouts;
+  }
+  debug('enableTimeouts %s', enabled);
+  this._enableTimeouts = enabled;
+  return this;
+};
+
+/**
+ * Set or get slow `ms` or short-hand such as "2s".
+ *
+ * @private
+ * @param {number|string} ms
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.slow = function(ms) {
+  if (!arguments.length) {
+    return this._slow;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('slow %d', ms);
+  this._slow = ms;
+  return this;
+};
+
+/**
+ * Set or get whether to bail after first error.
+ *
+ * @private
+ * @param {boolean} bail
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.bail = function(bail) {
+  if (!arguments.length) {
+    return this._bail;
+  }
+  debug('bail %s', bail);
+  this._bail = bail;
+  return this;
+};
+
+/**
+ * Check if this suite or its parent suite is marked as pending.
+ *
+ * @private
+ */
+Suite.prototype.isPending = function() {
+  return this.pending || (this.parent && this.parent.isPending());
+};
+
+/**
+ * Generic hook-creator.
+ * @private
+ * @param {string} title - Title of hook
+ * @param {Function} fn - Hook callback
+ * @returns {Hook} A new hook
+ */
+Suite.prototype._createHook = function(title, fn) {
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  hook.file = this.file;
+  return hook;
+};
+
+/**
+ * Run `fn(test[, done])` before running tests.
+ *
+ * @private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.beforeAll = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"before all" hook' + (title ? ': ' + title : '');
+
+  var hook = this._createHook(title, fn);
+  this._beforeAll.push(hook);
+  this.emit(constants.EVENT_SUITE_ADD_HOOK_BEFORE_ALL, hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` after running tests.
+ *
+ * @private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.afterAll = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"after all" hook' + (title ? ': ' + title : '');
+
+  var hook = this._createHook(title, fn);
+  this._afterAll.push(hook);
+  this.emit(constants.EVENT_SUITE_ADD_HOOK_AFTER_ALL, hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` before each test case.
+ *
+ * @private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.beforeEach = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"before each" hook' + (title ? ': ' + title : '');
+
+  var hook = this._createHook(title, fn);
+  this._beforeEach.push(hook);
+  this.emit(constants.EVENT_SUITE_ADD_HOOK_BEFORE_EACH, hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` after each test case.
+ *
+ * @private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.afterEach = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"after each" hook' + (title ? ': ' + title : '');
+
+  var hook = this._createHook(title, fn);
+  this._afterEach.push(hook);
+  this.emit(constants.EVENT_SUITE_ADD_HOOK_AFTER_EACH, hook);
+  return this;
+};
+
+/**
+ * Add a test `suite`.
+ *
+ * @private
+ * @param {Suite} suite
+ * @return {Suite} for chaining
+ */
+Suite.prototype.addSuite = function(suite) {
+  suite.parent = this;
+  suite.root = false;
+  suite.timeout(this.timeout());
+  suite.retries(this.retries());
+  suite.enableTimeouts(this.enableTimeouts());
+  suite.slow(this.slow());
+  suite.bail(this.bail());
+  this.suites.push(suite);
+  this.emit(constants.EVENT_SUITE_ADD_SUITE, suite);
+  return this;
+};
+
+/**
+ * Add a `test` to this suite.
+ *
+ * @private
+ * @param {Test} test
+ * @return {Suite} for chaining
+ */
+Suite.prototype.addTest = function(test) {
+  test.parent = this;
+  test.timeout(this.timeout());
+  test.retries(this.retries());
+  test.enableTimeouts(this.enableTimeouts());
+  test.slow(this.slow());
+  test.ctx = this.ctx;
+  this.tests.push(test);
+  this.emit(constants.EVENT_SUITE_ADD_TEST, test);
+  return this;
+};
+
+/**
+ * Return the full title generated by recursively concatenating the parent's
+ * full title.
+ *
+ * @memberof Suite
+ * @public
+ * @return {string}
+ */
+Suite.prototype.fullTitle = function() {
+  return this.titlePath().join(' ');
+};
+
+/**
+ * Return the title path generated by recursively concatenating the parent's
+ * title path.
+ *
+ * @memberof Suite
+ * @public
+ * @return {string}
+ */
+Suite.prototype.titlePath = function() {
+  var result = [];
+  if (this.parent) {
+    result = result.concat(this.parent.titlePath());
+  }
+  if (!this.root) {
+    result.push(this.title);
+  }
+  return result;
+};
+
+/**
+ * Return the total number of tests.
+ *
+ * @memberof Suite
+ * @public
+ * @return {number}
+ */
+Suite.prototype.total = function() {
+  return (
+    this.suites.reduce(function(sum, suite) {
+      return sum + suite.total();
+    }, 0) + this.tests.length
+  );
+};
+
+/**
+ * Iterates through each suite recursively to find all tests. Applies a
+ * function in the format `fn(test)`.
+ *
+ * @private
+ * @param {Function} fn
+ * @return {Suite}
+ */
+Suite.prototype.eachTest = function(fn) {
+  this.tests.forEach(fn);
+  this.suites.forEach(function(suite) {
+    suite.eachTest(fn);
+  });
+  return this;
+};
+
+/**
+ * This will run the root suite if we happen to be running in delayed mode.
+ * @private
+ */
+Suite.prototype.run = function run() {
+  if (this.root) {
+    this.emit(constants.EVENT_ROOT_SUITE_RUN);
+  }
+};
+
+/**
+ * Determines whether a suite has an `only` test or suite as a descendant.
+ *
+ * @private
+ * @returns {Boolean}
+ */
+Suite.prototype.hasOnly = function hasOnly() {
+  return (
+    this._onlyTests.length > 0 ||
+    this._onlySuites.length > 0 ||
+    this.suites.some(function(suite) {
+      return suite.hasOnly();
+    })
+  );
+};
+
+/**
+ * Filter suites based on `isOnly` logic.
+ *
+ * @private
+ * @returns {Boolean}
+ */
+Suite.prototype.filterOnly = function filterOnly() {
+  if (this._onlyTests.length) {
+    // If the suite contains `only` tests, run those and ignore any nested suites.
+    this.tests = this._onlyTests;
+    this.suites = [];
+  } else {
+    // Otherwise, do not run any of the tests in this suite.
+    this.tests = [];
+    this._onlySuites.forEach(function(onlySuite) {
+      // If there are other `only` tests/suites nested in the current `only` suite, then filter that `only` suite.
+      // Otherwise, all of the tests on this `only` suite should be run, so don't filter it.
+      if (onlySuite.hasOnly()) {
+        onlySuite.filterOnly();
+      }
+    });
+    // Run the `only` suites, as well as any other suites that have `only` tests/suites as descendants.
+    var onlySuites = this._onlySuites;
+    this.suites = this.suites.filter(function(childSuite) {
+      return onlySuites.indexOf(childSuite) !== -1 || childSuite.filterOnly();
+    });
+  }
+  // Keep the suite only if there is something to run
+  return this.tests.length > 0 || this.suites.length > 0;
+};
+
+/**
+ * Adds a suite to the list of subsuites marked `only`.
+ *
+ * @private
+ * @param {Suite} suite
+ */
+Suite.prototype.appendOnlySuite = function(suite) {
+  this._onlySuites.push(suite);
+};
+
+/**
+ * Adds a test to the list of tests marked `only`.
+ *
+ * @private
+ * @param {Test} test
+ */
+Suite.prototype.appendOnlyTest = function(test) {
+  this._onlyTests.push(test);
+};
+
+/**
+ * Returns the array of hooks by hook name; see `HOOK_TYPE_*` constants.
+ * @private
+ */
+Suite.prototype.getHooks = function getHooks(name) {
+  return this['_' + name];
+};
+
+/**
+ * Cleans up the references to all the deferred functions
+ * (before/after/beforeEach/afterEach) and tests of a Suite.
+ * These must be deleted otherwise a memory leak can happen,
+ * as those functions may reference variables from closures,
+ * thus those variables can never be garbage collected as long
+ * as the deferred functions exist.
+ *
+ * @private
+ */
+Suite.prototype.cleanReferences = function cleanReferences() {
+  function cleanArrReferences(arr) {
+    for (var i = 0; i < arr.length; i++) {
+      delete arr[i].fn;
+    }
+  }
+
+  if (Array.isArray(this._beforeAll)) {
+    cleanArrReferences(this._beforeAll);
+  }
+
+  if (Array.isArray(this._beforeEach)) {
+    cleanArrReferences(this._beforeEach);
+  }
+
+  if (Array.isArray(this._afterAll)) {
+    cleanArrReferences(this._afterAll);
+  }
+
+  if (Array.isArray(this._afterEach)) {
+    cleanArrReferences(this._afterEach);
+  }
+
+  for (var i = 0; i < this.tests.length; i++) {
+    delete this.tests[i].fn;
+  }
+};
+
+var constants = utils.defineConstants(
+  /**
+   * {@link Suite}-related constants.
+   * @public
+   * @memberof Suite
+   * @alias constants
+   * @readonly
+   * @static
+   * @enum {string}
+   */
+  {
+    /**
+     * Event emitted after a test file has been loaded Not emitted in browser.
+     */
+    EVENT_FILE_POST_REQUIRE: 'post-require',
+    /**
+     * Event emitted before a test file has been loaded. In browser, this is emitted once an interface has been selected.
+     */
+    EVENT_FILE_PRE_REQUIRE: 'pre-require',
+    /**
+     * Event emitted immediately after a test file has been loaded. Not emitted in browser.
+     */
+    EVENT_FILE_REQUIRE: 'require',
+    /**
+     * Event emitted when `global.run()` is called (use with `delay` option)
+     */
+    EVENT_ROOT_SUITE_RUN: 'run',
+
+    /**
+     * Namespace for collection of a `Suite`'s "after all" hooks
+     */
+    HOOK_TYPE_AFTER_ALL: 'afterAll',
+    /**
+     * Namespace for collection of a `Suite`'s "after each" hooks
+     */
+    HOOK_TYPE_AFTER_EACH: 'afterEach',
+    /**
+     * Namespace for collection of a `Suite`'s "before all" hooks
+     */
+    HOOK_TYPE_BEFORE_ALL: 'beforeAll',
+    /**
+     * Namespace for collection of a `Suite`'s "before all" hooks
+     */
+    HOOK_TYPE_BEFORE_EACH: 'beforeEach',
+
+    // the following events are all deprecated
+
+    /**
+     * Emitted after an "after all" `Hook` has been added to a `Suite`. Deprecated
+     */
+    EVENT_SUITE_ADD_HOOK_AFTER_ALL: 'afterAll',
+    /**
+     * Emitted after an "after each" `Hook` has been added to a `Suite` Deprecated
+     */
+    EVENT_SUITE_ADD_HOOK_AFTER_EACH: 'afterEach',
+    /**
+     * Emitted after an "before all" `Hook` has been added to a `Suite` Deprecated
+     */
+    EVENT_SUITE_ADD_HOOK_BEFORE_ALL: 'beforeAll',
+    /**
+     * Emitted after an "before each" `Hook` has been added to a `Suite` Deprecated
+     */
+    EVENT_SUITE_ADD_HOOK_BEFORE_EACH: 'beforeEach',
+    /**
+     * Emitted after a child `Suite` has been added to a `Suite`. Deprecated
+     */
+    EVENT_SUITE_ADD_SUITE: 'suite',
+    /**
+     * Emitted after a `Test` has been added to a `Suite`. Deprecated
+     */
+    EVENT_SUITE_ADD_TEST: 'test'
+  }
+);
+
+/**
+ * @summary There are no known use cases for these events.
+ * @desc This is a `Set`-like object having all keys being the constant's string value and the value being `true`.
+ * @todo Remove eventually
+ * @type {Object<string,boolean>}
+ * @ignore
+ */
+var deprecatedEvents = Object.keys(constants)
+  .filter(function(constant) {
+    return constant.substring(0, 15) === 'EVENT_SUITE_ADD';
+  })
+  .reduce(function(acc, constant) {
+    acc[constants[constant]] = true;
+    return acc;
+  }, utils.createMap());
+
+Suite.constants = constants;
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/test.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/test.js
new file mode 100644
index 00000000000..f32008a85b1
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/test.js
@@ -0,0 +1,51 @@
+'use strict';
+var Runnable = require('./runnable');
+var utils = require('./utils');
+var errors = require('./errors');
+var createInvalidArgumentTypeError = errors.createInvalidArgumentTypeError;
+var isString = utils.isString;
+
+module.exports = Test;
+
+/**
+ * Initialize a new `Test` with the given `title` and callback `fn`.
+ *
+ * @public
+ * @class
+ * @extends Runnable
+ * @param {String} title - Test title (required)
+ * @param {Function} [fn] - Test callback.  If omitted, the Test is considered "pending"
+ */
+function Test(title, fn) {
+  if (!isString(title)) {
+    throw createInvalidArgumentTypeError(
+      'Test argument "title" should be a string. Received type "' +
+        typeof title +
+        '"',
+      'title',
+      'string'
+    );
+  }
+  Runnable.call(this, title, fn);
+  this.pending = !fn;
+  this.type = 'test';
+}
+
+/**
+ * Inherit from `Runnable.prototype`.
+ */
+utils.inherits(Test, Runnable);
+
+Test.prototype.clone = function() {
+  var test = new Test(this.title, this.fn);
+  test.timeout(this.timeout());
+  test.slow(this.slow());
+  test.enableTimeouts(this.enableTimeouts());
+  test.retries(this.retries());
+  test.currentRetry(this.currentRetry());
+  test.globals(this.globals());
+  test.parent = this.parent;
+  test.file = this.file;
+  test.ctx = this.ctx;
+  return test;
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/utils.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/utils.js
new file mode 100644
index 00000000000..996e843507b
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/lib/utils.js
@@ -0,0 +1,907 @@
+'use strict';
+
+/**
+ * Various utility functions used throughout Mocha's codebase.
+ * @module utils
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var fs = require('fs');
+var path = require('path');
+var util = require('util');
+var glob = require('glob');
+var he = require('he');
+var errors = require('./errors');
+var createNoFilesMatchPatternError = errors.createNoFilesMatchPatternError;
+var createMissingArgumentError = errors.createMissingArgumentError;
+
+var assign = (exports.assign = require('object.assign').getPolyfill());
+
+/**
+ * Inherit the prototype methods from one constructor into another.
+ *
+ * @param {function} ctor - Constructor function which needs to inherit the
+ *     prototype.
+ * @param {function} superCtor - Constructor function to inherit prototype from.
+ * @throws {TypeError} if either constructor is null, or if super constructor
+ *     lacks a prototype.
+ */
+exports.inherits = util.inherits;
+
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @private
+ * @param  {string} html
+ * @return {string}
+ */
+exports.escape = function(html) {
+  return he.encode(String(html), {useNamedReferences: false});
+};
+
+/**
+ * Test if the given obj is type of string.
+ *
+ * @private
+ * @param {Object} obj
+ * @return {boolean}
+ */
+exports.isString = function(obj) {
+  return typeof obj === 'string';
+};
+
+/**
+ * Watch the given `files` for changes
+ * and invoke `fn(file)` on modification.
+ *
+ * @private
+ * @param {Array} files
+ * @param {Function} fn
+ */
+exports.watch = function(files, fn) {
+  var options = {interval: 100};
+  var debug = require('debug')('mocha:watch');
+  files.forEach(function(file) {
+    debug('file %s', file);
+    fs.watchFile(file, options, function(curr, prev) {
+      if (prev.mtime < curr.mtime) {
+        fn(file);
+      }
+    });
+  });
+};
+
+/**
+ * Predicate to screen `pathname` for further consideration.
+ *
+ * @description
+ * Returns <code>false</code> for pathname referencing:
+ * <ul>
+ *   <li>'npm' package installation directory
+ *   <li>'git' version control directory
+ * </ul>
+ *
+ * @private
+ * @param {string} pathname - File or directory name to screen
+ * @return {boolean} whether pathname should be further considered
+ * @example
+ * ['node_modules', 'test.js'].filter(considerFurther); // => ['test.js']
+ */
+function considerFurther(pathname) {
+  var ignore = ['node_modules', '.git'];
+
+  return !~ignore.indexOf(pathname);
+}
+
+/**
+ * Lookup files in the given `dir`.
+ *
+ * @description
+ * Filenames are returned in _traversal_ order by the OS/filesystem.
+ * **Make no assumption that the names will be sorted in any fashion.**
+ *
+ * @private
+ * @param {string} dir
+ * @param {string[]} [exts=['js']]
+ * @param {Array} [ret=[]]
+ * @return {Array}
+ */
+exports.files = function(dir, exts, ret) {
+  ret = ret || [];
+  exts = exts || ['js'];
+
+  fs.readdirSync(dir)
+    .filter(considerFurther)
+    .forEach(function(dirent) {
+      var pathname = path.join(dir, dirent);
+      if (fs.lstatSync(pathname).isDirectory()) {
+        exports.files(pathname, exts, ret);
+      } else if (hasMatchingExtname(pathname, exts)) {
+        ret.push(pathname);
+      }
+    });
+
+  return ret;
+};
+
+/**
+ * Compute a slug from the given `str`.
+ *
+ * @private
+ * @param {string} str
+ * @return {string}
+ */
+exports.slug = function(str) {
+  return str
+    .toLowerCase()
+    .replace(/ +/g, '-')
+    .replace(/[^-\w]/g, '');
+};
+
+/**
+ * Strip the function definition from `str`, and re-indent for pre whitespace.
+ *
+ * @param {string} str
+ * @return {string}
+ */
+exports.clean = function(str) {
+  str = str
+    .replace(/\r\n?|[\n\u2028\u2029]/g, '\n')
+    .replace(/^\uFEFF/, '')
+    // (traditional)->  space/name     parameters    body     (lambda)-> parameters       body   multi-statement/single          keep body content
+    .replace(
+      /^function(?:\s*|\s+[^(]*)\([^)]*\)\s*\{((?:.|\n)*?)\s*\}$|^\([^)]*\)\s*=>\s*(?:\{((?:.|\n)*?)\s*\}|((?:.|\n)*))$/,
+      '$1$2$3'
+    );
+
+  var spaces = str.match(/^\n?( *)/)[1].length;
+  var tabs = str.match(/^\n?(\t*)/)[1].length;
+  var re = new RegExp(
+    '^\n?' + (tabs ? '\t' : ' ') + '{' + (tabs || spaces) + '}',
+    'gm'
+  );
+
+  str = str.replace(re, '');
+
+  return str.trim();
+};
+
+/**
+ * Parse the given `qs`.
+ *
+ * @private
+ * @param {string} qs
+ * @return {Object}
+ */
+exports.parseQuery = function(qs) {
+  return qs
+    .replace('?', '')
+    .split('&')
+    .reduce(function(obj, pair) {
+      var i = pair.indexOf('=');
+      var key = pair.slice(0, i);
+      var val = pair.slice(++i);
+
+      // Due to how the URLSearchParams API treats spaces
+      obj[key] = decodeURIComponent(val.replace(/\+/g, '%20'));
+
+      return obj;
+    }, {});
+};
+
+/**
+ * Highlight the given string of `js`.
+ *
+ * @private
+ * @param {string} js
+ * @return {string}
+ */
+function highlight(js) {
+  return js
+    .replace(/</g, '&lt;')
+    .replace(/>/g, '&gt;')
+    .replace(/\/\/(.*)/gm, '<span class="comment">//$1</span>')
+    .replace(/('.*?')/gm, '<span class="string">$1</span>')
+    .replace(/(\d+\.\d+)/gm, '<span class="number">$1</span>')
+    .replace(/(\d+)/gm, '<span class="number">$1</span>')
+    .replace(
+      /\bnew[ \t]+(\w+)/gm,
+      '<span class="keyword">new</span> <span class="init">$1</span>'
+    )
+    .replace(
+      /\b(function|new|throw|return|var|if|else)\b/gm,
+      '<span class="keyword">$1</span>'
+    );
+}
+
+/**
+ * Highlight the contents of tag `name`.
+ *
+ * @private
+ * @param {string} name
+ */
+exports.highlightTags = function(name) {
+  var code = document.getElementById('mocha').getElementsByTagName(name);
+  for (var i = 0, len = code.length; i < len; ++i) {
+    code[i].innerHTML = highlight(code[i].innerHTML);
+  }
+};
+
+/**
+ * If a value could have properties, and has none, this function is called,
+ * which returns a string representation of the empty value.
+ *
+ * Functions w/ no properties return `'[Function]'`
+ * Arrays w/ length === 0 return `'[]'`
+ * Objects w/ no properties return `'{}'`
+ * All else: return result of `value.toString()`
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @param {string} typeHint The type of the value
+ * @returns {string}
+ */
+function emptyRepresentation(value, typeHint) {
+  switch (typeHint) {
+    case 'function':
+      return '[Function]';
+    case 'object':
+      return '{}';
+    case 'array':
+      return '[]';
+    default:
+      return value.toString();
+  }
+}
+
+/**
+ * Takes some variable and asks `Object.prototype.toString()` what it thinks it
+ * is.
+ *
+ * @private
+ * @see https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/toString
+ * @param {*} value The value to test.
+ * @returns {string} Computed type
+ * @example
+ * type({}) // 'object'
+ * type([]) // 'array'
+ * type(1) // 'number'
+ * type(false) // 'boolean'
+ * type(Infinity) // 'number'
+ * type(null) // 'null'
+ * type(new Date()) // 'date'
+ * type(/foo/) // 'regexp'
+ * type('type') // 'string'
+ * type(global) // 'global'
+ * type(new String('foo') // 'object'
+ */
+var type = (exports.type = function type(value) {
+  if (value === undefined) {
+    return 'undefined';
+  } else if (value === null) {
+    return 'null';
+  } else if (Buffer.isBuffer(value)) {
+    return 'buffer';
+  }
+  return Object.prototype.toString
+    .call(value)
+    .replace(/^\[.+\s(.+?)]$/, '$1')
+    .toLowerCase();
+});
+
+/**
+ * Stringify `value`. Different behavior depending on type of value:
+ *
+ * - If `value` is undefined or null, return `'[undefined]'` or `'[null]'`, respectively.
+ * - If `value` is not an object, function or array, return result of `value.toString()` wrapped in double-quotes.
+ * - If `value` is an *empty* object, function, or array, return result of function
+ *   {@link emptyRepresentation}.
+ * - If `value` has properties, call {@link exports.canonicalize} on it, then return result of
+ *   JSON.stringify().
+ *
+ * @private
+ * @see exports.type
+ * @param {*} value
+ * @return {string}
+ */
+exports.stringify = function(value) {
+  var typeHint = type(value);
+
+  if (!~['object', 'array', 'function'].indexOf(typeHint)) {
+    if (typeHint === 'buffer') {
+      var json = Buffer.prototype.toJSON.call(value);
+      // Based on the toJSON result
+      return jsonStringify(
+        json.data && json.type ? json.data : json,
+        2
+      ).replace(/,(\n|$)/g, '$1');
+    }
+
+    // IE7/IE8 has a bizarre String constructor; needs to be coerced
+    // into an array and back to obj.
+    if (typeHint === 'string' && typeof value === 'object') {
+      value = value.split('').reduce(function(acc, char, idx) {
+        acc[idx] = char;
+        return acc;
+      }, {});
+      typeHint = 'object';
+    } else {
+      return jsonStringify(value);
+    }
+  }
+
+  for (var prop in value) {
+    if (Object.prototype.hasOwnProperty.call(value, prop)) {
+      return jsonStringify(
+        exports.canonicalize(value, null, typeHint),
+        2
+      ).replace(/,(\n|$)/g, '$1');
+    }
+  }
+
+  return emptyRepresentation(value, typeHint);
+};
+
+/**
+ * like JSON.stringify but more sense.
+ *
+ * @private
+ * @param {Object}  object
+ * @param {number=} spaces
+ * @param {number=} depth
+ * @returns {*}
+ */
+function jsonStringify(object, spaces, depth) {
+  if (typeof spaces === 'undefined') {
+    // primitive types
+    return _stringify(object);
+  }
+
+  depth = depth || 1;
+  var space = spaces * depth;
+  var str = Array.isArray(object) ? '[' : '{';
+  var end = Array.isArray(object) ? ']' : '}';
+  var length =
+    typeof object.length === 'number'
+      ? object.length
+      : Object.keys(object).length;
+  // `.repeat()` polyfill
+  function repeat(s, n) {
+    return new Array(n).join(s);
+  }
+
+  function _stringify(val) {
+    switch (type(val)) {
+      case 'null':
+      case 'undefined':
+        val = '[' + val + ']';
+        break;
+      case 'array':
+      case 'object':
+        val = jsonStringify(val, spaces, depth + 1);
+        break;
+      case 'boolean':
+      case 'regexp':
+      case 'symbol':
+      case 'number':
+        val =
+          val === 0 && 1 / val === -Infinity // `-0`
+            ? '-0'
+            : val.toString();
+        break;
+      case 'date':
+        var sDate = isNaN(val.getTime()) ? val.toString() : val.toISOString();
+        val = '[Date: ' + sDate + ']';
+        break;
+      case 'buffer':
+        var json = val.toJSON();
+        // Based on the toJSON result
+        json = json.data && json.type ? json.data : json;
+        val = '[Buffer: ' + jsonStringify(json, 2, depth + 1) + ']';
+        break;
+      default:
+        val =
+          val === '[Function]' || val === '[Circular]'
+            ? val
+            : JSON.stringify(val); // string
+    }
+    return val;
+  }
+
+  for (var i in object) {
+    if (!Object.prototype.hasOwnProperty.call(object, i)) {
+      continue; // not my business
+    }
+    --length;
+    str +=
+      '\n ' +
+      repeat(' ', space) +
+      (Array.isArray(object) ? '' : '"' + i + '": ') + // key
+      _stringify(object[i]) + // value
+      (length ? ',' : ''); // comma
+  }
+
+  return (
+    str +
+    // [], {}
+    (str.length !== 1 ? '\n' + repeat(' ', --space) + end : end)
+  );
+}
+
+/**
+ * Return a new Thing that has the keys in sorted order. Recursive.
+ *
+ * If the Thing...
+ * - has already been seen, return string `'[Circular]'`
+ * - is `undefined`, return string `'[undefined]'`
+ * - is `null`, return value `null`
+ * - is some other primitive, return the value
+ * - is not a primitive or an `Array`, `Object`, or `Function`, return the value of the Thing's `toString()` method
+ * - is a non-empty `Array`, `Object`, or `Function`, return the result of calling this function again.
+ * - is an empty `Array`, `Object`, or `Function`, return the result of calling `emptyRepresentation()`
+ *
+ * @private
+ * @see {@link exports.stringify}
+ * @param {*} value Thing to inspect.  May or may not have properties.
+ * @param {Array} [stack=[]] Stack of seen values
+ * @param {string} [typeHint] Type hint
+ * @return {(Object|Array|Function|string|undefined)}
+ */
+exports.canonicalize = function canonicalize(value, stack, typeHint) {
+  var canonicalizedObj;
+  /* eslint-disable no-unused-vars */
+  var prop;
+  /* eslint-enable no-unused-vars */
+  typeHint = typeHint || type(value);
+  function withStack(value, fn) {
+    stack.push(value);
+    fn();
+    stack.pop();
+  }
+
+  stack = stack || [];
+
+  if (stack.indexOf(value) !== -1) {
+    return '[Circular]';
+  }
+
+  switch (typeHint) {
+    case 'undefined':
+    case 'buffer':
+    case 'null':
+      canonicalizedObj = value;
+      break;
+    case 'array':
+      withStack(value, function() {
+        canonicalizedObj = value.map(function(item) {
+          return exports.canonicalize(item, stack);
+        });
+      });
+      break;
+    case 'function':
+      /* eslint-disable guard-for-in */
+      for (prop in value) {
+        canonicalizedObj = {};
+        break;
+      }
+      /* eslint-enable guard-for-in */
+      if (!canonicalizedObj) {
+        canonicalizedObj = emptyRepresentation(value, typeHint);
+        break;
+      }
+    /* falls through */
+    case 'object':
+      canonicalizedObj = canonicalizedObj || {};
+      withStack(value, function() {
+        Object.keys(value)
+          .sort()
+          .forEach(function(key) {
+            canonicalizedObj[key] = exports.canonicalize(value[key], stack);
+          });
+      });
+      break;
+    case 'date':
+    case 'number':
+    case 'regexp':
+    case 'boolean':
+    case 'symbol':
+      canonicalizedObj = value;
+      break;
+    default:
+      canonicalizedObj = value + '';
+  }
+
+  return canonicalizedObj;
+};
+
+/**
+ * Determines if pathname has a matching file extension.
+ *
+ * @private
+ * @param {string} pathname - Pathname to check for match.
+ * @param {string[]} exts - List of file extensions (sans period).
+ * @return {boolean} whether file extension matches.
+ * @example
+ * hasMatchingExtname('foo.html', ['js', 'css']); // => false
+ */
+function hasMatchingExtname(pathname, exts) {
+  var suffix = path.extname(pathname).slice(1);
+  return exts.some(function(element) {
+    return suffix === element;
+  });
+}
+
+/**
+ * Determines if pathname would be a "hidden" file (or directory) on UN*X.
+ *
+ * @description
+ * On UN*X, pathnames beginning with a full stop (aka dot) are hidden during
+ * typical usage. Dotfiles, plain-text configuration files, are prime examples.
+ *
+ * @see {@link http://xahlee.info/UnixResource_dir/writ/unix_origin_of_dot_filename.html|Origin of Dot File Names}
+ *
+ * @private
+ * @param {string} pathname - Pathname to check for match.
+ * @return {boolean} whether pathname would be considered a hidden file.
+ * @example
+ * isHiddenOnUnix('.profile'); // => true
+ */
+function isHiddenOnUnix(pathname) {
+  return path.basename(pathname)[0] === '.';
+}
+
+/**
+ * Lookup file names at the given `path`.
+ *
+ * @description
+ * Filenames are returned in _traversal_ order by the OS/filesystem.
+ * **Make no assumption that the names will be sorted in any fashion.**
+ *
+ * @public
+ * @memberof Mocha.utils
+ * @param {string} filepath - Base path to start searching from.
+ * @param {string[]} [extensions=[]] - File extensions to look for.
+ * @param {boolean} [recursive=false] - Whether to recurse into subdirectories.
+ * @return {string[]} An array of paths.
+ * @throws {Error} if no files match pattern.
+ * @throws {TypeError} if `filepath` is directory and `extensions` not provided.
+ */
+exports.lookupFiles = function lookupFiles(filepath, extensions, recursive) {
+  extensions = extensions || [];
+  recursive = recursive || false;
+  var files = [];
+  var stat;
+
+  if (!fs.existsSync(filepath)) {
+    var pattern;
+    if (glob.hasMagic(filepath)) {
+      // Handle glob as is without extensions
+      pattern = filepath;
+    } else {
+      // glob pattern e.g. 'filepath+(.js|.ts)'
+      var strExtensions = extensions
+        .map(function(v) {
+          return '.' + v;
+        })
+        .join('|');
+      pattern = filepath + '+(' + strExtensions + ')';
+    }
+    files = glob.sync(pattern, {nodir: true});
+    if (!files.length) {
+      throw createNoFilesMatchPatternError(
+        'Cannot find any files matching pattern ' + exports.dQuote(filepath),
+        filepath
+      );
+    }
+    return files;
+  }
+
+  // Handle file
+  try {
+    stat = fs.statSync(filepath);
+    if (stat.isFile()) {
+      return filepath;
+    }
+  } catch (err) {
+    // ignore error
+    return;
+  }
+
+  // Handle directory
+  fs.readdirSync(filepath).forEach(function(dirent) {
+    var pathname = path.join(filepath, dirent);
+    var stat;
+
+    try {
+      stat = fs.statSync(pathname);
+      if (stat.isDirectory()) {
+        if (recursive) {
+          files = files.concat(lookupFiles(pathname, extensions, recursive));
+        }
+        return;
+      }
+    } catch (err) {
+      // ignore error
+      return;
+    }
+    if (!extensions.length) {
+      throw createMissingArgumentError(
+        util.format(
+          'Argument %s required when argument %s is a directory',
+          exports.sQuote('extensions'),
+          exports.sQuote('filepath')
+        ),
+        'extensions',
+        'array'
+      );
+    }
+
+    if (
+      !stat.isFile() ||
+      !hasMatchingExtname(pathname, extensions) ||
+      isHiddenOnUnix(pathname)
+    ) {
+      return;
+    }
+    files.push(pathname);
+  });
+
+  return files;
+};
+
+/**
+ * process.emitWarning or a polyfill
+ * @see https://nodejs.org/api/process.html#process_process_emitwarning_warning_options
+ * @ignore
+ */
+function emitWarning(msg, type) {
+  if (process.emitWarning) {
+    process.emitWarning(msg, type);
+  } else {
+    process.nextTick(function() {
+      console.warn(type + ': ' + msg);
+    });
+  }
+}
+
+/**
+ * Show a deprecation warning. Each distinct message is only displayed once.
+ * Ignores empty messages.
+ *
+ * @param {string} [msg] - Warning to print
+ * @private
+ */
+exports.deprecate = function deprecate(msg) {
+  msg = String(msg);
+  if (msg && !deprecate.cache[msg]) {
+    deprecate.cache[msg] = true;
+    emitWarning(msg, 'DeprecationWarning');
+  }
+};
+exports.deprecate.cache = {};
+
+/**
+ * Show a generic warning.
+ * Ignores empty messages.
+ *
+ * @param {string} [msg] - Warning to print
+ * @private
+ */
+exports.warn = function warn(msg) {
+  if (msg) {
+    emitWarning(msg);
+  }
+};
+
+/**
+ * @summary
+ * This Filter based on `mocha-clean` module.(see: `github.com/rstacruz/mocha-clean`)
+ * @description
+ * When invoking this function you get a filter function that get the Error.stack as an input,
+ * and return a prettify output.
+ * (i.e: strip Mocha and internal node functions from stack trace).
+ * @returns {Function}
+ */
+exports.stackTraceFilter = function() {
+  // TODO: Replace with `process.browser`
+  var is = typeof document === 'undefined' ? {node: true} : {browser: true};
+  var slash = path.sep;
+  var cwd;
+  if (is.node) {
+    cwd = process.cwd() + slash;
+  } else {
+    cwd = (typeof location === 'undefined'
+      ? window.location
+      : location
+    ).href.replace(/\/[^/]*$/, '/');
+    slash = '/';
+  }
+
+  function isMochaInternal(line) {
+    return (
+      ~line.indexOf('node_modules' + slash + 'mocha' + slash) ||
+      ~line.indexOf(slash + 'mocha.js') ||
+      ~line.indexOf(slash + 'mocha.min.js')
+    );
+  }
+
+  function isNodeInternal(line) {
+    return (
+      ~line.indexOf('(timers.js:') ||
+      ~line.indexOf('(events.js:') ||
+      ~line.indexOf('(node.js:') ||
+      ~line.indexOf('(module.js:') ||
+      ~line.indexOf('GeneratorFunctionPrototype.next (native)') ||
+      false
+    );
+  }
+
+  return function(stack) {
+    stack = stack.split('\n');
+
+    stack = stack.reduce(function(list, line) {
+      if (isMochaInternal(line)) {
+        return list;
+      }
+
+      if (is.node && isNodeInternal(line)) {
+        return list;
+      }
+
+      // Clean up cwd(absolute)
+      if (/:\d+:\d+\)?$/.test(line)) {
+        line = line.replace('(' + cwd, '(');
+      }
+
+      list.push(line);
+      return list;
+    }, []);
+
+    return stack.join('\n');
+  };
+};
+
+/**
+ * Crude, but effective.
+ * @public
+ * @param {*} value
+ * @returns {boolean} Whether or not `value` is a Promise
+ */
+exports.isPromise = function isPromise(value) {
+  return (
+    typeof value === 'object' &&
+    value !== null &&
+    typeof value.then === 'function'
+  );
+};
+
+/**
+ * Clamps a numeric value to an inclusive range.
+ *
+ * @param {number} value - Value to be clamped.
+ * @param {numer[]} range - Two element array specifying [min, max] range.
+ * @returns {number} clamped value
+ */
+exports.clamp = function clamp(value, range) {
+  return Math.min(Math.max(value, range[0]), range[1]);
+};
+
+/**
+ * Single quote text by combining with undirectional ASCII quotation marks.
+ *
+ * @description
+ * Provides a simple means of markup for quoting text to be used in output.
+ * Use this to quote names of variables, methods, and packages.
+ *
+ * <samp>package 'foo' cannot be found</samp>
+ *
+ * @private
+ * @param {string} str - Value to be quoted.
+ * @returns {string} quoted value
+ * @example
+ * sQuote('n') // => 'n'
+ */
+exports.sQuote = function(str) {
+  return "'" + str + "'";
+};
+
+/**
+ * Double quote text by combining with undirectional ASCII quotation marks.
+ *
+ * @description
+ * Provides a simple means of markup for quoting text to be used in output.
+ * Use this to quote names of datatypes, classes, pathnames, and strings.
+ *
+ * <samp>argument 'value' must be "string" or "number"</samp>
+ *
+ * @private
+ * @param {string} str - Value to be quoted.
+ * @returns {string} quoted value
+ * @example
+ * dQuote('number') // => "number"
+ */
+exports.dQuote = function(str) {
+  return '"' + str + '"';
+};
+
+/**
+ * Provides simplistic message translation for dealing with plurality.
+ *
+ * @description
+ * Use this to create messages which need to be singular or plural.
+ * Some languages have several plural forms, so _complete_ message clauses
+ * are preferable to generating the message on the fly.
+ *
+ * @private
+ * @param {number} n - Non-negative integer
+ * @param {string} msg1 - Message to be used in English for `n = 1`
+ * @param {string} msg2 - Message to be used in English for `n = 0, 2, 3, ...`
+ * @returns {string} message corresponding to value of `n`
+ * @example
+ * var sprintf = require('util').format;
+ * var pkgs = ['one', 'two'];
+ * var msg = sprintf(
+ *   ngettext(
+ *     pkgs.length,
+ *     'cannot load package: %s',
+ *     'cannot load packages: %s'
+ *   ),
+ *   pkgs.map(sQuote).join(', ')
+ * );
+ * console.log(msg); // => cannot load packages: 'one', 'two'
+ */
+exports.ngettext = function(n, msg1, msg2) {
+  if (typeof n === 'number' && n >= 0) {
+    return n === 1 ? msg1 : msg2;
+  }
+};
+
+/**
+ * It's a noop.
+ * @public
+ */
+exports.noop = function() {};
+
+/**
+ * Creates a map-like object.
+ *
+ * @description
+ * A "map" is an object with no prototype, for our purposes. In some cases
+ * this would be more appropriate than a `Map`, especially if your environment
+ * doesn't support it. Recommended for use in Mocha's public APIs.
+ *
+ * @public
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Map|MDN:Map}
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/create#Custom_and_Null_objects|MDN:Object.create - Custom objects}
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/assign|MDN:Object.assign}
+ * @param {...*} [obj] - Arguments to `Object.assign()`.
+ * @returns {Object} An object with no prototype, having `...obj` properties
+ */
+exports.createMap = function(obj) {
+  return assign.apply(
+    null,
+    [Object.create(null)].concat(Array.prototype.slice.call(arguments))
+  );
+};
+
+/**
+ * Creates a read-only map-like object.
+ *
+ * @description
+ * This differs from {@link module:utils.createMap createMap} only in that
+ * the argument must be non-empty, because the result is frozen.
+ *
+ * @see {@link module:utils.createMap createMap}
+ * @param {...*} [obj] - Arguments to `Object.assign()`.
+ * @returns {Object} A frozen object with no prototype, having `...obj` properties
+ * @throws {TypeError} if argument is not a non-empty object.
+ */
+exports.defineConstants = function(obj) {
+  if (type(obj) !== 'object' || !Object.keys(obj).length) {
+    throw new TypeError('Invalid argument; expected a non-empty object');
+  }
+  return Object.freeze(exports.createMap(obj));
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/mocha.css b/chromium/third_party/devtools-frontend/src/node_modules/mocha/mocha.css
new file mode 100644
index 00000000000..4ca8fcb897a
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/mocha.css
@@ -0,0 +1,325 @@
+@charset "utf-8";
+
+body {
+  margin:0;
+}
+
+#mocha {
+  font: 20px/1.5 "Helvetica Neue", Helvetica, Arial, sans-serif;
+  margin: 60px 50px;
+}
+
+#mocha ul,
+#mocha li {
+  margin: 0;
+  padding: 0;
+}
+
+#mocha ul {
+  list-style: none;
+}
+
+#mocha h1,
+#mocha h2 {
+  margin: 0;
+}
+
+#mocha h1 {
+  margin-top: 15px;
+  font-size: 1em;
+  font-weight: 200;
+}
+
+#mocha h1 a {
+  text-decoration: none;
+  color: inherit;
+}
+
+#mocha h1 a:hover {
+  text-decoration: underline;
+}
+
+#mocha .suite .suite h1 {
+  margin-top: 0;
+  font-size: .8em;
+}
+
+#mocha .hidden {
+  display: none;
+}
+
+#mocha h2 {
+  font-size: 12px;
+  font-weight: normal;
+  cursor: pointer;
+}
+
+#mocha .suite {
+  margin-left: 15px;
+}
+
+#mocha .test {
+  margin-left: 15px;
+  overflow: hidden;
+}
+
+#mocha .test.pending:hover h2::after {
+  content: '(pending)';
+  font-family: arial, sans-serif;
+}
+
+#mocha .test.pass.medium .duration {
+  background: #c09853;
+}
+
+#mocha .test.pass.slow .duration {
+  background: #b94a48;
+}
+
+#mocha .test.pass::before {
+  content: '✓';
+  font-size: 12px;
+  display: block;
+  float: left;
+  margin-right: 5px;
+  color: #00d6b2;
+}
+
+#mocha .test.pass .duration {
+  font-size: 9px;
+  margin-left: 5px;
+  padding: 2px 5px;
+  color: #fff;
+  -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.2);
+  -moz-box-shadow: inset 0 1px 1px rgba(0,0,0,.2);
+  box-shadow: inset 0 1px 1px rgba(0,0,0,.2);
+  -webkit-border-radius: 5px;
+  -moz-border-radius: 5px;
+  -ms-border-radius: 5px;
+  -o-border-radius: 5px;
+  border-radius: 5px;
+}
+
+#mocha .test.pass.fast .duration {
+  display: none;
+}
+
+#mocha .test.pending {
+  color: #0b97c4;
+}
+
+#mocha .test.pending::before {
+  content: '◦';
+  color: #0b97c4;
+}
+
+#mocha .test.fail {
+  color: #c00;
+}
+
+#mocha .test.fail pre {
+  color: black;
+}
+
+#mocha .test.fail::before {
+  content: '✖';
+  font-size: 12px;
+  display: block;
+  float: left;
+  margin-right: 5px;
+  color: #c00;
+}
+
+#mocha .test pre.error {
+  color: #c00;
+  max-height: 300px;
+  overflow: auto;
+}
+
+#mocha .test .html-error {
+  overflow: auto;
+  color: black;
+  display: block;
+  float: left;
+  clear: left;
+  font: 12px/1.5 monaco, monospace;
+  margin: 5px;
+  padding: 15px;
+  border: 1px solid #eee;
+  max-width: 85%; /*(1)*/
+  max-width: -webkit-calc(100% - 42px);
+  max-width: -moz-calc(100% - 42px);
+  max-width: calc(100% - 42px); /*(2)*/
+  max-height: 300px;
+  word-wrap: break-word;
+  border-bottom-color: #ddd;
+  -webkit-box-shadow: 0 1px 3px #eee;
+  -moz-box-shadow: 0 1px 3px #eee;
+  box-shadow: 0 1px 3px #eee;
+  -webkit-border-radius: 3px;
+  -moz-border-radius: 3px;
+  border-radius: 3px;
+}
+
+#mocha .test .html-error pre.error {
+  border: none;
+  -webkit-border-radius: 0;
+  -moz-border-radius: 0;
+  border-radius: 0;
+  -webkit-box-shadow: 0;
+  -moz-box-shadow: 0;
+  box-shadow: 0;
+  padding: 0;
+  margin: 0;
+  margin-top: 18px;
+  max-height: none;
+}
+
+/**
+ * (1): approximate for browsers not supporting calc
+ * (2): 42 = 2*15 + 2*10 + 2*1 (padding + margin + border)
+ *      ^^ seriously
+ */
+#mocha .test pre {
+  display: block;
+  float: left;
+  clear: left;
+  font: 12px/1.5 monaco, monospace;
+  margin: 5px;
+  padding: 15px;
+  border: 1px solid #eee;
+  max-width: 85%; /*(1)*/
+  max-width: -webkit-calc(100% - 42px);
+  max-width: -moz-calc(100% - 42px);
+  max-width: calc(100% - 42px); /*(2)*/
+  word-wrap: break-word;
+  border-bottom-color: #ddd;
+  -webkit-box-shadow: 0 1px 3px #eee;
+  -moz-box-shadow: 0 1px 3px #eee;
+  box-shadow: 0 1px 3px #eee;
+  -webkit-border-radius: 3px;
+  -moz-border-radius: 3px;
+  border-radius: 3px;
+}
+
+#mocha .test h2 {
+  position: relative;
+}
+
+#mocha .test a.replay {
+  position: absolute;
+  top: 3px;
+  right: 0;
+  text-decoration: none;
+  vertical-align: middle;
+  display: block;
+  width: 15px;
+  height: 15px;
+  line-height: 15px;
+  text-align: center;
+  background: #eee;
+  font-size: 15px;
+  -webkit-border-radius: 15px;
+  -moz-border-radius: 15px;
+  border-radius: 15px;
+  -webkit-transition:opacity 200ms;
+  -moz-transition:opacity 200ms;
+  -o-transition:opacity 200ms;
+  transition: opacity 200ms;
+  opacity: 0.3;
+  color: #888;
+}
+
+#mocha .test:hover a.replay {
+  opacity: 1;
+}
+
+#mocha-report.pass .test.fail {
+  display: none;
+}
+
+#mocha-report.fail .test.pass {
+  display: none;
+}
+
+#mocha-report.pending .test.pass,
+#mocha-report.pending .test.fail {
+  display: none;
+}
+#mocha-report.pending .test.pass.pending {
+  display: block;
+}
+
+#mocha-error {
+  color: #c00;
+  font-size: 1.5em;
+  font-weight: 100;
+  letter-spacing: 1px;
+}
+
+#mocha-stats {
+  position: fixed;
+  top: 15px;
+  right: 10px;
+  font-size: 12px;
+  margin: 0;
+  color: #888;
+  z-index: 1;
+}
+
+#mocha-stats .progress {
+  float: right;
+  padding-top: 0;
+
+  /**
+   * Set safe initial values, so mochas .progress does not inherit these
+   * properties from Bootstrap .progress (which causes .progress height to
+   * equal line height set in Bootstrap).
+   */
+  height: auto;
+  -webkit-box-shadow: none;
+  -moz-box-shadow: none;
+  box-shadow: none;
+  background-color: initial;
+}
+
+#mocha-stats em {
+  color: black;
+}
+
+#mocha-stats a {
+  text-decoration: none;
+  color: inherit;
+}
+
+#mocha-stats a:hover {
+  border-bottom: 1px solid #eee;
+}
+
+#mocha-stats li {
+  display: inline-block;
+  margin: 0 5px;
+  list-style: none;
+  padding-top: 11px;
+}
+
+#mocha-stats canvas {
+  width: 40px;
+  height: 40px;
+}
+
+#mocha code .comment { color: #ddd; }
+#mocha code .init { color: #2f6fad; }
+#mocha code .string { color: #5890ad; }
+#mocha code .keyword { color: #8a6343; }
+#mocha code .number { color: #2f6fad; }
+
+@media screen and (max-device-width: 480px) {
+  #mocha {
+    margin: 60px 0px;
+  }
+
+  #mocha #stats {
+    position: absolute;
+  }
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/mocha.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/mocha.js
new file mode 100644
index 00000000000..7fb99d4ef22
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/mocha.js
@@ -0,0 +1,18104 @@
+(function(){function r(e,n,t){function o(i,f){if(!n[i]){if(!e[i]){var c="function"==typeof require&&require;if(!f&&c)return c(i,!0);if(u)return u(i,!0);var a=new Error("Cannot find module '"+i+"'");throw a.code="MODULE_NOT_FOUND",a}var p=n[i]={exports:{}};e[i][0].call(p.exports,function(r){var n=e[i][1][r];return o(n||r)},p,p.exports,r,e,n,t)}return n[i].exports}for(var u="function"==typeof require&&require,i=0;i<t.length;i++)o(t[i]);return o}return r})()({1:[function(require,module,exports){
+(function (process,global){
+'use strict';
+
+/* eslint no-unused-vars: off */
+/* eslint-env commonjs */
+
+/**
+ * Shim process.stdout.
+ */
+
+process.stdout = require('browser-stdout')({label: false});
+
+var Mocha = require('./lib/mocha');
+
+/**
+ * Create a Mocha instance.
+ *
+ * @return {undefined}
+ */
+
+var mocha = new Mocha({reporter: 'html'});
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var setInterval = global.setInterval;
+var clearTimeout = global.clearTimeout;
+var clearInterval = global.clearInterval;
+
+var uncaughtExceptionHandlers = [];
+
+var originalOnerrorHandler = global.onerror;
+
+/**
+ * Remove uncaughtException listener.
+ * Revert to original onerror handler if previously defined.
+ */
+
+process.removeListener = function(e, fn) {
+  if (e === 'uncaughtException') {
+    if (originalOnerrorHandler) {
+      global.onerror = originalOnerrorHandler;
+    } else {
+      global.onerror = function() {};
+    }
+    var i = uncaughtExceptionHandlers.indexOf(fn);
+    if (i !== -1) {
+      uncaughtExceptionHandlers.splice(i, 1);
+    }
+  }
+};
+
+/**
+ * Implements uncaughtException listener.
+ */
+
+process.on = function(e, fn) {
+  if (e === 'uncaughtException') {
+    global.onerror = function(err, url, line) {
+      fn(new Error(err + ' (' + url + ':' + line + ')'));
+      return !mocha.allowUncaught;
+    };
+    uncaughtExceptionHandlers.push(fn);
+  }
+};
+
+// The BDD UI is registered by default, but no UI will be functional in the
+// browser without an explicit call to the overridden `mocha.ui` (see below).
+// Ensure that this default UI does not expose its methods to the global scope.
+mocha.suite.removeAllListeners('pre-require');
+
+var immediateQueue = [];
+var immediateTimeout;
+
+function timeslice() {
+  var immediateStart = new Date().getTime();
+  while (immediateQueue.length && new Date().getTime() - immediateStart < 100) {
+    immediateQueue.shift()();
+  }
+  if (immediateQueue.length) {
+    immediateTimeout = setTimeout(timeslice, 0);
+  } else {
+    immediateTimeout = null;
+  }
+}
+
+/**
+ * High-performance override of Runner.immediately.
+ */
+
+Mocha.Runner.immediately = function(callback) {
+  immediateQueue.push(callback);
+  if (!immediateTimeout) {
+    immediateTimeout = setTimeout(timeslice, 0);
+  }
+};
+
+/**
+ * Function to allow assertion libraries to throw errors directly into mocha.
+ * This is useful when running tests in a browser because window.onerror will
+ * only receive the 'message' attribute of the Error.
+ */
+mocha.throwError = function(err) {
+  uncaughtExceptionHandlers.forEach(function(fn) {
+    fn(err);
+  });
+  throw err;
+};
+
+/**
+ * Override ui to ensure that the ui functions are initialized.
+ * Normally this would happen in Mocha.prototype.loadFiles.
+ */
+
+mocha.ui = function(ui) {
+  Mocha.prototype.ui.call(this, ui);
+  this.suite.emit('pre-require', global, null, this);
+  return this;
+};
+
+/**
+ * Setup mocha with the given setting options.
+ */
+
+mocha.setup = function(opts) {
+  if (typeof opts === 'string') {
+    opts = {ui: opts};
+  }
+  for (var opt in opts) {
+    if (opts.hasOwnProperty(opt)) {
+      this[opt](opts[opt]);
+    }
+  }
+  return this;
+};
+
+/**
+ * Run mocha, returning the Runner.
+ */
+
+mocha.run = function(fn) {
+  var options = mocha.options;
+  mocha.globals('location');
+
+  var query = Mocha.utils.parseQuery(global.location.search || '');
+  if (query.grep) {
+    mocha.grep(query.grep);
+  }
+  if (query.fgrep) {
+    mocha.fgrep(query.fgrep);
+  }
+  if (query.invert) {
+    mocha.invert();
+  }
+
+  return Mocha.prototype.run.call(mocha, function(err) {
+    // The DOM Document is not available in Web Workers.
+    var document = global.document;
+    if (
+      document &&
+      document.getElementById('mocha') &&
+      options.noHighlighting !== true
+    ) {
+      Mocha.utils.highlightTags('code');
+    }
+    if (fn) {
+      fn(err);
+    }
+  });
+};
+
+/**
+ * Expose the process shim.
+ * https://github.com/mochajs/mocha/pull/916
+ */
+
+Mocha.process = process;
+
+/**
+ * Expose mocha.
+ */
+
+global.Mocha = Mocha;
+global.mocha = mocha;
+
+// this allows test/acceptance/required-tokens.js to pass; thus,
+// you can now do `const describe = require('mocha').describe` in a
+// browser context (assuming browserification).  should fix #880
+module.exports = global;
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./lib/mocha":14,"_process":69,"browser-stdout":41}],2:[function(require,module,exports){
+(function (process,global){
+'use strict';
+
+/**
+ * Web Notifications module.
+ * @module Growl
+ */
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var EVENT_RUN_END = require('../runner').constants.EVENT_RUN_END;
+
+/**
+ * Checks if browser notification support exists.
+ *
+ * @public
+ * @see {@link https://caniuse.com/#feat=notifications|Browser support (notifications)}
+ * @see {@link https://caniuse.com/#feat=promises|Browser support (promises)}
+ * @see {@link Mocha#growl}
+ * @see {@link Mocha#isGrowlCapable}
+ * @return {boolean} whether browser notification support exists
+ */
+exports.isCapable = function() {
+  var hasNotificationSupport = 'Notification' in window;
+  var hasPromiseSupport = typeof Promise === 'function';
+  return process.browser && hasNotificationSupport && hasPromiseSupport;
+};
+
+/**
+ * Implements browser notifications as a pseudo-reporter.
+ *
+ * @public
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/API/notification|Notification API}
+ * @see {@link https://developers.google.com/web/fundamentals/push-notifications/display-a-notification|Displaying a Notification}
+ * @see {@link Growl#isPermitted}
+ * @see {@link Mocha#_growl}
+ * @param {Runner} runner - Runner instance.
+ */
+exports.notify = function(runner) {
+  var promise = isPermitted();
+
+  /**
+   * Attempt notification.
+   */
+  var sendNotification = function() {
+    // If user hasn't responded yet... "No notification for you!" (Seinfeld)
+    Promise.race([promise, Promise.resolve(undefined)])
+      .then(canNotify)
+      .then(function() {
+        display(runner);
+      })
+      .catch(notPermitted);
+  };
+
+  runner.once(EVENT_RUN_END, sendNotification);
+};
+
+/**
+ * Checks if browser notification is permitted by user.
+ *
+ * @private
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/API/Notification/permission|Notification.permission}
+ * @see {@link Mocha#growl}
+ * @see {@link Mocha#isGrowlPermitted}
+ * @returns {Promise<boolean>} promise determining if browser notification
+ *     permissible when fulfilled.
+ */
+function isPermitted() {
+  var permitted = {
+    granted: function allow() {
+      return Promise.resolve(true);
+    },
+    denied: function deny() {
+      return Promise.resolve(false);
+    },
+    default: function ask() {
+      return Notification.requestPermission().then(function(permission) {
+        return permission === 'granted';
+      });
+    }
+  };
+
+  return permitted[Notification.permission]();
+}
+
+/**
+ * @summary
+ * Determines if notification should proceed.
+ *
+ * @description
+ * Notification shall <strong>not</strong> proceed unless `value` is true.
+ *
+ * `value` will equal one of:
+ * <ul>
+ *   <li><code>true</code> (from `isPermitted`)</li>
+ *   <li><code>false</code> (from `isPermitted`)</li>
+ *   <li><code>undefined</code> (from `Promise.race`)</li>
+ * </ul>
+ *
+ * @private
+ * @param {boolean|undefined} value - Determines if notification permissible.
+ * @returns {Promise<undefined>} Notification can proceed
+ */
+function canNotify(value) {
+  if (!value) {
+    var why = value === false ? 'blocked' : 'unacknowledged';
+    var reason = 'not permitted by user (' + why + ')';
+    return Promise.reject(new Error(reason));
+  }
+  return Promise.resolve();
+}
+
+/**
+ * Displays the notification.
+ *
+ * @private
+ * @param {Runner} runner - Runner instance.
+ */
+function display(runner) {
+  var stats = runner.stats;
+  var symbol = {
+    cross: '\u274C',
+    tick: '\u2705'
+  };
+  var logo = require('../../package').notifyLogo;
+  var _message;
+  var message;
+  var title;
+
+  if (stats.failures) {
+    _message = stats.failures + ' of ' + stats.tests + ' tests failed';
+    message = symbol.cross + ' ' + _message;
+    title = 'Failed';
+  } else {
+    _message = stats.passes + ' tests passed in ' + stats.duration + 'ms';
+    message = symbol.tick + ' ' + _message;
+    title = 'Passed';
+  }
+
+  // Send notification
+  var options = {
+    badge: logo,
+    body: message,
+    dir: 'ltr',
+    icon: logo,
+    lang: 'en-US',
+    name: 'mocha',
+    requireInteraction: false,
+    timestamp: Date.now()
+  };
+  var notification = new Notification(title, options);
+
+  // Autoclose after brief delay (makes various browsers act same)
+  var FORCE_DURATION = 4000;
+  setTimeout(notification.close.bind(notification), FORCE_DURATION);
+}
+
+/**
+ * As notifications are tangential to our purpose, just log the error.
+ *
+ * @private
+ * @param {Error} err - Why notification didn't happen.
+ */
+function notPermitted(err) {
+  console.error('notification error:', err.message);
+}
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"../../package":90,"../runner":34,"_process":69}],3:[function(require,module,exports){
+'use strict';
+
+/**
+ * Expose `Progress`.
+ */
+
+module.exports = Progress;
+
+/**
+ * Initialize a new `Progress` indicator.
+ */
+function Progress() {
+  this.percent = 0;
+  this.size(0);
+  this.fontSize(11);
+  this.font('helvetica, arial, sans-serif');
+}
+
+/**
+ * Set progress size to `size`.
+ *
+ * @public
+ * @param {number} size
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.size = function(size) {
+  this._size = size;
+  return this;
+};
+
+/**
+ * Set text to `text`.
+ *
+ * @public
+ * @param {string} text
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.text = function(text) {
+  this._text = text;
+  return this;
+};
+
+/**
+ * Set font size to `size`.
+ *
+ * @public
+ * @param {number} size
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.fontSize = function(size) {
+  this._fontSize = size;
+  return this;
+};
+
+/**
+ * Set font to `family`.
+ *
+ * @param {string} family
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.font = function(family) {
+  this._font = family;
+  return this;
+};
+
+/**
+ * Update percentage to `n`.
+ *
+ * @param {number} n
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.update = function(n) {
+  this.percent = n;
+  return this;
+};
+
+/**
+ * Draw on `ctx`.
+ *
+ * @param {CanvasRenderingContext2d} ctx
+ * @return {Progress} Progress instance.
+ */
+Progress.prototype.draw = function(ctx) {
+  try {
+    var percent = Math.min(this.percent, 100);
+    var size = this._size;
+    var half = size / 2;
+    var x = half;
+    var y = half;
+    var rad = half - 1;
+    var fontSize = this._fontSize;
+
+    ctx.font = fontSize + 'px ' + this._font;
+
+    var angle = Math.PI * 2 * (percent / 100);
+    ctx.clearRect(0, 0, size, size);
+
+    // outer circle
+    ctx.strokeStyle = '#9f9f9f';
+    ctx.beginPath();
+    ctx.arc(x, y, rad, 0, angle, false);
+    ctx.stroke();
+
+    // inner circle
+    ctx.strokeStyle = '#eee';
+    ctx.beginPath();
+    ctx.arc(x, y, rad - 1, 0, angle, true);
+    ctx.stroke();
+
+    // text
+    var text = this._text || (percent | 0) + '%';
+    var w = ctx.measureText(text).width;
+
+    ctx.fillText(text, x - w / 2 + 1, y + fontSize / 2 - 1);
+  } catch (ignore) {
+    // don't fail if we can't render progress
+  }
+  return this;
+};
+
+},{}],4:[function(require,module,exports){
+(function (global){
+'use strict';
+
+exports.isatty = function isatty() {
+  return true;
+};
+
+exports.getWindowSize = function getWindowSize() {
+  if ('innerHeight' in global) {
+    return [global.innerHeight, global.innerWidth];
+  }
+  // In a Web Worker, the DOM Window is not available.
+  return [640, 480];
+};
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{}],5:[function(require,module,exports){
+'use strict';
+/**
+ * @module Context
+ */
+/**
+ * Expose `Context`.
+ */
+
+module.exports = Context;
+
+/**
+ * Initialize a new `Context`.
+ *
+ * @private
+ */
+function Context() {}
+
+/**
+ * Set or get the context `Runnable` to `runnable`.
+ *
+ * @private
+ * @param {Runnable} runnable
+ * @return {Context} context
+ */
+Context.prototype.runnable = function(runnable) {
+  if (!arguments.length) {
+    return this._runnable;
+  }
+  this.test = this._runnable = runnable;
+  return this;
+};
+
+/**
+ * Set or get test timeout `ms`.
+ *
+ * @private
+ * @param {number} ms
+ * @return {Context} self
+ */
+Context.prototype.timeout = function(ms) {
+  if (!arguments.length) {
+    return this.runnable().timeout();
+  }
+  this.runnable().timeout(ms);
+  return this;
+};
+
+/**
+ * Set test timeout `enabled`.
+ *
+ * @private
+ * @param {boolean} enabled
+ * @return {Context} self
+ */
+Context.prototype.enableTimeouts = function(enabled) {
+  if (!arguments.length) {
+    return this.runnable().enableTimeouts();
+  }
+  this.runnable().enableTimeouts(enabled);
+  return this;
+};
+
+/**
+ * Set or get test slowness threshold `ms`.
+ *
+ * @private
+ * @param {number} ms
+ * @return {Context} self
+ */
+Context.prototype.slow = function(ms) {
+  if (!arguments.length) {
+    return this.runnable().slow();
+  }
+  this.runnable().slow(ms);
+  return this;
+};
+
+/**
+ * Mark a test as skipped.
+ *
+ * @private
+ * @throws Pending
+ */
+Context.prototype.skip = function() {
+  this.runnable().skip();
+};
+
+/**
+ * Set or get a number of allowed retries on failed tests
+ *
+ * @private
+ * @param {number} n
+ * @return {Context} self
+ */
+Context.prototype.retries = function(n) {
+  if (!arguments.length) {
+    return this.runnable().retries();
+  }
+  this.runnable().retries(n);
+  return this;
+};
+
+},{}],6:[function(require,module,exports){
+'use strict';
+/**
+ * @module Errors
+ */
+/**
+ * Factory functions to create throwable error objects
+ */
+
+/**
+ * Creates an error object to be thrown when no files to be tested could be found using specified pattern.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} pattern - User-specified argument value.
+ * @returns {Error} instance detailing the error condition
+ */
+function createNoFilesMatchPatternError(message, pattern) {
+  var err = new Error(message);
+  err.code = 'ERR_MOCHA_NO_FILES_MATCH_PATTERN';
+  err.pattern = pattern;
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when the reporter specified in the options was not found.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} reporter - User-specified reporter value.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidReporterError(message, reporter) {
+  var err = new TypeError(message);
+  err.code = 'ERR_MOCHA_INVALID_REPORTER';
+  err.reporter = reporter;
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when the interface specified in the options was not found.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} ui - User-specified interface value.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidInterfaceError(message, ui) {
+  var err = new Error(message);
+  err.code = 'ERR_MOCHA_INVALID_INTERFACE';
+  err.interface = ui;
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when a behavior, option, or parameter is unsupported.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @returns {Error} instance detailing the error condition
+ */
+function createUnsupportedError(message) {
+  var err = new Error(message);
+  err.code = 'ERR_MOCHA_UNSUPPORTED';
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when an argument is missing.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} argument - Argument name.
+ * @param {string} expected - Expected argument datatype.
+ * @returns {Error} instance detailing the error condition
+ */
+function createMissingArgumentError(message, argument, expected) {
+  return createInvalidArgumentTypeError(message, argument, expected);
+}
+
+/**
+ * Creates an error object to be thrown when an argument did not use the supported type
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} argument - Argument name.
+ * @param {string} expected - Expected argument datatype.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidArgumentTypeError(message, argument, expected) {
+  var err = new TypeError(message);
+  err.code = 'ERR_MOCHA_INVALID_ARG_TYPE';
+  err.argument = argument;
+  err.expected = expected;
+  err.actual = typeof argument;
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when an argument did not use the supported value
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @param {string} argument - Argument name.
+ * @param {string} value - Argument value.
+ * @param {string} [reason] - Why value is invalid.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidArgumentValueError(message, argument, value, reason) {
+  var err = new TypeError(message);
+  err.code = 'ERR_MOCHA_INVALID_ARG_VALUE';
+  err.argument = argument;
+  err.value = value;
+  err.reason = typeof reason !== 'undefined' ? reason : 'is invalid';
+  return err;
+}
+
+/**
+ * Creates an error object to be thrown when an exception was caught, but the `Error` is falsy or undefined.
+ *
+ * @public
+ * @param {string} message - Error message to be displayed.
+ * @returns {Error} instance detailing the error condition
+ */
+function createInvalidExceptionError(message, value) {
+  var err = new Error(message);
+  err.code = 'ERR_MOCHA_INVALID_EXCEPTION';
+  err.valueType = typeof value;
+  err.value = value;
+  return err;
+}
+
+module.exports = {
+  createInvalidArgumentTypeError: createInvalidArgumentTypeError,
+  createInvalidArgumentValueError: createInvalidArgumentValueError,
+  createInvalidExceptionError: createInvalidExceptionError,
+  createInvalidInterfaceError: createInvalidInterfaceError,
+  createInvalidReporterError: createInvalidReporterError,
+  createMissingArgumentError: createMissingArgumentError,
+  createNoFilesMatchPatternError: createNoFilesMatchPatternError,
+  createUnsupportedError: createUnsupportedError
+};
+
+},{}],7:[function(require,module,exports){
+'use strict';
+
+var Runnable = require('./runnable');
+var inherits = require('./utils').inherits;
+
+/**
+ * Expose `Hook`.
+ */
+
+module.exports = Hook;
+
+/**
+ * Initialize a new `Hook` with the given `title` and callback `fn`
+ *
+ * @class
+ * @extends Runnable
+ * @param {String} title
+ * @param {Function} fn
+ */
+function Hook(title, fn) {
+  Runnable.call(this, title, fn);
+  this.type = 'hook';
+}
+
+/**
+ * Inherit from `Runnable.prototype`.
+ */
+inherits(Hook, Runnable);
+
+/**
+ * Get or set the test `err`.
+ *
+ * @memberof Hook
+ * @public
+ * @param {Error} err
+ * @return {Error}
+ */
+Hook.prototype.error = function(err) {
+  if (!arguments.length) {
+    err = this._error;
+    this._error = null;
+    return err;
+  }
+
+  this._error = err;
+};
+
+},{"./runnable":33,"./utils":38}],8:[function(require,module,exports){
+'use strict';
+
+var Test = require('../test');
+var EVENT_FILE_PRE_REQUIRE = require('../suite').constants
+  .EVENT_FILE_PRE_REQUIRE;
+
+/**
+ * BDD-style interface:
+ *
+ *      describe('Array', function() {
+ *        describe('#indexOf()', function() {
+ *          it('should return -1 when not present', function() {
+ *            // ...
+ *          });
+ *
+ *          it('should return the index when present', function() {
+ *            // ...
+ *          });
+ *        });
+ *      });
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function bddInterface(suite) {
+  var suites = [suite];
+
+  suite.on(EVENT_FILE_PRE_REQUIRE, function(context, file, mocha) {
+    var common = require('./common')(suites, context, mocha);
+
+    context.before = common.before;
+    context.after = common.after;
+    context.beforeEach = common.beforeEach;
+    context.afterEach = common.afterEach;
+    context.run = mocha.options.delay && common.runWithSuite(suite);
+    /**
+     * Describe a "suite" with the given `title`
+     * and callback `fn` containing nested suites
+     * and/or tests.
+     */
+
+    context.describe = context.context = function(title, fn) {
+      return common.suite.create({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Pending describe.
+     */
+
+    context.xdescribe = context.xcontext = context.describe.skip = function(
+      title,
+      fn
+    ) {
+      return common.suite.skip({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Exclusive suite.
+     */
+
+    context.describe.only = function(title, fn) {
+      return common.suite.only({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Describe a specification or test-case
+     * with the given `title` and callback `fn`
+     * acting as a thunk.
+     */
+
+    context.it = context.specify = function(title, fn) {
+      var suite = suites[0];
+      if (suite.isPending()) {
+        fn = null;
+      }
+      var test = new Test(title, fn);
+      test.file = file;
+      suite.addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.it.only = function(title, fn) {
+      return common.test.only(mocha, context.it(title, fn));
+    };
+
+    /**
+     * Pending test case.
+     */
+
+    context.xit = context.xspecify = context.it.skip = function(title) {
+      return context.it(title);
+    };
+
+    /**
+     * Number of attempts to retry.
+     */
+    context.it.retries = function(n) {
+      context.retries(n);
+    };
+  });
+};
+
+module.exports.description = 'BDD or RSpec style [default]';
+
+},{"../suite":36,"../test":37,"./common":9}],9:[function(require,module,exports){
+'use strict';
+
+var Suite = require('../suite');
+var errors = require('../errors');
+var createMissingArgumentError = errors.createMissingArgumentError;
+
+/**
+ * Functions common to more than one interface.
+ *
+ * @param {Suite[]} suites
+ * @param {Context} context
+ * @param {Mocha} mocha
+ * @return {Object} An object containing common functions.
+ */
+module.exports = function(suites, context, mocha) {
+  /**
+   * Check if the suite should be tested.
+   *
+   * @private
+   * @param {Suite} suite - suite to check
+   * @returns {boolean}
+   */
+  function shouldBeTested(suite) {
+    return (
+      !mocha.options.grep ||
+      (mocha.options.grep &&
+        mocha.options.grep.test(suite.fullTitle()) &&
+        !mocha.options.invert)
+    );
+  }
+
+  return {
+    /**
+     * This is only present if flag --delay is passed into Mocha. It triggers
+     * root suite execution.
+     *
+     * @param {Suite} suite The root suite.
+     * @return {Function} A function which runs the root suite
+     */
+    runWithSuite: function runWithSuite(suite) {
+      return function run() {
+        suite.run();
+      };
+    },
+
+    /**
+     * Execute before running tests.
+     *
+     * @param {string} name
+     * @param {Function} fn
+     */
+    before: function(name, fn) {
+      suites[0].beforeAll(name, fn);
+    },
+
+    /**
+     * Execute after running tests.
+     *
+     * @param {string} name
+     * @param {Function} fn
+     */
+    after: function(name, fn) {
+      suites[0].afterAll(name, fn);
+    },
+
+    /**
+     * Execute before each test case.
+     *
+     * @param {string} name
+     * @param {Function} fn
+     */
+    beforeEach: function(name, fn) {
+      suites[0].beforeEach(name, fn);
+    },
+
+    /**
+     * Execute after each test case.
+     *
+     * @param {string} name
+     * @param {Function} fn
+     */
+    afterEach: function(name, fn) {
+      suites[0].afterEach(name, fn);
+    },
+
+    suite: {
+      /**
+       * Create an exclusive Suite; convenience function
+       * See docstring for create() below.
+       *
+       * @param {Object} opts
+       * @returns {Suite}
+       */
+      only: function only(opts) {
+        opts.isOnly = true;
+        return this.create(opts);
+      },
+
+      /**
+       * Create a Suite, but skip it; convenience function
+       * See docstring for create() below.
+       *
+       * @param {Object} opts
+       * @returns {Suite}
+       */
+      skip: function skip(opts) {
+        opts.pending = true;
+        return this.create(opts);
+      },
+
+      /**
+       * Creates a suite.
+       *
+       * @param {Object} opts Options
+       * @param {string} opts.title Title of Suite
+       * @param {Function} [opts.fn] Suite Function (not always applicable)
+       * @param {boolean} [opts.pending] Is Suite pending?
+       * @param {string} [opts.file] Filepath where this Suite resides
+       * @param {boolean} [opts.isOnly] Is Suite exclusive?
+       * @returns {Suite}
+       */
+      create: function create(opts) {
+        var suite = Suite.create(suites[0], opts.title);
+        suite.pending = Boolean(opts.pending);
+        suite.file = opts.file;
+        suites.unshift(suite);
+        if (opts.isOnly) {
+          if (mocha.options.forbidOnly && shouldBeTested(suite)) {
+            throw new Error('`.only` forbidden');
+          }
+
+          suite.parent.appendOnlySuite(suite);
+        }
+        if (suite.pending) {
+          if (mocha.options.forbidPending && shouldBeTested(suite)) {
+            throw new Error('Pending test forbidden');
+          }
+        }
+        if (typeof opts.fn === 'function') {
+          opts.fn.call(suite);
+          suites.shift();
+        } else if (typeof opts.fn === 'undefined' && !suite.pending) {
+          throw createMissingArgumentError(
+            'Suite "' +
+              suite.fullTitle() +
+              '" was defined but no callback was supplied. ' +
+              'Supply a callback or explicitly skip the suite.',
+            'callback',
+            'function'
+          );
+        } else if (!opts.fn && suite.pending) {
+          suites.shift();
+        }
+
+        return suite;
+      }
+    },
+
+    test: {
+      /**
+       * Exclusive test-case.
+       *
+       * @param {Object} mocha
+       * @param {Function} test
+       * @returns {*}
+       */
+      only: function(mocha, test) {
+        test.parent.appendOnlyTest(test);
+        return test;
+      },
+
+      /**
+       * Pending test case.
+       *
+       * @param {string} title
+       */
+      skip: function(title) {
+        context.test(title);
+      },
+
+      /**
+       * Number of retry attempts
+       *
+       * @param {number} n
+       */
+      retries: function(n) {
+        context.retries(n);
+      }
+    }
+  };
+};
+
+},{"../errors":6,"../suite":36}],10:[function(require,module,exports){
+'use strict';
+var Suite = require('../suite');
+var Test = require('../test');
+
+/**
+ * Exports-style (as Node.js module) interface:
+ *
+ *     exports.Array = {
+ *       '#indexOf()': {
+ *         'should return -1 when the value is not present': function() {
+ *
+ *         },
+ *
+ *         'should return the correct index when the value is present': function() {
+ *
+ *         }
+ *       }
+ *     };
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function(suite) {
+  var suites = [suite];
+
+  suite.on(Suite.constants.EVENT_FILE_REQUIRE, visit);
+
+  function visit(obj, file) {
+    var suite;
+    for (var key in obj) {
+      if (typeof obj[key] === 'function') {
+        var fn = obj[key];
+        switch (key) {
+          case 'before':
+            suites[0].beforeAll(fn);
+            break;
+          case 'after':
+            suites[0].afterAll(fn);
+            break;
+          case 'beforeEach':
+            suites[0].beforeEach(fn);
+            break;
+          case 'afterEach':
+            suites[0].afterEach(fn);
+            break;
+          default:
+            var test = new Test(key, fn);
+            test.file = file;
+            suites[0].addTest(test);
+        }
+      } else {
+        suite = Suite.create(suites[0], key);
+        suites.unshift(suite);
+        visit(obj[key], file);
+        suites.shift();
+      }
+    }
+  }
+};
+
+module.exports.description = 'Node.js module ("exports") style';
+
+},{"../suite":36,"../test":37}],11:[function(require,module,exports){
+'use strict';
+
+exports.bdd = require('./bdd');
+exports.tdd = require('./tdd');
+exports.qunit = require('./qunit');
+exports.exports = require('./exports');
+
+},{"./bdd":8,"./exports":10,"./qunit":12,"./tdd":13}],12:[function(require,module,exports){
+'use strict';
+
+var Test = require('../test');
+var EVENT_FILE_PRE_REQUIRE = require('../suite').constants
+  .EVENT_FILE_PRE_REQUIRE;
+
+/**
+ * QUnit-style interface:
+ *
+ *     suite('Array');
+ *
+ *     test('#length', function() {
+ *       var arr = [1,2,3];
+ *       ok(arr.length == 3);
+ *     });
+ *
+ *     test('#indexOf()', function() {
+ *       var arr = [1,2,3];
+ *       ok(arr.indexOf(1) == 0);
+ *       ok(arr.indexOf(2) == 1);
+ *       ok(arr.indexOf(3) == 2);
+ *     });
+ *
+ *     suite('String');
+ *
+ *     test('#length', function() {
+ *       ok('foo'.length == 3);
+ *     });
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function qUnitInterface(suite) {
+  var suites = [suite];
+
+  suite.on(EVENT_FILE_PRE_REQUIRE, function(context, file, mocha) {
+    var common = require('./common')(suites, context, mocha);
+
+    context.before = common.before;
+    context.after = common.after;
+    context.beforeEach = common.beforeEach;
+    context.afterEach = common.afterEach;
+    context.run = mocha.options.delay && common.runWithSuite(suite);
+    /**
+     * Describe a "suite" with the given `title`.
+     */
+
+    context.suite = function(title) {
+      if (suites.length > 1) {
+        suites.shift();
+      }
+      return common.suite.create({
+        title: title,
+        file: file,
+        fn: false
+      });
+    };
+
+    /**
+     * Exclusive Suite.
+     */
+
+    context.suite.only = function(title) {
+      if (suites.length > 1) {
+        suites.shift();
+      }
+      return common.suite.only({
+        title: title,
+        file: file,
+        fn: false
+      });
+    };
+
+    /**
+     * Describe a specification or test-case
+     * with the given `title` and callback `fn`
+     * acting as a thunk.
+     */
+
+    context.test = function(title, fn) {
+      var test = new Test(title, fn);
+      test.file = file;
+      suites[0].addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.test.only = function(title, fn) {
+      return common.test.only(mocha, context.test(title, fn));
+    };
+
+    context.test.skip = common.test.skip;
+    context.test.retries = common.test.retries;
+  });
+};
+
+module.exports.description = 'QUnit style';
+
+},{"../suite":36,"../test":37,"./common":9}],13:[function(require,module,exports){
+'use strict';
+
+var Test = require('../test');
+var EVENT_FILE_PRE_REQUIRE = require('../suite').constants
+  .EVENT_FILE_PRE_REQUIRE;
+
+/**
+ * TDD-style interface:
+ *
+ *      suite('Array', function() {
+ *        suite('#indexOf()', function() {
+ *          suiteSetup(function() {
+ *
+ *          });
+ *
+ *          test('should return -1 when not present', function() {
+ *
+ *          });
+ *
+ *          test('should return the index when present', function() {
+ *
+ *          });
+ *
+ *          suiteTeardown(function() {
+ *
+ *          });
+ *        });
+ *      });
+ *
+ * @param {Suite} suite Root suite.
+ */
+module.exports = function(suite) {
+  var suites = [suite];
+
+  suite.on(EVENT_FILE_PRE_REQUIRE, function(context, file, mocha) {
+    var common = require('./common')(suites, context, mocha);
+
+    context.setup = common.beforeEach;
+    context.teardown = common.afterEach;
+    context.suiteSetup = common.before;
+    context.suiteTeardown = common.after;
+    context.run = mocha.options.delay && common.runWithSuite(suite);
+
+    /**
+     * Describe a "suite" with the given `title` and callback `fn` containing
+     * nested suites and/or tests.
+     */
+    context.suite = function(title, fn) {
+      return common.suite.create({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Pending suite.
+     */
+    context.suite.skip = function(title, fn) {
+      return common.suite.skip({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+    context.suite.only = function(title, fn) {
+      return common.suite.only({
+        title: title,
+        file: file,
+        fn: fn
+      });
+    };
+
+    /**
+     * Describe a specification or test-case with the given `title` and
+     * callback `fn` acting as a thunk.
+     */
+    context.test = function(title, fn) {
+      var suite = suites[0];
+      if (suite.isPending()) {
+        fn = null;
+      }
+      var test = new Test(title, fn);
+      test.file = file;
+      suite.addTest(test);
+      return test;
+    };
+
+    /**
+     * Exclusive test-case.
+     */
+
+    context.test.only = function(title, fn) {
+      return common.test.only(mocha, context.test(title, fn));
+    };
+
+    context.test.skip = common.test.skip;
+    context.test.retries = common.test.retries;
+  });
+};
+
+module.exports.description =
+  'traditional "suite"/"test" instead of BDD\'s "describe"/"it"';
+
+},{"../suite":36,"../test":37,"./common":9}],14:[function(require,module,exports){
+(function (process,global){
+'use strict';
+
+/*!
+ * mocha
+ * Copyright(c) 2011 TJ Holowaychuk <tj@vision-media.ca>
+ * MIT Licensed
+ */
+
+var escapeRe = require('escape-string-regexp');
+var path = require('path');
+var builtinReporters = require('./reporters');
+var growl = require('./growl');
+var utils = require('./utils');
+var mocharc = require('./mocharc.json');
+var errors = require('./errors');
+var Suite = require('./suite');
+var createStatsCollector = require('./stats-collector');
+var createInvalidReporterError = errors.createInvalidReporterError;
+var createInvalidInterfaceError = errors.createInvalidInterfaceError;
+var EVENT_FILE_PRE_REQUIRE = Suite.constants.EVENT_FILE_PRE_REQUIRE;
+var EVENT_FILE_POST_REQUIRE = Suite.constants.EVENT_FILE_POST_REQUIRE;
+var EVENT_FILE_REQUIRE = Suite.constants.EVENT_FILE_REQUIRE;
+var sQuote = utils.sQuote;
+
+exports = module.exports = Mocha;
+
+/**
+ * To require local UIs and reporters when running in node.
+ */
+
+if (!process.browser) {
+  var cwd = process.cwd();
+  module.paths.push(cwd, path.join(cwd, 'node_modules'));
+}
+
+/**
+ * Expose internals.
+ */
+
+/**
+ * @public
+ * @class utils
+ * @memberof Mocha
+ */
+exports.utils = utils;
+exports.interfaces = require('./interfaces');
+/**
+ * @public
+ * @memberof Mocha
+ */
+exports.reporters = builtinReporters;
+exports.Runnable = require('./runnable');
+exports.Context = require('./context');
+/**
+ *
+ * @memberof Mocha
+ */
+exports.Runner = require('./runner');
+exports.Suite = Suite;
+exports.Hook = require('./hook');
+exports.Test = require('./test');
+
+/**
+ * Constructs a new Mocha instance with `options`.
+ *
+ * @public
+ * @class Mocha
+ * @param {Object} [options] - Settings object.
+ * @param {boolean} [options.allowUncaught] - Propagate uncaught errors?
+ * @param {boolean} [options.asyncOnly] - Force `done` callback or promise?
+ * @param {boolean} [options.bail] - Bail after first test failure?
+ * @param {boolean} [options.checkLeaks] - If true, check leaks.
+ * @param {boolean} [options.delay] - Delay root suite execution?
+ * @param {boolean} [options.enableTimeouts] - Enable timeouts?
+ * @param {string} [options.fgrep] - Test filter given string.
+ * @param {boolean} [options.forbidOnly] - Tests marked `only` fail the suite?
+ * @param {boolean} [options.forbidPending] - Pending tests fail the suite?
+ * @param {boolean} [options.fullStackTrace] - Full stacktrace upon failure?
+ * @param {string[]} [options.global] - Variables expected in global scope.
+ * @param {RegExp|string} [options.grep] - Test filter given regular expression.
+ * @param {boolean} [options.growl] - Enable desktop notifications?
+ * @param {boolean} [options.hideDiff] - Suppress diffs from failures?
+ * @param {boolean} [options.ignoreLeaks] - Ignore global leaks?
+ * @param {boolean} [options.invert] - Invert test filter matches?
+ * @param {boolean} [options.noHighlighting] - Disable syntax highlighting?
+ * @param {string} [options.reporter] - Reporter name.
+ * @param {Object} [options.reporterOption] - Reporter settings object.
+ * @param {number} [options.retries] - Number of times to retry failed tests.
+ * @param {number} [options.slow] - Slow threshold value.
+ * @param {number|string} [options.timeout] - Timeout threshold value.
+ * @param {string} [options.ui] - Interface name.
+ * @param {boolean} [options.color] - Color TTY output from reporter?
+ * @param {boolean} [options.useInlineDiffs] - Use inline diffs?
+ */
+function Mocha(options) {
+  options = utils.assign({}, mocharc, options || {});
+  this.files = [];
+  this.options = options;
+  // root suite
+  this.suite = new exports.Suite('', new exports.Context(), true);
+
+  if ('useColors' in options) {
+    utils.deprecate(
+      'useColors is DEPRECATED and will be removed from a future version of Mocha. Instead, use the "color" option'
+    );
+    options.color = 'color' in options ? options.color : options.useColors;
+  }
+
+  // Globals are passed in as options.global, with options.globals for backward compatibility.
+  options.globals = options.global || options.globals || [];
+  delete options.global;
+
+  this.grep(options.grep)
+    .fgrep(options.fgrep)
+    .ui(options.ui)
+    .bail(options.bail)
+    .reporter(options.reporter, options.reporterOptions)
+    .useColors(options.color)
+    .slow(options.slow)
+    .useInlineDiffs(options.inlineDiffs)
+    .globals(options.globals);
+
+  if ('enableTimeouts' in options) {
+    utils.deprecate(
+      'enableTimeouts is DEPRECATED and will be removed from a future version of Mocha. Instead, use "timeout: false" to disable timeouts.'
+    );
+    if (options.enableTimeouts === false) {
+      this.timeout(0);
+    }
+  }
+
+  // this guard exists because Suite#timeout does not consider `undefined` to be valid input
+  if (typeof options.timeout !== 'undefined') {
+    this.timeout(options.timeout === false ? 0 : options.timeout);
+  }
+
+  if ('retries' in options) {
+    this.retries(options.retries);
+  }
+
+  if ('diff' in options) {
+    this.hideDiff(!options.diff);
+  }
+
+  [
+    'allowUncaught',
+    'asyncOnly',
+    'checkLeaks',
+    'delay',
+    'forbidOnly',
+    'forbidPending',
+    'fullTrace',
+    'growl',
+    'invert'
+  ].forEach(function(opt) {
+    if (options[opt]) {
+      this[opt]();
+    }
+  }, this);
+}
+
+/**
+ * Enables or disables bailing on the first failure.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-b---bail|CLI option}
+ * @param {boolean} [bail=true] - Whether to bail on first error.
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.bail = function(bail) {
+  if (!arguments.length) {
+    bail = true;
+  }
+  this.suite.bail(bail);
+  return this;
+};
+
+/**
+ * @summary
+ * Adds `file` to be loaded for execution.
+ *
+ * @description
+ * Useful for generic setup code that must be included within test suite.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#--file-file|CLI option}
+ * @param {string} file - Pathname of file to be loaded.
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.addFile = function(file) {
+  this.files.push(file);
+  return this;
+};
+
+/**
+ * Sets reporter to `reporter`, defaults to "spec".
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-r---reporter-name|CLI option}
+ * @see {@link https://mochajs.org/#reporters|Reporters}
+ * @param {String|Function} reporter - Reporter name or constructor.
+ * @param {Object} [reporterOptions] - Options used to configure the reporter.
+ * @returns {Mocha} this
+ * @chainable
+ * @throws {Error} if requested reporter cannot be loaded
+ * @example
+ *
+ * // Use XUnit reporter and direct its output to file
+ * mocha.reporter('xunit', { output: '/path/to/testspec.xunit.xml' });
+ */
+Mocha.prototype.reporter = function(reporter, reporterOptions) {
+  if (typeof reporter === 'function') {
+    this._reporter = reporter;
+  } else {
+    reporter = reporter || 'spec';
+    var _reporter;
+    // Try to load a built-in reporter.
+    if (builtinReporters[reporter]) {
+      _reporter = builtinReporters[reporter];
+    }
+    // Try to load reporters from process.cwd() and node_modules
+    if (!_reporter) {
+      try {
+        _reporter = require(reporter);
+      } catch (err) {
+        if (
+          err.code !== 'MODULE_NOT_FOUND' ||
+          err.message.indexOf('Cannot find module') !== -1
+        ) {
+          // Try to load reporters from a path (absolute or relative)
+          try {
+            _reporter = require(path.resolve(process.cwd(), reporter));
+          } catch (_err) {
+            _err.code !== 'MODULE_NOT_FOUND' ||
+            _err.message.indexOf('Cannot find module') !== -1
+              ? console.warn(sQuote(reporter) + ' reporter not found')
+              : console.warn(
+                  sQuote(reporter) +
+                    ' reporter blew up with error:\n' +
+                    err.stack
+                );
+          }
+        } else {
+          console.warn(
+            sQuote(reporter) + ' reporter blew up with error:\n' + err.stack
+          );
+        }
+      }
+    }
+    if (!_reporter) {
+      throw createInvalidReporterError(
+        'invalid reporter ' + sQuote(reporter),
+        reporter
+      );
+    }
+    this._reporter = _reporter;
+  }
+  this.options.reporterOptions = reporterOptions;
+  return this;
+};
+
+/**
+ * Sets test UI `name`, defaults to "bdd".
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-u---ui-name|CLI option}
+ * @see {@link https://mochajs.org/#interfaces|Interface DSLs}
+ * @param {string|Function} [ui=bdd] - Interface name or class.
+ * @returns {Mocha} this
+ * @chainable
+ * @throws {Error} if requested interface cannot be loaded
+ */
+Mocha.prototype.ui = function(ui) {
+  var bindInterface;
+  if (typeof ui === 'function') {
+    bindInterface = ui;
+  } else {
+    ui = ui || 'bdd';
+    bindInterface = exports.interfaces[ui];
+    if (!bindInterface) {
+      try {
+        bindInterface = require(ui);
+      } catch (err) {
+        throw createInvalidInterfaceError(
+          'invalid interface ' + sQuote(ui),
+          ui
+        );
+      }
+    }
+  }
+  bindInterface(this.suite);
+
+  this.suite.on(EVENT_FILE_PRE_REQUIRE, function(context) {
+    exports.afterEach = context.afterEach || context.teardown;
+    exports.after = context.after || context.suiteTeardown;
+    exports.beforeEach = context.beforeEach || context.setup;
+    exports.before = context.before || context.suiteSetup;
+    exports.describe = context.describe || context.suite;
+    exports.it = context.it || context.test;
+    exports.xit = context.xit || (context.test && context.test.skip);
+    exports.setup = context.setup || context.beforeEach;
+    exports.suiteSetup = context.suiteSetup || context.before;
+    exports.suiteTeardown = context.suiteTeardown || context.after;
+    exports.suite = context.suite || context.describe;
+    exports.teardown = context.teardown || context.afterEach;
+    exports.test = context.test || context.it;
+    exports.run = context.run;
+  });
+
+  return this;
+};
+
+/**
+ * Loads `files` prior to execution.
+ *
+ * @description
+ * The implementation relies on Node's `require` to execute
+ * the test interface functions and will be subject to its cache.
+ *
+ * @private
+ * @see {@link Mocha#addFile}
+ * @see {@link Mocha#run}
+ * @see {@link Mocha#unloadFiles}
+ * @param {Function} [fn] - Callback invoked upon completion.
+ */
+Mocha.prototype.loadFiles = function(fn) {
+  var self = this;
+  var suite = this.suite;
+  this.files.forEach(function(file) {
+    file = path.resolve(file);
+    suite.emit(EVENT_FILE_PRE_REQUIRE, global, file, self);
+    suite.emit(EVENT_FILE_REQUIRE, require(file), file, self);
+    suite.emit(EVENT_FILE_POST_REQUIRE, global, file, self);
+  });
+  fn && fn();
+};
+
+/**
+ * Removes a previously loaded file from Node's `require` cache.
+ *
+ * @private
+ * @static
+ * @see {@link Mocha#unloadFiles}
+ * @param {string} file - Pathname of file to be unloaded.
+ */
+Mocha.unloadFile = function(file) {
+  delete require.cache[require.resolve(file)];
+};
+
+/**
+ * Unloads `files` from Node's `require` cache.
+ *
+ * @description
+ * This allows files to be "freshly" reloaded, providing the ability
+ * to reuse a Mocha instance programmatically.
+ *
+ * <strong>Intended for consumers &mdash; not used internally</strong>
+ *
+ * @public
+ * @see {@link Mocha.unloadFile}
+ * @see {@link Mocha#loadFiles}
+ * @see {@link Mocha#run}
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.unloadFiles = function() {
+  this.files.forEach(Mocha.unloadFile);
+  return this;
+};
+
+/**
+ * Sets `grep` filter after escaping RegExp special characters.
+ *
+ * @public
+ * @see {@link Mocha#grep}
+ * @param {string} str - Value to be converted to a regexp.
+ * @returns {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Select tests whose full title begins with `"foo"` followed by a period
+ * mocha.fgrep('foo.');
+ */
+Mocha.prototype.fgrep = function(str) {
+  if (!str) {
+    return this;
+  }
+  return this.grep(new RegExp(escapeRe(str)));
+};
+
+/**
+ * @summary
+ * Sets `grep` filter used to select specific tests for execution.
+ *
+ * @description
+ * If `re` is a regexp-like string, it will be converted to regexp.
+ * The regexp is tested against the full title of each test (i.e., the
+ * name of the test preceded by titles of each its ancestral suites).
+ * As such, using an <em>exact-match</em> fixed pattern against the
+ * test name itself will not yield any matches.
+ * <br>
+ * <strong>Previous filter value will be overwritten on each call!</strong>
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-g---grep-pattern|CLI option}
+ * @see {@link Mocha#fgrep}
+ * @see {@link Mocha#invert}
+ * @param {RegExp|String} re - Regular expression used to select tests.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Select tests whose full title contains `"match"`, ignoring case
+ * mocha.grep(/match/i);
+ * @example
+ *
+ * // Same as above but with regexp-like string argument
+ * mocha.grep('/match/i');
+ * @example
+ *
+ * // ## Anti-example
+ * // Given embedded test `it('only-this-test')`...
+ * mocha.grep('/^only-this-test$/');    // NO! Use `.only()` to do this!
+ */
+Mocha.prototype.grep = function(re) {
+  if (utils.isString(re)) {
+    // extract args if it's regex-like, i.e: [string, pattern, flag]
+    var arg = re.match(/^\/(.*)\/(g|i|)$|.*/);
+    this.options.grep = new RegExp(arg[1] || arg[0], arg[2]);
+  } else {
+    this.options.grep = re;
+  }
+  return this;
+};
+
+/**
+ * Inverts `grep` matches.
+ *
+ * @public
+ * @see {@link Mocha#grep}
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Select tests whose full title does *not* contain `"match"`, ignoring case
+ * mocha.grep(/match/i).invert();
+ */
+Mocha.prototype.invert = function() {
+  this.options.invert = true;
+  return this;
+};
+
+/**
+ * Enables or disables ignoring global leaks.
+ *
+ * @public
+ * @see {@link Mocha#checkLeaks}
+ * @param {boolean} ignoreLeaks - Whether to ignore global leaks.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Ignore global leaks
+ * mocha.ignoreLeaks(true);
+ */
+Mocha.prototype.ignoreLeaks = function(ignoreLeaks) {
+  this.options.ignoreLeaks = Boolean(ignoreLeaks);
+  return this;
+};
+
+/**
+ * Enables checking for global variables leaked while running tests.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#--check-leaks|CLI option}
+ * @see {@link Mocha#ignoreLeaks}
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.checkLeaks = function() {
+  this.options.ignoreLeaks = false;
+  return this;
+};
+
+/**
+ * Displays full stack trace upon test failure.
+ *
+ * @public
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.fullTrace = function() {
+  this.options.fullStackTrace = true;
+  return this;
+};
+
+/**
+ * Enables desktop notification support if prerequisite software installed.
+ *
+ * @public
+ * @see {@link Mocha#isGrowlCapable}
+ * @see {@link Mocha#_growl}
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.growl = function() {
+  this.options.growl = this.isGrowlCapable();
+  if (!this.options.growl) {
+    var detail = process.browser
+      ? 'notification support not available in this browser...'
+      : 'notification support prerequisites not installed...';
+    console.error(detail + ' cannot enable!');
+  }
+  return this;
+};
+
+/**
+ * @summary
+ * Determines if Growl support seems likely.
+ *
+ * @description
+ * <strong>Not available when run in browser.</strong>
+ *
+ * @private
+ * @see {@link Growl#isCapable}
+ * @see {@link Mocha#growl}
+ * @return {boolean} whether Growl support can be expected
+ */
+Mocha.prototype.isGrowlCapable = growl.isCapable;
+
+/**
+ * Implements desktop notifications using a pseudo-reporter.
+ *
+ * @private
+ * @see {@link Mocha#growl}
+ * @see {@link Growl#notify}
+ * @param {Runner} runner - Runner instance.
+ */
+Mocha.prototype._growl = growl.notify;
+
+/**
+ * Specifies whitelist of variable names to be expected in global scope.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-global-variable-name|CLI option}
+ * @see {@link Mocha#checkLeaks}
+ * @param {String[]|String} globals - Accepted global variable name(s).
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Specify variables to be expected in global scope
+ * mocha.globals(['jQuery', 'MyLib']);
+ */
+Mocha.prototype.globals = function(globals) {
+  this.options.globals = this.options.globals
+    .concat(globals)
+    .filter(Boolean)
+    .filter(function(elt, idx, arr) {
+      return arr.indexOf(elt) === idx;
+    });
+  return this;
+};
+
+/**
+ * Enables or disables TTY color output by screen-oriented reporters.
+ *
+ * @public
+ * @param {boolean} colors - Whether to enable color output.
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.useColors = function(colors) {
+  if (colors !== undefined) {
+    this.options.useColors = colors;
+  }
+  return this;
+};
+
+/**
+ * Determines if reporter should use inline diffs (rather than +/-)
+ * in test failure output.
+ *
+ * @public
+ * @param {boolean} inlineDiffs - Whether to use inline diffs.
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.useInlineDiffs = function(inlineDiffs) {
+  this.options.useInlineDiffs = inlineDiffs !== undefined && inlineDiffs;
+  return this;
+};
+
+/**
+ * Determines if reporter should include diffs in test failure output.
+ *
+ * @public
+ * @param {boolean} hideDiff - Whether to hide diffs.
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.hideDiff = function(hideDiff) {
+  this.options.hideDiff = hideDiff !== undefined && hideDiff;
+  return this;
+};
+
+/**
+ * @summary
+ * Sets timeout threshold value.
+ *
+ * @description
+ * A string argument can use shorthand (such as "2s") and will be converted.
+ * If the value is `0`, timeouts will be disabled.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-t---timeout-ms|CLI option}
+ * @see {@link https://mochajs.org/#--no-timeouts|CLI option}
+ * @see {@link https://mochajs.org/#timeouts|Timeouts}
+ * @see {@link Mocha#enableTimeouts}
+ * @param {number|string} msecs - Timeout threshold value.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Sets timeout to one second
+ * mocha.timeout(1000);
+ * @example
+ *
+ * // Same as above but using string argument
+ * mocha.timeout('1s');
+ */
+Mocha.prototype.timeout = function(msecs) {
+  this.suite.timeout(msecs);
+  return this;
+};
+
+/**
+ * Sets the number of times to retry failed tests.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#retry-tests|Retry Tests}
+ * @param {number} retry - Number of times to retry failed tests.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Allow any failed test to retry one more time
+ * mocha.retries(1);
+ */
+Mocha.prototype.retries = function(n) {
+  this.suite.retries(n);
+  return this;
+};
+
+/**
+ * Sets slowness threshold value.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-s---slow-ms|CLI option}
+ * @param {number} msecs - Slowness threshold value.
+ * @return {Mocha} this
+ * @chainable
+ * @example
+ *
+ * // Sets "slow" threshold to half a second
+ * mocha.slow(500);
+ * @example
+ *
+ * // Same as above but using string argument
+ * mocha.slow('0.5s');
+ */
+Mocha.prototype.slow = function(msecs) {
+  this.suite.slow(msecs);
+  return this;
+};
+
+/**
+ * Enables or disables timeouts.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#-t---timeout-ms|CLI option}
+ * @see {@link https://mochajs.org/#--no-timeouts|CLI option}
+ * @param {boolean} enableTimeouts - Whether to enable timeouts.
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.enableTimeouts = function(enableTimeouts) {
+  this.suite.enableTimeouts(
+    arguments.length && enableTimeouts !== undefined ? enableTimeouts : true
+  );
+  return this;
+};
+
+/**
+ * Forces all tests to either accept a `done` callback or return a promise.
+ *
+ * @public
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.asyncOnly = function() {
+  this.options.asyncOnly = true;
+  return this;
+};
+
+/**
+ * Disables syntax highlighting (in browser).
+ *
+ * @public
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.noHighlighting = function() {
+  this.options.noHighlighting = true;
+  return this;
+};
+
+/**
+ * Enables uncaught errors to propagate (in browser).
+ *
+ * @public
+ * @return {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.allowUncaught = function() {
+  this.options.allowUncaught = true;
+  return this;
+};
+
+/**
+ * @summary
+ * Delays root suite execution.
+ *
+ * @description
+ * Used to perform asynch operations before any suites are run.
+ *
+ * @public
+ * @see {@link https://mochajs.org/#delayed-root-suite|delayed root suite}
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.delay = function delay() {
+  this.options.delay = true;
+  return this;
+};
+
+/**
+ * Causes tests marked `only` to fail the suite.
+ *
+ * @public
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.forbidOnly = function() {
+  this.options.forbidOnly = true;
+  return this;
+};
+
+/**
+ * Causes pending tests and tests marked `skip` to fail the suite.
+ *
+ * @public
+ * @returns {Mocha} this
+ * @chainable
+ */
+Mocha.prototype.forbidPending = function() {
+  this.options.forbidPending = true;
+  return this;
+};
+
+/**
+ * Mocha version as specified by "package.json".
+ *
+ * @name Mocha#version
+ * @type string
+ * @readonly
+ */
+Object.defineProperty(Mocha.prototype, 'version', {
+  value: require('../package.json').version,
+  configurable: false,
+  enumerable: true,
+  writable: false
+});
+
+/**
+ * Callback to be invoked when test execution is complete.
+ *
+ * @callback DoneCB
+ * @param {number} failures - Number of failures that occurred.
+ */
+
+/**
+ * Runs root suite and invokes `fn()` when complete.
+ *
+ * @description
+ * To run tests multiple times (or to run tests in files that are
+ * already in the `require` cache), make sure to clear them from
+ * the cache first!
+ *
+ * @public
+ * @see {@link Mocha#loadFiles}
+ * @see {@link Mocha#unloadFiles}
+ * @see {@link Runner#run}
+ * @param {DoneCB} [fn] - Callback invoked when test execution completed.
+ * @return {Runner} runner instance
+ */
+Mocha.prototype.run = function(fn) {
+  if (this.files.length) {
+    this.loadFiles();
+  }
+  var suite = this.suite;
+  var options = this.options;
+  options.files = this.files;
+  var runner = new exports.Runner(suite, options.delay);
+  createStatsCollector(runner);
+  var reporter = new this._reporter(runner, options);
+  runner.ignoreLeaks = options.ignoreLeaks !== false;
+  runner.fullStackTrace = options.fullStackTrace;
+  runner.asyncOnly = options.asyncOnly;
+  runner.allowUncaught = options.allowUncaught;
+  runner.forbidOnly = options.forbidOnly;
+  runner.forbidPending = options.forbidPending;
+  if (options.grep) {
+    runner.grep(options.grep, options.invert);
+  }
+  if (options.globals) {
+    runner.globals(options.globals);
+  }
+  if (options.growl) {
+    this._growl(runner);
+  }
+  if (options.useColors !== undefined) {
+    exports.reporters.Base.useColors = options.useColors;
+  }
+  exports.reporters.Base.inlineDiffs = options.useInlineDiffs;
+  exports.reporters.Base.hideDiff = options.hideDiff;
+
+  function done(failures) {
+    fn = fn || utils.noop;
+    if (reporter.done) {
+      reporter.done(failures, fn);
+    } else {
+      fn(failures);
+    }
+  }
+
+  return runner.run(done);
+};
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"../package.json":90,"./context":5,"./errors":6,"./growl":2,"./hook":7,"./interfaces":11,"./mocharc.json":15,"./reporters":21,"./runnable":33,"./runner":34,"./stats-collector":35,"./suite":36,"./test":37,"./utils":38,"_process":69,"escape-string-regexp":49,"path":42}],15:[function(require,module,exports){
+module.exports={
+  "diff": true,
+  "extension": ["js"],
+  "opts": "./test/mocha.opts",
+  "package": "./package.json",
+  "reporter": "spec",
+  "slow": 75,
+  "timeout": 2000,
+  "ui": "bdd"
+}
+
+},{}],16:[function(require,module,exports){
+'use strict';
+
+module.exports = Pending;
+
+/**
+ * Initialize a new `Pending` error with the given message.
+ *
+ * @param {string} message
+ */
+function Pending(message) {
+  this.message = message;
+}
+
+},{}],17:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module Base
+ */
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var diff = require('diff');
+var milliseconds = require('ms');
+var utils = require('../utils');
+var supportsColor = process.browser ? null : require('supports-color');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+
+/**
+ * Expose `Base`.
+ */
+
+exports = module.exports = Base;
+
+/**
+ * Check if both stdio streams are associated with a tty.
+ */
+
+var isatty = tty.isatty(1) && tty.isatty(2);
+
+/**
+ * Save log references to avoid tests interfering (see GH-3604).
+ */
+var consoleLog = console.log;
+
+/**
+ * Enable coloring by default, except in the browser interface.
+ */
+
+exports.useColors =
+  !process.browser &&
+  (supportsColor.stdout || process.env.MOCHA_COLORS !== undefined);
+
+/**
+ * Inline diffs instead of +/-
+ */
+
+exports.inlineDiffs = false;
+
+/**
+ * Default color map.
+ */
+
+exports.colors = {
+  pass: 90,
+  fail: 31,
+  'bright pass': 92,
+  'bright fail': 91,
+  'bright yellow': 93,
+  pending: 36,
+  suite: 0,
+  'error title': 0,
+  'error message': 31,
+  'error stack': 90,
+  checkmark: 32,
+  fast: 90,
+  medium: 33,
+  slow: 31,
+  green: 32,
+  light: 90,
+  'diff gutter': 90,
+  'diff added': 32,
+  'diff removed': 31
+};
+
+/**
+ * Default symbol map.
+ */
+
+exports.symbols = {
+  ok: '✓',
+  err: '✖',
+  dot: '․',
+  comma: ',',
+  bang: '!'
+};
+
+// With node.js on Windows: use symbols available in terminal default fonts
+if (process.platform === 'win32') {
+  exports.symbols.ok = '\u221A';
+  exports.symbols.err = '\u00D7';
+  exports.symbols.dot = '.';
+}
+
+/**
+ * Color `str` with the given `type`,
+ * allowing colors to be disabled,
+ * as well as user-defined color
+ * schemes.
+ *
+ * @private
+ * @param {string} type
+ * @param {string} str
+ * @return {string}
+ */
+var color = (exports.color = function(type, str) {
+  if (!exports.useColors) {
+    return String(str);
+  }
+  return '\u001b[' + exports.colors[type] + 'm' + str + '\u001b[0m';
+});
+
+/**
+ * Expose term window size, with some defaults for when stderr is not a tty.
+ */
+
+exports.window = {
+  width: 75
+};
+
+if (isatty) {
+  exports.window.width = process.stdout.getWindowSize
+    ? process.stdout.getWindowSize(1)[0]
+    : tty.getWindowSize()[1];
+}
+
+/**
+ * Expose some basic cursor interactions that are common among reporters.
+ */
+
+exports.cursor = {
+  hide: function() {
+    isatty && process.stdout.write('\u001b[?25l');
+  },
+
+  show: function() {
+    isatty && process.stdout.write('\u001b[?25h');
+  },
+
+  deleteLine: function() {
+    isatty && process.stdout.write('\u001b[2K');
+  },
+
+  beginningOfLine: function() {
+    isatty && process.stdout.write('\u001b[0G');
+  },
+
+  CR: function() {
+    if (isatty) {
+      exports.cursor.deleteLine();
+      exports.cursor.beginningOfLine();
+    } else {
+      process.stdout.write('\r');
+    }
+  }
+};
+
+function showDiff(err) {
+  return (
+    err &&
+    err.showDiff !== false &&
+    sameType(err.actual, err.expected) &&
+    err.expected !== undefined
+  );
+}
+
+function stringifyDiffObjs(err) {
+  if (!utils.isString(err.actual) || !utils.isString(err.expected)) {
+    err.actual = utils.stringify(err.actual);
+    err.expected = utils.stringify(err.expected);
+  }
+}
+
+/**
+ * Returns a diff between 2 strings with coloured ANSI output.
+ *
+ * @description
+ * The diff will be either inline or unified dependent on the value
+ * of `Base.inlineDiff`.
+ *
+ * @param {string} actual
+ * @param {string} expected
+ * @return {string} Diff
+ */
+var generateDiff = (exports.generateDiff = function(actual, expected) {
+  return exports.inlineDiffs
+    ? inlineDiff(actual, expected)
+    : unifiedDiff(actual, expected);
+});
+
+/**
+ * Outputs the given `failures` as a list.
+ *
+ * @public
+ * @memberof Mocha.reporters.Base
+ * @variation 1
+ * @param {Object[]} failures - Each is Test instance with corresponding
+ *     Error property
+ */
+exports.list = function(failures) {
+  Base.consoleLog();
+  failures.forEach(function(test, i) {
+    // format
+    var fmt =
+      color('error title', '  %s) %s:\n') +
+      color('error message', '     %s') +
+      color('error stack', '\n%s\n');
+
+    // msg
+    var msg;
+    var err = test.err;
+    var message;
+    if (err.message && typeof err.message.toString === 'function') {
+      message = err.message + '';
+    } else if (typeof err.inspect === 'function') {
+      message = err.inspect() + '';
+    } else {
+      message = '';
+    }
+    var stack = err.stack || message;
+    var index = message ? stack.indexOf(message) : -1;
+
+    if (index === -1) {
+      msg = message;
+    } else {
+      index += message.length;
+      msg = stack.slice(0, index);
+      // remove msg from stack
+      stack = stack.slice(index + 1);
+    }
+
+    // uncaught
+    if (err.uncaught) {
+      msg = 'Uncaught ' + msg;
+    }
+    // explicitly show diff
+    if (!exports.hideDiff && showDiff(err)) {
+      stringifyDiffObjs(err);
+      fmt =
+        color('error title', '  %s) %s:\n%s') + color('error stack', '\n%s\n');
+      var match = message.match(/^([^:]+): expected/);
+      msg = '\n      ' + color('error message', match ? match[1] : msg);
+
+      msg += generateDiff(err.actual, err.expected);
+    }
+
+    // indent stack trace
+    stack = stack.replace(/^/gm, '  ');
+
+    // indented test title
+    var testTitle = '';
+    test.titlePath().forEach(function(str, index) {
+      if (index !== 0) {
+        testTitle += '\n     ';
+      }
+      for (var i = 0; i < index; i++) {
+        testTitle += '  ';
+      }
+      testTitle += str;
+    });
+
+    Base.consoleLog(fmt, i + 1, testTitle, msg, stack);
+  });
+};
+
+/**
+ * Constructs a new `Base` reporter instance.
+ *
+ * @description
+ * All other reporters generally inherit from this reporter.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Base(runner, options) {
+  var failures = (this.failures = []);
+
+  if (!runner) {
+    throw new TypeError('Missing runner argument');
+  }
+  this.options = options || {};
+  this.runner = runner;
+  this.stats = runner.stats; // assigned so Reporters keep a closer reference
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    if (test.duration > test.slow()) {
+      test.speed = 'slow';
+    } else if (test.duration > test.slow() / 2) {
+      test.speed = 'medium';
+    } else {
+      test.speed = 'fast';
+    }
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test, err) {
+    if (showDiff(err)) {
+      stringifyDiffObjs(err);
+    }
+    test.err = err;
+    failures.push(test);
+  });
+}
+
+/**
+ * Outputs common epilogue used by many of the bundled reporters.
+ *
+ * @public
+ * @memberof Mocha.reporters.Base
+ */
+Base.prototype.epilogue = function() {
+  var stats = this.stats;
+  var fmt;
+
+  Base.consoleLog();
+
+  // passes
+  fmt =
+    color('bright pass', ' ') +
+    color('green', ' %d passing') +
+    color('light', ' (%s)');
+
+  Base.consoleLog(fmt, stats.passes || 0, milliseconds(stats.duration));
+
+  // pending
+  if (stats.pending) {
+    fmt = color('pending', ' ') + color('pending', ' %d pending');
+
+    Base.consoleLog(fmt, stats.pending);
+  }
+
+  // failures
+  if (stats.failures) {
+    fmt = color('fail', '  %d failing');
+
+    Base.consoleLog(fmt, stats.failures);
+
+    Base.list(this.failures);
+    Base.consoleLog();
+  }
+
+  Base.consoleLog();
+};
+
+/**
+ * Pads the given `str` to `len`.
+ *
+ * @private
+ * @param {string} str
+ * @param {string} len
+ * @return {string}
+ */
+function pad(str, len) {
+  str = String(str);
+  return Array(len - str.length + 1).join(' ') + str;
+}
+
+/**
+ * Returns inline diff between 2 strings with coloured ANSI output.
+ *
+ * @private
+ * @param {String} actual
+ * @param {String} expected
+ * @return {string} Diff
+ */
+function inlineDiff(actual, expected) {
+  var msg = errorDiff(actual, expected);
+
+  // linenos
+  var lines = msg.split('\n');
+  if (lines.length > 4) {
+    var width = String(lines.length).length;
+    msg = lines
+      .map(function(str, i) {
+        return pad(++i, width) + ' |' + ' ' + str;
+      })
+      .join('\n');
+  }
+
+  // legend
+  msg =
+    '\n' +
+    color('diff removed', 'actual') +
+    ' ' +
+    color('diff added', 'expected') +
+    '\n\n' +
+    msg +
+    '\n';
+
+  // indent
+  msg = msg.replace(/^/gm, '      ');
+  return msg;
+}
+
+/**
+ * Returns unified diff between two strings with coloured ANSI output.
+ *
+ * @private
+ * @param {String} actual
+ * @param {String} expected
+ * @return {string} The diff.
+ */
+function unifiedDiff(actual, expected) {
+  var indent = '      ';
+  function cleanUp(line) {
+    if (line[0] === '+') {
+      return indent + colorLines('diff added', line);
+    }
+    if (line[0] === '-') {
+      return indent + colorLines('diff removed', line);
+    }
+    if (line.match(/@@/)) {
+      return '--';
+    }
+    if (line.match(/\\ No newline/)) {
+      return null;
+    }
+    return indent + line;
+  }
+  function notBlank(line) {
+    return typeof line !== 'undefined' && line !== null;
+  }
+  var msg = diff.createPatch('string', actual, expected);
+  var lines = msg.split('\n').splice(5);
+  return (
+    '\n      ' +
+    colorLines('diff added', '+ expected') +
+    ' ' +
+    colorLines('diff removed', '- actual') +
+    '\n\n' +
+    lines
+      .map(cleanUp)
+      .filter(notBlank)
+      .join('\n')
+  );
+}
+
+/**
+ * Returns character diff for `err`.
+ *
+ * @private
+ * @param {String} actual
+ * @param {String} expected
+ * @return {string} the diff
+ */
+function errorDiff(actual, expected) {
+  return diff
+    .diffWordsWithSpace(actual, expected)
+    .map(function(str) {
+      if (str.added) {
+        return colorLines('diff added', str.value);
+      }
+      if (str.removed) {
+        return colorLines('diff removed', str.value);
+      }
+      return str.value;
+    })
+    .join('');
+}
+
+/**
+ * Colors lines for `str`, using the color `name`.
+ *
+ * @private
+ * @param {string} name
+ * @param {string} str
+ * @return {string}
+ */
+function colorLines(name, str) {
+  return str
+    .split('\n')
+    .map(function(str) {
+      return color(name, str);
+    })
+    .join('\n');
+}
+
+/**
+ * Object#toString reference.
+ */
+var objToString = Object.prototype.toString;
+
+/**
+ * Checks that a / b have the same type.
+ *
+ * @private
+ * @param {Object} a
+ * @param {Object} b
+ * @return {boolean}
+ */
+function sameType(a, b) {
+  return objToString.call(a) === objToString.call(b);
+}
+
+Base.consoleLog = consoleLog;
+
+Base.abstract = true;
+
+}).call(this,require('_process'))
+},{"../runner":34,"../utils":38,"_process":69,"diff":48,"ms":60,"supports-color":42,"tty":4}],18:[function(require,module,exports){
+'use strict';
+/**
+ * @module Doc
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_SUITE_END = constants.EVENT_SUITE_END;
+
+/**
+ * Expose `Doc`.
+ */
+
+exports = module.exports = Doc;
+
+/**
+ * Constructs a new `Doc` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Doc(runner, options) {
+  Base.call(this, runner, options);
+
+  var indents = 2;
+
+  function indent() {
+    return Array(indents).join('  ');
+  }
+
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    if (suite.root) {
+      return;
+    }
+    ++indents;
+    Base.consoleLog('%s<section class="suite">', indent());
+    ++indents;
+    Base.consoleLog('%s<h1>%s</h1>', indent(), utils.escape(suite.title));
+    Base.consoleLog('%s<dl>', indent());
+  });
+
+  runner.on(EVENT_SUITE_END, function(suite) {
+    if (suite.root) {
+      return;
+    }
+    Base.consoleLog('%s</dl>', indent());
+    --indents;
+    Base.consoleLog('%s</section>', indent());
+    --indents;
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    Base.consoleLog('%s  <dt>%s</dt>', indent(), utils.escape(test.title));
+    var code = utils.escape(utils.clean(test.body));
+    Base.consoleLog('%s  <dd><pre><code>%s</code></pre></dd>', indent(), code);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test, err) {
+    Base.consoleLog(
+      '%s  <dt class="error">%s</dt>',
+      indent(),
+      utils.escape(test.title)
+    );
+    var code = utils.escape(utils.clean(test.body));
+    Base.consoleLog(
+      '%s  <dd class="error"><pre><code>%s</code></pre></dd>',
+      indent(),
+      code
+    );
+    Base.consoleLog(
+      '%s  <dd class="error">%s</dd>',
+      indent(),
+      utils.escape(err)
+    );
+  });
+}
+
+Doc.description = 'HTML documentation';
+
+},{"../runner":34,"../utils":38,"./base":17}],19:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module Dot
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+
+/**
+ * Expose `Dot`.
+ */
+
+exports = module.exports = Dot;
+
+/**
+ * Constructs a new `Dot` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Dot(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var width = (Base.window.width * 0.75) | 0;
+  var n = -1;
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    process.stdout.write('\n');
+  });
+
+  runner.on(EVENT_TEST_PENDING, function() {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    process.stdout.write(Base.color('pending', Base.symbols.comma));
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    if (test.speed === 'slow') {
+      process.stdout.write(Base.color('bright yellow', Base.symbols.dot));
+    } else {
+      process.stdout.write(Base.color(test.speed, Base.symbols.dot));
+    }
+  });
+
+  runner.on(EVENT_TEST_FAIL, function() {
+    if (++n % width === 0) {
+      process.stdout.write('\n  ');
+    }
+    process.stdout.write(Base.color('fail', Base.symbols.bang));
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    process.stdout.write('\n');
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Dot, Base);
+
+Dot.description = 'dot matrix representation';
+
+}).call(this,require('_process'))
+},{"../runner":34,"../utils":38,"./base":17,"_process":69}],20:[function(require,module,exports){
+(function (global){
+'use strict';
+
+/* eslint-env browser */
+/**
+ * @module HTML
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var Progress = require('../browser/progress');
+var escapeRe = require('escape-string-regexp');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_SUITE_END = constants.EVENT_SUITE_END;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var escape = utils.escape;
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+
+var Date = global.Date;
+
+/**
+ * Expose `HTML`.
+ */
+
+exports = module.exports = HTML;
+
+/**
+ * Stats template.
+ */
+
+var statsTemplate =
+  '<ul id="mocha-stats">' +
+  '<li class="progress"><canvas width="40" height="40"></canvas></li>' +
+  '<li class="passes"><a href="javascript:void(0);">passes:</a> <em>0</em></li>' +
+  '<li class="failures"><a href="javascript:void(0);">failures:</a> <em>0</em></li>' +
+  '<li class="duration">duration: <em>0</em>s</li>' +
+  '</ul>';
+
+var playIcon = '&#x2023;';
+
+/**
+ * Constructs a new `HTML` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function HTML(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var stats = this.stats;
+  var stat = fragment(statsTemplate);
+  var items = stat.getElementsByTagName('li');
+  var passes = items[1].getElementsByTagName('em')[0];
+  var passesLink = items[1].getElementsByTagName('a')[0];
+  var failures = items[2].getElementsByTagName('em')[0];
+  var failuresLink = items[2].getElementsByTagName('a')[0];
+  var duration = items[3].getElementsByTagName('em')[0];
+  var canvas = stat.getElementsByTagName('canvas')[0];
+  var report = fragment('<ul id="mocha-report"></ul>');
+  var stack = [report];
+  var progress;
+  var ctx;
+  var root = document.getElementById('mocha');
+
+  if (canvas.getContext) {
+    var ratio = window.devicePixelRatio || 1;
+    canvas.style.width = canvas.width;
+    canvas.style.height = canvas.height;
+    canvas.width *= ratio;
+    canvas.height *= ratio;
+    ctx = canvas.getContext('2d');
+    ctx.scale(ratio, ratio);
+    progress = new Progress();
+  }
+
+  if (!root) {
+    return error('#mocha div missing, add it to your document');
+  }
+
+  // pass toggle
+  on(passesLink, 'click', function(evt) {
+    evt.preventDefault();
+    unhide();
+    var name = /pass/.test(report.className) ? '' : ' pass';
+    report.className = report.className.replace(/fail|pass/g, '') + name;
+    if (report.className.trim()) {
+      hideSuitesWithout('test pass');
+    }
+  });
+
+  // failure toggle
+  on(failuresLink, 'click', function(evt) {
+    evt.preventDefault();
+    unhide();
+    var name = /fail/.test(report.className) ? '' : ' fail';
+    report.className = report.className.replace(/fail|pass/g, '') + name;
+    if (report.className.trim()) {
+      hideSuitesWithout('test fail');
+    }
+  });
+
+  root.appendChild(stat);
+  root.appendChild(report);
+
+  if (progress) {
+    progress.size(40);
+  }
+
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    if (suite.root) {
+      return;
+    }
+
+    // suite
+    var url = self.suiteURL(suite);
+    var el = fragment(
+      '<li class="suite"><h1><a href="%s">%s</a></h1></li>',
+      url,
+      escape(suite.title)
+    );
+
+    // container
+    stack[0].appendChild(el);
+    stack.unshift(document.createElement('ul'));
+    el.appendChild(stack[0]);
+  });
+
+  runner.on(EVENT_SUITE_END, function(suite) {
+    if (suite.root) {
+      updateStats();
+      return;
+    }
+    stack.shift();
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    var url = self.testURL(test);
+    var markup =
+      '<li class="test pass %e"><h2>%e<span class="duration">%ems</span> ' +
+      '<a href="%s" class="replay">' +
+      playIcon +
+      '</a></h2></li>';
+    var el = fragment(markup, test.speed, test.title, test.duration, url);
+    self.addCodeToggle(el, test.body);
+    appendToStack(el);
+    updateStats();
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    var el = fragment(
+      '<li class="test fail"><h2>%e <a href="%e" class="replay">' +
+        playIcon +
+        '</a></h2></li>',
+      test.title,
+      self.testURL(test)
+    );
+    var stackString; // Note: Includes leading newline
+    var message = test.err.toString();
+
+    // <=IE7 stringifies to [Object Error]. Since it can be overloaded, we
+    // check for the result of the stringifying.
+    if (message === '[object Error]') {
+      message = test.err.message;
+    }
+
+    if (test.err.stack) {
+      var indexOfMessage = test.err.stack.indexOf(test.err.message);
+      if (indexOfMessage === -1) {
+        stackString = test.err.stack;
+      } else {
+        stackString = test.err.stack.substr(
+          test.err.message.length + indexOfMessage
+        );
+      }
+    } else if (test.err.sourceURL && test.err.line !== undefined) {
+      // Safari doesn't give you a stack. Let's at least provide a source line.
+      stackString = '\n(' + test.err.sourceURL + ':' + test.err.line + ')';
+    }
+
+    stackString = stackString || '';
+
+    if (test.err.htmlMessage && stackString) {
+      el.appendChild(
+        fragment(
+          '<div class="html-error">%s\n<pre class="error">%e</pre></div>',
+          test.err.htmlMessage,
+          stackString
+        )
+      );
+    } else if (test.err.htmlMessage) {
+      el.appendChild(
+        fragment('<div class="html-error">%s</div>', test.err.htmlMessage)
+      );
+    } else {
+      el.appendChild(
+        fragment('<pre class="error">%e%e</pre>', message, stackString)
+      );
+    }
+
+    self.addCodeToggle(el, test.body);
+    appendToStack(el);
+    updateStats();
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    var el = fragment(
+      '<li class="test pass pending"><h2>%e</h2></li>',
+      test.title
+    );
+    appendToStack(el);
+    updateStats();
+  });
+
+  function appendToStack(el) {
+    // Don't call .appendChild if #mocha-report was already .shift()'ed off the stack.
+    if (stack[0]) {
+      stack[0].appendChild(el);
+    }
+  }
+
+  function updateStats() {
+    // TODO: add to stats
+    var percent = ((stats.tests / runner.total) * 100) | 0;
+    if (progress) {
+      progress.update(percent).draw(ctx);
+    }
+
+    // update stats
+    var ms = new Date() - stats.start;
+    text(passes, stats.passes);
+    text(failures, stats.failures);
+    text(duration, (ms / 1000).toFixed(2));
+  }
+}
+
+/**
+ * Makes a URL, preserving querystring ("search") parameters.
+ *
+ * @param {string} s
+ * @return {string} A new URL.
+ */
+function makeUrl(s) {
+  var search = window.location.search;
+
+  // Remove previous grep query parameter if present
+  if (search) {
+    search = search.replace(/[?&]grep=[^&\s]*/g, '').replace(/^&/, '?');
+  }
+
+  return (
+    window.location.pathname +
+    (search ? search + '&' : '?') +
+    'grep=' +
+    encodeURIComponent(escapeRe(s))
+  );
+}
+
+/**
+ * Provide suite URL.
+ *
+ * @param {Object} [suite]
+ */
+HTML.prototype.suiteURL = function(suite) {
+  return makeUrl(suite.fullTitle());
+};
+
+/**
+ * Provide test URL.
+ *
+ * @param {Object} [test]
+ */
+HTML.prototype.testURL = function(test) {
+  return makeUrl(test.fullTitle());
+};
+
+/**
+ * Adds code toggle functionality for the provided test's list element.
+ *
+ * @param {HTMLLIElement} el
+ * @param {string} contents
+ */
+HTML.prototype.addCodeToggle = function(el, contents) {
+  var h2 = el.getElementsByTagName('h2')[0];
+
+  on(h2, 'click', function() {
+    pre.style.display = pre.style.display === 'none' ? 'block' : 'none';
+  });
+
+  var pre = fragment('<pre><code>%e</code></pre>', utils.clean(contents));
+  el.appendChild(pre);
+  pre.style.display = 'none';
+};
+
+/**
+ * Display error `msg`.
+ *
+ * @param {string} msg
+ */
+function error(msg) {
+  document.body.appendChild(fragment('<div id="mocha-error">%s</div>', msg));
+}
+
+/**
+ * Return a DOM fragment from `html`.
+ *
+ * @param {string} html
+ */
+function fragment(html) {
+  var args = arguments;
+  var div = document.createElement('div');
+  var i = 1;
+
+  div.innerHTML = html.replace(/%([se])/g, function(_, type) {
+    switch (type) {
+      case 's':
+        return String(args[i++]);
+      case 'e':
+        return escape(args[i++]);
+      // no default
+    }
+  });
+
+  return div.firstChild;
+}
+
+/**
+ * Check for suites that do not have elements
+ * with `classname`, and hide them.
+ *
+ * @param {text} classname
+ */
+function hideSuitesWithout(classname) {
+  var suites = document.getElementsByClassName('suite');
+  for (var i = 0; i < suites.length; i++) {
+    var els = suites[i].getElementsByClassName(classname);
+    if (!els.length) {
+      suites[i].className += ' hidden';
+    }
+  }
+}
+
+/**
+ * Unhide .hidden suites.
+ */
+function unhide() {
+  var els = document.getElementsByClassName('suite hidden');
+  for (var i = 0; i < els.length; ++i) {
+    els[i].className = els[i].className.replace('suite hidden', 'suite');
+  }
+}
+
+/**
+ * Set an element's text contents.
+ *
+ * @param {HTMLElement} el
+ * @param {string} contents
+ */
+function text(el, contents) {
+  if (el.textContent) {
+    el.textContent = contents;
+  } else {
+    el.innerText = contents;
+  }
+}
+
+/**
+ * Listen on `event` with callback `fn`.
+ */
+function on(el, event, fn) {
+  if (el.addEventListener) {
+    el.addEventListener(event, fn, false);
+  } else {
+    el.attachEvent('on' + event, fn);
+  }
+}
+
+HTML.browserOnly = true;
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"../browser/progress":3,"../runner":34,"../utils":38,"./base":17,"escape-string-regexp":49}],21:[function(require,module,exports){
+'use strict';
+
+// Alias exports to a their normalized format Mocha#reporter to prevent a need
+// for dynamic (try/catch) requires, which Browserify doesn't handle.
+exports.Base = exports.base = require('./base');
+exports.Dot = exports.dot = require('./dot');
+exports.Doc = exports.doc = require('./doc');
+exports.TAP = exports.tap = require('./tap');
+exports.JSON = exports.json = require('./json');
+exports.HTML = exports.html = require('./html');
+exports.List = exports.list = require('./list');
+exports.Min = exports.min = require('./min');
+exports.Spec = exports.spec = require('./spec');
+exports.Nyan = exports.nyan = require('./nyan');
+exports.XUnit = exports.xunit = require('./xunit');
+exports.Markdown = exports.markdown = require('./markdown');
+exports.Progress = exports.progress = require('./progress');
+exports.Landing = exports.landing = require('./landing');
+exports.JSONStream = exports['json-stream'] = require('./json-stream');
+
+},{"./base":17,"./doc":18,"./dot":19,"./html":20,"./json":23,"./json-stream":22,"./landing":24,"./list":25,"./markdown":26,"./min":27,"./nyan":28,"./progress":29,"./spec":30,"./tap":31,"./xunit":32}],22:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module JSONStream
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+
+/**
+ * Expose `JSONStream`.
+ */
+
+exports = module.exports = JSONStream;
+
+/**
+ * Constructs a new `JSONStream` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function JSONStream(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var total = runner.total;
+
+  runner.once(EVENT_RUN_BEGIN, function() {
+    writeEvent(['start', {total: total}]);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    writeEvent(['pass', clean(test)]);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test, err) {
+    test = clean(test);
+    test.err = err.message;
+    test.stack = err.stack || null;
+    writeEvent(['fail', test]);
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    writeEvent(['end', self.stats]);
+  });
+}
+
+/**
+ * Mocha event to be written to the output stream.
+ * @typedef {Array} JSONStream~MochaEvent
+ */
+
+/**
+ * Writes Mocha event to reporter output stream.
+ *
+ * @private
+ * @param {JSONStream~MochaEvent} event - Mocha event to be output.
+ */
+function writeEvent(event) {
+  process.stdout.write(JSON.stringify(event) + '\n');
+}
+
+/**
+ * Returns an object literal representation of `test`
+ * free of cyclic properties, etc.
+ *
+ * @private
+ * @param {Test} test - Instance used as data source.
+ * @return {Object} object containing pared-down test instance data
+ */
+function clean(test) {
+  return {
+    title: test.title,
+    fullTitle: test.fullTitle(),
+    duration: test.duration,
+    currentRetry: test.currentRetry()
+  };
+}
+
+JSONStream.description = 'newline delimited JSON events';
+
+}).call(this,require('_process'))
+},{"../runner":34,"./base":17,"_process":69}],23:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module JSON
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+
+/**
+ * Expose `JSON`.
+ */
+
+exports = module.exports = JSONReporter;
+
+/**
+ * Constructs a new `JSON` reporter instance.
+ *
+ * @public
+ * @class JSON
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function JSONReporter(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var tests = [];
+  var pending = [];
+  var failures = [];
+  var passes = [];
+
+  runner.on(EVENT_TEST_END, function(test) {
+    tests.push(test);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    passes.push(test);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    failures.push(test);
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    pending.push(test);
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    var obj = {
+      stats: self.stats,
+      tests: tests.map(clean),
+      pending: pending.map(clean),
+      failures: failures.map(clean),
+      passes: passes.map(clean)
+    };
+
+    runner.testResults = obj;
+
+    process.stdout.write(JSON.stringify(obj, null, 2));
+  });
+}
+
+/**
+ * Return a plain-object representation of `test`
+ * free of cyclic properties etc.
+ *
+ * @private
+ * @param {Object} test
+ * @return {Object}
+ */
+function clean(test) {
+  var err = test.err || {};
+  if (err instanceof Error) {
+    err = errorJSON(err);
+  }
+
+  return {
+    title: test.title,
+    fullTitle: test.fullTitle(),
+    duration: test.duration,
+    currentRetry: test.currentRetry(),
+    err: cleanCycles(err)
+  };
+}
+
+/**
+ * Replaces any circular references inside `obj` with '[object Object]'
+ *
+ * @private
+ * @param {Object} obj
+ * @return {Object}
+ */
+function cleanCycles(obj) {
+  var cache = [];
+  return JSON.parse(
+    JSON.stringify(obj, function(key, value) {
+      if (typeof value === 'object' && value !== null) {
+        if (cache.indexOf(value) !== -1) {
+          // Instead of going in a circle, we'll print [object Object]
+          return '' + value;
+        }
+        cache.push(value);
+      }
+
+      return value;
+    })
+  );
+}
+
+/**
+ * Transform an Error object into a JSON object.
+ *
+ * @private
+ * @param {Error} err
+ * @return {Object}
+ */
+function errorJSON(err) {
+  var res = {};
+  Object.getOwnPropertyNames(err).forEach(function(key) {
+    res[key] = err[key];
+  }, err);
+  return res;
+}
+
+JSONReporter.description = 'single JSON object';
+
+}).call(this,require('_process'))
+},{"../runner":34,"./base":17,"_process":69}],24:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module Landing
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var constants = require('../runner').constants;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+var STATE_FAILED = require('../runnable').constants.STATE_FAILED;
+
+var cursor = Base.cursor;
+var color = Base.color;
+
+/**
+ * Expose `Landing`.
+ */
+
+exports = module.exports = Landing;
+
+/**
+ * Airplane color.
+ */
+
+Base.colors.plane = 0;
+
+/**
+ * Airplane crash color.
+ */
+
+Base.colors['plane crash'] = 31;
+
+/**
+ * Runway color.
+ */
+
+Base.colors.runway = 90;
+
+/**
+ * Constructs a new `Landing` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Landing(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var width = (Base.window.width * 0.75) | 0;
+  var total = runner.total;
+  var stream = process.stdout;
+  var plane = color('plane', '✈');
+  var crashed = -1;
+  var n = 0;
+
+  function runway() {
+    var buf = Array(width).join('-');
+    return '  ' + color('runway', buf);
+  }
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    stream.write('\n\n\n  ');
+    cursor.hide();
+  });
+
+  runner.on(EVENT_TEST_END, function(test) {
+    // check if the plane crashed
+    var col = crashed === -1 ? ((width * ++n) / total) | 0 : crashed;
+
+    // show the crash
+    if (test.state === STATE_FAILED) {
+      plane = color('plane crash', '✈');
+      crashed = col;
+    }
+
+    // render landing strip
+    stream.write('\u001b[' + (width + 1) + 'D\u001b[2A');
+    stream.write(runway());
+    stream.write('\n  ');
+    stream.write(color('runway', Array(col).join('⋅')));
+    stream.write(plane);
+    stream.write(color('runway', Array(width - col).join('⋅') + '\n'));
+    stream.write(runway());
+    stream.write('\u001b[0m');
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    cursor.show();
+    process.stdout.write('\n');
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Landing, Base);
+
+Landing.description = 'Unicode landing strip';
+
+}).call(this,require('_process'))
+},{"../runnable":33,"../runner":34,"../utils":38,"./base":17,"_process":69}],25:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module List
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var constants = require('../runner').constants;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_BEGIN = constants.EVENT_TEST_BEGIN;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `List`.
+ */
+
+exports = module.exports = List;
+
+/**
+ * Constructs a new `List` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function List(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var n = 0;
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    Base.consoleLog();
+  });
+
+  runner.on(EVENT_TEST_BEGIN, function(test) {
+    process.stdout.write(color('pass', '    ' + test.fullTitle() + ': '));
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    var fmt = color('checkmark', '  -') + color('pending', ' %s');
+    Base.consoleLog(fmt, test.fullTitle());
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    var fmt =
+      color('checkmark', '  ' + Base.symbols.ok) +
+      color('pass', ' %s: ') +
+      color(test.speed, '%dms');
+    cursor.CR();
+    Base.consoleLog(fmt, test.fullTitle(), test.duration);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    cursor.CR();
+    Base.consoleLog(color('fail', '  %d) %s'), ++n, test.fullTitle());
+  });
+
+  runner.once(EVENT_RUN_END, self.epilogue.bind(self));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(List, Base);
+
+List.description = 'like "spec" reporter but flat';
+
+}).call(this,require('_process'))
+},{"../runner":34,"../utils":38,"./base":17,"_process":69}],26:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module Markdown
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var constants = require('../runner').constants;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_SUITE_END = constants.EVENT_SUITE_END;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+
+/**
+ * Constants
+ */
+
+var SUITE_PREFIX = '$';
+
+/**
+ * Expose `Markdown`.
+ */
+
+exports = module.exports = Markdown;
+
+/**
+ * Constructs a new `Markdown` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Markdown(runner, options) {
+  Base.call(this, runner, options);
+
+  var level = 0;
+  var buf = '';
+
+  function title(str) {
+    return Array(level).join('#') + ' ' + str;
+  }
+
+  function mapTOC(suite, obj) {
+    var ret = obj;
+    var key = SUITE_PREFIX + suite.title;
+
+    obj = obj[key] = obj[key] || {suite: suite};
+    suite.suites.forEach(function(suite) {
+      mapTOC(suite, obj);
+    });
+
+    return ret;
+  }
+
+  function stringifyTOC(obj, level) {
+    ++level;
+    var buf = '';
+    var link;
+    for (var key in obj) {
+      if (key === 'suite') {
+        continue;
+      }
+      if (key !== SUITE_PREFIX) {
+        link = ' - [' + key.substring(1) + ']';
+        link += '(#' + utils.slug(obj[key].suite.fullTitle()) + ')\n';
+        buf += Array(level).join('  ') + link;
+      }
+      buf += stringifyTOC(obj[key], level);
+    }
+    return buf;
+  }
+
+  function generateTOC(suite) {
+    var obj = mapTOC(suite, {});
+    return stringifyTOC(obj, 0);
+  }
+
+  generateTOC(runner.suite);
+
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    ++level;
+    var slug = utils.slug(suite.fullTitle());
+    buf += '<a name="' + slug + '"></a>' + '\n';
+    buf += title(suite.title) + '\n';
+  });
+
+  runner.on(EVENT_SUITE_END, function() {
+    --level;
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    var code = utils.clean(test.body);
+    buf += test.title + '.\n';
+    buf += '\n```js\n';
+    buf += code + '\n';
+    buf += '```\n\n';
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    process.stdout.write('# TOC\n');
+    process.stdout.write(generateTOC(runner.suite));
+    process.stdout.write(buf);
+  });
+}
+
+Markdown.description = 'GitHub Flavored Markdown';
+
+}).call(this,require('_process'))
+},{"../runner":34,"../utils":38,"./base":17,"_process":69}],27:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module Min
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var inherits = require('../utils').inherits;
+var constants = require('../runner').constants;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+
+/**
+ * Expose `Min`.
+ */
+
+exports = module.exports = Min;
+
+/**
+ * Constructs a new `Min` reporter instance.
+ *
+ * @description
+ * This minimal test reporter is best used with '--watch'.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Min(runner, options) {
+  Base.call(this, runner, options);
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    // clear screen
+    process.stdout.write('\u001b[2J');
+    // set cursor position
+    process.stdout.write('\u001b[1;3H');
+  });
+
+  runner.once(EVENT_RUN_END, this.epilogue.bind(this));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Min, Base);
+
+Min.description = 'essentially just a summary';
+
+}).call(this,require('_process'))
+},{"../runner":34,"../utils":38,"./base":17,"_process":69}],28:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module Nyan
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var inherits = require('../utils').inherits;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+
+/**
+ * Expose `Dot`.
+ */
+
+exports = module.exports = NyanCat;
+
+/**
+ * Constructs a new `Nyan` reporter instance.
+ *
+ * @public
+ * @class Nyan
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function NyanCat(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var width = (Base.window.width * 0.75) | 0;
+  var nyanCatWidth = (this.nyanCatWidth = 11);
+
+  this.colorIndex = 0;
+  this.numberOfLines = 4;
+  this.rainbowColors = self.generateColors();
+  this.scoreboardWidth = 5;
+  this.tick = 0;
+  this.trajectories = [[], [], [], []];
+  this.trajectoryWidthMax = width - nyanCatWidth;
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    Base.cursor.hide();
+    self.draw();
+  });
+
+  runner.on(EVENT_TEST_PENDING, function() {
+    self.draw();
+  });
+
+  runner.on(EVENT_TEST_PASS, function() {
+    self.draw();
+  });
+
+  runner.on(EVENT_TEST_FAIL, function() {
+    self.draw();
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    Base.cursor.show();
+    for (var i = 0; i < self.numberOfLines; i++) {
+      write('\n');
+    }
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(NyanCat, Base);
+
+/**
+ * Draw the nyan cat
+ *
+ * @private
+ */
+
+NyanCat.prototype.draw = function() {
+  this.appendRainbow();
+  this.drawScoreboard();
+  this.drawRainbow();
+  this.drawNyanCat();
+  this.tick = !this.tick;
+};
+
+/**
+ * Draw the "scoreboard" showing the number
+ * of passes, failures and pending tests.
+ *
+ * @private
+ */
+
+NyanCat.prototype.drawScoreboard = function() {
+  var stats = this.stats;
+
+  function draw(type, n) {
+    write(' ');
+    write(Base.color(type, n));
+    write('\n');
+  }
+
+  draw('green', stats.passes);
+  draw('fail', stats.failures);
+  draw('pending', stats.pending);
+  write('\n');
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Append the rainbow.
+ *
+ * @private
+ */
+
+NyanCat.prototype.appendRainbow = function() {
+  var segment = this.tick ? '_' : '-';
+  var rainbowified = this.rainbowify(segment);
+
+  for (var index = 0; index < this.numberOfLines; index++) {
+    var trajectory = this.trajectories[index];
+    if (trajectory.length >= this.trajectoryWidthMax) {
+      trajectory.shift();
+    }
+    trajectory.push(rainbowified);
+  }
+};
+
+/**
+ * Draw the rainbow.
+ *
+ * @private
+ */
+
+NyanCat.prototype.drawRainbow = function() {
+  var self = this;
+
+  this.trajectories.forEach(function(line) {
+    write('\u001b[' + self.scoreboardWidth + 'C');
+    write(line.join(''));
+    write('\n');
+  });
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Draw the nyan cat
+ *
+ * @private
+ */
+NyanCat.prototype.drawNyanCat = function() {
+  var self = this;
+  var startWidth = this.scoreboardWidth + this.trajectories[0].length;
+  var dist = '\u001b[' + startWidth + 'C';
+  var padding = '';
+
+  write(dist);
+  write('_,------,');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? '  ' : '   ';
+  write('_|' + padding + '/\\_/\\ ');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? '_' : '__';
+  var tail = self.tick ? '~' : '^';
+  write(tail + '|' + padding + this.face() + ' ');
+  write('\n');
+
+  write(dist);
+  padding = self.tick ? ' ' : '  ';
+  write(padding + '""  "" ');
+  write('\n');
+
+  this.cursorUp(this.numberOfLines);
+};
+
+/**
+ * Draw nyan cat face.
+ *
+ * @private
+ * @return {string}
+ */
+
+NyanCat.prototype.face = function() {
+  var stats = this.stats;
+  if (stats.failures) {
+    return '( x .x)';
+  } else if (stats.pending) {
+    return '( o .o)';
+  } else if (stats.passes) {
+    return '( ^ .^)';
+  }
+  return '( - .-)';
+};
+
+/**
+ * Move cursor up `n`.
+ *
+ * @private
+ * @param {number} n
+ */
+
+NyanCat.prototype.cursorUp = function(n) {
+  write('\u001b[' + n + 'A');
+};
+
+/**
+ * Move cursor down `n`.
+ *
+ * @private
+ * @param {number} n
+ */
+
+NyanCat.prototype.cursorDown = function(n) {
+  write('\u001b[' + n + 'B');
+};
+
+/**
+ * Generate rainbow colors.
+ *
+ * @private
+ * @return {Array}
+ */
+NyanCat.prototype.generateColors = function() {
+  var colors = [];
+
+  for (var i = 0; i < 6 * 7; i++) {
+    var pi3 = Math.floor(Math.PI / 3);
+    var n = i * (1.0 / 6);
+    var r = Math.floor(3 * Math.sin(n) + 3);
+    var g = Math.floor(3 * Math.sin(n + 2 * pi3) + 3);
+    var b = Math.floor(3 * Math.sin(n + 4 * pi3) + 3);
+    colors.push(36 * r + 6 * g + b + 16);
+  }
+
+  return colors;
+};
+
+/**
+ * Apply rainbow to the given `str`.
+ *
+ * @private
+ * @param {string} str
+ * @return {string}
+ */
+NyanCat.prototype.rainbowify = function(str) {
+  if (!Base.useColors) {
+    return str;
+  }
+  var color = this.rainbowColors[this.colorIndex % this.rainbowColors.length];
+  this.colorIndex += 1;
+  return '\u001b[38;5;' + color + 'm' + str + '\u001b[0m';
+};
+
+/**
+ * Stdout helper.
+ *
+ * @param {string} string A message to write to stdout.
+ */
+function write(string) {
+  process.stdout.write(string);
+}
+
+NyanCat.description = '"nyan cat"';
+
+}).call(this,require('_process'))
+},{"../runner":34,"../utils":38,"./base":17,"_process":69}],29:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module Progress
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var inherits = require('../utils').inherits;
+var color = Base.color;
+var cursor = Base.cursor;
+
+/**
+ * Expose `Progress`.
+ */
+
+exports = module.exports = Progress;
+
+/**
+ * General progress bar color.
+ */
+
+Base.colors.progress = 90;
+
+/**
+ * Constructs a new `Progress` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Progress(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var width = (Base.window.width * 0.5) | 0;
+  var total = runner.total;
+  var complete = 0;
+  var lastN = -1;
+
+  // default chars
+  options = options || {};
+  var reporterOptions = options.reporterOptions || {};
+
+  options.open = reporterOptions.open || '[';
+  options.complete = reporterOptions.complete || '▬';
+  options.incomplete = reporterOptions.incomplete || Base.symbols.dot;
+  options.close = reporterOptions.close || ']';
+  options.verbose = reporterOptions.verbose || false;
+
+  // tests started
+  runner.on(EVENT_RUN_BEGIN, function() {
+    process.stdout.write('\n');
+    cursor.hide();
+  });
+
+  // tests complete
+  runner.on(EVENT_TEST_END, function() {
+    complete++;
+
+    var percent = complete / total;
+    var n = (width * percent) | 0;
+    var i = width - n;
+
+    if (n === lastN && !options.verbose) {
+      // Don't re-render the line if it hasn't changed
+      return;
+    }
+    lastN = n;
+
+    cursor.CR();
+    process.stdout.write('\u001b[J');
+    process.stdout.write(color('progress', '  ' + options.open));
+    process.stdout.write(Array(n).join(options.complete));
+    process.stdout.write(Array(i).join(options.incomplete));
+    process.stdout.write(color('progress', options.close));
+    if (options.verbose) {
+      process.stdout.write(color('progress', ' ' + complete + ' of ' + total));
+    }
+  });
+
+  // tests are complete, output some stats
+  // and the failures if any
+  runner.once(EVENT_RUN_END, function() {
+    cursor.show();
+    process.stdout.write('\n');
+    self.epilogue();
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Progress, Base);
+
+Progress.description = 'a progress bar';
+
+}).call(this,require('_process'))
+},{"../runner":34,"../utils":38,"./base":17,"_process":69}],30:[function(require,module,exports){
+'use strict';
+/**
+ * @module Spec
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_SUITE_END = constants.EVENT_SUITE_END;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var inherits = require('../utils').inherits;
+var color = Base.color;
+
+/**
+ * Expose `Spec`.
+ */
+
+exports = module.exports = Spec;
+
+/**
+ * Constructs a new `Spec` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function Spec(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var indents = 0;
+  var n = 0;
+
+  function indent() {
+    return Array(indents).join('  ');
+  }
+
+  runner.on(EVENT_RUN_BEGIN, function() {
+    Base.consoleLog();
+  });
+
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    ++indents;
+    Base.consoleLog(color('suite', '%s%s'), indent(), suite.title);
+  });
+
+  runner.on(EVENT_SUITE_END, function() {
+    --indents;
+    if (indents === 1) {
+      Base.consoleLog();
+    }
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    var fmt = indent() + color('pending', '  - %s');
+    Base.consoleLog(fmt, test.title);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    var fmt;
+    if (test.speed === 'fast') {
+      fmt =
+        indent() +
+        color('checkmark', '  ' + Base.symbols.ok) +
+        color('pass', ' %s');
+      Base.consoleLog(fmt, test.title);
+    } else {
+      fmt =
+        indent() +
+        color('checkmark', '  ' + Base.symbols.ok) +
+        color('pass', ' %s') +
+        color(test.speed, ' (%dms)');
+      Base.consoleLog(fmt, test.title, test.duration);
+    }
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    Base.consoleLog(indent() + color('fail', '  %d) %s'), ++n, test.title);
+  });
+
+  runner.once(EVENT_RUN_END, self.epilogue.bind(self));
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(Spec, Base);
+
+Spec.description = 'hierarchical & verbose [default]';
+
+},{"../runner":34,"../utils":38,"./base":17}],31:[function(require,module,exports){
+(function (process){
+'use strict';
+/**
+ * @module TAP
+ */
+/**
+ * Module dependencies.
+ */
+
+var util = require('util');
+var Base = require('./base');
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+var inherits = require('../utils').inherits;
+var sprintf = util.format;
+
+/**
+ * Expose `TAP`.
+ */
+
+exports = module.exports = TAP;
+
+/**
+ * Constructs a new `TAP` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function TAP(runner, options) {
+  Base.call(this, runner, options);
+
+  var self = this;
+  var n = 1;
+
+  var tapVersion = '12';
+  if (options && options.reporterOptions) {
+    if (options.reporterOptions.tapVersion) {
+      tapVersion = options.reporterOptions.tapVersion.toString();
+    }
+  }
+
+  this._producer = createProducer(tapVersion);
+
+  runner.once(EVENT_RUN_BEGIN, function() {
+    var ntests = runner.grepTotal(runner.suite);
+    self._producer.writeVersion();
+    self._producer.writePlan(ntests);
+  });
+
+  runner.on(EVENT_TEST_END, function() {
+    ++n;
+  });
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    self._producer.writePending(n, test);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    self._producer.writePass(n, test);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test, err) {
+    self._producer.writeFail(n, test, err);
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    self._producer.writeEpilogue(runner.stats);
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(TAP, Base);
+
+/**
+ * Returns a TAP-safe title of `test`.
+ *
+ * @private
+ * @param {Test} test - Test instance.
+ * @return {String} title with any hash character removed
+ */
+function title(test) {
+  return test.fullTitle().replace(/#/g, '');
+}
+
+/**
+ * Writes newline-terminated formatted string to reporter output stream.
+ *
+ * @private
+ * @param {string} format - `printf`-like format string
+ * @param {...*} [varArgs] - Format string arguments
+ */
+function println(format, varArgs) {
+  var vargs = Array.from(arguments);
+  vargs[0] += '\n';
+  process.stdout.write(sprintf.apply(null, vargs));
+}
+
+/**
+ * Returns a `tapVersion`-appropriate TAP producer instance, if possible.
+ *
+ * @private
+ * @param {string} tapVersion - Version of TAP specification to produce.
+ * @returns {TAPProducer} specification-appropriate instance
+ * @throws {Error} if specification version has no associated producer.
+ */
+function createProducer(tapVersion) {
+  var producers = {
+    '12': new TAP12Producer(),
+    '13': new TAP13Producer()
+  };
+  var producer = producers[tapVersion];
+
+  if (!producer) {
+    throw new Error(
+      'invalid or unsupported TAP version: ' + JSON.stringify(tapVersion)
+    );
+  }
+
+  return producer;
+}
+
+/**
+ * @summary
+ * Constructs a new TAPProducer.
+ *
+ * @description
+ * <em>Only</em> to be used as an abstract base class.
+ *
+ * @private
+ * @constructor
+ */
+function TAPProducer() {}
+
+/**
+ * Writes the TAP version to reporter output stream.
+ *
+ * @abstract
+ */
+TAPProducer.prototype.writeVersion = function() {};
+
+/**
+ * Writes the plan to reporter output stream.
+ *
+ * @abstract
+ * @param {number} ntests - Number of tests that are planned to run.
+ */
+TAPProducer.prototype.writePlan = function(ntests) {
+  println('%d..%d', 1, ntests);
+};
+
+/**
+ * Writes that test passed to reporter output stream.
+ *
+ * @abstract
+ * @param {number} n - Index of test that passed.
+ * @param {Test} test - Instance containing test information.
+ */
+TAPProducer.prototype.writePass = function(n, test) {
+  println('ok %d %s', n, title(test));
+};
+
+/**
+ * Writes that test was skipped to reporter output stream.
+ *
+ * @abstract
+ * @param {number} n - Index of test that was skipped.
+ * @param {Test} test - Instance containing test information.
+ */
+TAPProducer.prototype.writePending = function(n, test) {
+  println('ok %d %s # SKIP -', n, title(test));
+};
+
+/**
+ * Writes that test failed to reporter output stream.
+ *
+ * @abstract
+ * @param {number} n - Index of test that failed.
+ * @param {Test} test - Instance containing test information.
+ * @param {Error} err - Reason the test failed.
+ */
+TAPProducer.prototype.writeFail = function(n, test, err) {
+  println('not ok %d %s', n, title(test));
+};
+
+/**
+ * Writes the summary epilogue to reporter output stream.
+ *
+ * @abstract
+ * @param {Object} stats - Object containing run statistics.
+ */
+TAPProducer.prototype.writeEpilogue = function(stats) {
+  // :TBD: Why is this not counting pending tests?
+  println('# tests ' + (stats.passes + stats.failures));
+  println('# pass ' + stats.passes);
+  // :TBD: Why are we not showing pending results?
+  println('# fail ' + stats.failures);
+};
+
+/**
+ * @summary
+ * Constructs a new TAP12Producer.
+ *
+ * @description
+ * Produces output conforming to the TAP12 specification.
+ *
+ * @private
+ * @constructor
+ * @extends TAPProducer
+ * @see {@link https://testanything.org/tap-specification.html|Specification}
+ */
+function TAP12Producer() {
+  /**
+   * Writes that test failed to reporter output stream, with error formatting.
+   * @override
+   */
+  this.writeFail = function(n, test, err) {
+    TAPProducer.prototype.writeFail.call(this, n, test, err);
+    if (err.message) {
+      println(err.message.replace(/^/gm, '  '));
+    }
+    if (err.stack) {
+      println(err.stack.replace(/^/gm, '  '));
+    }
+  };
+}
+
+/**
+ * Inherit from `TAPProducer.prototype`.
+ */
+inherits(TAP12Producer, TAPProducer);
+
+/**
+ * @summary
+ * Constructs a new TAP13Producer.
+ *
+ * @description
+ * Produces output conforming to the TAP13 specification.
+ *
+ * @private
+ * @constructor
+ * @extends TAPProducer
+ * @see {@link https://testanything.org/tap-version-13-specification.html|Specification}
+ */
+function TAP13Producer() {
+  /**
+   * Writes the TAP version to reporter output stream.
+   * @override
+   */
+  this.writeVersion = function() {
+    println('TAP version 13');
+  };
+
+  /**
+   * Writes that test failed to reporter output stream, with error formatting.
+   * @override
+   */
+  this.writeFail = function(n, test, err) {
+    TAPProducer.prototype.writeFail.call(this, n, test, err);
+    var emitYamlBlock = err.message != null || err.stack != null;
+    if (emitYamlBlock) {
+      println(indent(1) + '---');
+      if (err.message) {
+        println(indent(2) + 'message: |-');
+        println(err.message.replace(/^/gm, indent(3)));
+      }
+      if (err.stack) {
+        println(indent(2) + 'stack: |-');
+        println(err.stack.replace(/^/gm, indent(3)));
+      }
+      println(indent(1) + '...');
+    }
+  };
+
+  function indent(level) {
+    return Array(level + 1).join('  ');
+  }
+}
+
+/**
+ * Inherit from `TAPProducer.prototype`.
+ */
+inherits(TAP13Producer, TAPProducer);
+
+TAP.description = 'TAP-compatible output';
+
+}).call(this,require('_process'))
+},{"../runner":34,"../utils":38,"./base":17,"_process":69,"util":89}],32:[function(require,module,exports){
+(function (process,global){
+'use strict';
+/**
+ * @module XUnit
+ */
+/**
+ * Module dependencies.
+ */
+
+var Base = require('./base');
+var utils = require('../utils');
+var fs = require('fs');
+var mkdirp = require('mkdirp');
+var path = require('path');
+var errors = require('../errors');
+var createUnsupportedError = errors.createUnsupportedError;
+var constants = require('../runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var STATE_FAILED = require('../runnable').constants.STATE_FAILED;
+var inherits = utils.inherits;
+var escape = utils.escape;
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+var Date = global.Date;
+
+/**
+ * Expose `XUnit`.
+ */
+
+exports = module.exports = XUnit;
+
+/**
+ * Constructs a new `XUnit` reporter instance.
+ *
+ * @public
+ * @class
+ * @memberof Mocha.reporters
+ * @extends Mocha.reporters.Base
+ * @param {Runner} runner - Instance triggers reporter actions.
+ * @param {Object} [options] - runner options
+ */
+function XUnit(runner, options) {
+  Base.call(this, runner, options);
+
+  var stats = this.stats;
+  var tests = [];
+  var self = this;
+
+  // the name of the test suite, as it will appear in the resulting XML file
+  var suiteName;
+
+  // the default name of the test suite if none is provided
+  var DEFAULT_SUITE_NAME = 'Mocha Tests';
+
+  if (options && options.reporterOptions) {
+    if (options.reporterOptions.output) {
+      if (!fs.createWriteStream) {
+        throw createUnsupportedError('file output not supported in browser');
+      }
+
+      mkdirp.sync(path.dirname(options.reporterOptions.output));
+      self.fileStream = fs.createWriteStream(options.reporterOptions.output);
+    }
+
+    // get the suite name from the reporter options (if provided)
+    suiteName = options.reporterOptions.suiteName;
+  }
+
+  // fall back to the default suite name
+  suiteName = suiteName || DEFAULT_SUITE_NAME;
+
+  runner.on(EVENT_TEST_PENDING, function(test) {
+    tests.push(test);
+  });
+
+  runner.on(EVENT_TEST_PASS, function(test) {
+    tests.push(test);
+  });
+
+  runner.on(EVENT_TEST_FAIL, function(test) {
+    tests.push(test);
+  });
+
+  runner.once(EVENT_RUN_END, function() {
+    self.write(
+      tag(
+        'testsuite',
+        {
+          name: suiteName,
+          tests: stats.tests,
+          failures: 0,
+          errors: stats.failures,
+          skipped: stats.tests - stats.failures - stats.passes,
+          timestamp: new Date().toUTCString(),
+          time: stats.duration / 1000 || 0
+        },
+        false
+      )
+    );
+
+    tests.forEach(function(t) {
+      self.test(t);
+    });
+
+    self.write('</testsuite>');
+  });
+}
+
+/**
+ * Inherit from `Base.prototype`.
+ */
+inherits(XUnit, Base);
+
+/**
+ * Override done to close the stream (if it's a file).
+ *
+ * @param failures
+ * @param {Function} fn
+ */
+XUnit.prototype.done = function(failures, fn) {
+  if (this.fileStream) {
+    this.fileStream.end(function() {
+      fn(failures);
+    });
+  } else {
+    fn(failures);
+  }
+};
+
+/**
+ * Write out the given line.
+ *
+ * @param {string} line
+ */
+XUnit.prototype.write = function(line) {
+  if (this.fileStream) {
+    this.fileStream.write(line + '\n');
+  } else if (typeof process === 'object' && process.stdout) {
+    process.stdout.write(line + '\n');
+  } else {
+    Base.consoleLog(line);
+  }
+};
+
+/**
+ * Output tag for the given `test.`
+ *
+ * @param {Test} test
+ */
+XUnit.prototype.test = function(test) {
+  Base.useColors = false;
+
+  var attrs = {
+    classname: test.parent.fullTitle(),
+    name: test.title,
+    time: test.duration / 1000 || 0
+  };
+
+  if (test.state === STATE_FAILED) {
+    var err = test.err;
+    var diff =
+      Base.hideDiff || !err.actual || !err.expected
+        ? ''
+        : '\n' + Base.generateDiff(err.actual, err.expected);
+    this.write(
+      tag(
+        'testcase',
+        attrs,
+        false,
+        tag(
+          'failure',
+          {},
+          false,
+          escape(err.message) + escape(diff) + '\n' + escape(err.stack)
+        )
+      )
+    );
+  } else if (test.isPending()) {
+    this.write(tag('testcase', attrs, false, tag('skipped', {}, true)));
+  } else {
+    this.write(tag('testcase', attrs, true));
+  }
+};
+
+/**
+ * HTML tag helper.
+ *
+ * @param name
+ * @param attrs
+ * @param close
+ * @param content
+ * @return {string}
+ */
+function tag(name, attrs, close, content) {
+  var end = close ? '/>' : '>';
+  var pairs = [];
+  var tag;
+
+  for (var key in attrs) {
+    if (Object.prototype.hasOwnProperty.call(attrs, key)) {
+      pairs.push(key + '="' + escape(attrs[key]) + '"');
+    }
+  }
+
+  tag = '<' + name + (pairs.length ? ' ' + pairs.join(' ') : '') + end;
+  if (content) {
+    tag += content + '</' + name + end;
+  }
+  return tag;
+}
+
+XUnit.description = 'XUnit-compatible XML output';
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"../errors":6,"../runnable":33,"../runner":34,"../utils":38,"./base":17,"_process":69,"fs":42,"mkdirp":59,"path":42}],33:[function(require,module,exports){
+(function (global){
+'use strict';
+
+var EventEmitter = require('events').EventEmitter;
+var Pending = require('./pending');
+var debug = require('debug')('mocha:runnable');
+var milliseconds = require('ms');
+var utils = require('./utils');
+var createInvalidExceptionError = require('./errors')
+  .createInvalidExceptionError;
+
+/**
+ * Save timer references to avoid Sinon interfering (see GH-237).
+ */
+var Date = global.Date;
+var setTimeout = global.setTimeout;
+var clearTimeout = global.clearTimeout;
+var toString = Object.prototype.toString;
+
+module.exports = Runnable;
+
+/**
+ * Initialize a new `Runnable` with the given `title` and callback `fn`.
+ *
+ * @class
+ * @extends external:EventEmitter
+ * @public
+ * @param {String} title
+ * @param {Function} fn
+ */
+function Runnable(title, fn) {
+  this.title = title;
+  this.fn = fn;
+  this.body = (fn || '').toString();
+  this.async = fn && fn.length;
+  this.sync = !this.async;
+  this._timeout = 2000;
+  this._slow = 75;
+  this._enableTimeouts = true;
+  this.timedOut = false;
+  this._retries = -1;
+  this._currentRetry = 0;
+  this.pending = false;
+}
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+utils.inherits(Runnable, EventEmitter);
+
+/**
+ * Get current timeout value in msecs.
+ *
+ * @private
+ * @returns {number} current timeout threshold value
+ */
+/**
+ * @summary
+ * Set timeout threshold value (msecs).
+ *
+ * @description
+ * A string argument can use shorthand (e.g., "2s") and will be converted.
+ * The value will be clamped to range [<code>0</code>, <code>2^<sup>31</sup>-1</code>].
+ * If clamped value matches either range endpoint, timeouts will be disabled.
+ *
+ * @private
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/API/WindowOrWorkerGlobalScope/setTimeout#Maximum_delay_value}
+ * @param {number|string} ms - Timeout threshold value.
+ * @returns {Runnable} this
+ * @chainable
+ */
+Runnable.prototype.timeout = function(ms) {
+  if (!arguments.length) {
+    return this._timeout;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+
+  // Clamp to range
+  var INT_MAX = Math.pow(2, 31) - 1;
+  var range = [0, INT_MAX];
+  ms = utils.clamp(ms, range);
+
+  // see #1652 for reasoning
+  if (ms === range[0] || ms === range[1]) {
+    this._enableTimeouts = false;
+  }
+  debug('timeout %d', ms);
+  this._timeout = ms;
+  if (this.timer) {
+    this.resetTimeout();
+  }
+  return this;
+};
+
+/**
+ * Set or get slow `ms`.
+ *
+ * @private
+ * @param {number|string} ms
+ * @return {Runnable|number} ms or Runnable instance.
+ */
+Runnable.prototype.slow = function(ms) {
+  if (!arguments.length || typeof ms === 'undefined') {
+    return this._slow;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('slow %d', ms);
+  this._slow = ms;
+  return this;
+};
+
+/**
+ * Set and get whether timeout is `enabled`.
+ *
+ * @private
+ * @param {boolean} enabled
+ * @return {Runnable|boolean} enabled or Runnable instance.
+ */
+Runnable.prototype.enableTimeouts = function(enabled) {
+  if (!arguments.length) {
+    return this._enableTimeouts;
+  }
+  debug('enableTimeouts %s', enabled);
+  this._enableTimeouts = enabled;
+  return this;
+};
+
+/**
+ * Halt and mark as pending.
+ *
+ * @memberof Mocha.Runnable
+ * @public
+ */
+Runnable.prototype.skip = function() {
+  throw new Pending('sync skip');
+};
+
+/**
+ * Check if this runnable or its parent suite is marked as pending.
+ *
+ * @private
+ */
+Runnable.prototype.isPending = function() {
+  return this.pending || (this.parent && this.parent.isPending());
+};
+
+/**
+ * Return `true` if this Runnable has failed.
+ * @return {boolean}
+ * @private
+ */
+Runnable.prototype.isFailed = function() {
+  return !this.isPending() && this.state === constants.STATE_FAILED;
+};
+
+/**
+ * Return `true` if this Runnable has passed.
+ * @return {boolean}
+ * @private
+ */
+Runnable.prototype.isPassed = function() {
+  return !this.isPending() && this.state === constants.STATE_PASSED;
+};
+
+/**
+ * Set or get number of retries.
+ *
+ * @private
+ */
+Runnable.prototype.retries = function(n) {
+  if (!arguments.length) {
+    return this._retries;
+  }
+  this._retries = n;
+};
+
+/**
+ * Set or get current retry
+ *
+ * @private
+ */
+Runnable.prototype.currentRetry = function(n) {
+  if (!arguments.length) {
+    return this._currentRetry;
+  }
+  this._currentRetry = n;
+};
+
+/**
+ * Return the full title generated by recursively concatenating the parent's
+ * full title.
+ *
+ * @memberof Mocha.Runnable
+ * @public
+ * @return {string}
+ */
+Runnable.prototype.fullTitle = function() {
+  return this.titlePath().join(' ');
+};
+
+/**
+ * Return the title path generated by concatenating the parent's title path with the title.
+ *
+ * @memberof Mocha.Runnable
+ * @public
+ * @return {string}
+ */
+Runnable.prototype.titlePath = function() {
+  return this.parent.titlePath().concat([this.title]);
+};
+
+/**
+ * Clear the timeout.
+ *
+ * @private
+ */
+Runnable.prototype.clearTimeout = function() {
+  clearTimeout(this.timer);
+};
+
+/**
+ * Inspect the runnable void of private properties.
+ *
+ * @private
+ * @return {string}
+ */
+Runnable.prototype.inspect = function() {
+  return JSON.stringify(
+    this,
+    function(key, val) {
+      if (key[0] === '_') {
+        return;
+      }
+      if (key === 'parent') {
+        return '#<Suite>';
+      }
+      if (key === 'ctx') {
+        return '#<Context>';
+      }
+      return val;
+    },
+    2
+  );
+};
+
+/**
+ * Reset the timeout.
+ *
+ * @private
+ */
+Runnable.prototype.resetTimeout = function() {
+  var self = this;
+  var ms = this.timeout() || 1e9;
+
+  if (!this._enableTimeouts) {
+    return;
+  }
+  this.clearTimeout();
+  this.timer = setTimeout(function() {
+    if (!self._enableTimeouts) {
+      return;
+    }
+    self.callback(self._timeoutError(ms));
+    self.timedOut = true;
+  }, ms);
+};
+
+/**
+ * Set or get a list of whitelisted globals for this test run.
+ *
+ * @private
+ * @param {string[]} globals
+ */
+Runnable.prototype.globals = function(globals) {
+  if (!arguments.length) {
+    return this._allowedGlobals;
+  }
+  this._allowedGlobals = globals;
+};
+
+/**
+ * Run the test and invoke `fn(err)`.
+ *
+ * @param {Function} fn
+ * @private
+ */
+Runnable.prototype.run = function(fn) {
+  var self = this;
+  var start = new Date();
+  var ctx = this.ctx;
+  var finished;
+  var emitted;
+
+  // Sometimes the ctx exists, but it is not runnable
+  if (ctx && ctx.runnable) {
+    ctx.runnable(this);
+  }
+
+  // called multiple times
+  function multiple(err) {
+    if (emitted) {
+      return;
+    }
+    emitted = true;
+    var msg = 'done() called multiple times';
+    if (err && err.message) {
+      err.message += " (and Mocha's " + msg + ')';
+      self.emit('error', err);
+    } else {
+      self.emit('error', new Error(msg));
+    }
+  }
+
+  // finished
+  function done(err) {
+    var ms = self.timeout();
+    if (self.timedOut) {
+      return;
+    }
+
+    if (finished) {
+      return multiple(err);
+    }
+
+    self.clearTimeout();
+    self.duration = new Date() - start;
+    finished = true;
+    if (!err && self.duration > ms && self._enableTimeouts) {
+      err = self._timeoutError(ms);
+    }
+    fn(err);
+  }
+
+  // for .resetTimeout()
+  this.callback = done;
+
+  // explicit async with `done` argument
+  if (this.async) {
+    this.resetTimeout();
+
+    // allows skip() to be used in an explicit async context
+    this.skip = function asyncSkip() {
+      done(new Pending('async skip call'));
+      // halt execution.  the Runnable will be marked pending
+      // by the previous call, and the uncaught handler will ignore
+      // the failure.
+      throw new Pending('async skip; aborting execution');
+    };
+
+    if (this.allowUncaught) {
+      return callFnAsync(this.fn);
+    }
+    try {
+      callFnAsync(this.fn);
+    } catch (err) {
+      emitted = true;
+      done(Runnable.toValueOrError(err));
+    }
+    return;
+  }
+
+  if (this.allowUncaught) {
+    if (this.isPending()) {
+      done();
+    } else {
+      callFn(this.fn);
+    }
+    return;
+  }
+
+  // sync or promise-returning
+  try {
+    if (this.isPending()) {
+      done();
+    } else {
+      callFn(this.fn);
+    }
+  } catch (err) {
+    emitted = true;
+    done(Runnable.toValueOrError(err));
+  }
+
+  function callFn(fn) {
+    var result = fn.call(ctx);
+    if (result && typeof result.then === 'function') {
+      self.resetTimeout();
+      result.then(
+        function() {
+          done();
+          // Return null so libraries like bluebird do not warn about
+          // subsequently constructed Promises.
+          return null;
+        },
+        function(reason) {
+          done(reason || new Error('Promise rejected with no or falsy reason'));
+        }
+      );
+    } else {
+      if (self.asyncOnly) {
+        return done(
+          new Error(
+            '--async-only option in use without declaring `done()` or returning a promise'
+          )
+        );
+      }
+
+      done();
+    }
+  }
+
+  function callFnAsync(fn) {
+    var result = fn.call(ctx, function(err) {
+      if (err instanceof Error || toString.call(err) === '[object Error]') {
+        return done(err);
+      }
+      if (err) {
+        if (Object.prototype.toString.call(err) === '[object Object]') {
+          return done(
+            new Error('done() invoked with non-Error: ' + JSON.stringify(err))
+          );
+        }
+        return done(new Error('done() invoked with non-Error: ' + err));
+      }
+      if (result && utils.isPromise(result)) {
+        return done(
+          new Error(
+            'Resolution method is overspecified. Specify a callback *or* return a Promise; not both.'
+          )
+        );
+      }
+
+      done();
+    });
+  }
+};
+
+/**
+ * Instantiates a "timeout" error
+ *
+ * @param {number} ms - Timeout (in milliseconds)
+ * @returns {Error} a "timeout" error
+ * @private
+ */
+Runnable.prototype._timeoutError = function(ms) {
+  var msg =
+    'Timeout of ' +
+    ms +
+    'ms exceeded. For async tests and hooks, ensure "done()" is called; if returning a Promise, ensure it resolves.';
+  if (this.file) {
+    msg += ' (' + this.file + ')';
+  }
+  return new Error(msg);
+};
+
+var constants = utils.defineConstants(
+  /**
+   * {@link Runnable}-related constants.
+   * @public
+   * @memberof Runnable
+   * @readonly
+   * @static
+   * @alias constants
+   * @enum {string}
+   */
+  {
+    /**
+     * Value of `state` prop when a `Runnable` has failed
+     */
+    STATE_FAILED: 'failed',
+    /**
+     * Value of `state` prop when a `Runnable` has passed
+     */
+    STATE_PASSED: 'passed'
+  }
+);
+
+/**
+ * Given `value`, return identity if truthy, otherwise create an "invalid exception" error and return that.
+ * @param {*} [value] - Value to return, if present
+ * @returns {*|Error} `value`, otherwise an `Error`
+ * @private
+ */
+Runnable.toValueOrError = function(value) {
+  return (
+    value ||
+    createInvalidExceptionError(
+      'Runnable failed with falsy or undefined exception. Please throw an Error instead.',
+      value
+    )
+  );
+};
+
+Runnable.constants = constants;
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./errors":6,"./pending":16,"./utils":38,"debug":45,"events":50,"ms":60}],34:[function(require,module,exports){
+(function (process,global){
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+var util = require('util');
+var EventEmitter = require('events').EventEmitter;
+var Pending = require('./pending');
+var utils = require('./utils');
+var inherits = utils.inherits;
+var debug = require('debug')('mocha:runner');
+var Runnable = require('./runnable');
+var Suite = require('./suite');
+var HOOK_TYPE_BEFORE_EACH = Suite.constants.HOOK_TYPE_BEFORE_EACH;
+var HOOK_TYPE_AFTER_EACH = Suite.constants.HOOK_TYPE_AFTER_EACH;
+var HOOK_TYPE_AFTER_ALL = Suite.constants.HOOK_TYPE_AFTER_ALL;
+var HOOK_TYPE_BEFORE_ALL = Suite.constants.HOOK_TYPE_BEFORE_ALL;
+var EVENT_ROOT_SUITE_RUN = Suite.constants.EVENT_ROOT_SUITE_RUN;
+var STATE_FAILED = Runnable.constants.STATE_FAILED;
+var STATE_PASSED = Runnable.constants.STATE_PASSED;
+var dQuote = utils.dQuote;
+var ngettext = utils.ngettext;
+var sQuote = utils.sQuote;
+var stackFilter = utils.stackTraceFilter();
+var stringify = utils.stringify;
+var type = utils.type;
+var createInvalidExceptionError = require('./errors')
+  .createInvalidExceptionError;
+
+/**
+ * Non-enumerable globals.
+ * @readonly
+ */
+var globals = [
+  'setTimeout',
+  'clearTimeout',
+  'setInterval',
+  'clearInterval',
+  'XMLHttpRequest',
+  'Date',
+  'setImmediate',
+  'clearImmediate'
+];
+
+var constants = utils.defineConstants(
+  /**
+   * {@link Runner}-related constants.
+   * @public
+   * @memberof Runner
+   * @readonly
+   * @alias constants
+   * @static
+   * @enum {string}
+   */
+  {
+    /**
+     * Emitted when {@link Hook} execution begins
+     */
+    EVENT_HOOK_BEGIN: 'hook',
+    /**
+     * Emitted when {@link Hook} execution ends
+     */
+    EVENT_HOOK_END: 'hook end',
+    /**
+     * Emitted when Root {@link Suite} execution begins (all files have been parsed and hooks/tests are ready for execution)
+     */
+    EVENT_RUN_BEGIN: 'start',
+    /**
+     * Emitted when Root {@link Suite} execution has been delayed via `delay` option
+     */
+    EVENT_DELAY_BEGIN: 'waiting',
+    /**
+     * Emitted when delayed Root {@link Suite} execution is triggered by user via `global.run()`
+     */
+    EVENT_DELAY_END: 'ready',
+    /**
+     * Emitted when Root {@link Suite} execution ends
+     */
+    EVENT_RUN_END: 'end',
+    /**
+     * Emitted when {@link Suite} execution begins
+     */
+    EVENT_SUITE_BEGIN: 'suite',
+    /**
+     * Emitted when {@link Suite} execution ends
+     */
+    EVENT_SUITE_END: 'suite end',
+    /**
+     * Emitted when {@link Test} execution begins
+     */
+    EVENT_TEST_BEGIN: 'test',
+    /**
+     * Emitted when {@link Test} execution ends
+     */
+    EVENT_TEST_END: 'test end',
+    /**
+     * Emitted when {@link Test} execution fails
+     */
+    EVENT_TEST_FAIL: 'fail',
+    /**
+     * Emitted when {@link Test} execution succeeds
+     */
+    EVENT_TEST_PASS: 'pass',
+    /**
+     * Emitted when {@link Test} becomes pending
+     */
+    EVENT_TEST_PENDING: 'pending',
+    /**
+     * Emitted when {@link Test} execution has failed, but will retry
+     */
+    EVENT_TEST_RETRY: 'retry'
+  }
+);
+
+module.exports = Runner;
+
+/**
+ * Initialize a `Runner` at the Root {@link Suite}, which represents a hierarchy of {@link Suite|Suites} and {@link Test|Tests}.
+ *
+ * @extends external:EventEmitter
+ * @public
+ * @class
+ * @param {Suite} suite Root suite
+ * @param {boolean} [delay] Whether or not to delay execution of root suite
+ * until ready.
+ */
+function Runner(suite, delay) {
+  var self = this;
+  this._globals = [];
+  this._abort = false;
+  this._delay = delay;
+  this.suite = suite;
+  this.started = false;
+  this.total = suite.total();
+  this.failures = 0;
+  this.on(constants.EVENT_TEST_END, function(test) {
+    self.checkGlobals(test);
+  });
+  this.on(constants.EVENT_HOOK_END, function(hook) {
+    self.checkGlobals(hook);
+  });
+  this._defaultGrep = /.*/;
+  this.grep(this._defaultGrep);
+  this.globals(this.globalProps().concat(extraGlobals()));
+}
+
+/**
+ * Wrapper for setImmediate, process.nextTick, or browser polyfill.
+ *
+ * @param {Function} fn
+ * @private
+ */
+Runner.immediately = global.setImmediate || process.nextTick;
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+inherits(Runner, EventEmitter);
+
+/**
+ * Run tests with full titles matching `re`. Updates runner.total
+ * with number of tests matched.
+ *
+ * @public
+ * @memberof Runner
+ * @param {RegExp} re
+ * @param {boolean} invert
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.grep = function(re, invert) {
+  debug('grep %s', re);
+  this._grep = re;
+  this._invert = invert;
+  this.total = this.grepTotal(this.suite);
+  return this;
+};
+
+/**
+ * Returns the number of tests matching the grep search for the
+ * given suite.
+ *
+ * @memberof Runner
+ * @public
+ * @param {Suite} suite
+ * @return {number}
+ */
+Runner.prototype.grepTotal = function(suite) {
+  var self = this;
+  var total = 0;
+
+  suite.eachTest(function(test) {
+    var match = self._grep.test(test.fullTitle());
+    if (self._invert) {
+      match = !match;
+    }
+    if (match) {
+      total++;
+    }
+  });
+
+  return total;
+};
+
+/**
+ * Return a list of global properties.
+ *
+ * @return {Array}
+ * @private
+ */
+Runner.prototype.globalProps = function() {
+  var props = Object.keys(global);
+
+  // non-enumerables
+  for (var i = 0; i < globals.length; ++i) {
+    if (~props.indexOf(globals[i])) {
+      continue;
+    }
+    props.push(globals[i]);
+  }
+
+  return props;
+};
+
+/**
+ * Allow the given `arr` of globals.
+ *
+ * @public
+ * @memberof Runner
+ * @param {Array} arr
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.globals = function(arr) {
+  if (!arguments.length) {
+    return this._globals;
+  }
+  debug('globals %j', arr);
+  this._globals = this._globals.concat(arr);
+  return this;
+};
+
+/**
+ * Check for global variable leaks.
+ *
+ * @private
+ */
+Runner.prototype.checkGlobals = function(test) {
+  if (this.ignoreLeaks) {
+    return;
+  }
+  var ok = this._globals;
+
+  var globals = this.globalProps();
+  var leaks;
+
+  if (test) {
+    ok = ok.concat(test._allowedGlobals || []);
+  }
+
+  if (this.prevGlobalsLength === globals.length) {
+    return;
+  }
+  this.prevGlobalsLength = globals.length;
+
+  leaks = filterLeaks(ok, globals);
+  this._globals = this._globals.concat(leaks);
+
+  if (leaks.length) {
+    var format = ngettext(
+      leaks.length,
+      'global leak detected: %s',
+      'global leaks detected: %s'
+    );
+    var error = new Error(util.format(format, leaks.map(sQuote).join(', ')));
+    this.fail(test, error);
+  }
+};
+
+/**
+ * Fail the given `test`.
+ *
+ * @private
+ * @param {Test} test
+ * @param {Error} err
+ */
+Runner.prototype.fail = function(test, err) {
+  if (test.isPending()) {
+    return;
+  }
+
+  ++this.failures;
+  test.state = STATE_FAILED;
+
+  if (!isError(err)) {
+    err = thrown2Error(err);
+  }
+
+  try {
+    err.stack =
+      this.fullStackTrace || !err.stack ? err.stack : stackFilter(err.stack);
+  } catch (ignore) {
+    // some environments do not take kindly to monkeying with the stack
+  }
+
+  this.emit(constants.EVENT_TEST_FAIL, test, err);
+};
+
+/**
+ * Fail the given `hook` with `err`.
+ *
+ * Hook failures work in the following pattern:
+ * - If bail, run corresponding `after each` and `after` hooks,
+ *   then exit
+ * - Failed `before` hook skips all tests in a suite and subsuites,
+ *   but jumps to corresponding `after` hook
+ * - Failed `before each` hook skips remaining tests in a
+ *   suite and jumps to corresponding `after each` hook,
+ *   which is run only once
+ * - Failed `after` hook does not alter
+ *   execution order
+ * - Failed `after each` hook skips remaining tests in a
+ *   suite and subsuites, but executes other `after each`
+ *   hooks
+ *
+ * @private
+ * @param {Hook} hook
+ * @param {Error} err
+ */
+Runner.prototype.failHook = function(hook, err) {
+  hook.originalTitle = hook.originalTitle || hook.title;
+  if (hook.ctx && hook.ctx.currentTest) {
+    hook.title =
+      hook.originalTitle + ' for ' + dQuote(hook.ctx.currentTest.title);
+  } else {
+    var parentTitle;
+    if (hook.parent.title) {
+      parentTitle = hook.parent.title;
+    } else {
+      parentTitle = hook.parent.root ? '{root}' : '';
+    }
+    hook.title = hook.originalTitle + ' in ' + dQuote(parentTitle);
+  }
+
+  this.fail(hook, err);
+};
+
+/**
+ * Run hook `name` callbacks and then invoke `fn()`.
+ *
+ * @private
+ * @param {string} name
+ * @param {Function} fn
+ */
+
+Runner.prototype.hook = function(name, fn) {
+  var suite = this.suite;
+  var hooks = suite.getHooks(name);
+  var self = this;
+
+  function next(i) {
+    var hook = hooks[i];
+    if (!hook) {
+      return fn();
+    }
+    self.currentRunnable = hook;
+
+    if (name === HOOK_TYPE_BEFORE_ALL) {
+      hook.ctx.currentTest = hook.parent.tests[0];
+    } else if (name === HOOK_TYPE_AFTER_ALL) {
+      hook.ctx.currentTest = hook.parent.tests[hook.parent.tests.length - 1];
+    } else {
+      hook.ctx.currentTest = self.test;
+    }
+
+    hook.allowUncaught = self.allowUncaught;
+
+    self.emit(constants.EVENT_HOOK_BEGIN, hook);
+
+    if (!hook.listeners('error').length) {
+      hook.on('error', function(err) {
+        self.failHook(hook, err);
+      });
+    }
+
+    hook.run(function(err) {
+      var testError = hook.error();
+      if (testError) {
+        self.fail(self.test, testError);
+      }
+      if (err) {
+        if (err instanceof Pending) {
+          if (name === HOOK_TYPE_AFTER_ALL) {
+            utils.deprecate(
+              'Skipping a test within an "after all" hook is DEPRECATED and will throw an exception in a future version of Mocha. ' +
+                'Use a return statement or other means to abort hook execution.'
+            );
+          }
+          if (name === HOOK_TYPE_BEFORE_EACH || name === HOOK_TYPE_AFTER_EACH) {
+            if (self.test) {
+              self.test.pending = true;
+            }
+          } else {
+            suite.tests.forEach(function(test) {
+              test.pending = true;
+            });
+            suite.suites.forEach(function(suite) {
+              suite.pending = true;
+            });
+            // a pending hook won't be executed twice.
+            hook.pending = true;
+          }
+        } else {
+          self.failHook(hook, err);
+
+          // stop executing hooks, notify callee of hook err
+          return fn(err);
+        }
+      }
+      self.emit(constants.EVENT_HOOK_END, hook);
+      delete hook.ctx.currentTest;
+      next(++i);
+    });
+  }
+
+  Runner.immediately(function() {
+    next(0);
+  });
+};
+
+/**
+ * Run hook `name` for the given array of `suites`
+ * in order, and callback `fn(err, errSuite)`.
+ *
+ * @private
+ * @param {string} name
+ * @param {Array} suites
+ * @param {Function} fn
+ */
+Runner.prototype.hooks = function(name, suites, fn) {
+  var self = this;
+  var orig = this.suite;
+
+  function next(suite) {
+    self.suite = suite;
+
+    if (!suite) {
+      self.suite = orig;
+      return fn();
+    }
+
+    self.hook(name, function(err) {
+      if (err) {
+        var errSuite = self.suite;
+        self.suite = orig;
+        return fn(err, errSuite);
+      }
+
+      next(suites.pop());
+    });
+  }
+
+  next(suites.pop());
+};
+
+/**
+ * Run hooks from the top level down.
+ *
+ * @param {String} name
+ * @param {Function} fn
+ * @private
+ */
+Runner.prototype.hookUp = function(name, fn) {
+  var suites = [this.suite].concat(this.parents()).reverse();
+  this.hooks(name, suites, fn);
+};
+
+/**
+ * Run hooks from the bottom up.
+ *
+ * @param {String} name
+ * @param {Function} fn
+ * @private
+ */
+Runner.prototype.hookDown = function(name, fn) {
+  var suites = [this.suite].concat(this.parents());
+  this.hooks(name, suites, fn);
+};
+
+/**
+ * Return an array of parent Suites from
+ * closest to furthest.
+ *
+ * @return {Array}
+ * @private
+ */
+Runner.prototype.parents = function() {
+  var suite = this.suite;
+  var suites = [];
+  while (suite.parent) {
+    suite = suite.parent;
+    suites.push(suite);
+  }
+  return suites;
+};
+
+/**
+ * Run the current test and callback `fn(err)`.
+ *
+ * @param {Function} fn
+ * @private
+ */
+Runner.prototype.runTest = function(fn) {
+  var self = this;
+  var test = this.test;
+
+  if (!test) {
+    return;
+  }
+
+  var suite = this.parents().reverse()[0] || this.suite;
+  if (this.forbidOnly && suite.hasOnly()) {
+    fn(new Error('`.only` forbidden'));
+    return;
+  }
+  if (this.asyncOnly) {
+    test.asyncOnly = true;
+  }
+  test.on('error', function(err) {
+    self.fail(test, err);
+  });
+  if (this.allowUncaught) {
+    test.allowUncaught = true;
+    return test.run(fn);
+  }
+  try {
+    test.run(fn);
+  } catch (err) {
+    fn(err);
+  }
+};
+
+/**
+ * Run tests in the given `suite` and invoke the callback `fn()` when complete.
+ *
+ * @private
+ * @param {Suite} suite
+ * @param {Function} fn
+ */
+Runner.prototype.runTests = function(suite, fn) {
+  var self = this;
+  var tests = suite.tests.slice();
+  var test;
+
+  function hookErr(_, errSuite, after) {
+    // before/after Each hook for errSuite failed:
+    var orig = self.suite;
+
+    // for failed 'after each' hook start from errSuite parent,
+    // otherwise start from errSuite itself
+    self.suite = after ? errSuite.parent : errSuite;
+
+    if (self.suite) {
+      // call hookUp afterEach
+      self.hookUp(HOOK_TYPE_AFTER_EACH, function(err2, errSuite2) {
+        self.suite = orig;
+        // some hooks may fail even now
+        if (err2) {
+          return hookErr(err2, errSuite2, true);
+        }
+        // report error suite
+        fn(errSuite);
+      });
+    } else {
+      // there is no need calling other 'after each' hooks
+      self.suite = orig;
+      fn(errSuite);
+    }
+  }
+
+  function next(err, errSuite) {
+    // if we bail after first err
+    if (self.failures && suite._bail) {
+      tests = [];
+    }
+
+    if (self._abort) {
+      return fn();
+    }
+
+    if (err) {
+      return hookErr(err, errSuite, true);
+    }
+
+    // next test
+    test = tests.shift();
+
+    // all done
+    if (!test) {
+      return fn();
+    }
+
+    // grep
+    var match = self._grep.test(test.fullTitle());
+    if (self._invert) {
+      match = !match;
+    }
+    if (!match) {
+      // Run immediately only if we have defined a grep. When we
+      // define a grep — It can cause maximum callstack error if
+      // the grep is doing a large recursive loop by neglecting
+      // all tests. The run immediately function also comes with
+      // a performance cost. So we don't want to run immediately
+      // if we run the whole test suite, because running the whole
+      // test suite don't do any immediate recursive loops. Thus,
+      // allowing a JS runtime to breathe.
+      if (self._grep !== self._defaultGrep) {
+        Runner.immediately(next);
+      } else {
+        next();
+      }
+      return;
+    }
+
+    if (test.isPending()) {
+      if (self.forbidPending) {
+        test.isPending = alwaysFalse;
+        self.fail(test, new Error('Pending test forbidden'));
+        delete test.isPending;
+      } else {
+        self.emit(constants.EVENT_TEST_PENDING, test);
+      }
+      self.emit(constants.EVENT_TEST_END, test);
+      return next();
+    }
+
+    // execute test and hook(s)
+    self.emit(constants.EVENT_TEST_BEGIN, (self.test = test));
+    self.hookDown(HOOK_TYPE_BEFORE_EACH, function(err, errSuite) {
+      if (test.isPending()) {
+        if (self.forbidPending) {
+          test.isPending = alwaysFalse;
+          self.fail(test, new Error('Pending test forbidden'));
+          delete test.isPending;
+        } else {
+          self.emit(constants.EVENT_TEST_PENDING, test);
+        }
+        self.emit(constants.EVENT_TEST_END, test);
+        return next();
+      }
+      if (err) {
+        return hookErr(err, errSuite, false);
+      }
+      self.currentRunnable = self.test;
+      self.runTest(function(err) {
+        test = self.test;
+        if (err) {
+          var retry = test.currentRetry();
+          if (err instanceof Pending && self.forbidPending) {
+            self.fail(test, new Error('Pending test forbidden'));
+          } else if (err instanceof Pending) {
+            test.pending = true;
+            self.emit(constants.EVENT_TEST_PENDING, test);
+          } else if (retry < test.retries()) {
+            var clonedTest = test.clone();
+            clonedTest.currentRetry(retry + 1);
+            tests.unshift(clonedTest);
+
+            self.emit(constants.EVENT_TEST_RETRY, test, err);
+
+            // Early return + hook trigger so that it doesn't
+            // increment the count wrong
+            return self.hookUp(HOOK_TYPE_AFTER_EACH, next);
+          } else {
+            self.fail(test, err);
+          }
+          self.emit(constants.EVENT_TEST_END, test);
+
+          if (err instanceof Pending) {
+            return next();
+          }
+
+          return self.hookUp(HOOK_TYPE_AFTER_EACH, next);
+        }
+
+        test.state = STATE_PASSED;
+        self.emit(constants.EVENT_TEST_PASS, test);
+        self.emit(constants.EVENT_TEST_END, test);
+        self.hookUp(HOOK_TYPE_AFTER_EACH, next);
+      });
+    });
+  }
+
+  this.next = next;
+  this.hookErr = hookErr;
+  next();
+};
+
+function alwaysFalse() {
+  return false;
+}
+
+/**
+ * Run the given `suite` and invoke the callback `fn()` when complete.
+ *
+ * @private
+ * @param {Suite} suite
+ * @param {Function} fn
+ */
+Runner.prototype.runSuite = function(suite, fn) {
+  var i = 0;
+  var self = this;
+  var total = this.grepTotal(suite);
+  var afterAllHookCalled = false;
+
+  debug('run suite %s', suite.fullTitle());
+
+  if (!total || (self.failures && suite._bail)) {
+    return fn();
+  }
+
+  this.emit(constants.EVENT_SUITE_BEGIN, (this.suite = suite));
+
+  function next(errSuite) {
+    if (errSuite) {
+      // current suite failed on a hook from errSuite
+      if (errSuite === suite) {
+        // if errSuite is current suite
+        // continue to the next sibling suite
+        return done();
+      }
+      // errSuite is among the parents of current suite
+      // stop execution of errSuite and all sub-suites
+      return done(errSuite);
+    }
+
+    if (self._abort) {
+      return done();
+    }
+
+    var curr = suite.suites[i++];
+    if (!curr) {
+      return done();
+    }
+
+    // Avoid grep neglecting large number of tests causing a
+    // huge recursive loop and thus a maximum call stack error.
+    // See comment in `this.runTests()` for more information.
+    if (self._grep !== self._defaultGrep) {
+      Runner.immediately(function() {
+        self.runSuite(curr, next);
+      });
+    } else {
+      self.runSuite(curr, next);
+    }
+  }
+
+  function done(errSuite) {
+    self.suite = suite;
+    self.nextSuite = next;
+
+    if (afterAllHookCalled) {
+      fn(errSuite);
+    } else {
+      // mark that the afterAll block has been called once
+      // and so can be skipped if there is an error in it.
+      afterAllHookCalled = true;
+
+      // remove reference to test
+      delete self.test;
+
+      self.hook(HOOK_TYPE_AFTER_ALL, function() {
+        self.emit(constants.EVENT_SUITE_END, suite);
+        fn(errSuite);
+      });
+    }
+  }
+
+  this.nextSuite = next;
+
+  this.hook(HOOK_TYPE_BEFORE_ALL, function(err) {
+    if (err) {
+      return done();
+    }
+    self.runTests(suite, next);
+  });
+};
+
+/**
+ * Handle uncaught exceptions.
+ *
+ * @param {Error} err
+ * @private
+ */
+Runner.prototype.uncaught = function(err) {
+  if (err instanceof Pending) {
+    return;
+  }
+  if (err) {
+    debug('uncaught exception %O', err);
+  } else {
+    debug('uncaught undefined/falsy exception');
+    err = createInvalidExceptionError(
+      'Caught falsy/undefined exception which would otherwise be uncaught. No stack trace found; try a debugger',
+      err
+    );
+  }
+
+  if (!isError(err)) {
+    err = thrown2Error(err);
+  }
+  err.uncaught = true;
+
+  var runnable = this.currentRunnable;
+
+  if (!runnable) {
+    runnable = new Runnable('Uncaught error outside test suite');
+    runnable.parent = this.suite;
+
+    if (this.started) {
+      this.fail(runnable, err);
+    } else {
+      // Can't recover from this failure
+      this.emit(constants.EVENT_RUN_BEGIN);
+      this.fail(runnable, err);
+      this.emit(constants.EVENT_RUN_END);
+    }
+
+    return;
+  }
+
+  runnable.clearTimeout();
+
+  // Ignore errors if already failed or pending
+  // See #3226
+  if (runnable.isFailed() || runnable.isPending()) {
+    return;
+  }
+  // we cannot recover gracefully if a Runnable has already passed
+  // then fails asynchronously
+  var alreadyPassed = runnable.isPassed();
+  // this will change the state to "failed" regardless of the current value
+  this.fail(runnable, err);
+  if (!alreadyPassed) {
+    // recover from test
+    if (runnable.type === constants.EVENT_TEST_BEGIN) {
+      this.emit(constants.EVENT_TEST_END, runnable);
+      this.hookUp(HOOK_TYPE_AFTER_EACH, this.next);
+      return;
+    }
+    debug(runnable);
+
+    // recover from hooks
+    var errSuite = this.suite;
+
+    // XXX how about a less awful way to determine this?
+    // if hook failure is in afterEach block
+    if (runnable.fullTitle().indexOf('after each') > -1) {
+      return this.hookErr(err, errSuite, true);
+    }
+    // if hook failure is in beforeEach block
+    if (runnable.fullTitle().indexOf('before each') > -1) {
+      return this.hookErr(err, errSuite, false);
+    }
+    // if hook failure is in after or before blocks
+    return this.nextSuite(errSuite);
+  }
+
+  // bail
+  this.emit(constants.EVENT_RUN_END);
+};
+
+/**
+ * Run the root suite and invoke `fn(failures)`
+ * on completion.
+ *
+ * @public
+ * @memberof Runner
+ * @param {Function} fn
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.run = function(fn) {
+  var self = this;
+  var rootSuite = this.suite;
+
+  fn = fn || function() {};
+
+  function uncaught(err) {
+    self.uncaught(err);
+  }
+
+  function start() {
+    // If there is an `only` filter
+    if (rootSuite.hasOnly()) {
+      rootSuite.filterOnly();
+    }
+    self.started = true;
+    if (self._delay) {
+      self.emit(constants.EVENT_DELAY_END);
+    }
+    self.emit(constants.EVENT_RUN_BEGIN);
+
+    self.runSuite(rootSuite, function() {
+      debug('finished running');
+      self.emit(constants.EVENT_RUN_END);
+    });
+  }
+
+  debug(constants.EVENT_RUN_BEGIN);
+
+  // references cleanup to avoid memory leaks
+  this.on(constants.EVENT_SUITE_END, function(suite) {
+    suite.cleanReferences();
+  });
+
+  // callback
+  this.on(constants.EVENT_RUN_END, function() {
+    debug(constants.EVENT_RUN_END);
+    process.removeListener('uncaughtException', uncaught);
+    fn(self.failures);
+  });
+
+  // uncaught exception
+  process.on('uncaughtException', uncaught);
+
+  if (this._delay) {
+    // for reporters, I guess.
+    // might be nice to debounce some dots while we wait.
+    this.emit(constants.EVENT_DELAY_BEGIN, rootSuite);
+    rootSuite.once(EVENT_ROOT_SUITE_RUN, start);
+  } else {
+    start();
+  }
+
+  return this;
+};
+
+/**
+ * Cleanly abort execution.
+ *
+ * @memberof Runner
+ * @public
+ * @return {Runner} Runner instance.
+ */
+Runner.prototype.abort = function() {
+  debug('aborting');
+  this._abort = true;
+
+  return this;
+};
+
+/**
+ * Filter leaks with the given globals flagged as `ok`.
+ *
+ * @private
+ * @param {Array} ok
+ * @param {Array} globals
+ * @return {Array}
+ */
+function filterLeaks(ok, globals) {
+  return globals.filter(function(key) {
+    // Firefox and Chrome exposes iframes as index inside the window object
+    if (/^\d+/.test(key)) {
+      return false;
+    }
+
+    // in firefox
+    // if runner runs in an iframe, this iframe's window.getInterface method
+    // not init at first it is assigned in some seconds
+    if (global.navigator && /^getInterface/.test(key)) {
+      return false;
+    }
+
+    // an iframe could be approached by window[iframeIndex]
+    // in ie6,7,8 and opera, iframeIndex is enumerable, this could cause leak
+    if (global.navigator && /^\d+/.test(key)) {
+      return false;
+    }
+
+    // Opera and IE expose global variables for HTML element IDs (issue #243)
+    if (/^mocha-/.test(key)) {
+      return false;
+    }
+
+    var matched = ok.filter(function(ok) {
+      if (~ok.indexOf('*')) {
+        return key.indexOf(ok.split('*')[0]) === 0;
+      }
+      return key === ok;
+    });
+    return !matched.length && (!global.navigator || key !== 'onerror');
+  });
+}
+
+/**
+ * Check if argument is an instance of Error object or a duck-typed equivalent.
+ *
+ * @private
+ * @param {Object} err - object to check
+ * @param {string} err.message - error message
+ * @returns {boolean}
+ */
+function isError(err) {
+  return err instanceof Error || (err && typeof err.message === 'string');
+}
+
+/**
+ *
+ * Converts thrown non-extensible type into proper Error.
+ *
+ * @private
+ * @param {*} thrown - Non-extensible type thrown by code
+ * @return {Error}
+ */
+function thrown2Error(err) {
+  return new Error(
+    'the ' + type(err) + ' ' + stringify(err) + ' was thrown, throw an Error :)'
+  );
+}
+
+/**
+ * Array of globals dependent on the environment.
+ *
+ * @return {Array}
+ * @deprecated
+ * @todo remove; long since unsupported
+ * @private
+ */
+function extraGlobals() {
+  if (typeof process === 'object' && typeof process.version === 'string') {
+    var parts = process.version.split('.');
+    var nodeVersion = parts.reduce(function(a, v) {
+      return (a << 8) | v;
+    });
+
+    // 'errno' was renamed to process._errno in v0.9.11.
+    if (nodeVersion < 0x00090b) {
+      return ['errno'];
+    }
+  }
+
+  return [];
+}
+
+Runner.constants = constants;
+
+/**
+ * Node.js' `EventEmitter`
+ * @external EventEmitter
+ * @see {@link https://nodejs.org/api/events.html#events_class_eventemitter}
+ */
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./errors":6,"./pending":16,"./runnable":33,"./suite":36,"./utils":38,"_process":69,"debug":45,"events":50,"util":89}],35:[function(require,module,exports){
+(function (global){
+'use strict';
+
+/**
+ * Provides a factory function for a {@link StatsCollector} object.
+ * @module
+ */
+
+var constants = require('./runner').constants;
+var EVENT_TEST_PASS = constants.EVENT_TEST_PASS;
+var EVENT_TEST_FAIL = constants.EVENT_TEST_FAIL;
+var EVENT_SUITE_BEGIN = constants.EVENT_SUITE_BEGIN;
+var EVENT_RUN_BEGIN = constants.EVENT_RUN_BEGIN;
+var EVENT_TEST_PENDING = constants.EVENT_TEST_PENDING;
+var EVENT_RUN_END = constants.EVENT_RUN_END;
+var EVENT_TEST_END = constants.EVENT_TEST_END;
+
+/**
+ * Test statistics collector.
+ *
+ * @public
+ * @typedef {Object} StatsCollector
+ * @property {number} suites - integer count of suites run.
+ * @property {number} tests - integer count of tests run.
+ * @property {number} passes - integer count of passing tests.
+ * @property {number} pending - integer count of pending tests.
+ * @property {number} failures - integer count of failed tests.
+ * @property {Date} start - time when testing began.
+ * @property {Date} end - time when testing concluded.
+ * @property {number} duration - number of msecs that testing took.
+ */
+
+var Date = global.Date;
+
+/**
+ * Provides stats such as test duration, number of tests passed / failed etc., by listening for events emitted by `runner`.
+ *
+ * @private
+ * @param {Runner} runner - Runner instance
+ * @throws {TypeError} If falsy `runner`
+ */
+function createStatsCollector(runner) {
+  /**
+   * @type StatsCollector
+   */
+  var stats = {
+    suites: 0,
+    tests: 0,
+    passes: 0,
+    pending: 0,
+    failures: 0
+  };
+
+  if (!runner) {
+    throw new TypeError('Missing runner argument');
+  }
+
+  runner.stats = stats;
+
+  runner.once(EVENT_RUN_BEGIN, function() {
+    stats.start = new Date();
+  });
+  runner.on(EVENT_SUITE_BEGIN, function(suite) {
+    suite.root || stats.suites++;
+  });
+  runner.on(EVENT_TEST_PASS, function() {
+    stats.passes++;
+  });
+  runner.on(EVENT_TEST_FAIL, function() {
+    stats.failures++;
+  });
+  runner.on(EVENT_TEST_PENDING, function() {
+    stats.pending++;
+  });
+  runner.on(EVENT_TEST_END, function() {
+    stats.tests++;
+  });
+  runner.once(EVENT_RUN_END, function() {
+    stats.end = new Date();
+    stats.duration = stats.end - stats.start;
+  });
+}
+
+module.exports = createStatsCollector;
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./runner":34}],36:[function(require,module,exports){
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+var EventEmitter = require('events').EventEmitter;
+var Hook = require('./hook');
+var utils = require('./utils');
+var inherits = utils.inherits;
+var debug = require('debug')('mocha:suite');
+var milliseconds = require('ms');
+var errors = require('./errors');
+var createInvalidArgumentTypeError = errors.createInvalidArgumentTypeError;
+
+/**
+ * Expose `Suite`.
+ */
+
+exports = module.exports = Suite;
+
+/**
+ * Create a new `Suite` with the given `title` and parent `Suite`.
+ *
+ * @public
+ * @param {Suite} parent - Parent suite (required!)
+ * @param {string} title - Title
+ * @return {Suite}
+ */
+Suite.create = function(parent, title) {
+  var suite = new Suite(title, parent.ctx);
+  suite.parent = parent;
+  title = suite.fullTitle();
+  parent.addSuite(suite);
+  return suite;
+};
+
+/**
+ * Constructs a new `Suite` instance with the given `title`, `ctx`, and `isRoot`.
+ *
+ * @public
+ * @class
+ * @extends EventEmitter
+ * @see {@link https://nodejs.org/api/events.html#events_class_eventemitter|EventEmitter}
+ * @param {string} title - Suite title.
+ * @param {Context} parentContext - Parent context instance.
+ * @param {boolean} [isRoot=false] - Whether this is the root suite.
+ */
+function Suite(title, parentContext, isRoot) {
+  if (!utils.isString(title)) {
+    throw createInvalidArgumentTypeError(
+      'Suite argument "title" must be a string. Received type "' +
+        typeof title +
+        '"',
+      'title',
+      'string'
+    );
+  }
+  this.title = title;
+  function Context() {}
+  Context.prototype = parentContext;
+  this.ctx = new Context();
+  this.suites = [];
+  this.tests = [];
+  this.pending = false;
+  this._beforeEach = [];
+  this._beforeAll = [];
+  this._afterEach = [];
+  this._afterAll = [];
+  this.root = isRoot === true;
+  this._timeout = 2000;
+  this._enableTimeouts = true;
+  this._slow = 75;
+  this._bail = false;
+  this._retries = -1;
+  this._onlyTests = [];
+  this._onlySuites = [];
+  this.delayed = false;
+
+  this.on('newListener', function(event) {
+    if (deprecatedEvents[event]) {
+      utils.deprecate(
+        'Event "' +
+          event +
+          '" is deprecated.  Please let the Mocha team know about your use case: https://git.io/v6Lwm'
+      );
+    }
+  });
+}
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+inherits(Suite, EventEmitter);
+
+/**
+ * Return a clone of this `Suite`.
+ *
+ * @private
+ * @return {Suite}
+ */
+Suite.prototype.clone = function() {
+  var suite = new Suite(this.title);
+  debug('clone');
+  suite.ctx = this.ctx;
+  suite.root = this.root;
+  suite.timeout(this.timeout());
+  suite.retries(this.retries());
+  suite.enableTimeouts(this.enableTimeouts());
+  suite.slow(this.slow());
+  suite.bail(this.bail());
+  return suite;
+};
+
+/**
+ * Set or get timeout `ms` or short-hand such as "2s".
+ *
+ * @private
+ * @todo Do not attempt to set value if `ms` is undefined
+ * @param {number|string} ms
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.timeout = function(ms) {
+  if (!arguments.length) {
+    return this._timeout;
+  }
+  if (ms.toString() === '0') {
+    this._enableTimeouts = false;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('timeout %d', ms);
+  this._timeout = parseInt(ms, 10);
+  return this;
+};
+
+/**
+ * Set or get number of times to retry a failed test.
+ *
+ * @private
+ * @param {number|string} n
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.retries = function(n) {
+  if (!arguments.length) {
+    return this._retries;
+  }
+  debug('retries %d', n);
+  this._retries = parseInt(n, 10) || 0;
+  return this;
+};
+
+/**
+ * Set or get timeout to `enabled`.
+ *
+ * @private
+ * @param {boolean} enabled
+ * @return {Suite|boolean} self or enabled
+ */
+Suite.prototype.enableTimeouts = function(enabled) {
+  if (!arguments.length) {
+    return this._enableTimeouts;
+  }
+  debug('enableTimeouts %s', enabled);
+  this._enableTimeouts = enabled;
+  return this;
+};
+
+/**
+ * Set or get slow `ms` or short-hand such as "2s".
+ *
+ * @private
+ * @param {number|string} ms
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.slow = function(ms) {
+  if (!arguments.length) {
+    return this._slow;
+  }
+  if (typeof ms === 'string') {
+    ms = milliseconds(ms);
+  }
+  debug('slow %d', ms);
+  this._slow = ms;
+  return this;
+};
+
+/**
+ * Set or get whether to bail after first error.
+ *
+ * @private
+ * @param {boolean} bail
+ * @return {Suite|number} for chaining
+ */
+Suite.prototype.bail = function(bail) {
+  if (!arguments.length) {
+    return this._bail;
+  }
+  debug('bail %s', bail);
+  this._bail = bail;
+  return this;
+};
+
+/**
+ * Check if this suite or its parent suite is marked as pending.
+ *
+ * @private
+ */
+Suite.prototype.isPending = function() {
+  return this.pending || (this.parent && this.parent.isPending());
+};
+
+/**
+ * Generic hook-creator.
+ * @private
+ * @param {string} title - Title of hook
+ * @param {Function} fn - Hook callback
+ * @returns {Hook} A new hook
+ */
+Suite.prototype._createHook = function(title, fn) {
+  var hook = new Hook(title, fn);
+  hook.parent = this;
+  hook.timeout(this.timeout());
+  hook.retries(this.retries());
+  hook.enableTimeouts(this.enableTimeouts());
+  hook.slow(this.slow());
+  hook.ctx = this.ctx;
+  hook.file = this.file;
+  return hook;
+};
+
+/**
+ * Run `fn(test[, done])` before running tests.
+ *
+ * @private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.beforeAll = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"before all" hook' + (title ? ': ' + title : '');
+
+  var hook = this._createHook(title, fn);
+  this._beforeAll.push(hook);
+  this.emit(constants.EVENT_SUITE_ADD_HOOK_BEFORE_ALL, hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` after running tests.
+ *
+ * @private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.afterAll = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"after all" hook' + (title ? ': ' + title : '');
+
+  var hook = this._createHook(title, fn);
+  this._afterAll.push(hook);
+  this.emit(constants.EVENT_SUITE_ADD_HOOK_AFTER_ALL, hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` before each test case.
+ *
+ * @private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.beforeEach = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"before each" hook' + (title ? ': ' + title : '');
+
+  var hook = this._createHook(title, fn);
+  this._beforeEach.push(hook);
+  this.emit(constants.EVENT_SUITE_ADD_HOOK_BEFORE_EACH, hook);
+  return this;
+};
+
+/**
+ * Run `fn(test[, done])` after each test case.
+ *
+ * @private
+ * @param {string} title
+ * @param {Function} fn
+ * @return {Suite} for chaining
+ */
+Suite.prototype.afterEach = function(title, fn) {
+  if (this.isPending()) {
+    return this;
+  }
+  if (typeof title === 'function') {
+    fn = title;
+    title = fn.name;
+  }
+  title = '"after each" hook' + (title ? ': ' + title : '');
+
+  var hook = this._createHook(title, fn);
+  this._afterEach.push(hook);
+  this.emit(constants.EVENT_SUITE_ADD_HOOK_AFTER_EACH, hook);
+  return this;
+};
+
+/**
+ * Add a test `suite`.
+ *
+ * @private
+ * @param {Suite} suite
+ * @return {Suite} for chaining
+ */
+Suite.prototype.addSuite = function(suite) {
+  suite.parent = this;
+  suite.root = false;
+  suite.timeout(this.timeout());
+  suite.retries(this.retries());
+  suite.enableTimeouts(this.enableTimeouts());
+  suite.slow(this.slow());
+  suite.bail(this.bail());
+  this.suites.push(suite);
+  this.emit(constants.EVENT_SUITE_ADD_SUITE, suite);
+  return this;
+};
+
+/**
+ * Add a `test` to this suite.
+ *
+ * @private
+ * @param {Test} test
+ * @return {Suite} for chaining
+ */
+Suite.prototype.addTest = function(test) {
+  test.parent = this;
+  test.timeout(this.timeout());
+  test.retries(this.retries());
+  test.enableTimeouts(this.enableTimeouts());
+  test.slow(this.slow());
+  test.ctx = this.ctx;
+  this.tests.push(test);
+  this.emit(constants.EVENT_SUITE_ADD_TEST, test);
+  return this;
+};
+
+/**
+ * Return the full title generated by recursively concatenating the parent's
+ * full title.
+ *
+ * @memberof Suite
+ * @public
+ * @return {string}
+ */
+Suite.prototype.fullTitle = function() {
+  return this.titlePath().join(' ');
+};
+
+/**
+ * Return the title path generated by recursively concatenating the parent's
+ * title path.
+ *
+ * @memberof Suite
+ * @public
+ * @return {string}
+ */
+Suite.prototype.titlePath = function() {
+  var result = [];
+  if (this.parent) {
+    result = result.concat(this.parent.titlePath());
+  }
+  if (!this.root) {
+    result.push(this.title);
+  }
+  return result;
+};
+
+/**
+ * Return the total number of tests.
+ *
+ * @memberof Suite
+ * @public
+ * @return {number}
+ */
+Suite.prototype.total = function() {
+  return (
+    this.suites.reduce(function(sum, suite) {
+      return sum + suite.total();
+    }, 0) + this.tests.length
+  );
+};
+
+/**
+ * Iterates through each suite recursively to find all tests. Applies a
+ * function in the format `fn(test)`.
+ *
+ * @private
+ * @param {Function} fn
+ * @return {Suite}
+ */
+Suite.prototype.eachTest = function(fn) {
+  this.tests.forEach(fn);
+  this.suites.forEach(function(suite) {
+    suite.eachTest(fn);
+  });
+  return this;
+};
+
+/**
+ * This will run the root suite if we happen to be running in delayed mode.
+ * @private
+ */
+Suite.prototype.run = function run() {
+  if (this.root) {
+    this.emit(constants.EVENT_ROOT_SUITE_RUN);
+  }
+};
+
+/**
+ * Determines whether a suite has an `only` test or suite as a descendant.
+ *
+ * @private
+ * @returns {Boolean}
+ */
+Suite.prototype.hasOnly = function hasOnly() {
+  return (
+    this._onlyTests.length > 0 ||
+    this._onlySuites.length > 0 ||
+    this.suites.some(function(suite) {
+      return suite.hasOnly();
+    })
+  );
+};
+
+/**
+ * Filter suites based on `isOnly` logic.
+ *
+ * @private
+ * @returns {Boolean}
+ */
+Suite.prototype.filterOnly = function filterOnly() {
+  if (this._onlyTests.length) {
+    // If the suite contains `only` tests, run those and ignore any nested suites.
+    this.tests = this._onlyTests;
+    this.suites = [];
+  } else {
+    // Otherwise, do not run any of the tests in this suite.
+    this.tests = [];
+    this._onlySuites.forEach(function(onlySuite) {
+      // If there are other `only` tests/suites nested in the current `only` suite, then filter that `only` suite.
+      // Otherwise, all of the tests on this `only` suite should be run, so don't filter it.
+      if (onlySuite.hasOnly()) {
+        onlySuite.filterOnly();
+      }
+    });
+    // Run the `only` suites, as well as any other suites that have `only` tests/suites as descendants.
+    var onlySuites = this._onlySuites;
+    this.suites = this.suites.filter(function(childSuite) {
+      return onlySuites.indexOf(childSuite) !== -1 || childSuite.filterOnly();
+    });
+  }
+  // Keep the suite only if there is something to run
+  return this.tests.length > 0 || this.suites.length > 0;
+};
+
+/**
+ * Adds a suite to the list of subsuites marked `only`.
+ *
+ * @private
+ * @param {Suite} suite
+ */
+Suite.prototype.appendOnlySuite = function(suite) {
+  this._onlySuites.push(suite);
+};
+
+/**
+ * Adds a test to the list of tests marked `only`.
+ *
+ * @private
+ * @param {Test} test
+ */
+Suite.prototype.appendOnlyTest = function(test) {
+  this._onlyTests.push(test);
+};
+
+/**
+ * Returns the array of hooks by hook name; see `HOOK_TYPE_*` constants.
+ * @private
+ */
+Suite.prototype.getHooks = function getHooks(name) {
+  return this['_' + name];
+};
+
+/**
+ * Cleans up the references to all the deferred functions
+ * (before/after/beforeEach/afterEach) and tests of a Suite.
+ * These must be deleted otherwise a memory leak can happen,
+ * as those functions may reference variables from closures,
+ * thus those variables can never be garbage collected as long
+ * as the deferred functions exist.
+ *
+ * @private
+ */
+Suite.prototype.cleanReferences = function cleanReferences() {
+  function cleanArrReferences(arr) {
+    for (var i = 0; i < arr.length; i++) {
+      delete arr[i].fn;
+    }
+  }
+
+  if (Array.isArray(this._beforeAll)) {
+    cleanArrReferences(this._beforeAll);
+  }
+
+  if (Array.isArray(this._beforeEach)) {
+    cleanArrReferences(this._beforeEach);
+  }
+
+  if (Array.isArray(this._afterAll)) {
+    cleanArrReferences(this._afterAll);
+  }
+
+  if (Array.isArray(this._afterEach)) {
+    cleanArrReferences(this._afterEach);
+  }
+
+  for (var i = 0; i < this.tests.length; i++) {
+    delete this.tests[i].fn;
+  }
+};
+
+var constants = utils.defineConstants(
+  /**
+   * {@link Suite}-related constants.
+   * @public
+   * @memberof Suite
+   * @alias constants
+   * @readonly
+   * @static
+   * @enum {string}
+   */
+  {
+    /**
+     * Event emitted after a test file has been loaded Not emitted in browser.
+     */
+    EVENT_FILE_POST_REQUIRE: 'post-require',
+    /**
+     * Event emitted before a test file has been loaded. In browser, this is emitted once an interface has been selected.
+     */
+    EVENT_FILE_PRE_REQUIRE: 'pre-require',
+    /**
+     * Event emitted immediately after a test file has been loaded. Not emitted in browser.
+     */
+    EVENT_FILE_REQUIRE: 'require',
+    /**
+     * Event emitted when `global.run()` is called (use with `delay` option)
+     */
+    EVENT_ROOT_SUITE_RUN: 'run',
+
+    /**
+     * Namespace for collection of a `Suite`'s "after all" hooks
+     */
+    HOOK_TYPE_AFTER_ALL: 'afterAll',
+    /**
+     * Namespace for collection of a `Suite`'s "after each" hooks
+     */
+    HOOK_TYPE_AFTER_EACH: 'afterEach',
+    /**
+     * Namespace for collection of a `Suite`'s "before all" hooks
+     */
+    HOOK_TYPE_BEFORE_ALL: 'beforeAll',
+    /**
+     * Namespace for collection of a `Suite`'s "before all" hooks
+     */
+    HOOK_TYPE_BEFORE_EACH: 'beforeEach',
+
+    // the following events are all deprecated
+
+    /**
+     * Emitted after an "after all" `Hook` has been added to a `Suite`. Deprecated
+     */
+    EVENT_SUITE_ADD_HOOK_AFTER_ALL: 'afterAll',
+    /**
+     * Emitted after an "after each" `Hook` has been added to a `Suite` Deprecated
+     */
+    EVENT_SUITE_ADD_HOOK_AFTER_EACH: 'afterEach',
+    /**
+     * Emitted after an "before all" `Hook` has been added to a `Suite` Deprecated
+     */
+    EVENT_SUITE_ADD_HOOK_BEFORE_ALL: 'beforeAll',
+    /**
+     * Emitted after an "before each" `Hook` has been added to a `Suite` Deprecated
+     */
+    EVENT_SUITE_ADD_HOOK_BEFORE_EACH: 'beforeEach',
+    /**
+     * Emitted after a child `Suite` has been added to a `Suite`. Deprecated
+     */
+    EVENT_SUITE_ADD_SUITE: 'suite',
+    /**
+     * Emitted after a `Test` has been added to a `Suite`. Deprecated
+     */
+    EVENT_SUITE_ADD_TEST: 'test'
+  }
+);
+
+/**
+ * @summary There are no known use cases for these events.
+ * @desc This is a `Set`-like object having all keys being the constant's string value and the value being `true`.
+ * @todo Remove eventually
+ * @type {Object<string,boolean>}
+ * @ignore
+ */
+var deprecatedEvents = Object.keys(constants)
+  .filter(function(constant) {
+    return constant.substring(0, 15) === 'EVENT_SUITE_ADD';
+  })
+  .reduce(function(acc, constant) {
+    acc[constants[constant]] = true;
+    return acc;
+  }, utils.createMap());
+
+Suite.constants = constants;
+
+},{"./errors":6,"./hook":7,"./utils":38,"debug":45,"events":50,"ms":60}],37:[function(require,module,exports){
+'use strict';
+var Runnable = require('./runnable');
+var utils = require('./utils');
+var errors = require('./errors');
+var createInvalidArgumentTypeError = errors.createInvalidArgumentTypeError;
+var isString = utils.isString;
+
+module.exports = Test;
+
+/**
+ * Initialize a new `Test` with the given `title` and callback `fn`.
+ *
+ * @public
+ * @class
+ * @extends Runnable
+ * @param {String} title - Test title (required)
+ * @param {Function} [fn] - Test callback.  If omitted, the Test is considered "pending"
+ */
+function Test(title, fn) {
+  if (!isString(title)) {
+    throw createInvalidArgumentTypeError(
+      'Test argument "title" should be a string. Received type "' +
+        typeof title +
+        '"',
+      'title',
+      'string'
+    );
+  }
+  Runnable.call(this, title, fn);
+  this.pending = !fn;
+  this.type = 'test';
+}
+
+/**
+ * Inherit from `Runnable.prototype`.
+ */
+utils.inherits(Test, Runnable);
+
+Test.prototype.clone = function() {
+  var test = new Test(this.title, this.fn);
+  test.timeout(this.timeout());
+  test.slow(this.slow());
+  test.enableTimeouts(this.enableTimeouts());
+  test.retries(this.retries());
+  test.currentRetry(this.currentRetry());
+  test.globals(this.globals());
+  test.parent = this.parent;
+  test.file = this.file;
+  test.ctx = this.ctx;
+  return test;
+};
+
+},{"./errors":6,"./runnable":33,"./utils":38}],38:[function(require,module,exports){
+(function (process,Buffer){
+'use strict';
+
+/**
+ * Various utility functions used throughout Mocha's codebase.
+ * @module utils
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var fs = require('fs');
+var path = require('path');
+var util = require('util');
+var glob = require('glob');
+var he = require('he');
+var errors = require('./errors');
+var createNoFilesMatchPatternError = errors.createNoFilesMatchPatternError;
+var createMissingArgumentError = errors.createMissingArgumentError;
+
+var assign = (exports.assign = require('object.assign').getPolyfill());
+
+/**
+ * Inherit the prototype methods from one constructor into another.
+ *
+ * @param {function} ctor - Constructor function which needs to inherit the
+ *     prototype.
+ * @param {function} superCtor - Constructor function to inherit prototype from.
+ * @throws {TypeError} if either constructor is null, or if super constructor
+ *     lacks a prototype.
+ */
+exports.inherits = util.inherits;
+
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @private
+ * @param  {string} html
+ * @return {string}
+ */
+exports.escape = function(html) {
+  return he.encode(String(html), {useNamedReferences: false});
+};
+
+/**
+ * Test if the given obj is type of string.
+ *
+ * @private
+ * @param {Object} obj
+ * @return {boolean}
+ */
+exports.isString = function(obj) {
+  return typeof obj === 'string';
+};
+
+/**
+ * Watch the given `files` for changes
+ * and invoke `fn(file)` on modification.
+ *
+ * @private
+ * @param {Array} files
+ * @param {Function} fn
+ */
+exports.watch = function(files, fn) {
+  var options = {interval: 100};
+  var debug = require('debug')('mocha:watch');
+  files.forEach(function(file) {
+    debug('file %s', file);
+    fs.watchFile(file, options, function(curr, prev) {
+      if (prev.mtime < curr.mtime) {
+        fn(file);
+      }
+    });
+  });
+};
+
+/**
+ * Predicate to screen `pathname` for further consideration.
+ *
+ * @description
+ * Returns <code>false</code> for pathname referencing:
+ * <ul>
+ *   <li>'npm' package installation directory
+ *   <li>'git' version control directory
+ * </ul>
+ *
+ * @private
+ * @param {string} pathname - File or directory name to screen
+ * @return {boolean} whether pathname should be further considered
+ * @example
+ * ['node_modules', 'test.js'].filter(considerFurther); // => ['test.js']
+ */
+function considerFurther(pathname) {
+  var ignore = ['node_modules', '.git'];
+
+  return !~ignore.indexOf(pathname);
+}
+
+/**
+ * Lookup files in the given `dir`.
+ *
+ * @description
+ * Filenames are returned in _traversal_ order by the OS/filesystem.
+ * **Make no assumption that the names will be sorted in any fashion.**
+ *
+ * @private
+ * @param {string} dir
+ * @param {string[]} [exts=['js']]
+ * @param {Array} [ret=[]]
+ * @return {Array}
+ */
+exports.files = function(dir, exts, ret) {
+  ret = ret || [];
+  exts = exts || ['js'];
+
+  fs.readdirSync(dir)
+    .filter(considerFurther)
+    .forEach(function(dirent) {
+      var pathname = path.join(dir, dirent);
+      if (fs.lstatSync(pathname).isDirectory()) {
+        exports.files(pathname, exts, ret);
+      } else if (hasMatchingExtname(pathname, exts)) {
+        ret.push(pathname);
+      }
+    });
+
+  return ret;
+};
+
+/**
+ * Compute a slug from the given `str`.
+ *
+ * @private
+ * @param {string} str
+ * @return {string}
+ */
+exports.slug = function(str) {
+  return str
+    .toLowerCase()
+    .replace(/ +/g, '-')
+    .replace(/[^-\w]/g, '');
+};
+
+/**
+ * Strip the function definition from `str`, and re-indent for pre whitespace.
+ *
+ * @param {string} str
+ * @return {string}
+ */
+exports.clean = function(str) {
+  str = str
+    .replace(/\r\n?|[\n\u2028\u2029]/g, '\n')
+    .replace(/^\uFEFF/, '')
+    // (traditional)->  space/name     parameters    body     (lambda)-> parameters       body   multi-statement/single          keep body content
+    .replace(
+      /^function(?:\s*|\s+[^(]*)\([^)]*\)\s*\{((?:.|\n)*?)\s*\}$|^\([^)]*\)\s*=>\s*(?:\{((?:.|\n)*?)\s*\}|((?:.|\n)*))$/,
+      '$1$2$3'
+    );
+
+  var spaces = str.match(/^\n?( *)/)[1].length;
+  var tabs = str.match(/^\n?(\t*)/)[1].length;
+  var re = new RegExp(
+    '^\n?' + (tabs ? '\t' : ' ') + '{' + (tabs || spaces) + '}',
+    'gm'
+  );
+
+  str = str.replace(re, '');
+
+  return str.trim();
+};
+
+/**
+ * Parse the given `qs`.
+ *
+ * @private
+ * @param {string} qs
+ * @return {Object}
+ */
+exports.parseQuery = function(qs) {
+  return qs
+    .replace('?', '')
+    .split('&')
+    .reduce(function(obj, pair) {
+      var i = pair.indexOf('=');
+      var key = pair.slice(0, i);
+      var val = pair.slice(++i);
+
+      // Due to how the URLSearchParams API treats spaces
+      obj[key] = decodeURIComponent(val.replace(/\+/g, '%20'));
+
+      return obj;
+    }, {});
+};
+
+/**
+ * Highlight the given string of `js`.
+ *
+ * @private
+ * @param {string} js
+ * @return {string}
+ */
+function highlight(js) {
+  return js
+    .replace(/</g, '&lt;')
+    .replace(/>/g, '&gt;')
+    .replace(/\/\/(.*)/gm, '<span class="comment">//$1</span>')
+    .replace(/('.*?')/gm, '<span class="string">$1</span>')
+    .replace(/(\d+\.\d+)/gm, '<span class="number">$1</span>')
+    .replace(/(\d+)/gm, '<span class="number">$1</span>')
+    .replace(
+      /\bnew[ \t]+(\w+)/gm,
+      '<span class="keyword">new</span> <span class="init">$1</span>'
+    )
+    .replace(
+      /\b(function|new|throw|return|var|if|else)\b/gm,
+      '<span class="keyword">$1</span>'
+    );
+}
+
+/**
+ * Highlight the contents of tag `name`.
+ *
+ * @private
+ * @param {string} name
+ */
+exports.highlightTags = function(name) {
+  var code = document.getElementById('mocha').getElementsByTagName(name);
+  for (var i = 0, len = code.length; i < len; ++i) {
+    code[i].innerHTML = highlight(code[i].innerHTML);
+  }
+};
+
+/**
+ * If a value could have properties, and has none, this function is called,
+ * which returns a string representation of the empty value.
+ *
+ * Functions w/ no properties return `'[Function]'`
+ * Arrays w/ length === 0 return `'[]'`
+ * Objects w/ no properties return `'{}'`
+ * All else: return result of `value.toString()`
+ *
+ * @private
+ * @param {*} value The value to inspect.
+ * @param {string} typeHint The type of the value
+ * @returns {string}
+ */
+function emptyRepresentation(value, typeHint) {
+  switch (typeHint) {
+    case 'function':
+      return '[Function]';
+    case 'object':
+      return '{}';
+    case 'array':
+      return '[]';
+    default:
+      return value.toString();
+  }
+}
+
+/**
+ * Takes some variable and asks `Object.prototype.toString()` what it thinks it
+ * is.
+ *
+ * @private
+ * @see https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/toString
+ * @param {*} value The value to test.
+ * @returns {string} Computed type
+ * @example
+ * type({}) // 'object'
+ * type([]) // 'array'
+ * type(1) // 'number'
+ * type(false) // 'boolean'
+ * type(Infinity) // 'number'
+ * type(null) // 'null'
+ * type(new Date()) // 'date'
+ * type(/foo/) // 'regexp'
+ * type('type') // 'string'
+ * type(global) // 'global'
+ * type(new String('foo') // 'object'
+ */
+var type = (exports.type = function type(value) {
+  if (value === undefined) {
+    return 'undefined';
+  } else if (value === null) {
+    return 'null';
+  } else if (Buffer.isBuffer(value)) {
+    return 'buffer';
+  }
+  return Object.prototype.toString
+    .call(value)
+    .replace(/^\[.+\s(.+?)]$/, '$1')
+    .toLowerCase();
+});
+
+/**
+ * Stringify `value`. Different behavior depending on type of value:
+ *
+ * - If `value` is undefined or null, return `'[undefined]'` or `'[null]'`, respectively.
+ * - If `value` is not an object, function or array, return result of `value.toString()` wrapped in double-quotes.
+ * - If `value` is an *empty* object, function, or array, return result of function
+ *   {@link emptyRepresentation}.
+ * - If `value` has properties, call {@link exports.canonicalize} on it, then return result of
+ *   JSON.stringify().
+ *
+ * @private
+ * @see exports.type
+ * @param {*} value
+ * @return {string}
+ */
+exports.stringify = function(value) {
+  var typeHint = type(value);
+
+  if (!~['object', 'array', 'function'].indexOf(typeHint)) {
+    if (typeHint === 'buffer') {
+      var json = Buffer.prototype.toJSON.call(value);
+      // Based on the toJSON result
+      return jsonStringify(
+        json.data && json.type ? json.data : json,
+        2
+      ).replace(/,(\n|$)/g, '$1');
+    }
+
+    // IE7/IE8 has a bizarre String constructor; needs to be coerced
+    // into an array and back to obj.
+    if (typeHint === 'string' && typeof value === 'object') {
+      value = value.split('').reduce(function(acc, char, idx) {
+        acc[idx] = char;
+        return acc;
+      }, {});
+      typeHint = 'object';
+    } else {
+      return jsonStringify(value);
+    }
+  }
+
+  for (var prop in value) {
+    if (Object.prototype.hasOwnProperty.call(value, prop)) {
+      return jsonStringify(
+        exports.canonicalize(value, null, typeHint),
+        2
+      ).replace(/,(\n|$)/g, '$1');
+    }
+  }
+
+  return emptyRepresentation(value, typeHint);
+};
+
+/**
+ * like JSON.stringify but more sense.
+ *
+ * @private
+ * @param {Object}  object
+ * @param {number=} spaces
+ * @param {number=} depth
+ * @returns {*}
+ */
+function jsonStringify(object, spaces, depth) {
+  if (typeof spaces === 'undefined') {
+    // primitive types
+    return _stringify(object);
+  }
+
+  depth = depth || 1;
+  var space = spaces * depth;
+  var str = Array.isArray(object) ? '[' : '{';
+  var end = Array.isArray(object) ? ']' : '}';
+  var length =
+    typeof object.length === 'number'
+      ? object.length
+      : Object.keys(object).length;
+  // `.repeat()` polyfill
+  function repeat(s, n) {
+    return new Array(n).join(s);
+  }
+
+  function _stringify(val) {
+    switch (type(val)) {
+      case 'null':
+      case 'undefined':
+        val = '[' + val + ']';
+        break;
+      case 'array':
+      case 'object':
+        val = jsonStringify(val, spaces, depth + 1);
+        break;
+      case 'boolean':
+      case 'regexp':
+      case 'symbol':
+      case 'number':
+        val =
+          val === 0 && 1 / val === -Infinity // `-0`
+            ? '-0'
+            : val.toString();
+        break;
+      case 'date':
+        var sDate = isNaN(val.getTime()) ? val.toString() : val.toISOString();
+        val = '[Date: ' + sDate + ']';
+        break;
+      case 'buffer':
+        var json = val.toJSON();
+        // Based on the toJSON result
+        json = json.data && json.type ? json.data : json;
+        val = '[Buffer: ' + jsonStringify(json, 2, depth + 1) + ']';
+        break;
+      default:
+        val =
+          val === '[Function]' || val === '[Circular]'
+            ? val
+            : JSON.stringify(val); // string
+    }
+    return val;
+  }
+
+  for (var i in object) {
+    if (!Object.prototype.hasOwnProperty.call(object, i)) {
+      continue; // not my business
+    }
+    --length;
+    str +=
+      '\n ' +
+      repeat(' ', space) +
+      (Array.isArray(object) ? '' : '"' + i + '": ') + // key
+      _stringify(object[i]) + // value
+      (length ? ',' : ''); // comma
+  }
+
+  return (
+    str +
+    // [], {}
+    (str.length !== 1 ? '\n' + repeat(' ', --space) + end : end)
+  );
+}
+
+/**
+ * Return a new Thing that has the keys in sorted order. Recursive.
+ *
+ * If the Thing...
+ * - has already been seen, return string `'[Circular]'`
+ * - is `undefined`, return string `'[undefined]'`
+ * - is `null`, return value `null`
+ * - is some other primitive, return the value
+ * - is not a primitive or an `Array`, `Object`, or `Function`, return the value of the Thing's `toString()` method
+ * - is a non-empty `Array`, `Object`, or `Function`, return the result of calling this function again.
+ * - is an empty `Array`, `Object`, or `Function`, return the result of calling `emptyRepresentation()`
+ *
+ * @private
+ * @see {@link exports.stringify}
+ * @param {*} value Thing to inspect.  May or may not have properties.
+ * @param {Array} [stack=[]] Stack of seen values
+ * @param {string} [typeHint] Type hint
+ * @return {(Object|Array|Function|string|undefined)}
+ */
+exports.canonicalize = function canonicalize(value, stack, typeHint) {
+  var canonicalizedObj;
+  /* eslint-disable no-unused-vars */
+  var prop;
+  /* eslint-enable no-unused-vars */
+  typeHint = typeHint || type(value);
+  function withStack(value, fn) {
+    stack.push(value);
+    fn();
+    stack.pop();
+  }
+
+  stack = stack || [];
+
+  if (stack.indexOf(value) !== -1) {
+    return '[Circular]';
+  }
+
+  switch (typeHint) {
+    case 'undefined':
+    case 'buffer':
+    case 'null':
+      canonicalizedObj = value;
+      break;
+    case 'array':
+      withStack(value, function() {
+        canonicalizedObj = value.map(function(item) {
+          return exports.canonicalize(item, stack);
+        });
+      });
+      break;
+    case 'function':
+      /* eslint-disable guard-for-in */
+      for (prop in value) {
+        canonicalizedObj = {};
+        break;
+      }
+      /* eslint-enable guard-for-in */
+      if (!canonicalizedObj) {
+        canonicalizedObj = emptyRepresentation(value, typeHint);
+        break;
+      }
+    /* falls through */
+    case 'object':
+      canonicalizedObj = canonicalizedObj || {};
+      withStack(value, function() {
+        Object.keys(value)
+          .sort()
+          .forEach(function(key) {
+            canonicalizedObj[key] = exports.canonicalize(value[key], stack);
+          });
+      });
+      break;
+    case 'date':
+    case 'number':
+    case 'regexp':
+    case 'boolean':
+    case 'symbol':
+      canonicalizedObj = value;
+      break;
+    default:
+      canonicalizedObj = value + '';
+  }
+
+  return canonicalizedObj;
+};
+
+/**
+ * Determines if pathname has a matching file extension.
+ *
+ * @private
+ * @param {string} pathname - Pathname to check for match.
+ * @param {string[]} exts - List of file extensions (sans period).
+ * @return {boolean} whether file extension matches.
+ * @example
+ * hasMatchingExtname('foo.html', ['js', 'css']); // => false
+ */
+function hasMatchingExtname(pathname, exts) {
+  var suffix = path.extname(pathname).slice(1);
+  return exts.some(function(element) {
+    return suffix === element;
+  });
+}
+
+/**
+ * Determines if pathname would be a "hidden" file (or directory) on UN*X.
+ *
+ * @description
+ * On UN*X, pathnames beginning with a full stop (aka dot) are hidden during
+ * typical usage. Dotfiles, plain-text configuration files, are prime examples.
+ *
+ * @see {@link http://xahlee.info/UnixResource_dir/writ/unix_origin_of_dot_filename.html|Origin of Dot File Names}
+ *
+ * @private
+ * @param {string} pathname - Pathname to check for match.
+ * @return {boolean} whether pathname would be considered a hidden file.
+ * @example
+ * isHiddenOnUnix('.profile'); // => true
+ */
+function isHiddenOnUnix(pathname) {
+  return path.basename(pathname)[0] === '.';
+}
+
+/**
+ * Lookup file names at the given `path`.
+ *
+ * @description
+ * Filenames are returned in _traversal_ order by the OS/filesystem.
+ * **Make no assumption that the names will be sorted in any fashion.**
+ *
+ * @public
+ * @memberof Mocha.utils
+ * @param {string} filepath - Base path to start searching from.
+ * @param {string[]} [extensions=[]] - File extensions to look for.
+ * @param {boolean} [recursive=false] - Whether to recurse into subdirectories.
+ * @return {string[]} An array of paths.
+ * @throws {Error} if no files match pattern.
+ * @throws {TypeError} if `filepath` is directory and `extensions` not provided.
+ */
+exports.lookupFiles = function lookupFiles(filepath, extensions, recursive) {
+  extensions = extensions || [];
+  recursive = recursive || false;
+  var files = [];
+  var stat;
+
+  if (!fs.existsSync(filepath)) {
+    var pattern;
+    if (glob.hasMagic(filepath)) {
+      // Handle glob as is without extensions
+      pattern = filepath;
+    } else {
+      // glob pattern e.g. 'filepath+(.js|.ts)'
+      var strExtensions = extensions
+        .map(function(v) {
+          return '.' + v;
+        })
+        .join('|');
+      pattern = filepath + '+(' + strExtensions + ')';
+    }
+    files = glob.sync(pattern, {nodir: true});
+    if (!files.length) {
+      throw createNoFilesMatchPatternError(
+        'Cannot find any files matching pattern ' + exports.dQuote(filepath),
+        filepath
+      );
+    }
+    return files;
+  }
+
+  // Handle file
+  try {
+    stat = fs.statSync(filepath);
+    if (stat.isFile()) {
+      return filepath;
+    }
+  } catch (err) {
+    // ignore error
+    return;
+  }
+
+  // Handle directory
+  fs.readdirSync(filepath).forEach(function(dirent) {
+    var pathname = path.join(filepath, dirent);
+    var stat;
+
+    try {
+      stat = fs.statSync(pathname);
+      if (stat.isDirectory()) {
+        if (recursive) {
+          files = files.concat(lookupFiles(pathname, extensions, recursive));
+        }
+        return;
+      }
+    } catch (err) {
+      // ignore error
+      return;
+    }
+    if (!extensions.length) {
+      throw createMissingArgumentError(
+        util.format(
+          'Argument %s required when argument %s is a directory',
+          exports.sQuote('extensions'),
+          exports.sQuote('filepath')
+        ),
+        'extensions',
+        'array'
+      );
+    }
+
+    if (
+      !stat.isFile() ||
+      !hasMatchingExtname(pathname, extensions) ||
+      isHiddenOnUnix(pathname)
+    ) {
+      return;
+    }
+    files.push(pathname);
+  });
+
+  return files;
+};
+
+/**
+ * process.emitWarning or a polyfill
+ * @see https://nodejs.org/api/process.html#process_process_emitwarning_warning_options
+ * @ignore
+ */
+function emitWarning(msg, type) {
+  if (process.emitWarning) {
+    process.emitWarning(msg, type);
+  } else {
+    process.nextTick(function() {
+      console.warn(type + ': ' + msg);
+    });
+  }
+}
+
+/**
+ * Show a deprecation warning. Each distinct message is only displayed once.
+ * Ignores empty messages.
+ *
+ * @param {string} [msg] - Warning to print
+ * @private
+ */
+exports.deprecate = function deprecate(msg) {
+  msg = String(msg);
+  if (msg && !deprecate.cache[msg]) {
+    deprecate.cache[msg] = true;
+    emitWarning(msg, 'DeprecationWarning');
+  }
+};
+exports.deprecate.cache = {};
+
+/**
+ * Show a generic warning.
+ * Ignores empty messages.
+ *
+ * @param {string} [msg] - Warning to print
+ * @private
+ */
+exports.warn = function warn(msg) {
+  if (msg) {
+    emitWarning(msg);
+  }
+};
+
+/**
+ * @summary
+ * This Filter based on `mocha-clean` module.(see: `github.com/rstacruz/mocha-clean`)
+ * @description
+ * When invoking this function you get a filter function that get the Error.stack as an input,
+ * and return a prettify output.
+ * (i.e: strip Mocha and internal node functions from stack trace).
+ * @returns {Function}
+ */
+exports.stackTraceFilter = function() {
+  // TODO: Replace with `process.browser`
+  var is = typeof document === 'undefined' ? {node: true} : {browser: true};
+  var slash = path.sep;
+  var cwd;
+  if (is.node) {
+    cwd = process.cwd() + slash;
+  } else {
+    cwd = (typeof location === 'undefined'
+      ? window.location
+      : location
+    ).href.replace(/\/[^/]*$/, '/');
+    slash = '/';
+  }
+
+  function isMochaInternal(line) {
+    return (
+      ~line.indexOf('node_modules' + slash + 'mocha' + slash) ||
+      ~line.indexOf(slash + 'mocha.js') ||
+      ~line.indexOf(slash + 'mocha.min.js')
+    );
+  }
+
+  function isNodeInternal(line) {
+    return (
+      ~line.indexOf('(timers.js:') ||
+      ~line.indexOf('(events.js:') ||
+      ~line.indexOf('(node.js:') ||
+      ~line.indexOf('(module.js:') ||
+      ~line.indexOf('GeneratorFunctionPrototype.next (native)') ||
+      false
+    );
+  }
+
+  return function(stack) {
+    stack = stack.split('\n');
+
+    stack = stack.reduce(function(list, line) {
+      if (isMochaInternal(line)) {
+        return list;
+      }
+
+      if (is.node && isNodeInternal(line)) {
+        return list;
+      }
+
+      // Clean up cwd(absolute)
+      if (/:\d+:\d+\)?$/.test(line)) {
+        line = line.replace('(' + cwd, '(');
+      }
+
+      list.push(line);
+      return list;
+    }, []);
+
+    return stack.join('\n');
+  };
+};
+
+/**
+ * Crude, but effective.
+ * @public
+ * @param {*} value
+ * @returns {boolean} Whether or not `value` is a Promise
+ */
+exports.isPromise = function isPromise(value) {
+  return (
+    typeof value === 'object' &&
+    value !== null &&
+    typeof value.then === 'function'
+  );
+};
+
+/**
+ * Clamps a numeric value to an inclusive range.
+ *
+ * @param {number} value - Value to be clamped.
+ * @param {numer[]} range - Two element array specifying [min, max] range.
+ * @returns {number} clamped value
+ */
+exports.clamp = function clamp(value, range) {
+  return Math.min(Math.max(value, range[0]), range[1]);
+};
+
+/**
+ * Single quote text by combining with undirectional ASCII quotation marks.
+ *
+ * @description
+ * Provides a simple means of markup for quoting text to be used in output.
+ * Use this to quote names of variables, methods, and packages.
+ *
+ * <samp>package 'foo' cannot be found</samp>
+ *
+ * @private
+ * @param {string} str - Value to be quoted.
+ * @returns {string} quoted value
+ * @example
+ * sQuote('n') // => 'n'
+ */
+exports.sQuote = function(str) {
+  return "'" + str + "'";
+};
+
+/**
+ * Double quote text by combining with undirectional ASCII quotation marks.
+ *
+ * @description
+ * Provides a simple means of markup for quoting text to be used in output.
+ * Use this to quote names of datatypes, classes, pathnames, and strings.
+ *
+ * <samp>argument 'value' must be "string" or "number"</samp>
+ *
+ * @private
+ * @param {string} str - Value to be quoted.
+ * @returns {string} quoted value
+ * @example
+ * dQuote('number') // => "number"
+ */
+exports.dQuote = function(str) {
+  return '"' + str + '"';
+};
+
+/**
+ * Provides simplistic message translation for dealing with plurality.
+ *
+ * @description
+ * Use this to create messages which need to be singular or plural.
+ * Some languages have several plural forms, so _complete_ message clauses
+ * are preferable to generating the message on the fly.
+ *
+ * @private
+ * @param {number} n - Non-negative integer
+ * @param {string} msg1 - Message to be used in English for `n = 1`
+ * @param {string} msg2 - Message to be used in English for `n = 0, 2, 3, ...`
+ * @returns {string} message corresponding to value of `n`
+ * @example
+ * var sprintf = require('util').format;
+ * var pkgs = ['one', 'two'];
+ * var msg = sprintf(
+ *   ngettext(
+ *     pkgs.length,
+ *     'cannot load package: %s',
+ *     'cannot load packages: %s'
+ *   ),
+ *   pkgs.map(sQuote).join(', ')
+ * );
+ * console.log(msg); // => cannot load packages: 'one', 'two'
+ */
+exports.ngettext = function(n, msg1, msg2) {
+  if (typeof n === 'number' && n >= 0) {
+    return n === 1 ? msg1 : msg2;
+  }
+};
+
+/**
+ * It's a noop.
+ * @public
+ */
+exports.noop = function() {};
+
+/**
+ * Creates a map-like object.
+ *
+ * @description
+ * A "map" is an object with no prototype, for our purposes. In some cases
+ * this would be more appropriate than a `Map`, especially if your environment
+ * doesn't support it. Recommended for use in Mocha's public APIs.
+ *
+ * @public
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Map|MDN:Map}
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/create#Custom_and_Null_objects|MDN:Object.create - Custom objects}
+ * @see {@link https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/assign|MDN:Object.assign}
+ * @param {...*} [obj] - Arguments to `Object.assign()`.
+ * @returns {Object} An object with no prototype, having `...obj` properties
+ */
+exports.createMap = function(obj) {
+  return assign.apply(
+    null,
+    [Object.create(null)].concat(Array.prototype.slice.call(arguments))
+  );
+};
+
+/**
+ * Creates a read-only map-like object.
+ *
+ * @description
+ * This differs from {@link module:utils.createMap createMap} only in that
+ * the argument must be non-empty, because the result is frozen.
+ *
+ * @see {@link module:utils.createMap createMap}
+ * @param {...*} [obj] - Arguments to `Object.assign()`.
+ * @returns {Object} A frozen object with no prototype, having `...obj` properties
+ * @throws {TypeError} if argument is not a non-empty object.
+ */
+exports.defineConstants = function(obj) {
+  if (type(obj) !== 'object' || !Object.keys(obj).length) {
+    throw new TypeError('Invalid argument; expected a non-empty object');
+  }
+  return Object.freeze(exports.createMap(obj));
+};
+
+}).call(this,require('_process'),require("buffer").Buffer)
+},{"./errors":6,"_process":69,"buffer":43,"debug":45,"fs":42,"glob":42,"he":54,"object.assign":65,"path":42,"util":89}],39:[function(require,module,exports){
+'use strict'
+
+exports.byteLength = byteLength
+exports.toByteArray = toByteArray
+exports.fromByteArray = fromByteArray
+
+var lookup = []
+var revLookup = []
+var Arr = typeof Uint8Array !== 'undefined' ? Uint8Array : Array
+
+var code = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'
+for (var i = 0, len = code.length; i < len; ++i) {
+  lookup[i] = code[i]
+  revLookup[code.charCodeAt(i)] = i
+}
+
+// Support decoding URL-safe base64 strings, as Node.js does.
+// See: https://en.wikipedia.org/wiki/Base64#URL_applications
+revLookup['-'.charCodeAt(0)] = 62
+revLookup['_'.charCodeAt(0)] = 63
+
+function getLens (b64) {
+  var len = b64.length
+
+  if (len % 4 > 0) {
+    throw new Error('Invalid string. Length must be a multiple of 4')
+  }
+
+  // Trim off extra bytes after placeholder bytes are found
+  // See: https://github.com/beatgammit/base64-js/issues/42
+  var validLen = b64.indexOf('=')
+  if (validLen === -1) validLen = len
+
+  var placeHoldersLen = validLen === len
+    ? 0
+    : 4 - (validLen % 4)
+
+  return [validLen, placeHoldersLen]
+}
+
+// base64 is 4/3 + up to two characters of the original data
+function byteLength (b64) {
+  var lens = getLens(b64)
+  var validLen = lens[0]
+  var placeHoldersLen = lens[1]
+  return ((validLen + placeHoldersLen) * 3 / 4) - placeHoldersLen
+}
+
+function _byteLength (b64, validLen, placeHoldersLen) {
+  return ((validLen + placeHoldersLen) * 3 / 4) - placeHoldersLen
+}
+
+function toByteArray (b64) {
+  var tmp
+  var lens = getLens(b64)
+  var validLen = lens[0]
+  var placeHoldersLen = lens[1]
+
+  var arr = new Arr(_byteLength(b64, validLen, placeHoldersLen))
+
+  var curByte = 0
+
+  // if there are placeholders, only get up to the last complete 4 chars
+  var len = placeHoldersLen > 0
+    ? validLen - 4
+    : validLen
+
+  for (var i = 0; i < len; i += 4) {
+    tmp =
+      (revLookup[b64.charCodeAt(i)] << 18) |
+      (revLookup[b64.charCodeAt(i + 1)] << 12) |
+      (revLookup[b64.charCodeAt(i + 2)] << 6) |
+      revLookup[b64.charCodeAt(i + 3)]
+    arr[curByte++] = (tmp >> 16) & 0xFF
+    arr[curByte++] = (tmp >> 8) & 0xFF
+    arr[curByte++] = tmp & 0xFF
+  }
+
+  if (placeHoldersLen === 2) {
+    tmp =
+      (revLookup[b64.charCodeAt(i)] << 2) |
+      (revLookup[b64.charCodeAt(i + 1)] >> 4)
+    arr[curByte++] = tmp & 0xFF
+  }
+
+  if (placeHoldersLen === 1) {
+    tmp =
+      (revLookup[b64.charCodeAt(i)] << 10) |
+      (revLookup[b64.charCodeAt(i + 1)] << 4) |
+      (revLookup[b64.charCodeAt(i + 2)] >> 2)
+    arr[curByte++] = (tmp >> 8) & 0xFF
+    arr[curByte++] = tmp & 0xFF
+  }
+
+  return arr
+}
+
+function tripletToBase64 (num) {
+  return lookup[num >> 18 & 0x3F] +
+    lookup[num >> 12 & 0x3F] +
+    lookup[num >> 6 & 0x3F] +
+    lookup[num & 0x3F]
+}
+
+function encodeChunk (uint8, start, end) {
+  var tmp
+  var output = []
+  for (var i = start; i < end; i += 3) {
+    tmp =
+      ((uint8[i] << 16) & 0xFF0000) +
+      ((uint8[i + 1] << 8) & 0xFF00) +
+      (uint8[i + 2] & 0xFF)
+    output.push(tripletToBase64(tmp))
+  }
+  return output.join('')
+}
+
+function fromByteArray (uint8) {
+  var tmp
+  var len = uint8.length
+  var extraBytes = len % 3 // if we have 1 byte left, pad 2 bytes
+  var parts = []
+  var maxChunkLength = 16383 // must be multiple of 3
+
+  // go through the array every three bytes, we'll deal with trailing stuff later
+  for (var i = 0, len2 = len - extraBytes; i < len2; i += maxChunkLength) {
+    parts.push(encodeChunk(
+      uint8, i, (i + maxChunkLength) > len2 ? len2 : (i + maxChunkLength)
+    ))
+  }
+
+  // pad the end with zeros, but make sure to not forget the extra bytes
+  if (extraBytes === 1) {
+    tmp = uint8[len - 1]
+    parts.push(
+      lookup[tmp >> 2] +
+      lookup[(tmp << 4) & 0x3F] +
+      '=='
+    )
+  } else if (extraBytes === 2) {
+    tmp = (uint8[len - 2] << 8) + uint8[len - 1]
+    parts.push(
+      lookup[tmp >> 10] +
+      lookup[(tmp >> 4) & 0x3F] +
+      lookup[(tmp << 2) & 0x3F] +
+      '='
+    )
+  }
+
+  return parts.join('')
+}
+
+},{}],40:[function(require,module,exports){
+
+},{}],41:[function(require,module,exports){
+(function (process){
+var WritableStream = require('stream').Writable
+var inherits = require('util').inherits
+
+module.exports = BrowserStdout
+
+
+inherits(BrowserStdout, WritableStream)
+
+function BrowserStdout(opts) {
+  if (!(this instanceof BrowserStdout)) return new BrowserStdout(opts)
+
+  opts = opts || {}
+  WritableStream.call(this, opts)
+  this.label = (opts.label !== undefined) ? opts.label : 'stdout'
+}
+
+BrowserStdout.prototype._write = function(chunks, encoding, cb) {
+  var output = chunks.toString ? chunks.toString() : chunks
+  if (this.label === false) {
+    console.log(output)
+  } else {
+    console.log(this.label+':', output)
+  }
+  process.nextTick(cb)
+}
+
+}).call(this,require('_process'))
+},{"_process":69,"stream":84,"util":89}],42:[function(require,module,exports){
+arguments[4][40][0].apply(exports,arguments)
+},{"dup":40}],43:[function(require,module,exports){
+(function (Buffer){
+/*!
+ * The buffer module from node.js, for the browser.
+ *
+ * @author   Feross Aboukhadijeh <https://feross.org>
+ * @license  MIT
+ */
+/* eslint-disable no-proto */
+
+'use strict'
+
+var base64 = require('base64-js')
+var ieee754 = require('ieee754')
+
+exports.Buffer = Buffer
+exports.SlowBuffer = SlowBuffer
+exports.INSPECT_MAX_BYTES = 50
+
+var K_MAX_LENGTH = 0x7fffffff
+exports.kMaxLength = K_MAX_LENGTH
+
+/**
+ * If `Buffer.TYPED_ARRAY_SUPPORT`:
+ *   === true    Use Uint8Array implementation (fastest)
+ *   === false   Print warning and recommend using `buffer` v4.x which has an Object
+ *               implementation (most compatible, even IE6)
+ *
+ * Browsers that support typed arrays are IE 10+, Firefox 4+, Chrome 7+, Safari 5.1+,
+ * Opera 11.6+, iOS 4.2+.
+ *
+ * We report that the browser does not support typed arrays if the are not subclassable
+ * using __proto__. Firefox 4-29 lacks support for adding new properties to `Uint8Array`
+ * (See: https://bugzilla.mozilla.org/show_bug.cgi?id=695438). IE 10 lacks support
+ * for __proto__ and has a buggy typed array implementation.
+ */
+Buffer.TYPED_ARRAY_SUPPORT = typedArraySupport()
+
+if (!Buffer.TYPED_ARRAY_SUPPORT && typeof console !== 'undefined' &&
+    typeof console.error === 'function') {
+  console.error(
+    'This browser lacks typed array (Uint8Array) support which is required by ' +
+    '`buffer` v5.x. Use `buffer` v4.x if you require old browser support.'
+  )
+}
+
+function typedArraySupport () {
+  // Can typed array instances can be augmented?
+  try {
+    var arr = new Uint8Array(1)
+    arr.__proto__ = { __proto__: Uint8Array.prototype, foo: function () { return 42 } }
+    return arr.foo() === 42
+  } catch (e) {
+    return false
+  }
+}
+
+Object.defineProperty(Buffer.prototype, 'parent', {
+  enumerable: true,
+  get: function () {
+    if (!Buffer.isBuffer(this)) return undefined
+    return this.buffer
+  }
+})
+
+Object.defineProperty(Buffer.prototype, 'offset', {
+  enumerable: true,
+  get: function () {
+    if (!Buffer.isBuffer(this)) return undefined
+    return this.byteOffset
+  }
+})
+
+function createBuffer (length) {
+  if (length > K_MAX_LENGTH) {
+    throw new RangeError('The value "' + length + '" is invalid for option "size"')
+  }
+  // Return an augmented `Uint8Array` instance
+  var buf = new Uint8Array(length)
+  buf.__proto__ = Buffer.prototype
+  return buf
+}
+
+/**
+ * The Buffer constructor returns instances of `Uint8Array` that have their
+ * prototype changed to `Buffer.prototype`. Furthermore, `Buffer` is a subclass of
+ * `Uint8Array`, so the returned instances will have all the node `Buffer` methods
+ * and the `Uint8Array` methods. Square bracket notation works as expected -- it
+ * returns a single octet.
+ *
+ * The `Uint8Array` prototype remains unmodified.
+ */
+
+function Buffer (arg, encodingOrOffset, length) {
+  // Common case.
+  if (typeof arg === 'number') {
+    if (typeof encodingOrOffset === 'string') {
+      throw new TypeError(
+        'The "string" argument must be of type string. Received type number'
+      )
+    }
+    return allocUnsafe(arg)
+  }
+  return from(arg, encodingOrOffset, length)
+}
+
+// Fix subarray() in ES2016. See: https://github.com/feross/buffer/pull/97
+if (typeof Symbol !== 'undefined' && Symbol.species != null &&
+    Buffer[Symbol.species] === Buffer) {
+  Object.defineProperty(Buffer, Symbol.species, {
+    value: null,
+    configurable: true,
+    enumerable: false,
+    writable: false
+  })
+}
+
+Buffer.poolSize = 8192 // not used by this implementation
+
+function from (value, encodingOrOffset, length) {
+  if (typeof value === 'string') {
+    return fromString(value, encodingOrOffset)
+  }
+
+  if (ArrayBuffer.isView(value)) {
+    return fromArrayLike(value)
+  }
+
+  if (value == null) {
+    throw TypeError(
+      'The first argument must be one of type string, Buffer, ArrayBuffer, Array, ' +
+      'or Array-like Object. Received type ' + (typeof value)
+    )
+  }
+
+  if (isInstance(value, ArrayBuffer) ||
+      (value && isInstance(value.buffer, ArrayBuffer))) {
+    return fromArrayBuffer(value, encodingOrOffset, length)
+  }
+
+  if (typeof value === 'number') {
+    throw new TypeError(
+      'The "value" argument must not be of type number. Received type number'
+    )
+  }
+
+  var valueOf = value.valueOf && value.valueOf()
+  if (valueOf != null && valueOf !== value) {
+    return Buffer.from(valueOf, encodingOrOffset, length)
+  }
+
+  var b = fromObject(value)
+  if (b) return b
+
+  if (typeof Symbol !== 'undefined' && Symbol.toPrimitive != null &&
+      typeof value[Symbol.toPrimitive] === 'function') {
+    return Buffer.from(
+      value[Symbol.toPrimitive]('string'), encodingOrOffset, length
+    )
+  }
+
+  throw new TypeError(
+    'The first argument must be one of type string, Buffer, ArrayBuffer, Array, ' +
+    'or Array-like Object. Received type ' + (typeof value)
+  )
+}
+
+/**
+ * Functionally equivalent to Buffer(arg, encoding) but throws a TypeError
+ * if value is a number.
+ * Buffer.from(str[, encoding])
+ * Buffer.from(array)
+ * Buffer.from(buffer)
+ * Buffer.from(arrayBuffer[, byteOffset[, length]])
+ **/
+Buffer.from = function (value, encodingOrOffset, length) {
+  return from(value, encodingOrOffset, length)
+}
+
+// Note: Change prototype *after* Buffer.from is defined to workaround Chrome bug:
+// https://github.com/feross/buffer/pull/148
+Buffer.prototype.__proto__ = Uint8Array.prototype
+Buffer.__proto__ = Uint8Array
+
+function assertSize (size) {
+  if (typeof size !== 'number') {
+    throw new TypeError('"size" argument must be of type number')
+  } else if (size < 0) {
+    throw new RangeError('The value "' + size + '" is invalid for option "size"')
+  }
+}
+
+function alloc (size, fill, encoding) {
+  assertSize(size)
+  if (size <= 0) {
+    return createBuffer(size)
+  }
+  if (fill !== undefined) {
+    // Only pay attention to encoding if it's a string. This
+    // prevents accidentally sending in a number that would
+    // be interpretted as a start offset.
+    return typeof encoding === 'string'
+      ? createBuffer(size).fill(fill, encoding)
+      : createBuffer(size).fill(fill)
+  }
+  return createBuffer(size)
+}
+
+/**
+ * Creates a new filled Buffer instance.
+ * alloc(size[, fill[, encoding]])
+ **/
+Buffer.alloc = function (size, fill, encoding) {
+  return alloc(size, fill, encoding)
+}
+
+function allocUnsafe (size) {
+  assertSize(size)
+  return createBuffer(size < 0 ? 0 : checked(size) | 0)
+}
+
+/**
+ * Equivalent to Buffer(num), by default creates a non-zero-filled Buffer instance.
+ * */
+Buffer.allocUnsafe = function (size) {
+  return allocUnsafe(size)
+}
+/**
+ * Equivalent to SlowBuffer(num), by default creates a non-zero-filled Buffer instance.
+ */
+Buffer.allocUnsafeSlow = function (size) {
+  return allocUnsafe(size)
+}
+
+function fromString (string, encoding) {
+  if (typeof encoding !== 'string' || encoding === '') {
+    encoding = 'utf8'
+  }
+
+  if (!Buffer.isEncoding(encoding)) {
+    throw new TypeError('Unknown encoding: ' + encoding)
+  }
+
+  var length = byteLength(string, encoding) | 0
+  var buf = createBuffer(length)
+
+  var actual = buf.write(string, encoding)
+
+  if (actual !== length) {
+    // Writing a hex string, for example, that contains invalid characters will
+    // cause everything after the first invalid character to be ignored. (e.g.
+    // 'abxxcd' will be treated as 'ab')
+    buf = buf.slice(0, actual)
+  }
+
+  return buf
+}
+
+function fromArrayLike (array) {
+  var length = array.length < 0 ? 0 : checked(array.length) | 0
+  var buf = createBuffer(length)
+  for (var i = 0; i < length; i += 1) {
+    buf[i] = array[i] & 255
+  }
+  return buf
+}
+
+function fromArrayBuffer (array, byteOffset, length) {
+  if (byteOffset < 0 || array.byteLength < byteOffset) {
+    throw new RangeError('"offset" is outside of buffer bounds')
+  }
+
+  if (array.byteLength < byteOffset + (length || 0)) {
+    throw new RangeError('"length" is outside of buffer bounds')
+  }
+
+  var buf
+  if (byteOffset === undefined && length === undefined) {
+    buf = new Uint8Array(array)
+  } else if (length === undefined) {
+    buf = new Uint8Array(array, byteOffset)
+  } else {
+    buf = new Uint8Array(array, byteOffset, length)
+  }
+
+  // Return an augmented `Uint8Array` instance
+  buf.__proto__ = Buffer.prototype
+  return buf
+}
+
+function fromObject (obj) {
+  if (Buffer.isBuffer(obj)) {
+    var len = checked(obj.length) | 0
+    var buf = createBuffer(len)
+
+    if (buf.length === 0) {
+      return buf
+    }
+
+    obj.copy(buf, 0, 0, len)
+    return buf
+  }
+
+  if (obj.length !== undefined) {
+    if (typeof obj.length !== 'number' || numberIsNaN(obj.length)) {
+      return createBuffer(0)
+    }
+    return fromArrayLike(obj)
+  }
+
+  if (obj.type === 'Buffer' && Array.isArray(obj.data)) {
+    return fromArrayLike(obj.data)
+  }
+}
+
+function checked (length) {
+  // Note: cannot use `length < K_MAX_LENGTH` here because that fails when
+  // length is NaN (which is otherwise coerced to zero.)
+  if (length >= K_MAX_LENGTH) {
+    throw new RangeError('Attempt to allocate Buffer larger than maximum ' +
+                         'size: 0x' + K_MAX_LENGTH.toString(16) + ' bytes')
+  }
+  return length | 0
+}
+
+function SlowBuffer (length) {
+  if (+length != length) { // eslint-disable-line eqeqeq
+    length = 0
+  }
+  return Buffer.alloc(+length)
+}
+
+Buffer.isBuffer = function isBuffer (b) {
+  return b != null && b._isBuffer === true &&
+    b !== Buffer.prototype // so Buffer.isBuffer(Buffer.prototype) will be false
+}
+
+Buffer.compare = function compare (a, b) {
+  if (isInstance(a, Uint8Array)) a = Buffer.from(a, a.offset, a.byteLength)
+  if (isInstance(b, Uint8Array)) b = Buffer.from(b, b.offset, b.byteLength)
+  if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) {
+    throw new TypeError(
+      'The "buf1", "buf2" arguments must be one of type Buffer or Uint8Array'
+    )
+  }
+
+  if (a === b) return 0
+
+  var x = a.length
+  var y = b.length
+
+  for (var i = 0, len = Math.min(x, y); i < len; ++i) {
+    if (a[i] !== b[i]) {
+      x = a[i]
+      y = b[i]
+      break
+    }
+  }
+
+  if (x < y) return -1
+  if (y < x) return 1
+  return 0
+}
+
+Buffer.isEncoding = function isEncoding (encoding) {
+  switch (String(encoding).toLowerCase()) {
+    case 'hex':
+    case 'utf8':
+    case 'utf-8':
+    case 'ascii':
+    case 'latin1':
+    case 'binary':
+    case 'base64':
+    case 'ucs2':
+    case 'ucs-2':
+    case 'utf16le':
+    case 'utf-16le':
+      return true
+    default:
+      return false
+  }
+}
+
+Buffer.concat = function concat (list, length) {
+  if (!Array.isArray(list)) {
+    throw new TypeError('"list" argument must be an Array of Buffers')
+  }
+
+  if (list.length === 0) {
+    return Buffer.alloc(0)
+  }
+
+  var i
+  if (length === undefined) {
+    length = 0
+    for (i = 0; i < list.length; ++i) {
+      length += list[i].length
+    }
+  }
+
+  var buffer = Buffer.allocUnsafe(length)
+  var pos = 0
+  for (i = 0; i < list.length; ++i) {
+    var buf = list[i]
+    if (isInstance(buf, Uint8Array)) {
+      buf = Buffer.from(buf)
+    }
+    if (!Buffer.isBuffer(buf)) {
+      throw new TypeError('"list" argument must be an Array of Buffers')
+    }
+    buf.copy(buffer, pos)
+    pos += buf.length
+  }
+  return buffer
+}
+
+function byteLength (string, encoding) {
+  if (Buffer.isBuffer(string)) {
+    return string.length
+  }
+  if (ArrayBuffer.isView(string) || isInstance(string, ArrayBuffer)) {
+    return string.byteLength
+  }
+  if (typeof string !== 'string') {
+    throw new TypeError(
+      'The "string" argument must be one of type string, Buffer, or ArrayBuffer. ' +
+      'Received type ' + typeof string
+    )
+  }
+
+  var len = string.length
+  var mustMatch = (arguments.length > 2 && arguments[2] === true)
+  if (!mustMatch && len === 0) return 0
+
+  // Use a for loop to avoid recursion
+  var loweredCase = false
+  for (;;) {
+    switch (encoding) {
+      case 'ascii':
+      case 'latin1':
+      case 'binary':
+        return len
+      case 'utf8':
+      case 'utf-8':
+        return utf8ToBytes(string).length
+      case 'ucs2':
+      case 'ucs-2':
+      case 'utf16le':
+      case 'utf-16le':
+        return len * 2
+      case 'hex':
+        return len >>> 1
+      case 'base64':
+        return base64ToBytes(string).length
+      default:
+        if (loweredCase) {
+          return mustMatch ? -1 : utf8ToBytes(string).length // assume utf8
+        }
+        encoding = ('' + encoding).toLowerCase()
+        loweredCase = true
+    }
+  }
+}
+Buffer.byteLength = byteLength
+
+function slowToString (encoding, start, end) {
+  var loweredCase = false
+
+  // No need to verify that "this.length <= MAX_UINT32" since it's a read-only
+  // property of a typed array.
+
+  // This behaves neither like String nor Uint8Array in that we set start/end
+  // to their upper/lower bounds if the value passed is out of range.
+  // undefined is handled specially as per ECMA-262 6th Edition,
+  // Section 13.3.3.7 Runtime Semantics: KeyedBindingInitialization.
+  if (start === undefined || start < 0) {
+    start = 0
+  }
+  // Return early if start > this.length. Done here to prevent potential uint32
+  // coercion fail below.
+  if (start > this.length) {
+    return ''
+  }
+
+  if (end === undefined || end > this.length) {
+    end = this.length
+  }
+
+  if (end <= 0) {
+    return ''
+  }
+
+  // Force coersion to uint32. This will also coerce falsey/NaN values to 0.
+  end >>>= 0
+  start >>>= 0
+
+  if (end <= start) {
+    return ''
+  }
+
+  if (!encoding) encoding = 'utf8'
+
+  while (true) {
+    switch (encoding) {
+      case 'hex':
+        return hexSlice(this, start, end)
+
+      case 'utf8':
+      case 'utf-8':
+        return utf8Slice(this, start, end)
+
+      case 'ascii':
+        return asciiSlice(this, start, end)
+
+      case 'latin1':
+      case 'binary':
+        return latin1Slice(this, start, end)
+
+      case 'base64':
+        return base64Slice(this, start, end)
+
+      case 'ucs2':
+      case 'ucs-2':
+      case 'utf16le':
+      case 'utf-16le':
+        return utf16leSlice(this, start, end)
+
+      default:
+        if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
+        encoding = (encoding + '').toLowerCase()
+        loweredCase = true
+    }
+  }
+}
+
+// This property is used by `Buffer.isBuffer` (and the `is-buffer` npm package)
+// to detect a Buffer instance. It's not possible to use `instanceof Buffer`
+// reliably in a browserify context because there could be multiple different
+// copies of the 'buffer' package in use. This method works even for Buffer
+// instances that were created from another copy of the `buffer` package.
+// See: https://github.com/feross/buffer/issues/154
+Buffer.prototype._isBuffer = true
+
+function swap (b, n, m) {
+  var i = b[n]
+  b[n] = b[m]
+  b[m] = i
+}
+
+Buffer.prototype.swap16 = function swap16 () {
+  var len = this.length
+  if (len % 2 !== 0) {
+    throw new RangeError('Buffer size must be a multiple of 16-bits')
+  }
+  for (var i = 0; i < len; i += 2) {
+    swap(this, i, i + 1)
+  }
+  return this
+}
+
+Buffer.prototype.swap32 = function swap32 () {
+  var len = this.length
+  if (len % 4 !== 0) {
+    throw new RangeError('Buffer size must be a multiple of 32-bits')
+  }
+  for (var i = 0; i < len; i += 4) {
+    swap(this, i, i + 3)
+    swap(this, i + 1, i + 2)
+  }
+  return this
+}
+
+Buffer.prototype.swap64 = function swap64 () {
+  var len = this.length
+  if (len % 8 !== 0) {
+    throw new RangeError('Buffer size must be a multiple of 64-bits')
+  }
+  for (var i = 0; i < len; i += 8) {
+    swap(this, i, i + 7)
+    swap(this, i + 1, i + 6)
+    swap(this, i + 2, i + 5)
+    swap(this, i + 3, i + 4)
+  }
+  return this
+}
+
+Buffer.prototype.toString = function toString () {
+  var length = this.length
+  if (length === 0) return ''
+  if (arguments.length === 0) return utf8Slice(this, 0, length)
+  return slowToString.apply(this, arguments)
+}
+
+Buffer.prototype.toLocaleString = Buffer.prototype.toString
+
+Buffer.prototype.equals = function equals (b) {
+  if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer')
+  if (this === b) return true
+  return Buffer.compare(this, b) === 0
+}
+
+Buffer.prototype.inspect = function inspect () {
+  var str = ''
+  var max = exports.INSPECT_MAX_BYTES
+  str = this.toString('hex', 0, max).replace(/(.{2})/g, '$1 ').trim()
+  if (this.length > max) str += ' ... '
+  return '<Buffer ' + str + '>'
+}
+
+Buffer.prototype.compare = function compare (target, start, end, thisStart, thisEnd) {
+  if (isInstance(target, Uint8Array)) {
+    target = Buffer.from(target, target.offset, target.byteLength)
+  }
+  if (!Buffer.isBuffer(target)) {
+    throw new TypeError(
+      'The "target" argument must be one of type Buffer or Uint8Array. ' +
+      'Received type ' + (typeof target)
+    )
+  }
+
+  if (start === undefined) {
+    start = 0
+  }
+  if (end === undefined) {
+    end = target ? target.length : 0
+  }
+  if (thisStart === undefined) {
+    thisStart = 0
+  }
+  if (thisEnd === undefined) {
+    thisEnd = this.length
+  }
+
+  if (start < 0 || end > target.length || thisStart < 0 || thisEnd > this.length) {
+    throw new RangeError('out of range index')
+  }
+
+  if (thisStart >= thisEnd && start >= end) {
+    return 0
+  }
+  if (thisStart >= thisEnd) {
+    return -1
+  }
+  if (start >= end) {
+    return 1
+  }
+
+  start >>>= 0
+  end >>>= 0
+  thisStart >>>= 0
+  thisEnd >>>= 0
+
+  if (this === target) return 0
+
+  var x = thisEnd - thisStart
+  var y = end - start
+  var len = Math.min(x, y)
+
+  var thisCopy = this.slice(thisStart, thisEnd)
+  var targetCopy = target.slice(start, end)
+
+  for (var i = 0; i < len; ++i) {
+    if (thisCopy[i] !== targetCopy[i]) {
+      x = thisCopy[i]
+      y = targetCopy[i]
+      break
+    }
+  }
+
+  if (x < y) return -1
+  if (y < x) return 1
+  return 0
+}
+
+// Finds either the first index of `val` in `buffer` at offset >= `byteOffset`,
+// OR the last index of `val` in `buffer` at offset <= `byteOffset`.
+//
+// Arguments:
+// - buffer - a Buffer to search
+// - val - a string, Buffer, or number
+// - byteOffset - an index into `buffer`; will be clamped to an int32
+// - encoding - an optional encoding, relevant is val is a string
+// - dir - true for indexOf, false for lastIndexOf
+function bidirectionalIndexOf (buffer, val, byteOffset, encoding, dir) {
+  // Empty buffer means no match
+  if (buffer.length === 0) return -1
+
+  // Normalize byteOffset
+  if (typeof byteOffset === 'string') {
+    encoding = byteOffset
+    byteOffset = 0
+  } else if (byteOffset > 0x7fffffff) {
+    byteOffset = 0x7fffffff
+  } else if (byteOffset < -0x80000000) {
+    byteOffset = -0x80000000
+  }
+  byteOffset = +byteOffset // Coerce to Number.
+  if (numberIsNaN(byteOffset)) {
+    // byteOffset: it it's undefined, null, NaN, "foo", etc, search whole buffer
+    byteOffset = dir ? 0 : (buffer.length - 1)
+  }
+
+  // Normalize byteOffset: negative offsets start from the end of the buffer
+  if (byteOffset < 0) byteOffset = buffer.length + byteOffset
+  if (byteOffset >= buffer.length) {
+    if (dir) return -1
+    else byteOffset = buffer.length - 1
+  } else if (byteOffset < 0) {
+    if (dir) byteOffset = 0
+    else return -1
+  }
+
+  // Normalize val
+  if (typeof val === 'string') {
+    val = Buffer.from(val, encoding)
+  }
+
+  // Finally, search either indexOf (if dir is true) or lastIndexOf
+  if (Buffer.isBuffer(val)) {
+    // Special case: looking for empty string/buffer always fails
+    if (val.length === 0) {
+      return -1
+    }
+    return arrayIndexOf(buffer, val, byteOffset, encoding, dir)
+  } else if (typeof val === 'number') {
+    val = val & 0xFF // Search for a byte value [0-255]
+    if (typeof Uint8Array.prototype.indexOf === 'function') {
+      if (dir) {
+        return Uint8Array.prototype.indexOf.call(buffer, val, byteOffset)
+      } else {
+        return Uint8Array.prototype.lastIndexOf.call(buffer, val, byteOffset)
+      }
+    }
+    return arrayIndexOf(buffer, [ val ], byteOffset, encoding, dir)
+  }
+
+  throw new TypeError('val must be string, number or Buffer')
+}
+
+function arrayIndexOf (arr, val, byteOffset, encoding, dir) {
+  var indexSize = 1
+  var arrLength = arr.length
+  var valLength = val.length
+
+  if (encoding !== undefined) {
+    encoding = String(encoding).toLowerCase()
+    if (encoding === 'ucs2' || encoding === 'ucs-2' ||
+        encoding === 'utf16le' || encoding === 'utf-16le') {
+      if (arr.length < 2 || val.length < 2) {
+        return -1
+      }
+      indexSize = 2
+      arrLength /= 2
+      valLength /= 2
+      byteOffset /= 2
+    }
+  }
+
+  function read (buf, i) {
+    if (indexSize === 1) {
+      return buf[i]
+    } else {
+      return buf.readUInt16BE(i * indexSize)
+    }
+  }
+
+  var i
+  if (dir) {
+    var foundIndex = -1
+    for (i = byteOffset; i < arrLength; i++) {
+      if (read(arr, i) === read(val, foundIndex === -1 ? 0 : i - foundIndex)) {
+        if (foundIndex === -1) foundIndex = i
+        if (i - foundIndex + 1 === valLength) return foundIndex * indexSize
+      } else {
+        if (foundIndex !== -1) i -= i - foundIndex
+        foundIndex = -1
+      }
+    }
+  } else {
+    if (byteOffset + valLength > arrLength) byteOffset = arrLength - valLength
+    for (i = byteOffset; i >= 0; i--) {
+      var found = true
+      for (var j = 0; j < valLength; j++) {
+        if (read(arr, i + j) !== read(val, j)) {
+          found = false
+          break
+        }
+      }
+      if (found) return i
+    }
+  }
+
+  return -1
+}
+
+Buffer.prototype.includes = function includes (val, byteOffset, encoding) {
+  return this.indexOf(val, byteOffset, encoding) !== -1
+}
+
+Buffer.prototype.indexOf = function indexOf (val, byteOffset, encoding) {
+  return bidirectionalIndexOf(this, val, byteOffset, encoding, true)
+}
+
+Buffer.prototype.lastIndexOf = function lastIndexOf (val, byteOffset, encoding) {
+  return bidirectionalIndexOf(this, val, byteOffset, encoding, false)
+}
+
+function hexWrite (buf, string, offset, length) {
+  offset = Number(offset) || 0
+  var remaining = buf.length - offset
+  if (!length) {
+    length = remaining
+  } else {
+    length = Number(length)
+    if (length > remaining) {
+      length = remaining
+    }
+  }
+
+  var strLen = string.length
+
+  if (length > strLen / 2) {
+    length = strLen / 2
+  }
+  for (var i = 0; i < length; ++i) {
+    var parsed = parseInt(string.substr(i * 2, 2), 16)
+    if (numberIsNaN(parsed)) return i
+    buf[offset + i] = parsed
+  }
+  return i
+}
+
+function utf8Write (buf, string, offset, length) {
+  return blitBuffer(utf8ToBytes(string, buf.length - offset), buf, offset, length)
+}
+
+function asciiWrite (buf, string, offset, length) {
+  return blitBuffer(asciiToBytes(string), buf, offset, length)
+}
+
+function latin1Write (buf, string, offset, length) {
+  return asciiWrite(buf, string, offset, length)
+}
+
+function base64Write (buf, string, offset, length) {
+  return blitBuffer(base64ToBytes(string), buf, offset, length)
+}
+
+function ucs2Write (buf, string, offset, length) {
+  return blitBuffer(utf16leToBytes(string, buf.length - offset), buf, offset, length)
+}
+
+Buffer.prototype.write = function write (string, offset, length, encoding) {
+  // Buffer#write(string)
+  if (offset === undefined) {
+    encoding = 'utf8'
+    length = this.length
+    offset = 0
+  // Buffer#write(string, encoding)
+  } else if (length === undefined && typeof offset === 'string') {
+    encoding = offset
+    length = this.length
+    offset = 0
+  // Buffer#write(string, offset[, length][, encoding])
+  } else if (isFinite(offset)) {
+    offset = offset >>> 0
+    if (isFinite(length)) {
+      length = length >>> 0
+      if (encoding === undefined) encoding = 'utf8'
+    } else {
+      encoding = length
+      length = undefined
+    }
+  } else {
+    throw new Error(
+      'Buffer.write(string, encoding, offset[, length]) is no longer supported'
+    )
+  }
+
+  var remaining = this.length - offset
+  if (length === undefined || length > remaining) length = remaining
+
+  if ((string.length > 0 && (length < 0 || offset < 0)) || offset > this.length) {
+    throw new RangeError('Attempt to write outside buffer bounds')
+  }
+
+  if (!encoding) encoding = 'utf8'
+
+  var loweredCase = false
+  for (;;) {
+    switch (encoding) {
+      case 'hex':
+        return hexWrite(this, string, offset, length)
+
+      case 'utf8':
+      case 'utf-8':
+        return utf8Write(this, string, offset, length)
+
+      case 'ascii':
+        return asciiWrite(this, string, offset, length)
+
+      case 'latin1':
+      case 'binary':
+        return latin1Write(this, string, offset, length)
+
+      case 'base64':
+        // Warning: maxLength not taken into account in base64Write
+        return base64Write(this, string, offset, length)
+
+      case 'ucs2':
+      case 'ucs-2':
+      case 'utf16le':
+      case 'utf-16le':
+        return ucs2Write(this, string, offset, length)
+
+      default:
+        if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding)
+        encoding = ('' + encoding).toLowerCase()
+        loweredCase = true
+    }
+  }
+}
+
+Buffer.prototype.toJSON = function toJSON () {
+  return {
+    type: 'Buffer',
+    data: Array.prototype.slice.call(this._arr || this, 0)
+  }
+}
+
+function base64Slice (buf, start, end) {
+  if (start === 0 && end === buf.length) {
+    return base64.fromByteArray(buf)
+  } else {
+    return base64.fromByteArray(buf.slice(start, end))
+  }
+}
+
+function utf8Slice (buf, start, end) {
+  end = Math.min(buf.length, end)
+  var res = []
+
+  var i = start
+  while (i < end) {
+    var firstByte = buf[i]
+    var codePoint = null
+    var bytesPerSequence = (firstByte > 0xEF) ? 4
+      : (firstByte > 0xDF) ? 3
+        : (firstByte > 0xBF) ? 2
+          : 1
+
+    if (i + bytesPerSequence <= end) {
+      var secondByte, thirdByte, fourthByte, tempCodePoint
+
+      switch (bytesPerSequence) {
+        case 1:
+          if (firstByte < 0x80) {
+            codePoint = firstByte
+          }
+          break
+        case 2:
+          secondByte = buf[i + 1]
+          if ((secondByte & 0xC0) === 0x80) {
+            tempCodePoint = (firstByte & 0x1F) << 0x6 | (secondByte & 0x3F)
+            if (tempCodePoint > 0x7F) {
+              codePoint = tempCodePoint
+            }
+          }
+          break
+        case 3:
+          secondByte = buf[i + 1]
+          thirdByte = buf[i + 2]
+          if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80) {
+            tempCodePoint = (firstByte & 0xF) << 0xC | (secondByte & 0x3F) << 0x6 | (thirdByte & 0x3F)
+            if (tempCodePoint > 0x7FF && (tempCodePoint < 0xD800 || tempCodePoint > 0xDFFF)) {
+              codePoint = tempCodePoint
+            }
+          }
+          break
+        case 4:
+          secondByte = buf[i + 1]
+          thirdByte = buf[i + 2]
+          fourthByte = buf[i + 3]
+          if ((secondByte & 0xC0) === 0x80 && (thirdByte & 0xC0) === 0x80 && (fourthByte & 0xC0) === 0x80) {
+            tempCodePoint = (firstByte & 0xF) << 0x12 | (secondByte & 0x3F) << 0xC | (thirdByte & 0x3F) << 0x6 | (fourthByte & 0x3F)
+            if (tempCodePoint > 0xFFFF && tempCodePoint < 0x110000) {
+              codePoint = tempCodePoint
+            }
+          }
+      }
+    }
+
+    if (codePoint === null) {
+      // we did not generate a valid codePoint so insert a
+      // replacement char (U+FFFD) and advance only 1 byte
+      codePoint = 0xFFFD
+      bytesPerSequence = 1
+    } else if (codePoint > 0xFFFF) {
+      // encode to utf16 (surrogate pair dance)
+      codePoint -= 0x10000
+      res.push(codePoint >>> 10 & 0x3FF | 0xD800)
+      codePoint = 0xDC00 | codePoint & 0x3FF
+    }
+
+    res.push(codePoint)
+    i += bytesPerSequence
+  }
+
+  return decodeCodePointsArray(res)
+}
+
+// Based on http://stackoverflow.com/a/22747272/680742, the browser with
+// the lowest limit is Chrome, with 0x10000 args.
+// We go 1 magnitude less, for safety
+var MAX_ARGUMENTS_LENGTH = 0x1000
+
+function decodeCodePointsArray (codePoints) {
+  var len = codePoints.length
+  if (len <= MAX_ARGUMENTS_LENGTH) {
+    return String.fromCharCode.apply(String, codePoints) // avoid extra slice()
+  }
+
+  // Decode in chunks to avoid "call stack size exceeded".
+  var res = ''
+  var i = 0
+  while (i < len) {
+    res += String.fromCharCode.apply(
+      String,
+      codePoints.slice(i, i += MAX_ARGUMENTS_LENGTH)
+    )
+  }
+  return res
+}
+
+function asciiSlice (buf, start, end) {
+  var ret = ''
+  end = Math.min(buf.length, end)
+
+  for (var i = start; i < end; ++i) {
+    ret += String.fromCharCode(buf[i] & 0x7F)
+  }
+  return ret
+}
+
+function latin1Slice (buf, start, end) {
+  var ret = ''
+  end = Math.min(buf.length, end)
+
+  for (var i = start; i < end; ++i) {
+    ret += String.fromCharCode(buf[i])
+  }
+  return ret
+}
+
+function hexSlice (buf, start, end) {
+  var len = buf.length
+
+  if (!start || start < 0) start = 0
+  if (!end || end < 0 || end > len) end = len
+
+  var out = ''
+  for (var i = start; i < end; ++i) {
+    out += toHex(buf[i])
+  }
+  return out
+}
+
+function utf16leSlice (buf, start, end) {
+  var bytes = buf.slice(start, end)
+  var res = ''
+  for (var i = 0; i < bytes.length; i += 2) {
+    res += String.fromCharCode(bytes[i] + (bytes[i + 1] * 256))
+  }
+  return res
+}
+
+Buffer.prototype.slice = function slice (start, end) {
+  var len = this.length
+  start = ~~start
+  end = end === undefined ? len : ~~end
+
+  if (start < 0) {
+    start += len
+    if (start < 0) start = 0
+  } else if (start > len) {
+    start = len
+  }
+
+  if (end < 0) {
+    end += len
+    if (end < 0) end = 0
+  } else if (end > len) {
+    end = len
+  }
+
+  if (end < start) end = start
+
+  var newBuf = this.subarray(start, end)
+  // Return an augmented `Uint8Array` instance
+  newBuf.__proto__ = Buffer.prototype
+  return newBuf
+}
+
+/*
+ * Need to make sure that buffer isn't trying to write out of bounds.
+ */
+function checkOffset (offset, ext, length) {
+  if ((offset % 1) !== 0 || offset < 0) throw new RangeError('offset is not uint')
+  if (offset + ext > length) throw new RangeError('Trying to access beyond buffer length')
+}
+
+Buffer.prototype.readUIntLE = function readUIntLE (offset, byteLength, noAssert) {
+  offset = offset >>> 0
+  byteLength = byteLength >>> 0
+  if (!noAssert) checkOffset(offset, byteLength, this.length)
+
+  var val = this[offset]
+  var mul = 1
+  var i = 0
+  while (++i < byteLength && (mul *= 0x100)) {
+    val += this[offset + i] * mul
+  }
+
+  return val
+}
+
+Buffer.prototype.readUIntBE = function readUIntBE (offset, byteLength, noAssert) {
+  offset = offset >>> 0
+  byteLength = byteLength >>> 0
+  if (!noAssert) {
+    checkOffset(offset, byteLength, this.length)
+  }
+
+  var val = this[offset + --byteLength]
+  var mul = 1
+  while (byteLength > 0 && (mul *= 0x100)) {
+    val += this[offset + --byteLength] * mul
+  }
+
+  return val
+}
+
+Buffer.prototype.readUInt8 = function readUInt8 (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 1, this.length)
+  return this[offset]
+}
+
+Buffer.prototype.readUInt16LE = function readUInt16LE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 2, this.length)
+  return this[offset] | (this[offset + 1] << 8)
+}
+
+Buffer.prototype.readUInt16BE = function readUInt16BE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 2, this.length)
+  return (this[offset] << 8) | this[offset + 1]
+}
+
+Buffer.prototype.readUInt32LE = function readUInt32LE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 4, this.length)
+
+  return ((this[offset]) |
+      (this[offset + 1] << 8) |
+      (this[offset + 2] << 16)) +
+      (this[offset + 3] * 0x1000000)
+}
+
+Buffer.prototype.readUInt32BE = function readUInt32BE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 4, this.length)
+
+  return (this[offset] * 0x1000000) +
+    ((this[offset + 1] << 16) |
+    (this[offset + 2] << 8) |
+    this[offset + 3])
+}
+
+Buffer.prototype.readIntLE = function readIntLE (offset, byteLength, noAssert) {
+  offset = offset >>> 0
+  byteLength = byteLength >>> 0
+  if (!noAssert) checkOffset(offset, byteLength, this.length)
+
+  var val = this[offset]
+  var mul = 1
+  var i = 0
+  while (++i < byteLength && (mul *= 0x100)) {
+    val += this[offset + i] * mul
+  }
+  mul *= 0x80
+
+  if (val >= mul) val -= Math.pow(2, 8 * byteLength)
+
+  return val
+}
+
+Buffer.prototype.readIntBE = function readIntBE (offset, byteLength, noAssert) {
+  offset = offset >>> 0
+  byteLength = byteLength >>> 0
+  if (!noAssert) checkOffset(offset, byteLength, this.length)
+
+  var i = byteLength
+  var mul = 1
+  var val = this[offset + --i]
+  while (i > 0 && (mul *= 0x100)) {
+    val += this[offset + --i] * mul
+  }
+  mul *= 0x80
+
+  if (val >= mul) val -= Math.pow(2, 8 * byteLength)
+
+  return val
+}
+
+Buffer.prototype.readInt8 = function readInt8 (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 1, this.length)
+  if (!(this[offset] & 0x80)) return (this[offset])
+  return ((0xff - this[offset] + 1) * -1)
+}
+
+Buffer.prototype.readInt16LE = function readInt16LE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 2, this.length)
+  var val = this[offset] | (this[offset + 1] << 8)
+  return (val & 0x8000) ? val | 0xFFFF0000 : val
+}
+
+Buffer.prototype.readInt16BE = function readInt16BE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 2, this.length)
+  var val = this[offset + 1] | (this[offset] << 8)
+  return (val & 0x8000) ? val | 0xFFFF0000 : val
+}
+
+Buffer.prototype.readInt32LE = function readInt32LE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 4, this.length)
+
+  return (this[offset]) |
+    (this[offset + 1] << 8) |
+    (this[offset + 2] << 16) |
+    (this[offset + 3] << 24)
+}
+
+Buffer.prototype.readInt32BE = function readInt32BE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 4, this.length)
+
+  return (this[offset] << 24) |
+    (this[offset + 1] << 16) |
+    (this[offset + 2] << 8) |
+    (this[offset + 3])
+}
+
+Buffer.prototype.readFloatLE = function readFloatLE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 4, this.length)
+  return ieee754.read(this, offset, true, 23, 4)
+}
+
+Buffer.prototype.readFloatBE = function readFloatBE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 4, this.length)
+  return ieee754.read(this, offset, false, 23, 4)
+}
+
+Buffer.prototype.readDoubleLE = function readDoubleLE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 8, this.length)
+  return ieee754.read(this, offset, true, 52, 8)
+}
+
+Buffer.prototype.readDoubleBE = function readDoubleBE (offset, noAssert) {
+  offset = offset >>> 0
+  if (!noAssert) checkOffset(offset, 8, this.length)
+  return ieee754.read(this, offset, false, 52, 8)
+}
+
+function checkInt (buf, value, offset, ext, max, min) {
+  if (!Buffer.isBuffer(buf)) throw new TypeError('"buffer" argument must be a Buffer instance')
+  if (value > max || value < min) throw new RangeError('"value" argument is out of bounds')
+  if (offset + ext > buf.length) throw new RangeError('Index out of range')
+}
+
+Buffer.prototype.writeUIntLE = function writeUIntLE (value, offset, byteLength, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  byteLength = byteLength >>> 0
+  if (!noAssert) {
+    var maxBytes = Math.pow(2, 8 * byteLength) - 1
+    checkInt(this, value, offset, byteLength, maxBytes, 0)
+  }
+
+  var mul = 1
+  var i = 0
+  this[offset] = value & 0xFF
+  while (++i < byteLength && (mul *= 0x100)) {
+    this[offset + i] = (value / mul) & 0xFF
+  }
+
+  return offset + byteLength
+}
+
+Buffer.prototype.writeUIntBE = function writeUIntBE (value, offset, byteLength, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  byteLength = byteLength >>> 0
+  if (!noAssert) {
+    var maxBytes = Math.pow(2, 8 * byteLength) - 1
+    checkInt(this, value, offset, byteLength, maxBytes, 0)
+  }
+
+  var i = byteLength - 1
+  var mul = 1
+  this[offset + i] = value & 0xFF
+  while (--i >= 0 && (mul *= 0x100)) {
+    this[offset + i] = (value / mul) & 0xFF
+  }
+
+  return offset + byteLength
+}
+
+Buffer.prototype.writeUInt8 = function writeUInt8 (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 1, 0xff, 0)
+  this[offset] = (value & 0xff)
+  return offset + 1
+}
+
+Buffer.prototype.writeUInt16LE = function writeUInt16LE (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
+  this[offset] = (value & 0xff)
+  this[offset + 1] = (value >>> 8)
+  return offset + 2
+}
+
+Buffer.prototype.writeUInt16BE = function writeUInt16BE (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0)
+  this[offset] = (value >>> 8)
+  this[offset + 1] = (value & 0xff)
+  return offset + 2
+}
+
+Buffer.prototype.writeUInt32LE = function writeUInt32LE (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
+  this[offset + 3] = (value >>> 24)
+  this[offset + 2] = (value >>> 16)
+  this[offset + 1] = (value >>> 8)
+  this[offset] = (value & 0xff)
+  return offset + 4
+}
+
+Buffer.prototype.writeUInt32BE = function writeUInt32BE (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0)
+  this[offset] = (value >>> 24)
+  this[offset + 1] = (value >>> 16)
+  this[offset + 2] = (value >>> 8)
+  this[offset + 3] = (value & 0xff)
+  return offset + 4
+}
+
+Buffer.prototype.writeIntLE = function writeIntLE (value, offset, byteLength, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) {
+    var limit = Math.pow(2, (8 * byteLength) - 1)
+
+    checkInt(this, value, offset, byteLength, limit - 1, -limit)
+  }
+
+  var i = 0
+  var mul = 1
+  var sub = 0
+  this[offset] = value & 0xFF
+  while (++i < byteLength && (mul *= 0x100)) {
+    if (value < 0 && sub === 0 && this[offset + i - 1] !== 0) {
+      sub = 1
+    }
+    this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
+  }
+
+  return offset + byteLength
+}
+
+Buffer.prototype.writeIntBE = function writeIntBE (value, offset, byteLength, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) {
+    var limit = Math.pow(2, (8 * byteLength) - 1)
+
+    checkInt(this, value, offset, byteLength, limit - 1, -limit)
+  }
+
+  var i = byteLength - 1
+  var mul = 1
+  var sub = 0
+  this[offset + i] = value & 0xFF
+  while (--i >= 0 && (mul *= 0x100)) {
+    if (value < 0 && sub === 0 && this[offset + i + 1] !== 0) {
+      sub = 1
+    }
+    this[offset + i] = ((value / mul) >> 0) - sub & 0xFF
+  }
+
+  return offset + byteLength
+}
+
+Buffer.prototype.writeInt8 = function writeInt8 (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 1, 0x7f, -0x80)
+  if (value < 0) value = 0xff + value + 1
+  this[offset] = (value & 0xff)
+  return offset + 1
+}
+
+Buffer.prototype.writeInt16LE = function writeInt16LE (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
+  this[offset] = (value & 0xff)
+  this[offset + 1] = (value >>> 8)
+  return offset + 2
+}
+
+Buffer.prototype.writeInt16BE = function writeInt16BE (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000)
+  this[offset] = (value >>> 8)
+  this[offset + 1] = (value & 0xff)
+  return offset + 2
+}
+
+Buffer.prototype.writeInt32LE = function writeInt32LE (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
+  this[offset] = (value & 0xff)
+  this[offset + 1] = (value >>> 8)
+  this[offset + 2] = (value >>> 16)
+  this[offset + 3] = (value >>> 24)
+  return offset + 4
+}
+
+Buffer.prototype.writeInt32BE = function writeInt32BE (value, offset, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000)
+  if (value < 0) value = 0xffffffff + value + 1
+  this[offset] = (value >>> 24)
+  this[offset + 1] = (value >>> 16)
+  this[offset + 2] = (value >>> 8)
+  this[offset + 3] = (value & 0xff)
+  return offset + 4
+}
+
+function checkIEEE754 (buf, value, offset, ext, max, min) {
+  if (offset + ext > buf.length) throw new RangeError('Index out of range')
+  if (offset < 0) throw new RangeError('Index out of range')
+}
+
+function writeFloat (buf, value, offset, littleEndian, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) {
+    checkIEEE754(buf, value, offset, 4, 3.4028234663852886e+38, -3.4028234663852886e+38)
+  }
+  ieee754.write(buf, value, offset, littleEndian, 23, 4)
+  return offset + 4
+}
+
+Buffer.prototype.writeFloatLE = function writeFloatLE (value, offset, noAssert) {
+  return writeFloat(this, value, offset, true, noAssert)
+}
+
+Buffer.prototype.writeFloatBE = function writeFloatBE (value, offset, noAssert) {
+  return writeFloat(this, value, offset, false, noAssert)
+}
+
+function writeDouble (buf, value, offset, littleEndian, noAssert) {
+  value = +value
+  offset = offset >>> 0
+  if (!noAssert) {
+    checkIEEE754(buf, value, offset, 8, 1.7976931348623157E+308, -1.7976931348623157E+308)
+  }
+  ieee754.write(buf, value, offset, littleEndian, 52, 8)
+  return offset + 8
+}
+
+Buffer.prototype.writeDoubleLE = function writeDoubleLE (value, offset, noAssert) {
+  return writeDouble(this, value, offset, true, noAssert)
+}
+
+Buffer.prototype.writeDoubleBE = function writeDoubleBE (value, offset, noAssert) {
+  return writeDouble(this, value, offset, false, noAssert)
+}
+
+// copy(targetBuffer, targetStart=0, sourceStart=0, sourceEnd=buffer.length)
+Buffer.prototype.copy = function copy (target, targetStart, start, end) {
+  if (!Buffer.isBuffer(target)) throw new TypeError('argument should be a Buffer')
+  if (!start) start = 0
+  if (!end && end !== 0) end = this.length
+  if (targetStart >= target.length) targetStart = target.length
+  if (!targetStart) targetStart = 0
+  if (end > 0 && end < start) end = start
+
+  // Copy 0 bytes; we're done
+  if (end === start) return 0
+  if (target.length === 0 || this.length === 0) return 0
+
+  // Fatal error conditions
+  if (targetStart < 0) {
+    throw new RangeError('targetStart out of bounds')
+  }
+  if (start < 0 || start >= this.length) throw new RangeError('Index out of range')
+  if (end < 0) throw new RangeError('sourceEnd out of bounds')
+
+  // Are we oob?
+  if (end > this.length) end = this.length
+  if (target.length - targetStart < end - start) {
+    end = target.length - targetStart + start
+  }
+
+  var len = end - start
+
+  if (this === target && typeof Uint8Array.prototype.copyWithin === 'function') {
+    // Use built-in when available, missing from IE11
+    this.copyWithin(targetStart, start, end)
+  } else if (this === target && start < targetStart && targetStart < end) {
+    // descending copy from end
+    for (var i = len - 1; i >= 0; --i) {
+      target[i + targetStart] = this[i + start]
+    }
+  } else {
+    Uint8Array.prototype.set.call(
+      target,
+      this.subarray(start, end),
+      targetStart
+    )
+  }
+
+  return len
+}
+
+// Usage:
+//    buffer.fill(number[, offset[, end]])
+//    buffer.fill(buffer[, offset[, end]])
+//    buffer.fill(string[, offset[, end]][, encoding])
+Buffer.prototype.fill = function fill (val, start, end, encoding) {
+  // Handle string cases:
+  if (typeof val === 'string') {
+    if (typeof start === 'string') {
+      encoding = start
+      start = 0
+      end = this.length
+    } else if (typeof end === 'string') {
+      encoding = end
+      end = this.length
+    }
+    if (encoding !== undefined && typeof encoding !== 'string') {
+      throw new TypeError('encoding must be a string')
+    }
+    if (typeof encoding === 'string' && !Buffer.isEncoding(encoding)) {
+      throw new TypeError('Unknown encoding: ' + encoding)
+    }
+    if (val.length === 1) {
+      var code = val.charCodeAt(0)
+      if ((encoding === 'utf8' && code < 128) ||
+          encoding === 'latin1') {
+        // Fast path: If `val` fits into a single byte, use that numeric value.
+        val = code
+      }
+    }
+  } else if (typeof val === 'number') {
+    val = val & 255
+  }
+
+  // Invalid ranges are not set to a default, so can range check early.
+  if (start < 0 || this.length < start || this.length < end) {
+    throw new RangeError('Out of range index')
+  }
+
+  if (end <= start) {
+    return this
+  }
+
+  start = start >>> 0
+  end = end === undefined ? this.length : end >>> 0
+
+  if (!val) val = 0
+
+  var i
+  if (typeof val === 'number') {
+    for (i = start; i < end; ++i) {
+      this[i] = val
+    }
+  } else {
+    var bytes = Buffer.isBuffer(val)
+      ? val
+      : Buffer.from(val, encoding)
+    var len = bytes.length
+    if (len === 0) {
+      throw new TypeError('The value "' + val +
+        '" is invalid for argument "value"')
+    }
+    for (i = 0; i < end - start; ++i) {
+      this[i + start] = bytes[i % len]
+    }
+  }
+
+  return this
+}
+
+// HELPER FUNCTIONS
+// ================
+
+var INVALID_BASE64_RE = /[^+/0-9A-Za-z-_]/g
+
+function base64clean (str) {
+  // Node takes equal signs as end of the Base64 encoding
+  str = str.split('=')[0]
+  // Node strips out invalid characters like \n and \t from the string, base64-js does not
+  str = str.trim().replace(INVALID_BASE64_RE, '')
+  // Node converts strings with length < 2 to ''
+  if (str.length < 2) return ''
+  // Node allows for non-padded base64 strings (missing trailing ===), base64-js does not
+  while (str.length % 4 !== 0) {
+    str = str + '='
+  }
+  return str
+}
+
+function toHex (n) {
+  if (n < 16) return '0' + n.toString(16)
+  return n.toString(16)
+}
+
+function utf8ToBytes (string, units) {
+  units = units || Infinity
+  var codePoint
+  var length = string.length
+  var leadSurrogate = null
+  var bytes = []
+
+  for (var i = 0; i < length; ++i) {
+    codePoint = string.charCodeAt(i)
+
+    // is surrogate component
+    if (codePoint > 0xD7FF && codePoint < 0xE000) {
+      // last char was a lead
+      if (!leadSurrogate) {
+        // no lead yet
+        if (codePoint > 0xDBFF) {
+          // unexpected trail
+          if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+          continue
+        } else if (i + 1 === length) {
+          // unpaired lead
+          if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+          continue
+        }
+
+        // valid lead
+        leadSurrogate = codePoint
+
+        continue
+      }
+
+      // 2 leads in a row
+      if (codePoint < 0xDC00) {
+        if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+        leadSurrogate = codePoint
+        continue
+      }
+
+      // valid surrogate pair
+      codePoint = (leadSurrogate - 0xD800 << 10 | codePoint - 0xDC00) + 0x10000
+    } else if (leadSurrogate) {
+      // valid bmp char, but last char was a lead
+      if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD)
+    }
+
+    leadSurrogate = null
+
+    // encode utf8
+    if (codePoint < 0x80) {
+      if ((units -= 1) < 0) break
+      bytes.push(codePoint)
+    } else if (codePoint < 0x800) {
+      if ((units -= 2) < 0) break
+      bytes.push(
+        codePoint >> 0x6 | 0xC0,
+        codePoint & 0x3F | 0x80
+      )
+    } else if (codePoint < 0x10000) {
+      if ((units -= 3) < 0) break
+      bytes.push(
+        codePoint >> 0xC | 0xE0,
+        codePoint >> 0x6 & 0x3F | 0x80,
+        codePoint & 0x3F | 0x80
+      )
+    } else if (codePoint < 0x110000) {
+      if ((units -= 4) < 0) break
+      bytes.push(
+        codePoint >> 0x12 | 0xF0,
+        codePoint >> 0xC & 0x3F | 0x80,
+        codePoint >> 0x6 & 0x3F | 0x80,
+        codePoint & 0x3F | 0x80
+      )
+    } else {
+      throw new Error('Invalid code point')
+    }
+  }
+
+  return bytes
+}
+
+function asciiToBytes (str) {
+  var byteArray = []
+  for (var i = 0; i < str.length; ++i) {
+    // Node's code seems to be doing this and not & 0x7F..
+    byteArray.push(str.charCodeAt(i) & 0xFF)
+  }
+  return byteArray
+}
+
+function utf16leToBytes (str, units) {
+  var c, hi, lo
+  var byteArray = []
+  for (var i = 0; i < str.length; ++i) {
+    if ((units -= 2) < 0) break
+
+    c = str.charCodeAt(i)
+    hi = c >> 8
+    lo = c % 256
+    byteArray.push(lo)
+    byteArray.push(hi)
+  }
+
+  return byteArray
+}
+
+function base64ToBytes (str) {
+  return base64.toByteArray(base64clean(str))
+}
+
+function blitBuffer (src, dst, offset, length) {
+  for (var i = 0; i < length; ++i) {
+    if ((i + offset >= dst.length) || (i >= src.length)) break
+    dst[i + offset] = src[i]
+  }
+  return i
+}
+
+// ArrayBuffer or Uint8Array objects from other contexts (i.e. iframes) do not pass
+// the `instanceof` check but they should be treated as of that type.
+// See: https://github.com/feross/buffer/issues/166
+function isInstance (obj, type) {
+  return obj instanceof type ||
+    (obj != null && obj.constructor != null && obj.constructor.name != null &&
+      obj.constructor.name === type.name)
+}
+function numberIsNaN (obj) {
+  // For IE11 support
+  return obj !== obj // eslint-disable-line no-self-compare
+}
+
+}).call(this,require("buffer").Buffer)
+},{"base64-js":39,"buffer":43,"ieee754":55}],44:[function(require,module,exports){
+(function (Buffer){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// NOTE: These type checking functions intentionally don't use `instanceof`
+// because it is fragile and can be easily faked with `Object.create()`.
+
+function isArray(arg) {
+  if (Array.isArray) {
+    return Array.isArray(arg);
+  }
+  return objectToString(arg) === '[object Array]';
+}
+exports.isArray = isArray;
+
+function isBoolean(arg) {
+  return typeof arg === 'boolean';
+}
+exports.isBoolean = isBoolean;
+
+function isNull(arg) {
+  return arg === null;
+}
+exports.isNull = isNull;
+
+function isNullOrUndefined(arg) {
+  return arg == null;
+}
+exports.isNullOrUndefined = isNullOrUndefined;
+
+function isNumber(arg) {
+  return typeof arg === 'number';
+}
+exports.isNumber = isNumber;
+
+function isString(arg) {
+  return typeof arg === 'string';
+}
+exports.isString = isString;
+
+function isSymbol(arg) {
+  return typeof arg === 'symbol';
+}
+exports.isSymbol = isSymbol;
+
+function isUndefined(arg) {
+  return arg === void 0;
+}
+exports.isUndefined = isUndefined;
+
+function isRegExp(re) {
+  return objectToString(re) === '[object RegExp]';
+}
+exports.isRegExp = isRegExp;
+
+function isObject(arg) {
+  return typeof arg === 'object' && arg !== null;
+}
+exports.isObject = isObject;
+
+function isDate(d) {
+  return objectToString(d) === '[object Date]';
+}
+exports.isDate = isDate;
+
+function isError(e) {
+  return (objectToString(e) === '[object Error]' || e instanceof Error);
+}
+exports.isError = isError;
+
+function isFunction(arg) {
+  return typeof arg === 'function';
+}
+exports.isFunction = isFunction;
+
+function isPrimitive(arg) {
+  return arg === null ||
+         typeof arg === 'boolean' ||
+         typeof arg === 'number' ||
+         typeof arg === 'string' ||
+         typeof arg === 'symbol' ||  // ES6 symbol
+         typeof arg === 'undefined';
+}
+exports.isPrimitive = isPrimitive;
+
+exports.isBuffer = Buffer.isBuffer;
+
+function objectToString(o) {
+  return Object.prototype.toString.call(o);
+}
+
+}).call(this,{"isBuffer":require("../../is-buffer/index.js")})
+},{"../../is-buffer/index.js":57}],45:[function(require,module,exports){
+(function (process){
+"use strict";
+
+function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
+
+/* eslint-env browser */
+
+/**
+ * This is the web browser implementation of `debug()`.
+ */
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = localstorage();
+/**
+ * Colors.
+ */
+
+exports.colors = ['#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33'];
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+// eslint-disable-next-line complexity
+
+function useColors() {
+  // NB: In an Electron preload script, document will be defined but not fully
+  // initialized. Since we know we're in Chrome, we'll just detect this case
+  // explicitly
+  if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
+    return true;
+  } // Internet Explorer and Edge do not support colors.
+
+
+  if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
+    return false;
+  } // Is webkit? http://stackoverflow.com/a/16459606/376773
+  // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+
+
+  return typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance || // Is firebug? http://stackoverflow.com/a/398120/376773
+  typeof window !== 'undefined' && window.console && (window.console.firebug || window.console.exception && window.console.table) || // Is firefox >= v31?
+  // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+  typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31 || // Double check webkit in userAgent just in case we are in a worker
+  typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/);
+}
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+
+function formatArgs(args) {
+  args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff);
+
+  if (!this.useColors) {
+    return;
+  }
+
+  var c = 'color: ' + this.color;
+  args.splice(1, 0, c, 'color: inherit'); // The final "%c" is somewhat tricky, because there could be other
+  // arguments passed either before or after the %c, so we need to
+  // figure out the correct index to insert the CSS into
+
+  var index = 0;
+  var lastC = 0;
+  args[0].replace(/%[a-zA-Z%]/g, function (match) {
+    if (match === '%%') {
+      return;
+    }
+
+    index++;
+
+    if (match === '%c') {
+      // We only are interested in the *last* %c
+      // (the user may have provided their own)
+      lastC = index;
+    }
+  });
+  args.splice(lastC, 0, c);
+}
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+
+function log() {
+  var _console;
+
+  // This hackery is required for IE8/9, where
+  // the `console.log` function doesn't have 'apply'
+  return (typeof console === "undefined" ? "undefined" : _typeof(console)) === 'object' && console.log && (_console = console).log.apply(_console, arguments);
+}
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+
+function save(namespaces) {
+  try {
+    if (namespaces) {
+      exports.storage.setItem('debug', namespaces);
+    } else {
+      exports.storage.removeItem('debug');
+    }
+  } catch (error) {// Swallow
+    // XXX (@Qix-) should we be logging these?
+  }
+}
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+
+function load() {
+  var r;
+
+  try {
+    r = exports.storage.getItem('debug');
+  } catch (error) {} // Swallow
+  // XXX (@Qix-) should we be logging these?
+  // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+
+
+  if (!r && typeof process !== 'undefined' && 'env' in process) {
+    r = process.env.DEBUG;
+  }
+
+  return r;
+}
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+
+function localstorage() {
+  try {
+    // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
+    // The Browser also has localStorage in the global context.
+    return localStorage;
+  } catch (error) {// Swallow
+    // XXX (@Qix-) should we be logging these?
+  }
+}
+
+module.exports = require('./common')(exports);
+var formatters = module.exports.formatters;
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+formatters.j = function (v) {
+  try {
+    return JSON.stringify(v);
+  } catch (error) {
+    return '[UnexpectedJSONParseError]: ' + error.message;
+  }
+};
+
+
+}).call(this,require('_process'))
+},{"./common":46,"_process":69}],46:[function(require,module,exports){
+"use strict";
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ */
+function setup(env) {
+  createDebug.debug = createDebug;
+  createDebug.default = createDebug;
+  createDebug.coerce = coerce;
+  createDebug.disable = disable;
+  createDebug.enable = enable;
+  createDebug.enabled = enabled;
+  createDebug.humanize = require('ms');
+  Object.keys(env).forEach(function (key) {
+    createDebug[key] = env[key];
+  });
+  /**
+  * Active `debug` instances.
+  */
+
+  createDebug.instances = [];
+  /**
+  * The currently active debug mode names, and names to skip.
+  */
+
+  createDebug.names = [];
+  createDebug.skips = [];
+  /**
+  * Map of special "%n" handling functions, for the debug "format" argument.
+  *
+  * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+  */
+
+  createDebug.formatters = {};
+  /**
+  * Selects a color for a debug namespace
+  * @param {String} namespace The namespace string for the for the debug instance to be colored
+  * @return {Number|String} An ANSI color code for the given namespace
+  * @api private
+  */
+
+  function selectColor(namespace) {
+    var hash = 0;
+
+    for (var i = 0; i < namespace.length; i++) {
+      hash = (hash << 5) - hash + namespace.charCodeAt(i);
+      hash |= 0; // Convert to 32bit integer
+    }
+
+    return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
+  }
+
+  createDebug.selectColor = selectColor;
+  /**
+  * Create a debugger with the given `namespace`.
+  *
+  * @param {String} namespace
+  * @return {Function}
+  * @api public
+  */
+
+  function createDebug(namespace) {
+    var prevTime;
+
+    function debug() {
+      // Disabled?
+      if (!debug.enabled) {
+        return;
+      }
+
+      for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
+        args[_key] = arguments[_key];
+      }
+
+      var self = debug; // Set `diff` timestamp
+
+      var curr = Number(new Date());
+      var ms = curr - (prevTime || curr);
+      self.diff = ms;
+      self.prev = prevTime;
+      self.curr = curr;
+      prevTime = curr;
+      args[0] = createDebug.coerce(args[0]);
+
+      if (typeof args[0] !== 'string') {
+        // Anything else let's inspect with %O
+        args.unshift('%O');
+      } // Apply any `formatters` transformations
+
+
+      var index = 0;
+      args[0] = args[0].replace(/%([a-zA-Z%])/g, function (match, format) {
+        // If we encounter an escaped % then don't increase the array index
+        if (match === '%%') {
+          return match;
+        }
+
+        index++;
+        var formatter = createDebug.formatters[format];
+
+        if (typeof formatter === 'function') {
+          var val = args[index];
+          match = formatter.call(self, val); // Now we need to remove `args[index]` since it's inlined in the `format`
+
+          args.splice(index, 1);
+          index--;
+        }
+
+        return match;
+      }); // Apply env-specific formatting (colors, etc.)
+
+      createDebug.formatArgs.call(self, args);
+      var logFn = self.log || createDebug.log;
+      logFn.apply(self, args);
+    }
+
+    debug.namespace = namespace;
+    debug.enabled = createDebug.enabled(namespace);
+    debug.useColors = createDebug.useColors();
+    debug.color = selectColor(namespace);
+    debug.destroy = destroy;
+    debug.extend = extend; // Debug.formatArgs = formatArgs;
+    // debug.rawLog = rawLog;
+    // env-specific initialization logic for debug instances
+
+    if (typeof createDebug.init === 'function') {
+      createDebug.init(debug);
+    }
+
+    createDebug.instances.push(debug);
+    return debug;
+  }
+
+  function destroy() {
+    var index = createDebug.instances.indexOf(this);
+
+    if (index !== -1) {
+      createDebug.instances.splice(index, 1);
+      return true;
+    }
+
+    return false;
+  }
+
+  function extend(namespace, delimiter) {
+    return createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
+  }
+  /**
+  * Enables a debug mode by namespaces. This can include modes
+  * separated by a colon and wildcards.
+  *
+  * @param {String} namespaces
+  * @api public
+  */
+
+
+  function enable(namespaces) {
+    createDebug.save(namespaces);
+    createDebug.names = [];
+    createDebug.skips = [];
+    var i;
+    var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+    var len = split.length;
+
+    for (i = 0; i < len; i++) {
+      if (!split[i]) {
+        // ignore empty strings
+        continue;
+      }
+
+      namespaces = split[i].replace(/\*/g, '.*?');
+
+      if (namespaces[0] === '-') {
+        createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+      } else {
+        createDebug.names.push(new RegExp('^' + namespaces + '$'));
+      }
+    }
+
+    for (i = 0; i < createDebug.instances.length; i++) {
+      var instance = createDebug.instances[i];
+      instance.enabled = createDebug.enabled(instance.namespace);
+    }
+  }
+  /**
+  * Disable debug output.
+  *
+  * @api public
+  */
+
+
+  function disable() {
+    createDebug.enable('');
+  }
+  /**
+  * Returns true if the given mode name is enabled, false otherwise.
+  *
+  * @param {String} name
+  * @return {Boolean}
+  * @api public
+  */
+
+
+  function enabled(name) {
+    if (name[name.length - 1] === '*') {
+      return true;
+    }
+
+    var i;
+    var len;
+
+    for (i = 0, len = createDebug.skips.length; i < len; i++) {
+      if (createDebug.skips[i].test(name)) {
+        return false;
+      }
+    }
+
+    for (i = 0, len = createDebug.names.length; i < len; i++) {
+      if (createDebug.names[i].test(name)) {
+        return true;
+      }
+    }
+
+    return false;
+  }
+  /**
+  * Coerce `val`.
+  *
+  * @param {Mixed} val
+  * @return {Mixed}
+  * @api private
+  */
+
+
+  function coerce(val) {
+    if (val instanceof Error) {
+      return val.stack || val.message;
+    }
+
+    return val;
+  }
+
+  createDebug.enable(createDebug.load());
+  return createDebug;
+}
+
+module.exports = setup;
+
+
+},{"ms":60}],47:[function(require,module,exports){
+'use strict';
+
+var keys = require('object-keys');
+var hasSymbols = typeof Symbol === 'function' && typeof Symbol('foo') === 'symbol';
+
+var toStr = Object.prototype.toString;
+var concat = Array.prototype.concat;
+var origDefineProperty = Object.defineProperty;
+
+var isFunction = function (fn) {
+	return typeof fn === 'function' && toStr.call(fn) === '[object Function]';
+};
+
+var arePropertyDescriptorsSupported = function () {
+	var obj = {};
+	try {
+		origDefineProperty(obj, 'x', { enumerable: false, value: obj });
+		// eslint-disable-next-line no-unused-vars, no-restricted-syntax
+		for (var _ in obj) { // jscs:ignore disallowUnusedVariables
+			return false;
+		}
+		return obj.x === obj;
+	} catch (e) { /* this is IE 8. */
+		return false;
+	}
+};
+var supportsDescriptors = origDefineProperty && arePropertyDescriptorsSupported();
+
+var defineProperty = function (object, name, value, predicate) {
+	if (name in object && (!isFunction(predicate) || !predicate())) {
+		return;
+	}
+	if (supportsDescriptors) {
+		origDefineProperty(object, name, {
+			configurable: true,
+			enumerable: false,
+			value: value,
+			writable: true
+		});
+	} else {
+		object[name] = value;
+	}
+};
+
+var defineProperties = function (object, map) {
+	var predicates = arguments.length > 2 ? arguments[2] : {};
+	var props = keys(map);
+	if (hasSymbols) {
+		props = concat.call(props, Object.getOwnPropertySymbols(map));
+	}
+	for (var i = 0; i < props.length; i += 1) {
+		defineProperty(object, props[i], map[props[i]], predicates[props[i]]);
+	}
+};
+
+defineProperties.supportsDescriptors = !!supportsDescriptors;
+
+module.exports = defineProperties;
+
+},{"object-keys":62}],48:[function(require,module,exports){
+/*!
+
+ diff v3.5.0
+
+Software License Agreement (BSD License)
+
+Copyright (c) 2009-2015, Kevin Decker <kpdecker@gmail.com>
+
+All rights reserved.
+
+Redistribution and use of this software in source and binary forms, with or without modification,
+are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above
+  copyright notice, this list of conditions and the
+  following disclaimer.
+
+* Redistributions in binary form must reproduce the above
+  copyright notice, this list of conditions and the
+  following disclaimer in the documentation and/or other
+  materials provided with the distribution.
+
+* Neither the name of Kevin Decker nor the names of its
+  contributors may be used to endorse or promote products
+  derived from this software without specific prior
+  written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND
+FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR
+CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER
+IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
+OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+@license
+*/
+(function webpackUniversalModuleDefinition(root, factory) {
+	if(typeof exports === 'object' && typeof module === 'object')
+		module.exports = factory();
+	else if(false)
+		define([], factory);
+	else if(typeof exports === 'object')
+		exports["JsDiff"] = factory();
+	else
+		root["JsDiff"] = factory();
+})(this, function() {
+return /******/ (function(modules) { // webpackBootstrap
+/******/ 	// The module cache
+/******/ 	var installedModules = {};
+
+/******/ 	// The require function
+/******/ 	function __webpack_require__(moduleId) {
+
+/******/ 		// Check if module is in cache
+/******/ 		if(installedModules[moduleId])
+/******/ 			return installedModules[moduleId].exports;
+
+/******/ 		// Create a new module (and put it into the cache)
+/******/ 		var module = installedModules[moduleId] = {
+/******/ 			exports: {},
+/******/ 			id: moduleId,
+/******/ 			loaded: false
+/******/ 		};
+
+/******/ 		// Execute the module function
+/******/ 		modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
+
+/******/ 		// Flag the module as loaded
+/******/ 		module.loaded = true;
+
+/******/ 		// Return the exports of the module
+/******/ 		return module.exports;
+/******/ 	}
+
+
+/******/ 	// expose the modules object (__webpack_modules__)
+/******/ 	__webpack_require__.m = modules;
+
+/******/ 	// expose the module cache
+/******/ 	__webpack_require__.c = installedModules;
+
+/******/ 	// __webpack_public_path__
+/******/ 	__webpack_require__.p = "";
+
+/******/ 	// Load entry module and return exports
+/******/ 	return __webpack_require__(0);
+/******/ })
+/************************************************************************/
+/******/ ([
+/* 0 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.canonicalize = exports.convertChangesToXML = exports.convertChangesToDMP = exports.merge = exports.parsePatch = exports.applyPatches = exports.applyPatch = exports.createPatch = exports.createTwoFilesPatch = exports.structuredPatch = exports.diffArrays = exports.diffJson = exports.diffCss = exports.diffSentences = exports.diffTrimmedLines = exports.diffLines = exports.diffWordsWithSpace = exports.diffWords = exports.diffChars = exports.Diff = undefined;
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_character = __webpack_require__(2) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_word = __webpack_require__(3) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_line = __webpack_require__(5) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_sentence = __webpack_require__(6) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_css = __webpack_require__(7) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_json = __webpack_require__(8) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_array = __webpack_require__(9) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_apply = __webpack_require__(10) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_parse = __webpack_require__(11) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_merge = __webpack_require__(13) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_create = __webpack_require__(14) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_dmp = __webpack_require__(16) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_xml = __webpack_require__(17) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/* See LICENSE file for terms of use */
+
+	/*
+	 * Text diff implementation.
+	 *
+	 * This library supports the following APIS:
+	 * JsDiff.diffChars: Character by character diff
+	 * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace
+	 * JsDiff.diffLines: Line based diff
+	 *
+	 * JsDiff.diffCss: Diff targeted at CSS content
+	 *
+	 * These methods are based on the implementation proposed in
+	 * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986).
+	 * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927
+	 */
+	exports. /*istanbul ignore end*/Diff = _base2['default'];
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffChars = _character.diffChars;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWords = _word.diffWords;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = _word.diffWordsWithSpace;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffLines = _line.diffLines;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = _line.diffTrimmedLines;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffSentences = _sentence.diffSentences;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffCss = _css.diffCss;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffJson = _json.diffJson;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffArrays = _array.diffArrays;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/structuredPatch = _create.structuredPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = _create.createTwoFilesPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = _create.createPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatch = _apply.applyPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = _apply.applyPatches;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/parsePatch = _parse.parsePatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = _merge.merge;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToDMP = _dmp.convertChangesToDMP;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToXML = _xml.convertChangesToXML;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = _json.canonicalize;
+
+
+
+/***/ }),
+/* 1 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports['default'] = /*istanbul ignore end*/Diff;
+	function Diff() {}
+
+	Diff.prototype = {
+	  /*istanbul ignore start*/ /*istanbul ignore end*/diff: function diff(oldString, newString) {
+	    /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+	    var callback = options.callback;
+	    if (typeof options === 'function') {
+	      callback = options;
+	      options = {};
+	    }
+	    this.options = options;
+
+	    var self = this;
+
+	    function done(value) {
+	      if (callback) {
+	        setTimeout(function () {
+	          callback(undefined, value);
+	        }, 0);
+	        return true;
+	      } else {
+	        return value;
+	      }
+	    }
+
+	    // Allow subclasses to massage the input prior to running
+	    oldString = this.castInput(oldString);
+	    newString = this.castInput(newString);
+
+	    oldString = this.removeEmpty(this.tokenize(oldString));
+	    newString = this.removeEmpty(this.tokenize(newString));
+
+	    var newLen = newString.length,
+	        oldLen = oldString.length;
+	    var editLength = 1;
+	    var maxEditLength = newLen + oldLen;
+	    var bestPath = [{ newPos: -1, components: [] }];
+
+	    // Seed editLength = 0, i.e. the content starts with the same values
+	    var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0);
+	    if (bestPath[0].newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
+	      // Identity per the equality and tokenizer
+	      return done([{ value: this.join(newString), count: newString.length }]);
+	    }
+
+	    // Main worker method. checks all permutations of a given edit length for acceptance.
+	    function execEditLength() {
+	      for (var diagonalPath = -1 * editLength; diagonalPath <= editLength; diagonalPath += 2) {
+	        var basePath = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+	        var addPath = bestPath[diagonalPath - 1],
+	            removePath = bestPath[diagonalPath + 1],
+	            _oldPos = (removePath ? removePath.newPos : 0) - diagonalPath;
+	        if (addPath) {
+	          // No one else is going to attempt to use this value, clear it
+	          bestPath[diagonalPath - 1] = undefined;
+	        }
+
+	        var canAdd = addPath && addPath.newPos + 1 < newLen,
+	            canRemove = removePath && 0 <= _oldPos && _oldPos < oldLen;
+	        if (!canAdd && !canRemove) {
+	          // If this path is a terminal then prune
+	          bestPath[diagonalPath] = undefined;
+	          continue;
+	        }
+
+	        // Select the diagonal that we want to branch from. We select the prior
+	        // path whose position in the new string is the farthest from the origin
+	        // and does not pass the bounds of the diff graph
+	        if (!canAdd || canRemove && addPath.newPos < removePath.newPos) {
+	          basePath = clonePath(removePath);
+	          self.pushComponent(basePath.components, undefined, true);
+	        } else {
+	          basePath = addPath; // No need to clone, we've pulled it from the list
+	          basePath.newPos++;
+	          self.pushComponent(basePath.components, true, undefined);
+	        }
+
+	        _oldPos = self.extractCommon(basePath, newString, oldString, diagonalPath);
+
+	        // If we have hit the end of both strings, then we are done
+	        if (basePath.newPos + 1 >= newLen && _oldPos + 1 >= oldLen) {
+	          return done(buildValues(self, basePath.components, newString, oldString, self.useLongestToken));
+	        } else {
+	          // Otherwise track this path as a potential candidate and continue.
+	          bestPath[diagonalPath] = basePath;
+	        }
+	      }
+
+	      editLength++;
+	    }
+
+	    // Performs the length of edit iteration. Is a bit fugly as this has to support the
+	    // sync and async mode which is never fun. Loops over execEditLength until a value
+	    // is produced.
+	    if (callback) {
+	      (function exec() {
+	        setTimeout(function () {
+	          // This should not happen, but we want to be safe.
+	          /* istanbul ignore next */
+	          if (editLength > maxEditLength) {
+	            return callback();
+	          }
+
+	          if (!execEditLength()) {
+	            exec();
+	          }
+	        }, 0);
+	      })();
+	    } else {
+	      while (editLength <= maxEditLength) {
+	        var ret = execEditLength();
+	        if (ret) {
+	          return ret;
+	        }
+	      }
+	    }
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/pushComponent: function pushComponent(components, added, removed) {
+	    var last = components[components.length - 1];
+	    if (last && last.added === added && last.removed === removed) {
+	      // We need to clone here as the component clone operation is just
+	      // as shallow array clone
+	      components[components.length - 1] = { count: last.count + 1, added: added, removed: removed };
+	    } else {
+	      components.push({ count: 1, added: added, removed: removed });
+	    }
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/extractCommon: function extractCommon(basePath, newString, oldString, diagonalPath) {
+	    var newLen = newString.length,
+	        oldLen = oldString.length,
+	        newPos = basePath.newPos,
+	        oldPos = newPos - diagonalPath,
+	        commonCount = 0;
+	    while (newPos + 1 < newLen && oldPos + 1 < oldLen && this.equals(newString[newPos + 1], oldString[oldPos + 1])) {
+	      newPos++;
+	      oldPos++;
+	      commonCount++;
+	    }
+
+	    if (commonCount) {
+	      basePath.components.push({ count: commonCount });
+	    }
+
+	    basePath.newPos = newPos;
+	    return oldPos;
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/equals: function equals(left, right) {
+	    if (this.options.comparator) {
+	      return this.options.comparator(left, right);
+	    } else {
+	      return left === right || this.options.ignoreCase && left.toLowerCase() === right.toLowerCase();
+	    }
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/removeEmpty: function removeEmpty(array) {
+	    var ret = [];
+	    for (var i = 0; i < array.length; i++) {
+	      if (array[i]) {
+	        ret.push(array[i]);
+	      }
+	    }
+	    return ret;
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/castInput: function castInput(value) {
+	    return value;
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/tokenize: function tokenize(value) {
+	    return value.split('');
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/join: function join(chars) {
+	    return chars.join('');
+	  }
+	};
+
+	function buildValues(diff, components, newString, oldString, useLongestToken) {
+	  var componentPos = 0,
+	      componentLen = components.length,
+	      newPos = 0,
+	      oldPos = 0;
+
+	  for (; componentPos < componentLen; componentPos++) {
+	    var component = components[componentPos];
+	    if (!component.removed) {
+	      if (!component.added && useLongestToken) {
+	        var value = newString.slice(newPos, newPos + component.count);
+	        value = value.map(function (value, i) {
+	          var oldValue = oldString[oldPos + i];
+	          return oldValue.length > value.length ? oldValue : value;
+	        });
+
+	        component.value = diff.join(value);
+	      } else {
+	        component.value = diff.join(newString.slice(newPos, newPos + component.count));
+	      }
+	      newPos += component.count;
+
+	      // Common case
+	      if (!component.added) {
+	        oldPos += component.count;
+	      }
+	    } else {
+	      component.value = diff.join(oldString.slice(oldPos, oldPos + component.count));
+	      oldPos += component.count;
+
+	      // Reverse add and remove so removes are output first to match common convention
+	      // The diffing algorithm is tied to add then remove output and this is the simplest
+	      // route to get the desired output with minimal overhead.
+	      if (componentPos && components[componentPos - 1].added) {
+	        var tmp = components[componentPos - 1];
+	        components[componentPos - 1] = components[componentPos];
+	        components[componentPos] = tmp;
+	      }
+	    }
+	  }
+
+	  // Special case handle for when one terminal is ignored (i.e. whitespace).
+	  // For this case we merge the terminal into the prior string and drop the change.
+	  // This is only available for string mode.
+	  var lastComponent = components[componentLen - 1];
+	  if (componentLen > 1 && typeof lastComponent.value === 'string' && (lastComponent.added || lastComponent.removed) && diff.equals('', lastComponent.value)) {
+	    components[componentLen - 2].value += lastComponent.value;
+	    components.pop();
+	  }
+
+	  return components;
+	}
+
+	function clonePath(path) {
+	  return { newPos: path.newPos, components: path.components.slice(0) };
+	}
+
+
+
+/***/ }),
+/* 2 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.characterDiff = undefined;
+	exports. /*istanbul ignore end*/diffChars = diffChars;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var characterDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/characterDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	function diffChars(oldStr, newStr, options) {
+	  return characterDiff.diff(oldStr, newStr, options);
+	}
+
+
+
+/***/ }),
+/* 3 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.wordDiff = undefined;
+	exports. /*istanbul ignore end*/diffWords = diffWords;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = diffWordsWithSpace;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_params = __webpack_require__(4) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/ // Based on https://en.wikipedia.org/wiki/Latin_script_in_Unicode
+	//
+	// Ranges and exceptions:
+	// Latin-1 Supplement, 0080–00FF
+	//  - U+00D7  × Multiplication sign
+	//  - U+00F7  ÷ Division sign
+	// Latin Extended-A, 0100–017F
+	// Latin Extended-B, 0180–024F
+	// IPA Extensions, 0250–02AF
+	// Spacing Modifier Letters, 02B0–02FF
+	//  - U+02C7  ˇ &#711;  Caron
+	//  - U+02D8  ˘ &#728;  Breve
+	//  - U+02D9  ˙ &#729;  Dot Above
+	//  - U+02DA  ˚ &#730;  Ring Above
+	//  - U+02DB  ˛ &#731;  Ogonek
+	//  - U+02DC  ˜ &#732;  Small Tilde
+	//  - U+02DD  ˝ &#733;  Double Acute Accent
+	// Latin Extended Additional, 1E00–1EFF
+	var extendedWordChars = /^[A-Za-z\xC0-\u02C6\u02C8-\u02D7\u02DE-\u02FF\u1E00-\u1EFF]+$/;
+
+	var reWhitespace = /\S/;
+
+	var wordDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/wordDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	wordDiff.equals = function (left, right) {
+	  if (this.options.ignoreCase) {
+	    left = left.toLowerCase();
+	    right = right.toLowerCase();
+	  }
+	  return left === right || this.options.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right);
+	};
+	wordDiff.tokenize = function (value) {
+	  var tokens = value.split(/(\s+|\b)/);
+
+	  // Join the boundary splits that we do not consider to be boundaries. This is primarily the extended Latin character set.
+	  for (var i = 0; i < tokens.length - 1; i++) {
+	    // If we have an empty string in the next field and we have only word chars before and after, merge
+	    if (!tokens[i + 1] && tokens[i + 2] && extendedWordChars.test(tokens[i]) && extendedWordChars.test(tokens[i + 2])) {
+	      tokens[i] += tokens[i + 2];
+	      tokens.splice(i + 1, 2);
+	      i--;
+	    }
+	  }
+
+	  return tokens;
+	};
+
+	function diffWords(oldStr, newStr, options) {
+	  options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(options, { ignoreWhitespace: true });
+	  return wordDiff.diff(oldStr, newStr, options);
+	}
+
+	function diffWordsWithSpace(oldStr, newStr, options) {
+	  return wordDiff.diff(oldStr, newStr, options);
+	}
+
+
+
+/***/ }),
+/* 4 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/generateOptions = generateOptions;
+	function generateOptions(options, defaults) {
+	  if (typeof options === 'function') {
+	    defaults.callback = options;
+	  } else if (options) {
+	    for (var name in options) {
+	      /* istanbul ignore else */
+	      if (options.hasOwnProperty(name)) {
+	        defaults[name] = options[name];
+	      }
+	    }
+	  }
+	  return defaults;
+	}
+
+
+
+/***/ }),
+/* 5 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.lineDiff = undefined;
+	exports. /*istanbul ignore end*/diffLines = diffLines;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = diffTrimmedLines;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_params = __webpack_require__(4) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var lineDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/lineDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	lineDiff.tokenize = function (value) {
+	  var retLines = [],
+	      linesAndNewlines = value.split(/(\n|\r\n)/);
+
+	  // Ignore the final empty token that occurs if the string ends with a new line
+	  if (!linesAndNewlines[linesAndNewlines.length - 1]) {
+	    linesAndNewlines.pop();
+	  }
+
+	  // Merge the content and line separators into single tokens
+	  for (var i = 0; i < linesAndNewlines.length; i++) {
+	    var line = linesAndNewlines[i];
+
+	    if (i % 2 && !this.options.newlineIsToken) {
+	      retLines[retLines.length - 1] += line;
+	    } else {
+	      if (this.options.ignoreWhitespace) {
+	        line = line.trim();
+	      }
+	      retLines.push(line);
+	    }
+	  }
+
+	  return retLines;
+	};
+
+	function diffLines(oldStr, newStr, callback) {
+	  return lineDiff.diff(oldStr, newStr, callback);
+	}
+	function diffTrimmedLines(oldStr, newStr, callback) {
+	  var options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(callback, { ignoreWhitespace: true });
+	  return lineDiff.diff(oldStr, newStr, options);
+	}
+
+
+
+/***/ }),
+/* 6 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.sentenceDiff = undefined;
+	exports. /*istanbul ignore end*/diffSentences = diffSentences;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var sentenceDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/sentenceDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	sentenceDiff.tokenize = function (value) {
+	  return value.split(/(\S.+?[.!?])(?=\s+|$)/);
+	};
+
+	function diffSentences(oldStr, newStr, callback) {
+	  return sentenceDiff.diff(oldStr, newStr, callback);
+	}
+
+
+
+/***/ }),
+/* 7 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.cssDiff = undefined;
+	exports. /*istanbul ignore end*/diffCss = diffCss;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var cssDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/cssDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	cssDiff.tokenize = function (value) {
+	  return value.split(/([{}:;,]|\s+)/);
+	};
+
+	function diffCss(oldStr, newStr, callback) {
+	  return cssDiff.diff(oldStr, newStr, callback);
+	}
+
+
+
+/***/ }),
+/* 8 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.jsonDiff = undefined;
+
+	var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
+
+	exports. /*istanbul ignore end*/diffJson = diffJson;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = canonicalize;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_line = __webpack_require__(5) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var objectPrototypeToString = Object.prototype.toString;
+
+	var jsonDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/jsonDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	// Discriminate between two lines of pretty-printed, serialized JSON where one of them has a
+	// dangling comma and the other doesn't. Turns out including the dangling comma yields the nicest output:
+	jsonDiff.useLongestToken = true;
+
+	jsonDiff.tokenize = /*istanbul ignore start*/_line.lineDiff /*istanbul ignore end*/.tokenize;
+	jsonDiff.castInput = function (value) {
+	  /*istanbul ignore start*/var _options = /*istanbul ignore end*/this.options,
+	      undefinedReplacement = _options.undefinedReplacement,
+	      _options$stringifyRep = _options.stringifyReplacer,
+	      stringifyReplacer = _options$stringifyRep === undefined ? function (k, v) /*istanbul ignore start*/{
+	    return (/*istanbul ignore end*/typeof v === 'undefined' ? undefinedReplacement : v
+	    );
+	  } : _options$stringifyRep;
+
+
+	  return typeof value === 'string' ? value : JSON.stringify(canonicalize(value, null, null, stringifyReplacer), stringifyReplacer, '  ');
+	};
+	jsonDiff.equals = function (left, right) {
+	  return (/*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/.prototype.equals.call(jsonDiff, left.replace(/,([\r\n])/g, '$1'), right.replace(/,([\r\n])/g, '$1'))
+	  );
+	};
+
+	function diffJson(oldObj, newObj, options) {
+	  return jsonDiff.diff(oldObj, newObj, options);
+	}
+
+	// This function handles the presence of circular references by bailing out when encountering an
+	// object that is already on the "stack" of items being processed. Accepts an optional replacer
+	function canonicalize(obj, stack, replacementStack, replacer, key) {
+	  stack = stack || [];
+	  replacementStack = replacementStack || [];
+
+	  if (replacer) {
+	    obj = replacer(key, obj);
+	  }
+
+	  var i = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+	  for (i = 0; i < stack.length; i += 1) {
+	    if (stack[i] === obj) {
+	      return replacementStack[i];
+	    }
+	  }
+
+	  var canonicalizedObj = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+	  if ('[object Array]' === objectPrototypeToString.call(obj)) {
+	    stack.push(obj);
+	    canonicalizedObj = new Array(obj.length);
+	    replacementStack.push(canonicalizedObj);
+	    for (i = 0; i < obj.length; i += 1) {
+	      canonicalizedObj[i] = canonicalize(obj[i], stack, replacementStack, replacer, key);
+	    }
+	    stack.pop();
+	    replacementStack.pop();
+	    return canonicalizedObj;
+	  }
+
+	  if (obj && obj.toJSON) {
+	    obj = obj.toJSON();
+	  }
+
+	  if ( /*istanbul ignore start*/(typeof /*istanbul ignore end*/obj === 'undefined' ? 'undefined' : _typeof(obj)) === 'object' && obj !== null) {
+	    stack.push(obj);
+	    canonicalizedObj = {};
+	    replacementStack.push(canonicalizedObj);
+	    var sortedKeys = [],
+	        _key = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+	    for (_key in obj) {
+	      /* istanbul ignore else */
+	      if (obj.hasOwnProperty(_key)) {
+	        sortedKeys.push(_key);
+	      }
+	    }
+	    sortedKeys.sort();
+	    for (i = 0; i < sortedKeys.length; i += 1) {
+	      _key = sortedKeys[i];
+	      canonicalizedObj[_key] = canonicalize(obj[_key], stack, replacementStack, replacer, _key);
+	    }
+	    stack.pop();
+	    replacementStack.pop();
+	  } else {
+	    canonicalizedObj = obj;
+	  }
+	  return canonicalizedObj;
+	}
+
+
+
+/***/ }),
+/* 9 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.arrayDiff = undefined;
+	exports. /*istanbul ignore end*/diffArrays = diffArrays;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var arrayDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/arrayDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	arrayDiff.tokenize = function (value) {
+	  return value.slice();
+	};
+	arrayDiff.join = arrayDiff.removeEmpty = function (value) {
+	  return value;
+	};
+
+	function diffArrays(oldArr, newArr, callback) {
+	  return arrayDiff.diff(oldArr, newArr, callback);
+	}
+
+
+
+/***/ }),
+/* 10 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/applyPatch = applyPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = applyPatches;
+
+	var /*istanbul ignore start*/_parse = __webpack_require__(11) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_distanceIterator = __webpack_require__(12) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _distanceIterator2 = _interopRequireDefault(_distanceIterator);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/function applyPatch(source, uniDiff) {
+	  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+	  if (typeof uniDiff === 'string') {
+	    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+	  }
+
+	  if (Array.isArray(uniDiff)) {
+	    if (uniDiff.length > 1) {
+	      throw new Error('applyPatch only works with a single input.');
+	    }
+
+	    uniDiff = uniDiff[0];
+	  }
+
+	  // Apply the diff to the input
+	  var lines = source.split(/\r\n|[\n\v\f\r\x85]/),
+	      delimiters = source.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+	      hunks = uniDiff.hunks,
+	      compareLine = options.compareLine || function (lineNumber, line, operation, patchContent) /*istanbul ignore start*/{
+	    return (/*istanbul ignore end*/line === patchContent
+	    );
+	  },
+	      errorCount = 0,
+	      fuzzFactor = options.fuzzFactor || 0,
+	      minLine = 0,
+	      offset = 0,
+	      removeEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+	      addEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+	  /**
+	   * Checks if the hunk exactly fits on the provided location
+	   */
+	  function hunkFits(hunk, toPos) {
+	    for (var j = 0; j < hunk.lines.length; j++) {
+	      var line = hunk.lines[j],
+	          operation = line.length > 0 ? line[0] : ' ',
+	          content = line.length > 0 ? line.substr(1) : line;
+
+	      if (operation === ' ' || operation === '-') {
+	        // Context sanity check
+	        if (!compareLine(toPos + 1, lines[toPos], operation, content)) {
+	          errorCount++;
+
+	          if (errorCount > fuzzFactor) {
+	            return false;
+	          }
+	        }
+	        toPos++;
+	      }
+	    }
+
+	    return true;
+	  }
+
+	  // Search best fit offsets for each hunk based on the previous ones
+	  for (var i = 0; i < hunks.length; i++) {
+	    var hunk = hunks[i],
+	        maxLine = lines.length - hunk.oldLines,
+	        localOffset = 0,
+	        toPos = offset + hunk.oldStart - 1;
+
+	    var iterator = /*istanbul ignore start*/(0, _distanceIterator2['default']) /*istanbul ignore end*/(toPos, minLine, maxLine);
+
+	    for (; localOffset !== undefined; localOffset = iterator()) {
+	      if (hunkFits(hunk, toPos + localOffset)) {
+	        hunk.offset = offset += localOffset;
+	        break;
+	      }
+	    }
+
+	    if (localOffset === undefined) {
+	      return false;
+	    }
+
+	    // Set lower text limit to end of the current hunk, so next ones don't try
+	    // to fit over already patched text
+	    minLine = hunk.offset + hunk.oldStart + hunk.oldLines;
+	  }
+
+	  // Apply patch hunks
+	  var diffOffset = 0;
+	  for (var _i = 0; _i < hunks.length; _i++) {
+	    var _hunk = hunks[_i],
+	        _toPos = _hunk.oldStart + _hunk.offset + diffOffset - 1;
+	    diffOffset += _hunk.newLines - _hunk.oldLines;
+
+	    if (_toPos < 0) {
+	      // Creating a new file
+	      _toPos = 0;
+	    }
+
+	    for (var j = 0; j < _hunk.lines.length; j++) {
+	      var line = _hunk.lines[j],
+	          operation = line.length > 0 ? line[0] : ' ',
+	          content = line.length > 0 ? line.substr(1) : line,
+	          delimiter = _hunk.linedelimiters[j];
+
+	      if (operation === ' ') {
+	        _toPos++;
+	      } else if (operation === '-') {
+	        lines.splice(_toPos, 1);
+	        delimiters.splice(_toPos, 1);
+	        /* istanbul ignore else */
+	      } else if (operation === '+') {
+	        lines.splice(_toPos, 0, content);
+	        delimiters.splice(_toPos, 0, delimiter);
+	        _toPos++;
+	      } else if (operation === '\\') {
+	        var previousOperation = _hunk.lines[j - 1] ? _hunk.lines[j - 1][0] : null;
+	        if (previousOperation === '+') {
+	          removeEOFNL = true;
+	        } else if (previousOperation === '-') {
+	          addEOFNL = true;
+	        }
+	      }
+	    }
+	  }
+
+	  // Handle EOFNL insertion/removal
+	  if (removeEOFNL) {
+	    while (!lines[lines.length - 1]) {
+	      lines.pop();
+	      delimiters.pop();
+	    }
+	  } else if (addEOFNL) {
+	    lines.push('');
+	    delimiters.push('\n');
+	  }
+	  for (var _k = 0; _k < lines.length - 1; _k++) {
+	    lines[_k] = lines[_k] + delimiters[_k];
+	  }
+	  return lines.join('');
+	}
+
+	// Wrapper that supports multiple file patches via callbacks.
+	function applyPatches(uniDiff, options) {
+	  if (typeof uniDiff === 'string') {
+	    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+	  }
+
+	  var currentIndex = 0;
+	  function processIndex() {
+	    var index = uniDiff[currentIndex++];
+	    if (!index) {
+	      return options.complete();
+	    }
+
+	    options.loadFile(index, function (err, data) {
+	      if (err) {
+	        return options.complete(err);
+	      }
+
+	      var updatedContent = applyPatch(data, index, options);
+	      options.patched(index, updatedContent, function (err) {
+	        if (err) {
+	          return options.complete(err);
+	        }
+
+	        processIndex();
+	      });
+	    });
+	  }
+	  processIndex();
+	}
+
+
+
+/***/ }),
+/* 11 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/parsePatch = parsePatch;
+	function parsePatch(uniDiff) {
+	  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
+
+	  var diffstr = uniDiff.split(/\r\n|[\n\v\f\r\x85]/),
+	      delimiters = uniDiff.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+	      list = [],
+	      i = 0;
+
+	  function parseIndex() {
+	    var index = {};
+	    list.push(index);
+
+	    // Parse diff metadata
+	    while (i < diffstr.length) {
+	      var line = diffstr[i];
+
+	      // File header found, end parsing diff metadata
+	      if (/^(\-\-\-|\+\+\+|@@)\s/.test(line)) {
+	        break;
+	      }
+
+	      // Diff index
+	      var header = /^(?:Index:|diff(?: -r \w+)+)\s+(.+?)\s*$/.exec(line);
+	      if (header) {
+	        index.index = header[1];
+	      }
+
+	      i++;
+	    }
+
+	    // Parse file headers if they are defined. Unified diff requires them, but
+	    // there's no technical issues to have an isolated hunk without file header
+	    parseFileHeader(index);
+	    parseFileHeader(index);
+
+	    // Parse hunks
+	    index.hunks = [];
+
+	    while (i < diffstr.length) {
+	      var _line = diffstr[i];
+
+	      if (/^(Index:|diff|\-\-\-|\+\+\+)\s/.test(_line)) {
+	        break;
+	      } else if (/^@@/.test(_line)) {
+	        index.hunks.push(parseHunk());
+	      } else if (_line && options.strict) {
+	        // Ignore unexpected content unless in strict mode
+	        throw new Error('Unknown line ' + (i + 1) + ' ' + JSON.stringify(_line));
+	      } else {
+	        i++;
+	      }
+	    }
+	  }
+
+	  // Parses the --- and +++ headers, if none are found, no lines
+	  // are consumed.
+	  function parseFileHeader(index) {
+	    var fileHeader = /^(---|\+\+\+)\s+(.*)$/.exec(diffstr[i]);
+	    if (fileHeader) {
+	      var keyPrefix = fileHeader[1] === '---' ? 'old' : 'new';
+	      var data = fileHeader[2].split('\t', 2);
+	      var fileName = data[0].replace(/\\\\/g, '\\');
+	      if (/^".*"$/.test(fileName)) {
+	        fileName = fileName.substr(1, fileName.length - 2);
+	      }
+	      index[keyPrefix + 'FileName'] = fileName;
+	      index[keyPrefix + 'Header'] = (data[1] || '').trim();
+
+	      i++;
+	    }
+	  }
+
+	  // Parses a hunk
+	  // This assumes that we are at the start of a hunk.
+	  function parseHunk() {
+	    var chunkHeaderIndex = i,
+	        chunkHeaderLine = diffstr[i++],
+	        chunkHeader = chunkHeaderLine.split(/@@ -(\d+)(?:,(\d+))? \+(\d+)(?:,(\d+))? @@/);
+
+	    var hunk = {
+	      oldStart: +chunkHeader[1],
+	      oldLines: +chunkHeader[2] || 1,
+	      newStart: +chunkHeader[3],
+	      newLines: +chunkHeader[4] || 1,
+	      lines: [],
+	      linedelimiters: []
+	    };
+
+	    var addCount = 0,
+	        removeCount = 0;
+	    for (; i < diffstr.length; i++) {
+	      // Lines starting with '---' could be mistaken for the "remove line" operation
+	      // But they could be the header for the next file. Therefore prune such cases out.
+	      if (diffstr[i].indexOf('--- ') === 0 && i + 2 < diffstr.length && diffstr[i + 1].indexOf('+++ ') === 0 && diffstr[i + 2].indexOf('@@') === 0) {
+	        break;
+	      }
+	      var operation = diffstr[i].length == 0 && i != diffstr.length - 1 ? ' ' : diffstr[i][0];
+
+	      if (operation === '+' || operation === '-' || operation === ' ' || operation === '\\') {
+	        hunk.lines.push(diffstr[i]);
+	        hunk.linedelimiters.push(delimiters[i] || '\n');
+
+	        if (operation === '+') {
+	          addCount++;
+	        } else if (operation === '-') {
+	          removeCount++;
+	        } else if (operation === ' ') {
+	          addCount++;
+	          removeCount++;
+	        }
+	      } else {
+	        break;
+	      }
+	    }
+
+	    // Handle the empty block count case
+	    if (!addCount && hunk.newLines === 1) {
+	      hunk.newLines = 0;
+	    }
+	    if (!removeCount && hunk.oldLines === 1) {
+	      hunk.oldLines = 0;
+	    }
+
+	    // Perform optional sanity checking
+	    if (options.strict) {
+	      if (addCount !== hunk.newLines) {
+	        throw new Error('Added line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+	      }
+	      if (removeCount !== hunk.oldLines) {
+	        throw new Error('Removed line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+	      }
+	    }
+
+	    return hunk;
+	  }
+
+	  while (i < diffstr.length) {
+	    parseIndex();
+	  }
+
+	  return list;
+	}
+
+
+
+/***/ }),
+/* 12 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/"use strict";
+
+	exports.__esModule = true;
+
+	exports["default"] = /*istanbul ignore end*/function (start, minLine, maxLine) {
+	  var wantForward = true,
+	      backwardExhausted = false,
+	      forwardExhausted = false,
+	      localOffset = 1;
+
+	  return function iterator() {
+	    if (wantForward && !forwardExhausted) {
+	      if (backwardExhausted) {
+	        localOffset++;
+	      } else {
+	        wantForward = false;
+	      }
+
+	      // Check if trying to fit beyond text length, and if not, check it fits
+	      // after offset location (or desired location on first iteration)
+	      if (start + localOffset <= maxLine) {
+	        return localOffset;
+	      }
+
+	      forwardExhausted = true;
+	    }
+
+	    if (!backwardExhausted) {
+	      if (!forwardExhausted) {
+	        wantForward = true;
+	      }
+
+	      // Check if trying to fit before text beginning, and if not, check it fits
+	      // before offset location
+	      if (minLine <= start - localOffset) {
+	        return -localOffset++;
+	      }
+
+	      backwardExhausted = true;
+	      return iterator();
+	    }
+
+	    // We tried to fit hunk before text beginning and beyond text length, then
+	    // hunk can't fit on the text. Return undefined
+	  };
+	};
+
+
+
+/***/ }),
+/* 13 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/calcLineCount = calcLineCount;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = merge;
+
+	var /*istanbul ignore start*/_create = __webpack_require__(14) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_parse = __webpack_require__(11) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_array = __webpack_require__(15) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+	/*istanbul ignore end*/function calcLineCount(hunk) {
+	  /*istanbul ignore start*/var _calcOldNewLineCount = /*istanbul ignore end*/calcOldNewLineCount(hunk.lines),
+	      oldLines = _calcOldNewLineCount.oldLines,
+	      newLines = _calcOldNewLineCount.newLines;
+
+	  if (oldLines !== undefined) {
+	    hunk.oldLines = oldLines;
+	  } else {
+	    delete hunk.oldLines;
+	  }
+
+	  if (newLines !== undefined) {
+	    hunk.newLines = newLines;
+	  } else {
+	    delete hunk.newLines;
+	  }
+	}
+
+	function merge(mine, theirs, base) {
+	  mine = loadPatch(mine, base);
+	  theirs = loadPatch(theirs, base);
+
+	  var ret = {};
+
+	  // For index we just let it pass through as it doesn't have any necessary meaning.
+	  // Leaving sanity checks on this to the API consumer that may know more about the
+	  // meaning in their own context.
+	  if (mine.index || theirs.index) {
+	    ret.index = mine.index || theirs.index;
+	  }
+
+	  if (mine.newFileName || theirs.newFileName) {
+	    if (!fileNameChanged(mine)) {
+	      // No header or no change in ours, use theirs (and ours if theirs does not exist)
+	      ret.oldFileName = theirs.oldFileName || mine.oldFileName;
+	      ret.newFileName = theirs.newFileName || mine.newFileName;
+	      ret.oldHeader = theirs.oldHeader || mine.oldHeader;
+	      ret.newHeader = theirs.newHeader || mine.newHeader;
+	    } else if (!fileNameChanged(theirs)) {
+	      // No header or no change in theirs, use ours
+	      ret.oldFileName = mine.oldFileName;
+	      ret.newFileName = mine.newFileName;
+	      ret.oldHeader = mine.oldHeader;
+	      ret.newHeader = mine.newHeader;
+	    } else {
+	      // Both changed... figure it out
+	      ret.oldFileName = selectField(ret, mine.oldFileName, theirs.oldFileName);
+	      ret.newFileName = selectField(ret, mine.newFileName, theirs.newFileName);
+	      ret.oldHeader = selectField(ret, mine.oldHeader, theirs.oldHeader);
+	      ret.newHeader = selectField(ret, mine.newHeader, theirs.newHeader);
+	    }
+	  }
+
+	  ret.hunks = [];
+
+	  var mineIndex = 0,
+	      theirsIndex = 0,
+	      mineOffset = 0,
+	      theirsOffset = 0;
+
+	  while (mineIndex < mine.hunks.length || theirsIndex < theirs.hunks.length) {
+	    var mineCurrent = mine.hunks[mineIndex] || { oldStart: Infinity },
+	        theirsCurrent = theirs.hunks[theirsIndex] || { oldStart: Infinity };
+
+	    if (hunkBefore(mineCurrent, theirsCurrent)) {
+	      // This patch does not overlap with any of the others, yay.
+	      ret.hunks.push(cloneHunk(mineCurrent, mineOffset));
+	      mineIndex++;
+	      theirsOffset += mineCurrent.newLines - mineCurrent.oldLines;
+	    } else if (hunkBefore(theirsCurrent, mineCurrent)) {
+	      // This patch does not overlap with any of the others, yay.
+	      ret.hunks.push(cloneHunk(theirsCurrent, theirsOffset));
+	      theirsIndex++;
+	      mineOffset += theirsCurrent.newLines - theirsCurrent.oldLines;
+	    } else {
+	      // Overlap, merge as best we can
+	      var mergedHunk = {
+	        oldStart: Math.min(mineCurrent.oldStart, theirsCurrent.oldStart),
+	        oldLines: 0,
+	        newStart: Math.min(mineCurrent.newStart + mineOffset, theirsCurrent.oldStart + theirsOffset),
+	        newLines: 0,
+	        lines: []
+	      };
+	      mergeLines(mergedHunk, mineCurrent.oldStart, mineCurrent.lines, theirsCurrent.oldStart, theirsCurrent.lines);
+	      theirsIndex++;
+	      mineIndex++;
+
+	      ret.hunks.push(mergedHunk);
+	    }
+	  }
+
+	  return ret;
+	}
+
+	function loadPatch(param, base) {
+	  if (typeof param === 'string') {
+	    if (/^@@/m.test(param) || /^Index:/m.test(param)) {
+	      return (/*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(param)[0]
+	      );
+	    }
+
+	    if (!base) {
+	      throw new Error('Must provide a base reference or pass in a patch');
+	    }
+	    return (/*istanbul ignore start*/(0, _create.structuredPatch) /*istanbul ignore end*/(undefined, undefined, base, param)
+	    );
+	  }
+
+	  return param;
+	}
+
+	function fileNameChanged(patch) {
+	  return patch.newFileName && patch.newFileName !== patch.oldFileName;
+	}
+
+	function selectField(index, mine, theirs) {
+	  if (mine === theirs) {
+	    return mine;
+	  } else {
+	    index.conflict = true;
+	    return { mine: mine, theirs: theirs };
+	  }
+	}
+
+	function hunkBefore(test, check) {
+	  return test.oldStart < check.oldStart && test.oldStart + test.oldLines < check.oldStart;
+	}
+
+	function cloneHunk(hunk, offset) {
+	  return {
+	    oldStart: hunk.oldStart, oldLines: hunk.oldLines,
+	    newStart: hunk.newStart + offset, newLines: hunk.newLines,
+	    lines: hunk.lines
+	  };
+	}
+
+	function mergeLines(hunk, mineOffset, mineLines, theirOffset, theirLines) {
+	  // This will generally result in a conflicted hunk, but there are cases where the context
+	  // is the only overlap where we can successfully merge the content here.
+	  var mine = { offset: mineOffset, lines: mineLines, index: 0 },
+	      their = { offset: theirOffset, lines: theirLines, index: 0 };
+
+	  // Handle any leading content
+	  insertLeading(hunk, mine, their);
+	  insertLeading(hunk, their, mine);
+
+	  // Now in the overlap content. Scan through and select the best changes from each.
+	  while (mine.index < mine.lines.length && their.index < their.lines.length) {
+	    var mineCurrent = mine.lines[mine.index],
+	        theirCurrent = their.lines[their.index];
+
+	    if ((mineCurrent[0] === '-' || mineCurrent[0] === '+') && (theirCurrent[0] === '-' || theirCurrent[0] === '+')) {
+	      // Both modified ...
+	      mutualChange(hunk, mine, their);
+	    } else if (mineCurrent[0] === '+' && theirCurrent[0] === ' ') {
+	      /*istanbul ignore start*/var _hunk$lines;
+
+	      /*istanbul ignore end*/ // Mine inserted
+	      /*istanbul ignore start*/(_hunk$lines = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(mine)));
+	    } else if (theirCurrent[0] === '+' && mineCurrent[0] === ' ') {
+	      /*istanbul ignore start*/var _hunk$lines2;
+
+	      /*istanbul ignore end*/ // Theirs inserted
+	      /*istanbul ignore start*/(_hunk$lines2 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(their)));
+	    } else if (mineCurrent[0] === '-' && theirCurrent[0] === ' ') {
+	      // Mine removed or edited
+	      removal(hunk, mine, their);
+	    } else if (theirCurrent[0] === '-' && mineCurrent[0] === ' ') {
+	      // Their removed or edited
+	      removal(hunk, their, mine, true);
+	    } else if (mineCurrent === theirCurrent) {
+	      // Context identity
+	      hunk.lines.push(mineCurrent);
+	      mine.index++;
+	      their.index++;
+	    } else {
+	      // Context mismatch
+	      conflict(hunk, collectChange(mine), collectChange(their));
+	    }
+	  }
+
+	  // Now push anything that may be remaining
+	  insertTrailing(hunk, mine);
+	  insertTrailing(hunk, their);
+
+	  calcLineCount(hunk);
+	}
+
+	function mutualChange(hunk, mine, their) {
+	  var myChanges = collectChange(mine),
+	      theirChanges = collectChange(their);
+
+	  if (allRemoves(myChanges) && allRemoves(theirChanges)) {
+	    // Special case for remove changes that are supersets of one another
+	    if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(myChanges, theirChanges) && skipRemoveSuperset(their, myChanges, myChanges.length - theirChanges.length)) {
+	      /*istanbul ignore start*/var _hunk$lines3;
+
+	      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines3 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+	      return;
+	    } else if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(theirChanges, myChanges) && skipRemoveSuperset(mine, theirChanges, theirChanges.length - myChanges.length)) {
+	      /*istanbul ignore start*/var _hunk$lines4;
+
+	      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines4 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines4 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges));
+	      return;
+	    }
+	  } else if ( /*istanbul ignore start*/(0, _array.arrayEqual) /*istanbul ignore end*/(myChanges, theirChanges)) {
+	    /*istanbul ignore start*/var _hunk$lines5;
+
+	    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines5 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines5 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+	    return;
+	  }
+
+	  conflict(hunk, myChanges, theirChanges);
+	}
+
+	function removal(hunk, mine, their, swap) {
+	  var myChanges = collectChange(mine),
+	      theirChanges = collectContext(their, myChanges);
+	  if (theirChanges.merged) {
+	    /*istanbul ignore start*/var _hunk$lines6;
+
+	    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines6 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines6 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges.merged));
+	  } else {
+	    conflict(hunk, swap ? theirChanges : myChanges, swap ? myChanges : theirChanges);
+	  }
+	}
+
+	function conflict(hunk, mine, their) {
+	  hunk.conflict = true;
+	  hunk.lines.push({
+	    conflict: true,
+	    mine: mine,
+	    theirs: their
+	  });
+	}
+
+	function insertLeading(hunk, insert, their) {
+	  while (insert.offset < their.offset && insert.index < insert.lines.length) {
+	    var line = insert.lines[insert.index++];
+	    hunk.lines.push(line);
+	    insert.offset++;
+	  }
+	}
+	function insertTrailing(hunk, insert) {
+	  while (insert.index < insert.lines.length) {
+	    var line = insert.lines[insert.index++];
+	    hunk.lines.push(line);
+	  }
+	}
+
+	function collectChange(state) {
+	  var ret = [],
+	      operation = state.lines[state.index][0];
+	  while (state.index < state.lines.length) {
+	    var line = state.lines[state.index];
+
+	    // Group additions that are immediately after subtractions and treat them as one "atomic" modify change.
+	    if (operation === '-' && line[0] === '+') {
+	      operation = '+';
+	    }
+
+	    if (operation === line[0]) {
+	      ret.push(line);
+	      state.index++;
+	    } else {
+	      break;
+	    }
+	  }
+
+	  return ret;
+	}
+	function collectContext(state, matchChanges) {
+	  var changes = [],
+	      merged = [],
+	      matchIndex = 0,
+	      contextChanges = false,
+	      conflicted = false;
+	  while (matchIndex < matchChanges.length && state.index < state.lines.length) {
+	    var change = state.lines[state.index],
+	        match = matchChanges[matchIndex];
+
+	    // Once we've hit our add, then we are done
+	    if (match[0] === '+') {
+	      break;
+	    }
+
+	    contextChanges = contextChanges || change[0] !== ' ';
+
+	    merged.push(match);
+	    matchIndex++;
+
+	    // Consume any additions in the other block as a conflict to attempt
+	    // to pull in the remaining context after this
+	    if (change[0] === '+') {
+	      conflicted = true;
+
+	      while (change[0] === '+') {
+	        changes.push(change);
+	        change = state.lines[++state.index];
+	      }
+	    }
+
+	    if (match.substr(1) === change.substr(1)) {
+	      changes.push(change);
+	      state.index++;
+	    } else {
+	      conflicted = true;
+	    }
+	  }
+
+	  if ((matchChanges[matchIndex] || '')[0] === '+' && contextChanges) {
+	    conflicted = true;
+	  }
+
+	  if (conflicted) {
+	    return changes;
+	  }
+
+	  while (matchIndex < matchChanges.length) {
+	    merged.push(matchChanges[matchIndex++]);
+	  }
+
+	  return {
+	    merged: merged,
+	    changes: changes
+	  };
+	}
+
+	function allRemoves(changes) {
+	  return changes.reduce(function (prev, change) {
+	    return prev && change[0] === '-';
+	  }, true);
+	}
+	function skipRemoveSuperset(state, removeChanges, delta) {
+	  for (var i = 0; i < delta; i++) {
+	    var changeContent = removeChanges[removeChanges.length - delta + i].substr(1);
+	    if (state.lines[state.index + i] !== ' ' + changeContent) {
+	      return false;
+	    }
+	  }
+
+	  state.index += delta;
+	  return true;
+	}
+
+	function calcOldNewLineCount(lines) {
+	  var oldLines = 0;
+	  var newLines = 0;
+
+	  lines.forEach(function (line) {
+	    if (typeof line !== 'string') {
+	      var myCount = calcOldNewLineCount(line.mine);
+	      var theirCount = calcOldNewLineCount(line.theirs);
+
+	      if (oldLines !== undefined) {
+	        if (myCount.oldLines === theirCount.oldLines) {
+	          oldLines += myCount.oldLines;
+	        } else {
+	          oldLines = undefined;
+	        }
+	      }
+
+	      if (newLines !== undefined) {
+	        if (myCount.newLines === theirCount.newLines) {
+	          newLines += myCount.newLines;
+	        } else {
+	          newLines = undefined;
+	        }
+	      }
+	    } else {
+	      if (newLines !== undefined && (line[0] === '+' || line[0] === ' ')) {
+	        newLines++;
+	      }
+	      if (oldLines !== undefined && (line[0] === '-' || line[0] === ' ')) {
+	        oldLines++;
+	      }
+	    }
+	  });
+
+	  return { oldLines: oldLines, newLines: newLines };
+	}
+
+
+
+/***/ }),
+/* 14 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/structuredPatch = structuredPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = createTwoFilesPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = createPatch;
+
+	var /*istanbul ignore start*/_line = __webpack_require__(5) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+	/*istanbul ignore end*/function structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+	  if (!options) {
+	    options = {};
+	  }
+	  if (typeof options.context === 'undefined') {
+	    options.context = 4;
+	  }
+
+	  var diff = /*istanbul ignore start*/(0, _line.diffLines) /*istanbul ignore end*/(oldStr, newStr, options);
+	  diff.push({ value: '', lines: [] }); // Append an empty value to make cleanup easier
+
+	  function contextLines(lines) {
+	    return lines.map(function (entry) {
+	      return ' ' + entry;
+	    });
+	  }
+
+	  var hunks = [];
+	  var oldRangeStart = 0,
+	      newRangeStart = 0,
+	      curRange = [],
+	      oldLine = 1,
+	      newLine = 1;
+
+	  /*istanbul ignore start*/var _loop = function _loop( /*istanbul ignore end*/i) {
+	    var current = diff[i],
+	        lines = current.lines || current.value.replace(/\n$/, '').split('\n');
+	    current.lines = lines;
+
+	    if (current.added || current.removed) {
+	      /*istanbul ignore start*/var _curRange;
+
+	      /*istanbul ignore end*/ // If we have previous context, start with that
+	      if (!oldRangeStart) {
+	        var prev = diff[i - 1];
+	        oldRangeStart = oldLine;
+	        newRangeStart = newLine;
+
+	        if (prev) {
+	          curRange = options.context > 0 ? contextLines(prev.lines.slice(-options.context)) : [];
+	          oldRangeStart -= curRange.length;
+	          newRangeStart -= curRange.length;
+	        }
+	      }
+
+	      // Output our changes
+	      /*istanbul ignore start*/(_curRange = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/lines.map(function (entry) {
+	        return (current.added ? '+' : '-') + entry;
+	      })));
+
+	      // Track the updated file position
+	      if (current.added) {
+	        newLine += lines.length;
+	      } else {
+	        oldLine += lines.length;
+	      }
+	    } else {
+	      // Identical context lines. Track line changes
+	      if (oldRangeStart) {
+	        // Close out any changes that have been output (or join overlapping)
+	        if (lines.length <= options.context * 2 && i < diff.length - 2) {
+	          /*istanbul ignore start*/var _curRange2;
+
+	          /*istanbul ignore end*/ // Overlapping
+	          /*istanbul ignore start*/(_curRange2 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines)));
+	        } else {
+	          /*istanbul ignore start*/var _curRange3;
+
+	          /*istanbul ignore end*/ // end the range and output
+	          var contextSize = Math.min(lines.length, options.context);
+	          /*istanbul ignore start*/(_curRange3 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines.slice(0, contextSize))));
+
+	          var hunk = {
+	            oldStart: oldRangeStart,
+	            oldLines: oldLine - oldRangeStart + contextSize,
+	            newStart: newRangeStart,
+	            newLines: newLine - newRangeStart + contextSize,
+	            lines: curRange
+	          };
+	          if (i >= diff.length - 2 && lines.length <= options.context) {
+	            // EOF is inside this hunk
+	            var oldEOFNewline = /\n$/.test(oldStr);
+	            var newEOFNewline = /\n$/.test(newStr);
+	            if (lines.length == 0 && !oldEOFNewline) {
+	              // special case: old has no eol and no trailing context; no-nl can end up before adds
+	              curRange.splice(hunk.oldLines, 0, '\\ No newline at end of file');
+	            } else if (!oldEOFNewline || !newEOFNewline) {
+	              curRange.push('\\ No newline at end of file');
+	            }
+	          }
+	          hunks.push(hunk);
+
+	          oldRangeStart = 0;
+	          newRangeStart = 0;
+	          curRange = [];
+	        }
+	      }
+	      oldLine += lines.length;
+	      newLine += lines.length;
+	    }
+	  };
+
+	  for (var i = 0; i < diff.length; i++) {
+	    /*istanbul ignore start*/_loop( /*istanbul ignore end*/i);
+	  }
+
+	  return {
+	    oldFileName: oldFileName, newFileName: newFileName,
+	    oldHeader: oldHeader, newHeader: newHeader,
+	    hunks: hunks
+	  };
+	}
+
+	function createTwoFilesPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+	  var diff = structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options);
+
+	  var ret = [];
+	  if (oldFileName == newFileName) {
+	    ret.push('Index: ' + oldFileName);
+	  }
+	  ret.push('===================================================================');
+	  ret.push('--- ' + diff.oldFileName + (typeof diff.oldHeader === 'undefined' ? '' : '\t' + diff.oldHeader));
+	  ret.push('+++ ' + diff.newFileName + (typeof diff.newHeader === 'undefined' ? '' : '\t' + diff.newHeader));
+
+	  for (var i = 0; i < diff.hunks.length; i++) {
+	    var hunk = diff.hunks[i];
+	    ret.push('@@ -' + hunk.oldStart + ',' + hunk.oldLines + ' +' + hunk.newStart + ',' + hunk.newLines + ' @@');
+	    ret.push.apply(ret, hunk.lines);
+	  }
+
+	  return ret.join('\n') + '\n';
+	}
+
+	function createPatch(fileName, oldStr, newStr, oldHeader, newHeader, options) {
+	  return createTwoFilesPatch(fileName, fileName, oldStr, newStr, oldHeader, newHeader, options);
+	}
+
+
+
+/***/ }),
+/* 15 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/"use strict";
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/arrayEqual = arrayEqual;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/arrayStartsWith = arrayStartsWith;
+	function arrayEqual(a, b) {
+	  if (a.length !== b.length) {
+	    return false;
+	  }
+
+	  return arrayStartsWith(a, b);
+	}
+
+	function arrayStartsWith(array, start) {
+	  if (start.length > array.length) {
+	    return false;
+	  }
+
+	  for (var i = 0; i < start.length; i++) {
+	    if (start[i] !== array[i]) {
+	      return false;
+	    }
+	  }
+
+	  return true;
+	}
+
+
+
+/***/ }),
+/* 16 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/"use strict";
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/convertChangesToDMP = convertChangesToDMP;
+	// See: http://code.google.com/p/google-diff-match-patch/wiki/API
+	function convertChangesToDMP(changes) {
+	  var ret = [],
+	      change = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+	      operation = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+	  for (var i = 0; i < changes.length; i++) {
+	    change = changes[i];
+	    if (change.added) {
+	      operation = 1;
+	    } else if (change.removed) {
+	      operation = -1;
+	    } else {
+	      operation = 0;
+	    }
+
+	    ret.push([operation, change.value]);
+	  }
+	  return ret;
+	}
+
+
+
+/***/ }),
+/* 17 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/convertChangesToXML = convertChangesToXML;
+	function convertChangesToXML(changes) {
+	  var ret = [];
+	  for (var i = 0; i < changes.length; i++) {
+	    var change = changes[i];
+	    if (change.added) {
+	      ret.push('<ins>');
+	    } else if (change.removed) {
+	      ret.push('<del>');
+	    }
+
+	    ret.push(escapeHTML(change.value));
+
+	    if (change.added) {
+	      ret.push('</ins>');
+	    } else if (change.removed) {
+	      ret.push('</del>');
+	    }
+	  }
+	  return ret.join('');
+	}
+
+	function escapeHTML(s) {
+	  var n = s;
+	  n = n.replace(/&/g, '&amp;');
+	  n = n.replace(/</g, '&lt;');
+	  n = n.replace(/>/g, '&gt;');
+	  n = n.replace(/"/g, '&quot;');
+
+	  return n;
+	}
+
+
+
+/***/ })
+/******/ ])
+});
+;
+},{}],49:[function(require,module,exports){
+'use strict';
+
+var matchOperatorsRe = /[|\\{}()[\]^$+*?.]/g;
+
+module.exports = function (str) {
+	if (typeof str !== 'string') {
+		throw new TypeError('Expected a string');
+	}
+
+	return str.replace(matchOperatorsRe, '\\$&');
+};
+
+},{}],50:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+var objectCreate = Object.create || objectCreatePolyfill
+var objectKeys = Object.keys || objectKeysPolyfill
+var bind = Function.prototype.bind || functionBindPolyfill
+
+function EventEmitter() {
+  if (!this._events || !Object.prototype.hasOwnProperty.call(this, '_events')) {
+    this._events = objectCreate(null);
+    this._eventsCount = 0;
+  }
+
+  this._maxListeners = this._maxListeners || undefined;
+}
+module.exports = EventEmitter;
+
+// Backwards-compat with node 0.10.x
+EventEmitter.EventEmitter = EventEmitter;
+
+EventEmitter.prototype._events = undefined;
+EventEmitter.prototype._maxListeners = undefined;
+
+// By default EventEmitters will print a warning if more than 10 listeners are
+// added to it. This is a useful default which helps finding memory leaks.
+var defaultMaxListeners = 10;
+
+var hasDefineProperty;
+try {
+  var o = {};
+  if (Object.defineProperty) Object.defineProperty(o, 'x', { value: 0 });
+  hasDefineProperty = o.x === 0;
+} catch (err) { hasDefineProperty = false }
+if (hasDefineProperty) {
+  Object.defineProperty(EventEmitter, 'defaultMaxListeners', {
+    enumerable: true,
+    get: function() {
+      return defaultMaxListeners;
+    },
+    set: function(arg) {
+      // check whether the input is a positive number (whose value is zero or
+      // greater and not a NaN).
+      if (typeof arg !== 'number' || arg < 0 || arg !== arg)
+        throw new TypeError('"defaultMaxListeners" must be a positive number');
+      defaultMaxListeners = arg;
+    }
+  });
+} else {
+  EventEmitter.defaultMaxListeners = defaultMaxListeners;
+}
+
+// Obviously not all Emitters should be limited to 10. This function allows
+// that to be increased. Set to zero for unlimited.
+EventEmitter.prototype.setMaxListeners = function setMaxListeners(n) {
+  if (typeof n !== 'number' || n < 0 || isNaN(n))
+    throw new TypeError('"n" argument must be a positive number');
+  this._maxListeners = n;
+  return this;
+};
+
+function $getMaxListeners(that) {
+  if (that._maxListeners === undefined)
+    return EventEmitter.defaultMaxListeners;
+  return that._maxListeners;
+}
+
+EventEmitter.prototype.getMaxListeners = function getMaxListeners() {
+  return $getMaxListeners(this);
+};
+
+// These standalone emit* functions are used to optimize calling of event
+// handlers for fast cases because emit() itself often has a variable number of
+// arguments and can be deoptimized because of that. These functions always have
+// the same number of arguments and thus do not get deoptimized, so the code
+// inside them can execute faster.
+function emitNone(handler, isFn, self) {
+  if (isFn)
+    handler.call(self);
+  else {
+    var len = handler.length;
+    var listeners = arrayClone(handler, len);
+    for (var i = 0; i < len; ++i)
+      listeners[i].call(self);
+  }
+}
+function emitOne(handler, isFn, self, arg1) {
+  if (isFn)
+    handler.call(self, arg1);
+  else {
+    var len = handler.length;
+    var listeners = arrayClone(handler, len);
+    for (var i = 0; i < len; ++i)
+      listeners[i].call(self, arg1);
+  }
+}
+function emitTwo(handler, isFn, self, arg1, arg2) {
+  if (isFn)
+    handler.call(self, arg1, arg2);
+  else {
+    var len = handler.length;
+    var listeners = arrayClone(handler, len);
+    for (var i = 0; i < len; ++i)
+      listeners[i].call(self, arg1, arg2);
+  }
+}
+function emitThree(handler, isFn, self, arg1, arg2, arg3) {
+  if (isFn)
+    handler.call(self, arg1, arg2, arg3);
+  else {
+    var len = handler.length;
+    var listeners = arrayClone(handler, len);
+    for (var i = 0; i < len; ++i)
+      listeners[i].call(self, arg1, arg2, arg3);
+  }
+}
+
+function emitMany(handler, isFn, self, args) {
+  if (isFn)
+    handler.apply(self, args);
+  else {
+    var len = handler.length;
+    var listeners = arrayClone(handler, len);
+    for (var i = 0; i < len; ++i)
+      listeners[i].apply(self, args);
+  }
+}
+
+EventEmitter.prototype.emit = function emit(type) {
+  var er, handler, len, args, i, events;
+  var doError = (type === 'error');
+
+  events = this._events;
+  if (events)
+    doError = (doError && events.error == null);
+  else if (!doError)
+    return false;
+
+  // If there is no 'error' event listener then throw.
+  if (doError) {
+    if (arguments.length > 1)
+      er = arguments[1];
+    if (er instanceof Error) {
+      throw er; // Unhandled 'error' event
+    } else {
+      // At least give some kind of context to the user
+      var err = new Error('Unhandled "error" event. (' + er + ')');
+      err.context = er;
+      throw err;
+    }
+    return false;
+  }
+
+  handler = events[type];
+
+  if (!handler)
+    return false;
+
+  var isFn = typeof handler === 'function';
+  len = arguments.length;
+  switch (len) {
+      // fast cases
+    case 1:
+      emitNone(handler, isFn, this);
+      break;
+    case 2:
+      emitOne(handler, isFn, this, arguments[1]);
+      break;
+    case 3:
+      emitTwo(handler, isFn, this, arguments[1], arguments[2]);
+      break;
+    case 4:
+      emitThree(handler, isFn, this, arguments[1], arguments[2], arguments[3]);
+      break;
+      // slower
+    default:
+      args = new Array(len - 1);
+      for (i = 1; i < len; i++)
+        args[i - 1] = arguments[i];
+      emitMany(handler, isFn, this, args);
+  }
+
+  return true;
+};
+
+function _addListener(target, type, listener, prepend) {
+  var m;
+  var events;
+  var existing;
+
+  if (typeof listener !== 'function')
+    throw new TypeError('"listener" argument must be a function');
+
+  events = target._events;
+  if (!events) {
+    events = target._events = objectCreate(null);
+    target._eventsCount = 0;
+  } else {
+    // To avoid recursion in the case that type === "newListener"! Before
+    // adding it to the listeners, first emit "newListener".
+    if (events.newListener) {
+      target.emit('newListener', type,
+          listener.listener ? listener.listener : listener);
+
+      // Re-assign `events` because a newListener handler could have caused the
+      // this._events to be assigned to a new object
+      events = target._events;
+    }
+    existing = events[type];
+  }
+
+  if (!existing) {
+    // Optimize the case of one listener. Don't need the extra array object.
+    existing = events[type] = listener;
+    ++target._eventsCount;
+  } else {
+    if (typeof existing === 'function') {
+      // Adding the second element, need to change to array.
+      existing = events[type] =
+          prepend ? [listener, existing] : [existing, listener];
+    } else {
+      // If we've already got an array, just append.
+      if (prepend) {
+        existing.unshift(listener);
+      } else {
+        existing.push(listener);
+      }
+    }
+
+    // Check for listener leak
+    if (!existing.warned) {
+      m = $getMaxListeners(target);
+      if (m && m > 0 && existing.length > m) {
+        existing.warned = true;
+        var w = new Error('Possible EventEmitter memory leak detected. ' +
+            existing.length + ' "' + String(type) + '" listeners ' +
+            'added. Use emitter.setMaxListeners() to ' +
+            'increase limit.');
+        w.name = 'MaxListenersExceededWarning';
+        w.emitter = target;
+        w.type = type;
+        w.count = existing.length;
+        if (typeof console === 'object' && console.warn) {
+          console.warn('%s: %s', w.name, w.message);
+        }
+      }
+    }
+  }
+
+  return target;
+}
+
+EventEmitter.prototype.addListener = function addListener(type, listener) {
+  return _addListener(this, type, listener, false);
+};
+
+EventEmitter.prototype.on = EventEmitter.prototype.addListener;
+
+EventEmitter.prototype.prependListener =
+    function prependListener(type, listener) {
+      return _addListener(this, type, listener, true);
+    };
+
+function onceWrapper() {
+  if (!this.fired) {
+    this.target.removeListener(this.type, this.wrapFn);
+    this.fired = true;
+    switch (arguments.length) {
+      case 0:
+        return this.listener.call(this.target);
+      case 1:
+        return this.listener.call(this.target, arguments[0]);
+      case 2:
+        return this.listener.call(this.target, arguments[0], arguments[1]);
+      case 3:
+        return this.listener.call(this.target, arguments[0], arguments[1],
+            arguments[2]);
+      default:
+        var args = new Array(arguments.length);
+        for (var i = 0; i < args.length; ++i)
+          args[i] = arguments[i];
+        this.listener.apply(this.target, args);
+    }
+  }
+}
+
+function _onceWrap(target, type, listener) {
+  var state = { fired: false, wrapFn: undefined, target: target, type: type, listener: listener };
+  var wrapped = bind.call(onceWrapper, state);
+  wrapped.listener = listener;
+  state.wrapFn = wrapped;
+  return wrapped;
+}
+
+EventEmitter.prototype.once = function once(type, listener) {
+  if (typeof listener !== 'function')
+    throw new TypeError('"listener" argument must be a function');
+  this.on(type, _onceWrap(this, type, listener));
+  return this;
+};
+
+EventEmitter.prototype.prependOnceListener =
+    function prependOnceListener(type, listener) {
+      if (typeof listener !== 'function')
+        throw new TypeError('"listener" argument must be a function');
+      this.prependListener(type, _onceWrap(this, type, listener));
+      return this;
+    };
+
+// Emits a 'removeListener' event if and only if the listener was removed.
+EventEmitter.prototype.removeListener =
+    function removeListener(type, listener) {
+      var list, events, position, i, originalListener;
+
+      if (typeof listener !== 'function')
+        throw new TypeError('"listener" argument must be a function');
+
+      events = this._events;
+      if (!events)
+        return this;
+
+      list = events[type];
+      if (!list)
+        return this;
+
+      if (list === listener || list.listener === listener) {
+        if (--this._eventsCount === 0)
+          this._events = objectCreate(null);
+        else {
+          delete events[type];
+          if (events.removeListener)
+            this.emit('removeListener', type, list.listener || listener);
+        }
+      } else if (typeof list !== 'function') {
+        position = -1;
+
+        for (i = list.length - 1; i >= 0; i--) {
+          if (list[i] === listener || list[i].listener === listener) {
+            originalListener = list[i].listener;
+            position = i;
+            break;
+          }
+        }
+
+        if (position < 0)
+          return this;
+
+        if (position === 0)
+          list.shift();
+        else
+          spliceOne(list, position);
+
+        if (list.length === 1)
+          events[type] = list[0];
+
+        if (events.removeListener)
+          this.emit('removeListener', type, originalListener || listener);
+      }
+
+      return this;
+    };
+
+EventEmitter.prototype.removeAllListeners =
+    function removeAllListeners(type) {
+      var listeners, events, i;
+
+      events = this._events;
+      if (!events)
+        return this;
+
+      // not listening for removeListener, no need to emit
+      if (!events.removeListener) {
+        if (arguments.length === 0) {
+          this._events = objectCreate(null);
+          this._eventsCount = 0;
+        } else if (events[type]) {
+          if (--this._eventsCount === 0)
+            this._events = objectCreate(null);
+          else
+            delete events[type];
+        }
+        return this;
+      }
+
+      // emit removeListener for all listeners on all events
+      if (arguments.length === 0) {
+        var keys = objectKeys(events);
+        var key;
+        for (i = 0; i < keys.length; ++i) {
+          key = keys[i];
+          if (key === 'removeListener') continue;
+          this.removeAllListeners(key);
+        }
+        this.removeAllListeners('removeListener');
+        this._events = objectCreate(null);
+        this._eventsCount = 0;
+        return this;
+      }
+
+      listeners = events[type];
+
+      if (typeof listeners === 'function') {
+        this.removeListener(type, listeners);
+      } else if (listeners) {
+        // LIFO order
+        for (i = listeners.length - 1; i >= 0; i--) {
+          this.removeListener(type, listeners[i]);
+        }
+      }
+
+      return this;
+    };
+
+function _listeners(target, type, unwrap) {
+  var events = target._events;
+
+  if (!events)
+    return [];
+
+  var evlistener = events[type];
+  if (!evlistener)
+    return [];
+
+  if (typeof evlistener === 'function')
+    return unwrap ? [evlistener.listener || evlistener] : [evlistener];
+
+  return unwrap ? unwrapListeners(evlistener) : arrayClone(evlistener, evlistener.length);
+}
+
+EventEmitter.prototype.listeners = function listeners(type) {
+  return _listeners(this, type, true);
+};
+
+EventEmitter.prototype.rawListeners = function rawListeners(type) {
+  return _listeners(this, type, false);
+};
+
+EventEmitter.listenerCount = function(emitter, type) {
+  if (typeof emitter.listenerCount === 'function') {
+    return emitter.listenerCount(type);
+  } else {
+    return listenerCount.call(emitter, type);
+  }
+};
+
+EventEmitter.prototype.listenerCount = listenerCount;
+function listenerCount(type) {
+  var events = this._events;
+
+  if (events) {
+    var evlistener = events[type];
+
+    if (typeof evlistener === 'function') {
+      return 1;
+    } else if (evlistener) {
+      return evlistener.length;
+    }
+  }
+
+  return 0;
+}
+
+EventEmitter.prototype.eventNames = function eventNames() {
+  return this._eventsCount > 0 ? Reflect.ownKeys(this._events) : [];
+};
+
+// About 1.5x faster than the two-arg version of Array#splice().
+function spliceOne(list, index) {
+  for (var i = index, k = i + 1, n = list.length; k < n; i += 1, k += 1)
+    list[i] = list[k];
+  list.pop();
+}
+
+function arrayClone(arr, n) {
+  var copy = new Array(n);
+  for (var i = 0; i < n; ++i)
+    copy[i] = arr[i];
+  return copy;
+}
+
+function unwrapListeners(arr) {
+  var ret = new Array(arr.length);
+  for (var i = 0; i < ret.length; ++i) {
+    ret[i] = arr[i].listener || arr[i];
+  }
+  return ret;
+}
+
+function objectCreatePolyfill(proto) {
+  var F = function() {};
+  F.prototype = proto;
+  return new F;
+}
+function objectKeysPolyfill(obj) {
+  var keys = [];
+  for (var k in obj) if (Object.prototype.hasOwnProperty.call(obj, k)) {
+    keys.push(k);
+  }
+  return k;
+}
+function functionBindPolyfill(context) {
+  var fn = this;
+  return function () {
+    return fn.apply(context, arguments);
+  };
+}
+
+},{}],51:[function(require,module,exports){
+'use strict';
+
+/* eslint no-invalid-this: 1 */
+
+var ERROR_MESSAGE = 'Function.prototype.bind called on incompatible ';
+var slice = Array.prototype.slice;
+var toStr = Object.prototype.toString;
+var funcType = '[object Function]';
+
+module.exports = function bind(that) {
+    var target = this;
+    if (typeof target !== 'function' || toStr.call(target) !== funcType) {
+        throw new TypeError(ERROR_MESSAGE + target);
+    }
+    var args = slice.call(arguments, 1);
+
+    var bound;
+    var binder = function () {
+        if (this instanceof bound) {
+            var result = target.apply(
+                this,
+                args.concat(slice.call(arguments))
+            );
+            if (Object(result) === result) {
+                return result;
+            }
+            return this;
+        } else {
+            return target.apply(
+                that,
+                args.concat(slice.call(arguments))
+            );
+        }
+    };
+
+    var boundLength = Math.max(0, target.length - args.length);
+    var boundArgs = [];
+    for (var i = 0; i < boundLength; i++) {
+        boundArgs.push('$' + i);
+    }
+
+    bound = Function('binder', 'return function (' + boundArgs.join(',') + '){ return binder.apply(this,arguments); }')(binder);
+
+    if (target.prototype) {
+        var Empty = function Empty() {};
+        Empty.prototype = target.prototype;
+        bound.prototype = new Empty();
+        Empty.prototype = null;
+    }
+
+    return bound;
+};
+
+},{}],52:[function(require,module,exports){
+'use strict';
+
+var implementation = require('./implementation');
+
+module.exports = Function.prototype.bind || implementation;
+
+},{"./implementation":51}],53:[function(require,module,exports){
+'use strict';
+
+/* eslint complexity: [2, 17], max-statements: [2, 33] */
+module.exports = function hasSymbols() {
+	if (typeof Symbol !== 'function' || typeof Object.getOwnPropertySymbols !== 'function') { return false; }
+	if (typeof Symbol.iterator === 'symbol') { return true; }
+
+	var obj = {};
+	var sym = Symbol('test');
+	var symObj = Object(sym);
+	if (typeof sym === 'string') { return false; }
+
+	if (Object.prototype.toString.call(sym) !== '[object Symbol]') { return false; }
+	if (Object.prototype.toString.call(symObj) !== '[object Symbol]') { return false; }
+
+	// temp disabled per https://github.com/ljharb/object.assign/issues/17
+	// if (sym instanceof Symbol) { return false; }
+	// temp disabled per https://github.com/WebReflection/get-own-property-symbols/issues/4
+	// if (!(symObj instanceof Symbol)) { return false; }
+
+	// if (typeof Symbol.prototype.toString !== 'function') { return false; }
+	// if (String(sym) !== Symbol.prototype.toString.call(sym)) { return false; }
+
+	var symVal = 42;
+	obj[sym] = symVal;
+	for (sym in obj) { return false; } // eslint-disable-line no-restricted-syntax
+	if (typeof Object.keys === 'function' && Object.keys(obj).length !== 0) { return false; }
+
+	if (typeof Object.getOwnPropertyNames === 'function' && Object.getOwnPropertyNames(obj).length !== 0) { return false; }
+
+	var syms = Object.getOwnPropertySymbols(obj);
+	if (syms.length !== 1 || syms[0] !== sym) { return false; }
+
+	if (!Object.prototype.propertyIsEnumerable.call(obj, sym)) { return false; }
+
+	if (typeof Object.getOwnPropertyDescriptor === 'function') {
+		var descriptor = Object.getOwnPropertyDescriptor(obj, sym);
+		if (descriptor.value !== symVal || descriptor.enumerable !== true) { return false; }
+	}
+
+	return true;
+};
+
+},{}],54:[function(require,module,exports){
+(function (global){
+/*! https://mths.be/he v1.2.0 by @mathias | MIT license */
+;(function(root) {
+
+	// Detect free variables `exports`.
+	var freeExports = typeof exports == 'object' && exports;
+
+	// Detect free variable `module`.
+	var freeModule = typeof module == 'object' && module &&
+		module.exports == freeExports && module;
+
+	// Detect free variable `global`, from Node.js or Browserified code,
+	// and use it as `root`.
+	var freeGlobal = typeof global == 'object' && global;
+	if (freeGlobal.global === freeGlobal || freeGlobal.window === freeGlobal) {
+		root = freeGlobal;
+	}
+
+	/*--------------------------------------------------------------------------*/
+
+	// All astral symbols.
+	var regexAstralSymbols = /[\uD800-\uDBFF][\uDC00-\uDFFF]/g;
+	// All ASCII symbols (not just printable ASCII) except those listed in the
+	// first column of the overrides table.
+	// https://html.spec.whatwg.org/multipage/syntax.html#table-charref-overrides
+	var regexAsciiWhitelist = /[\x01-\x7F]/g;
+	// All BMP symbols that are not ASCII newlines, printable ASCII symbols, or
+	// code points listed in the first column of the overrides table on
+	// https://html.spec.whatwg.org/multipage/syntax.html#table-charref-overrides.
+	var regexBmpWhitelist = /[\x01-\t\x0B\f\x0E-\x1F\x7F\x81\x8D\x8F\x90\x9D\xA0-\uFFFF]/g;
+
+	var regexEncodeNonAscii = /<\u20D2|=\u20E5|>\u20D2|\u205F\u200A|\u219D\u0338|\u2202\u0338|\u2220\u20D2|\u2229\uFE00|\u222A\uFE00|\u223C\u20D2|\u223D\u0331|\u223E\u0333|\u2242\u0338|\u224B\u0338|\u224D\u20D2|\u224E\u0338|\u224F\u0338|\u2250\u0338|\u2261\u20E5|\u2264\u20D2|\u2265\u20D2|\u2266\u0338|\u2267\u0338|\u2268\uFE00|\u2269\uFE00|\u226A\u0338|\u226A\u20D2|\u226B\u0338|\u226B\u20D2|\u227F\u0338|\u2282\u20D2|\u2283\u20D2|\u228A\uFE00|\u228B\uFE00|\u228F\u0338|\u2290\u0338|\u2293\uFE00|\u2294\uFE00|\u22B4\u20D2|\u22B5\u20D2|\u22D8\u0338|\u22D9\u0338|\u22DA\uFE00|\u22DB\uFE00|\u22F5\u0338|\u22F9\u0338|\u2933\u0338|\u29CF\u0338|\u29D0\u0338|\u2A6D\u0338|\u2A70\u0338|\u2A7D\u0338|\u2A7E\u0338|\u2AA1\u0338|\u2AA2\u0338|\u2AAC\uFE00|\u2AAD\uFE00|\u2AAF\u0338|\u2AB0\u0338|\u2AC5\u0338|\u2AC6\u0338|\u2ACB\uFE00|\u2ACC\uFE00|\u2AFD\u20E5|[\xA0-\u0113\u0116-\u0122\u0124-\u012B\u012E-\u014D\u0150-\u017E\u0192\u01B5\u01F5\u0237\u02C6\u02C7\u02D8-\u02DD\u0311\u0391-\u03A1\u03A3-\u03A9\u03B1-\u03C9\u03D1\u03D2\u03D5\u03D6\u03DC\u03DD\u03F0\u03F1\u03F5\u03F6\u0401-\u040C\u040E-\u044F\u0451-\u045C\u045E\u045F\u2002-\u2005\u2007-\u2010\u2013-\u2016\u2018-\u201A\u201C-\u201E\u2020-\u2022\u2025\u2026\u2030-\u2035\u2039\u203A\u203E\u2041\u2043\u2044\u204F\u2057\u205F-\u2063\u20AC\u20DB\u20DC\u2102\u2105\u210A-\u2113\u2115-\u211E\u2122\u2124\u2127-\u2129\u212C\u212D\u212F-\u2131\u2133-\u2138\u2145-\u2148\u2153-\u215E\u2190-\u219B\u219D-\u21A7\u21A9-\u21AE\u21B0-\u21B3\u21B5-\u21B7\u21BA-\u21DB\u21DD\u21E4\u21E5\u21F5\u21FD-\u2205\u2207-\u2209\u220B\u220C\u220F-\u2214\u2216-\u2218\u221A\u221D-\u2238\u223A-\u2257\u2259\u225A\u225C\u225F-\u2262\u2264-\u228B\u228D-\u229B\u229D-\u22A5\u22A7-\u22B0\u22B2-\u22BB\u22BD-\u22DB\u22DE-\u22E3\u22E6-\u22F7\u22F9-\u22FE\u2305\u2306\u2308-\u2310\u2312\u2313\u2315\u2316\u231C-\u231F\u2322\u2323\u232D\u232E\u2336\u233D\u233F\u237C\u23B0\u23B1\u23B4-\u23B6\u23DC-\u23DF\u23E2\u23E7\u2423\u24C8\u2500\u2502\u250C\u2510\u2514\u2518\u251C\u2524\u252C\u2534\u253C\u2550-\u256C\u2580\u2584\u2588\u2591-\u2593\u25A1\u25AA\u25AB\u25AD\u25AE\u25B1\u25B3-\u25B5\u25B8\u25B9\u25BD-\u25BF\u25C2\u25C3\u25CA\u25CB\u25EC\u25EF\u25F8-\u25FC\u2605\u2606\u260E\u2640\u2642\u2660\u2663\u2665\u2666\u266A\u266D-\u266F\u2713\u2717\u2720\u2736\u2758\u2772\u2773\u27C8\u27C9\u27E6-\u27ED\u27F5-\u27FA\u27FC\u27FF\u2902-\u2905\u290C-\u2913\u2916\u2919-\u2920\u2923-\u292A\u2933\u2935-\u2939\u293C\u293D\u2945\u2948-\u294B\u294E-\u2976\u2978\u2979\u297B-\u297F\u2985\u2986\u298B-\u2996\u299A\u299C\u299D\u29A4-\u29B7\u29B9\u29BB\u29BC\u29BE-\u29C5\u29C9\u29CD-\u29D0\u29DC-\u29DE\u29E3-\u29E5\u29EB\u29F4\u29F6\u2A00-\u2A02\u2A04\u2A06\u2A0C\u2A0D\u2A10-\u2A17\u2A22-\u2A27\u2A29\u2A2A\u2A2D-\u2A31\u2A33-\u2A3C\u2A3F\u2A40\u2A42-\u2A4D\u2A50\u2A53-\u2A58\u2A5A-\u2A5D\u2A5F\u2A66\u2A6A\u2A6D-\u2A75\u2A77-\u2A9A\u2A9D-\u2AA2\u2AA4-\u2AB0\u2AB3-\u2AC8\u2ACB\u2ACC\u2ACF-\u2ADB\u2AE4\u2AE6-\u2AE9\u2AEB-\u2AF3\u2AFD\uFB00-\uFB04]|\uD835[\uDC9C\uDC9E\uDC9F\uDCA2\uDCA5\uDCA6\uDCA9-\uDCAC\uDCAE-\uDCB9\uDCBB\uDCBD-\uDCC3\uDCC5-\uDCCF\uDD04\uDD05\uDD07-\uDD0A\uDD0D-\uDD14\uDD16-\uDD1C\uDD1E-\uDD39\uDD3B-\uDD3E\uDD40-\uDD44\uDD46\uDD4A-\uDD50\uDD52-\uDD6B]/g;
+	var encodeMap = {'\xAD':'shy','\u200C':'zwnj','\u200D':'zwj','\u200E':'lrm','\u2063':'ic','\u2062':'it','\u2061':'af','\u200F':'rlm','\u200B':'ZeroWidthSpace','\u2060':'NoBreak','\u0311':'DownBreve','\u20DB':'tdot','\u20DC':'DotDot','\t':'Tab','\n':'NewLine','\u2008':'puncsp','\u205F':'MediumSpace','\u2009':'thinsp','\u200A':'hairsp','\u2004':'emsp13','\u2002':'ensp','\u2005':'emsp14','\u2003':'emsp','\u2007':'numsp','\xA0':'nbsp','\u205F\u200A':'ThickSpace','\u203E':'oline','_':'lowbar','\u2010':'dash','\u2013':'ndash','\u2014':'mdash','\u2015':'horbar',',':'comma',';':'semi','\u204F':'bsemi',':':'colon','\u2A74':'Colone','!':'excl','\xA1':'iexcl','?':'quest','\xBF':'iquest','.':'period','\u2025':'nldr','\u2026':'mldr','\xB7':'middot','\'':'apos','\u2018':'lsquo','\u2019':'rsquo','\u201A':'sbquo','\u2039':'lsaquo','\u203A':'rsaquo','"':'quot','\u201C':'ldquo','\u201D':'rdquo','\u201E':'bdquo','\xAB':'laquo','\xBB':'raquo','(':'lpar',')':'rpar','[':'lsqb',']':'rsqb','{':'lcub','}':'rcub','\u2308':'lceil','\u2309':'rceil','\u230A':'lfloor','\u230B':'rfloor','\u2985':'lopar','\u2986':'ropar','\u298B':'lbrke','\u298C':'rbrke','\u298D':'lbrkslu','\u298E':'rbrksld','\u298F':'lbrksld','\u2990':'rbrkslu','\u2991':'langd','\u2992':'rangd','\u2993':'lparlt','\u2994':'rpargt','\u2995':'gtlPar','\u2996':'ltrPar','\u27E6':'lobrk','\u27E7':'robrk','\u27E8':'lang','\u27E9':'rang','\u27EA':'Lang','\u27EB':'Rang','\u27EC':'loang','\u27ED':'roang','\u2772':'lbbrk','\u2773':'rbbrk','\u2016':'Vert','\xA7':'sect','\xB6':'para','@':'commat','*':'ast','/':'sol','undefined':null,'&':'amp','#':'num','%':'percnt','\u2030':'permil','\u2031':'pertenk','\u2020':'dagger','\u2021':'Dagger','\u2022':'bull','\u2043':'hybull','\u2032':'prime','\u2033':'Prime','\u2034':'tprime','\u2057':'qprime','\u2035':'bprime','\u2041':'caret','`':'grave','\xB4':'acute','\u02DC':'tilde','^':'Hat','\xAF':'macr','\u02D8':'breve','\u02D9':'dot','\xA8':'die','\u02DA':'ring','\u02DD':'dblac','\xB8':'cedil','\u02DB':'ogon','\u02C6':'circ','\u02C7':'caron','\xB0':'deg','\xA9':'copy','\xAE':'reg','\u2117':'copysr','\u2118':'wp','\u211E':'rx','\u2127':'mho','\u2129':'iiota','\u2190':'larr','\u219A':'nlarr','\u2192':'rarr','\u219B':'nrarr','\u2191':'uarr','\u2193':'darr','\u2194':'harr','\u21AE':'nharr','\u2195':'varr','\u2196':'nwarr','\u2197':'nearr','\u2198':'searr','\u2199':'swarr','\u219D':'rarrw','\u219D\u0338':'nrarrw','\u219E':'Larr','\u219F':'Uarr','\u21A0':'Rarr','\u21A1':'Darr','\u21A2':'larrtl','\u21A3':'rarrtl','\u21A4':'mapstoleft','\u21A5':'mapstoup','\u21A6':'map','\u21A7':'mapstodown','\u21A9':'larrhk','\u21AA':'rarrhk','\u21AB':'larrlp','\u21AC':'rarrlp','\u21AD':'harrw','\u21B0':'lsh','\u21B1':'rsh','\u21B2':'ldsh','\u21B3':'rdsh','\u21B5':'crarr','\u21B6':'cularr','\u21B7':'curarr','\u21BA':'olarr','\u21BB':'orarr','\u21BC':'lharu','\u21BD':'lhard','\u21BE':'uharr','\u21BF':'uharl','\u21C0':'rharu','\u21C1':'rhard','\u21C2':'dharr','\u21C3':'dharl','\u21C4':'rlarr','\u21C5':'udarr','\u21C6':'lrarr','\u21C7':'llarr','\u21C8':'uuarr','\u21C9':'rrarr','\u21CA':'ddarr','\u21CB':'lrhar','\u21CC':'rlhar','\u21D0':'lArr','\u21CD':'nlArr','\u21D1':'uArr','\u21D2':'rArr','\u21CF':'nrArr','\u21D3':'dArr','\u21D4':'iff','\u21CE':'nhArr','\u21D5':'vArr','\u21D6':'nwArr','\u21D7':'neArr','\u21D8':'seArr','\u21D9':'swArr','\u21DA':'lAarr','\u21DB':'rAarr','\u21DD':'zigrarr','\u21E4':'larrb','\u21E5':'rarrb','\u21F5':'duarr','\u21FD':'loarr','\u21FE':'roarr','\u21FF':'hoarr','\u2200':'forall','\u2201':'comp','\u2202':'part','\u2202\u0338':'npart','\u2203':'exist','\u2204':'nexist','\u2205':'empty','\u2207':'Del','\u2208':'in','\u2209':'notin','\u220B':'ni','\u220C':'notni','\u03F6':'bepsi','\u220F':'prod','\u2210':'coprod','\u2211':'sum','+':'plus','\xB1':'pm','\xF7':'div','\xD7':'times','<':'lt','\u226E':'nlt','<\u20D2':'nvlt','=':'equals','\u2260':'ne','=\u20E5':'bne','\u2A75':'Equal','>':'gt','\u226F':'ngt','>\u20D2':'nvgt','\xAC':'not','|':'vert','\xA6':'brvbar','\u2212':'minus','\u2213':'mp','\u2214':'plusdo','\u2044':'frasl','\u2216':'setmn','\u2217':'lowast','\u2218':'compfn','\u221A':'Sqrt','\u221D':'prop','\u221E':'infin','\u221F':'angrt','\u2220':'ang','\u2220\u20D2':'nang','\u2221':'angmsd','\u2222':'angsph','\u2223':'mid','\u2224':'nmid','\u2225':'par','\u2226':'npar','\u2227':'and','\u2228':'or','\u2229':'cap','\u2229\uFE00':'caps','\u222A':'cup','\u222A\uFE00':'cups','\u222B':'int','\u222C':'Int','\u222D':'tint','\u2A0C':'qint','\u222E':'oint','\u222F':'Conint','\u2230':'Cconint','\u2231':'cwint','\u2232':'cwconint','\u2233':'awconint','\u2234':'there4','\u2235':'becaus','\u2236':'ratio','\u2237':'Colon','\u2238':'minusd','\u223A':'mDDot','\u223B':'homtht','\u223C':'sim','\u2241':'nsim','\u223C\u20D2':'nvsim','\u223D':'bsim','\u223D\u0331':'race','\u223E':'ac','\u223E\u0333':'acE','\u223F':'acd','\u2240':'wr','\u2242':'esim','\u2242\u0338':'nesim','\u2243':'sime','\u2244':'nsime','\u2245':'cong','\u2247':'ncong','\u2246':'simne','\u2248':'ap','\u2249':'nap','\u224A':'ape','\u224B':'apid','\u224B\u0338':'napid','\u224C':'bcong','\u224D':'CupCap','\u226D':'NotCupCap','\u224D\u20D2':'nvap','\u224E':'bump','\u224E\u0338':'nbump','\u224F':'bumpe','\u224F\u0338':'nbumpe','\u2250':'doteq','\u2250\u0338':'nedot','\u2251':'eDot','\u2252':'efDot','\u2253':'erDot','\u2254':'colone','\u2255':'ecolon','\u2256':'ecir','\u2257':'cire','\u2259':'wedgeq','\u225A':'veeeq','\u225C':'trie','\u225F':'equest','\u2261':'equiv','\u2262':'nequiv','\u2261\u20E5':'bnequiv','\u2264':'le','\u2270':'nle','\u2264\u20D2':'nvle','\u2265':'ge','\u2271':'nge','\u2265\u20D2':'nvge','\u2266':'lE','\u2266\u0338':'nlE','\u2267':'gE','\u2267\u0338':'ngE','\u2268\uFE00':'lvnE','\u2268':'lnE','\u2269':'gnE','\u2269\uFE00':'gvnE','\u226A':'ll','\u226A\u0338':'nLtv','\u226A\u20D2':'nLt','\u226B':'gg','\u226B\u0338':'nGtv','\u226B\u20D2':'nGt','\u226C':'twixt','\u2272':'lsim','\u2274':'nlsim','\u2273':'gsim','\u2275':'ngsim','\u2276':'lg','\u2278':'ntlg','\u2277':'gl','\u2279':'ntgl','\u227A':'pr','\u2280':'npr','\u227B':'sc','\u2281':'nsc','\u227C':'prcue','\u22E0':'nprcue','\u227D':'sccue','\u22E1':'nsccue','\u227E':'prsim','\u227F':'scsim','\u227F\u0338':'NotSucceedsTilde','\u2282':'sub','\u2284':'nsub','\u2282\u20D2':'vnsub','\u2283':'sup','\u2285':'nsup','\u2283\u20D2':'vnsup','\u2286':'sube','\u2288':'nsube','\u2287':'supe','\u2289':'nsupe','\u228A\uFE00':'vsubne','\u228A':'subne','\u228B\uFE00':'vsupne','\u228B':'supne','\u228D':'cupdot','\u228E':'uplus','\u228F':'sqsub','\u228F\u0338':'NotSquareSubset','\u2290':'sqsup','\u2290\u0338':'NotSquareSuperset','\u2291':'sqsube','\u22E2':'nsqsube','\u2292':'sqsupe','\u22E3':'nsqsupe','\u2293':'sqcap','\u2293\uFE00':'sqcaps','\u2294':'sqcup','\u2294\uFE00':'sqcups','\u2295':'oplus','\u2296':'ominus','\u2297':'otimes','\u2298':'osol','\u2299':'odot','\u229A':'ocir','\u229B':'oast','\u229D':'odash','\u229E':'plusb','\u229F':'minusb','\u22A0':'timesb','\u22A1':'sdotb','\u22A2':'vdash','\u22AC':'nvdash','\u22A3':'dashv','\u22A4':'top','\u22A5':'bot','\u22A7':'models','\u22A8':'vDash','\u22AD':'nvDash','\u22A9':'Vdash','\u22AE':'nVdash','\u22AA':'Vvdash','\u22AB':'VDash','\u22AF':'nVDash','\u22B0':'prurel','\u22B2':'vltri','\u22EA':'nltri','\u22B3':'vrtri','\u22EB':'nrtri','\u22B4':'ltrie','\u22EC':'nltrie','\u22B4\u20D2':'nvltrie','\u22B5':'rtrie','\u22ED':'nrtrie','\u22B5\u20D2':'nvrtrie','\u22B6':'origof','\u22B7':'imof','\u22B8':'mumap','\u22B9':'hercon','\u22BA':'intcal','\u22BB':'veebar','\u22BD':'barvee','\u22BE':'angrtvb','\u22BF':'lrtri','\u22C0':'Wedge','\u22C1':'Vee','\u22C2':'xcap','\u22C3':'xcup','\u22C4':'diam','\u22C5':'sdot','\u22C6':'Star','\u22C7':'divonx','\u22C8':'bowtie','\u22C9':'ltimes','\u22CA':'rtimes','\u22CB':'lthree','\u22CC':'rthree','\u22CD':'bsime','\u22CE':'cuvee','\u22CF':'cuwed','\u22D0':'Sub','\u22D1':'Sup','\u22D2':'Cap','\u22D3':'Cup','\u22D4':'fork','\u22D5':'epar','\u22D6':'ltdot','\u22D7':'gtdot','\u22D8':'Ll','\u22D8\u0338':'nLl','\u22D9':'Gg','\u22D9\u0338':'nGg','\u22DA\uFE00':'lesg','\u22DA':'leg','\u22DB':'gel','\u22DB\uFE00':'gesl','\u22DE':'cuepr','\u22DF':'cuesc','\u22E6':'lnsim','\u22E7':'gnsim','\u22E8':'prnsim','\u22E9':'scnsim','\u22EE':'vellip','\u22EF':'ctdot','\u22F0':'utdot','\u22F1':'dtdot','\u22F2':'disin','\u22F3':'isinsv','\u22F4':'isins','\u22F5':'isindot','\u22F5\u0338':'notindot','\u22F6':'notinvc','\u22F7':'notinvb','\u22F9':'isinE','\u22F9\u0338':'notinE','\u22FA':'nisd','\u22FB':'xnis','\u22FC':'nis','\u22FD':'notnivc','\u22FE':'notnivb','\u2305':'barwed','\u2306':'Barwed','\u230C':'drcrop','\u230D':'dlcrop','\u230E':'urcrop','\u230F':'ulcrop','\u2310':'bnot','\u2312':'profline','\u2313':'profsurf','\u2315':'telrec','\u2316':'target','\u231C':'ulcorn','\u231D':'urcorn','\u231E':'dlcorn','\u231F':'drcorn','\u2322':'frown','\u2323':'smile','\u232D':'cylcty','\u232E':'profalar','\u2336':'topbot','\u233D':'ovbar','\u233F':'solbar','\u237C':'angzarr','\u23B0':'lmoust','\u23B1':'rmoust','\u23B4':'tbrk','\u23B5':'bbrk','\u23B6':'bbrktbrk','\u23DC':'OverParenthesis','\u23DD':'UnderParenthesis','\u23DE':'OverBrace','\u23DF':'UnderBrace','\u23E2':'trpezium','\u23E7':'elinters','\u2423':'blank','\u2500':'boxh','\u2502':'boxv','\u250C':'boxdr','\u2510':'boxdl','\u2514':'boxur','\u2518':'boxul','\u251C':'boxvr','\u2524':'boxvl','\u252C':'boxhd','\u2534':'boxhu','\u253C':'boxvh','\u2550':'boxH','\u2551':'boxV','\u2552':'boxdR','\u2553':'boxDr','\u2554':'boxDR','\u2555':'boxdL','\u2556':'boxDl','\u2557':'boxDL','\u2558':'boxuR','\u2559':'boxUr','\u255A':'boxUR','\u255B':'boxuL','\u255C':'boxUl','\u255D':'boxUL','\u255E':'boxvR','\u255F':'boxVr','\u2560':'boxVR','\u2561':'boxvL','\u2562':'boxVl','\u2563':'boxVL','\u2564':'boxHd','\u2565':'boxhD','\u2566':'boxHD','\u2567':'boxHu','\u2568':'boxhU','\u2569':'boxHU','\u256A':'boxvH','\u256B':'boxVh','\u256C':'boxVH','\u2580':'uhblk','\u2584':'lhblk','\u2588':'block','\u2591':'blk14','\u2592':'blk12','\u2593':'blk34','\u25A1':'squ','\u25AA':'squf','\u25AB':'EmptyVerySmallSquare','\u25AD':'rect','\u25AE':'marker','\u25B1':'fltns','\u25B3':'xutri','\u25B4':'utrif','\u25B5':'utri','\u25B8':'rtrif','\u25B9':'rtri','\u25BD':'xdtri','\u25BE':'dtrif','\u25BF':'dtri','\u25C2':'ltrif','\u25C3':'ltri','\u25CA':'loz','\u25CB':'cir','\u25EC':'tridot','\u25EF':'xcirc','\u25F8':'ultri','\u25F9':'urtri','\u25FA':'lltri','\u25FB':'EmptySmallSquare','\u25FC':'FilledSmallSquare','\u2605':'starf','\u2606':'star','\u260E':'phone','\u2640':'female','\u2642':'male','\u2660':'spades','\u2663':'clubs','\u2665':'hearts','\u2666':'diams','\u266A':'sung','\u2713':'check','\u2717':'cross','\u2720':'malt','\u2736':'sext','\u2758':'VerticalSeparator','\u27C8':'bsolhsub','\u27C9':'suphsol','\u27F5':'xlarr','\u27F6':'xrarr','\u27F7':'xharr','\u27F8':'xlArr','\u27F9':'xrArr','\u27FA':'xhArr','\u27FC':'xmap','\u27FF':'dzigrarr','\u2902':'nvlArr','\u2903':'nvrArr','\u2904':'nvHarr','\u2905':'Map','\u290C':'lbarr','\u290D':'rbarr','\u290E':'lBarr','\u290F':'rBarr','\u2910':'RBarr','\u2911':'DDotrahd','\u2912':'UpArrowBar','\u2913':'DownArrowBar','\u2916':'Rarrtl','\u2919':'latail','\u291A':'ratail','\u291B':'lAtail','\u291C':'rAtail','\u291D':'larrfs','\u291E':'rarrfs','\u291F':'larrbfs','\u2920':'rarrbfs','\u2923':'nwarhk','\u2924':'nearhk','\u2925':'searhk','\u2926':'swarhk','\u2927':'nwnear','\u2928':'toea','\u2929':'tosa','\u292A':'swnwar','\u2933':'rarrc','\u2933\u0338':'nrarrc','\u2935':'cudarrr','\u2936':'ldca','\u2937':'rdca','\u2938':'cudarrl','\u2939':'larrpl','\u293C':'curarrm','\u293D':'cularrp','\u2945':'rarrpl','\u2948':'harrcir','\u2949':'Uarrocir','\u294A':'lurdshar','\u294B':'ldrushar','\u294E':'LeftRightVector','\u294F':'RightUpDownVector','\u2950':'DownLeftRightVector','\u2951':'LeftUpDownVector','\u2952':'LeftVectorBar','\u2953':'RightVectorBar','\u2954':'RightUpVectorBar','\u2955':'RightDownVectorBar','\u2956':'DownLeftVectorBar','\u2957':'DownRightVectorBar','\u2958':'LeftUpVectorBar','\u2959':'LeftDownVectorBar','\u295A':'LeftTeeVector','\u295B':'RightTeeVector','\u295C':'RightUpTeeVector','\u295D':'RightDownTeeVector','\u295E':'DownLeftTeeVector','\u295F':'DownRightTeeVector','\u2960':'LeftUpTeeVector','\u2961':'LeftDownTeeVector','\u2962':'lHar','\u2963':'uHar','\u2964':'rHar','\u2965':'dHar','\u2966':'luruhar','\u2967':'ldrdhar','\u2968':'ruluhar','\u2969':'rdldhar','\u296A':'lharul','\u296B':'llhard','\u296C':'rharul','\u296D':'lrhard','\u296E':'udhar','\u296F':'duhar','\u2970':'RoundImplies','\u2971':'erarr','\u2972':'simrarr','\u2973':'larrsim','\u2974':'rarrsim','\u2975':'rarrap','\u2976':'ltlarr','\u2978':'gtrarr','\u2979':'subrarr','\u297B':'suplarr','\u297C':'lfisht','\u297D':'rfisht','\u297E':'ufisht','\u297F':'dfisht','\u299A':'vzigzag','\u299C':'vangrt','\u299D':'angrtvbd','\u29A4':'ange','\u29A5':'range','\u29A6':'dwangle','\u29A7':'uwangle','\u29A8':'angmsdaa','\u29A9':'angmsdab','\u29AA':'angmsdac','\u29AB':'angmsdad','\u29AC':'angmsdae','\u29AD':'angmsdaf','\u29AE':'angmsdag','\u29AF':'angmsdah','\u29B0':'bemptyv','\u29B1':'demptyv','\u29B2':'cemptyv','\u29B3':'raemptyv','\u29B4':'laemptyv','\u29B5':'ohbar','\u29B6':'omid','\u29B7':'opar','\u29B9':'operp','\u29BB':'olcross','\u29BC':'odsold','\u29BE':'olcir','\u29BF':'ofcir','\u29C0':'olt','\u29C1':'ogt','\u29C2':'cirscir','\u29C3':'cirE','\u29C4':'solb','\u29C5':'bsolb','\u29C9':'boxbox','\u29CD':'trisb','\u29CE':'rtriltri','\u29CF':'LeftTriangleBar','\u29CF\u0338':'NotLeftTriangleBar','\u29D0':'RightTriangleBar','\u29D0\u0338':'NotRightTriangleBar','\u29DC':'iinfin','\u29DD':'infintie','\u29DE':'nvinfin','\u29E3':'eparsl','\u29E4':'smeparsl','\u29E5':'eqvparsl','\u29EB':'lozf','\u29F4':'RuleDelayed','\u29F6':'dsol','\u2A00':'xodot','\u2A01':'xoplus','\u2A02':'xotime','\u2A04':'xuplus','\u2A06':'xsqcup','\u2A0D':'fpartint','\u2A10':'cirfnint','\u2A11':'awint','\u2A12':'rppolint','\u2A13':'scpolint','\u2A14':'npolint','\u2A15':'pointint','\u2A16':'quatint','\u2A17':'intlarhk','\u2A22':'pluscir','\u2A23':'plusacir','\u2A24':'simplus','\u2A25':'plusdu','\u2A26':'plussim','\u2A27':'plustwo','\u2A29':'mcomma','\u2A2A':'minusdu','\u2A2D':'loplus','\u2A2E':'roplus','\u2A2F':'Cross','\u2A30':'timesd','\u2A31':'timesbar','\u2A33':'smashp','\u2A34':'lotimes','\u2A35':'rotimes','\u2A36':'otimesas','\u2A37':'Otimes','\u2A38':'odiv','\u2A39':'triplus','\u2A3A':'triminus','\u2A3B':'tritime','\u2A3C':'iprod','\u2A3F':'amalg','\u2A40':'capdot','\u2A42':'ncup','\u2A43':'ncap','\u2A44':'capand','\u2A45':'cupor','\u2A46':'cupcap','\u2A47':'capcup','\u2A48':'cupbrcap','\u2A49':'capbrcup','\u2A4A':'cupcup','\u2A4B':'capcap','\u2A4C':'ccups','\u2A4D':'ccaps','\u2A50':'ccupssm','\u2A53':'And','\u2A54':'Or','\u2A55':'andand','\u2A56':'oror','\u2A57':'orslope','\u2A58':'andslope','\u2A5A':'andv','\u2A5B':'orv','\u2A5C':'andd','\u2A5D':'ord','\u2A5F':'wedbar','\u2A66':'sdote','\u2A6A':'simdot','\u2A6D':'congdot','\u2A6D\u0338':'ncongdot','\u2A6E':'easter','\u2A6F':'apacir','\u2A70':'apE','\u2A70\u0338':'napE','\u2A71':'eplus','\u2A72':'pluse','\u2A73':'Esim','\u2A77':'eDDot','\u2A78':'equivDD','\u2A79':'ltcir','\u2A7A':'gtcir','\u2A7B':'ltquest','\u2A7C':'gtquest','\u2A7D':'les','\u2A7D\u0338':'nles','\u2A7E':'ges','\u2A7E\u0338':'nges','\u2A7F':'lesdot','\u2A80':'gesdot','\u2A81':'lesdoto','\u2A82':'gesdoto','\u2A83':'lesdotor','\u2A84':'gesdotol','\u2A85':'lap','\u2A86':'gap','\u2A87':'lne','\u2A88':'gne','\u2A89':'lnap','\u2A8A':'gnap','\u2A8B':'lEg','\u2A8C':'gEl','\u2A8D':'lsime','\u2A8E':'gsime','\u2A8F':'lsimg','\u2A90':'gsiml','\u2A91':'lgE','\u2A92':'glE','\u2A93':'lesges','\u2A94':'gesles','\u2A95':'els','\u2A96':'egs','\u2A97':'elsdot','\u2A98':'egsdot','\u2A99':'el','\u2A9A':'eg','\u2A9D':'siml','\u2A9E':'simg','\u2A9F':'simlE','\u2AA0':'simgE','\u2AA1':'LessLess','\u2AA1\u0338':'NotNestedLessLess','\u2AA2':'GreaterGreater','\u2AA2\u0338':'NotNestedGreaterGreater','\u2AA4':'glj','\u2AA5':'gla','\u2AA6':'ltcc','\u2AA7':'gtcc','\u2AA8':'lescc','\u2AA9':'gescc','\u2AAA':'smt','\u2AAB':'lat','\u2AAC':'smte','\u2AAC\uFE00':'smtes','\u2AAD':'late','\u2AAD\uFE00':'lates','\u2AAE':'bumpE','\u2AAF':'pre','\u2AAF\u0338':'npre','\u2AB0':'sce','\u2AB0\u0338':'nsce','\u2AB3':'prE','\u2AB4':'scE','\u2AB5':'prnE','\u2AB6':'scnE','\u2AB7':'prap','\u2AB8':'scap','\u2AB9':'prnap','\u2ABA':'scnap','\u2ABB':'Pr','\u2ABC':'Sc','\u2ABD':'subdot','\u2ABE':'supdot','\u2ABF':'subplus','\u2AC0':'supplus','\u2AC1':'submult','\u2AC2':'supmult','\u2AC3':'subedot','\u2AC4':'supedot','\u2AC5':'subE','\u2AC5\u0338':'nsubE','\u2AC6':'supE','\u2AC6\u0338':'nsupE','\u2AC7':'subsim','\u2AC8':'supsim','\u2ACB\uFE00':'vsubnE','\u2ACB':'subnE','\u2ACC\uFE00':'vsupnE','\u2ACC':'supnE','\u2ACF':'csub','\u2AD0':'csup','\u2AD1':'csube','\u2AD2':'csupe','\u2AD3':'subsup','\u2AD4':'supsub','\u2AD5':'subsub','\u2AD6':'supsup','\u2AD7':'suphsub','\u2AD8':'supdsub','\u2AD9':'forkv','\u2ADA':'topfork','\u2ADB':'mlcp','\u2AE4':'Dashv','\u2AE6':'Vdashl','\u2AE7':'Barv','\u2AE8':'vBar','\u2AE9':'vBarv','\u2AEB':'Vbar','\u2AEC':'Not','\u2AED':'bNot','\u2AEE':'rnmid','\u2AEF':'cirmid','\u2AF0':'midcir','\u2AF1':'topcir','\u2AF2':'nhpar','\u2AF3':'parsim','\u2AFD':'parsl','\u2AFD\u20E5':'nparsl','\u266D':'flat','\u266E':'natur','\u266F':'sharp','\xA4':'curren','\xA2':'cent','$':'dollar','\xA3':'pound','\xA5':'yen','\u20AC':'euro','\xB9':'sup1','\xBD':'half','\u2153':'frac13','\xBC':'frac14','\u2155':'frac15','\u2159':'frac16','\u215B':'frac18','\xB2':'sup2','\u2154':'frac23','\u2156':'frac25','\xB3':'sup3','\xBE':'frac34','\u2157':'frac35','\u215C':'frac38','\u2158':'frac45','\u215A':'frac56','\u215D':'frac58','\u215E':'frac78','\uD835\uDCB6':'ascr','\uD835\uDD52':'aopf','\uD835\uDD1E':'afr','\uD835\uDD38':'Aopf','\uD835\uDD04':'Afr','\uD835\uDC9C':'Ascr','\xAA':'ordf','\xE1':'aacute','\xC1':'Aacute','\xE0':'agrave','\xC0':'Agrave','\u0103':'abreve','\u0102':'Abreve','\xE2':'acirc','\xC2':'Acirc','\xE5':'aring','\xC5':'angst','\xE4':'auml','\xC4':'Auml','\xE3':'atilde','\xC3':'Atilde','\u0105':'aogon','\u0104':'Aogon','\u0101':'amacr','\u0100':'Amacr','\xE6':'aelig','\xC6':'AElig','\uD835\uDCB7':'bscr','\uD835\uDD53':'bopf','\uD835\uDD1F':'bfr','\uD835\uDD39':'Bopf','\u212C':'Bscr','\uD835\uDD05':'Bfr','\uD835\uDD20':'cfr','\uD835\uDCB8':'cscr','\uD835\uDD54':'copf','\u212D':'Cfr','\uD835\uDC9E':'Cscr','\u2102':'Copf','\u0107':'cacute','\u0106':'Cacute','\u0109':'ccirc','\u0108':'Ccirc','\u010D':'ccaron','\u010C':'Ccaron','\u010B':'cdot','\u010A':'Cdot','\xE7':'ccedil','\xC7':'Ccedil','\u2105':'incare','\uD835\uDD21':'dfr','\u2146':'dd','\uD835\uDD55':'dopf','\uD835\uDCB9':'dscr','\uD835\uDC9F':'Dscr','\uD835\uDD07':'Dfr','\u2145':'DD','\uD835\uDD3B':'Dopf','\u010F':'dcaron','\u010E':'Dcaron','\u0111':'dstrok','\u0110':'Dstrok','\xF0':'eth','\xD0':'ETH','\u2147':'ee','\u212F':'escr','\uD835\uDD22':'efr','\uD835\uDD56':'eopf','\u2130':'Escr','\uD835\uDD08':'Efr','\uD835\uDD3C':'Eopf','\xE9':'eacute','\xC9':'Eacute','\xE8':'egrave','\xC8':'Egrave','\xEA':'ecirc','\xCA':'Ecirc','\u011B':'ecaron','\u011A':'Ecaron','\xEB':'euml','\xCB':'Euml','\u0117':'edot','\u0116':'Edot','\u0119':'eogon','\u0118':'Eogon','\u0113':'emacr','\u0112':'Emacr','\uD835\uDD23':'ffr','\uD835\uDD57':'fopf','\uD835\uDCBB':'fscr','\uD835\uDD09':'Ffr','\uD835\uDD3D':'Fopf','\u2131':'Fscr','\uFB00':'fflig','\uFB03':'ffilig','\uFB04':'ffllig','\uFB01':'filig','fj':'fjlig','\uFB02':'fllig','\u0192':'fnof','\u210A':'gscr','\uD835\uDD58':'gopf','\uD835\uDD24':'gfr','\uD835\uDCA2':'Gscr','\uD835\uDD3E':'Gopf','\uD835\uDD0A':'Gfr','\u01F5':'gacute','\u011F':'gbreve','\u011E':'Gbreve','\u011D':'gcirc','\u011C':'Gcirc','\u0121':'gdot','\u0120':'Gdot','\u0122':'Gcedil','\uD835\uDD25':'hfr','\u210E':'planckh','\uD835\uDCBD':'hscr','\uD835\uDD59':'hopf','\u210B':'Hscr','\u210C':'Hfr','\u210D':'Hopf','\u0125':'hcirc','\u0124':'Hcirc','\u210F':'hbar','\u0127':'hstrok','\u0126':'Hstrok','\uD835\uDD5A':'iopf','\uD835\uDD26':'ifr','\uD835\uDCBE':'iscr','\u2148':'ii','\uD835\uDD40':'Iopf','\u2110':'Iscr','\u2111':'Im','\xED':'iacute','\xCD':'Iacute','\xEC':'igrave','\xCC':'Igrave','\xEE':'icirc','\xCE':'Icirc','\xEF':'iuml','\xCF':'Iuml','\u0129':'itilde','\u0128':'Itilde','\u0130':'Idot','\u012F':'iogon','\u012E':'Iogon','\u012B':'imacr','\u012A':'Imacr','\u0133':'ijlig','\u0132':'IJlig','\u0131':'imath','\uD835\uDCBF':'jscr','\uD835\uDD5B':'jopf','\uD835\uDD27':'jfr','\uD835\uDCA5':'Jscr','\uD835\uDD0D':'Jfr','\uD835\uDD41':'Jopf','\u0135':'jcirc','\u0134':'Jcirc','\u0237':'jmath','\uD835\uDD5C':'kopf','\uD835\uDCC0':'kscr','\uD835\uDD28':'kfr','\uD835\uDCA6':'Kscr','\uD835\uDD42':'Kopf','\uD835\uDD0E':'Kfr','\u0137':'kcedil','\u0136':'Kcedil','\uD835\uDD29':'lfr','\uD835\uDCC1':'lscr','\u2113':'ell','\uD835\uDD5D':'lopf','\u2112':'Lscr','\uD835\uDD0F':'Lfr','\uD835\uDD43':'Lopf','\u013A':'lacute','\u0139':'Lacute','\u013E':'lcaron','\u013D':'Lcaron','\u013C':'lcedil','\u013B':'Lcedil','\u0142':'lstrok','\u0141':'Lstrok','\u0140':'lmidot','\u013F':'Lmidot','\uD835\uDD2A':'mfr','\uD835\uDD5E':'mopf','\uD835\uDCC2':'mscr','\uD835\uDD10':'Mfr','\uD835\uDD44':'Mopf','\u2133':'Mscr','\uD835\uDD2B':'nfr','\uD835\uDD5F':'nopf','\uD835\uDCC3':'nscr','\u2115':'Nopf','\uD835\uDCA9':'Nscr','\uD835\uDD11':'Nfr','\u0144':'nacute','\u0143':'Nacute','\u0148':'ncaron','\u0147':'Ncaron','\xF1':'ntilde','\xD1':'Ntilde','\u0146':'ncedil','\u0145':'Ncedil','\u2116':'numero','\u014B':'eng','\u014A':'ENG','\uD835\uDD60':'oopf','\uD835\uDD2C':'ofr','\u2134':'oscr','\uD835\uDCAA':'Oscr','\uD835\uDD12':'Ofr','\uD835\uDD46':'Oopf','\xBA':'ordm','\xF3':'oacute','\xD3':'Oacute','\xF2':'ograve','\xD2':'Ograve','\xF4':'ocirc','\xD4':'Ocirc','\xF6':'ouml','\xD6':'Ouml','\u0151':'odblac','\u0150':'Odblac','\xF5':'otilde','\xD5':'Otilde','\xF8':'oslash','\xD8':'Oslash','\u014D':'omacr','\u014C':'Omacr','\u0153':'oelig','\u0152':'OElig','\uD835\uDD2D':'pfr','\uD835\uDCC5':'pscr','\uD835\uDD61':'popf','\u2119':'Popf','\uD835\uDD13':'Pfr','\uD835\uDCAB':'Pscr','\uD835\uDD62':'qopf','\uD835\uDD2E':'qfr','\uD835\uDCC6':'qscr','\uD835\uDCAC':'Qscr','\uD835\uDD14':'Qfr','\u211A':'Qopf','\u0138':'kgreen','\uD835\uDD2F':'rfr','\uD835\uDD63':'ropf','\uD835\uDCC7':'rscr','\u211B':'Rscr','\u211C':'Re','\u211D':'Ropf','\u0155':'racute','\u0154':'Racute','\u0159':'rcaron','\u0158':'Rcaron','\u0157':'rcedil','\u0156':'Rcedil','\uD835\uDD64':'sopf','\uD835\uDCC8':'sscr','\uD835\uDD30':'sfr','\uD835\uDD4A':'Sopf','\uD835\uDD16':'Sfr','\uD835\uDCAE':'Sscr','\u24C8':'oS','\u015B':'sacute','\u015A':'Sacute','\u015D':'scirc','\u015C':'Scirc','\u0161':'scaron','\u0160':'Scaron','\u015F':'scedil','\u015E':'Scedil','\xDF':'szlig','\uD835\uDD31':'tfr','\uD835\uDCC9':'tscr','\uD835\uDD65':'topf','\uD835\uDCAF':'Tscr','\uD835\uDD17':'Tfr','\uD835\uDD4B':'Topf','\u0165':'tcaron','\u0164':'Tcaron','\u0163':'tcedil','\u0162':'Tcedil','\u2122':'trade','\u0167':'tstrok','\u0166':'Tstrok','\uD835\uDCCA':'uscr','\uD835\uDD66':'uopf','\uD835\uDD32':'ufr','\uD835\uDD4C':'Uopf','\uD835\uDD18':'Ufr','\uD835\uDCB0':'Uscr','\xFA':'uacute','\xDA':'Uacute','\xF9':'ugrave','\xD9':'Ugrave','\u016D':'ubreve','\u016C':'Ubreve','\xFB':'ucirc','\xDB':'Ucirc','\u016F':'uring','\u016E':'Uring','\xFC':'uuml','\xDC':'Uuml','\u0171':'udblac','\u0170':'Udblac','\u0169':'utilde','\u0168':'Utilde','\u0173':'uogon','\u0172':'Uogon','\u016B':'umacr','\u016A':'Umacr','\uD835\uDD33':'vfr','\uD835\uDD67':'vopf','\uD835\uDCCB':'vscr','\uD835\uDD19':'Vfr','\uD835\uDD4D':'Vopf','\uD835\uDCB1':'Vscr','\uD835\uDD68':'wopf','\uD835\uDCCC':'wscr','\uD835\uDD34':'wfr','\uD835\uDCB2':'Wscr','\uD835\uDD4E':'Wopf','\uD835\uDD1A':'Wfr','\u0175':'wcirc','\u0174':'Wcirc','\uD835\uDD35':'xfr','\uD835\uDCCD':'xscr','\uD835\uDD69':'xopf','\uD835\uDD4F':'Xopf','\uD835\uDD1B':'Xfr','\uD835\uDCB3':'Xscr','\uD835\uDD36':'yfr','\uD835\uDCCE':'yscr','\uD835\uDD6A':'yopf','\uD835\uDCB4':'Yscr','\uD835\uDD1C':'Yfr','\uD835\uDD50':'Yopf','\xFD':'yacute','\xDD':'Yacute','\u0177':'ycirc','\u0176':'Ycirc','\xFF':'yuml','\u0178':'Yuml','\uD835\uDCCF':'zscr','\uD835\uDD37':'zfr','\uD835\uDD6B':'zopf','\u2128':'Zfr','\u2124':'Zopf','\uD835\uDCB5':'Zscr','\u017A':'zacute','\u0179':'Zacute','\u017E':'zcaron','\u017D':'Zcaron','\u017C':'zdot','\u017B':'Zdot','\u01B5':'imped','\xFE':'thorn','\xDE':'THORN','\u0149':'napos','\u03B1':'alpha','\u0391':'Alpha','\u03B2':'beta','\u0392':'Beta','\u03B3':'gamma','\u0393':'Gamma','\u03B4':'delta','\u0394':'Delta','\u03B5':'epsi','\u03F5':'epsiv','\u0395':'Epsilon','\u03DD':'gammad','\u03DC':'Gammad','\u03B6':'zeta','\u0396':'Zeta','\u03B7':'eta','\u0397':'Eta','\u03B8':'theta','\u03D1':'thetav','\u0398':'Theta','\u03B9':'iota','\u0399':'Iota','\u03BA':'kappa','\u03F0':'kappav','\u039A':'Kappa','\u03BB':'lambda','\u039B':'Lambda','\u03BC':'mu','\xB5':'micro','\u039C':'Mu','\u03BD':'nu','\u039D':'Nu','\u03BE':'xi','\u039E':'Xi','\u03BF':'omicron','\u039F':'Omicron','\u03C0':'pi','\u03D6':'piv','\u03A0':'Pi','\u03C1':'rho','\u03F1':'rhov','\u03A1':'Rho','\u03C3':'sigma','\u03A3':'Sigma','\u03C2':'sigmaf','\u03C4':'tau','\u03A4':'Tau','\u03C5':'upsi','\u03A5':'Upsilon','\u03D2':'Upsi','\u03C6':'phi','\u03D5':'phiv','\u03A6':'Phi','\u03C7':'chi','\u03A7':'Chi','\u03C8':'psi','\u03A8':'Psi','\u03C9':'omega','\u03A9':'ohm','\u0430':'acy','\u0410':'Acy','\u0431':'bcy','\u0411':'Bcy','\u0432':'vcy','\u0412':'Vcy','\u0433':'gcy','\u0413':'Gcy','\u0453':'gjcy','\u0403':'GJcy','\u0434':'dcy','\u0414':'Dcy','\u0452':'djcy','\u0402':'DJcy','\u0435':'iecy','\u0415':'IEcy','\u0451':'iocy','\u0401':'IOcy','\u0454':'jukcy','\u0404':'Jukcy','\u0436':'zhcy','\u0416':'ZHcy','\u0437':'zcy','\u0417':'Zcy','\u0455':'dscy','\u0405':'DScy','\u0438':'icy','\u0418':'Icy','\u0456':'iukcy','\u0406':'Iukcy','\u0457':'yicy','\u0407':'YIcy','\u0439':'jcy','\u0419':'Jcy','\u0458':'jsercy','\u0408':'Jsercy','\u043A':'kcy','\u041A':'Kcy','\u045C':'kjcy','\u040C':'KJcy','\u043B':'lcy','\u041B':'Lcy','\u0459':'ljcy','\u0409':'LJcy','\u043C':'mcy','\u041C':'Mcy','\u043D':'ncy','\u041D':'Ncy','\u045A':'njcy','\u040A':'NJcy','\u043E':'ocy','\u041E':'Ocy','\u043F':'pcy','\u041F':'Pcy','\u0440':'rcy','\u0420':'Rcy','\u0441':'scy','\u0421':'Scy','\u0442':'tcy','\u0422':'Tcy','\u045B':'tshcy','\u040B':'TSHcy','\u0443':'ucy','\u0423':'Ucy','\u045E':'ubrcy','\u040E':'Ubrcy','\u0444':'fcy','\u0424':'Fcy','\u0445':'khcy','\u0425':'KHcy','\u0446':'tscy','\u0426':'TScy','\u0447':'chcy','\u0427':'CHcy','\u045F':'dzcy','\u040F':'DZcy','\u0448':'shcy','\u0428':'SHcy','\u0449':'shchcy','\u0429':'SHCHcy','\u044A':'hardcy','\u042A':'HARDcy','\u044B':'ycy','\u042B':'Ycy','\u044C':'softcy','\u042C':'SOFTcy','\u044D':'ecy','\u042D':'Ecy','\u044E':'yucy','\u042E':'YUcy','\u044F':'yacy','\u042F':'YAcy','\u2135':'aleph','\u2136':'beth','\u2137':'gimel','\u2138':'daleth'};
+
+	var regexEscape = /["&'<>`]/g;
+	var escapeMap = {
+		'"': '&quot;',
+		'&': '&amp;',
+		'\'': '&#x27;',
+		'<': '&lt;',
+		// See https://mathiasbynens.be/notes/ambiguous-ampersands: in HTML, the
+		// following is not strictly necessary unless it’s part of a tag or an
+		// unquoted attribute value. We’re only escaping it to support those
+		// situations, and for XML support.
+		'>': '&gt;',
+		// In Internet Explorer ≤ 8, the backtick character can be used
+		// to break out of (un)quoted attribute values or HTML comments.
+		// See http://html5sec.org/#102, http://html5sec.org/#108, and
+		// http://html5sec.org/#133.
+		'`': '&#x60;'
+	};
+
+	var regexInvalidEntity = /&#(?:[xX][^a-fA-F0-9]|[^0-9xX])/;
+	var regexInvalidRawCodePoint = /[\0-\x08\x0B\x0E-\x1F\x7F-\x9F\uFDD0-\uFDEF\uFFFE\uFFFF]|[\uD83F\uD87F\uD8BF\uD8FF\uD93F\uD97F\uD9BF\uD9FF\uDA3F\uDA7F\uDABF\uDAFF\uDB3F\uDB7F\uDBBF\uDBFF][\uDFFE\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/;
+	var regexDecode = /&(CounterClockwiseContourIntegral|DoubleLongLeftRightArrow|ClockwiseContourIntegral|NotNestedGreaterGreater|NotSquareSupersetEqual|DiacriticalDoubleAcute|NotRightTriangleEqual|NotSucceedsSlantEqual|NotPrecedesSlantEqual|CloseCurlyDoubleQuote|NegativeVeryThinSpace|DoubleContourIntegral|FilledVerySmallSquare|CapitalDifferentialD|OpenCurlyDoubleQuote|EmptyVerySmallSquare|NestedGreaterGreater|DoubleLongRightArrow|NotLeftTriangleEqual|NotGreaterSlantEqual|ReverseUpEquilibrium|DoubleLeftRightArrow|NotSquareSubsetEqual|NotDoubleVerticalBar|RightArrowLeftArrow|NotGreaterFullEqual|NotRightTriangleBar|SquareSupersetEqual|DownLeftRightVector|DoubleLongLeftArrow|leftrightsquigarrow|LeftArrowRightArrow|NegativeMediumSpace|blacktriangleright|RightDownVectorBar|PrecedesSlantEqual|RightDoubleBracket|SucceedsSlantEqual|NotLeftTriangleBar|RightTriangleEqual|SquareIntersection|RightDownTeeVector|ReverseEquilibrium|NegativeThickSpace|longleftrightarrow|Longleftrightarrow|LongLeftRightArrow|DownRightTeeVector|DownRightVectorBar|GreaterSlantEqual|SquareSubsetEqual|LeftDownVectorBar|LeftDoubleBracket|VerticalSeparator|rightleftharpoons|NotGreaterGreater|NotSquareSuperset|blacktriangleleft|blacktriangledown|NegativeThinSpace|LeftDownTeeVector|NotLessSlantEqual|leftrightharpoons|DoubleUpDownArrow|DoubleVerticalBar|LeftTriangleEqual|FilledSmallSquare|twoheadrightarrow|NotNestedLessLess|DownLeftTeeVector|DownLeftVectorBar|RightAngleBracket|NotTildeFullEqual|NotReverseElement|RightUpDownVector|DiacriticalTilde|NotSucceedsTilde|circlearrowright|NotPrecedesEqual|rightharpoondown|DoubleRightArrow|NotSucceedsEqual|NonBreakingSpace|NotRightTriangle|LessEqualGreater|RightUpTeeVector|LeftAngleBracket|GreaterFullEqual|DownArrowUpArrow|RightUpVectorBar|twoheadleftarrow|GreaterEqualLess|downharpoonright|RightTriangleBar|ntrianglerighteq|NotSupersetEqual|LeftUpDownVector|DiacriticalAcute|rightrightarrows|vartriangleright|UpArrowDownArrow|DiacriticalGrave|UnderParenthesis|EmptySmallSquare|LeftUpVectorBar|leftrightarrows|DownRightVector|downharpoonleft|trianglerighteq|ShortRightArrow|OverParenthesis|DoubleLeftArrow|DoubleDownArrow|NotSquareSubset|bigtriangledown|ntrianglelefteq|UpperRightArrow|curvearrowright|vartriangleleft|NotLeftTriangle|nleftrightarrow|LowerRightArrow|NotHumpDownHump|NotGreaterTilde|rightthreetimes|LeftUpTeeVector|NotGreaterEqual|straightepsilon|LeftTriangleBar|rightsquigarrow|ContourIntegral|rightleftarrows|CloseCurlyQuote|RightDownVector|LeftRightVector|nLeftrightarrow|leftharpoondown|circlearrowleft|SquareSuperset|OpenCurlyQuote|hookrightarrow|HorizontalLine|DiacriticalDot|NotLessGreater|ntriangleright|DoubleRightTee|InvisibleComma|InvisibleTimes|LowerLeftArrow|DownLeftVector|NotSubsetEqual|curvearrowleft|trianglelefteq|NotVerticalBar|TildeFullEqual|downdownarrows|NotGreaterLess|RightTeeVector|ZeroWidthSpace|looparrowright|LongRightArrow|doublebarwedge|ShortLeftArrow|ShortDownArrow|RightVectorBar|GreaterGreater|ReverseElement|rightharpoonup|LessSlantEqual|leftthreetimes|upharpoonright|rightarrowtail|LeftDownVector|Longrightarrow|NestedLessLess|UpperLeftArrow|nshortparallel|leftleftarrows|leftrightarrow|Leftrightarrow|LeftRightArrow|longrightarrow|upharpoonleft|RightArrowBar|ApplyFunction|LeftTeeVector|leftarrowtail|NotEqualTilde|varsubsetneqq|varsupsetneqq|RightTeeArrow|SucceedsEqual|SucceedsTilde|LeftVectorBar|SupersetEqual|hookleftarrow|DifferentialD|VerticalTilde|VeryThinSpace|blacktriangle|bigtriangleup|LessFullEqual|divideontimes|leftharpoonup|UpEquilibrium|ntriangleleft|RightTriangle|measuredangle|shortparallel|longleftarrow|Longleftarrow|LongLeftArrow|DoubleLeftTee|Poincareplane|PrecedesEqual|triangleright|DoubleUpArrow|RightUpVector|fallingdotseq|looparrowleft|PrecedesTilde|NotTildeEqual|NotTildeTilde|smallsetminus|Proportional|triangleleft|triangledown|UnderBracket|NotHumpEqual|exponentiale|ExponentialE|NotLessTilde|HilbertSpace|RightCeiling|blacklozenge|varsupsetneq|HumpDownHump|GreaterEqual|VerticalLine|LeftTeeArrow|NotLessEqual|DownTeeArrow|LeftTriangle|varsubsetneq|Intersection|NotCongruent|DownArrowBar|LeftUpVector|LeftArrowBar|risingdotseq|GreaterTilde|RoundImplies|SquareSubset|ShortUpArrow|NotSuperset|quaternions|precnapprox|backepsilon|preccurlyeq|OverBracket|blacksquare|MediumSpace|VerticalBar|circledcirc|circleddash|CircleMinus|CircleTimes|LessGreater|curlyeqprec|curlyeqsucc|diamondsuit|UpDownArrow|Updownarrow|RuleDelayed|Rrightarrow|updownarrow|RightVector|nRightarrow|nrightarrow|eqslantless|LeftCeiling|Equilibrium|SmallCircle|expectation|NotSucceeds|thickapprox|GreaterLess|SquareUnion|NotPrecedes|NotLessLess|straightphi|succnapprox|succcurlyeq|SubsetEqual|sqsupseteq|Proportion|Laplacetrf|ImaginaryI|supsetneqq|NotGreater|gtreqqless|NotElement|ThickSpace|TildeEqual|TildeTilde|Fouriertrf|rmoustache|EqualTilde|eqslantgtr|UnderBrace|LeftVector|UpArrowBar|nLeftarrow|nsubseteqq|subsetneqq|nsupseteqq|nleftarrow|succapprox|lessapprox|UpTeeArrow|upuparrows|curlywedge|lesseqqgtr|varepsilon|varnothing|RightFloor|complement|CirclePlus|sqsubseteq|Lleftarrow|circledast|RightArrow|Rightarrow|rightarrow|lmoustache|Bernoullis|precapprox|mapstoleft|mapstodown|longmapsto|dotsquare|downarrow|DoubleDot|nsubseteq|supsetneq|leftarrow|nsupseteq|subsetneq|ThinSpace|ngeqslant|subseteqq|HumpEqual|NotSubset|triangleq|NotCupCap|lesseqgtr|heartsuit|TripleDot|Leftarrow|Coproduct|Congruent|varpropto|complexes|gvertneqq|LeftArrow|LessTilde|supseteqq|MinusPlus|CircleDot|nleqslant|NotExists|gtreqless|nparallel|UnionPlus|LeftFloor|checkmark|CenterDot|centerdot|Mellintrf|gtrapprox|bigotimes|OverBrace|spadesuit|therefore|pitchfork|rationals|PlusMinus|Backslash|Therefore|DownBreve|backsimeq|backprime|DownArrow|nshortmid|Downarrow|lvertneqq|eqvparsl|imagline|imagpart|infintie|integers|Integral|intercal|LessLess|Uarrocir|intlarhk|sqsupset|angmsdaf|sqsubset|llcorner|vartheta|cupbrcap|lnapprox|Superset|SuchThat|succnsim|succneqq|angmsdag|biguplus|curlyvee|trpezium|Succeeds|NotTilde|bigwedge|angmsdah|angrtvbd|triminus|cwconint|fpartint|lrcorner|smeparsl|subseteq|urcorner|lurdshar|laemptyv|DDotrahd|approxeq|ldrushar|awconint|mapstoup|backcong|shortmid|triangle|geqslant|gesdotol|timesbar|circledR|circledS|setminus|multimap|naturals|scpolint|ncongdot|RightTee|boxminus|gnapprox|boxtimes|andslope|thicksim|angmsdaa|varsigma|cirfnint|rtriltri|angmsdab|rppolint|angmsdac|barwedge|drbkarow|clubsuit|thetasym|bsolhsub|capbrcup|dzigrarr|doteqdot|DotEqual|dotminus|UnderBar|NotEqual|realpart|otimesas|ulcorner|hksearow|hkswarow|parallel|PartialD|elinters|emptyset|plusacir|bbrktbrk|angmsdad|pointint|bigoplus|angmsdae|Precedes|bigsqcup|varkappa|notindot|supseteq|precneqq|precnsim|profalar|profline|profsurf|leqslant|lesdotor|raemptyv|subplus|notnivb|notnivc|subrarr|zigrarr|vzigzag|submult|subedot|Element|between|cirscir|larrbfs|larrsim|lotimes|lbrksld|lbrkslu|lozenge|ldrdhar|dbkarow|bigcirc|epsilon|simrarr|simplus|ltquest|Epsilon|luruhar|gtquest|maltese|npolint|eqcolon|npreceq|bigodot|ddagger|gtrless|bnequiv|harrcir|ddotseq|equivDD|backsim|demptyv|nsqsube|nsqsupe|Upsilon|nsubset|upsilon|minusdu|nsucceq|swarrow|nsupset|coloneq|searrow|boxplus|napprox|natural|asympeq|alefsym|congdot|nearrow|bigstar|diamond|supplus|tritime|LeftTee|nvinfin|triplus|NewLine|nvltrie|nvrtrie|nwarrow|nexists|Diamond|ruluhar|Implies|supmult|angzarr|suplarr|suphsub|questeq|because|digamma|Because|olcross|bemptyv|omicron|Omicron|rotimes|NoBreak|intprod|angrtvb|orderof|uwangle|suphsol|lesdoto|orslope|DownTee|realine|cudarrl|rdldhar|OverBar|supedot|lessdot|supdsub|topfork|succsim|rbrkslu|rbrksld|pertenk|cudarrr|isindot|planckh|lessgtr|pluscir|gesdoto|plussim|plustwo|lesssim|cularrp|rarrsim|Cayleys|notinva|notinvb|notinvc|UpArrow|Uparrow|uparrow|NotLess|dwangle|precsim|Product|curarrm|Cconint|dotplus|rarrbfs|ccupssm|Cedilla|cemptyv|notniva|quatint|frac35|frac38|frac45|frac56|frac58|frac78|tridot|xoplus|gacute|gammad|Gammad|lfisht|lfloor|bigcup|sqsupe|gbreve|Gbreve|lharul|sqsube|sqcups|Gcedil|apacir|llhard|lmidot|Lmidot|lmoust|andand|sqcaps|approx|Abreve|spades|circeq|tprime|divide|topcir|Assign|topbot|gesdot|divonx|xuplus|timesd|gesles|atilde|solbar|SOFTcy|loplus|timesb|lowast|lowbar|dlcorn|dlcrop|softcy|dollar|lparlt|thksim|lrhard|Atilde|lsaquo|smashp|bigvee|thinsp|wreath|bkarow|lsquor|lstrok|Lstrok|lthree|ltimes|ltlarr|DotDot|simdot|ltrPar|weierp|xsqcup|angmsd|sigmav|sigmaf|zeetrf|Zcaron|zcaron|mapsto|vsupne|thetav|cirmid|marker|mcomma|Zacute|vsubnE|there4|gtlPar|vsubne|bottom|gtrarr|SHCHcy|shchcy|midast|midcir|middot|minusb|minusd|gtrdot|bowtie|sfrown|mnplus|models|colone|seswar|Colone|mstpos|searhk|gtrsim|nacute|Nacute|boxbox|telrec|hairsp|Tcedil|nbumpe|scnsim|ncaron|Ncaron|ncedil|Ncedil|hamilt|Scedil|nearhk|hardcy|HARDcy|tcedil|Tcaron|commat|nequiv|nesear|tcaron|target|hearts|nexist|varrho|scedil|Scaron|scaron|hellip|Sacute|sacute|hercon|swnwar|compfn|rtimes|rthree|rsquor|rsaquo|zacute|wedgeq|homtht|barvee|barwed|Barwed|rpargt|horbar|conint|swarhk|roplus|nltrie|hslash|hstrok|Hstrok|rmoust|Conint|bprime|hybull|hyphen|iacute|Iacute|supsup|supsub|supsim|varphi|coprod|brvbar|agrave|Supset|supset|igrave|Igrave|notinE|Agrave|iiiint|iinfin|copysr|wedbar|Verbar|vangrt|becaus|incare|verbar|inodot|bullet|drcorn|intcal|drcrop|cularr|vellip|Utilde|bumpeq|cupcap|dstrok|Dstrok|CupCap|cupcup|cupdot|eacute|Eacute|supdot|iquest|easter|ecaron|Ecaron|ecolon|isinsv|utilde|itilde|Itilde|curarr|succeq|Bumpeq|cacute|ulcrop|nparsl|Cacute|nprcue|egrave|Egrave|nrarrc|nrarrw|subsup|subsub|nrtrie|jsercy|nsccue|Jsercy|kappav|kcedil|Kcedil|subsim|ulcorn|nsimeq|egsdot|veebar|kgreen|capand|elsdot|Subset|subset|curren|aacute|lacute|Lacute|emptyv|ntilde|Ntilde|lagran|lambda|Lambda|capcap|Ugrave|langle|subdot|emsp13|numero|emsp14|nvdash|nvDash|nVdash|nVDash|ugrave|ufisht|nvHarr|larrfs|nvlArr|larrhk|larrlp|larrpl|nvrArr|Udblac|nwarhk|larrtl|nwnear|oacute|Oacute|latail|lAtail|sstarf|lbrace|odblac|Odblac|lbrack|udblac|odsold|eparsl|lcaron|Lcaron|ograve|Ograve|lcedil|Lcedil|Aacute|ssmile|ssetmn|squarf|ldquor|capcup|ominus|cylcty|rharul|eqcirc|dagger|rfloor|rfisht|Dagger|daleth|equals|origof|capdot|equest|dcaron|Dcaron|rdquor|oslash|Oslash|otilde|Otilde|otimes|Otimes|urcrop|Ubreve|ubreve|Yacute|Uacute|uacute|Rcedil|rcedil|urcorn|parsim|Rcaron|Vdashl|rcaron|Tstrok|percnt|period|permil|Exists|yacute|rbrack|rbrace|phmmat|ccaron|Ccaron|planck|ccedil|plankv|tstrok|female|plusdo|plusdu|ffilig|plusmn|ffllig|Ccedil|rAtail|dfisht|bernou|ratail|Rarrtl|rarrtl|angsph|rarrpl|rarrlp|rarrhk|xwedge|xotime|forall|ForAll|Vvdash|vsupnE|preceq|bigcap|frac12|frac13|frac14|primes|rarrfs|prnsim|frac15|Square|frac16|square|lesdot|frac18|frac23|propto|prurel|rarrap|rangle|puncsp|frac25|Racute|qprime|racute|lesges|frac34|abreve|AElig|eqsim|utdot|setmn|urtri|Equal|Uring|seArr|uring|searr|dashv|Dashv|mumap|nabla|iogon|Iogon|sdote|sdotb|scsim|napid|napos|equiv|natur|Acirc|dblac|erarr|nbump|iprod|erDot|ucirc|awint|esdot|angrt|ncong|isinE|scnap|Scirc|scirc|ndash|isins|Ubrcy|nearr|neArr|isinv|nedot|ubrcy|acute|Ycirc|iukcy|Iukcy|xutri|nesim|caret|jcirc|Jcirc|caron|twixt|ddarr|sccue|exist|jmath|sbquo|ngeqq|angst|ccaps|lceil|ngsim|UpTee|delta|Delta|rtrif|nharr|nhArr|nhpar|rtrie|jukcy|Jukcy|kappa|rsquo|Kappa|nlarr|nlArr|TSHcy|rrarr|aogon|Aogon|fflig|xrarr|tshcy|ccirc|nleqq|filig|upsih|nless|dharl|nlsim|fjlig|ropar|nltri|dharr|robrk|roarr|fllig|fltns|roang|rnmid|subnE|subne|lAarr|trisb|Ccirc|acirc|ccups|blank|VDash|forkv|Vdash|langd|cedil|blk12|blk14|laquo|strns|diams|notin|vDash|larrb|blk34|block|disin|uplus|vdash|vBarv|aelig|starf|Wedge|check|xrArr|lates|lbarr|lBarr|notni|lbbrk|bcong|frasl|lbrke|frown|vrtri|vprop|vnsup|gamma|Gamma|wedge|xodot|bdquo|srarr|doteq|ldquo|boxdl|boxdL|gcirc|Gcirc|boxDl|boxDL|boxdr|boxdR|boxDr|TRADE|trade|rlhar|boxDR|vnsub|npart|vltri|rlarr|boxhd|boxhD|nprec|gescc|nrarr|nrArr|boxHd|boxHD|boxhu|boxhU|nrtri|boxHu|clubs|boxHU|times|colon|Colon|gimel|xlArr|Tilde|nsime|tilde|nsmid|nspar|THORN|thorn|xlarr|nsube|nsubE|thkap|xhArr|comma|nsucc|boxul|boxuL|nsupe|nsupE|gneqq|gnsim|boxUl|boxUL|grave|boxur|boxuR|boxUr|boxUR|lescc|angle|bepsi|boxvh|varpi|boxvH|numsp|Theta|gsime|gsiml|theta|boxVh|boxVH|boxvl|gtcir|gtdot|boxvL|boxVl|boxVL|crarr|cross|Cross|nvsim|boxvr|nwarr|nwArr|sqsup|dtdot|Uogon|lhard|lharu|dtrif|ocirc|Ocirc|lhblk|duarr|odash|sqsub|Hacek|sqcup|llarr|duhar|oelig|OElig|ofcir|boxvR|uogon|lltri|boxVr|csube|uuarr|ohbar|csupe|ctdot|olarr|olcir|harrw|oline|sqcap|omacr|Omacr|omega|Omega|boxVR|aleph|lneqq|lnsim|loang|loarr|rharu|lobrk|hcirc|operp|oplus|rhard|Hcirc|orarr|Union|order|ecirc|Ecirc|cuepr|szlig|cuesc|breve|reals|eDDot|Breve|hoarr|lopar|utrif|rdquo|Umacr|umacr|efDot|swArr|ultri|alpha|rceil|ovbar|swarr|Wcirc|wcirc|smtes|smile|bsemi|lrarr|aring|parsl|lrhar|bsime|uhblk|lrtri|cupor|Aring|uharr|uharl|slarr|rbrke|bsolb|lsime|rbbrk|RBarr|lsimg|phone|rBarr|rbarr|icirc|lsquo|Icirc|emacr|Emacr|ratio|simne|plusb|simlE|simgE|simeq|pluse|ltcir|ltdot|empty|xharr|xdtri|iexcl|Alpha|ltrie|rarrw|pound|ltrif|xcirc|bumpe|prcue|bumpE|asymp|amacr|cuvee|Sigma|sigma|iiint|udhar|iiota|ijlig|IJlig|supnE|imacr|Imacr|prime|Prime|image|prnap|eogon|Eogon|rarrc|mdash|mDDot|cuwed|imath|supne|imped|Amacr|udarr|prsim|micro|rarrb|cwint|raquo|infin|eplus|range|rangd|Ucirc|radic|minus|amalg|veeeq|rAarr|epsiv|ycirc|quest|sharp|quot|zwnj|Qscr|race|qscr|Qopf|qopf|qint|rang|Rang|Zscr|zscr|Zopf|zopf|rarr|rArr|Rarr|Pscr|pscr|prop|prod|prnE|prec|ZHcy|zhcy|prap|Zeta|zeta|Popf|popf|Zdot|plus|zdot|Yuml|yuml|phiv|YUcy|yucy|Yscr|yscr|perp|Yopf|yopf|part|para|YIcy|Ouml|rcub|yicy|YAcy|rdca|ouml|osol|Oscr|rdsh|yacy|real|oscr|xvee|andd|rect|andv|Xscr|oror|ordm|ordf|xscr|ange|aopf|Aopf|rHar|Xopf|opar|Oopf|xopf|xnis|rhov|oopf|omid|xmap|oint|apid|apos|ogon|ascr|Ascr|odot|odiv|xcup|xcap|ocir|oast|nvlt|nvle|nvgt|nvge|nvap|Wscr|wscr|auml|ntlg|ntgl|nsup|nsub|nsim|Nscr|nscr|nsce|Wopf|ring|npre|wopf|npar|Auml|Barv|bbrk|Nopf|nopf|nmid|nLtv|beta|ropf|Ropf|Beta|beth|nles|rpar|nleq|bnot|bNot|nldr|NJcy|rscr|Rscr|Vscr|vscr|rsqb|njcy|bopf|nisd|Bopf|rtri|Vopf|nGtv|ngtr|vopf|boxh|boxH|boxv|nges|ngeq|boxV|bscr|scap|Bscr|bsim|Vert|vert|bsol|bull|bump|caps|cdot|ncup|scnE|ncap|nbsp|napE|Cdot|cent|sdot|Vbar|nang|vBar|chcy|Mscr|mscr|sect|semi|CHcy|Mopf|mopf|sext|circ|cire|mldr|mlcp|cirE|comp|shcy|SHcy|vArr|varr|cong|copf|Copf|copy|COPY|malt|male|macr|lvnE|cscr|ltri|sime|ltcc|simg|Cscr|siml|csub|Uuml|lsqb|lsim|uuml|csup|Lscr|lscr|utri|smid|lpar|cups|smte|lozf|darr|Lopf|Uscr|solb|lopf|sopf|Sopf|lneq|uscr|spar|dArr|lnap|Darr|dash|Sqrt|LJcy|ljcy|lHar|dHar|Upsi|upsi|diam|lesg|djcy|DJcy|leqq|dopf|Dopf|dscr|Dscr|dscy|ldsh|ldca|squf|DScy|sscr|Sscr|dsol|lcub|late|star|Star|Uopf|Larr|lArr|larr|uopf|dtri|dzcy|sube|subE|Lang|lang|Kscr|kscr|Kopf|kopf|KJcy|kjcy|KHcy|khcy|DZcy|ecir|edot|eDot|Jscr|jscr|succ|Jopf|jopf|Edot|uHar|emsp|ensp|Iuml|iuml|eopf|isin|Iscr|iscr|Eopf|epar|sung|epsi|escr|sup1|sup2|sup3|Iota|iota|supe|supE|Iopf|iopf|IOcy|iocy|Escr|esim|Esim|imof|Uarr|QUOT|uArr|uarr|euml|IEcy|iecy|Idot|Euml|euro|excl|Hscr|hscr|Hopf|hopf|TScy|tscy|Tscr|hbar|tscr|flat|tbrk|fnof|hArr|harr|half|fopf|Fopf|tdot|gvnE|fork|trie|gtcc|fscr|Fscr|gdot|gsim|Gscr|gscr|Gopf|gopf|gneq|Gdot|tosa|gnap|Topf|topf|geqq|toea|GJcy|gjcy|tint|gesl|mid|Sfr|ggg|top|ges|gla|glE|glj|geq|gne|gEl|gel|gnE|Gcy|gcy|gap|Tfr|tfr|Tcy|tcy|Hat|Tau|Ffr|tau|Tab|hfr|Hfr|ffr|Fcy|fcy|icy|Icy|iff|ETH|eth|ifr|Ifr|Eta|eta|int|Int|Sup|sup|ucy|Ucy|Sum|sum|jcy|ENG|ufr|Ufr|eng|Jcy|jfr|els|ell|egs|Efr|efr|Jfr|uml|kcy|Kcy|Ecy|ecy|kfr|Kfr|lap|Sub|sub|lat|lcy|Lcy|leg|Dot|dot|lEg|leq|les|squ|div|die|lfr|Lfr|lgE|Dfr|dfr|Del|deg|Dcy|dcy|lne|lnE|sol|loz|smt|Cup|lrm|cup|lsh|Lsh|sim|shy|map|Map|mcy|Mcy|mfr|Mfr|mho|gfr|Gfr|sfr|cir|Chi|chi|nap|Cfr|vcy|Vcy|cfr|Scy|scy|ncy|Ncy|vee|Vee|Cap|cap|nfr|scE|sce|Nfr|nge|ngE|nGg|vfr|Vfr|ngt|bot|nGt|nis|niv|Rsh|rsh|nle|nlE|bne|Bfr|bfr|nLl|nlt|nLt|Bcy|bcy|not|Not|rlm|wfr|Wfr|npr|nsc|num|ocy|ast|Ocy|ofr|xfr|Xfr|Ofr|ogt|ohm|apE|olt|Rho|ape|rho|Rfr|rfr|ord|REG|ang|reg|orv|And|and|AMP|Rcy|amp|Afr|ycy|Ycy|yen|yfr|Yfr|rcy|par|pcy|Pcy|pfr|Pfr|phi|Phi|afr|Acy|acy|zcy|Zcy|piv|acE|acd|zfr|Zfr|pre|prE|psi|Psi|qfr|Qfr|zwj|Or|ge|Gg|gt|gg|el|oS|lt|Lt|LT|Re|lg|gl|eg|ne|Im|it|le|DD|wp|wr|nu|Nu|dd|lE|Sc|sc|pi|Pi|ee|af|ll|Ll|rx|gE|xi|pm|Xi|ic|pr|Pr|in|ni|mp|mu|ac|Mu|or|ap|Gt|GT|ii);|&(Aacute|Agrave|Atilde|Ccedil|Eacute|Egrave|Iacute|Igrave|Ntilde|Oacute|Ograve|Oslash|Otilde|Uacute|Ugrave|Yacute|aacute|agrave|atilde|brvbar|ccedil|curren|divide|eacute|egrave|frac12|frac14|frac34|iacute|igrave|iquest|middot|ntilde|oacute|ograve|oslash|otilde|plusmn|uacute|ugrave|yacute|AElig|Acirc|Aring|Ecirc|Icirc|Ocirc|THORN|Ucirc|acirc|acute|aelig|aring|cedil|ecirc|icirc|iexcl|laquo|micro|ocirc|pound|raquo|szlig|thorn|times|ucirc|Auml|COPY|Euml|Iuml|Ouml|QUOT|Uuml|auml|cent|copy|euml|iuml|macr|nbsp|ordf|ordm|ouml|para|quot|sect|sup1|sup2|sup3|uuml|yuml|AMP|ETH|REG|amp|deg|eth|not|reg|shy|uml|yen|GT|LT|gt|lt)(?!;)([=a-zA-Z0-9]?)|&#([0-9]+)(;?)|&#[xX]([a-fA-F0-9]+)(;?)|&([0-9a-zA-Z]+)/g;
+	var decodeMap = {'aacute':'\xE1','Aacute':'\xC1','abreve':'\u0103','Abreve':'\u0102','ac':'\u223E','acd':'\u223F','acE':'\u223E\u0333','acirc':'\xE2','Acirc':'\xC2','acute':'\xB4','acy':'\u0430','Acy':'\u0410','aelig':'\xE6','AElig':'\xC6','af':'\u2061','afr':'\uD835\uDD1E','Afr':'\uD835\uDD04','agrave':'\xE0','Agrave':'\xC0','alefsym':'\u2135','aleph':'\u2135','alpha':'\u03B1','Alpha':'\u0391','amacr':'\u0101','Amacr':'\u0100','amalg':'\u2A3F','amp':'&','AMP':'&','and':'\u2227','And':'\u2A53','andand':'\u2A55','andd':'\u2A5C','andslope':'\u2A58','andv':'\u2A5A','ang':'\u2220','ange':'\u29A4','angle':'\u2220','angmsd':'\u2221','angmsdaa':'\u29A8','angmsdab':'\u29A9','angmsdac':'\u29AA','angmsdad':'\u29AB','angmsdae':'\u29AC','angmsdaf':'\u29AD','angmsdag':'\u29AE','angmsdah':'\u29AF','angrt':'\u221F','angrtvb':'\u22BE','angrtvbd':'\u299D','angsph':'\u2222','angst':'\xC5','angzarr':'\u237C','aogon':'\u0105','Aogon':'\u0104','aopf':'\uD835\uDD52','Aopf':'\uD835\uDD38','ap':'\u2248','apacir':'\u2A6F','ape':'\u224A','apE':'\u2A70','apid':'\u224B','apos':'\'','ApplyFunction':'\u2061','approx':'\u2248','approxeq':'\u224A','aring':'\xE5','Aring':'\xC5','ascr':'\uD835\uDCB6','Ascr':'\uD835\uDC9C','Assign':'\u2254','ast':'*','asymp':'\u2248','asympeq':'\u224D','atilde':'\xE3','Atilde':'\xC3','auml':'\xE4','Auml':'\xC4','awconint':'\u2233','awint':'\u2A11','backcong':'\u224C','backepsilon':'\u03F6','backprime':'\u2035','backsim':'\u223D','backsimeq':'\u22CD','Backslash':'\u2216','Barv':'\u2AE7','barvee':'\u22BD','barwed':'\u2305','Barwed':'\u2306','barwedge':'\u2305','bbrk':'\u23B5','bbrktbrk':'\u23B6','bcong':'\u224C','bcy':'\u0431','Bcy':'\u0411','bdquo':'\u201E','becaus':'\u2235','because':'\u2235','Because':'\u2235','bemptyv':'\u29B0','bepsi':'\u03F6','bernou':'\u212C','Bernoullis':'\u212C','beta':'\u03B2','Beta':'\u0392','beth':'\u2136','between':'\u226C','bfr':'\uD835\uDD1F','Bfr':'\uD835\uDD05','bigcap':'\u22C2','bigcirc':'\u25EF','bigcup':'\u22C3','bigodot':'\u2A00','bigoplus':'\u2A01','bigotimes':'\u2A02','bigsqcup':'\u2A06','bigstar':'\u2605','bigtriangledown':'\u25BD','bigtriangleup':'\u25B3','biguplus':'\u2A04','bigvee':'\u22C1','bigwedge':'\u22C0','bkarow':'\u290D','blacklozenge':'\u29EB','blacksquare':'\u25AA','blacktriangle':'\u25B4','blacktriangledown':'\u25BE','blacktriangleleft':'\u25C2','blacktriangleright':'\u25B8','blank':'\u2423','blk12':'\u2592','blk14':'\u2591','blk34':'\u2593','block':'\u2588','bne':'=\u20E5','bnequiv':'\u2261\u20E5','bnot':'\u2310','bNot':'\u2AED','bopf':'\uD835\uDD53','Bopf':'\uD835\uDD39','bot':'\u22A5','bottom':'\u22A5','bowtie':'\u22C8','boxbox':'\u29C9','boxdl':'\u2510','boxdL':'\u2555','boxDl':'\u2556','boxDL':'\u2557','boxdr':'\u250C','boxdR':'\u2552','boxDr':'\u2553','boxDR':'\u2554','boxh':'\u2500','boxH':'\u2550','boxhd':'\u252C','boxhD':'\u2565','boxHd':'\u2564','boxHD':'\u2566','boxhu':'\u2534','boxhU':'\u2568','boxHu':'\u2567','boxHU':'\u2569','boxminus':'\u229F','boxplus':'\u229E','boxtimes':'\u22A0','boxul':'\u2518','boxuL':'\u255B','boxUl':'\u255C','boxUL':'\u255D','boxur':'\u2514','boxuR':'\u2558','boxUr':'\u2559','boxUR':'\u255A','boxv':'\u2502','boxV':'\u2551','boxvh':'\u253C','boxvH':'\u256A','boxVh':'\u256B','boxVH':'\u256C','boxvl':'\u2524','boxvL':'\u2561','boxVl':'\u2562','boxVL':'\u2563','boxvr':'\u251C','boxvR':'\u255E','boxVr':'\u255F','boxVR':'\u2560','bprime':'\u2035','breve':'\u02D8','Breve':'\u02D8','brvbar':'\xA6','bscr':'\uD835\uDCB7','Bscr':'\u212C','bsemi':'\u204F','bsim':'\u223D','bsime':'\u22CD','bsol':'\\','bsolb':'\u29C5','bsolhsub':'\u27C8','bull':'\u2022','bullet':'\u2022','bump':'\u224E','bumpe':'\u224F','bumpE':'\u2AAE','bumpeq':'\u224F','Bumpeq':'\u224E','cacute':'\u0107','Cacute':'\u0106','cap':'\u2229','Cap':'\u22D2','capand':'\u2A44','capbrcup':'\u2A49','capcap':'\u2A4B','capcup':'\u2A47','capdot':'\u2A40','CapitalDifferentialD':'\u2145','caps':'\u2229\uFE00','caret':'\u2041','caron':'\u02C7','Cayleys':'\u212D','ccaps':'\u2A4D','ccaron':'\u010D','Ccaron':'\u010C','ccedil':'\xE7','Ccedil':'\xC7','ccirc':'\u0109','Ccirc':'\u0108','Cconint':'\u2230','ccups':'\u2A4C','ccupssm':'\u2A50','cdot':'\u010B','Cdot':'\u010A','cedil':'\xB8','Cedilla':'\xB8','cemptyv':'\u29B2','cent':'\xA2','centerdot':'\xB7','CenterDot':'\xB7','cfr':'\uD835\uDD20','Cfr':'\u212D','chcy':'\u0447','CHcy':'\u0427','check':'\u2713','checkmark':'\u2713','chi':'\u03C7','Chi':'\u03A7','cir':'\u25CB','circ':'\u02C6','circeq':'\u2257','circlearrowleft':'\u21BA','circlearrowright':'\u21BB','circledast':'\u229B','circledcirc':'\u229A','circleddash':'\u229D','CircleDot':'\u2299','circledR':'\xAE','circledS':'\u24C8','CircleMinus':'\u2296','CirclePlus':'\u2295','CircleTimes':'\u2297','cire':'\u2257','cirE':'\u29C3','cirfnint':'\u2A10','cirmid':'\u2AEF','cirscir':'\u29C2','ClockwiseContourIntegral':'\u2232','CloseCurlyDoubleQuote':'\u201D','CloseCurlyQuote':'\u2019','clubs':'\u2663','clubsuit':'\u2663','colon':':','Colon':'\u2237','colone':'\u2254','Colone':'\u2A74','coloneq':'\u2254','comma':',','commat':'@','comp':'\u2201','compfn':'\u2218','complement':'\u2201','complexes':'\u2102','cong':'\u2245','congdot':'\u2A6D','Congruent':'\u2261','conint':'\u222E','Conint':'\u222F','ContourIntegral':'\u222E','copf':'\uD835\uDD54','Copf':'\u2102','coprod':'\u2210','Coproduct':'\u2210','copy':'\xA9','COPY':'\xA9','copysr':'\u2117','CounterClockwiseContourIntegral':'\u2233','crarr':'\u21B5','cross':'\u2717','Cross':'\u2A2F','cscr':'\uD835\uDCB8','Cscr':'\uD835\uDC9E','csub':'\u2ACF','csube':'\u2AD1','csup':'\u2AD0','csupe':'\u2AD2','ctdot':'\u22EF','cudarrl':'\u2938','cudarrr':'\u2935','cuepr':'\u22DE','cuesc':'\u22DF','cularr':'\u21B6','cularrp':'\u293D','cup':'\u222A','Cup':'\u22D3','cupbrcap':'\u2A48','cupcap':'\u2A46','CupCap':'\u224D','cupcup':'\u2A4A','cupdot':'\u228D','cupor':'\u2A45','cups':'\u222A\uFE00','curarr':'\u21B7','curarrm':'\u293C','curlyeqprec':'\u22DE','curlyeqsucc':'\u22DF','curlyvee':'\u22CE','curlywedge':'\u22CF','curren':'\xA4','curvearrowleft':'\u21B6','curvearrowright':'\u21B7','cuvee':'\u22CE','cuwed':'\u22CF','cwconint':'\u2232','cwint':'\u2231','cylcty':'\u232D','dagger':'\u2020','Dagger':'\u2021','daleth':'\u2138','darr':'\u2193','dArr':'\u21D3','Darr':'\u21A1','dash':'\u2010','dashv':'\u22A3','Dashv':'\u2AE4','dbkarow':'\u290F','dblac':'\u02DD','dcaron':'\u010F','Dcaron':'\u010E','dcy':'\u0434','Dcy':'\u0414','dd':'\u2146','DD':'\u2145','ddagger':'\u2021','ddarr':'\u21CA','DDotrahd':'\u2911','ddotseq':'\u2A77','deg':'\xB0','Del':'\u2207','delta':'\u03B4','Delta':'\u0394','demptyv':'\u29B1','dfisht':'\u297F','dfr':'\uD835\uDD21','Dfr':'\uD835\uDD07','dHar':'\u2965','dharl':'\u21C3','dharr':'\u21C2','DiacriticalAcute':'\xB4','DiacriticalDot':'\u02D9','DiacriticalDoubleAcute':'\u02DD','DiacriticalGrave':'`','DiacriticalTilde':'\u02DC','diam':'\u22C4','diamond':'\u22C4','Diamond':'\u22C4','diamondsuit':'\u2666','diams':'\u2666','die':'\xA8','DifferentialD':'\u2146','digamma':'\u03DD','disin':'\u22F2','div':'\xF7','divide':'\xF7','divideontimes':'\u22C7','divonx':'\u22C7','djcy':'\u0452','DJcy':'\u0402','dlcorn':'\u231E','dlcrop':'\u230D','dollar':'$','dopf':'\uD835\uDD55','Dopf':'\uD835\uDD3B','dot':'\u02D9','Dot':'\xA8','DotDot':'\u20DC','doteq':'\u2250','doteqdot':'\u2251','DotEqual':'\u2250','dotminus':'\u2238','dotplus':'\u2214','dotsquare':'\u22A1','doublebarwedge':'\u2306','DoubleContourIntegral':'\u222F','DoubleDot':'\xA8','DoubleDownArrow':'\u21D3','DoubleLeftArrow':'\u21D0','DoubleLeftRightArrow':'\u21D4','DoubleLeftTee':'\u2AE4','DoubleLongLeftArrow':'\u27F8','DoubleLongLeftRightArrow':'\u27FA','DoubleLongRightArrow':'\u27F9','DoubleRightArrow':'\u21D2','DoubleRightTee':'\u22A8','DoubleUpArrow':'\u21D1','DoubleUpDownArrow':'\u21D5','DoubleVerticalBar':'\u2225','downarrow':'\u2193','Downarrow':'\u21D3','DownArrow':'\u2193','DownArrowBar':'\u2913','DownArrowUpArrow':'\u21F5','DownBreve':'\u0311','downdownarrows':'\u21CA','downharpoonleft':'\u21C3','downharpoonright':'\u21C2','DownLeftRightVector':'\u2950','DownLeftTeeVector':'\u295E','DownLeftVector':'\u21BD','DownLeftVectorBar':'\u2956','DownRightTeeVector':'\u295F','DownRightVector':'\u21C1','DownRightVectorBar':'\u2957','DownTee':'\u22A4','DownTeeArrow':'\u21A7','drbkarow':'\u2910','drcorn':'\u231F','drcrop':'\u230C','dscr':'\uD835\uDCB9','Dscr':'\uD835\uDC9F','dscy':'\u0455','DScy':'\u0405','dsol':'\u29F6','dstrok':'\u0111','Dstrok':'\u0110','dtdot':'\u22F1','dtri':'\u25BF','dtrif':'\u25BE','duarr':'\u21F5','duhar':'\u296F','dwangle':'\u29A6','dzcy':'\u045F','DZcy':'\u040F','dzigrarr':'\u27FF','eacute':'\xE9','Eacute':'\xC9','easter':'\u2A6E','ecaron':'\u011B','Ecaron':'\u011A','ecir':'\u2256','ecirc':'\xEA','Ecirc':'\xCA','ecolon':'\u2255','ecy':'\u044D','Ecy':'\u042D','eDDot':'\u2A77','edot':'\u0117','eDot':'\u2251','Edot':'\u0116','ee':'\u2147','efDot':'\u2252','efr':'\uD835\uDD22','Efr':'\uD835\uDD08','eg':'\u2A9A','egrave':'\xE8','Egrave':'\xC8','egs':'\u2A96','egsdot':'\u2A98','el':'\u2A99','Element':'\u2208','elinters':'\u23E7','ell':'\u2113','els':'\u2A95','elsdot':'\u2A97','emacr':'\u0113','Emacr':'\u0112','empty':'\u2205','emptyset':'\u2205','EmptySmallSquare':'\u25FB','emptyv':'\u2205','EmptyVerySmallSquare':'\u25AB','emsp':'\u2003','emsp13':'\u2004','emsp14':'\u2005','eng':'\u014B','ENG':'\u014A','ensp':'\u2002','eogon':'\u0119','Eogon':'\u0118','eopf':'\uD835\uDD56','Eopf':'\uD835\uDD3C','epar':'\u22D5','eparsl':'\u29E3','eplus':'\u2A71','epsi':'\u03B5','epsilon':'\u03B5','Epsilon':'\u0395','epsiv':'\u03F5','eqcirc':'\u2256','eqcolon':'\u2255','eqsim':'\u2242','eqslantgtr':'\u2A96','eqslantless':'\u2A95','Equal':'\u2A75','equals':'=','EqualTilde':'\u2242','equest':'\u225F','Equilibrium':'\u21CC','equiv':'\u2261','equivDD':'\u2A78','eqvparsl':'\u29E5','erarr':'\u2971','erDot':'\u2253','escr':'\u212F','Escr':'\u2130','esdot':'\u2250','esim':'\u2242','Esim':'\u2A73','eta':'\u03B7','Eta':'\u0397','eth':'\xF0','ETH':'\xD0','euml':'\xEB','Euml':'\xCB','euro':'\u20AC','excl':'!','exist':'\u2203','Exists':'\u2203','expectation':'\u2130','exponentiale':'\u2147','ExponentialE':'\u2147','fallingdotseq':'\u2252','fcy':'\u0444','Fcy':'\u0424','female':'\u2640','ffilig':'\uFB03','fflig':'\uFB00','ffllig':'\uFB04','ffr':'\uD835\uDD23','Ffr':'\uD835\uDD09','filig':'\uFB01','FilledSmallSquare':'\u25FC','FilledVerySmallSquare':'\u25AA','fjlig':'fj','flat':'\u266D','fllig':'\uFB02','fltns':'\u25B1','fnof':'\u0192','fopf':'\uD835\uDD57','Fopf':'\uD835\uDD3D','forall':'\u2200','ForAll':'\u2200','fork':'\u22D4','forkv':'\u2AD9','Fouriertrf':'\u2131','fpartint':'\u2A0D','frac12':'\xBD','frac13':'\u2153','frac14':'\xBC','frac15':'\u2155','frac16':'\u2159','frac18':'\u215B','frac23':'\u2154','frac25':'\u2156','frac34':'\xBE','frac35':'\u2157','frac38':'\u215C','frac45':'\u2158','frac56':'\u215A','frac58':'\u215D','frac78':'\u215E','frasl':'\u2044','frown':'\u2322','fscr':'\uD835\uDCBB','Fscr':'\u2131','gacute':'\u01F5','gamma':'\u03B3','Gamma':'\u0393','gammad':'\u03DD','Gammad':'\u03DC','gap':'\u2A86','gbreve':'\u011F','Gbreve':'\u011E','Gcedil':'\u0122','gcirc':'\u011D','Gcirc':'\u011C','gcy':'\u0433','Gcy':'\u0413','gdot':'\u0121','Gdot':'\u0120','ge':'\u2265','gE':'\u2267','gel':'\u22DB','gEl':'\u2A8C','geq':'\u2265','geqq':'\u2267','geqslant':'\u2A7E','ges':'\u2A7E','gescc':'\u2AA9','gesdot':'\u2A80','gesdoto':'\u2A82','gesdotol':'\u2A84','gesl':'\u22DB\uFE00','gesles':'\u2A94','gfr':'\uD835\uDD24','Gfr':'\uD835\uDD0A','gg':'\u226B','Gg':'\u22D9','ggg':'\u22D9','gimel':'\u2137','gjcy':'\u0453','GJcy':'\u0403','gl':'\u2277','gla':'\u2AA5','glE':'\u2A92','glj':'\u2AA4','gnap':'\u2A8A','gnapprox':'\u2A8A','gne':'\u2A88','gnE':'\u2269','gneq':'\u2A88','gneqq':'\u2269','gnsim':'\u22E7','gopf':'\uD835\uDD58','Gopf':'\uD835\uDD3E','grave':'`','GreaterEqual':'\u2265','GreaterEqualLess':'\u22DB','GreaterFullEqual':'\u2267','GreaterGreater':'\u2AA2','GreaterLess':'\u2277','GreaterSlantEqual':'\u2A7E','GreaterTilde':'\u2273','gscr':'\u210A','Gscr':'\uD835\uDCA2','gsim':'\u2273','gsime':'\u2A8E','gsiml':'\u2A90','gt':'>','Gt':'\u226B','GT':'>','gtcc':'\u2AA7','gtcir':'\u2A7A','gtdot':'\u22D7','gtlPar':'\u2995','gtquest':'\u2A7C','gtrapprox':'\u2A86','gtrarr':'\u2978','gtrdot':'\u22D7','gtreqless':'\u22DB','gtreqqless':'\u2A8C','gtrless':'\u2277','gtrsim':'\u2273','gvertneqq':'\u2269\uFE00','gvnE':'\u2269\uFE00','Hacek':'\u02C7','hairsp':'\u200A','half':'\xBD','hamilt':'\u210B','hardcy':'\u044A','HARDcy':'\u042A','harr':'\u2194','hArr':'\u21D4','harrcir':'\u2948','harrw':'\u21AD','Hat':'^','hbar':'\u210F','hcirc':'\u0125','Hcirc':'\u0124','hearts':'\u2665','heartsuit':'\u2665','hellip':'\u2026','hercon':'\u22B9','hfr':'\uD835\uDD25','Hfr':'\u210C','HilbertSpace':'\u210B','hksearow':'\u2925','hkswarow':'\u2926','hoarr':'\u21FF','homtht':'\u223B','hookleftarrow':'\u21A9','hookrightarrow':'\u21AA','hopf':'\uD835\uDD59','Hopf':'\u210D','horbar':'\u2015','HorizontalLine':'\u2500','hscr':'\uD835\uDCBD','Hscr':'\u210B','hslash':'\u210F','hstrok':'\u0127','Hstrok':'\u0126','HumpDownHump':'\u224E','HumpEqual':'\u224F','hybull':'\u2043','hyphen':'\u2010','iacute':'\xED','Iacute':'\xCD','ic':'\u2063','icirc':'\xEE','Icirc':'\xCE','icy':'\u0438','Icy':'\u0418','Idot':'\u0130','iecy':'\u0435','IEcy':'\u0415','iexcl':'\xA1','iff':'\u21D4','ifr':'\uD835\uDD26','Ifr':'\u2111','igrave':'\xEC','Igrave':'\xCC','ii':'\u2148','iiiint':'\u2A0C','iiint':'\u222D','iinfin':'\u29DC','iiota':'\u2129','ijlig':'\u0133','IJlig':'\u0132','Im':'\u2111','imacr':'\u012B','Imacr':'\u012A','image':'\u2111','ImaginaryI':'\u2148','imagline':'\u2110','imagpart':'\u2111','imath':'\u0131','imof':'\u22B7','imped':'\u01B5','Implies':'\u21D2','in':'\u2208','incare':'\u2105','infin':'\u221E','infintie':'\u29DD','inodot':'\u0131','int':'\u222B','Int':'\u222C','intcal':'\u22BA','integers':'\u2124','Integral':'\u222B','intercal':'\u22BA','Intersection':'\u22C2','intlarhk':'\u2A17','intprod':'\u2A3C','InvisibleComma':'\u2063','InvisibleTimes':'\u2062','iocy':'\u0451','IOcy':'\u0401','iogon':'\u012F','Iogon':'\u012E','iopf':'\uD835\uDD5A','Iopf':'\uD835\uDD40','iota':'\u03B9','Iota':'\u0399','iprod':'\u2A3C','iquest':'\xBF','iscr':'\uD835\uDCBE','Iscr':'\u2110','isin':'\u2208','isindot':'\u22F5','isinE':'\u22F9','isins':'\u22F4','isinsv':'\u22F3','isinv':'\u2208','it':'\u2062','itilde':'\u0129','Itilde':'\u0128','iukcy':'\u0456','Iukcy':'\u0406','iuml':'\xEF','Iuml':'\xCF','jcirc':'\u0135','Jcirc':'\u0134','jcy':'\u0439','Jcy':'\u0419','jfr':'\uD835\uDD27','Jfr':'\uD835\uDD0D','jmath':'\u0237','jopf':'\uD835\uDD5B','Jopf':'\uD835\uDD41','jscr':'\uD835\uDCBF','Jscr':'\uD835\uDCA5','jsercy':'\u0458','Jsercy':'\u0408','jukcy':'\u0454','Jukcy':'\u0404','kappa':'\u03BA','Kappa':'\u039A','kappav':'\u03F0','kcedil':'\u0137','Kcedil':'\u0136','kcy':'\u043A','Kcy':'\u041A','kfr':'\uD835\uDD28','Kfr':'\uD835\uDD0E','kgreen':'\u0138','khcy':'\u0445','KHcy':'\u0425','kjcy':'\u045C','KJcy':'\u040C','kopf':'\uD835\uDD5C','Kopf':'\uD835\uDD42','kscr':'\uD835\uDCC0','Kscr':'\uD835\uDCA6','lAarr':'\u21DA','lacute':'\u013A','Lacute':'\u0139','laemptyv':'\u29B4','lagran':'\u2112','lambda':'\u03BB','Lambda':'\u039B','lang':'\u27E8','Lang':'\u27EA','langd':'\u2991','langle':'\u27E8','lap':'\u2A85','Laplacetrf':'\u2112','laquo':'\xAB','larr':'\u2190','lArr':'\u21D0','Larr':'\u219E','larrb':'\u21E4','larrbfs':'\u291F','larrfs':'\u291D','larrhk':'\u21A9','larrlp':'\u21AB','larrpl':'\u2939','larrsim':'\u2973','larrtl':'\u21A2','lat':'\u2AAB','latail':'\u2919','lAtail':'\u291B','late':'\u2AAD','lates':'\u2AAD\uFE00','lbarr':'\u290C','lBarr':'\u290E','lbbrk':'\u2772','lbrace':'{','lbrack':'[','lbrke':'\u298B','lbrksld':'\u298F','lbrkslu':'\u298D','lcaron':'\u013E','Lcaron':'\u013D','lcedil':'\u013C','Lcedil':'\u013B','lceil':'\u2308','lcub':'{','lcy':'\u043B','Lcy':'\u041B','ldca':'\u2936','ldquo':'\u201C','ldquor':'\u201E','ldrdhar':'\u2967','ldrushar':'\u294B','ldsh':'\u21B2','le':'\u2264','lE':'\u2266','LeftAngleBracket':'\u27E8','leftarrow':'\u2190','Leftarrow':'\u21D0','LeftArrow':'\u2190','LeftArrowBar':'\u21E4','LeftArrowRightArrow':'\u21C6','leftarrowtail':'\u21A2','LeftCeiling':'\u2308','LeftDoubleBracket':'\u27E6','LeftDownTeeVector':'\u2961','LeftDownVector':'\u21C3','LeftDownVectorBar':'\u2959','LeftFloor':'\u230A','leftharpoondown':'\u21BD','leftharpoonup':'\u21BC','leftleftarrows':'\u21C7','leftrightarrow':'\u2194','Leftrightarrow':'\u21D4','LeftRightArrow':'\u2194','leftrightarrows':'\u21C6','leftrightharpoons':'\u21CB','leftrightsquigarrow':'\u21AD','LeftRightVector':'\u294E','LeftTee':'\u22A3','LeftTeeArrow':'\u21A4','LeftTeeVector':'\u295A','leftthreetimes':'\u22CB','LeftTriangle':'\u22B2','LeftTriangleBar':'\u29CF','LeftTriangleEqual':'\u22B4','LeftUpDownVector':'\u2951','LeftUpTeeVector':'\u2960','LeftUpVector':'\u21BF','LeftUpVectorBar':'\u2958','LeftVector':'\u21BC','LeftVectorBar':'\u2952','leg':'\u22DA','lEg':'\u2A8B','leq':'\u2264','leqq':'\u2266','leqslant':'\u2A7D','les':'\u2A7D','lescc':'\u2AA8','lesdot':'\u2A7F','lesdoto':'\u2A81','lesdotor':'\u2A83','lesg':'\u22DA\uFE00','lesges':'\u2A93','lessapprox':'\u2A85','lessdot':'\u22D6','lesseqgtr':'\u22DA','lesseqqgtr':'\u2A8B','LessEqualGreater':'\u22DA','LessFullEqual':'\u2266','LessGreater':'\u2276','lessgtr':'\u2276','LessLess':'\u2AA1','lesssim':'\u2272','LessSlantEqual':'\u2A7D','LessTilde':'\u2272','lfisht':'\u297C','lfloor':'\u230A','lfr':'\uD835\uDD29','Lfr':'\uD835\uDD0F','lg':'\u2276','lgE':'\u2A91','lHar':'\u2962','lhard':'\u21BD','lharu':'\u21BC','lharul':'\u296A','lhblk':'\u2584','ljcy':'\u0459','LJcy':'\u0409','ll':'\u226A','Ll':'\u22D8','llarr':'\u21C7','llcorner':'\u231E','Lleftarrow':'\u21DA','llhard':'\u296B','lltri':'\u25FA','lmidot':'\u0140','Lmidot':'\u013F','lmoust':'\u23B0','lmoustache':'\u23B0','lnap':'\u2A89','lnapprox':'\u2A89','lne':'\u2A87','lnE':'\u2268','lneq':'\u2A87','lneqq':'\u2268','lnsim':'\u22E6','loang':'\u27EC','loarr':'\u21FD','lobrk':'\u27E6','longleftarrow':'\u27F5','Longleftarrow':'\u27F8','LongLeftArrow':'\u27F5','longleftrightarrow':'\u27F7','Longleftrightarrow':'\u27FA','LongLeftRightArrow':'\u27F7','longmapsto':'\u27FC','longrightarrow':'\u27F6','Longrightarrow':'\u27F9','LongRightArrow':'\u27F6','looparrowleft':'\u21AB','looparrowright':'\u21AC','lopar':'\u2985','lopf':'\uD835\uDD5D','Lopf':'\uD835\uDD43','loplus':'\u2A2D','lotimes':'\u2A34','lowast':'\u2217','lowbar':'_','LowerLeftArrow':'\u2199','LowerRightArrow':'\u2198','loz':'\u25CA','lozenge':'\u25CA','lozf':'\u29EB','lpar':'(','lparlt':'\u2993','lrarr':'\u21C6','lrcorner':'\u231F','lrhar':'\u21CB','lrhard':'\u296D','lrm':'\u200E','lrtri':'\u22BF','lsaquo':'\u2039','lscr':'\uD835\uDCC1','Lscr':'\u2112','lsh':'\u21B0','Lsh':'\u21B0','lsim':'\u2272','lsime':'\u2A8D','lsimg':'\u2A8F','lsqb':'[','lsquo':'\u2018','lsquor':'\u201A','lstrok':'\u0142','Lstrok':'\u0141','lt':'<','Lt':'\u226A','LT':'<','ltcc':'\u2AA6','ltcir':'\u2A79','ltdot':'\u22D6','lthree':'\u22CB','ltimes':'\u22C9','ltlarr':'\u2976','ltquest':'\u2A7B','ltri':'\u25C3','ltrie':'\u22B4','ltrif':'\u25C2','ltrPar':'\u2996','lurdshar':'\u294A','luruhar':'\u2966','lvertneqq':'\u2268\uFE00','lvnE':'\u2268\uFE00','macr':'\xAF','male':'\u2642','malt':'\u2720','maltese':'\u2720','map':'\u21A6','Map':'\u2905','mapsto':'\u21A6','mapstodown':'\u21A7','mapstoleft':'\u21A4','mapstoup':'\u21A5','marker':'\u25AE','mcomma':'\u2A29','mcy':'\u043C','Mcy':'\u041C','mdash':'\u2014','mDDot':'\u223A','measuredangle':'\u2221','MediumSpace':'\u205F','Mellintrf':'\u2133','mfr':'\uD835\uDD2A','Mfr':'\uD835\uDD10','mho':'\u2127','micro':'\xB5','mid':'\u2223','midast':'*','midcir':'\u2AF0','middot':'\xB7','minus':'\u2212','minusb':'\u229F','minusd':'\u2238','minusdu':'\u2A2A','MinusPlus':'\u2213','mlcp':'\u2ADB','mldr':'\u2026','mnplus':'\u2213','models':'\u22A7','mopf':'\uD835\uDD5E','Mopf':'\uD835\uDD44','mp':'\u2213','mscr':'\uD835\uDCC2','Mscr':'\u2133','mstpos':'\u223E','mu':'\u03BC','Mu':'\u039C','multimap':'\u22B8','mumap':'\u22B8','nabla':'\u2207','nacute':'\u0144','Nacute':'\u0143','nang':'\u2220\u20D2','nap':'\u2249','napE':'\u2A70\u0338','napid':'\u224B\u0338','napos':'\u0149','napprox':'\u2249','natur':'\u266E','natural':'\u266E','naturals':'\u2115','nbsp':'\xA0','nbump':'\u224E\u0338','nbumpe':'\u224F\u0338','ncap':'\u2A43','ncaron':'\u0148','Ncaron':'\u0147','ncedil':'\u0146','Ncedil':'\u0145','ncong':'\u2247','ncongdot':'\u2A6D\u0338','ncup':'\u2A42','ncy':'\u043D','Ncy':'\u041D','ndash':'\u2013','ne':'\u2260','nearhk':'\u2924','nearr':'\u2197','neArr':'\u21D7','nearrow':'\u2197','nedot':'\u2250\u0338','NegativeMediumSpace':'\u200B','NegativeThickSpace':'\u200B','NegativeThinSpace':'\u200B','NegativeVeryThinSpace':'\u200B','nequiv':'\u2262','nesear':'\u2928','nesim':'\u2242\u0338','NestedGreaterGreater':'\u226B','NestedLessLess':'\u226A','NewLine':'\n','nexist':'\u2204','nexists':'\u2204','nfr':'\uD835\uDD2B','Nfr':'\uD835\uDD11','nge':'\u2271','ngE':'\u2267\u0338','ngeq':'\u2271','ngeqq':'\u2267\u0338','ngeqslant':'\u2A7E\u0338','nges':'\u2A7E\u0338','nGg':'\u22D9\u0338','ngsim':'\u2275','ngt':'\u226F','nGt':'\u226B\u20D2','ngtr':'\u226F','nGtv':'\u226B\u0338','nharr':'\u21AE','nhArr':'\u21CE','nhpar':'\u2AF2','ni':'\u220B','nis':'\u22FC','nisd':'\u22FA','niv':'\u220B','njcy':'\u045A','NJcy':'\u040A','nlarr':'\u219A','nlArr':'\u21CD','nldr':'\u2025','nle':'\u2270','nlE':'\u2266\u0338','nleftarrow':'\u219A','nLeftarrow':'\u21CD','nleftrightarrow':'\u21AE','nLeftrightarrow':'\u21CE','nleq':'\u2270','nleqq':'\u2266\u0338','nleqslant':'\u2A7D\u0338','nles':'\u2A7D\u0338','nless':'\u226E','nLl':'\u22D8\u0338','nlsim':'\u2274','nlt':'\u226E','nLt':'\u226A\u20D2','nltri':'\u22EA','nltrie':'\u22EC','nLtv':'\u226A\u0338','nmid':'\u2224','NoBreak':'\u2060','NonBreakingSpace':'\xA0','nopf':'\uD835\uDD5F','Nopf':'\u2115','not':'\xAC','Not':'\u2AEC','NotCongruent':'\u2262','NotCupCap':'\u226D','NotDoubleVerticalBar':'\u2226','NotElement':'\u2209','NotEqual':'\u2260','NotEqualTilde':'\u2242\u0338','NotExists':'\u2204','NotGreater':'\u226F','NotGreaterEqual':'\u2271','NotGreaterFullEqual':'\u2267\u0338','NotGreaterGreater':'\u226B\u0338','NotGreaterLess':'\u2279','NotGreaterSlantEqual':'\u2A7E\u0338','NotGreaterTilde':'\u2275','NotHumpDownHump':'\u224E\u0338','NotHumpEqual':'\u224F\u0338','notin':'\u2209','notindot':'\u22F5\u0338','notinE':'\u22F9\u0338','notinva':'\u2209','notinvb':'\u22F7','notinvc':'\u22F6','NotLeftTriangle':'\u22EA','NotLeftTriangleBar':'\u29CF\u0338','NotLeftTriangleEqual':'\u22EC','NotLess':'\u226E','NotLessEqual':'\u2270','NotLessGreater':'\u2278','NotLessLess':'\u226A\u0338','NotLessSlantEqual':'\u2A7D\u0338','NotLessTilde':'\u2274','NotNestedGreaterGreater':'\u2AA2\u0338','NotNestedLessLess':'\u2AA1\u0338','notni':'\u220C','notniva':'\u220C','notnivb':'\u22FE','notnivc':'\u22FD','NotPrecedes':'\u2280','NotPrecedesEqual':'\u2AAF\u0338','NotPrecedesSlantEqual':'\u22E0','NotReverseElement':'\u220C','NotRightTriangle':'\u22EB','NotRightTriangleBar':'\u29D0\u0338','NotRightTriangleEqual':'\u22ED','NotSquareSubset':'\u228F\u0338','NotSquareSubsetEqual':'\u22E2','NotSquareSuperset':'\u2290\u0338','NotSquareSupersetEqual':'\u22E3','NotSubset':'\u2282\u20D2','NotSubsetEqual':'\u2288','NotSucceeds':'\u2281','NotSucceedsEqual':'\u2AB0\u0338','NotSucceedsSlantEqual':'\u22E1','NotSucceedsTilde':'\u227F\u0338','NotSuperset':'\u2283\u20D2','NotSupersetEqual':'\u2289','NotTilde':'\u2241','NotTildeEqual':'\u2244','NotTildeFullEqual':'\u2247','NotTildeTilde':'\u2249','NotVerticalBar':'\u2224','npar':'\u2226','nparallel':'\u2226','nparsl':'\u2AFD\u20E5','npart':'\u2202\u0338','npolint':'\u2A14','npr':'\u2280','nprcue':'\u22E0','npre':'\u2AAF\u0338','nprec':'\u2280','npreceq':'\u2AAF\u0338','nrarr':'\u219B','nrArr':'\u21CF','nrarrc':'\u2933\u0338','nrarrw':'\u219D\u0338','nrightarrow':'\u219B','nRightarrow':'\u21CF','nrtri':'\u22EB','nrtrie':'\u22ED','nsc':'\u2281','nsccue':'\u22E1','nsce':'\u2AB0\u0338','nscr':'\uD835\uDCC3','Nscr':'\uD835\uDCA9','nshortmid':'\u2224','nshortparallel':'\u2226','nsim':'\u2241','nsime':'\u2244','nsimeq':'\u2244','nsmid':'\u2224','nspar':'\u2226','nsqsube':'\u22E2','nsqsupe':'\u22E3','nsub':'\u2284','nsube':'\u2288','nsubE':'\u2AC5\u0338','nsubset':'\u2282\u20D2','nsubseteq':'\u2288','nsubseteqq':'\u2AC5\u0338','nsucc':'\u2281','nsucceq':'\u2AB0\u0338','nsup':'\u2285','nsupe':'\u2289','nsupE':'\u2AC6\u0338','nsupset':'\u2283\u20D2','nsupseteq':'\u2289','nsupseteqq':'\u2AC6\u0338','ntgl':'\u2279','ntilde':'\xF1','Ntilde':'\xD1','ntlg':'\u2278','ntriangleleft':'\u22EA','ntrianglelefteq':'\u22EC','ntriangleright':'\u22EB','ntrianglerighteq':'\u22ED','nu':'\u03BD','Nu':'\u039D','num':'#','numero':'\u2116','numsp':'\u2007','nvap':'\u224D\u20D2','nvdash':'\u22AC','nvDash':'\u22AD','nVdash':'\u22AE','nVDash':'\u22AF','nvge':'\u2265\u20D2','nvgt':'>\u20D2','nvHarr':'\u2904','nvinfin':'\u29DE','nvlArr':'\u2902','nvle':'\u2264\u20D2','nvlt':'<\u20D2','nvltrie':'\u22B4\u20D2','nvrArr':'\u2903','nvrtrie':'\u22B5\u20D2','nvsim':'\u223C\u20D2','nwarhk':'\u2923','nwarr':'\u2196','nwArr':'\u21D6','nwarrow':'\u2196','nwnear':'\u2927','oacute':'\xF3','Oacute':'\xD3','oast':'\u229B','ocir':'\u229A','ocirc':'\xF4','Ocirc':'\xD4','ocy':'\u043E','Ocy':'\u041E','odash':'\u229D','odblac':'\u0151','Odblac':'\u0150','odiv':'\u2A38','odot':'\u2299','odsold':'\u29BC','oelig':'\u0153','OElig':'\u0152','ofcir':'\u29BF','ofr':'\uD835\uDD2C','Ofr':'\uD835\uDD12','ogon':'\u02DB','ograve':'\xF2','Ograve':'\xD2','ogt':'\u29C1','ohbar':'\u29B5','ohm':'\u03A9','oint':'\u222E','olarr':'\u21BA','olcir':'\u29BE','olcross':'\u29BB','oline':'\u203E','olt':'\u29C0','omacr':'\u014D','Omacr':'\u014C','omega':'\u03C9','Omega':'\u03A9','omicron':'\u03BF','Omicron':'\u039F','omid':'\u29B6','ominus':'\u2296','oopf':'\uD835\uDD60','Oopf':'\uD835\uDD46','opar':'\u29B7','OpenCurlyDoubleQuote':'\u201C','OpenCurlyQuote':'\u2018','operp':'\u29B9','oplus':'\u2295','or':'\u2228','Or':'\u2A54','orarr':'\u21BB','ord':'\u2A5D','order':'\u2134','orderof':'\u2134','ordf':'\xAA','ordm':'\xBA','origof':'\u22B6','oror':'\u2A56','orslope':'\u2A57','orv':'\u2A5B','oS':'\u24C8','oscr':'\u2134','Oscr':'\uD835\uDCAA','oslash':'\xF8','Oslash':'\xD8','osol':'\u2298','otilde':'\xF5','Otilde':'\xD5','otimes':'\u2297','Otimes':'\u2A37','otimesas':'\u2A36','ouml':'\xF6','Ouml':'\xD6','ovbar':'\u233D','OverBar':'\u203E','OverBrace':'\u23DE','OverBracket':'\u23B4','OverParenthesis':'\u23DC','par':'\u2225','para':'\xB6','parallel':'\u2225','parsim':'\u2AF3','parsl':'\u2AFD','part':'\u2202','PartialD':'\u2202','pcy':'\u043F','Pcy':'\u041F','percnt':'%','period':'.','permil':'\u2030','perp':'\u22A5','pertenk':'\u2031','pfr':'\uD835\uDD2D','Pfr':'\uD835\uDD13','phi':'\u03C6','Phi':'\u03A6','phiv':'\u03D5','phmmat':'\u2133','phone':'\u260E','pi':'\u03C0','Pi':'\u03A0','pitchfork':'\u22D4','piv':'\u03D6','planck':'\u210F','planckh':'\u210E','plankv':'\u210F','plus':'+','plusacir':'\u2A23','plusb':'\u229E','pluscir':'\u2A22','plusdo':'\u2214','plusdu':'\u2A25','pluse':'\u2A72','PlusMinus':'\xB1','plusmn':'\xB1','plussim':'\u2A26','plustwo':'\u2A27','pm':'\xB1','Poincareplane':'\u210C','pointint':'\u2A15','popf':'\uD835\uDD61','Popf':'\u2119','pound':'\xA3','pr':'\u227A','Pr':'\u2ABB','prap':'\u2AB7','prcue':'\u227C','pre':'\u2AAF','prE':'\u2AB3','prec':'\u227A','precapprox':'\u2AB7','preccurlyeq':'\u227C','Precedes':'\u227A','PrecedesEqual':'\u2AAF','PrecedesSlantEqual':'\u227C','PrecedesTilde':'\u227E','preceq':'\u2AAF','precnapprox':'\u2AB9','precneqq':'\u2AB5','precnsim':'\u22E8','precsim':'\u227E','prime':'\u2032','Prime':'\u2033','primes':'\u2119','prnap':'\u2AB9','prnE':'\u2AB5','prnsim':'\u22E8','prod':'\u220F','Product':'\u220F','profalar':'\u232E','profline':'\u2312','profsurf':'\u2313','prop':'\u221D','Proportion':'\u2237','Proportional':'\u221D','propto':'\u221D','prsim':'\u227E','prurel':'\u22B0','pscr':'\uD835\uDCC5','Pscr':'\uD835\uDCAB','psi':'\u03C8','Psi':'\u03A8','puncsp':'\u2008','qfr':'\uD835\uDD2E','Qfr':'\uD835\uDD14','qint':'\u2A0C','qopf':'\uD835\uDD62','Qopf':'\u211A','qprime':'\u2057','qscr':'\uD835\uDCC6','Qscr':'\uD835\uDCAC','quaternions':'\u210D','quatint':'\u2A16','quest':'?','questeq':'\u225F','quot':'"','QUOT':'"','rAarr':'\u21DB','race':'\u223D\u0331','racute':'\u0155','Racute':'\u0154','radic':'\u221A','raemptyv':'\u29B3','rang':'\u27E9','Rang':'\u27EB','rangd':'\u2992','range':'\u29A5','rangle':'\u27E9','raquo':'\xBB','rarr':'\u2192','rArr':'\u21D2','Rarr':'\u21A0','rarrap':'\u2975','rarrb':'\u21E5','rarrbfs':'\u2920','rarrc':'\u2933','rarrfs':'\u291E','rarrhk':'\u21AA','rarrlp':'\u21AC','rarrpl':'\u2945','rarrsim':'\u2974','rarrtl':'\u21A3','Rarrtl':'\u2916','rarrw':'\u219D','ratail':'\u291A','rAtail':'\u291C','ratio':'\u2236','rationals':'\u211A','rbarr':'\u290D','rBarr':'\u290F','RBarr':'\u2910','rbbrk':'\u2773','rbrace':'}','rbrack':']','rbrke':'\u298C','rbrksld':'\u298E','rbrkslu':'\u2990','rcaron':'\u0159','Rcaron':'\u0158','rcedil':'\u0157','Rcedil':'\u0156','rceil':'\u2309','rcub':'}','rcy':'\u0440','Rcy':'\u0420','rdca':'\u2937','rdldhar':'\u2969','rdquo':'\u201D','rdquor':'\u201D','rdsh':'\u21B3','Re':'\u211C','real':'\u211C','realine':'\u211B','realpart':'\u211C','reals':'\u211D','rect':'\u25AD','reg':'\xAE','REG':'\xAE','ReverseElement':'\u220B','ReverseEquilibrium':'\u21CB','ReverseUpEquilibrium':'\u296F','rfisht':'\u297D','rfloor':'\u230B','rfr':'\uD835\uDD2F','Rfr':'\u211C','rHar':'\u2964','rhard':'\u21C1','rharu':'\u21C0','rharul':'\u296C','rho':'\u03C1','Rho':'\u03A1','rhov':'\u03F1','RightAngleBracket':'\u27E9','rightarrow':'\u2192','Rightarrow':'\u21D2','RightArrow':'\u2192','RightArrowBar':'\u21E5','RightArrowLeftArrow':'\u21C4','rightarrowtail':'\u21A3','RightCeiling':'\u2309','RightDoubleBracket':'\u27E7','RightDownTeeVector':'\u295D','RightDownVector':'\u21C2','RightDownVectorBar':'\u2955','RightFloor':'\u230B','rightharpoondown':'\u21C1','rightharpoonup':'\u21C0','rightleftarrows':'\u21C4','rightleftharpoons':'\u21CC','rightrightarrows':'\u21C9','rightsquigarrow':'\u219D','RightTee':'\u22A2','RightTeeArrow':'\u21A6','RightTeeVector':'\u295B','rightthreetimes':'\u22CC','RightTriangle':'\u22B3','RightTriangleBar':'\u29D0','RightTriangleEqual':'\u22B5','RightUpDownVector':'\u294F','RightUpTeeVector':'\u295C','RightUpVector':'\u21BE','RightUpVectorBar':'\u2954','RightVector':'\u21C0','RightVectorBar':'\u2953','ring':'\u02DA','risingdotseq':'\u2253','rlarr':'\u21C4','rlhar':'\u21CC','rlm':'\u200F','rmoust':'\u23B1','rmoustache':'\u23B1','rnmid':'\u2AEE','roang':'\u27ED','roarr':'\u21FE','robrk':'\u27E7','ropar':'\u2986','ropf':'\uD835\uDD63','Ropf':'\u211D','roplus':'\u2A2E','rotimes':'\u2A35','RoundImplies':'\u2970','rpar':')','rpargt':'\u2994','rppolint':'\u2A12','rrarr':'\u21C9','Rrightarrow':'\u21DB','rsaquo':'\u203A','rscr':'\uD835\uDCC7','Rscr':'\u211B','rsh':'\u21B1','Rsh':'\u21B1','rsqb':']','rsquo':'\u2019','rsquor':'\u2019','rthree':'\u22CC','rtimes':'\u22CA','rtri':'\u25B9','rtrie':'\u22B5','rtrif':'\u25B8','rtriltri':'\u29CE','RuleDelayed':'\u29F4','ruluhar':'\u2968','rx':'\u211E','sacute':'\u015B','Sacute':'\u015A','sbquo':'\u201A','sc':'\u227B','Sc':'\u2ABC','scap':'\u2AB8','scaron':'\u0161','Scaron':'\u0160','sccue':'\u227D','sce':'\u2AB0','scE':'\u2AB4','scedil':'\u015F','Scedil':'\u015E','scirc':'\u015D','Scirc':'\u015C','scnap':'\u2ABA','scnE':'\u2AB6','scnsim':'\u22E9','scpolint':'\u2A13','scsim':'\u227F','scy':'\u0441','Scy':'\u0421','sdot':'\u22C5','sdotb':'\u22A1','sdote':'\u2A66','searhk':'\u2925','searr':'\u2198','seArr':'\u21D8','searrow':'\u2198','sect':'\xA7','semi':';','seswar':'\u2929','setminus':'\u2216','setmn':'\u2216','sext':'\u2736','sfr':'\uD835\uDD30','Sfr':'\uD835\uDD16','sfrown':'\u2322','sharp':'\u266F','shchcy':'\u0449','SHCHcy':'\u0429','shcy':'\u0448','SHcy':'\u0428','ShortDownArrow':'\u2193','ShortLeftArrow':'\u2190','shortmid':'\u2223','shortparallel':'\u2225','ShortRightArrow':'\u2192','ShortUpArrow':'\u2191','shy':'\xAD','sigma':'\u03C3','Sigma':'\u03A3','sigmaf':'\u03C2','sigmav':'\u03C2','sim':'\u223C','simdot':'\u2A6A','sime':'\u2243','simeq':'\u2243','simg':'\u2A9E','simgE':'\u2AA0','siml':'\u2A9D','simlE':'\u2A9F','simne':'\u2246','simplus':'\u2A24','simrarr':'\u2972','slarr':'\u2190','SmallCircle':'\u2218','smallsetminus':'\u2216','smashp':'\u2A33','smeparsl':'\u29E4','smid':'\u2223','smile':'\u2323','smt':'\u2AAA','smte':'\u2AAC','smtes':'\u2AAC\uFE00','softcy':'\u044C','SOFTcy':'\u042C','sol':'/','solb':'\u29C4','solbar':'\u233F','sopf':'\uD835\uDD64','Sopf':'\uD835\uDD4A','spades':'\u2660','spadesuit':'\u2660','spar':'\u2225','sqcap':'\u2293','sqcaps':'\u2293\uFE00','sqcup':'\u2294','sqcups':'\u2294\uFE00','Sqrt':'\u221A','sqsub':'\u228F','sqsube':'\u2291','sqsubset':'\u228F','sqsubseteq':'\u2291','sqsup':'\u2290','sqsupe':'\u2292','sqsupset':'\u2290','sqsupseteq':'\u2292','squ':'\u25A1','square':'\u25A1','Square':'\u25A1','SquareIntersection':'\u2293','SquareSubset':'\u228F','SquareSubsetEqual':'\u2291','SquareSuperset':'\u2290','SquareSupersetEqual':'\u2292','SquareUnion':'\u2294','squarf':'\u25AA','squf':'\u25AA','srarr':'\u2192','sscr':'\uD835\uDCC8','Sscr':'\uD835\uDCAE','ssetmn':'\u2216','ssmile':'\u2323','sstarf':'\u22C6','star':'\u2606','Star':'\u22C6','starf':'\u2605','straightepsilon':'\u03F5','straightphi':'\u03D5','strns':'\xAF','sub':'\u2282','Sub':'\u22D0','subdot':'\u2ABD','sube':'\u2286','subE':'\u2AC5','subedot':'\u2AC3','submult':'\u2AC1','subne':'\u228A','subnE':'\u2ACB','subplus':'\u2ABF','subrarr':'\u2979','subset':'\u2282','Subset':'\u22D0','subseteq':'\u2286','subseteqq':'\u2AC5','SubsetEqual':'\u2286','subsetneq':'\u228A','subsetneqq':'\u2ACB','subsim':'\u2AC7','subsub':'\u2AD5','subsup':'\u2AD3','succ':'\u227B','succapprox':'\u2AB8','succcurlyeq':'\u227D','Succeeds':'\u227B','SucceedsEqual':'\u2AB0','SucceedsSlantEqual':'\u227D','SucceedsTilde':'\u227F','succeq':'\u2AB0','succnapprox':'\u2ABA','succneqq':'\u2AB6','succnsim':'\u22E9','succsim':'\u227F','SuchThat':'\u220B','sum':'\u2211','Sum':'\u2211','sung':'\u266A','sup':'\u2283','Sup':'\u22D1','sup1':'\xB9','sup2':'\xB2','sup3':'\xB3','supdot':'\u2ABE','supdsub':'\u2AD8','supe':'\u2287','supE':'\u2AC6','supedot':'\u2AC4','Superset':'\u2283','SupersetEqual':'\u2287','suphsol':'\u27C9','suphsub':'\u2AD7','suplarr':'\u297B','supmult':'\u2AC2','supne':'\u228B','supnE':'\u2ACC','supplus':'\u2AC0','supset':'\u2283','Supset':'\u22D1','supseteq':'\u2287','supseteqq':'\u2AC6','supsetneq':'\u228B','supsetneqq':'\u2ACC','supsim':'\u2AC8','supsub':'\u2AD4','supsup':'\u2AD6','swarhk':'\u2926','swarr':'\u2199','swArr':'\u21D9','swarrow':'\u2199','swnwar':'\u292A','szlig':'\xDF','Tab':'\t','target':'\u2316','tau':'\u03C4','Tau':'\u03A4','tbrk':'\u23B4','tcaron':'\u0165','Tcaron':'\u0164','tcedil':'\u0163','Tcedil':'\u0162','tcy':'\u0442','Tcy':'\u0422','tdot':'\u20DB','telrec':'\u2315','tfr':'\uD835\uDD31','Tfr':'\uD835\uDD17','there4':'\u2234','therefore':'\u2234','Therefore':'\u2234','theta':'\u03B8','Theta':'\u0398','thetasym':'\u03D1','thetav':'\u03D1','thickapprox':'\u2248','thicksim':'\u223C','ThickSpace':'\u205F\u200A','thinsp':'\u2009','ThinSpace':'\u2009','thkap':'\u2248','thksim':'\u223C','thorn':'\xFE','THORN':'\xDE','tilde':'\u02DC','Tilde':'\u223C','TildeEqual':'\u2243','TildeFullEqual':'\u2245','TildeTilde':'\u2248','times':'\xD7','timesb':'\u22A0','timesbar':'\u2A31','timesd':'\u2A30','tint':'\u222D','toea':'\u2928','top':'\u22A4','topbot':'\u2336','topcir':'\u2AF1','topf':'\uD835\uDD65','Topf':'\uD835\uDD4B','topfork':'\u2ADA','tosa':'\u2929','tprime':'\u2034','trade':'\u2122','TRADE':'\u2122','triangle':'\u25B5','triangledown':'\u25BF','triangleleft':'\u25C3','trianglelefteq':'\u22B4','triangleq':'\u225C','triangleright':'\u25B9','trianglerighteq':'\u22B5','tridot':'\u25EC','trie':'\u225C','triminus':'\u2A3A','TripleDot':'\u20DB','triplus':'\u2A39','trisb':'\u29CD','tritime':'\u2A3B','trpezium':'\u23E2','tscr':'\uD835\uDCC9','Tscr':'\uD835\uDCAF','tscy':'\u0446','TScy':'\u0426','tshcy':'\u045B','TSHcy':'\u040B','tstrok':'\u0167','Tstrok':'\u0166','twixt':'\u226C','twoheadleftarrow':'\u219E','twoheadrightarrow':'\u21A0','uacute':'\xFA','Uacute':'\xDA','uarr':'\u2191','uArr':'\u21D1','Uarr':'\u219F','Uarrocir':'\u2949','ubrcy':'\u045E','Ubrcy':'\u040E','ubreve':'\u016D','Ubreve':'\u016C','ucirc':'\xFB','Ucirc':'\xDB','ucy':'\u0443','Ucy':'\u0423','udarr':'\u21C5','udblac':'\u0171','Udblac':'\u0170','udhar':'\u296E','ufisht':'\u297E','ufr':'\uD835\uDD32','Ufr':'\uD835\uDD18','ugrave':'\xF9','Ugrave':'\xD9','uHar':'\u2963','uharl':'\u21BF','uharr':'\u21BE','uhblk':'\u2580','ulcorn':'\u231C','ulcorner':'\u231C','ulcrop':'\u230F','ultri':'\u25F8','umacr':'\u016B','Umacr':'\u016A','uml':'\xA8','UnderBar':'_','UnderBrace':'\u23DF','UnderBracket':'\u23B5','UnderParenthesis':'\u23DD','Union':'\u22C3','UnionPlus':'\u228E','uogon':'\u0173','Uogon':'\u0172','uopf':'\uD835\uDD66','Uopf':'\uD835\uDD4C','uparrow':'\u2191','Uparrow':'\u21D1','UpArrow':'\u2191','UpArrowBar':'\u2912','UpArrowDownArrow':'\u21C5','updownarrow':'\u2195','Updownarrow':'\u21D5','UpDownArrow':'\u2195','UpEquilibrium':'\u296E','upharpoonleft':'\u21BF','upharpoonright':'\u21BE','uplus':'\u228E','UpperLeftArrow':'\u2196','UpperRightArrow':'\u2197','upsi':'\u03C5','Upsi':'\u03D2','upsih':'\u03D2','upsilon':'\u03C5','Upsilon':'\u03A5','UpTee':'\u22A5','UpTeeArrow':'\u21A5','upuparrows':'\u21C8','urcorn':'\u231D','urcorner':'\u231D','urcrop':'\u230E','uring':'\u016F','Uring':'\u016E','urtri':'\u25F9','uscr':'\uD835\uDCCA','Uscr':'\uD835\uDCB0','utdot':'\u22F0','utilde':'\u0169','Utilde':'\u0168','utri':'\u25B5','utrif':'\u25B4','uuarr':'\u21C8','uuml':'\xFC','Uuml':'\xDC','uwangle':'\u29A7','vangrt':'\u299C','varepsilon':'\u03F5','varkappa':'\u03F0','varnothing':'\u2205','varphi':'\u03D5','varpi':'\u03D6','varpropto':'\u221D','varr':'\u2195','vArr':'\u21D5','varrho':'\u03F1','varsigma':'\u03C2','varsubsetneq':'\u228A\uFE00','varsubsetneqq':'\u2ACB\uFE00','varsupsetneq':'\u228B\uFE00','varsupsetneqq':'\u2ACC\uFE00','vartheta':'\u03D1','vartriangleleft':'\u22B2','vartriangleright':'\u22B3','vBar':'\u2AE8','Vbar':'\u2AEB','vBarv':'\u2AE9','vcy':'\u0432','Vcy':'\u0412','vdash':'\u22A2','vDash':'\u22A8','Vdash':'\u22A9','VDash':'\u22AB','Vdashl':'\u2AE6','vee':'\u2228','Vee':'\u22C1','veebar':'\u22BB','veeeq':'\u225A','vellip':'\u22EE','verbar':'|','Verbar':'\u2016','vert':'|','Vert':'\u2016','VerticalBar':'\u2223','VerticalLine':'|','VerticalSeparator':'\u2758','VerticalTilde':'\u2240','VeryThinSpace':'\u200A','vfr':'\uD835\uDD33','Vfr':'\uD835\uDD19','vltri':'\u22B2','vnsub':'\u2282\u20D2','vnsup':'\u2283\u20D2','vopf':'\uD835\uDD67','Vopf':'\uD835\uDD4D','vprop':'\u221D','vrtri':'\u22B3','vscr':'\uD835\uDCCB','Vscr':'\uD835\uDCB1','vsubne':'\u228A\uFE00','vsubnE':'\u2ACB\uFE00','vsupne':'\u228B\uFE00','vsupnE':'\u2ACC\uFE00','Vvdash':'\u22AA','vzigzag':'\u299A','wcirc':'\u0175','Wcirc':'\u0174','wedbar':'\u2A5F','wedge':'\u2227','Wedge':'\u22C0','wedgeq':'\u2259','weierp':'\u2118','wfr':'\uD835\uDD34','Wfr':'\uD835\uDD1A','wopf':'\uD835\uDD68','Wopf':'\uD835\uDD4E','wp':'\u2118','wr':'\u2240','wreath':'\u2240','wscr':'\uD835\uDCCC','Wscr':'\uD835\uDCB2','xcap':'\u22C2','xcirc':'\u25EF','xcup':'\u22C3','xdtri':'\u25BD','xfr':'\uD835\uDD35','Xfr':'\uD835\uDD1B','xharr':'\u27F7','xhArr':'\u27FA','xi':'\u03BE','Xi':'\u039E','xlarr':'\u27F5','xlArr':'\u27F8','xmap':'\u27FC','xnis':'\u22FB','xodot':'\u2A00','xopf':'\uD835\uDD69','Xopf':'\uD835\uDD4F','xoplus':'\u2A01','xotime':'\u2A02','xrarr':'\u27F6','xrArr':'\u27F9','xscr':'\uD835\uDCCD','Xscr':'\uD835\uDCB3','xsqcup':'\u2A06','xuplus':'\u2A04','xutri':'\u25B3','xvee':'\u22C1','xwedge':'\u22C0','yacute':'\xFD','Yacute':'\xDD','yacy':'\u044F','YAcy':'\u042F','ycirc':'\u0177','Ycirc':'\u0176','ycy':'\u044B','Ycy':'\u042B','yen':'\xA5','yfr':'\uD835\uDD36','Yfr':'\uD835\uDD1C','yicy':'\u0457','YIcy':'\u0407','yopf':'\uD835\uDD6A','Yopf':'\uD835\uDD50','yscr':'\uD835\uDCCE','Yscr':'\uD835\uDCB4','yucy':'\u044E','YUcy':'\u042E','yuml':'\xFF','Yuml':'\u0178','zacute':'\u017A','Zacute':'\u0179','zcaron':'\u017E','Zcaron':'\u017D','zcy':'\u0437','Zcy':'\u0417','zdot':'\u017C','Zdot':'\u017B','zeetrf':'\u2128','ZeroWidthSpace':'\u200B','zeta':'\u03B6','Zeta':'\u0396','zfr':'\uD835\uDD37','Zfr':'\u2128','zhcy':'\u0436','ZHcy':'\u0416','zigrarr':'\u21DD','zopf':'\uD835\uDD6B','Zopf':'\u2124','zscr':'\uD835\uDCCF','Zscr':'\uD835\uDCB5','zwj':'\u200D','zwnj':'\u200C'};
+	var decodeMapLegacy = {'aacute':'\xE1','Aacute':'\xC1','acirc':'\xE2','Acirc':'\xC2','acute':'\xB4','aelig':'\xE6','AElig':'\xC6','agrave':'\xE0','Agrave':'\xC0','amp':'&','AMP':'&','aring':'\xE5','Aring':'\xC5','atilde':'\xE3','Atilde':'\xC3','auml':'\xE4','Auml':'\xC4','brvbar':'\xA6','ccedil':'\xE7','Ccedil':'\xC7','cedil':'\xB8','cent':'\xA2','copy':'\xA9','COPY':'\xA9','curren':'\xA4','deg':'\xB0','divide':'\xF7','eacute':'\xE9','Eacute':'\xC9','ecirc':'\xEA','Ecirc':'\xCA','egrave':'\xE8','Egrave':'\xC8','eth':'\xF0','ETH':'\xD0','euml':'\xEB','Euml':'\xCB','frac12':'\xBD','frac14':'\xBC','frac34':'\xBE','gt':'>','GT':'>','iacute':'\xED','Iacute':'\xCD','icirc':'\xEE','Icirc':'\xCE','iexcl':'\xA1','igrave':'\xEC','Igrave':'\xCC','iquest':'\xBF','iuml':'\xEF','Iuml':'\xCF','laquo':'\xAB','lt':'<','LT':'<','macr':'\xAF','micro':'\xB5','middot':'\xB7','nbsp':'\xA0','not':'\xAC','ntilde':'\xF1','Ntilde':'\xD1','oacute':'\xF3','Oacute':'\xD3','ocirc':'\xF4','Ocirc':'\xD4','ograve':'\xF2','Ograve':'\xD2','ordf':'\xAA','ordm':'\xBA','oslash':'\xF8','Oslash':'\xD8','otilde':'\xF5','Otilde':'\xD5','ouml':'\xF6','Ouml':'\xD6','para':'\xB6','plusmn':'\xB1','pound':'\xA3','quot':'"','QUOT':'"','raquo':'\xBB','reg':'\xAE','REG':'\xAE','sect':'\xA7','shy':'\xAD','sup1':'\xB9','sup2':'\xB2','sup3':'\xB3','szlig':'\xDF','thorn':'\xFE','THORN':'\xDE','times':'\xD7','uacute':'\xFA','Uacute':'\xDA','ucirc':'\xFB','Ucirc':'\xDB','ugrave':'\xF9','Ugrave':'\xD9','uml':'\xA8','uuml':'\xFC','Uuml':'\xDC','yacute':'\xFD','Yacute':'\xDD','yen':'\xA5','yuml':'\xFF'};
+	var decodeMapNumeric = {'0':'\uFFFD','128':'\u20AC','130':'\u201A','131':'\u0192','132':'\u201E','133':'\u2026','134':'\u2020','135':'\u2021','136':'\u02C6','137':'\u2030','138':'\u0160','139':'\u2039','140':'\u0152','142':'\u017D','145':'\u2018','146':'\u2019','147':'\u201C','148':'\u201D','149':'\u2022','150':'\u2013','151':'\u2014','152':'\u02DC','153':'\u2122','154':'\u0161','155':'\u203A','156':'\u0153','158':'\u017E','159':'\u0178'};
+	var invalidReferenceCodePoints = [1,2,3,4,5,6,7,8,11,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,127,128,129,130,131,132,133,134,135,136,137,138,139,140,141,142,143,144,145,146,147,148,149,150,151,152,153,154,155,156,157,158,159,64976,64977,64978,64979,64980,64981,64982,64983,64984,64985,64986,64987,64988,64989,64990,64991,64992,64993,64994,64995,64996,64997,64998,64999,65000,65001,65002,65003,65004,65005,65006,65007,65534,65535,131070,131071,196606,196607,262142,262143,327678,327679,393214,393215,458750,458751,524286,524287,589822,589823,655358,655359,720894,720895,786430,786431,851966,851967,917502,917503,983038,983039,1048574,1048575,1114110,1114111];
+
+	/*--------------------------------------------------------------------------*/
+
+	var stringFromCharCode = String.fromCharCode;
+
+	var object = {};
+	var hasOwnProperty = object.hasOwnProperty;
+	var has = function(object, propertyName) {
+		return hasOwnProperty.call(object, propertyName);
+	};
+
+	var contains = function(array, value) {
+		var index = -1;
+		var length = array.length;
+		while (++index < length) {
+			if (array[index] == value) {
+				return true;
+			}
+		}
+		return false;
+	};
+
+	var merge = function(options, defaults) {
+		if (!options) {
+			return defaults;
+		}
+		var result = {};
+		var key;
+		for (key in defaults) {
+			// A `hasOwnProperty` check is not needed here, since only recognized
+			// option names are used anyway. Any others are ignored.
+			result[key] = has(options, key) ? options[key] : defaults[key];
+		}
+		return result;
+	};
+
+	// Modified version of `ucs2encode`; see https://mths.be/punycode.
+	var codePointToSymbol = function(codePoint, strict) {
+		var output = '';
+		if ((codePoint >= 0xD800 && codePoint <= 0xDFFF) || codePoint > 0x10FFFF) {
+			// See issue #4:
+			// “Otherwise, if the number is in the range 0xD800 to 0xDFFF or is
+			// greater than 0x10FFFF, then this is a parse error. Return a U+FFFD
+			// REPLACEMENT CHARACTER.”
+			if (strict) {
+				parseError('character reference outside the permissible Unicode range');
+			}
+			return '\uFFFD';
+		}
+		if (has(decodeMapNumeric, codePoint)) {
+			if (strict) {
+				parseError('disallowed character reference');
+			}
+			return decodeMapNumeric[codePoint];
+		}
+		if (strict && contains(invalidReferenceCodePoints, codePoint)) {
+			parseError('disallowed character reference');
+		}
+		if (codePoint > 0xFFFF) {
+			codePoint -= 0x10000;
+			output += stringFromCharCode(codePoint >>> 10 & 0x3FF | 0xD800);
+			codePoint = 0xDC00 | codePoint & 0x3FF;
+		}
+		output += stringFromCharCode(codePoint);
+		return output;
+	};
+
+	var hexEscape = function(codePoint) {
+		return '&#x' + codePoint.toString(16).toUpperCase() + ';';
+	};
+
+	var decEscape = function(codePoint) {
+		return '&#' + codePoint + ';';
+	};
+
+	var parseError = function(message) {
+		throw Error('Parse error: ' + message);
+	};
+
+	/*--------------------------------------------------------------------------*/
+
+	var encode = function(string, options) {
+		options = merge(options, encode.options);
+		var strict = options.strict;
+		if (strict && regexInvalidRawCodePoint.test(string)) {
+			parseError('forbidden code point');
+		}
+		var encodeEverything = options.encodeEverything;
+		var useNamedReferences = options.useNamedReferences;
+		var allowUnsafeSymbols = options.allowUnsafeSymbols;
+		var escapeCodePoint = options.decimal ? decEscape : hexEscape;
+
+		var escapeBmpSymbol = function(symbol) {
+			return escapeCodePoint(symbol.charCodeAt(0));
+		};
+
+		if (encodeEverything) {
+			// Encode ASCII symbols.
+			string = string.replace(regexAsciiWhitelist, function(symbol) {
+				// Use named references if requested & possible.
+				if (useNamedReferences && has(encodeMap, symbol)) {
+					return '&' + encodeMap[symbol] + ';';
+				}
+				return escapeBmpSymbol(symbol);
+			});
+			// Shorten a few escapes that represent two symbols, of which at least one
+			// is within the ASCII range.
+			if (useNamedReferences) {
+				string = string
+					.replace(/&gt;\u20D2/g, '&nvgt;')
+					.replace(/&lt;\u20D2/g, '&nvlt;')
+					.replace(/&#x66;&#x6A;/g, '&fjlig;');
+			}
+			// Encode non-ASCII symbols.
+			if (useNamedReferences) {
+				// Encode non-ASCII symbols that can be replaced with a named reference.
+				string = string.replace(regexEncodeNonAscii, function(string) {
+					// Note: there is no need to check `has(encodeMap, string)` here.
+					return '&' + encodeMap[string] + ';';
+				});
+			}
+			// Note: any remaining non-ASCII symbols are handled outside of the `if`.
+		} else if (useNamedReferences) {
+			// Apply named character references.
+			// Encode `<>"'&` using named character references.
+			if (!allowUnsafeSymbols) {
+				string = string.replace(regexEscape, function(string) {
+					return '&' + encodeMap[string] + ';'; // no need to check `has()` here
+				});
+			}
+			// Shorten escapes that represent two symbols, of which at least one is
+			// `<>"'&`.
+			string = string
+				.replace(/&gt;\u20D2/g, '&nvgt;')
+				.replace(/&lt;\u20D2/g, '&nvlt;');
+			// Encode non-ASCII symbols that can be replaced with a named reference.
+			string = string.replace(regexEncodeNonAscii, function(string) {
+				// Note: there is no need to check `has(encodeMap, string)` here.
+				return '&' + encodeMap[string] + ';';
+			});
+		} else if (!allowUnsafeSymbols) {
+			// Encode `<>"'&` using hexadecimal escapes, now that they’re not handled
+			// using named character references.
+			string = string.replace(regexEscape, escapeBmpSymbol);
+		}
+		return string
+			// Encode astral symbols.
+			.replace(regexAstralSymbols, function($0) {
+				// https://mathiasbynens.be/notes/javascript-encoding#surrogate-formulae
+				var high = $0.charCodeAt(0);
+				var low = $0.charCodeAt(1);
+				var codePoint = (high - 0xD800) * 0x400 + low - 0xDC00 + 0x10000;
+				return escapeCodePoint(codePoint);
+			})
+			// Encode any remaining BMP symbols that are not printable ASCII symbols
+			// using a hexadecimal escape.
+			.replace(regexBmpWhitelist, escapeBmpSymbol);
+	};
+	// Expose default options (so they can be overridden globally).
+	encode.options = {
+		'allowUnsafeSymbols': false,
+		'encodeEverything': false,
+		'strict': false,
+		'useNamedReferences': false,
+		'decimal' : false
+	};
+
+	var decode = function(html, options) {
+		options = merge(options, decode.options);
+		var strict = options.strict;
+		if (strict && regexInvalidEntity.test(html)) {
+			parseError('malformed character reference');
+		}
+		return html.replace(regexDecode, function($0, $1, $2, $3, $4, $5, $6, $7, $8) {
+			var codePoint;
+			var semicolon;
+			var decDigits;
+			var hexDigits;
+			var reference;
+			var next;
+
+			if ($1) {
+				reference = $1;
+				// Note: there is no need to check `has(decodeMap, reference)`.
+				return decodeMap[reference];
+			}
+
+			if ($2) {
+				// Decode named character references without trailing `;`, e.g. `&amp`.
+				// This is only a parse error if it gets converted to `&`, or if it is
+				// followed by `=` in an attribute context.
+				reference = $2;
+				next = $3;
+				if (next && options.isAttributeValue) {
+					if (strict && next == '=') {
+						parseError('`&` did not start a character reference');
+					}
+					return $0;
+				} else {
+					if (strict) {
+						parseError(
+							'named character reference was not terminated by a semicolon'
+						);
+					}
+					// Note: there is no need to check `has(decodeMapLegacy, reference)`.
+					return decodeMapLegacy[reference] + (next || '');
+				}
+			}
+
+			if ($4) {
+				// Decode decimal escapes, e.g. `&#119558;`.
+				decDigits = $4;
+				semicolon = $5;
+				if (strict && !semicolon) {
+					parseError('character reference was not terminated by a semicolon');
+				}
+				codePoint = parseInt(decDigits, 10);
+				return codePointToSymbol(codePoint, strict);
+			}
+
+			if ($6) {
+				// Decode hexadecimal escapes, e.g. `&#x1D306;`.
+				hexDigits = $6;
+				semicolon = $7;
+				if (strict && !semicolon) {
+					parseError('character reference was not terminated by a semicolon');
+				}
+				codePoint = parseInt(hexDigits, 16);
+				return codePointToSymbol(codePoint, strict);
+			}
+
+			// If we’re still here, `if ($7)` is implied; it’s an ambiguous
+			// ampersand for sure. https://mths.be/notes/ambiguous-ampersands
+			if (strict) {
+				parseError(
+					'named character reference was not terminated by a semicolon'
+				);
+			}
+			return $0;
+		});
+	};
+	// Expose default options (so they can be overridden globally).
+	decode.options = {
+		'isAttributeValue': false,
+		'strict': false
+	};
+
+	var escape = function(string) {
+		return string.replace(regexEscape, function($0) {
+			// Note: there is no need to check `has(escapeMap, $0)` here.
+			return escapeMap[$0];
+		});
+	};
+
+	/*--------------------------------------------------------------------------*/
+
+	var he = {
+		'version': '1.2.0',
+		'encode': encode,
+		'decode': decode,
+		'escape': escape,
+		'unescape': decode
+	};
+
+	// Some AMD build optimizers, like r.js, check for specific condition patterns
+	// like the following:
+	if (
+		false
+	) {
+		define(function() {
+			return he;
+		});
+	}	else if (freeExports && !freeExports.nodeType) {
+		if (freeModule) { // in Node.js, io.js, or RingoJS v0.8.0+
+			freeModule.exports = he;
+		} else { // in Narwhal or RingoJS v0.7.0-
+			for (var key in he) {
+				has(he, key) && (freeExports[key] = he[key]);
+			}
+		}
+	} else { // in Rhino or a web browser
+		root.he = he;
+	}
+
+}(this));
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{}],55:[function(require,module,exports){
+exports.read = function (buffer, offset, isLE, mLen, nBytes) {
+  var e, m
+  var eLen = (nBytes * 8) - mLen - 1
+  var eMax = (1 << eLen) - 1
+  var eBias = eMax >> 1
+  var nBits = -7
+  var i = isLE ? (nBytes - 1) : 0
+  var d = isLE ? -1 : 1
+  var s = buffer[offset + i]
+
+  i += d
+
+  e = s & ((1 << (-nBits)) - 1)
+  s >>= (-nBits)
+  nBits += eLen
+  for (; nBits > 0; e = (e * 256) + buffer[offset + i], i += d, nBits -= 8) {}
+
+  m = e & ((1 << (-nBits)) - 1)
+  e >>= (-nBits)
+  nBits += mLen
+  for (; nBits > 0; m = (m * 256) + buffer[offset + i], i += d, nBits -= 8) {}
+
+  if (e === 0) {
+    e = 1 - eBias
+  } else if (e === eMax) {
+    return m ? NaN : ((s ? -1 : 1) * Infinity)
+  } else {
+    m = m + Math.pow(2, mLen)
+    e = e - eBias
+  }
+  return (s ? -1 : 1) * m * Math.pow(2, e - mLen)
+}
+
+exports.write = function (buffer, value, offset, isLE, mLen, nBytes) {
+  var e, m, c
+  var eLen = (nBytes * 8) - mLen - 1
+  var eMax = (1 << eLen) - 1
+  var eBias = eMax >> 1
+  var rt = (mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0)
+  var i = isLE ? 0 : (nBytes - 1)
+  var d = isLE ? 1 : -1
+  var s = value < 0 || (value === 0 && 1 / value < 0) ? 1 : 0
+
+  value = Math.abs(value)
+
+  if (isNaN(value) || value === Infinity) {
+    m = isNaN(value) ? 1 : 0
+    e = eMax
+  } else {
+    e = Math.floor(Math.log(value) / Math.LN2)
+    if (value * (c = Math.pow(2, -e)) < 1) {
+      e--
+      c *= 2
+    }
+    if (e + eBias >= 1) {
+      value += rt / c
+    } else {
+      value += rt * Math.pow(2, 1 - eBias)
+    }
+    if (value * c >= 2) {
+      e++
+      c /= 2
+    }
+
+    if (e + eBias >= eMax) {
+      m = 0
+      e = eMax
+    } else if (e + eBias >= 1) {
+      m = ((value * c) - 1) * Math.pow(2, mLen)
+      e = e + eBias
+    } else {
+      m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen)
+      e = 0
+    }
+  }
+
+  for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8) {}
+
+  e = (e << mLen) | m
+  eLen += mLen
+  for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8) {}
+
+  buffer[offset + i - d] |= s * 128
+}
+
+},{}],56:[function(require,module,exports){
+if (typeof Object.create === 'function') {
+  // implementation from standard node.js 'util' module
+  module.exports = function inherits(ctor, superCtor) {
+    ctor.super_ = superCtor
+    ctor.prototype = Object.create(superCtor.prototype, {
+      constructor: {
+        value: ctor,
+        enumerable: false,
+        writable: true,
+        configurable: true
+      }
+    });
+  };
+} else {
+  // old school shim for old browsers
+  module.exports = function inherits(ctor, superCtor) {
+    ctor.super_ = superCtor
+    var TempCtor = function () {}
+    TempCtor.prototype = superCtor.prototype
+    ctor.prototype = new TempCtor()
+    ctor.prototype.constructor = ctor
+  }
+}
+
+},{}],57:[function(require,module,exports){
+/*!
+ * Determine if an object is a Buffer
+ *
+ * @author   Feross Aboukhadijeh <https://feross.org>
+ * @license  MIT
+ */
+
+// The _isBuffer check is for Safari 5-7 support, because it's missing
+// Object.prototype.constructor. Remove this eventually
+module.exports = function (obj) {
+  return obj != null && (isBuffer(obj) || isSlowBuffer(obj) || !!obj._isBuffer)
+}
+
+function isBuffer (obj) {
+  return !!obj.constructor && typeof obj.constructor.isBuffer === 'function' && obj.constructor.isBuffer(obj)
+}
+
+// For Node v0.10 support. Remove this eventually.
+function isSlowBuffer (obj) {
+  return typeof obj.readFloatLE === 'function' && typeof obj.slice === 'function' && isBuffer(obj.slice(0, 0))
+}
+
+},{}],58:[function(require,module,exports){
+var toString = {}.toString;
+
+module.exports = Array.isArray || function (arr) {
+  return toString.call(arr) == '[object Array]';
+};
+
+},{}],59:[function(require,module,exports){
+(function (process){
+var path = require('path');
+var fs = require('fs');
+var _0777 = parseInt('0777', 8);
+
+module.exports = mkdirP.mkdirp = mkdirP.mkdirP = mkdirP;
+
+function mkdirP (p, opts, f, made) {
+    if (typeof opts === 'function') {
+        f = opts;
+        opts = {};
+    }
+    else if (!opts || typeof opts !== 'object') {
+        opts = { mode: opts };
+    }
+    
+    var mode = opts.mode;
+    var xfs = opts.fs || fs;
+    
+    if (mode === undefined) {
+        mode = _0777 & (~process.umask());
+    }
+    if (!made) made = null;
+    
+    var cb = f || function () {};
+    p = path.resolve(p);
+    
+    xfs.mkdir(p, mode, function (er) {
+        if (!er) {
+            made = made || p;
+            return cb(null, made);
+        }
+        switch (er.code) {
+            case 'ENOENT':
+                mkdirP(path.dirname(p), opts, function (er, made) {
+                    if (er) cb(er, made);
+                    else mkdirP(p, opts, cb, made);
+                });
+                break;
+
+            // In the case of any other error, just see if there's a dir
+            // there already.  If so, then hooray!  If not, then something
+            // is borked.
+            default:
+                xfs.stat(p, function (er2, stat) {
+                    // if the stat fails, then that's super weird.
+                    // let the original error be the failure reason.
+                    if (er2 || !stat.isDirectory()) cb(er, made)
+                    else cb(null, made);
+                });
+                break;
+        }
+    });
+}
+
+mkdirP.sync = function sync (p, opts, made) {
+    if (!opts || typeof opts !== 'object') {
+        opts = { mode: opts };
+    }
+    
+    var mode = opts.mode;
+    var xfs = opts.fs || fs;
+    
+    if (mode === undefined) {
+        mode = _0777 & (~process.umask());
+    }
+    if (!made) made = null;
+
+    p = path.resolve(p);
+
+    try {
+        xfs.mkdirSync(p, mode);
+        made = made || p;
+    }
+    catch (err0) {
+        switch (err0.code) {
+            case 'ENOENT' :
+                made = sync(path.dirname(p), opts, made);
+                sync(p, opts, made);
+                break;
+
+            // In the case of any other error, just see if there's a dir
+            // there already.  If so, then hooray!  If not, then something
+            // is borked.
+            default:
+                var stat;
+                try {
+                    stat = xfs.statSync(p);
+                }
+                catch (err1) {
+                    throw err0;
+                }
+                if (!stat.isDirectory()) throw err0;
+                break;
+        }
+    }
+
+    return made;
+};
+
+}).call(this,require('_process'))
+},{"_process":69,"fs":42,"path":42}],60:[function(require,module,exports){
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var w = d * 7;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} [options]
+ * @throws {Error} throw an error if val is not a non-empty string or a number
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options) {
+  options = options || {};
+  var type = typeof val;
+  if (type === 'string' && val.length > 0) {
+    return parse(val);
+  } else if (type === 'number' && isNaN(val) === false) {
+    return options.long ? fmtLong(val) : fmtShort(val);
+  }
+  throw new Error(
+    'val is not a non-empty string or a valid number. val=' +
+      JSON.stringify(val)
+  );
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+  str = String(str);
+  if (str.length > 100) {
+    return;
+  }
+  var match = /^((?:\d+)?\-?\d?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(
+    str
+  );
+  if (!match) {
+    return;
+  }
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'yrs':
+    case 'yr':
+    case 'y':
+      return n * y;
+    case 'weeks':
+    case 'week':
+    case 'w':
+      return n * w;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'hrs':
+    case 'hr':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'mins':
+    case 'min':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 'secs':
+    case 'sec':
+    case 's':
+      return n * s;
+    case 'milliseconds':
+    case 'millisecond':
+    case 'msecs':
+    case 'msec':
+    case 'ms':
+      return n;
+    default:
+      return undefined;
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtShort(ms) {
+  var msAbs = Math.abs(ms);
+  if (msAbs >= d) {
+    return Math.round(ms / d) + 'd';
+  }
+  if (msAbs >= h) {
+    return Math.round(ms / h) + 'h';
+  }
+  if (msAbs >= m) {
+    return Math.round(ms / m) + 'm';
+  }
+  if (msAbs >= s) {
+    return Math.round(ms / s) + 's';
+  }
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtLong(ms) {
+  var msAbs = Math.abs(ms);
+  if (msAbs >= d) {
+    return plural(ms, msAbs, d, 'day');
+  }
+  if (msAbs >= h) {
+    return plural(ms, msAbs, h, 'hour');
+  }
+  if (msAbs >= m) {
+    return plural(ms, msAbs, m, 'minute');
+  }
+  if (msAbs >= s) {
+    return plural(ms, msAbs, s, 'second');
+  }
+  return ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, msAbs, n, name) {
+  var isPlural = msAbs >= n * 1.5;
+  return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
+}
+
+},{}],61:[function(require,module,exports){
+'use strict';
+
+var keysShim;
+if (!Object.keys) {
+	// modified from https://github.com/es-shims/es5-shim
+	var has = Object.prototype.hasOwnProperty;
+	var toStr = Object.prototype.toString;
+	var isArgs = require('./isArguments'); // eslint-disable-line global-require
+	var isEnumerable = Object.prototype.propertyIsEnumerable;
+	var hasDontEnumBug = !isEnumerable.call({ toString: null }, 'toString');
+	var hasProtoEnumBug = isEnumerable.call(function () {}, 'prototype');
+	var dontEnums = [
+		'toString',
+		'toLocaleString',
+		'valueOf',
+		'hasOwnProperty',
+		'isPrototypeOf',
+		'propertyIsEnumerable',
+		'constructor'
+	];
+	var equalsConstructorPrototype = function (o) {
+		var ctor = o.constructor;
+		return ctor && ctor.prototype === o;
+	};
+	var excludedKeys = {
+		$applicationCache: true,
+		$console: true,
+		$external: true,
+		$frame: true,
+		$frameElement: true,
+		$frames: true,
+		$innerHeight: true,
+		$innerWidth: true,
+		$outerHeight: true,
+		$outerWidth: true,
+		$pageXOffset: true,
+		$pageYOffset: true,
+		$parent: true,
+		$scrollLeft: true,
+		$scrollTop: true,
+		$scrollX: true,
+		$scrollY: true,
+		$self: true,
+		$webkitIndexedDB: true,
+		$webkitStorageInfo: true,
+		$window: true
+	};
+	var hasAutomationEqualityBug = (function () {
+		/* global window */
+		if (typeof window === 'undefined') { return false; }
+		for (var k in window) {
+			try {
+				if (!excludedKeys['$' + k] && has.call(window, k) && window[k] !== null && typeof window[k] === 'object') {
+					try {
+						equalsConstructorPrototype(window[k]);
+					} catch (e) {
+						return true;
+					}
+				}
+			} catch (e) {
+				return true;
+			}
+		}
+		return false;
+	}());
+	var equalsConstructorPrototypeIfNotBuggy = function (o) {
+		/* global window */
+		if (typeof window === 'undefined' || !hasAutomationEqualityBug) {
+			return equalsConstructorPrototype(o);
+		}
+		try {
+			return equalsConstructorPrototype(o);
+		} catch (e) {
+			return false;
+		}
+	};
+
+	keysShim = function keys(object) {
+		var isObject = object !== null && typeof object === 'object';
+		var isFunction = toStr.call(object) === '[object Function]';
+		var isArguments = isArgs(object);
+		var isString = isObject && toStr.call(object) === '[object String]';
+		var theKeys = [];
+
+		if (!isObject && !isFunction && !isArguments) {
+			throw new TypeError('Object.keys called on a non-object');
+		}
+
+		var skipProto = hasProtoEnumBug && isFunction;
+		if (isString && object.length > 0 && !has.call(object, 0)) {
+			for (var i = 0; i < object.length; ++i) {
+				theKeys.push(String(i));
+			}
+		}
+
+		if (isArguments && object.length > 0) {
+			for (var j = 0; j < object.length; ++j) {
+				theKeys.push(String(j));
+			}
+		} else {
+			for (var name in object) {
+				if (!(skipProto && name === 'prototype') && has.call(object, name)) {
+					theKeys.push(String(name));
+				}
+			}
+		}
+
+		if (hasDontEnumBug) {
+			var skipConstructor = equalsConstructorPrototypeIfNotBuggy(object);
+
+			for (var k = 0; k < dontEnums.length; ++k) {
+				if (!(skipConstructor && dontEnums[k] === 'constructor') && has.call(object, dontEnums[k])) {
+					theKeys.push(dontEnums[k]);
+				}
+			}
+		}
+		return theKeys;
+	};
+}
+module.exports = keysShim;
+
+},{"./isArguments":63}],62:[function(require,module,exports){
+'use strict';
+
+var slice = Array.prototype.slice;
+var isArgs = require('./isArguments');
+
+var origKeys = Object.keys;
+var keysShim = origKeys ? function keys(o) { return origKeys(o); } : require('./implementation');
+
+var originalKeys = Object.keys;
+
+keysShim.shim = function shimObjectKeys() {
+	if (Object.keys) {
+		var keysWorksWithArguments = (function () {
+			// Safari 5.0 bug
+			var args = Object.keys(arguments);
+			return args && args.length === arguments.length;
+		}(1, 2));
+		if (!keysWorksWithArguments) {
+			Object.keys = function keys(object) { // eslint-disable-line func-name-matching
+				if (isArgs(object)) {
+					return originalKeys(slice.call(object));
+				}
+				return originalKeys(object);
+			};
+		}
+	} else {
+		Object.keys = keysShim;
+	}
+	return Object.keys || keysShim;
+};
+
+module.exports = keysShim;
+
+},{"./implementation":61,"./isArguments":63}],63:[function(require,module,exports){
+'use strict';
+
+var toStr = Object.prototype.toString;
+
+module.exports = function isArguments(value) {
+	var str = toStr.call(value);
+	var isArgs = str === '[object Arguments]';
+	if (!isArgs) {
+		isArgs = str !== '[object Array]' &&
+			value !== null &&
+			typeof value === 'object' &&
+			typeof value.length === 'number' &&
+			value.length >= 0 &&
+			toStr.call(value.callee) === '[object Function]';
+	}
+	return isArgs;
+};
+
+},{}],64:[function(require,module,exports){
+'use strict';
+
+// modified from https://github.com/es-shims/es6-shim
+var keys = require('object-keys');
+var bind = require('function-bind');
+var canBeObject = function (obj) {
+	return typeof obj !== 'undefined' && obj !== null;
+};
+var hasSymbols = require('has-symbols/shams')();
+var toObject = Object;
+var push = bind.call(Function.call, Array.prototype.push);
+var propIsEnumerable = bind.call(Function.call, Object.prototype.propertyIsEnumerable);
+var originalGetSymbols = hasSymbols ? Object.getOwnPropertySymbols : null;
+
+module.exports = function assign(target, source1) {
+	if (!canBeObject(target)) { throw new TypeError('target must be an object'); }
+	var objTarget = toObject(target);
+	var s, source, i, props, syms, value, key;
+	for (s = 1; s < arguments.length; ++s) {
+		source = toObject(arguments[s]);
+		props = keys(source);
+		var getSymbols = hasSymbols && (Object.getOwnPropertySymbols || originalGetSymbols);
+		if (getSymbols) {
+			syms = getSymbols(source);
+			for (i = 0; i < syms.length; ++i) {
+				key = syms[i];
+				if (propIsEnumerable(source, key)) {
+					push(props, key);
+				}
+			}
+		}
+		for (i = 0; i < props.length; ++i) {
+			key = props[i];
+			value = source[key];
+			if (propIsEnumerable(source, key)) {
+				objTarget[key] = value;
+			}
+		}
+	}
+	return objTarget;
+};
+
+},{"function-bind":52,"has-symbols/shams":53,"object-keys":62}],65:[function(require,module,exports){
+'use strict';
+
+var defineProperties = require('define-properties');
+
+var implementation = require('./implementation');
+var getPolyfill = require('./polyfill');
+var shim = require('./shim');
+
+var polyfill = getPolyfill();
+
+defineProperties(polyfill, {
+	getPolyfill: getPolyfill,
+	implementation: implementation,
+	shim: shim
+});
+
+module.exports = polyfill;
+
+},{"./implementation":64,"./polyfill":66,"./shim":67,"define-properties":47}],66:[function(require,module,exports){
+'use strict';
+
+var implementation = require('./implementation');
+
+var lacksProperEnumerationOrder = function () {
+	if (!Object.assign) {
+		return false;
+	}
+	// v8, specifically in node 4.x, has a bug with incorrect property enumeration order
+	// note: this does not detect the bug unless there's 20 characters
+	var str = 'abcdefghijklmnopqrst';
+	var letters = str.split('');
+	var map = {};
+	for (var i = 0; i < letters.length; ++i) {
+		map[letters[i]] = letters[i];
+	}
+	var obj = Object.assign({}, map);
+	var actual = '';
+	for (var k in obj) {
+		actual += k;
+	}
+	return str !== actual;
+};
+
+var assignHasPendingExceptions = function () {
+	if (!Object.assign || !Object.preventExtensions) {
+		return false;
+	}
+	// Firefox 37 still has "pending exception" logic in its Object.assign implementation,
+	// which is 72% slower than our shim, and Firefox 40's native implementation.
+	var thrower = Object.preventExtensions({ 1: 2 });
+	try {
+		Object.assign(thrower, 'xy');
+	} catch (e) {
+		return thrower[1] === 'y';
+	}
+	return false;
+};
+
+module.exports = function getPolyfill() {
+	if (!Object.assign) {
+		return implementation;
+	}
+	if (lacksProperEnumerationOrder()) {
+		return implementation;
+	}
+	if (assignHasPendingExceptions()) {
+		return implementation;
+	}
+	return Object.assign;
+};
+
+},{"./implementation":64}],67:[function(require,module,exports){
+'use strict';
+
+var define = require('define-properties');
+var getPolyfill = require('./polyfill');
+
+module.exports = function shimAssign() {
+	var polyfill = getPolyfill();
+	define(
+		Object,
+		{ assign: polyfill },
+		{ assign: function () { return Object.assign !== polyfill; } }
+	);
+	return polyfill;
+};
+
+},{"./polyfill":66,"define-properties":47}],68:[function(require,module,exports){
+(function (process){
+'use strict';
+
+if (!process.version ||
+    process.version.indexOf('v0.') === 0 ||
+    process.version.indexOf('v1.') === 0 && process.version.indexOf('v1.8.') !== 0) {
+  module.exports = { nextTick: nextTick };
+} else {
+  module.exports = process
+}
+
+function nextTick(fn, arg1, arg2, arg3) {
+  if (typeof fn !== 'function') {
+    throw new TypeError('"callback" argument must be a function');
+  }
+  var len = arguments.length;
+  var args, i;
+  switch (len) {
+  case 0:
+  case 1:
+    return process.nextTick(fn);
+  case 2:
+    return process.nextTick(function afterTickOne() {
+      fn.call(null, arg1);
+    });
+  case 3:
+    return process.nextTick(function afterTickTwo() {
+      fn.call(null, arg1, arg2);
+    });
+  case 4:
+    return process.nextTick(function afterTickThree() {
+      fn.call(null, arg1, arg2, arg3);
+    });
+  default:
+    args = new Array(len - 1);
+    i = 0;
+    while (i < args.length) {
+      args[i++] = arguments[i];
+    }
+    return process.nextTick(function afterTick() {
+      fn.apply(null, args);
+    });
+  }
+}
+
+
+}).call(this,require('_process'))
+},{"_process":69}],69:[function(require,module,exports){
+// shim for using process in browser
+var process = module.exports = {};
+
+// cached from whatever global is present so that test runners that stub it
+// don't break things.  But we need to wrap it in a try catch in case it is
+// wrapped in strict mode code which doesn't define any globals.  It's inside a
+// function because try/catches deoptimize in certain engines.
+
+var cachedSetTimeout;
+var cachedClearTimeout;
+
+function defaultSetTimout() {
+    throw new Error('setTimeout has not been defined');
+}
+function defaultClearTimeout () {
+    throw new Error('clearTimeout has not been defined');
+}
+(function () {
+    try {
+        if (typeof setTimeout === 'function') {
+            cachedSetTimeout = setTimeout;
+        } else {
+            cachedSetTimeout = defaultSetTimout;
+        }
+    } catch (e) {
+        cachedSetTimeout = defaultSetTimout;
+    }
+    try {
+        if (typeof clearTimeout === 'function') {
+            cachedClearTimeout = clearTimeout;
+        } else {
+            cachedClearTimeout = defaultClearTimeout;
+        }
+    } catch (e) {
+        cachedClearTimeout = defaultClearTimeout;
+    }
+} ())
+function runTimeout(fun) {
+    if (cachedSetTimeout === setTimeout) {
+        //normal enviroments in sane situations
+        return setTimeout(fun, 0);
+    }
+    // if setTimeout wasn't available but was latter defined
+    if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
+        cachedSetTimeout = setTimeout;
+        return setTimeout(fun, 0);
+    }
+    try {
+        // when when somebody has screwed with setTimeout but no I.E. maddness
+        return cachedSetTimeout(fun, 0);
+    } catch(e){
+        try {
+            // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
+            return cachedSetTimeout.call(null, fun, 0);
+        } catch(e){
+            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
+            return cachedSetTimeout.call(this, fun, 0);
+        }
+    }
+
+
+}
+function runClearTimeout(marker) {
+    if (cachedClearTimeout === clearTimeout) {
+        //normal enviroments in sane situations
+        return clearTimeout(marker);
+    }
+    // if clearTimeout wasn't available but was latter defined
+    if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
+        cachedClearTimeout = clearTimeout;
+        return clearTimeout(marker);
+    }
+    try {
+        // when when somebody has screwed with setTimeout but no I.E. maddness
+        return cachedClearTimeout(marker);
+    } catch (e){
+        try {
+            // When we are in I.E. but the script has been evaled so I.E. doesn't  trust the global object when called normally
+            return cachedClearTimeout.call(null, marker);
+        } catch (e){
+            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
+            // Some versions of I.E. have different rules for clearTimeout vs setTimeout
+            return cachedClearTimeout.call(this, marker);
+        }
+    }
+
+
+
+}
+var queue = [];
+var draining = false;
+var currentQueue;
+var queueIndex = -1;
+
+function cleanUpNextTick() {
+    if (!draining || !currentQueue) {
+        return;
+    }
+    draining = false;
+    if (currentQueue.length) {
+        queue = currentQueue.concat(queue);
+    } else {
+        queueIndex = -1;
+    }
+    if (queue.length) {
+        drainQueue();
+    }
+}
+
+function drainQueue() {
+    if (draining) {
+        return;
+    }
+    var timeout = runTimeout(cleanUpNextTick);
+    draining = true;
+
+    var len = queue.length;
+    while(len) {
+        currentQueue = queue;
+        queue = [];
+        while (++queueIndex < len) {
+            if (currentQueue) {
+                currentQueue[queueIndex].run();
+            }
+        }
+        queueIndex = -1;
+        len = queue.length;
+    }
+    currentQueue = null;
+    draining = false;
+    runClearTimeout(timeout);
+}
+
+process.nextTick = function (fun) {
+    var args = new Array(arguments.length - 1);
+    if (arguments.length > 1) {
+        for (var i = 1; i < arguments.length; i++) {
+            args[i - 1] = arguments[i];
+        }
+    }
+    queue.push(new Item(fun, args));
+    if (queue.length === 1 && !draining) {
+        runTimeout(drainQueue);
+    }
+};
+
+// v8 likes predictible objects
+function Item(fun, array) {
+    this.fun = fun;
+    this.array = array;
+}
+Item.prototype.run = function () {
+    this.fun.apply(null, this.array);
+};
+process.title = 'browser';
+process.browser = true;
+process.env = {};
+process.argv = [];
+process.version = ''; // empty string to avoid regexp issues
+process.versions = {};
+
+function noop() {}
+
+process.on = noop;
+process.addListener = noop;
+process.once = noop;
+process.off = noop;
+process.removeListener = noop;
+process.removeAllListeners = noop;
+process.emit = noop;
+process.prependListener = noop;
+process.prependOnceListener = noop;
+
+process.listeners = function (name) { return [] }
+
+process.binding = function (name) {
+    throw new Error('process.binding is not supported');
+};
+
+process.cwd = function () { return '/' };
+process.chdir = function (dir) {
+    throw new Error('process.chdir is not supported');
+};
+process.umask = function() { return 0; };
+
+},{}],70:[function(require,module,exports){
+module.exports = require('./lib/_stream_duplex.js');
+
+},{"./lib/_stream_duplex.js":71}],71:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// a duplex stream is just a stream that is both readable and writable.
+// Since JS doesn't have multiple prototypal inheritance, this class
+// prototypally inherits from Readable, and then parasitically from
+// Writable.
+
+'use strict';
+
+/*<replacement>*/
+
+var pna = require('process-nextick-args');
+/*</replacement>*/
+
+/*<replacement>*/
+var objectKeys = Object.keys || function (obj) {
+  var keys = [];
+  for (var key in obj) {
+    keys.push(key);
+  }return keys;
+};
+/*</replacement>*/
+
+module.exports = Duplex;
+
+/*<replacement>*/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/*</replacement>*/
+
+var Readable = require('./_stream_readable');
+var Writable = require('./_stream_writable');
+
+util.inherits(Duplex, Readable);
+
+{
+  // avoid scope creep, the keys array can then be collected
+  var keys = objectKeys(Writable.prototype);
+  for (var v = 0; v < keys.length; v++) {
+    var method = keys[v];
+    if (!Duplex.prototype[method]) Duplex.prototype[method] = Writable.prototype[method];
+  }
+}
+
+function Duplex(options) {
+  if (!(this instanceof Duplex)) return new Duplex(options);
+
+  Readable.call(this, options);
+  Writable.call(this, options);
+
+  if (options && options.readable === false) this.readable = false;
+
+  if (options && options.writable === false) this.writable = false;
+
+  this.allowHalfOpen = true;
+  if (options && options.allowHalfOpen === false) this.allowHalfOpen = false;
+
+  this.once('end', onend);
+}
+
+Object.defineProperty(Duplex.prototype, 'writableHighWaterMark', {
+  // making it explicit this property is not enumerable
+  // because otherwise some prototype manipulation in
+  // userland will fail
+  enumerable: false,
+  get: function () {
+    return this._writableState.highWaterMark;
+  }
+});
+
+// the no-half-open enforcer
+function onend() {
+  // if we allow half-open state, or if the writable side ended,
+  // then we're ok.
+  if (this.allowHalfOpen || this._writableState.ended) return;
+
+  // no more data can be written.
+  // But allow more writes to happen in this tick.
+  pna.nextTick(onEndNT, this);
+}
+
+function onEndNT(self) {
+  self.end();
+}
+
+Object.defineProperty(Duplex.prototype, 'destroyed', {
+  get: function () {
+    if (this._readableState === undefined || this._writableState === undefined) {
+      return false;
+    }
+    return this._readableState.destroyed && this._writableState.destroyed;
+  },
+  set: function (value) {
+    // we ignore the value if the stream
+    // has not been initialized yet
+    if (this._readableState === undefined || this._writableState === undefined) {
+      return;
+    }
+
+    // backward compatibility, the user is explicitly
+    // managing destroyed
+    this._readableState.destroyed = value;
+    this._writableState.destroyed = value;
+  }
+});
+
+Duplex.prototype._destroy = function (err, cb) {
+  this.push(null);
+  this.end();
+
+  pna.nextTick(cb, err);
+};
+},{"./_stream_readable":73,"./_stream_writable":75,"core-util-is":44,"inherits":56,"process-nextick-args":68}],72:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// a passthrough stream.
+// basically just the most minimal sort of Transform stream.
+// Every written chunk gets output as-is.
+
+'use strict';
+
+module.exports = PassThrough;
+
+var Transform = require('./_stream_transform');
+
+/*<replacement>*/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/*</replacement>*/
+
+util.inherits(PassThrough, Transform);
+
+function PassThrough(options) {
+  if (!(this instanceof PassThrough)) return new PassThrough(options);
+
+  Transform.call(this, options);
+}
+
+PassThrough.prototype._transform = function (chunk, encoding, cb) {
+  cb(null, chunk);
+};
+},{"./_stream_transform":74,"core-util-is":44,"inherits":56}],73:[function(require,module,exports){
+(function (process,global){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+'use strict';
+
+/*<replacement>*/
+
+var pna = require('process-nextick-args');
+/*</replacement>*/
+
+module.exports = Readable;
+
+/*<replacement>*/
+var isArray = require('isarray');
+/*</replacement>*/
+
+/*<replacement>*/
+var Duplex;
+/*</replacement>*/
+
+Readable.ReadableState = ReadableState;
+
+/*<replacement>*/
+var EE = require('events').EventEmitter;
+
+var EElistenerCount = function (emitter, type) {
+  return emitter.listeners(type).length;
+};
+/*</replacement>*/
+
+/*<replacement>*/
+var Stream = require('./internal/streams/stream');
+/*</replacement>*/
+
+/*<replacement>*/
+
+var Buffer = require('safe-buffer').Buffer;
+var OurUint8Array = global.Uint8Array || function () {};
+function _uint8ArrayToBuffer(chunk) {
+  return Buffer.from(chunk);
+}
+function _isUint8Array(obj) {
+  return Buffer.isBuffer(obj) || obj instanceof OurUint8Array;
+}
+
+/*</replacement>*/
+
+/*<replacement>*/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/*</replacement>*/
+
+/*<replacement>*/
+var debugUtil = require('util');
+var debug = void 0;
+if (debugUtil && debugUtil.debuglog) {
+  debug = debugUtil.debuglog('stream');
+} else {
+  debug = function () {};
+}
+/*</replacement>*/
+
+var BufferList = require('./internal/streams/BufferList');
+var destroyImpl = require('./internal/streams/destroy');
+var StringDecoder;
+
+util.inherits(Readable, Stream);
+
+var kProxyEvents = ['error', 'close', 'destroy', 'pause', 'resume'];
+
+function prependListener(emitter, event, fn) {
+  // Sadly this is not cacheable as some libraries bundle their own
+  // event emitter implementation with them.
+  if (typeof emitter.prependListener === 'function') return emitter.prependListener(event, fn);
+
+  // This is a hack to make sure that our error handler is attached before any
+  // userland ones.  NEVER DO THIS. This is here only because this code needs
+  // to continue to work with older versions of Node.js that do not include
+  // the prependListener() method. The goal is to eventually remove this hack.
+  if (!emitter._events || !emitter._events[event]) emitter.on(event, fn);else if (isArray(emitter._events[event])) emitter._events[event].unshift(fn);else emitter._events[event] = [fn, emitter._events[event]];
+}
+
+function ReadableState(options, stream) {
+  Duplex = Duplex || require('./_stream_duplex');
+
+  options = options || {};
+
+  // Duplex streams are both readable and writable, but share
+  // the same options object.
+  // However, some cases require setting options to different
+  // values for the readable and the writable sides of the duplex stream.
+  // These options can be provided separately as readableXXX and writableXXX.
+  var isDuplex = stream instanceof Duplex;
+
+  // object stream flag. Used to make read(n) ignore n and to
+  // make all the buffer merging and length checks go away
+  this.objectMode = !!options.objectMode;
+
+  if (isDuplex) this.objectMode = this.objectMode || !!options.readableObjectMode;
+
+  // the point at which it stops calling _read() to fill the buffer
+  // Note: 0 is a valid value, means "don't call _read preemptively ever"
+  var hwm = options.highWaterMark;
+  var readableHwm = options.readableHighWaterMark;
+  var defaultHwm = this.objectMode ? 16 : 16 * 1024;
+
+  if (hwm || hwm === 0) this.highWaterMark = hwm;else if (isDuplex && (readableHwm || readableHwm === 0)) this.highWaterMark = readableHwm;else this.highWaterMark = defaultHwm;
+
+  // cast to ints.
+  this.highWaterMark = Math.floor(this.highWaterMark);
+
+  // A linked list is used to store data chunks instead of an array because the
+  // linked list can remove elements from the beginning faster than
+  // array.shift()
+  this.buffer = new BufferList();
+  this.length = 0;
+  this.pipes = null;
+  this.pipesCount = 0;
+  this.flowing = null;
+  this.ended = false;
+  this.endEmitted = false;
+  this.reading = false;
+
+  // a flag to be able to tell if the event 'readable'/'data' is emitted
+  // immediately, or on a later tick.  We set this to true at first, because
+  // any actions that shouldn't happen until "later" should generally also
+  // not happen before the first read call.
+  this.sync = true;
+
+  // whenever we return null, then we set a flag to say
+  // that we're awaiting a 'readable' event emission.
+  this.needReadable = false;
+  this.emittedReadable = false;
+  this.readableListening = false;
+  this.resumeScheduled = false;
+
+  // has it been destroyed
+  this.destroyed = false;
+
+  // Crypto is kind of old and crusty.  Historically, its default string
+  // encoding is 'binary' so we have to make this configurable.
+  // Everything else in the universe uses 'utf8', though.
+  this.defaultEncoding = options.defaultEncoding || 'utf8';
+
+  // the number of writers that are awaiting a drain event in .pipe()s
+  this.awaitDrain = 0;
+
+  // if true, a maybeReadMore has been scheduled
+  this.readingMore = false;
+
+  this.decoder = null;
+  this.encoding = null;
+  if (options.encoding) {
+    if (!StringDecoder) StringDecoder = require('string_decoder/').StringDecoder;
+    this.decoder = new StringDecoder(options.encoding);
+    this.encoding = options.encoding;
+  }
+}
+
+function Readable(options) {
+  Duplex = Duplex || require('./_stream_duplex');
+
+  if (!(this instanceof Readable)) return new Readable(options);
+
+  this._readableState = new ReadableState(options, this);
+
+  // legacy
+  this.readable = true;
+
+  if (options) {
+    if (typeof options.read === 'function') this._read = options.read;
+
+    if (typeof options.destroy === 'function') this._destroy = options.destroy;
+  }
+
+  Stream.call(this);
+}
+
+Object.defineProperty(Readable.prototype, 'destroyed', {
+  get: function () {
+    if (this._readableState === undefined) {
+      return false;
+    }
+    return this._readableState.destroyed;
+  },
+  set: function (value) {
+    // we ignore the value if the stream
+    // has not been initialized yet
+    if (!this._readableState) {
+      return;
+    }
+
+    // backward compatibility, the user is explicitly
+    // managing destroyed
+    this._readableState.destroyed = value;
+  }
+});
+
+Readable.prototype.destroy = destroyImpl.destroy;
+Readable.prototype._undestroy = destroyImpl.undestroy;
+Readable.prototype._destroy = function (err, cb) {
+  this.push(null);
+  cb(err);
+};
+
+// Manually shove something into the read() buffer.
+// This returns true if the highWaterMark has not been hit yet,
+// similar to how Writable.write() returns true if you should
+// write() some more.
+Readable.prototype.push = function (chunk, encoding) {
+  var state = this._readableState;
+  var skipChunkCheck;
+
+  if (!state.objectMode) {
+    if (typeof chunk === 'string') {
+      encoding = encoding || state.defaultEncoding;
+      if (encoding !== state.encoding) {
+        chunk = Buffer.from(chunk, encoding);
+        encoding = '';
+      }
+      skipChunkCheck = true;
+    }
+  } else {
+    skipChunkCheck = true;
+  }
+
+  return readableAddChunk(this, chunk, encoding, false, skipChunkCheck);
+};
+
+// Unshift should *always* be something directly out of read()
+Readable.prototype.unshift = function (chunk) {
+  return readableAddChunk(this, chunk, null, true, false);
+};
+
+function readableAddChunk(stream, chunk, encoding, addToFront, skipChunkCheck) {
+  var state = stream._readableState;
+  if (chunk === null) {
+    state.reading = false;
+    onEofChunk(stream, state);
+  } else {
+    var er;
+    if (!skipChunkCheck) er = chunkInvalid(state, chunk);
+    if (er) {
+      stream.emit('error', er);
+    } else if (state.objectMode || chunk && chunk.length > 0) {
+      if (typeof chunk !== 'string' && !state.objectMode && Object.getPrototypeOf(chunk) !== Buffer.prototype) {
+        chunk = _uint8ArrayToBuffer(chunk);
+      }
+
+      if (addToFront) {
+        if (state.endEmitted) stream.emit('error', new Error('stream.unshift() after end event'));else addChunk(stream, state, chunk, true);
+      } else if (state.ended) {
+        stream.emit('error', new Error('stream.push() after EOF'));
+      } else {
+        state.reading = false;
+        if (state.decoder && !encoding) {
+          chunk = state.decoder.write(chunk);
+          if (state.objectMode || chunk.length !== 0) addChunk(stream, state, chunk, false);else maybeReadMore(stream, state);
+        } else {
+          addChunk(stream, state, chunk, false);
+        }
+      }
+    } else if (!addToFront) {
+      state.reading = false;
+    }
+  }
+
+  return needMoreData(state);
+}
+
+function addChunk(stream, state, chunk, addToFront) {
+  if (state.flowing && state.length === 0 && !state.sync) {
+    stream.emit('data', chunk);
+    stream.read(0);
+  } else {
+    // update the buffer info.
+    state.length += state.objectMode ? 1 : chunk.length;
+    if (addToFront) state.buffer.unshift(chunk);else state.buffer.push(chunk);
+
+    if (state.needReadable) emitReadable(stream);
+  }
+  maybeReadMore(stream, state);
+}
+
+function chunkInvalid(state, chunk) {
+  var er;
+  if (!_isUint8Array(chunk) && typeof chunk !== 'string' && chunk !== undefined && !state.objectMode) {
+    er = new TypeError('Invalid non-string/buffer chunk');
+  }
+  return er;
+}
+
+// if it's past the high water mark, we can push in some more.
+// Also, if we have no data yet, we can stand some
+// more bytes.  This is to work around cases where hwm=0,
+// such as the repl.  Also, if the push() triggered a
+// readable event, and the user called read(largeNumber) such that
+// needReadable was set, then we ought to push more, so that another
+// 'readable' event will be triggered.
+function needMoreData(state) {
+  return !state.ended && (state.needReadable || state.length < state.highWaterMark || state.length === 0);
+}
+
+Readable.prototype.isPaused = function () {
+  return this._readableState.flowing === false;
+};
+
+// backwards compatibility.
+Readable.prototype.setEncoding = function (enc) {
+  if (!StringDecoder) StringDecoder = require('string_decoder/').StringDecoder;
+  this._readableState.decoder = new StringDecoder(enc);
+  this._readableState.encoding = enc;
+  return this;
+};
+
+// Don't raise the hwm > 8MB
+var MAX_HWM = 0x800000;
+function computeNewHighWaterMark(n) {
+  if (n >= MAX_HWM) {
+    n = MAX_HWM;
+  } else {
+    // Get the next highest power of 2 to prevent increasing hwm excessively in
+    // tiny amounts
+    n--;
+    n |= n >>> 1;
+    n |= n >>> 2;
+    n |= n >>> 4;
+    n |= n >>> 8;
+    n |= n >>> 16;
+    n++;
+  }
+  return n;
+}
+
+// This function is designed to be inlinable, so please take care when making
+// changes to the function body.
+function howMuchToRead(n, state) {
+  if (n <= 0 || state.length === 0 && state.ended) return 0;
+  if (state.objectMode) return 1;
+  if (n !== n) {
+    // Only flow one buffer at a time
+    if (state.flowing && state.length) return state.buffer.head.data.length;else return state.length;
+  }
+  // If we're asking for more than the current hwm, then raise the hwm.
+  if (n > state.highWaterMark) state.highWaterMark = computeNewHighWaterMark(n);
+  if (n <= state.length) return n;
+  // Don't have enough
+  if (!state.ended) {
+    state.needReadable = true;
+    return 0;
+  }
+  return state.length;
+}
+
+// you can override either this method, or the async _read(n) below.
+Readable.prototype.read = function (n) {
+  debug('read', n);
+  n = parseInt(n, 10);
+  var state = this._readableState;
+  var nOrig = n;
+
+  if (n !== 0) state.emittedReadable = false;
+
+  // if we're doing read(0) to trigger a readable event, but we
+  // already have a bunch of data in the buffer, then just trigger
+  // the 'readable' event and move on.
+  if (n === 0 && state.needReadable && (state.length >= state.highWaterMark || state.ended)) {
+    debug('read: emitReadable', state.length, state.ended);
+    if (state.length === 0 && state.ended) endReadable(this);else emitReadable(this);
+    return null;
+  }
+
+  n = howMuchToRead(n, state);
+
+  // if we've ended, and we're now clear, then finish it up.
+  if (n === 0 && state.ended) {
+    if (state.length === 0) endReadable(this);
+    return null;
+  }
+
+  // All the actual chunk generation logic needs to be
+  // *below* the call to _read.  The reason is that in certain
+  // synthetic stream cases, such as passthrough streams, _read
+  // may be a completely synchronous operation which may change
+  // the state of the read buffer, providing enough data when
+  // before there was *not* enough.
+  //
+  // So, the steps are:
+  // 1. Figure out what the state of things will be after we do
+  // a read from the buffer.
+  //
+  // 2. If that resulting state will trigger a _read, then call _read.
+  // Note that this may be asynchronous, or synchronous.  Yes, it is
+  // deeply ugly to write APIs this way, but that still doesn't mean
+  // that the Readable class should behave improperly, as streams are
+  // designed to be sync/async agnostic.
+  // Take note if the _read call is sync or async (ie, if the read call
+  // has returned yet), so that we know whether or not it's safe to emit
+  // 'readable' etc.
+  //
+  // 3. Actually pull the requested chunks out of the buffer and return.
+
+  // if we need a readable event, then we need to do some reading.
+  var doRead = state.needReadable;
+  debug('need readable', doRead);
+
+  // if we currently have less than the highWaterMark, then also read some
+  if (state.length === 0 || state.length - n < state.highWaterMark) {
+    doRead = true;
+    debug('length less than watermark', doRead);
+  }
+
+  // however, if we've ended, then there's no point, and if we're already
+  // reading, then it's unnecessary.
+  if (state.ended || state.reading) {
+    doRead = false;
+    debug('reading or ended', doRead);
+  } else if (doRead) {
+    debug('do read');
+    state.reading = true;
+    state.sync = true;
+    // if the length is currently zero, then we *need* a readable event.
+    if (state.length === 0) state.needReadable = true;
+    // call internal read method
+    this._read(state.highWaterMark);
+    state.sync = false;
+    // If _read pushed data synchronously, then `reading` will be false,
+    // and we need to re-evaluate how much data we can return to the user.
+    if (!state.reading) n = howMuchToRead(nOrig, state);
+  }
+
+  var ret;
+  if (n > 0) ret = fromList(n, state);else ret = null;
+
+  if (ret === null) {
+    state.needReadable = true;
+    n = 0;
+  } else {
+    state.length -= n;
+  }
+
+  if (state.length === 0) {
+    // If we have nothing in the buffer, then we want to know
+    // as soon as we *do* get something into the buffer.
+    if (!state.ended) state.needReadable = true;
+
+    // If we tried to read() past the EOF, then emit end on the next tick.
+    if (nOrig !== n && state.ended) endReadable(this);
+  }
+
+  if (ret !== null) this.emit('data', ret);
+
+  return ret;
+};
+
+function onEofChunk(stream, state) {
+  if (state.ended) return;
+  if (state.decoder) {
+    var chunk = state.decoder.end();
+    if (chunk && chunk.length) {
+      state.buffer.push(chunk);
+      state.length += state.objectMode ? 1 : chunk.length;
+    }
+  }
+  state.ended = true;
+
+  // emit 'readable' now to make sure it gets picked up.
+  emitReadable(stream);
+}
+
+// Don't emit readable right away in sync mode, because this can trigger
+// another read() call => stack overflow.  This way, it might trigger
+// a nextTick recursion warning, but that's not so bad.
+function emitReadable(stream) {
+  var state = stream._readableState;
+  state.needReadable = false;
+  if (!state.emittedReadable) {
+    debug('emitReadable', state.flowing);
+    state.emittedReadable = true;
+    if (state.sync) pna.nextTick(emitReadable_, stream);else emitReadable_(stream);
+  }
+}
+
+function emitReadable_(stream) {
+  debug('emit readable');
+  stream.emit('readable');
+  flow(stream);
+}
+
+// at this point, the user has presumably seen the 'readable' event,
+// and called read() to consume some data.  that may have triggered
+// in turn another _read(n) call, in which case reading = true if
+// it's in progress.
+// However, if we're not ended, or reading, and the length < hwm,
+// then go ahead and try to read some more preemptively.
+function maybeReadMore(stream, state) {
+  if (!state.readingMore) {
+    state.readingMore = true;
+    pna.nextTick(maybeReadMore_, stream, state);
+  }
+}
+
+function maybeReadMore_(stream, state) {
+  var len = state.length;
+  while (!state.reading && !state.flowing && !state.ended && state.length < state.highWaterMark) {
+    debug('maybeReadMore read 0');
+    stream.read(0);
+    if (len === state.length)
+      // didn't get any data, stop spinning.
+      break;else len = state.length;
+  }
+  state.readingMore = false;
+}
+
+// abstract method.  to be overridden in specific implementation classes.
+// call cb(er, data) where data is <= n in length.
+// for virtual (non-string, non-buffer) streams, "length" is somewhat
+// arbitrary, and perhaps not very meaningful.
+Readable.prototype._read = function (n) {
+  this.emit('error', new Error('_read() is not implemented'));
+};
+
+Readable.prototype.pipe = function (dest, pipeOpts) {
+  var src = this;
+  var state = this._readableState;
+
+  switch (state.pipesCount) {
+    case 0:
+      state.pipes = dest;
+      break;
+    case 1:
+      state.pipes = [state.pipes, dest];
+      break;
+    default:
+      state.pipes.push(dest);
+      break;
+  }
+  state.pipesCount += 1;
+  debug('pipe count=%d opts=%j', state.pipesCount, pipeOpts);
+
+  var doEnd = (!pipeOpts || pipeOpts.end !== false) && dest !== process.stdout && dest !== process.stderr;
+
+  var endFn = doEnd ? onend : unpipe;
+  if (state.endEmitted) pna.nextTick(endFn);else src.once('end', endFn);
+
+  dest.on('unpipe', onunpipe);
+  function onunpipe(readable, unpipeInfo) {
+    debug('onunpipe');
+    if (readable === src) {
+      if (unpipeInfo && unpipeInfo.hasUnpiped === false) {
+        unpipeInfo.hasUnpiped = true;
+        cleanup();
+      }
+    }
+  }
+
+  function onend() {
+    debug('onend');
+    dest.end();
+  }
+
+  // when the dest drains, it reduces the awaitDrain counter
+  // on the source.  This would be more elegant with a .once()
+  // handler in flow(), but adding and removing repeatedly is
+  // too slow.
+  var ondrain = pipeOnDrain(src);
+  dest.on('drain', ondrain);
+
+  var cleanedUp = false;
+  function cleanup() {
+    debug('cleanup');
+    // cleanup event handlers once the pipe is broken
+    dest.removeListener('close', onclose);
+    dest.removeListener('finish', onfinish);
+    dest.removeListener('drain', ondrain);
+    dest.removeListener('error', onerror);
+    dest.removeListener('unpipe', onunpipe);
+    src.removeListener('end', onend);
+    src.removeListener('end', unpipe);
+    src.removeListener('data', ondata);
+
+    cleanedUp = true;
+
+    // if the reader is waiting for a drain event from this
+    // specific writer, then it would cause it to never start
+    // flowing again.
+    // So, if this is awaiting a drain, then we just call it now.
+    // If we don't know, then assume that we are waiting for one.
+    if (state.awaitDrain && (!dest._writableState || dest._writableState.needDrain)) ondrain();
+  }
+
+  // If the user pushes more data while we're writing to dest then we'll end up
+  // in ondata again. However, we only want to increase awaitDrain once because
+  // dest will only emit one 'drain' event for the multiple writes.
+  // => Introduce a guard on increasing awaitDrain.
+  var increasedAwaitDrain = false;
+  src.on('data', ondata);
+  function ondata(chunk) {
+    debug('ondata');
+    increasedAwaitDrain = false;
+    var ret = dest.write(chunk);
+    if (false === ret && !increasedAwaitDrain) {
+      // If the user unpiped during `dest.write()`, it is possible
+      // to get stuck in a permanently paused state if that write
+      // also returned false.
+      // => Check whether `dest` is still a piping destination.
+      if ((state.pipesCount === 1 && state.pipes === dest || state.pipesCount > 1 && indexOf(state.pipes, dest) !== -1) && !cleanedUp) {
+        debug('false write response, pause', src._readableState.awaitDrain);
+        src._readableState.awaitDrain++;
+        increasedAwaitDrain = true;
+      }
+      src.pause();
+    }
+  }
+
+  // if the dest has an error, then stop piping into it.
+  // however, don't suppress the throwing behavior for this.
+  function onerror(er) {
+    debug('onerror', er);
+    unpipe();
+    dest.removeListener('error', onerror);
+    if (EElistenerCount(dest, 'error') === 0) dest.emit('error', er);
+  }
+
+  // Make sure our error handler is attached before userland ones.
+  prependListener(dest, 'error', onerror);
+
+  // Both close and finish should trigger unpipe, but only once.
+  function onclose() {
+    dest.removeListener('finish', onfinish);
+    unpipe();
+  }
+  dest.once('close', onclose);
+  function onfinish() {
+    debug('onfinish');
+    dest.removeListener('close', onclose);
+    unpipe();
+  }
+  dest.once('finish', onfinish);
+
+  function unpipe() {
+    debug('unpipe');
+    src.unpipe(dest);
+  }
+
+  // tell the dest that it's being piped to
+  dest.emit('pipe', src);
+
+  // start the flow if it hasn't been started already.
+  if (!state.flowing) {
+    debug('pipe resume');
+    src.resume();
+  }
+
+  return dest;
+};
+
+function pipeOnDrain(src) {
+  return function () {
+    var state = src._readableState;
+    debug('pipeOnDrain', state.awaitDrain);
+    if (state.awaitDrain) state.awaitDrain--;
+    if (state.awaitDrain === 0 && EElistenerCount(src, 'data')) {
+      state.flowing = true;
+      flow(src);
+    }
+  };
+}
+
+Readable.prototype.unpipe = function (dest) {
+  var state = this._readableState;
+  var unpipeInfo = { hasUnpiped: false };
+
+  // if we're not piping anywhere, then do nothing.
+  if (state.pipesCount === 0) return this;
+
+  // just one destination.  most common case.
+  if (state.pipesCount === 1) {
+    // passed in one, but it's not the right one.
+    if (dest && dest !== state.pipes) return this;
+
+    if (!dest) dest = state.pipes;
+
+    // got a match.
+    state.pipes = null;
+    state.pipesCount = 0;
+    state.flowing = false;
+    if (dest) dest.emit('unpipe', this, unpipeInfo);
+    return this;
+  }
+
+  // slow case. multiple pipe destinations.
+
+  if (!dest) {
+    // remove all.
+    var dests = state.pipes;
+    var len = state.pipesCount;
+    state.pipes = null;
+    state.pipesCount = 0;
+    state.flowing = false;
+
+    for (var i = 0; i < len; i++) {
+      dests[i].emit('unpipe', this, unpipeInfo);
+    }return this;
+  }
+
+  // try to find the right one.
+  var index = indexOf(state.pipes, dest);
+  if (index === -1) return this;
+
+  state.pipes.splice(index, 1);
+  state.pipesCount -= 1;
+  if (state.pipesCount === 1) state.pipes = state.pipes[0];
+
+  dest.emit('unpipe', this, unpipeInfo);
+
+  return this;
+};
+
+// set up data events if they are asked for
+// Ensure readable listeners eventually get something
+Readable.prototype.on = function (ev, fn) {
+  var res = Stream.prototype.on.call(this, ev, fn);
+
+  if (ev === 'data') {
+    // Start flowing on next tick if stream isn't explicitly paused
+    if (this._readableState.flowing !== false) this.resume();
+  } else if (ev === 'readable') {
+    var state = this._readableState;
+    if (!state.endEmitted && !state.readableListening) {
+      state.readableListening = state.needReadable = true;
+      state.emittedReadable = false;
+      if (!state.reading) {
+        pna.nextTick(nReadingNextTick, this);
+      } else if (state.length) {
+        emitReadable(this);
+      }
+    }
+  }
+
+  return res;
+};
+Readable.prototype.addListener = Readable.prototype.on;
+
+function nReadingNextTick(self) {
+  debug('readable nexttick read 0');
+  self.read(0);
+}
+
+// pause() and resume() are remnants of the legacy readable stream API
+// If the user uses them, then switch into old mode.
+Readable.prototype.resume = function () {
+  var state = this._readableState;
+  if (!state.flowing) {
+    debug('resume');
+    state.flowing = true;
+    resume(this, state);
+  }
+  return this;
+};
+
+function resume(stream, state) {
+  if (!state.resumeScheduled) {
+    state.resumeScheduled = true;
+    pna.nextTick(resume_, stream, state);
+  }
+}
+
+function resume_(stream, state) {
+  if (!state.reading) {
+    debug('resume read 0');
+    stream.read(0);
+  }
+
+  state.resumeScheduled = false;
+  state.awaitDrain = 0;
+  stream.emit('resume');
+  flow(stream);
+  if (state.flowing && !state.reading) stream.read(0);
+}
+
+Readable.prototype.pause = function () {
+  debug('call pause flowing=%j', this._readableState.flowing);
+  if (false !== this._readableState.flowing) {
+    debug('pause');
+    this._readableState.flowing = false;
+    this.emit('pause');
+  }
+  return this;
+};
+
+function flow(stream) {
+  var state = stream._readableState;
+  debug('flow', state.flowing);
+  while (state.flowing && stream.read() !== null) {}
+}
+
+// wrap an old-style stream as the async data source.
+// This is *not* part of the readable stream interface.
+// It is an ugly unfortunate mess of history.
+Readable.prototype.wrap = function (stream) {
+  var _this = this;
+
+  var state = this._readableState;
+  var paused = false;
+
+  stream.on('end', function () {
+    debug('wrapped end');
+    if (state.decoder && !state.ended) {
+      var chunk = state.decoder.end();
+      if (chunk && chunk.length) _this.push(chunk);
+    }
+
+    _this.push(null);
+  });
+
+  stream.on('data', function (chunk) {
+    debug('wrapped data');
+    if (state.decoder) chunk = state.decoder.write(chunk);
+
+    // don't skip over falsy values in objectMode
+    if (state.objectMode && (chunk === null || chunk === undefined)) return;else if (!state.objectMode && (!chunk || !chunk.length)) return;
+
+    var ret = _this.push(chunk);
+    if (!ret) {
+      paused = true;
+      stream.pause();
+    }
+  });
+
+  // proxy all the other methods.
+  // important when wrapping filters and duplexes.
+  for (var i in stream) {
+    if (this[i] === undefined && typeof stream[i] === 'function') {
+      this[i] = function (method) {
+        return function () {
+          return stream[method].apply(stream, arguments);
+        };
+      }(i);
+    }
+  }
+
+  // proxy certain important events.
+  for (var n = 0; n < kProxyEvents.length; n++) {
+    stream.on(kProxyEvents[n], this.emit.bind(this, kProxyEvents[n]));
+  }
+
+  // when we try to consume some more bytes, simply unpause the
+  // underlying stream.
+  this._read = function (n) {
+    debug('wrapped _read', n);
+    if (paused) {
+      paused = false;
+      stream.resume();
+    }
+  };
+
+  return this;
+};
+
+Object.defineProperty(Readable.prototype, 'readableHighWaterMark', {
+  // making it explicit this property is not enumerable
+  // because otherwise some prototype manipulation in
+  // userland will fail
+  enumerable: false,
+  get: function () {
+    return this._readableState.highWaterMark;
+  }
+});
+
+// exposed for testing purposes only.
+Readable._fromList = fromList;
+
+// Pluck off n bytes from an array of buffers.
+// Length is the combined lengths of all the buffers in the list.
+// This function is designed to be inlinable, so please take care when making
+// changes to the function body.
+function fromList(n, state) {
+  // nothing buffered
+  if (state.length === 0) return null;
+
+  var ret;
+  if (state.objectMode) ret = state.buffer.shift();else if (!n || n >= state.length) {
+    // read it all, truncate the list
+    if (state.decoder) ret = state.buffer.join('');else if (state.buffer.length === 1) ret = state.buffer.head.data;else ret = state.buffer.concat(state.length);
+    state.buffer.clear();
+  } else {
+    // read part of list
+    ret = fromListPartial(n, state.buffer, state.decoder);
+  }
+
+  return ret;
+}
+
+// Extracts only enough buffered data to satisfy the amount requested.
+// This function is designed to be inlinable, so please take care when making
+// changes to the function body.
+function fromListPartial(n, list, hasStrings) {
+  var ret;
+  if (n < list.head.data.length) {
+    // slice is the same for buffers and strings
+    ret = list.head.data.slice(0, n);
+    list.head.data = list.head.data.slice(n);
+  } else if (n === list.head.data.length) {
+    // first chunk is a perfect match
+    ret = list.shift();
+  } else {
+    // result spans more than one buffer
+    ret = hasStrings ? copyFromBufferString(n, list) : copyFromBuffer(n, list);
+  }
+  return ret;
+}
+
+// Copies a specified amount of characters from the list of buffered data
+// chunks.
+// This function is designed to be inlinable, so please take care when making
+// changes to the function body.
+function copyFromBufferString(n, list) {
+  var p = list.head;
+  var c = 1;
+  var ret = p.data;
+  n -= ret.length;
+  while (p = p.next) {
+    var str = p.data;
+    var nb = n > str.length ? str.length : n;
+    if (nb === str.length) ret += str;else ret += str.slice(0, n);
+    n -= nb;
+    if (n === 0) {
+      if (nb === str.length) {
+        ++c;
+        if (p.next) list.head = p.next;else list.head = list.tail = null;
+      } else {
+        list.head = p;
+        p.data = str.slice(nb);
+      }
+      break;
+    }
+    ++c;
+  }
+  list.length -= c;
+  return ret;
+}
+
+// Copies a specified amount of bytes from the list of buffered data chunks.
+// This function is designed to be inlinable, so please take care when making
+// changes to the function body.
+function copyFromBuffer(n, list) {
+  var ret = Buffer.allocUnsafe(n);
+  var p = list.head;
+  var c = 1;
+  p.data.copy(ret);
+  n -= p.data.length;
+  while (p = p.next) {
+    var buf = p.data;
+    var nb = n > buf.length ? buf.length : n;
+    buf.copy(ret, ret.length - n, 0, nb);
+    n -= nb;
+    if (n === 0) {
+      if (nb === buf.length) {
+        ++c;
+        if (p.next) list.head = p.next;else list.head = list.tail = null;
+      } else {
+        list.head = p;
+        p.data = buf.slice(nb);
+      }
+      break;
+    }
+    ++c;
+  }
+  list.length -= c;
+  return ret;
+}
+
+function endReadable(stream) {
+  var state = stream._readableState;
+
+  // If we get here before consuming all the bytes, then that is a
+  // bug in node.  Should never happen.
+  if (state.length > 0) throw new Error('"endReadable()" called on non-empty stream');
+
+  if (!state.endEmitted) {
+    state.ended = true;
+    pna.nextTick(endReadableNT, state, stream);
+  }
+}
+
+function endReadableNT(state, stream) {
+  // Check that we didn't get one last unshift.
+  if (!state.endEmitted && state.length === 0) {
+    state.endEmitted = true;
+    stream.readable = false;
+    stream.emit('end');
+  }
+}
+
+function indexOf(xs, x) {
+  for (var i = 0, l = xs.length; i < l; i++) {
+    if (xs[i] === x) return i;
+  }
+  return -1;
+}
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./_stream_duplex":71,"./internal/streams/BufferList":76,"./internal/streams/destroy":77,"./internal/streams/stream":78,"_process":69,"core-util-is":44,"events":50,"inherits":56,"isarray":58,"process-nextick-args":68,"safe-buffer":83,"string_decoder/":85,"util":40}],74:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// a transform stream is a readable/writable stream where you do
+// something with the data.  Sometimes it's called a "filter",
+// but that's not a great name for it, since that implies a thing where
+// some bits pass through, and others are simply ignored.  (That would
+// be a valid example of a transform, of course.)
+//
+// While the output is causally related to the input, it's not a
+// necessarily symmetric or synchronous transformation.  For example,
+// a zlib stream might take multiple plain-text writes(), and then
+// emit a single compressed chunk some time in the future.
+//
+// Here's how this works:
+//
+// The Transform stream has all the aspects of the readable and writable
+// stream classes.  When you write(chunk), that calls _write(chunk,cb)
+// internally, and returns false if there's a lot of pending writes
+// buffered up.  When you call read(), that calls _read(n) until
+// there's enough pending readable data buffered up.
+//
+// In a transform stream, the written data is placed in a buffer.  When
+// _read(n) is called, it transforms the queued up data, calling the
+// buffered _write cb's as it consumes chunks.  If consuming a single
+// written chunk would result in multiple output chunks, then the first
+// outputted bit calls the readcb, and subsequent chunks just go into
+// the read buffer, and will cause it to emit 'readable' if necessary.
+//
+// This way, back-pressure is actually determined by the reading side,
+// since _read has to be called to start processing a new chunk.  However,
+// a pathological inflate type of transform can cause excessive buffering
+// here.  For example, imagine a stream where every byte of input is
+// interpreted as an integer from 0-255, and then results in that many
+// bytes of output.  Writing the 4 bytes {ff,ff,ff,ff} would result in
+// 1kb of data being output.  In this case, you could write a very small
+// amount of input, and end up with a very large amount of output.  In
+// such a pathological inflating mechanism, there'd be no way to tell
+// the system to stop doing the transform.  A single 4MB write could
+// cause the system to run out of memory.
+//
+// However, even in such a pathological case, only a single written chunk
+// would be consumed, and then the rest would wait (un-transformed) until
+// the results of the previous transformed chunk were consumed.
+
+'use strict';
+
+module.exports = Transform;
+
+var Duplex = require('./_stream_duplex');
+
+/*<replacement>*/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/*</replacement>*/
+
+util.inherits(Transform, Duplex);
+
+function afterTransform(er, data) {
+  var ts = this._transformState;
+  ts.transforming = false;
+
+  var cb = ts.writecb;
+
+  if (!cb) {
+    return this.emit('error', new Error('write callback called multiple times'));
+  }
+
+  ts.writechunk = null;
+  ts.writecb = null;
+
+  if (data != null) // single equals check for both `null` and `undefined`
+    this.push(data);
+
+  cb(er);
+
+  var rs = this._readableState;
+  rs.reading = false;
+  if (rs.needReadable || rs.length < rs.highWaterMark) {
+    this._read(rs.highWaterMark);
+  }
+}
+
+function Transform(options) {
+  if (!(this instanceof Transform)) return new Transform(options);
+
+  Duplex.call(this, options);
+
+  this._transformState = {
+    afterTransform: afterTransform.bind(this),
+    needTransform: false,
+    transforming: false,
+    writecb: null,
+    writechunk: null,
+    writeencoding: null
+  };
+
+  // start out asking for a readable event once data is transformed.
+  this._readableState.needReadable = true;
+
+  // we have implemented the _read method, and done the other things
+  // that Readable wants before the first _read call, so unset the
+  // sync guard flag.
+  this._readableState.sync = false;
+
+  if (options) {
+    if (typeof options.transform === 'function') this._transform = options.transform;
+
+    if (typeof options.flush === 'function') this._flush = options.flush;
+  }
+
+  // When the writable side finishes, then flush out anything remaining.
+  this.on('prefinish', prefinish);
+}
+
+function prefinish() {
+  var _this = this;
+
+  if (typeof this._flush === 'function') {
+    this._flush(function (er, data) {
+      done(_this, er, data);
+    });
+  } else {
+    done(this, null, null);
+  }
+}
+
+Transform.prototype.push = function (chunk, encoding) {
+  this._transformState.needTransform = false;
+  return Duplex.prototype.push.call(this, chunk, encoding);
+};
+
+// This is the part where you do stuff!
+// override this function in implementation classes.
+// 'chunk' is an input chunk.
+//
+// Call `push(newChunk)` to pass along transformed output
+// to the readable side.  You may call 'push' zero or more times.
+//
+// Call `cb(err)` when you are done with this chunk.  If you pass
+// an error, then that'll put the hurt on the whole operation.  If you
+// never call cb(), then you'll never get another chunk.
+Transform.prototype._transform = function (chunk, encoding, cb) {
+  throw new Error('_transform() is not implemented');
+};
+
+Transform.prototype._write = function (chunk, encoding, cb) {
+  var ts = this._transformState;
+  ts.writecb = cb;
+  ts.writechunk = chunk;
+  ts.writeencoding = encoding;
+  if (!ts.transforming) {
+    var rs = this._readableState;
+    if (ts.needTransform || rs.needReadable || rs.length < rs.highWaterMark) this._read(rs.highWaterMark);
+  }
+};
+
+// Doesn't matter what the args are here.
+// _transform does all the work.
+// That we got here means that the readable side wants more data.
+Transform.prototype._read = function (n) {
+  var ts = this._transformState;
+
+  if (ts.writechunk !== null && ts.writecb && !ts.transforming) {
+    ts.transforming = true;
+    this._transform(ts.writechunk, ts.writeencoding, ts.afterTransform);
+  } else {
+    // mark that we need a transform, so that any data that comes in
+    // will get processed, now that we've asked for it.
+    ts.needTransform = true;
+  }
+};
+
+Transform.prototype._destroy = function (err, cb) {
+  var _this2 = this;
+
+  Duplex.prototype._destroy.call(this, err, function (err2) {
+    cb(err2);
+    _this2.emit('close');
+  });
+};
+
+function done(stream, er, data) {
+  if (er) return stream.emit('error', er);
+
+  if (data != null) // single equals check for both `null` and `undefined`
+    stream.push(data);
+
+  // if there's nothing in the write buffer, then that means
+  // that nothing more will ever be provided
+  if (stream._writableState.length) throw new Error('Calling transform done when ws.length != 0');
+
+  if (stream._transformState.transforming) throw new Error('Calling transform done when still transforming');
+
+  return stream.push(null);
+}
+},{"./_stream_duplex":71,"core-util-is":44,"inherits":56}],75:[function(require,module,exports){
+(function (process,global,setImmediate){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// A bit simpler than readable streams.
+// Implement an async ._write(chunk, encoding, cb), and it'll handle all
+// the drain event emission and buffering.
+
+'use strict';
+
+/*<replacement>*/
+
+var pna = require('process-nextick-args');
+/*</replacement>*/
+
+module.exports = Writable;
+
+/* <replacement> */
+function WriteReq(chunk, encoding, cb) {
+  this.chunk = chunk;
+  this.encoding = encoding;
+  this.callback = cb;
+  this.next = null;
+}
+
+// It seems a linked list but it is not
+// there will be only 2 of these for each stream
+function CorkedRequest(state) {
+  var _this = this;
+
+  this.next = null;
+  this.entry = null;
+  this.finish = function () {
+    onCorkedFinish(_this, state);
+  };
+}
+/* </replacement> */
+
+/*<replacement>*/
+var asyncWrite = !process.browser && ['v0.10', 'v0.9.'].indexOf(process.version.slice(0, 5)) > -1 ? setImmediate : pna.nextTick;
+/*</replacement>*/
+
+/*<replacement>*/
+var Duplex;
+/*</replacement>*/
+
+Writable.WritableState = WritableState;
+
+/*<replacement>*/
+var util = require('core-util-is');
+util.inherits = require('inherits');
+/*</replacement>*/
+
+/*<replacement>*/
+var internalUtil = {
+  deprecate: require('util-deprecate')
+};
+/*</replacement>*/
+
+/*<replacement>*/
+var Stream = require('./internal/streams/stream');
+/*</replacement>*/
+
+/*<replacement>*/
+
+var Buffer = require('safe-buffer').Buffer;
+var OurUint8Array = global.Uint8Array || function () {};
+function _uint8ArrayToBuffer(chunk) {
+  return Buffer.from(chunk);
+}
+function _isUint8Array(obj) {
+  return Buffer.isBuffer(obj) || obj instanceof OurUint8Array;
+}
+
+/*</replacement>*/
+
+var destroyImpl = require('./internal/streams/destroy');
+
+util.inherits(Writable, Stream);
+
+function nop() {}
+
+function WritableState(options, stream) {
+  Duplex = Duplex || require('./_stream_duplex');
+
+  options = options || {};
+
+  // Duplex streams are both readable and writable, but share
+  // the same options object.
+  // However, some cases require setting options to different
+  // values for the readable and the writable sides of the duplex stream.
+  // These options can be provided separately as readableXXX and writableXXX.
+  var isDuplex = stream instanceof Duplex;
+
+  // object stream flag to indicate whether or not this stream
+  // contains buffers or objects.
+  this.objectMode = !!options.objectMode;
+
+  if (isDuplex) this.objectMode = this.objectMode || !!options.writableObjectMode;
+
+  // the point at which write() starts returning false
+  // Note: 0 is a valid value, means that we always return false if
+  // the entire buffer is not flushed immediately on write()
+  var hwm = options.highWaterMark;
+  var writableHwm = options.writableHighWaterMark;
+  var defaultHwm = this.objectMode ? 16 : 16 * 1024;
+
+  if (hwm || hwm === 0) this.highWaterMark = hwm;else if (isDuplex && (writableHwm || writableHwm === 0)) this.highWaterMark = writableHwm;else this.highWaterMark = defaultHwm;
+
+  // cast to ints.
+  this.highWaterMark = Math.floor(this.highWaterMark);
+
+  // if _final has been called
+  this.finalCalled = false;
+
+  // drain event flag.
+  this.needDrain = false;
+  // at the start of calling end()
+  this.ending = false;
+  // when end() has been called, and returned
+  this.ended = false;
+  // when 'finish' is emitted
+  this.finished = false;
+
+  // has it been destroyed
+  this.destroyed = false;
+
+  // should we decode strings into buffers before passing to _write?
+  // this is here so that some node-core streams can optimize string
+  // handling at a lower level.
+  var noDecode = options.decodeStrings === false;
+  this.decodeStrings = !noDecode;
+
+  // Crypto is kind of old and crusty.  Historically, its default string
+  // encoding is 'binary' so we have to make this configurable.
+  // Everything else in the universe uses 'utf8', though.
+  this.defaultEncoding = options.defaultEncoding || 'utf8';
+
+  // not an actual buffer we keep track of, but a measurement
+  // of how much we're waiting to get pushed to some underlying
+  // socket or file.
+  this.length = 0;
+
+  // a flag to see when we're in the middle of a write.
+  this.writing = false;
+
+  // when true all writes will be buffered until .uncork() call
+  this.corked = 0;
+
+  // a flag to be able to tell if the onwrite cb is called immediately,
+  // or on a later tick.  We set this to true at first, because any
+  // actions that shouldn't happen until "later" should generally also
+  // not happen before the first write call.
+  this.sync = true;
+
+  // a flag to know if we're processing previously buffered items, which
+  // may call the _write() callback in the same tick, so that we don't
+  // end up in an overlapped onwrite situation.
+  this.bufferProcessing = false;
+
+  // the callback that's passed to _write(chunk,cb)
+  this.onwrite = function (er) {
+    onwrite(stream, er);
+  };
+
+  // the callback that the user supplies to write(chunk,encoding,cb)
+  this.writecb = null;
+
+  // the amount that is being written when _write is called.
+  this.writelen = 0;
+
+  this.bufferedRequest = null;
+  this.lastBufferedRequest = null;
+
+  // number of pending user-supplied write callbacks
+  // this must be 0 before 'finish' can be emitted
+  this.pendingcb = 0;
+
+  // emit prefinish if the only thing we're waiting for is _write cbs
+  // This is relevant for synchronous Transform streams
+  this.prefinished = false;
+
+  // True if the error was already emitted and should not be thrown again
+  this.errorEmitted = false;
+
+  // count buffered requests
+  this.bufferedRequestCount = 0;
+
+  // allocate the first CorkedRequest, there is always
+  // one allocated and free to use, and we maintain at most two
+  this.corkedRequestsFree = new CorkedRequest(this);
+}
+
+WritableState.prototype.getBuffer = function getBuffer() {
+  var current = this.bufferedRequest;
+  var out = [];
+  while (current) {
+    out.push(current);
+    current = current.next;
+  }
+  return out;
+};
+
+(function () {
+  try {
+    Object.defineProperty(WritableState.prototype, 'buffer', {
+      get: internalUtil.deprecate(function () {
+        return this.getBuffer();
+      }, '_writableState.buffer is deprecated. Use _writableState.getBuffer ' + 'instead.', 'DEP0003')
+    });
+  } catch (_) {}
+})();
+
+// Test _writableState for inheritance to account for Duplex streams,
+// whose prototype chain only points to Readable.
+var realHasInstance;
+if (typeof Symbol === 'function' && Symbol.hasInstance && typeof Function.prototype[Symbol.hasInstance] === 'function') {
+  realHasInstance = Function.prototype[Symbol.hasInstance];
+  Object.defineProperty(Writable, Symbol.hasInstance, {
+    value: function (object) {
+      if (realHasInstance.call(this, object)) return true;
+      if (this !== Writable) return false;
+
+      return object && object._writableState instanceof WritableState;
+    }
+  });
+} else {
+  realHasInstance = function (object) {
+    return object instanceof this;
+  };
+}
+
+function Writable(options) {
+  Duplex = Duplex || require('./_stream_duplex');
+
+  // Writable ctor is applied to Duplexes, too.
+  // `realHasInstance` is necessary because using plain `instanceof`
+  // would return false, as no `_writableState` property is attached.
+
+  // Trying to use the custom `instanceof` for Writable here will also break the
+  // Node.js LazyTransform implementation, which has a non-trivial getter for
+  // `_writableState` that would lead to infinite recursion.
+  if (!realHasInstance.call(Writable, this) && !(this instanceof Duplex)) {
+    return new Writable(options);
+  }
+
+  this._writableState = new WritableState(options, this);
+
+  // legacy.
+  this.writable = true;
+
+  if (options) {
+    if (typeof options.write === 'function') this._write = options.write;
+
+    if (typeof options.writev === 'function') this._writev = options.writev;
+
+    if (typeof options.destroy === 'function') this._destroy = options.destroy;
+
+    if (typeof options.final === 'function') this._final = options.final;
+  }
+
+  Stream.call(this);
+}
+
+// Otherwise people can pipe Writable streams, which is just wrong.
+Writable.prototype.pipe = function () {
+  this.emit('error', new Error('Cannot pipe, not readable'));
+};
+
+function writeAfterEnd(stream, cb) {
+  var er = new Error('write after end');
+  // TODO: defer error events consistently everywhere, not just the cb
+  stream.emit('error', er);
+  pna.nextTick(cb, er);
+}
+
+// Checks that a user-supplied chunk is valid, especially for the particular
+// mode the stream is in. Currently this means that `null` is never accepted
+// and undefined/non-string values are only allowed in object mode.
+function validChunk(stream, state, chunk, cb) {
+  var valid = true;
+  var er = false;
+
+  if (chunk === null) {
+    er = new TypeError('May not write null values to stream');
+  } else if (typeof chunk !== 'string' && chunk !== undefined && !state.objectMode) {
+    er = new TypeError('Invalid non-string/buffer chunk');
+  }
+  if (er) {
+    stream.emit('error', er);
+    pna.nextTick(cb, er);
+    valid = false;
+  }
+  return valid;
+}
+
+Writable.prototype.write = function (chunk, encoding, cb) {
+  var state = this._writableState;
+  var ret = false;
+  var isBuf = !state.objectMode && _isUint8Array(chunk);
+
+  if (isBuf && !Buffer.isBuffer(chunk)) {
+    chunk = _uint8ArrayToBuffer(chunk);
+  }
+
+  if (typeof encoding === 'function') {
+    cb = encoding;
+    encoding = null;
+  }
+
+  if (isBuf) encoding = 'buffer';else if (!encoding) encoding = state.defaultEncoding;
+
+  if (typeof cb !== 'function') cb = nop;
+
+  if (state.ended) writeAfterEnd(this, cb);else if (isBuf || validChunk(this, state, chunk, cb)) {
+    state.pendingcb++;
+    ret = writeOrBuffer(this, state, isBuf, chunk, encoding, cb);
+  }
+
+  return ret;
+};
+
+Writable.prototype.cork = function () {
+  var state = this._writableState;
+
+  state.corked++;
+};
+
+Writable.prototype.uncork = function () {
+  var state = this._writableState;
+
+  if (state.corked) {
+    state.corked--;
+
+    if (!state.writing && !state.corked && !state.finished && !state.bufferProcessing && state.bufferedRequest) clearBuffer(this, state);
+  }
+};
+
+Writable.prototype.setDefaultEncoding = function setDefaultEncoding(encoding) {
+  // node::ParseEncoding() requires lower case.
+  if (typeof encoding === 'string') encoding = encoding.toLowerCase();
+  if (!(['hex', 'utf8', 'utf-8', 'ascii', 'binary', 'base64', 'ucs2', 'ucs-2', 'utf16le', 'utf-16le', 'raw'].indexOf((encoding + '').toLowerCase()) > -1)) throw new TypeError('Unknown encoding: ' + encoding);
+  this._writableState.defaultEncoding = encoding;
+  return this;
+};
+
+function decodeChunk(state, chunk, encoding) {
+  if (!state.objectMode && state.decodeStrings !== false && typeof chunk === 'string') {
+    chunk = Buffer.from(chunk, encoding);
+  }
+  return chunk;
+}
+
+Object.defineProperty(Writable.prototype, 'writableHighWaterMark', {
+  // making it explicit this property is not enumerable
+  // because otherwise some prototype manipulation in
+  // userland will fail
+  enumerable: false,
+  get: function () {
+    return this._writableState.highWaterMark;
+  }
+});
+
+// if we're already writing something, then just put this
+// in the queue, and wait our turn.  Otherwise, call _write
+// If we return false, then we need a drain event, so set that flag.
+function writeOrBuffer(stream, state, isBuf, chunk, encoding, cb) {
+  if (!isBuf) {
+    var newChunk = decodeChunk(state, chunk, encoding);
+    if (chunk !== newChunk) {
+      isBuf = true;
+      encoding = 'buffer';
+      chunk = newChunk;
+    }
+  }
+  var len = state.objectMode ? 1 : chunk.length;
+
+  state.length += len;
+
+  var ret = state.length < state.highWaterMark;
+  // we must ensure that previous needDrain will not be reset to false.
+  if (!ret) state.needDrain = true;
+
+  if (state.writing || state.corked) {
+    var last = state.lastBufferedRequest;
+    state.lastBufferedRequest = {
+      chunk: chunk,
+      encoding: encoding,
+      isBuf: isBuf,
+      callback: cb,
+      next: null
+    };
+    if (last) {
+      last.next = state.lastBufferedRequest;
+    } else {
+      state.bufferedRequest = state.lastBufferedRequest;
+    }
+    state.bufferedRequestCount += 1;
+  } else {
+    doWrite(stream, state, false, len, chunk, encoding, cb);
+  }
+
+  return ret;
+}
+
+function doWrite(stream, state, writev, len, chunk, encoding, cb) {
+  state.writelen = len;
+  state.writecb = cb;
+  state.writing = true;
+  state.sync = true;
+  if (writev) stream._writev(chunk, state.onwrite);else stream._write(chunk, encoding, state.onwrite);
+  state.sync = false;
+}
+
+function onwriteError(stream, state, sync, er, cb) {
+  --state.pendingcb;
+
+  if (sync) {
+    // defer the callback if we are being called synchronously
+    // to avoid piling up things on the stack
+    pna.nextTick(cb, er);
+    // this can emit finish, and it will always happen
+    // after error
+    pna.nextTick(finishMaybe, stream, state);
+    stream._writableState.errorEmitted = true;
+    stream.emit('error', er);
+  } else {
+    // the caller expect this to happen before if
+    // it is async
+    cb(er);
+    stream._writableState.errorEmitted = true;
+    stream.emit('error', er);
+    // this can emit finish, but finish must
+    // always follow error
+    finishMaybe(stream, state);
+  }
+}
+
+function onwriteStateUpdate(state) {
+  state.writing = false;
+  state.writecb = null;
+  state.length -= state.writelen;
+  state.writelen = 0;
+}
+
+function onwrite(stream, er) {
+  var state = stream._writableState;
+  var sync = state.sync;
+  var cb = state.writecb;
+
+  onwriteStateUpdate(state);
+
+  if (er) onwriteError(stream, state, sync, er, cb);else {
+    // Check if we're actually ready to finish, but don't emit yet
+    var finished = needFinish(state);
+
+    if (!finished && !state.corked && !state.bufferProcessing && state.bufferedRequest) {
+      clearBuffer(stream, state);
+    }
+
+    if (sync) {
+      /*<replacement>*/
+      asyncWrite(afterWrite, stream, state, finished, cb);
+      /*</replacement>*/
+    } else {
+      afterWrite(stream, state, finished, cb);
+    }
+  }
+}
+
+function afterWrite(stream, state, finished, cb) {
+  if (!finished) onwriteDrain(stream, state);
+  state.pendingcb--;
+  cb();
+  finishMaybe(stream, state);
+}
+
+// Must force callback to be called on nextTick, so that we don't
+// emit 'drain' before the write() consumer gets the 'false' return
+// value, and has a chance to attach a 'drain' listener.
+function onwriteDrain(stream, state) {
+  if (state.length === 0 && state.needDrain) {
+    state.needDrain = false;
+    stream.emit('drain');
+  }
+}
+
+// if there's something in the buffer waiting, then process it
+function clearBuffer(stream, state) {
+  state.bufferProcessing = true;
+  var entry = state.bufferedRequest;
+
+  if (stream._writev && entry && entry.next) {
+    // Fast case, write everything using _writev()
+    var l = state.bufferedRequestCount;
+    var buffer = new Array(l);
+    var holder = state.corkedRequestsFree;
+    holder.entry = entry;
+
+    var count = 0;
+    var allBuffers = true;
+    while (entry) {
+      buffer[count] = entry;
+      if (!entry.isBuf) allBuffers = false;
+      entry = entry.next;
+      count += 1;
+    }
+    buffer.allBuffers = allBuffers;
+
+    doWrite(stream, state, true, state.length, buffer, '', holder.finish);
+
+    // doWrite is almost always async, defer these to save a bit of time
+    // as the hot path ends with doWrite
+    state.pendingcb++;
+    state.lastBufferedRequest = null;
+    if (holder.next) {
+      state.corkedRequestsFree = holder.next;
+      holder.next = null;
+    } else {
+      state.corkedRequestsFree = new CorkedRequest(state);
+    }
+    state.bufferedRequestCount = 0;
+  } else {
+    // Slow case, write chunks one-by-one
+    while (entry) {
+      var chunk = entry.chunk;
+      var encoding = entry.encoding;
+      var cb = entry.callback;
+      var len = state.objectMode ? 1 : chunk.length;
+
+      doWrite(stream, state, false, len, chunk, encoding, cb);
+      entry = entry.next;
+      state.bufferedRequestCount--;
+      // if we didn't call the onwrite immediately, then
+      // it means that we need to wait until it does.
+      // also, that means that the chunk and cb are currently
+      // being processed, so move the buffer counter past them.
+      if (state.writing) {
+        break;
+      }
+    }
+
+    if (entry === null) state.lastBufferedRequest = null;
+  }
+
+  state.bufferedRequest = entry;
+  state.bufferProcessing = false;
+}
+
+Writable.prototype._write = function (chunk, encoding, cb) {
+  cb(new Error('_write() is not implemented'));
+};
+
+Writable.prototype._writev = null;
+
+Writable.prototype.end = function (chunk, encoding, cb) {
+  var state = this._writableState;
+
+  if (typeof chunk === 'function') {
+    cb = chunk;
+    chunk = null;
+    encoding = null;
+  } else if (typeof encoding === 'function') {
+    cb = encoding;
+    encoding = null;
+  }
+
+  if (chunk !== null && chunk !== undefined) this.write(chunk, encoding);
+
+  // .end() fully uncorks
+  if (state.corked) {
+    state.corked = 1;
+    this.uncork();
+  }
+
+  // ignore unnecessary end() calls.
+  if (!state.ending && !state.finished) endWritable(this, state, cb);
+};
+
+function needFinish(state) {
+  return state.ending && state.length === 0 && state.bufferedRequest === null && !state.finished && !state.writing;
+}
+function callFinal(stream, state) {
+  stream._final(function (err) {
+    state.pendingcb--;
+    if (err) {
+      stream.emit('error', err);
+    }
+    state.prefinished = true;
+    stream.emit('prefinish');
+    finishMaybe(stream, state);
+  });
+}
+function prefinish(stream, state) {
+  if (!state.prefinished && !state.finalCalled) {
+    if (typeof stream._final === 'function') {
+      state.pendingcb++;
+      state.finalCalled = true;
+      pna.nextTick(callFinal, stream, state);
+    } else {
+      state.prefinished = true;
+      stream.emit('prefinish');
+    }
+  }
+}
+
+function finishMaybe(stream, state) {
+  var need = needFinish(state);
+  if (need) {
+    prefinish(stream, state);
+    if (state.pendingcb === 0) {
+      state.finished = true;
+      stream.emit('finish');
+    }
+  }
+  return need;
+}
+
+function endWritable(stream, state, cb) {
+  state.ending = true;
+  finishMaybe(stream, state);
+  if (cb) {
+    if (state.finished) pna.nextTick(cb);else stream.once('finish', cb);
+  }
+  state.ended = true;
+  stream.writable = false;
+}
+
+function onCorkedFinish(corkReq, state, err) {
+  var entry = corkReq.entry;
+  corkReq.entry = null;
+  while (entry) {
+    var cb = entry.callback;
+    state.pendingcb--;
+    cb(err);
+    entry = entry.next;
+  }
+  if (state.corkedRequestsFree) {
+    state.corkedRequestsFree.next = corkReq;
+  } else {
+    state.corkedRequestsFree = corkReq;
+  }
+}
+
+Object.defineProperty(Writable.prototype, 'destroyed', {
+  get: function () {
+    if (this._writableState === undefined) {
+      return false;
+    }
+    return this._writableState.destroyed;
+  },
+  set: function (value) {
+    // we ignore the value if the stream
+    // has not been initialized yet
+    if (!this._writableState) {
+      return;
+    }
+
+    // backward compatibility, the user is explicitly
+    // managing destroyed
+    this._writableState.destroyed = value;
+  }
+});
+
+Writable.prototype.destroy = destroyImpl.destroy;
+Writable.prototype._undestroy = destroyImpl.undestroy;
+Writable.prototype._destroy = function (err, cb) {
+  this.end();
+  cb(err);
+};
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {},require("timers").setImmediate)
+},{"./_stream_duplex":71,"./internal/streams/destroy":77,"./internal/streams/stream":78,"_process":69,"core-util-is":44,"inherits":56,"process-nextick-args":68,"safe-buffer":83,"timers":86,"util-deprecate":87}],76:[function(require,module,exports){
+'use strict';
+
+function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
+
+var Buffer = require('safe-buffer').Buffer;
+var util = require('util');
+
+function copyBuffer(src, target, offset) {
+  src.copy(target, offset);
+}
+
+module.exports = function () {
+  function BufferList() {
+    _classCallCheck(this, BufferList);
+
+    this.head = null;
+    this.tail = null;
+    this.length = 0;
+  }
+
+  BufferList.prototype.push = function push(v) {
+    var entry = { data: v, next: null };
+    if (this.length > 0) this.tail.next = entry;else this.head = entry;
+    this.tail = entry;
+    ++this.length;
+  };
+
+  BufferList.prototype.unshift = function unshift(v) {
+    var entry = { data: v, next: this.head };
+    if (this.length === 0) this.tail = entry;
+    this.head = entry;
+    ++this.length;
+  };
+
+  BufferList.prototype.shift = function shift() {
+    if (this.length === 0) return;
+    var ret = this.head.data;
+    if (this.length === 1) this.head = this.tail = null;else this.head = this.head.next;
+    --this.length;
+    return ret;
+  };
+
+  BufferList.prototype.clear = function clear() {
+    this.head = this.tail = null;
+    this.length = 0;
+  };
+
+  BufferList.prototype.join = function join(s) {
+    if (this.length === 0) return '';
+    var p = this.head;
+    var ret = '' + p.data;
+    while (p = p.next) {
+      ret += s + p.data;
+    }return ret;
+  };
+
+  BufferList.prototype.concat = function concat(n) {
+    if (this.length === 0) return Buffer.alloc(0);
+    if (this.length === 1) return this.head.data;
+    var ret = Buffer.allocUnsafe(n >>> 0);
+    var p = this.head;
+    var i = 0;
+    while (p) {
+      copyBuffer(p.data, ret, i);
+      i += p.data.length;
+      p = p.next;
+    }
+    return ret;
+  };
+
+  return BufferList;
+}();
+
+if (util && util.inspect && util.inspect.custom) {
+  module.exports.prototype[util.inspect.custom] = function () {
+    var obj = util.inspect({ length: this.length });
+    return this.constructor.name + ' ' + obj;
+  };
+}
+},{"safe-buffer":83,"util":40}],77:[function(require,module,exports){
+'use strict';
+
+/*<replacement>*/
+
+var pna = require('process-nextick-args');
+/*</replacement>*/
+
+// undocumented cb() API, needed for core, not for public API
+function destroy(err, cb) {
+  var _this = this;
+
+  var readableDestroyed = this._readableState && this._readableState.destroyed;
+  var writableDestroyed = this._writableState && this._writableState.destroyed;
+
+  if (readableDestroyed || writableDestroyed) {
+    if (cb) {
+      cb(err);
+    } else if (err && (!this._writableState || !this._writableState.errorEmitted)) {
+      pna.nextTick(emitErrorNT, this, err);
+    }
+    return this;
+  }
+
+  // we set destroyed to true before firing error callbacks in order
+  // to make it re-entrance safe in case destroy() is called within callbacks
+
+  if (this._readableState) {
+    this._readableState.destroyed = true;
+  }
+
+  // if this is a duplex stream mark the writable part as destroyed as well
+  if (this._writableState) {
+    this._writableState.destroyed = true;
+  }
+
+  this._destroy(err || null, function (err) {
+    if (!cb && err) {
+      pna.nextTick(emitErrorNT, _this, err);
+      if (_this._writableState) {
+        _this._writableState.errorEmitted = true;
+      }
+    } else if (cb) {
+      cb(err);
+    }
+  });
+
+  return this;
+}
+
+function undestroy() {
+  if (this._readableState) {
+    this._readableState.destroyed = false;
+    this._readableState.reading = false;
+    this._readableState.ended = false;
+    this._readableState.endEmitted = false;
+  }
+
+  if (this._writableState) {
+    this._writableState.destroyed = false;
+    this._writableState.ended = false;
+    this._writableState.ending = false;
+    this._writableState.finished = false;
+    this._writableState.errorEmitted = false;
+  }
+}
+
+function emitErrorNT(self, err) {
+  self.emit('error', err);
+}
+
+module.exports = {
+  destroy: destroy,
+  undestroy: undestroy
+};
+},{"process-nextick-args":68}],78:[function(require,module,exports){
+module.exports = require('events').EventEmitter;
+
+},{"events":50}],79:[function(require,module,exports){
+module.exports = require('./readable').PassThrough
+
+},{"./readable":80}],80:[function(require,module,exports){
+exports = module.exports = require('./lib/_stream_readable.js');
+exports.Stream = exports;
+exports.Readable = exports;
+exports.Writable = require('./lib/_stream_writable.js');
+exports.Duplex = require('./lib/_stream_duplex.js');
+exports.Transform = require('./lib/_stream_transform.js');
+exports.PassThrough = require('./lib/_stream_passthrough.js');
+
+},{"./lib/_stream_duplex.js":71,"./lib/_stream_passthrough.js":72,"./lib/_stream_readable.js":73,"./lib/_stream_transform.js":74,"./lib/_stream_writable.js":75}],81:[function(require,module,exports){
+module.exports = require('./readable').Transform
+
+},{"./readable":80}],82:[function(require,module,exports){
+module.exports = require('./lib/_stream_writable.js');
+
+},{"./lib/_stream_writable.js":75}],83:[function(require,module,exports){
+/* eslint-disable node/no-deprecated-api */
+var buffer = require('buffer')
+var Buffer = buffer.Buffer
+
+// alternative to using Object.keys for old browsers
+function copyProps (src, dst) {
+  for (var key in src) {
+    dst[key] = src[key]
+  }
+}
+if (Buffer.from && Buffer.alloc && Buffer.allocUnsafe && Buffer.allocUnsafeSlow) {
+  module.exports = buffer
+} else {
+  // Copy properties from require('buffer')
+  copyProps(buffer, exports)
+  exports.Buffer = SafeBuffer
+}
+
+function SafeBuffer (arg, encodingOrOffset, length) {
+  return Buffer(arg, encodingOrOffset, length)
+}
+
+// Copy static methods from Buffer
+copyProps(Buffer, SafeBuffer)
+
+SafeBuffer.from = function (arg, encodingOrOffset, length) {
+  if (typeof arg === 'number') {
+    throw new TypeError('Argument must not be a number')
+  }
+  return Buffer(arg, encodingOrOffset, length)
+}
+
+SafeBuffer.alloc = function (size, fill, encoding) {
+  if (typeof size !== 'number') {
+    throw new TypeError('Argument must be a number')
+  }
+  var buf = Buffer(size)
+  if (fill !== undefined) {
+    if (typeof encoding === 'string') {
+      buf.fill(fill, encoding)
+    } else {
+      buf.fill(fill)
+    }
+  } else {
+    buf.fill(0)
+  }
+  return buf
+}
+
+SafeBuffer.allocUnsafe = function (size) {
+  if (typeof size !== 'number') {
+    throw new TypeError('Argument must be a number')
+  }
+  return Buffer(size)
+}
+
+SafeBuffer.allocUnsafeSlow = function (size) {
+  if (typeof size !== 'number') {
+    throw new TypeError('Argument must be a number')
+  }
+  return buffer.SlowBuffer(size)
+}
+
+},{"buffer":43}],84:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+module.exports = Stream;
+
+var EE = require('events').EventEmitter;
+var inherits = require('inherits');
+
+inherits(Stream, EE);
+Stream.Readable = require('readable-stream/readable.js');
+Stream.Writable = require('readable-stream/writable.js');
+Stream.Duplex = require('readable-stream/duplex.js');
+Stream.Transform = require('readable-stream/transform.js');
+Stream.PassThrough = require('readable-stream/passthrough.js');
+
+// Backwards-compat with node 0.4.x
+Stream.Stream = Stream;
+
+
+
+// old-style streams.  Note that the pipe method (the only relevant
+// part of this class) is overridden in the Readable class.
+
+function Stream() {
+  EE.call(this);
+}
+
+Stream.prototype.pipe = function(dest, options) {
+  var source = this;
+
+  function ondata(chunk) {
+    if (dest.writable) {
+      if (false === dest.write(chunk) && source.pause) {
+        source.pause();
+      }
+    }
+  }
+
+  source.on('data', ondata);
+
+  function ondrain() {
+    if (source.readable && source.resume) {
+      source.resume();
+    }
+  }
+
+  dest.on('drain', ondrain);
+
+  // If the 'end' option is not supplied, dest.end() will be called when
+  // source gets the 'end' or 'close' events.  Only dest.end() once.
+  if (!dest._isStdio && (!options || options.end !== false)) {
+    source.on('end', onend);
+    source.on('close', onclose);
+  }
+
+  var didOnEnd = false;
+  function onend() {
+    if (didOnEnd) return;
+    didOnEnd = true;
+
+    dest.end();
+  }
+
+
+  function onclose() {
+    if (didOnEnd) return;
+    didOnEnd = true;
+
+    if (typeof dest.destroy === 'function') dest.destroy();
+  }
+
+  // don't leave dangling pipes when there are errors.
+  function onerror(er) {
+    cleanup();
+    if (EE.listenerCount(this, 'error') === 0) {
+      throw er; // Unhandled stream error in pipe.
+    }
+  }
+
+  source.on('error', onerror);
+  dest.on('error', onerror);
+
+  // remove all the event listeners that were added.
+  function cleanup() {
+    source.removeListener('data', ondata);
+    dest.removeListener('drain', ondrain);
+
+    source.removeListener('end', onend);
+    source.removeListener('close', onclose);
+
+    source.removeListener('error', onerror);
+    dest.removeListener('error', onerror);
+
+    source.removeListener('end', cleanup);
+    source.removeListener('close', cleanup);
+
+    dest.removeListener('close', cleanup);
+  }
+
+  source.on('end', cleanup);
+  source.on('close', cleanup);
+
+  dest.on('close', cleanup);
+
+  dest.emit('pipe', source);
+
+  // Allow for unix-like usage: A.pipe(B).pipe(C)
+  return dest;
+};
+
+},{"events":50,"inherits":56,"readable-stream/duplex.js":70,"readable-stream/passthrough.js":79,"readable-stream/readable.js":80,"readable-stream/transform.js":81,"readable-stream/writable.js":82}],85:[function(require,module,exports){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+'use strict';
+
+/*<replacement>*/
+
+var Buffer = require('safe-buffer').Buffer;
+/*</replacement>*/
+
+var isEncoding = Buffer.isEncoding || function (encoding) {
+  encoding = '' + encoding;
+  switch (encoding && encoding.toLowerCase()) {
+    case 'hex':case 'utf8':case 'utf-8':case 'ascii':case 'binary':case 'base64':case 'ucs2':case 'ucs-2':case 'utf16le':case 'utf-16le':case 'raw':
+      return true;
+    default:
+      return false;
+  }
+};
+
+function _normalizeEncoding(enc) {
+  if (!enc) return 'utf8';
+  var retried;
+  while (true) {
+    switch (enc) {
+      case 'utf8':
+      case 'utf-8':
+        return 'utf8';
+      case 'ucs2':
+      case 'ucs-2':
+      case 'utf16le':
+      case 'utf-16le':
+        return 'utf16le';
+      case 'latin1':
+      case 'binary':
+        return 'latin1';
+      case 'base64':
+      case 'ascii':
+      case 'hex':
+        return enc;
+      default:
+        if (retried) return; // undefined
+        enc = ('' + enc).toLowerCase();
+        retried = true;
+    }
+  }
+};
+
+// Do not cache `Buffer.isEncoding` when checking encoding names as some
+// modules monkey-patch it to support additional encodings
+function normalizeEncoding(enc) {
+  var nenc = _normalizeEncoding(enc);
+  if (typeof nenc !== 'string' && (Buffer.isEncoding === isEncoding || !isEncoding(enc))) throw new Error('Unknown encoding: ' + enc);
+  return nenc || enc;
+}
+
+// StringDecoder provides an interface for efficiently splitting a series of
+// buffers into a series of JS strings without breaking apart multi-byte
+// characters.
+exports.StringDecoder = StringDecoder;
+function StringDecoder(encoding) {
+  this.encoding = normalizeEncoding(encoding);
+  var nb;
+  switch (this.encoding) {
+    case 'utf16le':
+      this.text = utf16Text;
+      this.end = utf16End;
+      nb = 4;
+      break;
+    case 'utf8':
+      this.fillLast = utf8FillLast;
+      nb = 4;
+      break;
+    case 'base64':
+      this.text = base64Text;
+      this.end = base64End;
+      nb = 3;
+      break;
+    default:
+      this.write = simpleWrite;
+      this.end = simpleEnd;
+      return;
+  }
+  this.lastNeed = 0;
+  this.lastTotal = 0;
+  this.lastChar = Buffer.allocUnsafe(nb);
+}
+
+StringDecoder.prototype.write = function (buf) {
+  if (buf.length === 0) return '';
+  var r;
+  var i;
+  if (this.lastNeed) {
+    r = this.fillLast(buf);
+    if (r === undefined) return '';
+    i = this.lastNeed;
+    this.lastNeed = 0;
+  } else {
+    i = 0;
+  }
+  if (i < buf.length) return r ? r + this.text(buf, i) : this.text(buf, i);
+  return r || '';
+};
+
+StringDecoder.prototype.end = utf8End;
+
+// Returns only complete characters in a Buffer
+StringDecoder.prototype.text = utf8Text;
+
+// Attempts to complete a partial non-UTF-8 character using bytes from a Buffer
+StringDecoder.prototype.fillLast = function (buf) {
+  if (this.lastNeed <= buf.length) {
+    buf.copy(this.lastChar, this.lastTotal - this.lastNeed, 0, this.lastNeed);
+    return this.lastChar.toString(this.encoding, 0, this.lastTotal);
+  }
+  buf.copy(this.lastChar, this.lastTotal - this.lastNeed, 0, buf.length);
+  this.lastNeed -= buf.length;
+};
+
+// Checks the type of a UTF-8 byte, whether it's ASCII, a leading byte, or a
+// continuation byte. If an invalid byte is detected, -2 is returned.
+function utf8CheckByte(byte) {
+  if (byte <= 0x7F) return 0;else if (byte >> 5 === 0x06) return 2;else if (byte >> 4 === 0x0E) return 3;else if (byte >> 3 === 0x1E) return 4;
+  return byte >> 6 === 0x02 ? -1 : -2;
+}
+
+// Checks at most 3 bytes at the end of a Buffer in order to detect an
+// incomplete multi-byte UTF-8 character. The total number of bytes (2, 3, or 4)
+// needed to complete the UTF-8 character (if applicable) are returned.
+function utf8CheckIncomplete(self, buf, i) {
+  var j = buf.length - 1;
+  if (j < i) return 0;
+  var nb = utf8CheckByte(buf[j]);
+  if (nb >= 0) {
+    if (nb > 0) self.lastNeed = nb - 1;
+    return nb;
+  }
+  if (--j < i || nb === -2) return 0;
+  nb = utf8CheckByte(buf[j]);
+  if (nb >= 0) {
+    if (nb > 0) self.lastNeed = nb - 2;
+    return nb;
+  }
+  if (--j < i || nb === -2) return 0;
+  nb = utf8CheckByte(buf[j]);
+  if (nb >= 0) {
+    if (nb > 0) {
+      if (nb === 2) nb = 0;else self.lastNeed = nb - 3;
+    }
+    return nb;
+  }
+  return 0;
+}
+
+// Validates as many continuation bytes for a multi-byte UTF-8 character as
+// needed or are available. If we see a non-continuation byte where we expect
+// one, we "replace" the validated continuation bytes we've seen so far with
+// a single UTF-8 replacement character ('\ufffd'), to match v8's UTF-8 decoding
+// behavior. The continuation byte check is included three times in the case
+// where all of the continuation bytes for a character exist in the same buffer.
+// It is also done this way as a slight performance increase instead of using a
+// loop.
+function utf8CheckExtraBytes(self, buf, p) {
+  if ((buf[0] & 0xC0) !== 0x80) {
+    self.lastNeed = 0;
+    return '\ufffd';
+  }
+  if (self.lastNeed > 1 && buf.length > 1) {
+    if ((buf[1] & 0xC0) !== 0x80) {
+      self.lastNeed = 1;
+      return '\ufffd';
+    }
+    if (self.lastNeed > 2 && buf.length > 2) {
+      if ((buf[2] & 0xC0) !== 0x80) {
+        self.lastNeed = 2;
+        return '\ufffd';
+      }
+    }
+  }
+}
+
+// Attempts to complete a multi-byte UTF-8 character using bytes from a Buffer.
+function utf8FillLast(buf) {
+  var p = this.lastTotal - this.lastNeed;
+  var r = utf8CheckExtraBytes(this, buf, p);
+  if (r !== undefined) return r;
+  if (this.lastNeed <= buf.length) {
+    buf.copy(this.lastChar, p, 0, this.lastNeed);
+    return this.lastChar.toString(this.encoding, 0, this.lastTotal);
+  }
+  buf.copy(this.lastChar, p, 0, buf.length);
+  this.lastNeed -= buf.length;
+}
+
+// Returns all complete UTF-8 characters in a Buffer. If the Buffer ended on a
+// partial character, the character's bytes are buffered until the required
+// number of bytes are available.
+function utf8Text(buf, i) {
+  var total = utf8CheckIncomplete(this, buf, i);
+  if (!this.lastNeed) return buf.toString('utf8', i);
+  this.lastTotal = total;
+  var end = buf.length - (total - this.lastNeed);
+  buf.copy(this.lastChar, 0, end);
+  return buf.toString('utf8', i, end);
+}
+
+// For UTF-8, a replacement character is added when ending on a partial
+// character.
+function utf8End(buf) {
+  var r = buf && buf.length ? this.write(buf) : '';
+  if (this.lastNeed) return r + '\ufffd';
+  return r;
+}
+
+// UTF-16LE typically needs two bytes per character, but even if we have an even
+// number of bytes available, we need to check if we end on a leading/high
+// surrogate. In that case, we need to wait for the next two bytes in order to
+// decode the last character properly.
+function utf16Text(buf, i) {
+  if ((buf.length - i) % 2 === 0) {
+    var r = buf.toString('utf16le', i);
+    if (r) {
+      var c = r.charCodeAt(r.length - 1);
+      if (c >= 0xD800 && c <= 0xDBFF) {
+        this.lastNeed = 2;
+        this.lastTotal = 4;
+        this.lastChar[0] = buf[buf.length - 2];
+        this.lastChar[1] = buf[buf.length - 1];
+        return r.slice(0, -1);
+      }
+    }
+    return r;
+  }
+  this.lastNeed = 1;
+  this.lastTotal = 2;
+  this.lastChar[0] = buf[buf.length - 1];
+  return buf.toString('utf16le', i, buf.length - 1);
+}
+
+// For UTF-16LE we do not explicitly append special replacement characters if we
+// end on a partial character, we simply let v8 handle that.
+function utf16End(buf) {
+  var r = buf && buf.length ? this.write(buf) : '';
+  if (this.lastNeed) {
+    var end = this.lastTotal - this.lastNeed;
+    return r + this.lastChar.toString('utf16le', 0, end);
+  }
+  return r;
+}
+
+function base64Text(buf, i) {
+  var n = (buf.length - i) % 3;
+  if (n === 0) return buf.toString('base64', i);
+  this.lastNeed = 3 - n;
+  this.lastTotal = 3;
+  if (n === 1) {
+    this.lastChar[0] = buf[buf.length - 1];
+  } else {
+    this.lastChar[0] = buf[buf.length - 2];
+    this.lastChar[1] = buf[buf.length - 1];
+  }
+  return buf.toString('base64', i, buf.length - n);
+}
+
+function base64End(buf) {
+  var r = buf && buf.length ? this.write(buf) : '';
+  if (this.lastNeed) return r + this.lastChar.toString('base64', 0, 3 - this.lastNeed);
+  return r;
+}
+
+// Pass bytes on through for single-byte encodings (e.g. ascii, latin1, hex)
+function simpleWrite(buf) {
+  return buf.toString(this.encoding);
+}
+
+function simpleEnd(buf) {
+  return buf && buf.length ? this.write(buf) : '';
+}
+},{"safe-buffer":83}],86:[function(require,module,exports){
+(function (setImmediate,clearImmediate){
+var nextTick = require('process/browser.js').nextTick;
+var apply = Function.prototype.apply;
+var slice = Array.prototype.slice;
+var immediateIds = {};
+var nextImmediateId = 0;
+
+// DOM APIs, for completeness
+
+exports.setTimeout = function() {
+  return new Timeout(apply.call(setTimeout, window, arguments), clearTimeout);
+};
+exports.setInterval = function() {
+  return new Timeout(apply.call(setInterval, window, arguments), clearInterval);
+};
+exports.clearTimeout =
+exports.clearInterval = function(timeout) { timeout.close(); };
+
+function Timeout(id, clearFn) {
+  this._id = id;
+  this._clearFn = clearFn;
+}
+Timeout.prototype.unref = Timeout.prototype.ref = function() {};
+Timeout.prototype.close = function() {
+  this._clearFn.call(window, this._id);
+};
+
+// Does not start the time, just sets up the members needed.
+exports.enroll = function(item, msecs) {
+  clearTimeout(item._idleTimeoutId);
+  item._idleTimeout = msecs;
+};
+
+exports.unenroll = function(item) {
+  clearTimeout(item._idleTimeoutId);
+  item._idleTimeout = -1;
+};
+
+exports._unrefActive = exports.active = function(item) {
+  clearTimeout(item._idleTimeoutId);
+
+  var msecs = item._idleTimeout;
+  if (msecs >= 0) {
+    item._idleTimeoutId = setTimeout(function onTimeout() {
+      if (item._onTimeout)
+        item._onTimeout();
+    }, msecs);
+  }
+};
+
+// That's not how node.js implements it but the exposed api is the same.
+exports.setImmediate = typeof setImmediate === "function" ? setImmediate : function(fn) {
+  var id = nextImmediateId++;
+  var args = arguments.length < 2 ? false : slice.call(arguments, 1);
+
+  immediateIds[id] = true;
+
+  nextTick(function onNextTick() {
+    if (immediateIds[id]) {
+      // fn.call() is faster so we optimize for the common use-case
+      // @see http://jsperf.com/call-apply-segu
+      if (args) {
+        fn.apply(null, args);
+      } else {
+        fn.call(null);
+      }
+      // Prevent ids from leaking
+      exports.clearImmediate(id);
+    }
+  });
+
+  return id;
+};
+
+exports.clearImmediate = typeof clearImmediate === "function" ? clearImmediate : function(id) {
+  delete immediateIds[id];
+};
+}).call(this,require("timers").setImmediate,require("timers").clearImmediate)
+},{"process/browser.js":69,"timers":86}],87:[function(require,module,exports){
+(function (global){
+
+/**
+ * Module exports.
+ */
+
+module.exports = deprecate;
+
+/**
+ * Mark that a method should not be used.
+ * Returns a modified function which warns once by default.
+ *
+ * If `localStorage.noDeprecation = true` is set, then it is a no-op.
+ *
+ * If `localStorage.throwDeprecation = true` is set, then deprecated functions
+ * will throw an Error when invoked.
+ *
+ * If `localStorage.traceDeprecation = true` is set, then deprecated functions
+ * will invoke `console.trace()` instead of `console.error()`.
+ *
+ * @param {Function} fn - the function to deprecate
+ * @param {String} msg - the string to print to the console when `fn` is invoked
+ * @returns {Function} a new "deprecated" version of `fn`
+ * @api public
+ */
+
+function deprecate (fn, msg) {
+  if (config('noDeprecation')) {
+    return fn;
+  }
+
+  var warned = false;
+  function deprecated() {
+    if (!warned) {
+      if (config('throwDeprecation')) {
+        throw new Error(msg);
+      } else if (config('traceDeprecation')) {
+        console.trace(msg);
+      } else {
+        console.warn(msg);
+      }
+      warned = true;
+    }
+    return fn.apply(this, arguments);
+  }
+
+  return deprecated;
+}
+
+/**
+ * Checks `localStorage` for boolean values for the given `name`.
+ *
+ * @param {String} name
+ * @returns {Boolean}
+ * @api private
+ */
+
+function config (name) {
+  // accessing global.localStorage can trigger a DOMException in sandboxed iframes
+  try {
+    if (!global.localStorage) return false;
+  } catch (_) {
+    return false;
+  }
+  var val = global.localStorage[name];
+  if (null == val) return false;
+  return String(val).toLowerCase() === 'true';
+}
+
+}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{}],88:[function(require,module,exports){
+module.exports = function isBuffer(arg) {
+  return arg && typeof arg === 'object'
+    && typeof arg.copy === 'function'
+    && typeof arg.fill === 'function'
+    && typeof arg.readUInt8 === 'function';
+}
+},{}],89:[function(require,module,exports){
+(function (process,global){
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+var formatRegExp = /%[sdj%]/g;
+exports.format = function(f) {
+  if (!isString(f)) {
+    var objects = [];
+    for (var i = 0; i < arguments.length; i++) {
+      objects.push(inspect(arguments[i]));
+    }
+    return objects.join(' ');
+  }
+
+  var i = 1;
+  var args = arguments;
+  var len = args.length;
+  var str = String(f).replace(formatRegExp, function(x) {
+    if (x === '%%') return '%';
+    if (i >= len) return x;
+    switch (x) {
+      case '%s': return String(args[i++]);
+      case '%d': return Number(args[i++]);
+      case '%j':
+        try {
+          return JSON.stringify(args[i++]);
+        } catch (_) {
+          return '[Circular]';
+        }
+      default:
+        return x;
+    }
+  });
+  for (var x = args[i]; i < len; x = args[++i]) {
+    if (isNull(x) || !isObject(x)) {
+      str += ' ' + x;
+    } else {
+      str += ' ' + inspect(x);
+    }
+  }
+  return str;
+};
+
+
+// Mark that a method should not be used.
+// Returns a modified function which warns once by default.
+// If --no-deprecation is set, then it is a no-op.
+exports.deprecate = function(fn, msg) {
+  // Allow for deprecating things in the process of starting up.
+  if (isUndefined(global.process)) {
+    return function() {
+      return exports.deprecate(fn, msg).apply(this, arguments);
+    };
+  }
+
+  if (process.noDeprecation === true) {
+    return fn;
+  }
+
+  var warned = false;
+  function deprecated() {
+    if (!warned) {
+      if (process.throwDeprecation) {
+        throw new Error(msg);
+      } else if (process.traceDeprecation) {
+        console.trace(msg);
+      } else {
+        console.error(msg);
+      }
+      warned = true;
+    }
+    return fn.apply(this, arguments);
+  }
+
+  return deprecated;
+};
+
+
+var debugs = {};
+var debugEnviron;
+exports.debuglog = function(set) {
+  if (isUndefined(debugEnviron))
+    debugEnviron = process.env.NODE_DEBUG || '';
+  set = set.toUpperCase();
+  if (!debugs[set]) {
+    if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) {
+      var pid = process.pid;
+      debugs[set] = function() {
+        var msg = exports.format.apply(exports, arguments);
+        console.error('%s %d: %s', set, pid, msg);
+      };
+    } else {
+      debugs[set] = function() {};
+    }
+  }
+  return debugs[set];
+};
+
+
+/**
+ * Echos the value of a value. Trys to print the value out
+ * in the best way possible given the different types.
+ *
+ * @param {Object} obj The object to print out.
+ * @param {Object} opts Optional options object that alters the output.
+ */
+/* legacy: obj, showHidden, depth, colors*/
+function inspect(obj, opts) {
+  // default options
+  var ctx = {
+    seen: [],
+    stylize: stylizeNoColor
+  };
+  // legacy...
+  if (arguments.length >= 3) ctx.depth = arguments[2];
+  if (arguments.length >= 4) ctx.colors = arguments[3];
+  if (isBoolean(opts)) {
+    // legacy...
+    ctx.showHidden = opts;
+  } else if (opts) {
+    // got an "options" object
+    exports._extend(ctx, opts);
+  }
+  // set default options
+  if (isUndefined(ctx.showHidden)) ctx.showHidden = false;
+  if (isUndefined(ctx.depth)) ctx.depth = 2;
+  if (isUndefined(ctx.colors)) ctx.colors = false;
+  if (isUndefined(ctx.customInspect)) ctx.customInspect = true;
+  if (ctx.colors) ctx.stylize = stylizeWithColor;
+  return formatValue(ctx, obj, ctx.depth);
+}
+exports.inspect = inspect;
+
+
+// http://en.wikipedia.org/wiki/ANSI_escape_code#graphics
+inspect.colors = {
+  'bold' : [1, 22],
+  'italic' : [3, 23],
+  'underline' : [4, 24],
+  'inverse' : [7, 27],
+  'white' : [37, 39],
+  'grey' : [90, 39],
+  'black' : [30, 39],
+  'blue' : [34, 39],
+  'cyan' : [36, 39],
+  'green' : [32, 39],
+  'magenta' : [35, 39],
+  'red' : [31, 39],
+  'yellow' : [33, 39]
+};
+
+// Don't use 'blue' not visible on cmd.exe
+inspect.styles = {
+  'special': 'cyan',
+  'number': 'yellow',
+  'boolean': 'yellow',
+  'undefined': 'grey',
+  'null': 'bold',
+  'string': 'green',
+  'date': 'magenta',
+  // "name": intentionally not styling
+  'regexp': 'red'
+};
+
+
+function stylizeWithColor(str, styleType) {
+  var style = inspect.styles[styleType];
+
+  if (style) {
+    return '\u001b[' + inspect.colors[style][0] + 'm' + str +
+           '\u001b[' + inspect.colors[style][1] + 'm';
+  } else {
+    return str;
+  }
+}
+
+
+function stylizeNoColor(str, styleType) {
+  return str;
+}
+
+
+function arrayToHash(array) {
+  var hash = {};
+
+  array.forEach(function(val, idx) {
+    hash[val] = true;
+  });
+
+  return hash;
+}
+
+
+function formatValue(ctx, value, recurseTimes) {
+  // Provide a hook for user-specified inspect functions.
+  // Check that value is an object with an inspect function on it
+  if (ctx.customInspect &&
+      value &&
+      isFunction(value.inspect) &&
+      // Filter out the util module, it's inspect function is special
+      value.inspect !== exports.inspect &&
+      // Also filter out any prototype objects using the circular check.
+      !(value.constructor && value.constructor.prototype === value)) {
+    var ret = value.inspect(recurseTimes, ctx);
+    if (!isString(ret)) {
+      ret = formatValue(ctx, ret, recurseTimes);
+    }
+    return ret;
+  }
+
+  // Primitive types cannot have properties
+  var primitive = formatPrimitive(ctx, value);
+  if (primitive) {
+    return primitive;
+  }
+
+  // Look up the keys of the object.
+  var keys = Object.keys(value);
+  var visibleKeys = arrayToHash(keys);
+
+  if (ctx.showHidden) {
+    keys = Object.getOwnPropertyNames(value);
+  }
+
+  // IE doesn't make error fields non-enumerable
+  // http://msdn.microsoft.com/en-us/library/ie/dww52sbt(v=vs.94).aspx
+  if (isError(value)
+      && (keys.indexOf('message') >= 0 || keys.indexOf('description') >= 0)) {
+    return formatError(value);
+  }
+
+  // Some type of object without properties can be shortcutted.
+  if (keys.length === 0) {
+    if (isFunction(value)) {
+      var name = value.name ? ': ' + value.name : '';
+      return ctx.stylize('[Function' + name + ']', 'special');
+    }
+    if (isRegExp(value)) {
+      return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp');
+    }
+    if (isDate(value)) {
+      return ctx.stylize(Date.prototype.toString.call(value), 'date');
+    }
+    if (isError(value)) {
+      return formatError(value);
+    }
+  }
+
+  var base = '', array = false, braces = ['{', '}'];
+
+  // Make Array say that they are Array
+  if (isArray(value)) {
+    array = true;
+    braces = ['[', ']'];
+  }
+
+  // Make functions say that they are functions
+  if (isFunction(value)) {
+    var n = value.name ? ': ' + value.name : '';
+    base = ' [Function' + n + ']';
+  }
+
+  // Make RegExps say that they are RegExps
+  if (isRegExp(value)) {
+    base = ' ' + RegExp.prototype.toString.call(value);
+  }
+
+  // Make dates with properties first say the date
+  if (isDate(value)) {
+    base = ' ' + Date.prototype.toUTCString.call(value);
+  }
+
+  // Make error with message first say the error
+  if (isError(value)) {
+    base = ' ' + formatError(value);
+  }
+
+  if (keys.length === 0 && (!array || value.length == 0)) {
+    return braces[0] + base + braces[1];
+  }
+
+  if (recurseTimes < 0) {
+    if (isRegExp(value)) {
+      return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp');
+    } else {
+      return ctx.stylize('[Object]', 'special');
+    }
+  }
+
+  ctx.seen.push(value);
+
+  var output;
+  if (array) {
+    output = formatArray(ctx, value, recurseTimes, visibleKeys, keys);
+  } else {
+    output = keys.map(function(key) {
+      return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array);
+    });
+  }
+
+  ctx.seen.pop();
+
+  return reduceToSingleString(output, base, braces);
+}
+
+
+function formatPrimitive(ctx, value) {
+  if (isUndefined(value))
+    return ctx.stylize('undefined', 'undefined');
+  if (isString(value)) {
+    var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '')
+                                             .replace(/'/g, "\\'")
+                                             .replace(/\\"/g, '"') + '\'';
+    return ctx.stylize(simple, 'string');
+  }
+  if (isNumber(value))
+    return ctx.stylize('' + value, 'number');
+  if (isBoolean(value))
+    return ctx.stylize('' + value, 'boolean');
+  // For some reason typeof null is "object", so special case here.
+  if (isNull(value))
+    return ctx.stylize('null', 'null');
+}
+
+
+function formatError(value) {
+  return '[' + Error.prototype.toString.call(value) + ']';
+}
+
+
+function formatArray(ctx, value, recurseTimes, visibleKeys, keys) {
+  var output = [];
+  for (var i = 0, l = value.length; i < l; ++i) {
+    if (hasOwnProperty(value, String(i))) {
+      output.push(formatProperty(ctx, value, recurseTimes, visibleKeys,
+          String(i), true));
+    } else {
+      output.push('');
+    }
+  }
+  keys.forEach(function(key) {
+    if (!key.match(/^\d+$/)) {
+      output.push(formatProperty(ctx, value, recurseTimes, visibleKeys,
+          key, true));
+    }
+  });
+  return output;
+}
+
+
+function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) {
+  var name, str, desc;
+  desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] };
+  if (desc.get) {
+    if (desc.set) {
+      str = ctx.stylize('[Getter/Setter]', 'special');
+    } else {
+      str = ctx.stylize('[Getter]', 'special');
+    }
+  } else {
+    if (desc.set) {
+      str = ctx.stylize('[Setter]', 'special');
+    }
+  }
+  if (!hasOwnProperty(visibleKeys, key)) {
+    name = '[' + key + ']';
+  }
+  if (!str) {
+    if (ctx.seen.indexOf(desc.value) < 0) {
+      if (isNull(recurseTimes)) {
+        str = formatValue(ctx, desc.value, null);
+      } else {
+        str = formatValue(ctx, desc.value, recurseTimes - 1);
+      }
+      if (str.indexOf('\n') > -1) {
+        if (array) {
+          str = str.split('\n').map(function(line) {
+            return '  ' + line;
+          }).join('\n').substr(2);
+        } else {
+          str = '\n' + str.split('\n').map(function(line) {
+            return '   ' + line;
+          }).join('\n');
+        }
+      }
+    } else {
+      str = ctx.stylize('[Circular]', 'special');
+    }
+  }
+  if (isUndefined(name)) {
+    if (array && key.match(/^\d+$/)) {
+      return str;
+    }
+    name = JSON.stringify('' + key);
+    if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) {
+      name = name.substr(1, name.length - 2);
+      name = ctx.stylize(name, 'name');
+    } else {
+      name = name.replace(/'/g, "\\'")
+                 .replace(/\\"/g, '"')
+                 .replace(/(^"|"$)/g, "'");
+      name = ctx.stylize(name, 'string');
+    }
+  }
+
+  return name + ': ' + str;
+}
+
+
+function reduceToSingleString(output, base, braces) {
+  var numLinesEst = 0;
+  var length = output.reduce(function(prev, cur) {
+    numLinesEst++;
+    if (cur.indexOf('\n') >= 0) numLinesEst++;
+    return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1;
+  }, 0);
+
+  if (length > 60) {
+    return braces[0] +
+           (base === '' ? '' : base + '\n ') +
+           ' ' +
+           output.join(',\n  ') +
+           ' ' +
+           braces[1];
+  }
+
+  return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1];
+}
+
+
+// NOTE: These type checking functions intentionally don't use `instanceof`
+// because it is fragile and can be easily faked with `Object.create()`.
+function isArray(ar) {
+  return Array.isArray(ar);
+}
+exports.isArray = isArray;
+
+function isBoolean(arg) {
+  return typeof arg === 'boolean';
+}
+exports.isBoolean = isBoolean;
+
+function isNull(arg) {
+  return arg === null;
+}
+exports.isNull = isNull;
+
+function isNullOrUndefined(arg) {
+  return arg == null;
+}
+exports.isNullOrUndefined = isNullOrUndefined;
+
+function isNumber(arg) {
+  return typeof arg === 'number';
+}
+exports.isNumber = isNumber;
+
+function isString(arg) {
+  return typeof arg === 'string';
+}
+exports.isString = isString;
+
+function isSymbol(arg) {
+  return typeof arg === 'symbol';
+}
+exports.isSymbol = isSymbol;
+
+function isUndefined(arg) {
+  return arg === void 0;
+}
+exports.isUndefined = isUndefined;
+
+function isRegExp(re) {
+  return isObject(re) && objectToString(re) === '[object RegExp]';
+}
+exports.isRegExp = isRegExp;
+
+function isObject(arg) {
+  return typeof arg === 'object' && arg !== null;
+}
+exports.isObject = isObject;
+
+function isDate(d) {
+  return isObject(d) && objectToString(d) === '[object Date]';
+}
+exports.isDate = isDate;
+
+function isError(e) {
+  return isObject(e) &&
+      (objectToString(e) === '[object Error]' || e instanceof Error);
+}
+exports.isError = isError;
+
+function isFunction(arg) {
+  return typeof arg === 'function';
+}
+exports.isFunction = isFunction;
+
+function isPrimitive(arg) {
+  return arg === null ||
+         typeof arg === 'boolean' ||
+         typeof arg === 'number' ||
+         typeof arg === 'string' ||
+         typeof arg === 'symbol' ||  // ES6 symbol
+         typeof arg === 'undefined';
+}
+exports.isPrimitive = isPrimitive;
+
+exports.isBuffer = require('./support/isBuffer');
+
+function objectToString(o) {
+  return Object.prototype.toString.call(o);
+}
+
+
+function pad(n) {
+  return n < 10 ? '0' + n.toString(10) : n.toString(10);
+}
+
+
+var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep',
+              'Oct', 'Nov', 'Dec'];
+
+// 26 Feb 16:19:34
+function timestamp() {
+  var d = new Date();
+  var time = [pad(d.getHours()),
+              pad(d.getMinutes()),
+              pad(d.getSeconds())].join(':');
+  return [d.getDate(), months[d.getMonth()], time].join(' ');
+}
+
+
+// log is just a thin wrapper to console.log that prepends a timestamp
+exports.log = function() {
+  console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments));
+};
+
+
+/**
+ * Inherit the prototype methods from one constructor into another.
+ *
+ * The Function.prototype.inherits from lang.js rewritten as a standalone
+ * function (not on Function.prototype). NOTE: If this file is to be loaded
+ * during bootstrapping this function needs to be rewritten using some native
+ * functions as prototype setup using normal JavaScript does not work as
+ * expected during bootstrapping (see mirror.js in r114903).
+ *
+ * @param {function} ctor Constructor function which needs to inherit the
+ *     prototype.
+ * @param {function} superCtor Constructor function to inherit prototype from.
+ */
+exports.inherits = require('inherits');
+
+exports._extend = function(origin, add) {
+  // Don't do anything if add isn't an object
+  if (!add || !isObject(add)) return origin;
+
+  var keys = Object.keys(add);
+  var i = keys.length;
+  while (i--) {
+    origin[keys[i]] = add[keys[i]];
+  }
+  return origin;
+};
+
+function hasOwnProperty(obj, prop) {
+  return Object.prototype.hasOwnProperty.call(obj, prop);
+}
+
+}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {})
+},{"./support/isBuffer":88,"_process":69,"inherits":56}],90:[function(require,module,exports){
+module.exports={
+  "name": "mocha",
+  "version": "6.2.0",
+  "homepage": "https://mochajs.org/",
+  "notifyLogo": "https://ibin.co/4QuRuGjXvl36.png"
+}
+},{}]},{},[1]);
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/LICENSE b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/LICENSE
new file mode 100644
index 00000000000..8749cc754e5
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015-present, Brian Woodward.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/README.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/README.md
new file mode 100644
index 00000000000..49916771592
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/README.md
@@ -0,0 +1,274 @@
+# ansi-colors [![NPM version](https://img.shields.io/npm/v/ansi-colors.svg?style=flat)](https://www.npmjs.com/package/ansi-colors) [![NPM monthly downloads](https://img.shields.io/npm/dm/ansi-colors.svg?style=flat)](https://npmjs.org/package/ansi-colors) [![NPM total downloads](https://img.shields.io/npm/dt/ansi-colors.svg?style=flat)](https://npmjs.org/package/ansi-colors) [![Linux Build Status](https://img.shields.io/travis/doowb/ansi-colors.svg?style=flat&label=Travis)](https://travis-ci.org/doowb/ansi-colors) [![Windows Build Status](https://img.shields.io/appveyor/ci/doowb/ansi-colors.svg?style=flat&label=AppVeyor)](https://ci.appveyor.com/project/doowb/ansi-colors)
+
+> Easily add ANSI colors to your text and symbols in the terminal. A faster drop-in replacement for chalk, kleur and turbocolor (without the dependencies and rendering bugs).
+
+Please consider following this project's author, [Brian Woodward](https://github.com/doowb), and consider starring the project to show your :heart: and support.
+
+## Install
+
+Install with [npm](https://www.npmjs.com/):
+
+```sh
+$ npm install --save ansi-colors
+```
+
+![image](https://user-images.githubusercontent.com/383994/39635445-8a98a3a6-4f8b-11e8-89c1-068c45d4fff8.png)
+
+## Why use this?
+
+ansi-colors is _the fastest Node.js library for terminal styling_. A more performant drop-in replacement for chalk, with no dependencies.
+
+* _Blazing fast_ - Fastest terminal styling library in node.js, 10-20x faster than chalk!
+
+* _Drop-in replacement_ for [chalk](https://github.com/chalk/chalk).
+* _No dependencies_ (Chalk has 7 dependencies in its tree!)
+
+* _Safe_ - Does not modify the `String.prototype` like [colors](https://github.com/Marak/colors.js).
+* Supports [nested colors](#nested-colors), **and does not have the [nested styling bug](#nested-styling-bug) that is present in [colorette](https://github.com/jorgebucaran/colorette), [chalk](https://github.com/chalk/chalk), and [kleur](https://github.com/lukeed/kleur)**.
+* Supports [chained colors](#chained-colors).
+* [Toggle color support](#toggle-color-support) on or off.
+
+## Usage
+
+```js
+const c = require('ansi-colors');
+
+console.log(c.red('This is a red string!'));
+console.log(c.green('This is a red string!'));
+console.log(c.cyan('This is a cyan string!'));
+console.log(c.yellow('This is a yellow string!'));
+```
+
+![image](https://user-images.githubusercontent.com/383994/39653848-a38e67da-4fc0-11e8-89ae-98c65ebe9dcf.png)
+
+## Chained colors
+
+```js
+console.log(c.bold.red('this is a bold red message'));
+console.log(c.bold.yellow.italic('this is a bold yellow italicized message'));
+console.log(c.green.bold.underline('this is a bold green underlined message'));
+```
+
+![image](https://user-images.githubusercontent.com/383994/39635780-7617246a-4f8c-11e8-89e9-05216cc54e38.png)
+
+## Nested colors
+
+```js
+console.log(c.yellow(`foo ${c.red.bold('red')} bar ${c.cyan('cyan')} baz`));
+```
+
+![image](https://user-images.githubusercontent.com/383994/39635817-8ed93d44-4f8c-11e8-8afd-8c3ea35f5fbe.png)
+
+### Nested styling bug
+
+`ansi-colors` does not have the nested styling bug found in [colorette](https://github.com/jorgebucaran/colorette), [chalk](https://github.com/chalk/chalk), and [kleur](https://github.com/lukeed/kleur).
+
+```js
+const { bold, red } = require('ansi-styles');
+console.log(bold(`foo ${red.dim('bar')} baz`));
+
+const colorette = require('colorette');
+console.log(colorette.bold(`foo ${colorette.red(colorette.dim('bar'))} baz`));
+
+const kleur = require('kleur');
+console.log(kleur.bold(`foo ${kleur.red.dim('bar')} baz`));
+
+const chalk = require('chalk');
+console.log(chalk.bold(`foo ${chalk.red.dim('bar')} baz`));
+```
+
+**Results in the following**
+
+(sans icons and labels)
+
+![image](https://user-images.githubusercontent.com/383994/47280326-d2ee0580-d5a3-11e8-9611-ea6010f0a253.png)
+
+## Toggle color support
+
+Easily enable/disable colors.
+
+```js
+const c = require('ansi-colors');
+
+// disable colors manually
+c.enabled = false;
+
+// or use a library to automatically detect support
+c.enabled = require('color-support').hasBasic;
+
+console.log(c.red('I will only be colored red if the terminal supports colors'));
+```
+
+## Strip ANSI codes
+
+Use the `.unstyle` method to strip ANSI codes from a string.
+
+```js
+console.log(c.unstyle(c.blue.bold('foo bar baz')));
+//=> 'foo bar baz'
+```
+
+## Available styles
+
+**Note** that bright and bright-background colors are not always supported.
+
+| Colors  | Background Colors | Bright Colors | Bright Background Colors |
+| ------- | ----------------- | ------------- | ------------------------ |
+| black   | bgBlack           | blackBright   | bgBlackBright            |
+| red     | bgRed             | redBright     | bgRedBright              |
+| green   | bgGreen           | greenBright   | bgGreenBright            |
+| yellow  | bgYellow          | yellowBright  | bgYellowBright           |
+| blue    | bgBlue            | blueBright    | bgBlueBright             |
+| magenta | bgMagenta         | magentaBright | bgMagentaBright          |
+| cyan    | bgCyan            | cyanBright    | bgCyanBright             |
+| white   | bgWhite           | whiteBright   | bgWhiteBright            |
+| gray    |                   |               |                          |
+| grey    |                   |               |                          |
+
+_(`gray` is the U.S. spelling, `grey` is more commonly used in the Canada and U.K.)_
+
+### Style modifiers
+
+* dim
+* **bold**
+
+* hidden
+* _italic_
+
+* underline
+* inverse
+* ~~strikethrough~~
+
+* reset
+
+## Performance
+
+**Libraries tested**
+
+* ansi-colors v3.0.4
+* chalk v2.4.1
+
+### Mac
+
+> MacBook Pro, Intel Core i7, 2.3 GHz, 16 GB.
+
+**Load time**
+
+Time it takes to load the first time `require()` is called:
+
+* ansi-colors - `1.915ms`
+* chalk - `12.437ms`
+
+**Benchmarks**
+
+```
+# All Colors
+  ansi-colors x 173,851 ops/sec ±0.42% (91 runs sampled)
+  chalk x 9,944 ops/sec ±2.53% (81 runs sampled)))
+
+# Chained colors
+  ansi-colors x 20,791 ops/sec ±0.60% (88 runs sampled)
+  chalk x 2,111 ops/sec ±2.34% (83 runs sampled)
+
+# Nested colors
+  ansi-colors x 59,304 ops/sec ±0.98% (92 runs sampled)
+  chalk x 4,590 ops/sec ±2.08% (82 runs sampled)
+```
+
+### Windows
+
+> Windows 10, Intel Core i7-7700k CPU @ 4.2 GHz, 32 GB
+
+**Load time**
+
+Time it takes to load the first time `require()` is called:
+
+* ansi-colors - `1.494ms`
+* chalk - `11.523ms`
+
+**Benchmarks**
+
+```
+# All Colors
+  ansi-colors x 193,088 ops/sec ±0.51% (95 runs sampled))
+  chalk x 9,612 ops/sec ±3.31% (77 runs sampled)))
+
+# Chained colors
+  ansi-colors x 26,093 ops/sec ±1.13% (94 runs sampled)
+  chalk x 2,267 ops/sec ±2.88% (80 runs sampled))
+
+# Nested colors
+  ansi-colors x 67,747 ops/sec ±0.49% (93 runs sampled)
+  chalk x 4,446 ops/sec ±3.01% (82 runs sampled))
+```
+
+## About
+
+<details>
+<summary><strong>Contributing</strong></summary>
+
+Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new).
+
+</details>
+
+<details>
+<summary><strong>Running Tests</strong></summary>
+
+Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command:
+
+```sh
+$ npm install && npm test
+```
+
+</details>
+
+<details>
+<summary><strong>Building docs</strong></summary>
+
+_(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_
+
+To generate the readme, run the following command:
+
+```sh
+$ npm install -g verbose/verb#dev verb-generate-readme && verb
+```
+
+</details>
+
+### Related projects
+
+You might also be interested in these projects:
+
+* [ansi-wrap](https://www.npmjs.com/package/ansi-wrap): Create ansi colors by passing the open and close codes. | [homepage](https://github.com/jonschlinkert/ansi-wrap "Create ansi colors by passing the open and close codes.")
+* [strip-color](https://www.npmjs.com/package/strip-color): Strip ANSI color codes from a string. No dependencies. | [homepage](https://github.com/jonschlinkert/strip-color "Strip ANSI color codes from a string. No dependencies.")
+
+### Contributors
+
+| **Commits** | **Contributor** |  
+| --- | --- |  
+| 38 | [jonschlinkert](https://github.com/jonschlinkert) |  
+| 38 | [doowb](https://github.com/doowb) |  
+| 6  | [lukeed](https://github.com/lukeed) |  
+| 2  | [Silic0nS0ldier](https://github.com/Silic0nS0ldier) |  
+| 1  | [dwieeb](https://github.com/dwieeb) |  
+| 1  | [jorgebucaran](https://github.com/jorgebucaran) |  
+| 1  | [madhavarshney](https://github.com/madhavarshney) |  
+| 1  | [Weishi93](https://github.com/Weishi93) |  
+| 1  | [chapterjason](https://github.com/chapterjason) |  
+
+### Author
+
+**Brian Woodward**
+
+* [GitHub Profile](https://github.com/doowb)
+* [Twitter Profile](https://twitter.com/doowb)
+* [LinkedIn Profile](https://linkedin.com/in/woodwardbrian)
+
+### License
+
+Copyright © 2018, [Brian Woodward](https://github.com/doowb).
+Released under the [MIT License](LICENSE).
+
+***
+
+_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.8.0, on December 03, 2018._
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/index.js
new file mode 100644
index 00000000000..4e8ed08abc5
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/index.js
@@ -0,0 +1,114 @@
+'use strict';
+
+const colors = { enabled: true, visible: true, styles: {}, keys: {} };
+
+if ('FORCE_COLOR' in process.env) {
+  colors.enabled = process.env.FORCE_COLOR !== '0';
+}
+
+const ansi = style => {
+  style.open = `\u001b[${style.codes[0]}m`;
+  style.close = `\u001b[${style.codes[1]}m`;
+  style.regex = new RegExp(`\\u001b\\[${style.codes[1]}m`, 'g');
+  return style;
+};
+
+const wrap = (style, str, nl) => {
+  let { open, close, regex } = style;
+  str = open + (str.includes(close) ? str.replace(regex, close + open) : str) + close;
+  // see https://github.com/chalk/chalk/pull/92, thanks to the
+  // chalk contributors for this fix. However, we've confirmed that
+  // this issue is also present in Windows terminals
+  return nl ? str.replace(/\r?\n/g, `${close}$&${open}`) : str;
+};
+
+const style = (input, stack) => {
+  if (input === '' || input == null) return '';
+  if (colors.enabled === false) return input;
+  if (colors.visible === false) return '';
+  let str = '' + input;
+  let nl = str.includes('\n');
+  let n = stack.length;
+  while (n-- > 0) str = wrap(colors.styles[stack[n]], str, nl);
+  return str;
+};
+
+const define = (name, codes, type) => {
+  colors.styles[name] = ansi({ name, codes });
+  let t = colors.keys[type] || (colors.keys[type] = []);
+  t.push(name);
+
+  Reflect.defineProperty(colors, name, {
+    get() {
+      let color = input => style(input, color.stack);
+      Reflect.setPrototypeOf(color, colors);
+      color.stack = this.stack ? this.stack.concat(name) : [name];
+      return color;
+    }
+  });
+};
+
+define('reset', [0, 0], 'modifier');
+define('bold', [1, 22], 'modifier');
+define('dim', [2, 22], 'modifier');
+define('italic', [3, 23], 'modifier');
+define('underline', [4, 24], 'modifier');
+define('inverse', [7, 27], 'modifier');
+define('hidden', [8, 28], 'modifier');
+define('strikethrough', [9, 29], 'modifier');
+
+define('black', [30, 39], 'color');
+define('red', [31, 39], 'color');
+define('green', [32, 39], 'color');
+define('yellow', [33, 39], 'color');
+define('blue', [34, 39], 'color');
+define('magenta', [35, 39], 'color');
+define('cyan', [36, 39], 'color');
+define('white', [37, 39], 'color');
+define('gray', [90, 39], 'color');
+define('grey', [90, 39], 'color');
+
+define('bgBlack', [40, 49], 'bg');
+define('bgRed', [41, 49], 'bg');
+define('bgGreen', [42, 49], 'bg');
+define('bgYellow', [43, 49], 'bg');
+define('bgBlue', [44, 49], 'bg');
+define('bgMagenta', [45, 49], 'bg');
+define('bgCyan', [46, 49], 'bg');
+define('bgWhite', [47, 49], 'bg');
+
+define('blackBright', [90, 39], 'bright');
+define('redBright', [91, 39], 'bright');
+define('greenBright', [92, 39], 'bright');
+define('yellowBright', [93, 39], 'bright');
+define('blueBright', [94, 39], 'bright');
+define('magentaBright', [95, 39], 'bright');
+define('cyanBright', [96, 39], 'bright');
+define('whiteBright', [97, 39], 'bright');
+
+define('bgBlackBright', [100, 49], 'bgBright');
+define('bgRedBright', [101, 49], 'bgBright');
+define('bgGreenBright', [102, 49], 'bgBright');
+define('bgYellowBright', [103, 49], 'bgBright');
+define('bgBlueBright', [104, 49], 'bgBright');
+define('bgMagentaBright', [105, 49], 'bgBright');
+define('bgCyanBright', [106, 49], 'bgBright');
+define('bgWhiteBright', [107, 49], 'bgBright');
+
+/* eslint-disable no-control-regex */
+const re = colors.ansiRegex = /\u001b\[\d+m/gm;
+colors.hasColor = colors.hasAnsi = str => {
+  re.lastIndex = 0;
+  return !!str && typeof str === 'string' && re.test(str);
+};
+
+colors.unstyle = str => {
+  re.lastIndex = 0;
+  return typeof str === 'string' ? str.replace(re, '') : str;
+};
+
+colors.none = colors.clear = colors.noop = str => str; // no-op, for programmatic usage
+colors.stripColor = colors.unstyle;
+colors.symbols = require('./symbols');
+colors.define = define;
+module.exports = colors;
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/package.json b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/package.json
new file mode 100644
index 00000000000..1e6cf9260e4
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/package.json
@@ -0,0 +1,109 @@
+{
+  "author": "Brian Woodward (https://github.com/doowb)", 
+  "bugs": {
+    "url": "https://github.com/doowb/ansi-colors/issues"
+  }, 
+  "contributors": [
+    "Brian Woodward (https://twitter.com/doowb)", 
+    "Jason Schilling (https://sourecode.de)", 
+    "Jon Schlinkert (http://twitter.com/jonschlinkert)", 
+    "Jordan (https://github.com/Silic0nS0ldier)"
+  ], 
+  "description": "Easily add ANSI colors to your text and symbols in the terminal. A faster drop-in replacement for chalk, kleur and turbocolor (without the dependencies and rendering bugs).", 
+  "devDependencies": {
+    "decache": "^4.4.0", 
+    "gulp-format-md": "^1.0.0", 
+    "justified": "^1.0.1", 
+    "mocha": "^5.2.0", 
+    "text-table": "^0.2.0"
+  }, 
+  "engines": {
+    "node": ">=6"
+  }, 
+  "files": [
+    "index.js", 
+    "symbols.js", 
+    "types/index.d.ts"
+  ], 
+  "homepage": "https://github.com/doowb/ansi-colors", 
+  "keywords": [
+    "ansi", 
+    "bgblack", 
+    "bgBlack", 
+    "bgblue", 
+    "bgBlue", 
+    "bgcyan", 
+    "bgCyan", 
+    "bggreen", 
+    "bgGreen", 
+    "bgmagenta", 
+    "bgMagenta", 
+    "bgred", 
+    "bgRed", 
+    "bgwhite", 
+    "bgWhite", 
+    "bgyellow", 
+    "bgYellow", 
+    "black", 
+    "blue", 
+    "bold", 
+    "clorox", 
+    "colors", 
+    "cyan", 
+    "dim", 
+    "gray", 
+    "green", 
+    "grey", 
+    "hidden", 
+    "inverse", 
+    "italic", 
+    "kleur", 
+    "magenta", 
+    "red", 
+    "reset", 
+    "strikethrough", 
+    "underline", 
+    "white", 
+    "yellow"
+  ], 
+  "license": "MIT", 
+  "main": "index.js", 
+  "name": "ansi-colors", 
+  "repository": "doowb/ansi-colors", 
+  "scripts": {
+    "test": "mocha"
+  }, 
+  "types": "./types/index.d.ts", 
+  "verb": {
+    "data": {
+      "author": {
+        "linkedin": "woodwardbrian", 
+        "twitter": "doowb"
+      }
+    }, 
+    "layout": "default", 
+    "lint": {
+      "reflinks": true
+    }, 
+    "plugins": [
+      "gulp-format-md"
+    ], 
+    "reflinks": [
+      "chalk", 
+      "colorette", 
+      "colors", 
+      "kleur"
+    ], 
+    "related": {
+      "list": [
+        "ansi-wrap", 
+        "strip-color"
+      ]
+    }, 
+    "tasks": [
+      "readme"
+    ], 
+    "toc": false
+  }, 
+  "version": "3.2.3"
+}
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/symbols.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/symbols.js
new file mode 100644
index 00000000000..9643d8d0ad3
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/symbols.js
@@ -0,0 +1,46 @@
+'use strict';
+
+const isWindows = process.platform === 'win32';
+const isLinux = process.platform === 'linux';
+
+const windows = {
+  bullet: '•',
+  check: '√',
+  cross: '×',
+  ellipsis: '...',
+  heart: '❤',
+  info: 'i',
+  line: '─',
+  middot: '·',
+  minus: '－',
+  plus: '＋',
+  question: '?',
+  questionSmall: '﹖',
+  pointer: '>',
+  pointerSmall: '»',
+  warning: '‼'
+};
+
+const other = {
+  ballotCross: '✘',
+  bullet: '•',
+  check: '✔',
+  cross: '✖',
+  ellipsis: '…',
+  heart: '❤',
+  info: 'ℹ',
+  line: '─',
+  middot: '·',
+  minus: '－',
+  plus: '＋',
+  question: '?',
+  questionFull: '？',
+  questionSmall: '﹖',
+  pointer: isLinux ? '▸' : '❯',
+  pointerSmall: isLinux ? '‣' : '›',
+  warning: '⚠'
+};
+
+module.exports = isWindows ? windows : other;
+Reflect.defineProperty(module.exports, 'windows', { enumerable: false, value: windows });
+Reflect.defineProperty(module.exports, 'other', { enumerable: false, value: other });
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/types/index.d.ts b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/types/index.d.ts
new file mode 100644
index 00000000000..ca2d24acb12
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ansi-colors/types/index.d.ts
@@ -0,0 +1,161 @@
+// Imported from DefinitelyTyped project.
+// TypeScript definitions for ansi-colors
+// Definitions by: Rogier Schouten <https://github.com/rogierschouten>
+// Integrated by: Jordan Mele <https://github.com/Silic0nS0ldier>
+
+interface SymbolsType {
+  check: string;
+  cross: string;
+  info: string;
+  line: string;
+  pointer: string;
+  pointerSmall: string;
+  question: string;
+  warning: string;
+}
+
+type StyleArrayStructure = [number, number];
+interface StyleArrayProperties {
+  open: string;
+  close: string;
+  closeRe: string;
+}
+
+type StyleType = StyleArrayStructure & StyleArrayProperties;
+
+export interface StyleFunction extends StylesType<StyleFunction> {
+  (s: string): string;
+}
+
+interface StylesType<T> {
+  // modifiers
+  reset: T;
+  bold: T;
+  dim: T;
+  italic: T;
+  underline: T;
+  inverse: T;
+  hidden: T;
+  strikethrough: T;
+
+  // colors
+  black: T;
+  red: T;
+  green: T;
+  yellow: T;
+  blue: T;
+  magenta: T;
+  cyan: T;
+  white: T;
+  gray: T;
+  grey: T;
+
+  // bright colors
+  blackBright: T;
+  redBright: T;
+  greenBright: T;
+  yellowBright: T;
+  blueBright: T;
+  magentaBright: T;
+  cyanBright: T;
+  whiteBright: T;
+
+  // background colors
+  bgBlack: T;
+  bgRed: T;
+  bgGreen: T;
+  bgYellow: T;
+  bgBlue: T;
+  bgMagenta: T;
+  bgCyan: T;
+  bgWhite: T;
+
+  // bright background colors
+  bgBlackBright: T;
+  bgRedBright: T;
+  bgGreenBright: T;
+  bgYellowBright: T;
+  bgBlueBright: T;
+  bgMagentaBright: T;
+  bgCyanBright: T;
+  bgWhiteBright: T;
+}
+
+// modifiers
+export const reset: StyleFunction;
+export const bold: StyleFunction;
+export const dim: StyleFunction;
+export const italic: StyleFunction;
+export const underline: StyleFunction;
+export const inverse: StyleFunction;
+export const hidden: StyleFunction;
+export const strikethrough: StyleFunction;
+
+// colors
+export const black: StyleFunction;
+export const red: StyleFunction;
+export const green: StyleFunction;
+export const yellow: StyleFunction;
+export const blue: StyleFunction;
+export const magenta: StyleFunction;
+export const cyan: StyleFunction;
+export const white: StyleFunction;
+export const gray: StyleFunction;
+export const grey: StyleFunction;
+
+// bright colors
+export const blackBright: StyleFunction;
+export const redBright: StyleFunction;
+export const greenBright: StyleFunction;
+export const yellowBright: StyleFunction;
+export const blueBright: StyleFunction;
+export const magentaBright: StyleFunction;
+export const cyanBright: StyleFunction;
+export const whiteBright: StyleFunction;
+
+// background colors
+export const bgBlack: StyleFunction;
+export const bgRed: StyleFunction;
+export const bgGreen: StyleFunction;
+export const bgYellow: StyleFunction;
+export const bgBlue: StyleFunction;
+export const bgMagenta: StyleFunction;
+export const bgCyan: StyleFunction;
+export const bgWhite: StyleFunction;
+
+// bright background colors
+export const bgBlackBright: StyleFunction;
+export const bgRedBright: StyleFunction;
+export const bgGreenBright: StyleFunction;
+export const bgYellowBright: StyleFunction;
+export const bgBlueBright: StyleFunction;
+export const bgMagentaBright: StyleFunction;
+export const bgCyanBright: StyleFunction;
+export const bgWhiteBright: StyleFunction;
+
+export let enabled: boolean;
+export let visible: boolean;
+export const ansiRegex: RegExp;
+
+/**
+ * Remove styles from string
+ */
+export function stripColor(s: string): string;
+
+/**
+ * Remove styles from string
+ */
+export function strip(s: string): string;
+
+/**
+ * Remove styles from string
+ */
+export function unstyle(s: string): string;
+
+export const styles: StylesType<StyleType>;
+export const symbols: SymbolsType;
+
+/**
+ * Outputs a string with check-symbol as prefix
+ */
+export function ok(...args: string[]): string;
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/CHANGELOG.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/CHANGELOG.md
new file mode 100644
index 00000000000..820d21e3322
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/CHANGELOG.md
@@ -0,0 +1,395 @@
+
+3.1.0 / 2017-09-26
+==================
+
+  * Add `DEBUG_HIDE_DATE` env var (#486)
+  * Remove ReDoS regexp in %o formatter (#504)
+  * Remove "component" from package.json
+  * Remove `component.json`
+  * Ignore package-lock.json
+  * Examples: fix colors printout
+  * Fix: browser detection
+  * Fix: spelling mistake (#496, @EdwardBetts)
+
+3.0.1 / 2017-08-24
+==================
+
+  * Fix: Disable colors in Edge and Internet Explorer (#489)
+
+3.0.0 / 2017-08-08
+==================
+
+  * Breaking: Remove DEBUG_FD (#406)
+  * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
+  * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
+  * Addition: document `enabled` flag (#465)
+  * Addition: add 256 colors mode (#481)
+  * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
+  * Update: component: update "ms" to v2.0.0
+  * Update: separate the Node and Browser tests in Travis-CI
+  * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
+  * Update: separate Node.js and web browser examples for organization
+  * Update: update "browserify" to v14.4.0
+  * Fix: fix Readme typo (#473)
+
+2.6.9 / 2017-09-22
+==================
+
+  * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+  * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+  * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+  * Fix: Inline extend function in node implementation (#452, @dougwilson)
+  * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+  
+  * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+  * Misc: clean up browser reference checks (#447, @thebigredgeek)
+  * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+  * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+  * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+  * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+  * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+  * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+  * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+  * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+  * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+  * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+  * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+  * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+  * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+  * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+  * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+  * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+  * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+  * Docs: fixed README typo (#391, @lurch)
+  * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+  * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+  * Fix: wrong reference in bower file (@thebigredgeek)
+  * Fix: webworker compatibility (@thebigredgeek)
+  * Fix: output formatting issue (#388, @kribblo)
+  * Fix: babel-loader compatibility (#383, @escwald)
+  * Misc: removed built asset from repo and publications (@thebigredgeek)
+  * Misc: moved source files to /src (#378, @yamikuronue)
+  * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+  * Test: coveralls integration (#378, @yamikuronue)
+  * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+  * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+  * Fix: custom log function (#379, @hsiliev)
+  * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+  * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+  * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+  * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+  * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+  * Fix: browser colors (#367, @tootallnate)
+  * Misc: travis ci integration (@thebigredgeek)
+  * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+  * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+  * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+  * Fix: revert "handle regex special characters" (@tootallnate)
+  * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+  * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+  * Improvement: allow colors in workers (#335, @botverse)
+  * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+  * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+  * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+  * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+  * Fix: be super-safe in index.js as well (@TooTallNate)
+  * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+  * Fix: Added electron compatibility (#324, @paulcbetts)
+  * Improvement: Added performance optimizations (@tootallnate)
+  * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+  * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+  * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+  * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+  * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+  * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+  * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+  * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+  * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+  * Readme: fix USE_COLORS to DEBUG_COLORS
+  * Readme: Doc fixes for format string sugar (#269, @mlucool)
+  * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+  * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+  * Readme: better docs for browser support (#224, @matthewmueller)
+  * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+  * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+  * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+  * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+  * package: update "ms" to v0.7.1 (#202, @dougwilson)
+  * README: add logging to file example (#193, @DanielOchoa)
+  * README: fixed a typo (#191, @amir-s)
+  * browser: expose `storage` (#190, @stephenmathieson)
+  * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+  * Updated stdout/stderr example (#186)
+  * Updated example/stdout.js to match debug current behaviour
+  * Renamed example/stderr.js to stdout.js
+  * Update Readme.md (#184)
+  * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+  * dist: recompile
+  * update "ms" to v0.7.0
+  * package: update "browserify" to v9.0.3
+  * component: fix "ms.js" repo location
+  * changed bower package name
+  * updated documentation about using debug in a browser
+  * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+  * browser: use `typeof` to check for `console` existence
+  * browser: check for `console.log` truthiness (fix IE 8/9)
+  * browser: add support for Chrome apps
+  * Readme: added Windows usage remarks
+  * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+  * node: implement `DEBUG_FD` env variable support
+  * package: update "browserify" to v6.1.0
+  * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+  * package: update "browserify" to v5.11.0
+  * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+  * dist: recompile
+  * example: remove `console.info()` log usage
+  * example: add "Content-Type" UTF-8 header to browser example
+  * browser: place %c marker after the space character
+  * browser: reset the "content" color via `color: inherit`
+  * browser: add colors support for Firefox >= v31
+  * debug: prefer an instance `log()` function over the global one (#119)
+  * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+  * Add support for multiple wildcards in namespaces (#122, @seegno)
+  * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+  * browser: update color palette (#113, @gscottolson)
+  * common: make console logging function configurable (#108, @timoxley)
+  * node: fix %o colors on old node <= 0.8.x
+  * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+  * browser: use `removeItem()` to clear localStorage
+  * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+  * package: add "contributors" section
+  * node: fix comment typo
+  * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+  * make ms diff be global, not be scope
+  * debug: ignore empty strings in enable()
+  * node: make DEBUG_COLORS able to disable coloring
+  * *: export the `colors` array
+  * npmignore: don't publish the `dist` dir
+  * Makefile: refactor to use browserify
+  * package: add "browserify" as a dev dependency
+  * Readme: add Web Inspector Colors section
+  * node: reset terminal color for the debug content
+  * node: map "%o" to `util.inspect()`
+  * browser: map "%j" to `JSON.stringify()`
+  * debug: add custom "formatters"
+  * debug: use "ms" module for humanizing the diff
+  * Readme: add "bash" syntax highlighting
+  * browser: add Firebug color support
+  * browser: add colors for WebKit browsers
+  * node: apply log to `console`
+  * rewrite: abstract common logic for Node & browsers
+  * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+  * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+  * add `enable()` method for nodejs. Closes #27
+  * change from stderr to stdout
+  * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+  * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+  * fix: catch localStorage security error when cookies are blocked (Chrome)
+  * add debug(err) support. Closes #46
+  * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+  * fix package.json
+  * fix: Mobile Safari (private mode) is broken with debug
+  * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+  * add repository URL to package.json
+  * add DEBUG_COLORED to force colored output
+  * add browserify support
+  * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+  * Added .component to package.json
+  * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+  * Added support for "-" prefix in DEBUG [Vinay Pulim]
+  * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+  * Added: humanize diffs. Closes #8
+  * Added `debug.disable()` to the CS variant
+  * Removed padding. Closes #10
+  * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+  * Added browser variant support for older browsers [TooTallNate]
+  * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+  * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+  * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+  * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+  * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+  * Initial release
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/LICENSE b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/LICENSE
new file mode 100644
index 00000000000..658c933d282
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/LICENSE
@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software 
+and associated documentation files (the 'Software'), to deal in the Software without restriction, 
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, 
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial 
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT 
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. 
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, 
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE 
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/README.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/README.md
new file mode 100644
index 00000000000..0ee7634ddd0
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/README.md
@@ -0,0 +1,437 @@
+# debug
+[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug)  [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master)  [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
+[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+A tiny JavaScript debugging utility modelled after Node.js core's debugging
+technique. Works in Node.js and web browsers.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example [_app.js_](./examples/node/app.js):
+
+```js
+var debug = require('debug')('http')
+  , http = require('http')
+  , name = 'My App';
+
+// fake app
+
+debug('booting %o', name);
+
+http.createServer(function(req, res){
+  debug(req.method + ' ' + req.url);
+  res.end('hello\n');
+}).listen(3000, function(){
+  debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example [_worker.js_](./examples/node/worker.js):
+
+```js
+var a = require('debug')('worker:a')
+  , b = require('debug')('worker:b');
+
+function work() {
+  a('doing lots of uninteresting work');
+  setTimeout(work, Math.random() * 1000);
+}
+
+work();
+
+function workb() {
+  b('doing some work');
+  setTimeout(workb, Math.random() * 2000);
+}
+
+workb();
+```
+
+The `DEBUG` environment variable is then used to enable these based on space or
+comma-delimited names.
+
+Here are some examples:
+
+<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
+<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
+
+#### Windows command prompt notes
+
+##### CMD
+
+On Windows the environment variable is set using the `set` command.
+
+```cmd
+set DEBUG=*,-not_this
+```
+
+Example:
+
+```cmd
+set DEBUG=* & node app.js
+```
+
+##### PowerShell (VS Code default)
+
+PowerShell uses different syntax to set environment variables.
+
+```cmd
+$env:DEBUG = "*,-not_this"
+```
+
+Example:
+
+```cmd
+$env:DEBUG='app';node app.js
+```
+
+Then, run the program to be debugged as usual.
+
+npm script example:
+```js
+  "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
+```
+
+## Namespace Colors
+
+Every debug instance has a color generated for it based on its namespace name.
+This helps when visually parsing the debug output to identify which debug instance
+a debug line belongs to.
+
+#### Node.js
+
+In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
+the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
+otherwise debug will only use a small handful of basic colors.
+
+<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
+
+#### Web Browser
+
+Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+option. These are WebKit web inspectors, Firefox ([since version
+31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+and the Firebug plugin for Firefox (any version).
+
+<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
+
+
+## Millisecond diff
+
+When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
+
+When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
+
+<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
+
+
+## Conventions
+
+If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".  If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable.  You can then use it for normal output as well as debug output.
+
+## Wildcards
+
+The `*` character may be used as a wildcard. Suppose for example your library has
+debuggers named "connect:bodyParser", "connect:compress", "connect:session",
+instead of listing all three with
+`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
+`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+You can also exclude specific debuggers by prefixing them with a "-" character.
+For example, `DEBUG=*,-connect:*` would include all debuggers except those
+starting with "connect:".
+
+## Environment Variables
+
+When running through Node.js, you can set a few environment variables that will
+change the behavior of the debug logging:
+
+| Name      | Purpose                                         |
+|-----------|-------------------------------------------------|
+| `DEBUG`   | Enables/disables specific debugging namespaces. |
+| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY).  |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth.                    |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+__Note:__ The environment variables beginning with `DEBUG_` end up being
+converted into an Options object that gets used with `%o`/`%O` formatters.
+See the Node.js documentation for
+[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+for the complete list.
+
+## Formatters
+
+Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
+Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O`      | Pretty-print an Object on multiple lines. |
+| `%o`      | Pretty-print an Object all on a single line. |
+| `%s`      | String. |
+| `%d`      | Number (both integer and float). |
+| `%j`      | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%`      | Single percent sign ('%'). This does not consume an argument. |
+
+
+### Custom formatters
+
+You can add custom formatters by extending the `debug.formatters` object.
+For example, if you wanted to add support for rendering a Buffer as hex with
+`%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+  return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+//   foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+
+## Browser Support
+
+You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+if you don't want to build it yourself.
+
+Debug's enable state is currently persisted by `localStorage`.
+Consider the situation shown below where you have `worker:a` and `worker:b`,
+and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+  a('doing some work');
+}, 1000);
+
+setInterval(function(){
+  b('doing some work');
+}, 1200);
+```
+
+
+## Output streams
+
+  By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example [_stdout.js_](./examples/node/stdout.js):
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Extend
+You can simply extend debugger 
+```js
+const log = require('debug')('auth');
+
+//creates new debug instance with extended namespace
+const logSign = log.extend('sign');
+const logLogin = log.extend('login');
+
+log('hello'); // auth hello
+logSign('hello'); //auth:sign hello
+logLogin('hello'); //auth:login hello
+```
+
+## Set dynamically
+
+You can also enable debug dynamically by calling the `enable()` method :
+
+```js
+let debug = require('debug');
+
+console.log(1, debug.enabled('test'));
+
+debug.enable('test');
+console.log(2, debug.enabled('test'));
+
+debug.disable();
+console.log(3, debug.enabled('test'));
+
+```
+
+print :   
+```
+1 false
+2 true
+3 false
+```
+
+Usage :  
+`enable(namespaces)`  
+`namespaces` can include modes separated by a colon and wildcards.
+   
+Note that calling `enable()` completely overrides previously set DEBUG variable : 
+
+```
+$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
+=> false
+```
+
+## Checking whether a debug target is enabled
+
+After you've created a debug instance, you can determine whether or not it is
+enabled by checking the `enabled` property:
+
+```javascript
+const debug = require('debug')('http');
+
+if (debug.enabled) {
+  // do stuff...
+}
+```
+
+You can also manually toggle this property to force the debug instance to be
+enabled or disabled.
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
+
+
+## Sponsors
+
+Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
+
+<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
+<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/dist/debug.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/dist/debug.js
new file mode 100644
index 00000000000..f271e01c86b
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/dist/debug.js
@@ -0,0 +1,886 @@
+"use strict";
+
+function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
+
+(function (f) {
+  if ((typeof exports === "undefined" ? "undefined" : _typeof(exports)) === "object" && typeof module !== "undefined") {
+    module.exports = f();
+  } else if (typeof define === "function" && define.amd) {
+    define([], f);
+  } else {
+    var g;
+
+    if (typeof window !== "undefined") {
+      g = window;
+    } else if (typeof global !== "undefined") {
+      g = global;
+    } else if (typeof self !== "undefined") {
+      g = self;
+    } else {
+      g = this;
+    }
+
+    g.debug = f();
+  }
+})(function () {
+  var define, module, exports;
+  return function () {
+    function r(e, n, t) {
+      function o(i, f) {
+        if (!n[i]) {
+          if (!e[i]) {
+            var c = "function" == typeof require && require;
+            if (!f && c) return c(i, !0);
+            if (u) return u(i, !0);
+            var a = new Error("Cannot find module '" + i + "'");
+            throw a.code = "MODULE_NOT_FOUND", a;
+          }
+
+          var p = n[i] = {
+            exports: {}
+          };
+          e[i][0].call(p.exports, function (r) {
+            var n = e[i][1][r];
+            return o(n || r);
+          }, p, p.exports, r, e, n, t);
+        }
+
+        return n[i].exports;
+      }
+
+      for (var u = "function" == typeof require && require, i = 0; i < t.length; i++) {
+        o(t[i]);
+      }
+
+      return o;
+    }
+
+    return r;
+  }()({
+    1: [function (require, module, exports) {
+      /**
+       * Helpers.
+       */
+      var s = 1000;
+      var m = s * 60;
+      var h = m * 60;
+      var d = h * 24;
+      var w = d * 7;
+      var y = d * 365.25;
+      /**
+       * Parse or format the given `val`.
+       *
+       * Options:
+       *
+       *  - `long` verbose formatting [false]
+       *
+       * @param {String|Number} val
+       * @param {Object} [options]
+       * @throws {Error} throw an error if val is not a non-empty string or a number
+       * @return {String|Number}
+       * @api public
+       */
+
+      module.exports = function (val, options) {
+        options = options || {};
+
+        var type = _typeof(val);
+
+        if (type === 'string' && val.length > 0) {
+          return parse(val);
+        } else if (type === 'number' && isNaN(val) === false) {
+          return options.long ? fmtLong(val) : fmtShort(val);
+        }
+
+        throw new Error('val is not a non-empty string or a valid number. val=' + JSON.stringify(val));
+      };
+      /**
+       * Parse the given `str` and return milliseconds.
+       *
+       * @param {String} str
+       * @return {Number}
+       * @api private
+       */
+
+
+      function parse(str) {
+        str = String(str);
+
+        if (str.length > 100) {
+          return;
+        }
+
+        var match = /^((?:\d+)?\-?\d?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(str);
+
+        if (!match) {
+          return;
+        }
+
+        var n = parseFloat(match[1]);
+        var type = (match[2] || 'ms').toLowerCase();
+
+        switch (type) {
+          case 'years':
+          case 'year':
+          case 'yrs':
+          case 'yr':
+          case 'y':
+            return n * y;
+
+          case 'weeks':
+          case 'week':
+          case 'w':
+            return n * w;
+
+          case 'days':
+          case 'day':
+          case 'd':
+            return n * d;
+
+          case 'hours':
+          case 'hour':
+          case 'hrs':
+          case 'hr':
+          case 'h':
+            return n * h;
+
+          case 'minutes':
+          case 'minute':
+          case 'mins':
+          case 'min':
+          case 'm':
+            return n * m;
+
+          case 'seconds':
+          case 'second':
+          case 'secs':
+          case 'sec':
+          case 's':
+            return n * s;
+
+          case 'milliseconds':
+          case 'millisecond':
+          case 'msecs':
+          case 'msec':
+          case 'ms':
+            return n;
+
+          default:
+            return undefined;
+        }
+      }
+      /**
+       * Short format for `ms`.
+       *
+       * @param {Number} ms
+       * @return {String}
+       * @api private
+       */
+
+
+      function fmtShort(ms) {
+        var msAbs = Math.abs(ms);
+
+        if (msAbs >= d) {
+          return Math.round(ms / d) + 'd';
+        }
+
+        if (msAbs >= h) {
+          return Math.round(ms / h) + 'h';
+        }
+
+        if (msAbs >= m) {
+          return Math.round(ms / m) + 'm';
+        }
+
+        if (msAbs >= s) {
+          return Math.round(ms / s) + 's';
+        }
+
+        return ms + 'ms';
+      }
+      /**
+       * Long format for `ms`.
+       *
+       * @param {Number} ms
+       * @return {String}
+       * @api private
+       */
+
+
+      function fmtLong(ms) {
+        var msAbs = Math.abs(ms);
+
+        if (msAbs >= d) {
+          return plural(ms, msAbs, d, 'day');
+        }
+
+        if (msAbs >= h) {
+          return plural(ms, msAbs, h, 'hour');
+        }
+
+        if (msAbs >= m) {
+          return plural(ms, msAbs, m, 'minute');
+        }
+
+        if (msAbs >= s) {
+          return plural(ms, msAbs, s, 'second');
+        }
+
+        return ms + ' ms';
+      }
+      /**
+       * Pluralization helper.
+       */
+
+
+      function plural(ms, msAbs, n, name) {
+        var isPlural = msAbs >= n * 1.5;
+        return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
+      }
+    }, {}],
+    2: [function (require, module, exports) {
+      // shim for using process in browser
+      var process = module.exports = {}; // cached from whatever global is present so that test runners that stub it
+      // don't break things.  But we need to wrap it in a try catch in case it is
+      // wrapped in strict mode code which doesn't define any globals.  It's inside a
+      // function because try/catches deoptimize in certain engines.
+
+      var cachedSetTimeout;
+      var cachedClearTimeout;
+
+      function defaultSetTimout() {
+        throw new Error('setTimeout has not been defined');
+      }
+
+      function defaultClearTimeout() {
+        throw new Error('clearTimeout has not been defined');
+      }
+
+      (function () {
+        try {
+          if (typeof setTimeout === 'function') {
+            cachedSetTimeout = setTimeout;
+          } else {
+            cachedSetTimeout = defaultSetTimout;
+          }
+        } catch (e) {
+          cachedSetTimeout = defaultSetTimout;
+        }
+
+        try {
+          if (typeof clearTimeout === 'function') {
+            cachedClearTimeout = clearTimeout;
+          } else {
+            cachedClearTimeout = defaultClearTimeout;
+          }
+        } catch (e) {
+          cachedClearTimeout = defaultClearTimeout;
+        }
+      })();
+
+      function runTimeout(fun) {
+        if (cachedSetTimeout === setTimeout) {
+          //normal enviroments in sane situations
+          return setTimeout(fun, 0);
+        } // if setTimeout wasn't available but was latter defined
+
+
+        if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
+          cachedSetTimeout = setTimeout;
+          return setTimeout(fun, 0);
+        }
+
+        try {
+          // when when somebody has screwed with setTimeout but no I.E. maddness
+          return cachedSetTimeout(fun, 0);
+        } catch (e) {
+          try {
+            // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
+            return cachedSetTimeout.call(null, fun, 0);
+          } catch (e) {
+            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
+            return cachedSetTimeout.call(this, fun, 0);
+          }
+        }
+      }
+
+      function runClearTimeout(marker) {
+        if (cachedClearTimeout === clearTimeout) {
+          //normal enviroments in sane situations
+          return clearTimeout(marker);
+        } // if clearTimeout wasn't available but was latter defined
+
+
+        if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
+          cachedClearTimeout = clearTimeout;
+          return clearTimeout(marker);
+        }
+
+        try {
+          // when when somebody has screwed with setTimeout but no I.E. maddness
+          return cachedClearTimeout(marker);
+        } catch (e) {
+          try {
+            // When we are in I.E. but the script has been evaled so I.E. doesn't  trust the global object when called normally
+            return cachedClearTimeout.call(null, marker);
+          } catch (e) {
+            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
+            // Some versions of I.E. have different rules for clearTimeout vs setTimeout
+            return cachedClearTimeout.call(this, marker);
+          }
+        }
+      }
+
+      var queue = [];
+      var draining = false;
+      var currentQueue;
+      var queueIndex = -1;
+
+      function cleanUpNextTick() {
+        if (!draining || !currentQueue) {
+          return;
+        }
+
+        draining = false;
+
+        if (currentQueue.length) {
+          queue = currentQueue.concat(queue);
+        } else {
+          queueIndex = -1;
+        }
+
+        if (queue.length) {
+          drainQueue();
+        }
+      }
+
+      function drainQueue() {
+        if (draining) {
+          return;
+        }
+
+        var timeout = runTimeout(cleanUpNextTick);
+        draining = true;
+        var len = queue.length;
+
+        while (len) {
+          currentQueue = queue;
+          queue = [];
+
+          while (++queueIndex < len) {
+            if (currentQueue) {
+              currentQueue[queueIndex].run();
+            }
+          }
+
+          queueIndex = -1;
+          len = queue.length;
+        }
+
+        currentQueue = null;
+        draining = false;
+        runClearTimeout(timeout);
+      }
+
+      process.nextTick = function (fun) {
+        var args = new Array(arguments.length - 1);
+
+        if (arguments.length > 1) {
+          for (var i = 1; i < arguments.length; i++) {
+            args[i - 1] = arguments[i];
+          }
+        }
+
+        queue.push(new Item(fun, args));
+
+        if (queue.length === 1 && !draining) {
+          runTimeout(drainQueue);
+        }
+      }; // v8 likes predictible objects
+
+
+      function Item(fun, array) {
+        this.fun = fun;
+        this.array = array;
+      }
+
+      Item.prototype.run = function () {
+        this.fun.apply(null, this.array);
+      };
+
+      process.title = 'browser';
+      process.browser = true;
+      process.env = {};
+      process.argv = [];
+      process.version = ''; // empty string to avoid regexp issues
+
+      process.versions = {};
+
+      function noop() {}
+
+      process.on = noop;
+      process.addListener = noop;
+      process.once = noop;
+      process.off = noop;
+      process.removeListener = noop;
+      process.removeAllListeners = noop;
+      process.emit = noop;
+      process.prependListener = noop;
+      process.prependOnceListener = noop;
+
+      process.listeners = function (name) {
+        return [];
+      };
+
+      process.binding = function (name) {
+        throw new Error('process.binding is not supported');
+      };
+
+      process.cwd = function () {
+        return '/';
+      };
+
+      process.chdir = function (dir) {
+        throw new Error('process.chdir is not supported');
+      };
+
+      process.umask = function () {
+        return 0;
+      };
+    }, {}],
+    3: [function (require, module, exports) {
+      /**
+       * This is the common logic for both the Node.js and web browser
+       * implementations of `debug()`.
+       */
+      function setup(env) {
+        createDebug.debug = createDebug;
+        createDebug.default = createDebug;
+        createDebug.coerce = coerce;
+        createDebug.disable = disable;
+        createDebug.enable = enable;
+        createDebug.enabled = enabled;
+        createDebug.humanize = require('ms');
+        Object.keys(env).forEach(function (key) {
+          createDebug[key] = env[key];
+        });
+        /**
+        * Active `debug` instances.
+        */
+
+        createDebug.instances = [];
+        /**
+        * The currently active debug mode names, and names to skip.
+        */
+
+        createDebug.names = [];
+        createDebug.skips = [];
+        /**
+        * Map of special "%n" handling functions, for the debug "format" argument.
+        *
+        * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+        */
+
+        createDebug.formatters = {};
+        /**
+        * Selects a color for a debug namespace
+        * @param {String} namespace The namespace string for the for the debug instance to be colored
+        * @return {Number|String} An ANSI color code for the given namespace
+        * @api private
+        */
+
+        function selectColor(namespace) {
+          var hash = 0;
+
+          for (var i = 0; i < namespace.length; i++) {
+            hash = (hash << 5) - hash + namespace.charCodeAt(i);
+            hash |= 0; // Convert to 32bit integer
+          }
+
+          return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
+        }
+
+        createDebug.selectColor = selectColor;
+        /**
+        * Create a debugger with the given `namespace`.
+        *
+        * @param {String} namespace
+        * @return {Function}
+        * @api public
+        */
+
+        function createDebug(namespace) {
+          var prevTime;
+
+          function debug() {
+            for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
+              args[_key] = arguments[_key];
+            }
+
+            // Disabled?
+            if (!debug.enabled) {
+              return;
+            }
+
+            var self = debug; // Set `diff` timestamp
+
+            var curr = Number(new Date());
+            var ms = curr - (prevTime || curr);
+            self.diff = ms;
+            self.prev = prevTime;
+            self.curr = curr;
+            prevTime = curr;
+            args[0] = createDebug.coerce(args[0]);
+
+            if (typeof args[0] !== 'string') {
+              // Anything else let's inspect with %O
+              args.unshift('%O');
+            } // Apply any `formatters` transformations
+
+
+            var index = 0;
+            args[0] = args[0].replace(/%([a-zA-Z%])/g, function (match, format) {
+              // If we encounter an escaped % then don't increase the array index
+              if (match === '%%') {
+                return match;
+              }
+
+              index++;
+              var formatter = createDebug.formatters[format];
+
+              if (typeof formatter === 'function') {
+                var val = args[index];
+                match = formatter.call(self, val); // Now we need to remove `args[index]` since it's inlined in the `format`
+
+                args.splice(index, 1);
+                index--;
+              }
+
+              return match;
+            }); // Apply env-specific formatting (colors, etc.)
+
+            createDebug.formatArgs.call(self, args);
+            var logFn = self.log || createDebug.log;
+            logFn.apply(self, args);
+          }
+
+          debug.namespace = namespace;
+          debug.enabled = createDebug.enabled(namespace);
+          debug.useColors = createDebug.useColors();
+          debug.color = selectColor(namespace);
+          debug.destroy = destroy;
+          debug.extend = extend; // Debug.formatArgs = formatArgs;
+          // debug.rawLog = rawLog;
+          // env-specific initialization logic for debug instances
+
+          if (typeof createDebug.init === 'function') {
+            createDebug.init(debug);
+          }
+
+          createDebug.instances.push(debug);
+          return debug;
+        }
+
+        function destroy() {
+          var index = createDebug.instances.indexOf(this);
+
+          if (index !== -1) {
+            createDebug.instances.splice(index, 1);
+            return true;
+          }
+
+          return false;
+        }
+
+        function extend(namespace, delimiter) {
+          return createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
+        }
+        /**
+        * Enables a debug mode by namespaces. This can include modes
+        * separated by a colon and wildcards.
+        *
+        * @param {String} namespaces
+        * @api public
+        */
+
+
+        function enable(namespaces) {
+          createDebug.save(namespaces);
+          createDebug.names = [];
+          createDebug.skips = [];
+          var i;
+          var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+          var len = split.length;
+
+          for (i = 0; i < len; i++) {
+            if (!split[i]) {
+              // ignore empty strings
+              continue;
+            }
+
+            namespaces = split[i].replace(/\*/g, '.*?');
+
+            if (namespaces[0] === '-') {
+              createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+            } else {
+              createDebug.names.push(new RegExp('^' + namespaces + '$'));
+            }
+          }
+
+          for (i = 0; i < createDebug.instances.length; i++) {
+            var instance = createDebug.instances[i];
+            instance.enabled = createDebug.enabled(instance.namespace);
+          }
+        }
+        /**
+        * Disable debug output.
+        *
+        * @api public
+        */
+
+
+        function disable() {
+          createDebug.enable('');
+        }
+        /**
+        * Returns true if the given mode name is enabled, false otherwise.
+        *
+        * @param {String} name
+        * @return {Boolean}
+        * @api public
+        */
+
+
+        function enabled(name) {
+          if (name[name.length - 1] === '*') {
+            return true;
+          }
+
+          var i;
+          var len;
+
+          for (i = 0, len = createDebug.skips.length; i < len; i++) {
+            if (createDebug.skips[i].test(name)) {
+              return false;
+            }
+          }
+
+          for (i = 0, len = createDebug.names.length; i < len; i++) {
+            if (createDebug.names[i].test(name)) {
+              return true;
+            }
+          }
+
+          return false;
+        }
+        /**
+        * Coerce `val`.
+        *
+        * @param {Mixed} val
+        * @return {Mixed}
+        * @api private
+        */
+
+
+        function coerce(val) {
+          if (val instanceof Error) {
+            return val.stack || val.message;
+          }
+
+          return val;
+        }
+
+        createDebug.enable(createDebug.load());
+        return createDebug;
+      }
+
+      module.exports = setup;
+    }, {
+      "ms": 1
+    }],
+    4: [function (require, module, exports) {
+      (function (process) {
+        /* eslint-env browser */
+
+        /**
+         * This is the web browser implementation of `debug()`.
+         */
+        exports.log = log;
+        exports.formatArgs = formatArgs;
+        exports.save = save;
+        exports.load = load;
+        exports.useColors = useColors;
+        exports.storage = localstorage();
+        /**
+         * Colors.
+         */
+
+        exports.colors = ['#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33'];
+        /**
+         * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+         * and the Firebug extension (any Firefox version) are known
+         * to support "%c" CSS customizations.
+         *
+         * TODO: add a `localStorage` variable to explicitly enable/disable colors
+         */
+        // eslint-disable-next-line complexity
+
+        function useColors() {
+          // NB: In an Electron preload script, document will be defined but not fully
+          // initialized. Since we know we're in Chrome, we'll just detect this case
+          // explicitly
+          if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
+            return true;
+          } // Internet Explorer and Edge do not support colors.
+
+
+          if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
+            return false;
+          } // Is webkit? http://stackoverflow.com/a/16459606/376773
+          // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+
+
+          return typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance || // Is firebug? http://stackoverflow.com/a/398120/376773
+          typeof window !== 'undefined' && window.console && (window.console.firebug || window.console.exception && window.console.table) || // Is firefox >= v31?
+          // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+          typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31 || // Double check webkit in userAgent just in case we are in a worker
+          typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/);
+        }
+        /**
+         * Colorize log arguments if enabled.
+         *
+         * @api public
+         */
+
+
+        function formatArgs(args) {
+          args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff);
+
+          if (!this.useColors) {
+            return;
+          }
+
+          var c = 'color: ' + this.color;
+          args.splice(1, 0, c, 'color: inherit'); // The final "%c" is somewhat tricky, because there could be other
+          // arguments passed either before or after the %c, so we need to
+          // figure out the correct index to insert the CSS into
+
+          var index = 0;
+          var lastC = 0;
+          args[0].replace(/%[a-zA-Z%]/g, function (match) {
+            if (match === '%%') {
+              return;
+            }
+
+            index++;
+
+            if (match === '%c') {
+              // We only are interested in the *last* %c
+              // (the user may have provided their own)
+              lastC = index;
+            }
+          });
+          args.splice(lastC, 0, c);
+        }
+        /**
+         * Invokes `console.log()` when available.
+         * No-op when `console.log` is not a "function".
+         *
+         * @api public
+         */
+
+
+        function log() {
+          var _console;
+
+          // This hackery is required for IE8/9, where
+          // the `console.log` function doesn't have 'apply'
+          return (typeof console === "undefined" ? "undefined" : _typeof(console)) === 'object' && console.log && (_console = console).log.apply(_console, arguments);
+        }
+        /**
+         * Save `namespaces`.
+         *
+         * @param {String} namespaces
+         * @api private
+         */
+
+
+        function save(namespaces) {
+          try {
+            if (namespaces) {
+              exports.storage.setItem('debug', namespaces);
+            } else {
+              exports.storage.removeItem('debug');
+            }
+          } catch (error) {// Swallow
+            // XXX (@Qix-) should we be logging these?
+          }
+        }
+        /**
+         * Load `namespaces`.
+         *
+         * @return {String} returns the previously persisted debug modes
+         * @api private
+         */
+
+
+        function load() {
+          var r;
+
+          try {
+            r = exports.storage.getItem('debug');
+          } catch (error) {} // Swallow
+          // XXX (@Qix-) should we be logging these?
+          // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+
+
+          if (!r && typeof process !== 'undefined' && 'env' in process) {
+            r = process.env.DEBUG;
+          }
+
+          return r;
+        }
+        /**
+         * Localstorage attempts to return the localstorage.
+         *
+         * This is necessary because safari throws
+         * when a user disables cookies/localstorage
+         * and you attempt to access it.
+         *
+         * @return {LocalStorage}
+         * @api private
+         */
+
+
+        function localstorage() {
+          try {
+            // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
+            // The Browser also has localStorage in the global context.
+            return localStorage;
+          } catch (error) {// Swallow
+            // XXX (@Qix-) should we be logging these?
+          }
+        }
+
+        module.exports = require('./common')(exports);
+        var formatters = module.exports.formatters;
+        /**
+         * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+         */
+
+        formatters.j = function (v) {
+          try {
+            return JSON.stringify(v);
+          } catch (error) {
+            return '[UnexpectedJSONParseError]: ' + error.message;
+          }
+        };
+      }).call(this, require('_process'));
+    }, {
+      "./common": 3,
+      "_process": 2
+    }]
+  }, {}, [4])(4);
+});
+
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/node.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/node.js
new file mode 100644
index 00000000000..7fc36fe6dbe
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/node.js
@@ -0,0 +1 @@
+module.exports = require('./src/node');
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/package.json b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/package.json
new file mode 100644
index 00000000000..10b1956647b
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/package.json
@@ -0,0 +1,51 @@
+{
+  "author": "TJ Holowaychuk <tj@vision-media.ca>", 
+  "browser": "./src/browser.js", 
+  "contributors": [
+    "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)", 
+    "Andrew Rhyne <rhyneandrew@gmail.com>"
+  ], 
+  "dependencies": {
+    "ms": "^2.1.1"
+  }, 
+  "description": "small debugging utility", 
+  "devDependencies": {
+    "@babel/cli": "^7.0.0", 
+    "@babel/core": "^7.0.0", 
+    "@babel/preset-env": "^7.0.0", 
+    "browserify": "14.4.0", 
+    "chai": "^3.5.0", 
+    "concurrently": "^3.1.0", 
+    "coveralls": "^3.0.2", 
+    "istanbul": "^0.4.5", 
+    "karma": "^3.0.0", 
+    "karma-chai": "^0.1.0", 
+    "karma-mocha": "^1.3.0", 
+    "karma-phantomjs-launcher": "^1.0.2", 
+    "mocha": "^5.2.0", 
+    "mocha-lcov-reporter": "^1.2.0", 
+    "rimraf": "^2.5.4", 
+    "xo": "^0.23.0"
+  }, 
+  "files": [
+    "src", 
+    "node.js", 
+    "dist/debug.js", 
+    "LICENSE", 
+    "README.md"
+  ], 
+  "keywords": [
+    "debug", 
+    "log", 
+    "debugger"
+  ], 
+  "license": "MIT", 
+  "main": "./src/index.js", 
+  "name": "debug", 
+  "repository": {
+    "type": "git", 
+    "url": "git://github.com/visionmedia/debug.git"
+  }, 
+  "unpkg": "./dist/debug.js", 
+  "version": "3.2.6"
+}
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/browser.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/browser.js
new file mode 100644
index 00000000000..c924b0ac4d4
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/browser.js
@@ -0,0 +1,180 @@
+"use strict";
+
+function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
+
+/* eslint-env browser */
+
+/**
+ * This is the web browser implementation of `debug()`.
+ */
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = localstorage();
+/**
+ * Colors.
+ */
+
+exports.colors = ['#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33'];
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+// eslint-disable-next-line complexity
+
+function useColors() {
+  // NB: In an Electron preload script, document will be defined but not fully
+  // initialized. Since we know we're in Chrome, we'll just detect this case
+  // explicitly
+  if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
+    return true;
+  } // Internet Explorer and Edge do not support colors.
+
+
+  if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
+    return false;
+  } // Is webkit? http://stackoverflow.com/a/16459606/376773
+  // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+
+
+  return typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance || // Is firebug? http://stackoverflow.com/a/398120/376773
+  typeof window !== 'undefined' && window.console && (window.console.firebug || window.console.exception && window.console.table) || // Is firefox >= v31?
+  // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+  typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31 || // Double check webkit in userAgent just in case we are in a worker
+  typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/);
+}
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+
+function formatArgs(args) {
+  args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff);
+
+  if (!this.useColors) {
+    return;
+  }
+
+  var c = 'color: ' + this.color;
+  args.splice(1, 0, c, 'color: inherit'); // The final "%c" is somewhat tricky, because there could be other
+  // arguments passed either before or after the %c, so we need to
+  // figure out the correct index to insert the CSS into
+
+  var index = 0;
+  var lastC = 0;
+  args[0].replace(/%[a-zA-Z%]/g, function (match) {
+    if (match === '%%') {
+      return;
+    }
+
+    index++;
+
+    if (match === '%c') {
+      // We only are interested in the *last* %c
+      // (the user may have provided their own)
+      lastC = index;
+    }
+  });
+  args.splice(lastC, 0, c);
+}
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+
+function log() {
+  var _console;
+
+  // This hackery is required for IE8/9, where
+  // the `console.log` function doesn't have 'apply'
+  return (typeof console === "undefined" ? "undefined" : _typeof(console)) === 'object' && console.log && (_console = console).log.apply(_console, arguments);
+}
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+
+function save(namespaces) {
+  try {
+    if (namespaces) {
+      exports.storage.setItem('debug', namespaces);
+    } else {
+      exports.storage.removeItem('debug');
+    }
+  } catch (error) {// Swallow
+    // XXX (@Qix-) should we be logging these?
+  }
+}
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+
+function load() {
+  var r;
+
+  try {
+    r = exports.storage.getItem('debug');
+  } catch (error) {} // Swallow
+  // XXX (@Qix-) should we be logging these?
+  // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+
+
+  if (!r && typeof process !== 'undefined' && 'env' in process) {
+    r = process.env.DEBUG;
+  }
+
+  return r;
+}
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+
+function localstorage() {
+  try {
+    // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
+    // The Browser also has localStorage in the global context.
+    return localStorage;
+  } catch (error) {// Swallow
+    // XXX (@Qix-) should we be logging these?
+  }
+}
+
+module.exports = require('./common')(exports);
+var formatters = module.exports.formatters;
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+formatters.j = function (v) {
+  try {
+    return JSON.stringify(v);
+  } catch (error) {
+    return '[UnexpectedJSONParseError]: ' + error.message;
+  }
+};
+
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/common.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/common.js
new file mode 100644
index 00000000000..e0de3fb530f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/common.js
@@ -0,0 +1,249 @@
+"use strict";
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ */
+function setup(env) {
+  createDebug.debug = createDebug;
+  createDebug.default = createDebug;
+  createDebug.coerce = coerce;
+  createDebug.disable = disable;
+  createDebug.enable = enable;
+  createDebug.enabled = enabled;
+  createDebug.humanize = require('ms');
+  Object.keys(env).forEach(function (key) {
+    createDebug[key] = env[key];
+  });
+  /**
+  * Active `debug` instances.
+  */
+
+  createDebug.instances = [];
+  /**
+  * The currently active debug mode names, and names to skip.
+  */
+
+  createDebug.names = [];
+  createDebug.skips = [];
+  /**
+  * Map of special "%n" handling functions, for the debug "format" argument.
+  *
+  * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+  */
+
+  createDebug.formatters = {};
+  /**
+  * Selects a color for a debug namespace
+  * @param {String} namespace The namespace string for the for the debug instance to be colored
+  * @return {Number|String} An ANSI color code for the given namespace
+  * @api private
+  */
+
+  function selectColor(namespace) {
+    var hash = 0;
+
+    for (var i = 0; i < namespace.length; i++) {
+      hash = (hash << 5) - hash + namespace.charCodeAt(i);
+      hash |= 0; // Convert to 32bit integer
+    }
+
+    return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
+  }
+
+  createDebug.selectColor = selectColor;
+  /**
+  * Create a debugger with the given `namespace`.
+  *
+  * @param {String} namespace
+  * @return {Function}
+  * @api public
+  */
+
+  function createDebug(namespace) {
+    var prevTime;
+
+    function debug() {
+      // Disabled?
+      if (!debug.enabled) {
+        return;
+      }
+
+      for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
+        args[_key] = arguments[_key];
+      }
+
+      var self = debug; // Set `diff` timestamp
+
+      var curr = Number(new Date());
+      var ms = curr - (prevTime || curr);
+      self.diff = ms;
+      self.prev = prevTime;
+      self.curr = curr;
+      prevTime = curr;
+      args[0] = createDebug.coerce(args[0]);
+
+      if (typeof args[0] !== 'string') {
+        // Anything else let's inspect with %O
+        args.unshift('%O');
+      } // Apply any `formatters` transformations
+
+
+      var index = 0;
+      args[0] = args[0].replace(/%([a-zA-Z%])/g, function (match, format) {
+        // If we encounter an escaped % then don't increase the array index
+        if (match === '%%') {
+          return match;
+        }
+
+        index++;
+        var formatter = createDebug.formatters[format];
+
+        if (typeof formatter === 'function') {
+          var val = args[index];
+          match = formatter.call(self, val); // Now we need to remove `args[index]` since it's inlined in the `format`
+
+          args.splice(index, 1);
+          index--;
+        }
+
+        return match;
+      }); // Apply env-specific formatting (colors, etc.)
+
+      createDebug.formatArgs.call(self, args);
+      var logFn = self.log || createDebug.log;
+      logFn.apply(self, args);
+    }
+
+    debug.namespace = namespace;
+    debug.enabled = createDebug.enabled(namespace);
+    debug.useColors = createDebug.useColors();
+    debug.color = selectColor(namespace);
+    debug.destroy = destroy;
+    debug.extend = extend; // Debug.formatArgs = formatArgs;
+    // debug.rawLog = rawLog;
+    // env-specific initialization logic for debug instances
+
+    if (typeof createDebug.init === 'function') {
+      createDebug.init(debug);
+    }
+
+    createDebug.instances.push(debug);
+    return debug;
+  }
+
+  function destroy() {
+    var index = createDebug.instances.indexOf(this);
+
+    if (index !== -1) {
+      createDebug.instances.splice(index, 1);
+      return true;
+    }
+
+    return false;
+  }
+
+  function extend(namespace, delimiter) {
+    return createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
+  }
+  /**
+  * Enables a debug mode by namespaces. This can include modes
+  * separated by a colon and wildcards.
+  *
+  * @param {String} namespaces
+  * @api public
+  */
+
+
+  function enable(namespaces) {
+    createDebug.save(namespaces);
+    createDebug.names = [];
+    createDebug.skips = [];
+    var i;
+    var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+    var len = split.length;
+
+    for (i = 0; i < len; i++) {
+      if (!split[i]) {
+        // ignore empty strings
+        continue;
+      }
+
+      namespaces = split[i].replace(/\*/g, '.*?');
+
+      if (namespaces[0] === '-') {
+        createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+      } else {
+        createDebug.names.push(new RegExp('^' + namespaces + '$'));
+      }
+    }
+
+    for (i = 0; i < createDebug.instances.length; i++) {
+      var instance = createDebug.instances[i];
+      instance.enabled = createDebug.enabled(instance.namespace);
+    }
+  }
+  /**
+  * Disable debug output.
+  *
+  * @api public
+  */
+
+
+  function disable() {
+    createDebug.enable('');
+  }
+  /**
+  * Returns true if the given mode name is enabled, false otherwise.
+  *
+  * @param {String} name
+  * @return {Boolean}
+  * @api public
+  */
+
+
+  function enabled(name) {
+    if (name[name.length - 1] === '*') {
+      return true;
+    }
+
+    var i;
+    var len;
+
+    for (i = 0, len = createDebug.skips.length; i < len; i++) {
+      if (createDebug.skips[i].test(name)) {
+        return false;
+      }
+    }
+
+    for (i = 0, len = createDebug.names.length; i < len; i++) {
+      if (createDebug.names[i].test(name)) {
+        return true;
+      }
+    }
+
+    return false;
+  }
+  /**
+  * Coerce `val`.
+  *
+  * @param {Mixed} val
+  * @return {Mixed}
+  * @api private
+  */
+
+
+  function coerce(val) {
+    if (val instanceof Error) {
+      return val.stack || val.message;
+    }
+
+    return val;
+  }
+
+  createDebug.enable(createDebug.load());
+  return createDebug;
+}
+
+module.exports = setup;
+
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/index.js
new file mode 100644
index 00000000000..021731593ac
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/index.js
@@ -0,0 +1,12 @@
+"use strict";
+
+/**
+ * Detect Electron renderer / nwjs process, which is node, but we should
+ * treat as a browser.
+ */
+if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) {
+  module.exports = require('./browser.js');
+} else {
+  module.exports = require('./node.js');
+}
+
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/node.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/node.js
new file mode 100644
index 00000000000..dbbb5f1087f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/debug/src/node.js
@@ -0,0 +1,174 @@
+"use strict";
+
+/**
+ * Module dependencies.
+ */
+var tty = require('tty');
+
+var util = require('util');
+/**
+ * This is the Node.js implementation of `debug()`.
+ */
+
+
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+try {
+  // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json)
+  // eslint-disable-next-line import/no-extraneous-dependencies
+  var supportsColor = require('supports-color');
+
+  if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) {
+    exports.colors = [20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, 205, 206, 207, 208, 209, 214, 215, 220, 221];
+  }
+} catch (error) {} // Swallow - we only care if `supports-color` is available; it doesn't have to be.
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ *   $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+  return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+  // Camel-case
+  var prop = key.substring(6).toLowerCase().replace(/_([a-z])/g, function (_, k) {
+    return k.toUpperCase();
+  }); // Coerce string value into JS value
+
+  var val = process.env[key];
+
+  if (/^(yes|on|true|enabled)$/i.test(val)) {
+    val = true;
+  } else if (/^(no|off|false|disabled)$/i.test(val)) {
+    val = false;
+  } else if (val === 'null') {
+    val = null;
+  } else {
+    val = Number(val);
+  }
+
+  obj[prop] = val;
+  return obj;
+}, {});
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+  return 'colors' in exports.inspectOpts ? Boolean(exports.inspectOpts.colors) : tty.isatty(process.stderr.fd);
+}
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+
+function formatArgs(args) {
+  var name = this.namespace,
+      useColors = this.useColors;
+
+  if (useColors) {
+    var c = this.color;
+    var colorCode = "\x1B[3" + (c < 8 ? c : '8;5;' + c);
+    var prefix = "  ".concat(colorCode, ";1m").concat(name, " \x1B[0m");
+    args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+    args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + "\x1B[0m");
+  } else {
+    args[0] = getDate() + name + ' ' + args[0];
+  }
+}
+
+function getDate() {
+  if (exports.inspectOpts.hideDate) {
+    return '';
+  }
+
+  return new Date().toISOString() + ' ';
+}
+/**
+ * Invokes `util.format()` with the specified arguments and writes to stderr.
+ */
+
+
+function log() {
+  return process.stderr.write(util.format.apply(util, arguments) + '\n');
+}
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+
+function save(namespaces) {
+  if (namespaces) {
+    process.env.DEBUG = namespaces;
+  } else {
+    // If you set a process.env field to null or undefined, it gets cast to the
+    // string 'null' or 'undefined'. Just delete instead.
+    delete process.env.DEBUG;
+  }
+}
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+
+function load() {
+  return process.env.DEBUG;
+}
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+
+function init(debug) {
+  debug.inspectOpts = {};
+  var keys = Object.keys(exports.inspectOpts);
+
+  for (var i = 0; i < keys.length; i++) {
+    debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+  }
+}
+
+module.exports = require('./common')(exports);
+var formatters = module.exports.formatters;
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+formatters.o = function (v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts).replace(/\s*\n\s*/g, ' ');
+};
+/**
+ * Map %O to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+
+formatters.O = function (v) {
+  this.inspectOpts.colors = this.useColors;
+  return util.inspect(v, this.inspectOpts);
+};
+
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/CONTRIBUTING.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/CONTRIBUTING.md
new file mode 100644
index 00000000000..96f4530a611
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/CONTRIBUTING.md
@@ -0,0 +1,39 @@
+# How to Contribute
+
+## Pull Requests
+
+We also accept [pull requests][pull-request]!
+
+Generally we like to see pull requests that
+- Maintain the existing code style
+- Are focused on a single change (i.e. avoid large refactoring or style adjustments in untouched code if not the primary goal of the pull request)
+- Have [good commit messages](http://tbaggery.com/2008/04/19/a-note-about-git-commit-messages.html)
+- Have tests
+- Don't decrease the current code coverage (see coverage/lcov-report/index.html)
+
+## Building
+
+```
+npm install
+npm test
+````
+
+The `npm test -- dev` implements watching for tests within Node and `karma start` may be used for manual testing in browsers.
+
+If you notice any problems, please report them to the GitHub issue tracker at
+[http://github.com/kpdecker/jsdiff/issues](http://github.com/kpdecker/jsdiff/issues).
+
+## Releasing
+
+JsDiff utilizes the [release yeoman generator][generator-release] to perform most release tasks.
+
+A full release may be completed with the following:
+
+```
+yo release
+npm publish
+yo release:publish components jsdiff dist/components/
+```
+
+[generator-release]: https://github.com/walmartlabs/generator-release
+[pull-request]: https://github.com/kpdecker/jsdiff/pull/new/master
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/LICENSE b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/LICENSE
new file mode 100644
index 00000000000..4e7146ed78a
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/LICENSE
@@ -0,0 +1,31 @@
+Software License Agreement (BSD License)
+
+Copyright (c) 2009-2015, Kevin Decker <kpdecker@gmail.com>
+
+All rights reserved.
+
+Redistribution and use of this software in source and binary forms, with or without modification,
+are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above
+  copyright notice, this list of conditions and the
+  following disclaimer.
+
+* Redistributions in binary form must reproduce the above
+  copyright notice, this list of conditions and the
+  following disclaimer in the documentation and/or other
+  materials provided with the distribution.
+
+* Neither the name of Kevin Decker nor the names of its
+  contributors may be used to endorse or promote products
+  derived from this software without specific prior
+  written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND
+FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR
+CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER
+IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
+OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/README.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/README.md
new file mode 100644
index 00000000000..5747fe36747
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/README.md
@@ -0,0 +1,211 @@
+# jsdiff
+
+[![Build Status](https://secure.travis-ci.org/kpdecker/jsdiff.svg)](http://travis-ci.org/kpdecker/jsdiff)
+[![Sauce Test Status](https://saucelabs.com/buildstatus/jsdiff)](https://saucelabs.com/u/jsdiff)
+
+A javascript text differencing implementation.
+
+Based on the algorithm proposed in
+["An O(ND) Difference Algorithm and its Variations" (Myers, 1986)](http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927).
+
+## Installation
+```bash
+npm install diff --save
+```
+or
+```bash
+bower install jsdiff --save
+```
+
+## API
+
+* `JsDiff.diffChars(oldStr, newStr[, options])` - diffs two blocks of text, comparing character by character.
+
+    Returns a list of change objects (See below).
+
+    Options
+    * `ignoreCase`: `true` to ignore casing difference. Defaults to `false`.
+
+* `JsDiff.diffWords(oldStr, newStr[, options])` - diffs two blocks of text, comparing word by word, ignoring whitespace.
+
+    Returns a list of change objects (See below).
+
+    Options
+    * `ignoreCase`: Same as in `diffChars`.
+
+* `JsDiff.diffWordsWithSpace(oldStr, newStr[, options])` - diffs two blocks of text, comparing word by word, treating whitespace as significant.
+
+    Returns a list of change objects (See below).
+
+* `JsDiff.diffLines(oldStr, newStr[, options])` - diffs two blocks of text, comparing line by line.
+
+    Options
+    * `ignoreWhitespace`: `true` to ignore leading and trailing whitespace. This is the same as `diffTrimmedLines`
+    * `newlineIsToken`: `true` to treat newline characters as separate tokens.  This allows for changes to the newline structure to occur independently of the line content and to be treated as such. In general this is the more human friendly form of `diffLines` and `diffLines` is better suited for patches and other computer friendly output.
+
+    Returns a list of change objects (See below).
+
+* `JsDiff.diffTrimmedLines(oldStr, newStr[, options])` - diffs two blocks of text, comparing line by line, ignoring leading and trailing whitespace.
+
+    Returns a list of change objects (See below).
+
+* `JsDiff.diffSentences(oldStr, newStr[, options])` - diffs two blocks of text, comparing sentence by sentence.
+
+    Returns a list of change objects (See below).
+
+* `JsDiff.diffCss(oldStr, newStr[, options])` - diffs two blocks of text, comparing CSS tokens.
+
+    Returns a list of change objects (See below).
+
+* `JsDiff.diffJson(oldObj, newObj[, options])` - diffs two JSON objects, comparing the fields defined on each. The order of fields, etc does not matter in this comparison.
+
+    Returns a list of change objects (See below).
+
+* `JsDiff.diffArrays(oldArr, newArr[, options])` - diffs two arrays, comparing each item for strict equality (===).
+
+    Options
+    * `comparator`: `function(left, right)` for custom equality checks
+
+    Returns a list of change objects (See below).
+
+* `JsDiff.createTwoFilesPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader)` - creates a unified diff patch.
+
+    Parameters:
+    * `oldFileName` : String to be output in the filename section of the patch for the removals
+    * `newFileName` : String to be output in the filename section of the patch for the additions
+    * `oldStr` : Original string value
+    * `newStr` : New string value
+    * `oldHeader` : Additional information to include in the old file header
+    * `newHeader` : Additional information to include in the new file header
+    * `options` : An object with options. Currently, only `context` is supported and describes how many lines of context should be included.
+
+* `JsDiff.createPatch(fileName, oldStr, newStr, oldHeader, newHeader)` - creates a unified diff patch.
+
+    Just like JsDiff.createTwoFilesPatch, but with oldFileName being equal to newFileName.
+
+
+* `JsDiff.structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options)` - returns an object with an array of hunk objects.
+
+    This method is similar to createTwoFilesPatch, but returns a data structure
+    suitable for further processing. Parameters are the same as createTwoFilesPatch. The data structure returned may look like this:
+
+    ```js
+    {
+      oldFileName: 'oldfile', newFileName: 'newfile',
+      oldHeader: 'header1', newHeader: 'header2',
+      hunks: [{
+        oldStart: 1, oldLines: 3, newStart: 1, newLines: 3,
+        lines: [' line2', ' line3', '-line4', '+line5', '\\ No newline at end of file'],
+      }]
+    }
+    ```
+
+* `JsDiff.applyPatch(source, patch[, options])` - applies a unified diff patch.
+
+    Return a string containing new version of provided data. `patch` may be a string diff or the output from the `parsePatch` or `structuredPatch` methods.
+
+    The optional `options` object may have the following keys:
+
+    - `fuzzFactor`: Number of lines that are allowed to differ before rejecting a patch. Defaults to 0.
+    - `compareLine(lineNumber, line, operation, patchContent)`: Callback used to compare to given lines to determine if they should be considered equal when patching. Defaults to strict equality but may be overridden to provide fuzzier comparison. Should return false if the lines should be rejected.
+
+* `JsDiff.applyPatches(patch, options)` - applies one or more patches.
+
+    This method will iterate over the contents of the patch and apply to data provided through callbacks. The general flow for each patch index is:
+
+    - `options.loadFile(index, callback)` is called. The caller should then load the contents of the file and then pass that to the `callback(err, data)` callback. Passing an `err` will terminate further patch execution.
+    - `options.patched(index, content, callback)` is called once the patch has been applied. `content` will be the return value from `applyPatch`. When it's ready, the caller should call `callback(err)` callback. Passing an `err` will terminate further patch execution.
+
+    Once all patches have been applied or an error occurs, the `options.complete(err)` callback is made.
+
+* `JsDiff.parsePatch(diffStr)` - Parses a patch into structured data
+
+    Return a JSON object representation of the a patch, suitable for use with the `applyPatch` method. This parses to the same structure returned by `JsDiff.structuredPatch`.
+
+* `convertChangesToXML(changes)` - converts a list of changes to a serialized XML format
+
+
+All methods above which accept the optional `callback` method will run in sync mode when that parameter is omitted and in async mode when supplied. This allows for larger diffs without blocking the event loop. This may be passed either directly as the final parameter or as the `callback` field in the `options` object.
+
+### Change Objects
+Many of the methods above return change objects. These objects consist of the following fields:
+
+* `value`: Text content
+* `added`: True if the value was inserted into the new string
+* `removed`: True of the value was removed from the old string
+
+Note that some cases may omit a particular flag field. Comparison on the flag fields should always be done in a truthy or falsy manner.
+
+## Examples
+
+Basic example in Node
+
+```js
+require('colors');
+var jsdiff = require('diff');
+
+var one = 'beep boop';
+var other = 'beep boob blah';
+
+var diff = jsdiff.diffChars(one, other);
+
+diff.forEach(function(part){
+  // green for additions, red for deletions
+  // grey for common parts
+  var color = part.added ? 'green' :
+    part.removed ? 'red' : 'grey';
+  process.stderr.write(part.value[color]);
+});
+
+console.log();
+```
+Running the above program should yield
+
+<img src="images/node_example.png" alt="Node Example">
+
+Basic example in a web page
+
+```html
+<pre id="display"></pre>
+<script src="diff.js"></script>
+<script>
+var one = 'beep boop',
+    other = 'beep boob blah',
+    color = '',
+    span = null;
+
+var diff = JsDiff.diffChars(one, other),
+    display = document.getElementById('display'),
+    fragment = document.createDocumentFragment();
+
+diff.forEach(function(part){
+  // green for additions, red for deletions
+  // grey for common parts
+  color = part.added ? 'green' :
+    part.removed ? 'red' : 'grey';
+  span = document.createElement('span');
+  span.style.color = color;
+  span.appendChild(document
+    .createTextNode(part.value));
+  fragment.appendChild(span);
+});
+
+display.appendChild(fragment);
+</script>
+```
+
+Open the above .html file in a browser and you should see
+
+<img src="images/web_example.png" alt="Node Example">
+
+**[Full online demo](http://kpdecker.github.com/jsdiff)**
+
+## Compatibility
+
+[![Sauce Test Status](https://saucelabs.com/browser-matrix/jsdiff.svg)](https://saucelabs.com/u/jsdiff)
+
+jsdiff supports all ES3 environments with some known issues on IE8 and below. Under these browsers some diff algorithms such as word diff and others may fail due to lack of support for capturing groups in the `split` operation.
+
+## License
+
+See [LICENSE](https://github.com/kpdecker/jsdiff/blob/master/LICENSE).
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/dist/diff.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/dist/diff.js
new file mode 100644
index 00000000000..0b824f1237d
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/dist/diff.js
@@ -0,0 +1,1843 @@
+/*!
+
+ diff v3.5.0
+
+Software License Agreement (BSD License)
+
+Copyright (c) 2009-2015, Kevin Decker <kpdecker@gmail.com>
+
+All rights reserved.
+
+Redistribution and use of this software in source and binary forms, with or without modification,
+are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above
+  copyright notice, this list of conditions and the
+  following disclaimer.
+
+* Redistributions in binary form must reproduce the above
+  copyright notice, this list of conditions and the
+  following disclaimer in the documentation and/or other
+  materials provided with the distribution.
+
+* Neither the name of Kevin Decker nor the names of its
+  contributors may be used to endorse or promote products
+  derived from this software without specific prior
+  written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND
+FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR
+CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER
+IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
+OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+@license
+*/
+(function webpackUniversalModuleDefinition(root, factory) {
+	if(typeof exports === 'object' && typeof module === 'object')
+		module.exports = factory();
+	else if(typeof define === 'function' && define.amd)
+		define([], factory);
+	else if(typeof exports === 'object')
+		exports["JsDiff"] = factory();
+	else
+		root["JsDiff"] = factory();
+})(this, function() {
+return /******/ (function(modules) { // webpackBootstrap
+/******/ 	// The module cache
+/******/ 	var installedModules = {};
+
+/******/ 	// The require function
+/******/ 	function __webpack_require__(moduleId) {
+
+/******/ 		// Check if module is in cache
+/******/ 		if(installedModules[moduleId])
+/******/ 			return installedModules[moduleId].exports;
+
+/******/ 		// Create a new module (and put it into the cache)
+/******/ 		var module = installedModules[moduleId] = {
+/******/ 			exports: {},
+/******/ 			id: moduleId,
+/******/ 			loaded: false
+/******/ 		};
+
+/******/ 		// Execute the module function
+/******/ 		modules[moduleId].call(module.exports, module, module.exports, __webpack_require__);
+
+/******/ 		// Flag the module as loaded
+/******/ 		module.loaded = true;
+
+/******/ 		// Return the exports of the module
+/******/ 		return module.exports;
+/******/ 	}
+
+
+/******/ 	// expose the modules object (__webpack_modules__)
+/******/ 	__webpack_require__.m = modules;
+
+/******/ 	// expose the module cache
+/******/ 	__webpack_require__.c = installedModules;
+
+/******/ 	// __webpack_public_path__
+/******/ 	__webpack_require__.p = "";
+
+/******/ 	// Load entry module and return exports
+/******/ 	return __webpack_require__(0);
+/******/ })
+/************************************************************************/
+/******/ ([
+/* 0 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.canonicalize = exports.convertChangesToXML = exports.convertChangesToDMP = exports.merge = exports.parsePatch = exports.applyPatches = exports.applyPatch = exports.createPatch = exports.createTwoFilesPatch = exports.structuredPatch = exports.diffArrays = exports.diffJson = exports.diffCss = exports.diffSentences = exports.diffTrimmedLines = exports.diffLines = exports.diffWordsWithSpace = exports.diffWords = exports.diffChars = exports.Diff = undefined;
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_character = __webpack_require__(2) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_word = __webpack_require__(3) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_line = __webpack_require__(5) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_sentence = __webpack_require__(6) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_css = __webpack_require__(7) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_json = __webpack_require__(8) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_array = __webpack_require__(9) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_apply = __webpack_require__(10) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_parse = __webpack_require__(11) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_merge = __webpack_require__(13) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_create = __webpack_require__(14) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_dmp = __webpack_require__(16) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_xml = __webpack_require__(17) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/* See LICENSE file for terms of use */
+
+	/*
+	 * Text diff implementation.
+	 *
+	 * This library supports the following APIS:
+	 * JsDiff.diffChars: Character by character diff
+	 * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace
+	 * JsDiff.diffLines: Line based diff
+	 *
+	 * JsDiff.diffCss: Diff targeted at CSS content
+	 *
+	 * These methods are based on the implementation proposed in
+	 * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986).
+	 * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927
+	 */
+	exports. /*istanbul ignore end*/Diff = _base2['default'];
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffChars = _character.diffChars;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWords = _word.diffWords;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = _word.diffWordsWithSpace;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffLines = _line.diffLines;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = _line.diffTrimmedLines;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffSentences = _sentence.diffSentences;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffCss = _css.diffCss;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffJson = _json.diffJson;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffArrays = _array.diffArrays;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/structuredPatch = _create.structuredPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = _create.createTwoFilesPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = _create.createPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatch = _apply.applyPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = _apply.applyPatches;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/parsePatch = _parse.parsePatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = _merge.merge;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToDMP = _dmp.convertChangesToDMP;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToXML = _xml.convertChangesToXML;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = _json.canonicalize;
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uL3NyYy9pbmRleC5qcyJdLCJuYW1lcyI6WyJEaWZmIiwiZGlmZkNoYXJzIiwiZGlmZldvcmRzIiwiZGlmZldvcmRzV2l0aFNwYWNlIiwiZGlmZkxpbmVzIiwiZGlmZlRyaW1tZWRMaW5lcyIsImRpZmZTZW50ZW5jZXMiLCJkaWZmQ3NzIiwiZGlmZkpzb24iLCJkaWZmQXJyYXlzIiwic3RydWN0dXJlZFBhdGNoIiwiY3JlYXRlVHdvRmlsZXNQYXRjaCIsImNyZWF0ZVBhdGNoIiwiYXBwbHlQYXRjaCIsImFwcGx5UGF0Y2hlcyIsInBhcnNlUGF0Y2giLCJtZXJnZSIsImNvbnZlcnRDaGFuZ2VzVG9ETVAiLCJjb252ZXJ0Q2hhbmdlc1RvWE1MIiwiY2Fub25pY2FsaXplIl0sIm1hcHBpbmdzIjoiOzs7Ozt1QkFnQkE7Ozs7dUJBQ0E7O0FBQ0E7O0FBQ0E7O0FBQ0E7O0FBRUE7O0FBQ0E7O0FBRUE7O0FBRUE7O0FBQ0E7O0FBQ0E7O0FBQ0E7O0FBRUE7O0FBQ0E7Ozs7QUFqQ0E7O0FBRUE7Ozs7Ozs7Ozs7Ozs7O2dDQWtDRUEsSTt5REFFQUMsUzt5REFDQUMsUzt5REFDQUMsa0I7eURBQ0FDLFM7eURBQ0FDLGdCO3lEQUNBQyxhO3lEQUVBQyxPO3lEQUNBQyxRO3lEQUVBQyxVO3lEQUVBQyxlO3lEQUNBQyxtQjt5REFDQUMsVzt5REFDQUMsVTt5REFDQUMsWTt5REFDQUMsVTt5REFDQUMsSzt5REFDQUMsbUI7eURBQ0FDLG1CO3lEQUNBQyxZIiwiZmlsZSI6ImluZGV4LmpzIiwic291cmNlc0NvbnRlbnQiOlsiLyogU2VlIExJQ0VOU0UgZmlsZSBmb3IgdGVybXMgb2YgdXNlICovXG5cbi8qXG4gKiBUZXh0IGRpZmYgaW1wbGVtZW50YXRpb24uXG4gKlxuICogVGhpcyBsaWJyYXJ5IHN1cHBvcnRzIHRoZSBmb2xsb3dpbmcgQVBJUzpcbiAqIEpzRGlmZi5kaWZmQ2hhcnM6IENoYXJhY3RlciBieSBjaGFyYWN0ZXIgZGlmZlxuICogSnNEaWZmLmRpZmZXb3JkczogV29yZCAoYXMgZGVmaW5lZCBieSBcXGIgcmVnZXgpIGRpZmYgd2hpY2ggaWdub3JlcyB3aGl0ZXNwYWNlXG4gKiBKc0RpZmYuZGlmZkxpbmVzOiBMaW5lIGJhc2VkIGRpZmZcbiAqXG4gKiBKc0RpZmYuZGlmZkNzczogRGlmZiB0YXJnZXRlZCBhdCBDU1MgY29udGVudFxuICpcbiAqIFRoZXNlIG1ldGhvZHMgYXJlIGJhc2VkIG9uIHRoZSBpbXBsZW1lbnRhdGlvbiBwcm9wb3NlZCBpblxuICogXCJBbiBPKE5EKSBEaWZmZXJlbmNlIEFsZ29yaXRobSBhbmQgaXRzIFZhcmlhdGlvbnNcIiAoTXllcnMsIDE5ODYpLlxuICogaHR0cDovL2NpdGVzZWVyeC5pc3QucHN1LmVkdS92aWV3ZG9jL3N1bW1hcnk/ZG9pPTEwLjEuMS40LjY5MjdcbiAqL1xuaW1wb3J0IERpZmYgZnJvbSAnLi9kaWZmL2Jhc2UnO1xuaW1wb3J0IHtkaWZmQ2hhcnN9IGZyb20gJy4vZGlmZi9jaGFyYWN0ZXInO1xuaW1wb3J0IHtkaWZmV29yZHMsIGRpZmZXb3Jkc1dpdGhTcGFjZX0gZnJvbSAnLi9kaWZmL3dvcmQnO1xuaW1wb3J0IHtkaWZmTGluZXMsIGRpZmZUcmltbWVkTGluZXN9IGZyb20gJy4vZGlmZi9saW5lJztcbmltcG9ydCB7ZGlmZlNlbnRlbmNlc30gZnJvbSAnLi9kaWZmL3NlbnRlbmNlJztcblxuaW1wb3J0IHtkaWZmQ3NzfSBmcm9tICcuL2RpZmYvY3NzJztcbmltcG9ydCB7ZGlmZkpzb24sIGNhbm9uaWNhbGl6ZX0gZnJvbSAnLi9kaWZmL2pzb24nO1xuXG5pbXBvcnQge2RpZmZBcnJheXN9IGZyb20gJy4vZGlmZi9hcnJheSc7XG5cbmltcG9ydCB7YXBwbHlQYXRjaCwgYXBwbHlQYXRjaGVzfSBmcm9tICcuL3BhdGNoL2FwcGx5JztcbmltcG9ydCB7cGFyc2VQYXRjaH0gZnJvbSAnLi9wYXRjaC9wYXJzZSc7XG5pbXBvcnQge21lcmdlfSBmcm9tICcuL3BhdGNoL21lcmdlJztcbmltcG9ydCB7c3RydWN0dXJlZFBhdGNoLCBjcmVhdGVUd29GaWxlc1BhdGNoLCBjcmVhdGVQYXRjaH0gZnJvbSAnLi9wYXRjaC9jcmVhdGUnO1xuXG5pbXBvcnQge2NvbnZlcnRDaGFuZ2VzVG9ETVB9IGZyb20gJy4vY29udmVydC9kbXAnO1xuaW1wb3J0IHtjb252ZXJ0Q2hhbmdlc1RvWE1MfSBmcm9tICcuL2NvbnZlcnQveG1sJztcblxuZXhwb3J0IHtcbiAgRGlmZixcblxuICBkaWZmQ2hhcnMsXG4gIGRpZmZXb3JkcyxcbiAgZGlmZldvcmRzV2l0aFNwYWNlLFxuICBkaWZmTGluZXMsXG4gIGRpZmZUcmltbWVkTGluZXMsXG4gIGRpZmZTZW50ZW5jZXMsXG5cbiAgZGlmZkNzcyxcbiAgZGlmZkpzb24sXG5cbiAgZGlmZkFycmF5cyxcblxuICBzdHJ1Y3R1cmVkUGF0Y2gsXG4gIGNyZWF0ZVR3b0ZpbGVzUGF0Y2gsXG4gIGNyZWF0ZVBhdGNoLFxuICBhcHBseVBhdGNoLFxuICBhcHBseVBhdGNoZXMsXG4gIHBhcnNlUGF0Y2gsXG4gIG1lcmdlLFxuICBjb252ZXJ0Q2hhbmdlc1RvRE1QLFxuICBjb252ZXJ0Q2hhbmdlc1RvWE1MLFxuICBjYW5vbmljYWxpemVcbn07XG4iXX0=
+
+
+/***/ }),
+/* 1 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports['default'] = /*istanbul ignore end*/Diff;
+	function Diff() {}
+
+	Diff.prototype = {
+	  /*istanbul ignore start*/ /*istanbul ignore end*/diff: function diff(oldString, newString) {
+	    /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+	    var callback = options.callback;
+	    if (typeof options === 'function') {
+	      callback = options;
+	      options = {};
+	    }
+	    this.options = options;
+
+	    var self = this;
+
+	    function done(value) {
+	      if (callback) {
+	        setTimeout(function () {
+	          callback(undefined, value);
+	        }, 0);
+	        return true;
+	      } else {
+	        return value;
+	      }
+	    }
+
+	    // Allow subclasses to massage the input prior to running
+	    oldString = this.castInput(oldString);
+	    newString = this.castInput(newString);
+
+	    oldString = this.removeEmpty(this.tokenize(oldString));
+	    newString = this.removeEmpty(this.tokenize(newString));
+
+	    var newLen = newString.length,
+	        oldLen = oldString.length;
+	    var editLength = 1;
+	    var maxEditLength = newLen + oldLen;
+	    var bestPath = [{ newPos: -1, components: [] }];
+
+	    // Seed editLength = 0, i.e. the content starts with the same values
+	    var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0);
+	    if (bestPath[0].newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
+	      // Identity per the equality and tokenizer
+	      return done([{ value: this.join(newString), count: newString.length }]);
+	    }
+
+	    // Main worker method. checks all permutations of a given edit length for acceptance.
+	    function execEditLength() {
+	      for (var diagonalPath = -1 * editLength; diagonalPath <= editLength; diagonalPath += 2) {
+	        var basePath = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+	        var addPath = bestPath[diagonalPath - 1],
+	            removePath = bestPath[diagonalPath + 1],
+	            _oldPos = (removePath ? removePath.newPos : 0) - diagonalPath;
+	        if (addPath) {
+	          // No one else is going to attempt to use this value, clear it
+	          bestPath[diagonalPath - 1] = undefined;
+	        }
+
+	        var canAdd = addPath && addPath.newPos + 1 < newLen,
+	            canRemove = removePath && 0 <= _oldPos && _oldPos < oldLen;
+	        if (!canAdd && !canRemove) {
+	          // If this path is a terminal then prune
+	          bestPath[diagonalPath] = undefined;
+	          continue;
+	        }
+
+	        // Select the diagonal that we want to branch from. We select the prior
+	        // path whose position in the new string is the farthest from the origin
+	        // and does not pass the bounds of the diff graph
+	        if (!canAdd || canRemove && addPath.newPos < removePath.newPos) {
+	          basePath = clonePath(removePath);
+	          self.pushComponent(basePath.components, undefined, true);
+	        } else {
+	          basePath = addPath; // No need to clone, we've pulled it from the list
+	          basePath.newPos++;
+	          self.pushComponent(basePath.components, true, undefined);
+	        }
+
+	        _oldPos = self.extractCommon(basePath, newString, oldString, diagonalPath);
+
+	        // If we have hit the end of both strings, then we are done
+	        if (basePath.newPos + 1 >= newLen && _oldPos + 1 >= oldLen) {
+	          return done(buildValues(self, basePath.components, newString, oldString, self.useLongestToken));
+	        } else {
+	          // Otherwise track this path as a potential candidate and continue.
+	          bestPath[diagonalPath] = basePath;
+	        }
+	      }
+
+	      editLength++;
+	    }
+
+	    // Performs the length of edit iteration. Is a bit fugly as this has to support the
+	    // sync and async mode which is never fun. Loops over execEditLength until a value
+	    // is produced.
+	    if (callback) {
+	      (function exec() {
+	        setTimeout(function () {
+	          // This should not happen, but we want to be safe.
+	          /* istanbul ignore next */
+	          if (editLength > maxEditLength) {
+	            return callback();
+	          }
+
+	          if (!execEditLength()) {
+	            exec();
+	          }
+	        }, 0);
+	      })();
+	    } else {
+	      while (editLength <= maxEditLength) {
+	        var ret = execEditLength();
+	        if (ret) {
+	          return ret;
+	        }
+	      }
+	    }
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/pushComponent: function pushComponent(components, added, removed) {
+	    var last = components[components.length - 1];
+	    if (last && last.added === added && last.removed === removed) {
+	      // We need to clone here as the component clone operation is just
+	      // as shallow array clone
+	      components[components.length - 1] = { count: last.count + 1, added: added, removed: removed };
+	    } else {
+	      components.push({ count: 1, added: added, removed: removed });
+	    }
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/extractCommon: function extractCommon(basePath, newString, oldString, diagonalPath) {
+	    var newLen = newString.length,
+	        oldLen = oldString.length,
+	        newPos = basePath.newPos,
+	        oldPos = newPos - diagonalPath,
+	        commonCount = 0;
+	    while (newPos + 1 < newLen && oldPos + 1 < oldLen && this.equals(newString[newPos + 1], oldString[oldPos + 1])) {
+	      newPos++;
+	      oldPos++;
+	      commonCount++;
+	    }
+
+	    if (commonCount) {
+	      basePath.components.push({ count: commonCount });
+	    }
+
+	    basePath.newPos = newPos;
+	    return oldPos;
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/equals: function equals(left, right) {
+	    if (this.options.comparator) {
+	      return this.options.comparator(left, right);
+	    } else {
+	      return left === right || this.options.ignoreCase && left.toLowerCase() === right.toLowerCase();
+	    }
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/removeEmpty: function removeEmpty(array) {
+	    var ret = [];
+	    for (var i = 0; i < array.length; i++) {
+	      if (array[i]) {
+	        ret.push(array[i]);
+	      }
+	    }
+	    return ret;
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/castInput: function castInput(value) {
+	    return value;
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/tokenize: function tokenize(value) {
+	    return value.split('');
+	  },
+	  /*istanbul ignore start*/ /*istanbul ignore end*/join: function join(chars) {
+	    return chars.join('');
+	  }
+	};
+
+	function buildValues(diff, components, newString, oldString, useLongestToken) {
+	  var componentPos = 0,
+	      componentLen = components.length,
+	      newPos = 0,
+	      oldPos = 0;
+
+	  for (; componentPos < componentLen; componentPos++) {
+	    var component = components[componentPos];
+	    if (!component.removed) {
+	      if (!component.added && useLongestToken) {
+	        var value = newString.slice(newPos, newPos + component.count);
+	        value = value.map(function (value, i) {
+	          var oldValue = oldString[oldPos + i];
+	          return oldValue.length > value.length ? oldValue : value;
+	        });
+
+	        component.value = diff.join(value);
+	      } else {
+	        component.value = diff.join(newString.slice(newPos, newPos + component.count));
+	      }
+	      newPos += component.count;
+
+	      // Common case
+	      if (!component.added) {
+	        oldPos += component.count;
+	      }
+	    } else {
+	      component.value = diff.join(oldString.slice(oldPos, oldPos + component.count));
+	      oldPos += component.count;
+
+	      // Reverse add and remove so removes are output first to match common convention
+	      // The diffing algorithm is tied to add then remove output and this is the simplest
+	      // route to get the desired output with minimal overhead.
+	      if (componentPos && components[componentPos - 1].added) {
+	        var tmp = components[componentPos - 1];
+	        components[componentPos - 1] = components[componentPos];
+	        components[componentPos] = tmp;
+	      }
+	    }
+	  }
+
+	  // Special case handle for when one terminal is ignored (i.e. whitespace).
+	  // For this case we merge the terminal into the prior string and drop the change.
+	  // This is only available for string mode.
+	  var lastComponent = components[componentLen - 1];
+	  if (componentLen > 1 && typeof lastComponent.value === 'string' && (lastComponent.added || lastComponent.removed) && diff.equals('', lastComponent.value)) {
+	    components[componentLen - 2].value += lastComponent.value;
+	    components.pop();
+	  }
+
+	  return components;
+	}
+
+	function clonePath(path) {
+	  return { newPos: path.newPos, components: path.components.slice(0) };
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2Jhc2UuanMiXSwibmFtZXMiOlsiRGlmZiIsInByb3RvdHlwZSIsImRpZmYiLCJvbGRTdHJpbmciLCJuZXdTdHJpbmciLCJvcHRpb25zIiwiY2FsbGJhY2siLCJzZWxmIiwiZG9uZSIsInZhbHVlIiwic2V0VGltZW91dCIsInVuZGVmaW5lZCIsImNhc3RJbnB1dCIsInJlbW92ZUVtcHR5IiwidG9rZW5pemUiLCJuZXdMZW4iLCJsZW5ndGgiLCJvbGRMZW4iLCJlZGl0TGVuZ3RoIiwibWF4RWRpdExlbmd0aCIsImJlc3RQYXRoIiwibmV3UG9zIiwiY29tcG9uZW50cyIsIm9sZFBvcyIsImV4dHJhY3RDb21tb24iLCJqb2luIiwiY291bnQiLCJleGVjRWRpdExlbmd0aCIsImRpYWdvbmFsUGF0aCIsImJhc2VQYXRoIiwiYWRkUGF0aCIsInJlbW92ZVBhdGgiLCJjYW5BZGQiLCJjYW5SZW1vdmUiLCJjbG9uZVBhdGgiLCJwdXNoQ29tcG9uZW50IiwiYnVpbGRWYWx1ZXMiLCJ1c2VMb25nZXN0VG9rZW4iLCJleGVjIiwicmV0IiwiYWRkZWQiLCJyZW1vdmVkIiwibGFzdCIsInB1c2giLCJjb21tb25Db3VudCIsImVxdWFscyIsImxlZnQiLCJyaWdodCIsImNvbXBhcmF0b3IiLCJpZ25vcmVDYXNlIiwidG9Mb3dlckNhc2UiLCJhcnJheSIsImkiLCJzcGxpdCIsImNoYXJzIiwiY29tcG9uZW50UG9zIiwiY29tcG9uZW50TGVuIiwiY29tcG9uZW50Iiwic2xpY2UiLCJtYXAiLCJvbGRWYWx1ZSIsInRtcCIsImxhc3RDb21wb25lbnQiLCJwb3AiLCJwYXRoIl0sIm1hcHBpbmdzIjoiOzs7NENBQXdCQSxJO0FBQVQsU0FBU0EsSUFBVCxHQUFnQixDQUFFOztBQUVqQ0EsS0FBS0MsU0FBTCxHQUFpQjtBQUFBLG1EQUNmQyxJQURlLGdCQUNWQyxTQURVLEVBQ0NDLFNBREQsRUFDMEI7QUFBQSx3REFBZEMsT0FBYyx1RUFBSixFQUFJOztBQUN2QyxRQUFJQyxXQUFXRCxRQUFRQyxRQUF2QjtBQUNBLFFBQUksT0FBT0QsT0FBUCxLQUFtQixVQUF2QixFQUFtQztBQUNqQ0MsaUJBQVdELE9BQVg7QUFDQUEsZ0JBQVUsRUFBVjtBQUNEO0FBQ0QsU0FBS0EsT0FBTCxHQUFlQSxPQUFmOztBQUVBLFFBQUlFLE9BQU8sSUFBWDs7QUFFQSxhQUFTQyxJQUFULENBQWNDLEtBQWQsRUFBcUI7QUFDbkIsVUFBSUgsUUFBSixFQUFjO0FBQ1pJLG1CQUFXLFlBQVc7QUFBRUosbUJBQVNLLFNBQVQsRUFBb0JGLEtBQXBCO0FBQTZCLFNBQXJELEVBQXVELENBQXZEO0FBQ0EsZUFBTyxJQUFQO0FBQ0QsT0FIRCxNQUdPO0FBQ0wsZUFBT0EsS0FBUDtBQUNEO0FBQ0Y7O0FBRUQ7QUFDQU4sZ0JBQVksS0FBS1MsU0FBTCxDQUFlVCxTQUFmLENBQVo7QUFDQUMsZ0JBQVksS0FBS1EsU0FBTCxDQUFlUixTQUFmLENBQVo7O0FBRUFELGdCQUFZLEtBQUtVLFdBQUwsQ0FBaUIsS0FBS0MsUUFBTCxDQUFjWCxTQUFkLENBQWpCLENBQVo7QUFDQUMsZ0JBQVksS0FBS1MsV0FBTCxDQUFpQixLQUFLQyxRQUFMLENBQWNWLFNBQWQsQ0FBakIsQ0FBWjs7QUFFQSxRQUFJVyxTQUFTWCxVQUFVWSxNQUF2QjtBQUFBLFFBQStCQyxTQUFTZCxVQUFVYSxNQUFsRDtBQUNBLFFBQUlFLGFBQWEsQ0FBakI7QUFDQSxRQUFJQyxnQkFBZ0JKLFNBQVNFLE1BQTdCO0FBQ0EsUUFBSUcsV0FBVyxDQUFDLEVBQUVDLFFBQVEsQ0FBQyxDQUFYLEVBQWNDLFlBQVksRUFBMUIsRUFBRCxDQUFmOztBQUVBO0FBQ0EsUUFBSUMsU0FBUyxLQUFLQyxhQUFMLENBQW1CSixTQUFTLENBQVQsQ0FBbkIsRUFBZ0NoQixTQUFoQyxFQUEyQ0QsU0FBM0MsRUFBc0QsQ0FBdEQsQ0FBYjtBQUNBLFFBQUlpQixTQUFTLENBQVQsRUFBWUMsTUFBWixHQUFxQixDQUFyQixJQUEwQk4sTUFBMUIsSUFBb0NRLFNBQVMsQ0FBVCxJQUFjTixNQUF0RCxFQUE4RDtBQUM1RDtBQUNBLGFBQU9ULEtBQUssQ0FBQyxFQUFDQyxPQUFPLEtBQUtnQixJQUFMLENBQVVyQixTQUFWLENBQVIsRUFBOEJzQixPQUFPdEIsVUFBVVksTUFBL0MsRUFBRCxDQUFMLENBQVA7QUFDRDs7QUFFRDtBQUNBLGFBQVNXLGNBQVQsR0FBMEI7QUFDeEIsV0FBSyxJQUFJQyxlQUFlLENBQUMsQ0FBRCxHQUFLVixVQUE3QixFQUF5Q1UsZ0JBQWdCVixVQUF6RCxFQUFxRVUsZ0JBQWdCLENBQXJGLEVBQXdGO0FBQ3RGLFlBQUlDLDBDQUFKO0FBQ0EsWUFBSUMsVUFBVVYsU0FBU1EsZUFBZSxDQUF4QixDQUFkO0FBQUEsWUFDSUcsYUFBYVgsU0FBU1EsZUFBZSxDQUF4QixDQURqQjtBQUFBLFlBRUlMLFVBQVMsQ0FBQ1EsYUFBYUEsV0FBV1YsTUFBeEIsR0FBaUMsQ0FBbEMsSUFBdUNPLFlBRnBEO0FBR0EsWUFBSUUsT0FBSixFQUFhO0FBQ1g7QUFDQVYsbUJBQVNRLGVBQWUsQ0FBeEIsSUFBNkJqQixTQUE3QjtBQUNEOztBQUVELFlBQUlxQixTQUFTRixXQUFXQSxRQUFRVCxNQUFSLEdBQWlCLENBQWpCLEdBQXFCTixNQUE3QztBQUFBLFlBQ0lrQixZQUFZRixjQUFjLEtBQUtSLE9BQW5CLElBQTZCQSxVQUFTTixNQUR0RDtBQUVBLFlBQUksQ0FBQ2UsTUFBRCxJQUFXLENBQUNDLFNBQWhCLEVBQTJCO0FBQ3pCO0FBQ0FiLG1CQUFTUSxZQUFULElBQXlCakIsU0FBekI7QUFDQTtBQUNEOztBQUVEO0FBQ0E7QUFDQTtBQUNBLFlBQUksQ0FBQ3FCLE1BQUQsSUFBWUMsYUFBYUgsUUFBUVQsTUFBUixHQUFpQlUsV0FBV1YsTUFBekQsRUFBa0U7QUFDaEVRLHFCQUFXSyxVQUFVSCxVQUFWLENBQVg7QUFDQXhCLGVBQUs0QixhQUFMLENBQW1CTixTQUFTUCxVQUE1QixFQUF3Q1gsU0FBeEMsRUFBbUQsSUFBbkQ7QUFDRCxTQUhELE1BR087QUFDTGtCLHFCQUFXQyxPQUFYLENBREssQ0FDaUI7QUFDdEJELG1CQUFTUixNQUFUO0FBQ0FkLGVBQUs0QixhQUFMLENBQW1CTixTQUFTUCxVQUE1QixFQUF3QyxJQUF4QyxFQUE4Q1gsU0FBOUM7QUFDRDs7QUFFRFksa0JBQVNoQixLQUFLaUIsYUFBTCxDQUFtQkssUUFBbkIsRUFBNkJ6QixTQUE3QixFQUF3Q0QsU0FBeEMsRUFBbUR5QixZQUFuRCxDQUFUOztBQUVBO0FBQ0EsWUFBSUMsU0FBU1IsTUFBVCxHQUFrQixDQUFsQixJQUF1Qk4sTUFBdkIsSUFBaUNRLFVBQVMsQ0FBVCxJQUFjTixNQUFuRCxFQUEyRDtBQUN6RCxpQkFBT1QsS0FBSzRCLFlBQVk3QixJQUFaLEVBQWtCc0IsU0FBU1AsVUFBM0IsRUFBdUNsQixTQUF2QyxFQUFrREQsU0FBbEQsRUFBNkRJLEtBQUs4QixlQUFsRSxDQUFMLENBQVA7QUFDRCxTQUZELE1BRU87QUFDTDtBQUNBakIsbUJBQVNRLFlBQVQsSUFBeUJDLFFBQXpCO0FBQ0Q7QUFDRjs7QUFFRFg7QUFDRDs7QUFFRDtBQUNBO0FBQ0E7QUFDQSxRQUFJWixRQUFKLEVBQWM7QUFDWCxnQkFBU2dDLElBQVQsR0FBZ0I7QUFDZjVCLG1CQUFXLFlBQVc7QUFDcEI7QUFDQTtBQUNBLGNBQUlRLGFBQWFDLGFBQWpCLEVBQWdDO0FBQzlCLG1CQUFPYixVQUFQO0FBQ0Q7O0FBRUQsY0FBSSxDQUFDcUIsZ0JBQUwsRUFBdUI7QUFDckJXO0FBQ0Q7QUFDRixTQVZELEVBVUcsQ0FWSDtBQVdELE9BWkEsR0FBRDtBQWFELEtBZEQsTUFjTztBQUNMLGFBQU9wQixjQUFjQyxhQUFyQixFQUFvQztBQUNsQyxZQUFJb0IsTUFBTVosZ0JBQVY7QUFDQSxZQUFJWSxHQUFKLEVBQVM7QUFDUCxpQkFBT0EsR0FBUDtBQUNEO0FBQ0Y7QUFDRjtBQUNGLEdBOUdjO0FBQUEsbURBZ0hmSixhQWhIZSx5QkFnSERiLFVBaEhDLEVBZ0hXa0IsS0FoSFgsRUFnSGtCQyxPQWhIbEIsRUFnSDJCO0FBQ3hDLFFBQUlDLE9BQU9wQixXQUFXQSxXQUFXTixNQUFYLEdBQW9CLENBQS9CLENBQVg7QUFDQSxRQUFJMEIsUUFBUUEsS0FBS0YsS0FBTCxLQUFlQSxLQUF2QixJQUFnQ0UsS0FBS0QsT0FBTCxLQUFpQkEsT0FBckQsRUFBOEQ7QUFDNUQ7QUFDQTtBQUNBbkIsaUJBQVdBLFdBQVdOLE1BQVgsR0FBb0IsQ0FBL0IsSUFBb0MsRUFBQ1UsT0FBT2dCLEtBQUtoQixLQUFMLEdBQWEsQ0FBckIsRUFBd0JjLE9BQU9BLEtBQS9CLEVBQXNDQyxTQUFTQSxPQUEvQyxFQUFwQztBQUNELEtBSkQsTUFJTztBQUNMbkIsaUJBQVdxQixJQUFYLENBQWdCLEVBQUNqQixPQUFPLENBQVIsRUFBV2MsT0FBT0EsS0FBbEIsRUFBeUJDLFNBQVNBLE9BQWxDLEVBQWhCO0FBQ0Q7QUFDRixHQXpIYztBQUFBLG1EQTBIZmpCLGFBMUhlLHlCQTBIREssUUExSEMsRUEwSFN6QixTQTFIVCxFQTBIb0JELFNBMUhwQixFQTBIK0J5QixZQTFIL0IsRUEwSDZDO0FBQzFELFFBQUliLFNBQVNYLFVBQVVZLE1BQXZCO0FBQUEsUUFDSUMsU0FBU2QsVUFBVWEsTUFEdkI7QUFBQSxRQUVJSyxTQUFTUSxTQUFTUixNQUZ0QjtBQUFBLFFBR0lFLFNBQVNGLFNBQVNPLFlBSHRCO0FBQUEsUUFLSWdCLGNBQWMsQ0FMbEI7QUFNQSxXQUFPdkIsU0FBUyxDQUFULEdBQWFOLE1BQWIsSUFBdUJRLFNBQVMsQ0FBVCxHQUFhTixNQUFwQyxJQUE4QyxLQUFLNEIsTUFBTCxDQUFZekMsVUFBVWlCLFNBQVMsQ0FBbkIsQ0FBWixFQUFtQ2xCLFVBQVVvQixTQUFTLENBQW5CLENBQW5DLENBQXJELEVBQWdIO0FBQzlHRjtBQUNBRTtBQUNBcUI7QUFDRDs7QUFFRCxRQUFJQSxXQUFKLEVBQWlCO0FBQ2ZmLGVBQVNQLFVBQVQsQ0FBb0JxQixJQUFwQixDQUF5QixFQUFDakIsT0FBT2tCLFdBQVIsRUFBekI7QUFDRDs7QUFFRGYsYUFBU1IsTUFBVCxHQUFrQkEsTUFBbEI7QUFDQSxXQUFPRSxNQUFQO0FBQ0QsR0E3SWM7QUFBQSxtREErSWZzQixNQS9JZSxrQkErSVJDLElBL0lRLEVBK0lGQyxLQS9JRSxFQStJSztBQUNsQixRQUFJLEtBQUsxQyxPQUFMLENBQWEyQyxVQUFqQixFQUE2QjtBQUMzQixhQUFPLEtBQUszQyxPQUFMLENBQWEyQyxVQUFiLENBQXdCRixJQUF4QixFQUE4QkMsS0FBOUIsQ0FBUDtBQUNELEtBRkQsTUFFTztBQUNMLGFBQU9ELFNBQVNDLEtBQVQsSUFDRCxLQUFLMUMsT0FBTCxDQUFhNEMsVUFBYixJQUEyQkgsS0FBS0ksV0FBTCxPQUF1QkgsTUFBTUcsV0FBTixFQUR4RDtBQUVEO0FBQ0YsR0F0SmM7QUFBQSxtREF1SmZyQyxXQXZKZSx1QkF1SkhzQyxLQXZKRyxFQXVKSTtBQUNqQixRQUFJWixNQUFNLEVBQVY7QUFDQSxTQUFLLElBQUlhLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsTUFBTW5DLE1BQTFCLEVBQWtDb0MsR0FBbEMsRUFBdUM7QUFDckMsVUFBSUQsTUFBTUMsQ0FBTixDQUFKLEVBQWM7QUFDWmIsWUFBSUksSUFBSixDQUFTUSxNQUFNQyxDQUFOLENBQVQ7QUFDRDtBQUNGO0FBQ0QsV0FBT2IsR0FBUDtBQUNELEdBL0pjO0FBQUEsbURBZ0tmM0IsU0FoS2UscUJBZ0tMSCxLQWhLSyxFQWdLRTtBQUNmLFdBQU9BLEtBQVA7QUFDRCxHQWxLYztBQUFBLG1EQW1LZkssUUFuS2Usb0JBbUtOTCxLQW5LTSxFQW1LQztBQUNkLFdBQU9BLE1BQU00QyxLQUFOLENBQVksRUFBWixDQUFQO0FBQ0QsR0FyS2M7QUFBQSxtREFzS2Y1QixJQXRLZSxnQkFzS1Y2QixLQXRLVSxFQXNLSDtBQUNWLFdBQU9BLE1BQU03QixJQUFOLENBQVcsRUFBWCxDQUFQO0FBQ0Q7QUF4S2MsQ0FBakI7O0FBMktBLFNBQVNXLFdBQVQsQ0FBcUJsQyxJQUFyQixFQUEyQm9CLFVBQTNCLEVBQXVDbEIsU0FBdkMsRUFBa0RELFNBQWxELEVBQTZEa0MsZUFBN0QsRUFBOEU7QUFDNUUsTUFBSWtCLGVBQWUsQ0FBbkI7QUFBQSxNQUNJQyxlQUFlbEMsV0FBV04sTUFEOUI7QUFBQSxNQUVJSyxTQUFTLENBRmI7QUFBQSxNQUdJRSxTQUFTLENBSGI7O0FBS0EsU0FBT2dDLGVBQWVDLFlBQXRCLEVBQW9DRCxjQUFwQyxFQUFvRDtBQUNsRCxRQUFJRSxZQUFZbkMsV0FBV2lDLFlBQVgsQ0FBaEI7QUFDQSxRQUFJLENBQUNFLFVBQVVoQixPQUFmLEVBQXdCO0FBQ3RCLFVBQUksQ0FBQ2dCLFVBQVVqQixLQUFYLElBQW9CSCxlQUF4QixFQUF5QztBQUN2QyxZQUFJNUIsUUFBUUwsVUFBVXNELEtBQVYsQ0FBZ0JyQyxNQUFoQixFQUF3QkEsU0FBU29DLFVBQVUvQixLQUEzQyxDQUFaO0FBQ0FqQixnQkFBUUEsTUFBTWtELEdBQU4sQ0FBVSxVQUFTbEQsS0FBVCxFQUFnQjJDLENBQWhCLEVBQW1CO0FBQ25DLGNBQUlRLFdBQVd6RCxVQUFVb0IsU0FBUzZCLENBQW5CLENBQWY7QUFDQSxpQkFBT1EsU0FBUzVDLE1BQVQsR0FBa0JQLE1BQU1PLE1BQXhCLEdBQWlDNEMsUUFBakMsR0FBNENuRCxLQUFuRDtBQUNELFNBSE8sQ0FBUjs7QUFLQWdELGtCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVWhCLEtBQVYsQ0FBbEI7QUFDRCxPQVJELE1BUU87QUFDTGdELGtCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVXJCLFVBQVVzRCxLQUFWLENBQWdCckMsTUFBaEIsRUFBd0JBLFNBQVNvQyxVQUFVL0IsS0FBM0MsQ0FBVixDQUFsQjtBQUNEO0FBQ0RMLGdCQUFVb0MsVUFBVS9CLEtBQXBCOztBQUVBO0FBQ0EsVUFBSSxDQUFDK0IsVUFBVWpCLEtBQWYsRUFBc0I7QUFDcEJqQixrQkFBVWtDLFVBQVUvQixLQUFwQjtBQUNEO0FBQ0YsS0FsQkQsTUFrQk87QUFDTCtCLGdCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVXRCLFVBQVV1RCxLQUFWLENBQWdCbkMsTUFBaEIsRUFBd0JBLFNBQVNrQyxVQUFVL0IsS0FBM0MsQ0FBVixDQUFsQjtBQUNBSCxnQkFBVWtDLFVBQVUvQixLQUFwQjs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxVQUFJNkIsZ0JBQWdCakMsV0FBV2lDLGVBQWUsQ0FBMUIsRUFBNkJmLEtBQWpELEVBQXdEO0FBQ3RELFlBQUlxQixNQUFNdkMsV0FBV2lDLGVBQWUsQ0FBMUIsQ0FBVjtBQUNBakMsbUJBQVdpQyxlQUFlLENBQTFCLElBQStCakMsV0FBV2lDLFlBQVgsQ0FBL0I7QUFDQWpDLG1CQUFXaUMsWUFBWCxJQUEyQk0sR0FBM0I7QUFDRDtBQUNGO0FBQ0Y7O0FBRUQ7QUFDQTtBQUNBO0FBQ0EsTUFBSUMsZ0JBQWdCeEMsV0FBV2tDLGVBQWUsQ0FBMUIsQ0FBcEI7QUFDQSxNQUFJQSxlQUFlLENBQWYsSUFDRyxPQUFPTSxjQUFjckQsS0FBckIsS0FBK0IsUUFEbEMsS0FFSXFELGNBQWN0QixLQUFkLElBQXVCc0IsY0FBY3JCLE9BRnpDLEtBR0d2QyxLQUFLMkMsTUFBTCxDQUFZLEVBQVosRUFBZ0JpQixjQUFjckQsS0FBOUIsQ0FIUCxFQUc2QztBQUMzQ2EsZUFBV2tDLGVBQWUsQ0FBMUIsRUFBNkIvQyxLQUE3QixJQUFzQ3FELGNBQWNyRCxLQUFwRDtBQUNBYSxlQUFXeUMsR0FBWDtBQUNEOztBQUVELFNBQU96QyxVQUFQO0FBQ0Q7O0FBRUQsU0FBU1ksU0FBVCxDQUFtQjhCLElBQW5CLEVBQXlCO0FBQ3ZCLFNBQU8sRUFBRTNDLFFBQVEyQyxLQUFLM0MsTUFBZixFQUF1QkMsWUFBWTBDLEtBQUsxQyxVQUFMLENBQWdCb0MsS0FBaEIsQ0FBc0IsQ0FBdEIsQ0FBbkMsRUFBUDtBQUNEIiwiZmlsZSI6ImJhc2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZGVmYXVsdCBmdW5jdGlvbiBEaWZmKCkge31cblxuRGlmZi5wcm90b3R5cGUgPSB7XG4gIGRpZmYob2xkU3RyaW5nLCBuZXdTdHJpbmcsIG9wdGlvbnMgPSB7fSkge1xuICAgIGxldCBjYWxsYmFjayA9IG9wdGlvbnMuY2FsbGJhY2s7XG4gICAgaWYgKHR5cGVvZiBvcHRpb25zID09PSAnZnVuY3Rpb24nKSB7XG4gICAgICBjYWxsYmFjayA9IG9wdGlvbnM7XG4gICAgICBvcHRpb25zID0ge307XG4gICAgfVxuICAgIHRoaXMub3B0aW9ucyA9IG9wdGlvbnM7XG5cbiAgICBsZXQgc2VsZiA9IHRoaXM7XG5cbiAgICBmdW5jdGlvbiBkb25lKHZhbHVlKSB7XG4gICAgICBpZiAoY2FsbGJhY2spIHtcbiAgICAgICAgc2V0VGltZW91dChmdW5jdGlvbigpIHsgY2FsbGJhY2sodW5kZWZpbmVkLCB2YWx1ZSk7IH0sIDApO1xuICAgICAgICByZXR1cm4gdHJ1ZTtcbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIHJldHVybiB2YWx1ZTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICAvLyBBbGxvdyBzdWJjbGFzc2VzIHRvIG1hc3NhZ2UgdGhlIGlucHV0IHByaW9yIHRvIHJ1bm5pbmdcbiAgICBvbGRTdHJpbmcgPSB0aGlzLmNhc3RJbnB1dChvbGRTdHJpbmcpO1xuICAgIG5ld1N0cmluZyA9IHRoaXMuY2FzdElucHV0KG5ld1N0cmluZyk7XG5cbiAgICBvbGRTdHJpbmcgPSB0aGlzLnJlbW92ZUVtcHR5KHRoaXMudG9rZW5pemUob2xkU3RyaW5nKSk7XG4gICAgbmV3U3RyaW5nID0gdGhpcy5yZW1vdmVFbXB0eSh0aGlzLnRva2VuaXplKG5ld1N0cmluZykpO1xuXG4gICAgbGV0IG5ld0xlbiA9IG5ld1N0cmluZy5sZW5ndGgsIG9sZExlbiA9IG9sZFN0cmluZy5sZW5ndGg7XG4gICAgbGV0IGVkaXRMZW5ndGggPSAxO1xuICAgIGxldCBtYXhFZGl0TGVuZ3RoID0gbmV3TGVuICsgb2xkTGVuO1xuICAgIGxldCBiZXN0UGF0aCA9IFt7IG5ld1BvczogLTEsIGNvbXBvbmVudHM6IFtdIH1dO1xuXG4gICAgLy8gU2VlZCBlZGl0TGVuZ3RoID0gMCwgaS5lLiB0aGUgY29udGVudCBzdGFydHMgd2l0aCB0aGUgc2FtZSB2YWx1ZXNcbiAgICBsZXQgb2xkUG9zID0gdGhpcy5leHRyYWN0Q29tbW9uKGJlc3RQYXRoWzBdLCBuZXdTdHJpbmcsIG9sZFN0cmluZywgMCk7XG4gICAgaWYgKGJlc3RQYXRoWzBdLm5ld1BvcyArIDEgPj0gbmV3TGVuICYmIG9sZFBvcyArIDEgPj0gb2xkTGVuKSB7XG4gICAgICAvLyBJZGVudGl0eSBwZXIgdGhlIGVxdWFsaXR5IGFuZCB0b2tlbml6ZXJcbiAgICAgIHJldHVybiBkb25lKFt7dmFsdWU6IHRoaXMuam9pbihuZXdTdHJpbmcpLCBjb3VudDogbmV3U3RyaW5nLmxlbmd0aH1dKTtcbiAgICB9XG5cbiAgICAvLyBNYWluIHdvcmtlciBtZXRob2QuIGNoZWNrcyBhbGwgcGVybXV0YXRpb25zIG9mIGEgZ2l2ZW4gZWRpdCBsZW5ndGggZm9yIGFjY2VwdGFuY2UuXG4gICAgZnVuY3Rpb24gZXhlY0VkaXRMZW5ndGgoKSB7XG4gICAgICBmb3IgKGxldCBkaWFnb25hbFBhdGggPSAtMSAqIGVkaXRMZW5ndGg7IGRpYWdvbmFsUGF0aCA8PSBlZGl0TGVuZ3RoOyBkaWFnb25hbFBhdGggKz0gMikge1xuICAgICAgICBsZXQgYmFzZVBhdGg7XG4gICAgICAgIGxldCBhZGRQYXRoID0gYmVzdFBhdGhbZGlhZ29uYWxQYXRoIC0gMV0sXG4gICAgICAgICAgICByZW1vdmVQYXRoID0gYmVzdFBhdGhbZGlhZ29uYWxQYXRoICsgMV0sXG4gICAgICAgICAgICBvbGRQb3MgPSAocmVtb3ZlUGF0aCA/IHJlbW92ZVBhdGgubmV3UG9zIDogMCkgLSBkaWFnb25hbFBhdGg7XG4gICAgICAgIGlmIChhZGRQYXRoKSB7XG4gICAgICAgICAgLy8gTm8gb25lIGVsc2UgaXMgZ29pbmcgdG8gYXR0ZW1wdCB0byB1c2UgdGhpcyB2YWx1ZSwgY2xlYXIgaXRcbiAgICAgICAgICBiZXN0UGF0aFtkaWFnb25hbFBhdGggLSAxXSA9IHVuZGVmaW5lZDtcbiAgICAgICAgfVxuXG4gICAgICAgIGxldCBjYW5BZGQgPSBhZGRQYXRoICYmIGFkZFBhdGgubmV3UG9zICsgMSA8IG5ld0xlbixcbiAgICAgICAgICAgIGNhblJlbW92ZSA9IHJlbW92ZVBhdGggJiYgMCA8PSBvbGRQb3MgJiYgb2xkUG9zIDwgb2xkTGVuO1xuICAgICAgICBpZiAoIWNhbkFkZCAmJiAhY2FuUmVtb3ZlKSB7XG4gICAgICAgICAgLy8gSWYgdGhpcyBwYXRoIGlzIGEgdGVybWluYWwgdGhlbiBwcnVuZVxuICAgICAgICAgIGJlc3RQYXRoW2RpYWdvbmFsUGF0aF0gPSB1bmRlZmluZWQ7XG4gICAgICAgICAgY29udGludWU7XG4gICAgICAgIH1cblxuICAgICAgICAvLyBTZWxlY3QgdGhlIGRpYWdvbmFsIHRoYXQgd2Ugd2FudCB0byBicmFuY2ggZnJvbS4gV2Ugc2VsZWN0IHRoZSBwcmlvclxuICAgICAgICAvLyBwYXRoIHdob3NlIHBvc2l0aW9uIGluIHRoZSBuZXcgc3RyaW5nIGlzIHRoZSBmYXJ0aGVzdCBmcm9tIHRoZSBvcmlnaW5cbiAgICAgICAgLy8gYW5kIGRvZXMgbm90IHBhc3MgdGhlIGJvdW5kcyBvZiB0aGUgZGlmZiBncmFwaFxuICAgICAgICBpZiAoIWNhbkFkZCB8fCAoY2FuUmVtb3ZlICYmIGFkZFBhdGgubmV3UG9zIDwgcmVtb3ZlUGF0aC5uZXdQb3MpKSB7XG4gICAgICAgICAgYmFzZVBhdGggPSBjbG9uZVBhdGgocmVtb3ZlUGF0aCk7XG4gICAgICAgICAgc2VsZi5wdXNoQ29tcG9uZW50KGJhc2VQYXRoLmNvbXBvbmVudHMsIHVuZGVmaW5lZCwgdHJ1ZSk7XG4gICAgICAgIH0gZWxzZSB7XG4gICAgICAgICAgYmFzZVBhdGggPSBhZGRQYXRoOyAgIC8vIE5vIG5lZWQgdG8gY2xvbmUsIHdlJ3ZlIHB1bGxlZCBpdCBmcm9tIHRoZSBsaXN0XG4gICAgICAgICAgYmFzZVBhdGgubmV3UG9zKys7XG4gICAgICAgICAgc2VsZi5wdXNoQ29tcG9uZW50KGJhc2VQYXRoLmNvbXBvbmVudHMsIHRydWUsIHVuZGVmaW5lZCk7XG4gICAgICAgIH1cblxuICAgICAgICBvbGRQb3MgPSBzZWxmLmV4dHJhY3RDb21tb24oYmFzZVBhdGgsIG5ld1N0cmluZywgb2xkU3RyaW5nLCBkaWFnb25hbFBhdGgpO1xuXG4gICAgICAgIC8vIElmIHdlIGhhdmUgaGl0IHRoZSBlbmQgb2YgYm90aCBzdHJpbmdzLCB0aGVuIHdlIGFyZSBkb25lXG4gICAgICAgIGlmIChiYXNlUGF0aC5uZXdQb3MgKyAxID49IG5ld0xlbiAmJiBvbGRQb3MgKyAxID49IG9sZExlbikge1xuICAgICAgICAgIHJldHVybiBkb25lKGJ1aWxkVmFsdWVzKHNlbGYsIGJhc2VQYXRoLmNvbXBvbmVudHMsIG5ld1N0cmluZywgb2xkU3RyaW5nLCBzZWxmLnVzZUxvbmdlc3RUb2tlbikpO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIE90aGVyd2lzZSB0cmFjayB0aGlzIHBhdGggYXMgYSBwb3RlbnRpYWwgY2FuZGlkYXRlIGFuZCBjb250aW51ZS5cbiAgICAgICAgICBiZXN0UGF0aFtkaWFnb25hbFBhdGhdID0gYmFzZVBhdGg7XG4gICAgICAgIH1cbiAgICAgIH1cblxuICAgICAgZWRpdExlbmd0aCsrO1xuICAgIH1cblxuICAgIC8vIFBlcmZvcm1zIHRoZSBsZW5ndGggb2YgZWRpdCBpdGVyYXRpb24uIElzIGEgYml0IGZ1Z2x5IGFzIHRoaXMgaGFzIHRvIHN1cHBvcnQgdGhlXG4gICAgLy8gc3luYyBhbmQgYXN5bmMgbW9kZSB3aGljaCBpcyBuZXZlciBmdW4uIExvb3BzIG92ZXIgZXhlY0VkaXRMZW5ndGggdW50aWwgYSB2YWx1ZVxuICAgIC8vIGlzIHByb2R1Y2VkLlxuICAgIGlmIChjYWxsYmFjaykge1xuICAgICAgKGZ1bmN0aW9uIGV4ZWMoKSB7XG4gICAgICAgIHNldFRpbWVvdXQoZnVuY3Rpb24oKSB7XG4gICAgICAgICAgLy8gVGhpcyBzaG91bGQgbm90IGhhcHBlbiwgYnV0IHdlIHdhbnQgdG8gYmUgc2FmZS5cbiAgICAgICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgbmV4dCAqL1xuICAgICAgICAgIGlmIChlZGl0TGVuZ3RoID4gbWF4RWRpdExlbmd0aCkge1xuICAgICAgICAgICAgcmV0dXJuIGNhbGxiYWNrKCk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKCFleGVjRWRpdExlbmd0aCgpKSB7XG4gICAgICAgICAgICBleGVjKCk7XG4gICAgICAgICAgfVxuICAgICAgICB9LCAwKTtcbiAgICAgIH0oKSk7XG4gICAgfSBlbHNlIHtcbiAgICAgIHdoaWxlIChlZGl0TGVuZ3RoIDw9IG1heEVkaXRMZW5ndGgpIHtcbiAgICAgICAgbGV0IHJldCA9IGV4ZWNFZGl0TGVuZ3RoKCk7XG4gICAgICAgIGlmIChyZXQpIHtcbiAgICAgICAgICByZXR1cm4gcmV0O1xuICAgICAgICB9XG4gICAgICB9XG4gICAgfVxuICB9LFxuXG4gIHB1c2hDb21wb25lbnQoY29tcG9uZW50cywgYWRkZWQsIHJlbW92ZWQpIHtcbiAgICBsZXQgbGFzdCA9IGNvbXBvbmVudHNbY29tcG9uZW50cy5sZW5ndGggLSAxXTtcbiAgICBpZiAobGFzdCAmJiBsYXN0LmFkZGVkID09PSBhZGRlZCAmJiBsYXN0LnJlbW92ZWQgPT09IHJlbW92ZWQpIHtcbiAgICAgIC8vIFdlIG5lZWQgdG8gY2xvbmUgaGVyZSBhcyB0aGUgY29tcG9uZW50IGNsb25lIG9wZXJhdGlvbiBpcyBqdXN0XG4gICAgICAvLyBhcyBzaGFsbG93IGFycmF5IGNsb25lXG4gICAgICBjb21wb25lbnRzW2NvbXBvbmVudHMubGVuZ3RoIC0gMV0gPSB7Y291bnQ6IGxhc3QuY291bnQgKyAxLCBhZGRlZDogYWRkZWQsIHJlbW92ZWQ6IHJlbW92ZWQgfTtcbiAgICB9IGVsc2Uge1xuICAgICAgY29tcG9uZW50cy5wdXNoKHtjb3VudDogMSwgYWRkZWQ6IGFkZGVkLCByZW1vdmVkOiByZW1vdmVkIH0pO1xuICAgIH1cbiAgfSxcbiAgZXh0cmFjdENvbW1vbihiYXNlUGF0aCwgbmV3U3RyaW5nLCBvbGRTdHJpbmcsIGRpYWdvbmFsUGF0aCkge1xuICAgIGxldCBuZXdMZW4gPSBuZXdTdHJpbmcubGVuZ3RoLFxuICAgICAgICBvbGRMZW4gPSBvbGRTdHJpbmcubGVuZ3RoLFxuICAgICAgICBuZXdQb3MgPSBiYXNlUGF0aC5uZXdQb3MsXG4gICAgICAgIG9sZFBvcyA9IG5ld1BvcyAtIGRpYWdvbmFsUGF0aCxcblxuICAgICAgICBjb21tb25Db3VudCA9IDA7XG4gICAgd2hpbGUgKG5ld1BvcyArIDEgPCBuZXdMZW4gJiYgb2xkUG9zICsgMSA8IG9sZExlbiAmJiB0aGlzLmVxdWFscyhuZXdTdHJpbmdbbmV3UG9zICsgMV0sIG9sZFN0cmluZ1tvbGRQb3MgKyAxXSkpIHtcbiAgICAgIG5ld1BvcysrO1xuICAgICAgb2xkUG9zKys7XG4gICAgICBjb21tb25Db3VudCsrO1xuICAgIH1cblxuICAgIGlmIChjb21tb25Db3VudCkge1xuICAgICAgYmFzZVBhdGguY29tcG9uZW50cy5wdXNoKHtjb3VudDogY29tbW9uQ291bnR9KTtcbiAgICB9XG5cbiAgICBiYXNlUGF0aC5uZXdQb3MgPSBuZXdQb3M7XG4gICAgcmV0dXJuIG9sZFBvcztcbiAgfSxcblxuICBlcXVhbHMobGVmdCwgcmlnaHQpIHtcbiAgICBpZiAodGhpcy5vcHRpb25zLmNvbXBhcmF0b3IpIHtcbiAgICAgIHJldHVybiB0aGlzLm9wdGlvbnMuY29tcGFyYXRvcihsZWZ0LCByaWdodCk7XG4gICAgfSBlbHNlIHtcbiAgICAgIHJldHVybiBsZWZ0ID09PSByaWdodFxuICAgICAgICB8fCAodGhpcy5vcHRpb25zLmlnbm9yZUNhc2UgJiYgbGVmdC50b0xvd2VyQ2FzZSgpID09PSByaWdodC50b0xvd2VyQ2FzZSgpKTtcbiAgICB9XG4gIH0sXG4gIHJlbW92ZUVtcHR5KGFycmF5KSB7XG4gICAgbGV0IHJldCA9IFtdO1xuICAgIGZvciAobGV0IGkgPSAwOyBpIDwgYXJyYXkubGVuZ3RoOyBpKyspIHtcbiAgICAgIGlmIChhcnJheVtpXSkge1xuICAgICAgICByZXQucHVzaChhcnJheVtpXSk7XG4gICAgICB9XG4gICAgfVxuICAgIHJldHVybiByZXQ7XG4gIH0sXG4gIGNhc3RJbnB1dCh2YWx1ZSkge1xuICAgIHJldHVybiB2YWx1ZTtcbiAgfSxcbiAgdG9rZW5pemUodmFsdWUpIHtcbiAgICByZXR1cm4gdmFsdWUuc3BsaXQoJycpO1xuICB9LFxuICBqb2luKGNoYXJzKSB7XG4gICAgcmV0dXJuIGNoYXJzLmpvaW4oJycpO1xuICB9XG59O1xuXG5mdW5jdGlvbiBidWlsZFZhbHVlcyhkaWZmLCBjb21wb25lbnRzLCBuZXdTdHJpbmcsIG9sZFN0cmluZywgdXNlTG9uZ2VzdFRva2VuKSB7XG4gIGxldCBjb21wb25lbnRQb3MgPSAwLFxuICAgICAgY29tcG9uZW50TGVuID0gY29tcG9uZW50cy5sZW5ndGgsXG4gICAgICBuZXdQb3MgPSAwLFxuICAgICAgb2xkUG9zID0gMDtcblxuICBmb3IgKDsgY29tcG9uZW50UG9zIDwgY29tcG9uZW50TGVuOyBjb21wb25lbnRQb3MrKykge1xuICAgIGxldCBjb21wb25lbnQgPSBjb21wb25lbnRzW2NvbXBvbmVudFBvc107XG4gICAgaWYgKCFjb21wb25lbnQucmVtb3ZlZCkge1xuICAgICAgaWYgKCFjb21wb25lbnQuYWRkZWQgJiYgdXNlTG9uZ2VzdFRva2VuKSB7XG4gICAgICAgIGxldCB2YWx1ZSA9IG5ld1N0cmluZy5zbGljZShuZXdQb3MsIG5ld1BvcyArIGNvbXBvbmVudC5jb3VudCk7XG4gICAgICAgIHZhbHVlID0gdmFsdWUubWFwKGZ1bmN0aW9uKHZhbHVlLCBpKSB7XG4gICAgICAgICAgbGV0IG9sZFZhbHVlID0gb2xkU3RyaW5nW29sZFBvcyArIGldO1xuICAgICAgICAgIHJldHVybiBvbGRWYWx1ZS5sZW5ndGggPiB2YWx1ZS5sZW5ndGggPyBvbGRWYWx1ZSA6IHZhbHVlO1xuICAgICAgICB9KTtcblxuICAgICAgICBjb21wb25lbnQudmFsdWUgPSBkaWZmLmpvaW4odmFsdWUpO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgY29tcG9uZW50LnZhbHVlID0gZGlmZi5qb2luKG5ld1N0cmluZy5zbGljZShuZXdQb3MsIG5ld1BvcyArIGNvbXBvbmVudC5jb3VudCkpO1xuICAgICAgfVxuICAgICAgbmV3UG9zICs9IGNvbXBvbmVudC5jb3VudDtcblxuICAgICAgLy8gQ29tbW9uIGNhc2VcbiAgICAgIGlmICghY29tcG9uZW50LmFkZGVkKSB7XG4gICAgICAgIG9sZFBvcyArPSBjb21wb25lbnQuY291bnQ7XG4gICAgICB9XG4gICAgfSBlbHNlIHtcbiAgICAgIGNvbXBvbmVudC52YWx1ZSA9IGRpZmYuam9pbihvbGRTdHJpbmcuc2xpY2Uob2xkUG9zLCBvbGRQb3MgKyBjb21wb25lbnQuY291bnQpKTtcbiAgICAgIG9sZFBvcyArPSBjb21wb25lbnQuY291bnQ7XG5cbiAgICAgIC8vIFJldmVyc2UgYWRkIGFuZCByZW1vdmUgc28gcmVtb3ZlcyBhcmUgb3V0cHV0IGZpcnN0IHRvIG1hdGNoIGNvbW1vbiBjb252ZW50aW9uXG4gICAgICAvLyBUaGUgZGlmZmluZyBhbGdvcml0aG0gaXMgdGllZCB0byBhZGQgdGhlbiByZW1vdmUgb3V0cHV0IGFuZCB0aGlzIGlzIHRoZSBzaW1wbGVzdFxuICAgICAgLy8gcm91dGUgdG8gZ2V0IHRoZSBkZXNpcmVkIG91dHB1dCB3aXRoIG1pbmltYWwgb3ZlcmhlYWQuXG4gICAgICBpZiAoY29tcG9uZW50UG9zICYmIGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV0uYWRkZWQpIHtcbiAgICAgICAgbGV0IHRtcCA9IGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV07XG4gICAgICAgIGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV0gPSBjb21wb25lbnRzW2NvbXBvbmVudFBvc107XG4gICAgICAgIGNvbXBvbmVudHNbY29tcG9uZW50UG9zXSA9IHRtcDtcbiAgICAgIH1cbiAgICB9XG4gIH1cblxuICAvLyBTcGVjaWFsIGNhc2UgaGFuZGxlIGZvciB3aGVuIG9uZSB0ZXJtaW5hbCBpcyBpZ25vcmVkIChpLmUuIHdoaXRlc3BhY2UpLlxuICAvLyBGb3IgdGhpcyBjYXNlIHdlIG1lcmdlIHRoZSB0ZXJtaW5hbCBpbnRvIHRoZSBwcmlvciBzdHJpbmcgYW5kIGRyb3AgdGhlIGNoYW5nZS5cbiAgLy8gVGhpcyBpcyBvbmx5IGF2YWlsYWJsZSBmb3Igc3RyaW5nIG1vZGUuXG4gIGxldCBsYXN0Q29tcG9uZW50ID0gY29tcG9uZW50c1tjb21wb25lbnRMZW4gLSAxXTtcbiAgaWYgKGNvbXBvbmVudExlbiA+IDFcbiAgICAgICYmIHR5cGVvZiBsYXN0Q29tcG9uZW50LnZhbHVlID09PSAnc3RyaW5nJ1xuICAgICAgJiYgKGxhc3RDb21wb25lbnQuYWRkZWQgfHwgbGFzdENvbXBvbmVudC5yZW1vdmVkKVxuICAgICAgJiYgZGlmZi5lcXVhbHMoJycsIGxhc3RDb21wb25lbnQudmFsdWUpKSB7XG4gICAgY29tcG9uZW50c1tjb21wb25lbnRMZW4gLSAyXS52YWx1ZSArPSBsYXN0Q29tcG9uZW50LnZhbHVlO1xuICAgIGNvbXBvbmVudHMucG9wKCk7XG4gIH1cblxuICByZXR1cm4gY29tcG9uZW50cztcbn1cblxuZnVuY3Rpb24gY2xvbmVQYXRoKHBhdGgpIHtcbiAgcmV0dXJuIHsgbmV3UG9zOiBwYXRoLm5ld1BvcywgY29tcG9uZW50czogcGF0aC5jb21wb25lbnRzLnNsaWNlKDApIH07XG59XG4iXX0=
+
+
+/***/ }),
+/* 2 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.characterDiff = undefined;
+	exports. /*istanbul ignore end*/diffChars = diffChars;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var characterDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/characterDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	function diffChars(oldStr, newStr, options) {
+	  return characterDiff.diff(oldStr, newStr, options);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2NoYXJhY3Rlci5qcyJdLCJuYW1lcyI6WyJkaWZmQ2hhcnMiLCJjaGFyYWN0ZXJEaWZmIiwib2xkU3RyIiwibmV3U3RyIiwib3B0aW9ucyIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBR2dCQSxTLEdBQUFBLFM7O0FBSGhCOzs7Ozs7dUJBRU8sSUFBTUMseUZBQWdCLHdFQUF0QjtBQUNBLFNBQVNELFNBQVQsQ0FBbUJFLE1BQW5CLEVBQTJCQyxNQUEzQixFQUFtQ0MsT0FBbkMsRUFBNEM7QUFBRSxTQUFPSCxjQUFjSSxJQUFkLENBQW1CSCxNQUFuQixFQUEyQkMsTUFBM0IsRUFBbUNDLE9BQW5DLENBQVA7QUFBcUQiLCJmaWxlIjoiY2hhcmFjdGVyLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IERpZmYgZnJvbSAnLi9iYXNlJztcblxuZXhwb3J0IGNvbnN0IGNoYXJhY3RlckRpZmYgPSBuZXcgRGlmZigpO1xuZXhwb3J0IGZ1bmN0aW9uIGRpZmZDaGFycyhvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykgeyByZXR1cm4gY2hhcmFjdGVyRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTsgfVxuIl19
+
+
+/***/ }),
+/* 3 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.wordDiff = undefined;
+	exports. /*istanbul ignore end*/diffWords = diffWords;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = diffWordsWithSpace;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_params = __webpack_require__(4) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/ // Based on https://en.wikipedia.org/wiki/Latin_script_in_Unicode
+	//
+	// Ranges and exceptions:
+	// Latin-1 Supplement, 0080–00FF
+	//  - U+00D7  × Multiplication sign
+	//  - U+00F7  ÷ Division sign
+	// Latin Extended-A, 0100–017F
+	// Latin Extended-B, 0180–024F
+	// IPA Extensions, 0250–02AF
+	// Spacing Modifier Letters, 02B0–02FF
+	//  - U+02C7  ˇ &#711;  Caron
+	//  - U+02D8  ˘ &#728;  Breve
+	//  - U+02D9  ˙ &#729;  Dot Above
+	//  - U+02DA  ˚ &#730;  Ring Above
+	//  - U+02DB  ˛ &#731;  Ogonek
+	//  - U+02DC  ˜ &#732;  Small Tilde
+	//  - U+02DD  ˝ &#733;  Double Acute Accent
+	// Latin Extended Additional, 1E00–1EFF
+	var extendedWordChars = /^[A-Za-z\xC0-\u02C6\u02C8-\u02D7\u02DE-\u02FF\u1E00-\u1EFF]+$/;
+
+	var reWhitespace = /\S/;
+
+	var wordDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/wordDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	wordDiff.equals = function (left, right) {
+	  if (this.options.ignoreCase) {
+	    left = left.toLowerCase();
+	    right = right.toLowerCase();
+	  }
+	  return left === right || this.options.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right);
+	};
+	wordDiff.tokenize = function (value) {
+	  var tokens = value.split(/(\s+|\b)/);
+
+	  // Join the boundary splits that we do not consider to be boundaries. This is primarily the extended Latin character set.
+	  for (var i = 0; i < tokens.length - 1; i++) {
+	    // If we have an empty string in the next field and we have only word chars before and after, merge
+	    if (!tokens[i + 1] && tokens[i + 2] && extendedWordChars.test(tokens[i]) && extendedWordChars.test(tokens[i + 2])) {
+	      tokens[i] += tokens[i + 2];
+	      tokens.splice(i + 1, 2);
+	      i--;
+	    }
+	  }
+
+	  return tokens;
+	};
+
+	function diffWords(oldStr, newStr, options) {
+	  options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(options, { ignoreWhitespace: true });
+	  return wordDiff.diff(oldStr, newStr, options);
+	}
+
+	function diffWordsWithSpace(oldStr, newStr, options) {
+	  return wordDiff.diff(oldStr, newStr, options);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL3dvcmQuanMiXSwibmFtZXMiOlsiZGlmZldvcmRzIiwiZGlmZldvcmRzV2l0aFNwYWNlIiwiZXh0ZW5kZWRXb3JkQ2hhcnMiLCJyZVdoaXRlc3BhY2UiLCJ3b3JkRGlmZiIsImVxdWFscyIsImxlZnQiLCJyaWdodCIsIm9wdGlvbnMiLCJpZ25vcmVDYXNlIiwidG9Mb3dlckNhc2UiLCJpZ25vcmVXaGl0ZXNwYWNlIiwidGVzdCIsInRva2VuaXplIiwidmFsdWUiLCJ0b2tlbnMiLCJzcGxpdCIsImkiLCJsZW5ndGgiLCJzcGxpY2UiLCJvbGRTdHIiLCJuZXdTdHIiLCJkaWZmIl0sIm1hcHBpbmdzIjoiOzs7O2dDQW1EZ0JBLFMsR0FBQUEsUzt5REFLQUMsa0IsR0FBQUEsa0I7O0FBeERoQjs7Ozt1QkFDQTs7Ozt3QkFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxJQUFNQyxvQkFBb0IsK0RBQTFCOztBQUVBLElBQU1DLGVBQWUsSUFBckI7O0FBRU8sSUFBTUMsK0VBQVcsd0VBQWpCO0FBQ1BBLFNBQVNDLE1BQVQsR0FBa0IsVUFBU0MsSUFBVCxFQUFlQyxLQUFmLEVBQXNCO0FBQ3RDLE1BQUksS0FBS0MsT0FBTCxDQUFhQyxVQUFqQixFQUE2QjtBQUMzQkgsV0FBT0EsS0FBS0ksV0FBTCxFQUFQO0FBQ0FILFlBQVFBLE1BQU1HLFdBQU4sRUFBUjtBQUNEO0FBQ0QsU0FBT0osU0FBU0MsS0FBVCxJQUFtQixLQUFLQyxPQUFMLENBQWFHLGdCQUFiLElBQWlDLENBQUNSLGFBQWFTLElBQWIsQ0FBa0JOLElBQWxCLENBQWxDLElBQTZELENBQUNILGFBQWFTLElBQWIsQ0FBa0JMLEtBQWxCLENBQXhGO0FBQ0QsQ0FORDtBQU9BSCxTQUFTUyxRQUFULEdBQW9CLFVBQVNDLEtBQVQsRUFBZ0I7QUFDbEMsTUFBSUMsU0FBU0QsTUFBTUUsS0FBTixDQUFZLFVBQVosQ0FBYjs7QUFFQTtBQUNBLE9BQUssSUFBSUMsSUFBSSxDQUFiLEVBQWdCQSxJQUFJRixPQUFPRyxNQUFQLEdBQWdCLENBQXBDLEVBQXVDRCxHQUF2QyxFQUE0QztBQUMxQztBQUNBLFFBQUksQ0FBQ0YsT0FBT0UsSUFBSSxDQUFYLENBQUQsSUFBa0JGLE9BQU9FLElBQUksQ0FBWCxDQUFsQixJQUNLZixrQkFBa0JVLElBQWxCLENBQXVCRyxPQUFPRSxDQUFQLENBQXZCLENBREwsSUFFS2Ysa0JBQWtCVSxJQUFsQixDQUF1QkcsT0FBT0UsSUFBSSxDQUFYLENBQXZCLENBRlQsRUFFZ0Q7QUFDOUNGLGFBQU9FLENBQVAsS0FBYUYsT0FBT0UsSUFBSSxDQUFYLENBQWI7QUFDQUYsYUFBT0ksTUFBUCxDQUFjRixJQUFJLENBQWxCLEVBQXFCLENBQXJCO0FBQ0FBO0FBQ0Q7QUFDRjs7QUFFRCxTQUFPRixNQUFQO0FBQ0QsQ0FoQkQ7O0FBa0JPLFNBQVNmLFNBQVQsQ0FBbUJvQixNQUFuQixFQUEyQkMsTUFBM0IsRUFBbUNiLE9BQW5DLEVBQTRDO0FBQ2pEQSxZQUFVLDhFQUFnQkEsT0FBaEIsRUFBeUIsRUFBQ0csa0JBQWtCLElBQW5CLEVBQXpCLENBQVY7QUFDQSxTQUFPUCxTQUFTa0IsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUNEOztBQUVNLFNBQVNQLGtCQUFULENBQTRCbUIsTUFBNUIsRUFBb0NDLE1BQXBDLEVBQTRDYixPQUE1QyxFQUFxRDtBQUMxRCxTQUFPSixTQUFTa0IsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUNEIiwiZmlsZSI6IndvcmQuanMiLCJzb3VyY2VzQ29udGVudCI6WyJpbXBvcnQgRGlmZiBmcm9tICcuL2Jhc2UnO1xuaW1wb3J0IHtnZW5lcmF0ZU9wdGlvbnN9IGZyb20gJy4uL3V0aWwvcGFyYW1zJztcblxuLy8gQmFzZWQgb24gaHR0cHM6Ly9lbi53aWtpcGVkaWEub3JnL3dpa2kvTGF0aW5fc2NyaXB0X2luX1VuaWNvZGVcbi8vXG4vLyBSYW5nZXMgYW5kIGV4Y2VwdGlvbnM6XG4vLyBMYXRpbi0xIFN1cHBsZW1lbnQsIDAwODDigJMwMEZGXG4vLyAgLSBVKzAwRDcgIMOXIE11bHRpcGxpY2F0aW9uIHNpZ25cbi8vICAtIFUrMDBGNyAgw7cgRGl2aXNpb24gc2lnblxuLy8gTGF0aW4gRXh0ZW5kZWQtQSwgMDEwMOKAkzAxN0Zcbi8vIExhdGluIEV4dGVuZGVkLUIsIDAxODDigJMwMjRGXG4vLyBJUEEgRXh0ZW5zaW9ucywgMDI1MOKAkzAyQUZcbi8vIFNwYWNpbmcgTW9kaWZpZXIgTGV0dGVycywgMDJCMOKAkzAyRkZcbi8vICAtIFUrMDJDNyAgy4cgJiM3MTE7ICBDYXJvblxuLy8gIC0gVSswMkQ4ICDLmCAmIzcyODsgIEJyZXZlXG4vLyAgLSBVKzAyRDkgIMuZICYjNzI5OyAgRG90IEFib3ZlXG4vLyAgLSBVKzAyREEgIMuaICYjNzMwOyAgUmluZyBBYm92ZVxuLy8gIC0gVSswMkRCICDLmyAmIzczMTsgIE9nb25la1xuLy8gIC0gVSswMkRDICDLnCAmIzczMjsgIFNtYWxsIFRpbGRlXG4vLyAgLSBVKzAyREQgIMudICYjNzMzOyAgRG91YmxlIEFjdXRlIEFjY2VudFxuLy8gTGF0aW4gRXh0ZW5kZWQgQWRkaXRpb25hbCwgMUUwMOKAkzFFRkZcbmNvbnN0IGV4dGVuZGVkV29yZENoYXJzID0gL15bYS16QS1aXFx1e0MwfS1cXHV7RkZ9XFx1e0Q4fS1cXHV7RjZ9XFx1e0Y4fS1cXHV7MkM2fVxcdXsyQzh9LVxcdXsyRDd9XFx1ezJERX0tXFx1ezJGRn1cXHV7MUUwMH0tXFx1ezFFRkZ9XSskL3U7XG5cbmNvbnN0IHJlV2hpdGVzcGFjZSA9IC9cXFMvO1xuXG5leHBvcnQgY29uc3Qgd29yZERpZmYgPSBuZXcgRGlmZigpO1xud29yZERpZmYuZXF1YWxzID0gZnVuY3Rpb24obGVmdCwgcmlnaHQpIHtcbiAgaWYgKHRoaXMub3B0aW9ucy5pZ25vcmVDYXNlKSB7XG4gICAgbGVmdCA9IGxlZnQudG9Mb3dlckNhc2UoKTtcbiAgICByaWdodCA9IHJpZ2h0LnRvTG93ZXJDYXNlKCk7XG4gIH1cbiAgcmV0dXJuIGxlZnQgPT09IHJpZ2h0IHx8ICh0aGlzLm9wdGlvbnMuaWdub3JlV2hpdGVzcGFjZSAmJiAhcmVXaGl0ZXNwYWNlLnRlc3QobGVmdCkgJiYgIXJlV2hpdGVzcGFjZS50ZXN0KHJpZ2h0KSk7XG59O1xud29yZERpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICBsZXQgdG9rZW5zID0gdmFsdWUuc3BsaXQoLyhcXHMrfFxcYikvKTtcblxuICAvLyBKb2luIHRoZSBib3VuZGFyeSBzcGxpdHMgdGhhdCB3ZSBkbyBub3QgY29uc2lkZXIgdG8gYmUgYm91bmRhcmllcy4gVGhpcyBpcyBwcmltYXJpbHkgdGhlIGV4dGVuZGVkIExhdGluIGNoYXJhY3RlciBzZXQuXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgdG9rZW5zLmxlbmd0aCAtIDE7IGkrKykge1xuICAgIC8vIElmIHdlIGhhdmUgYW4gZW1wdHkgc3RyaW5nIGluIHRoZSBuZXh0IGZpZWxkIGFuZCB3ZSBoYXZlIG9ubHkgd29yZCBjaGFycyBiZWZvcmUgYW5kIGFmdGVyLCBtZXJnZVxuICAgIGlmICghdG9rZW5zW2kgKyAxXSAmJiB0b2tlbnNbaSArIDJdXG4gICAgICAgICAgJiYgZXh0ZW5kZWRXb3JkQ2hhcnMudGVzdCh0b2tlbnNbaV0pXG4gICAgICAgICAgJiYgZXh0ZW5kZWRXb3JkQ2hhcnMudGVzdCh0b2tlbnNbaSArIDJdKSkge1xuICAgICAgdG9rZW5zW2ldICs9IHRva2Vuc1tpICsgMl07XG4gICAgICB0b2tlbnMuc3BsaWNlKGkgKyAxLCAyKTtcbiAgICAgIGktLTtcbiAgICB9XG4gIH1cblxuICByZXR1cm4gdG9rZW5zO1xufTtcblxuZXhwb3J0IGZ1bmN0aW9uIGRpZmZXb3JkcyhvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykge1xuICBvcHRpb25zID0gZ2VuZXJhdGVPcHRpb25zKG9wdGlvbnMsIHtpZ25vcmVXaGl0ZXNwYWNlOiB0cnVlfSk7XG4gIHJldHVybiB3b3JkRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGRpZmZXb3Jkc1dpdGhTcGFjZShvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykge1xuICByZXR1cm4gd29yZERpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucyk7XG59XG4iXX0=
+
+
+/***/ }),
+/* 4 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/generateOptions = generateOptions;
+	function generateOptions(options, defaults) {
+	  if (typeof options === 'function') {
+	    defaults.callback = options;
+	  } else if (options) {
+	    for (var name in options) {
+	      /* istanbul ignore else */
+	      if (options.hasOwnProperty(name)) {
+	        defaults[name] = options[name];
+	      }
+	    }
+	  }
+	  return defaults;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL3BhcmFtcy5qcyJdLCJuYW1lcyI6WyJnZW5lcmF0ZU9wdGlvbnMiLCJvcHRpb25zIiwiZGVmYXVsdHMiLCJjYWxsYmFjayIsIm5hbWUiLCJoYXNPd25Qcm9wZXJ0eSJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsZSxHQUFBQSxlO0FBQVQsU0FBU0EsZUFBVCxDQUF5QkMsT0FBekIsRUFBa0NDLFFBQWxDLEVBQTRDO0FBQ2pELE1BQUksT0FBT0QsT0FBUCxLQUFtQixVQUF2QixFQUFtQztBQUNqQ0MsYUFBU0MsUUFBVCxHQUFvQkYsT0FBcEI7QUFDRCxHQUZELE1BRU8sSUFBSUEsT0FBSixFQUFhO0FBQ2xCLFNBQUssSUFBSUcsSUFBVCxJQUFpQkgsT0FBakIsRUFBMEI7QUFDeEI7QUFDQSxVQUFJQSxRQUFRSSxjQUFSLENBQXVCRCxJQUF2QixDQUFKLEVBQWtDO0FBQ2hDRixpQkFBU0UsSUFBVCxJQUFpQkgsUUFBUUcsSUFBUixDQUFqQjtBQUNEO0FBQ0Y7QUFDRjtBQUNELFNBQU9GLFFBQVA7QUFDRCIsImZpbGUiOiJwYXJhbXMuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZnVuY3Rpb24gZ2VuZXJhdGVPcHRpb25zKG9wdGlvbnMsIGRlZmF1bHRzKSB7XG4gIGlmICh0eXBlb2Ygb3B0aW9ucyA9PT0gJ2Z1bmN0aW9uJykge1xuICAgIGRlZmF1bHRzLmNhbGxiYWNrID0gb3B0aW9ucztcbiAgfSBlbHNlIGlmIChvcHRpb25zKSB7XG4gICAgZm9yIChsZXQgbmFtZSBpbiBvcHRpb25zKSB7XG4gICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgZWxzZSAqL1xuICAgICAgaWYgKG9wdGlvbnMuaGFzT3duUHJvcGVydHkobmFtZSkpIHtcbiAgICAgICAgZGVmYXVsdHNbbmFtZV0gPSBvcHRpb25zW25hbWVdO1xuICAgICAgfVxuICAgIH1cbiAgfVxuICByZXR1cm4gZGVmYXVsdHM7XG59XG4iXX0=
+
+
+/***/ }),
+/* 5 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.lineDiff = undefined;
+	exports. /*istanbul ignore end*/diffLines = diffLines;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = diffTrimmedLines;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_params = __webpack_require__(4) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var lineDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/lineDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	lineDiff.tokenize = function (value) {
+	  var retLines = [],
+	      linesAndNewlines = value.split(/(\n|\r\n)/);
+
+	  // Ignore the final empty token that occurs if the string ends with a new line
+	  if (!linesAndNewlines[linesAndNewlines.length - 1]) {
+	    linesAndNewlines.pop();
+	  }
+
+	  // Merge the content and line separators into single tokens
+	  for (var i = 0; i < linesAndNewlines.length; i++) {
+	    var line = linesAndNewlines[i];
+
+	    if (i % 2 && !this.options.newlineIsToken) {
+	      retLines[retLines.length - 1] += line;
+	    } else {
+	      if (this.options.ignoreWhitespace) {
+	        line = line.trim();
+	      }
+	      retLines.push(line);
+	    }
+	  }
+
+	  return retLines;
+	};
+
+	function diffLines(oldStr, newStr, callback) {
+	  return lineDiff.diff(oldStr, newStr, callback);
+	}
+	function diffTrimmedLines(oldStr, newStr, callback) {
+	  var options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(callback, { ignoreWhitespace: true });
+	  return lineDiff.diff(oldStr, newStr, options);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2xpbmUuanMiXSwibmFtZXMiOlsiZGlmZkxpbmVzIiwiZGlmZlRyaW1tZWRMaW5lcyIsImxpbmVEaWZmIiwidG9rZW5pemUiLCJ2YWx1ZSIsInJldExpbmVzIiwibGluZXNBbmROZXdsaW5lcyIsInNwbGl0IiwibGVuZ3RoIiwicG9wIiwiaSIsImxpbmUiLCJvcHRpb25zIiwibmV3bGluZUlzVG9rZW4iLCJpZ25vcmVXaGl0ZXNwYWNlIiwidHJpbSIsInB1c2giLCJvbGRTdHIiLCJuZXdTdHIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBOEJnQkEsUyxHQUFBQSxTO3lEQUNBQyxnQixHQUFBQSxnQjs7QUEvQmhCOzs7O3VCQUNBOzs7O3VCQUVPLElBQU1DLCtFQUFXLHdFQUFqQjtBQUNQQSxTQUFTQyxRQUFULEdBQW9CLFVBQVNDLEtBQVQsRUFBZ0I7QUFDbEMsTUFBSUMsV0FBVyxFQUFmO0FBQUEsTUFDSUMsbUJBQW1CRixNQUFNRyxLQUFOLENBQVksV0FBWixDQUR2Qjs7QUFHQTtBQUNBLE1BQUksQ0FBQ0QsaUJBQWlCQSxpQkFBaUJFLE1BQWpCLEdBQTBCLENBQTNDLENBQUwsRUFBb0Q7QUFDbERGLHFCQUFpQkcsR0FBakI7QUFDRDs7QUFFRDtBQUNBLE9BQUssSUFBSUMsSUFBSSxDQUFiLEVBQWdCQSxJQUFJSixpQkFBaUJFLE1BQXJDLEVBQTZDRSxHQUE3QyxFQUFrRDtBQUNoRCxRQUFJQyxPQUFPTCxpQkFBaUJJLENBQWpCLENBQVg7O0FBRUEsUUFBSUEsSUFBSSxDQUFKLElBQVMsQ0FBQyxLQUFLRSxPQUFMLENBQWFDLGNBQTNCLEVBQTJDO0FBQ3pDUixlQUFTQSxTQUFTRyxNQUFULEdBQWtCLENBQTNCLEtBQWlDRyxJQUFqQztBQUNELEtBRkQsTUFFTztBQUNMLFVBQUksS0FBS0MsT0FBTCxDQUFhRSxnQkFBakIsRUFBbUM7QUFDakNILGVBQU9BLEtBQUtJLElBQUwsRUFBUDtBQUNEO0FBQ0RWLGVBQVNXLElBQVQsQ0FBY0wsSUFBZDtBQUNEO0FBQ0Y7O0FBRUQsU0FBT04sUUFBUDtBQUNELENBeEJEOztBQTBCTyxTQUFTTCxTQUFULENBQW1CaUIsTUFBbkIsRUFBMkJDLE1BQTNCLEVBQW1DQyxRQUFuQyxFQUE2QztBQUFFLFNBQU9qQixTQUFTa0IsSUFBVCxDQUFjSCxNQUFkLEVBQXNCQyxNQUF0QixFQUE4QkMsUUFBOUIsQ0FBUDtBQUFpRDtBQUNoRyxTQUFTbEIsZ0JBQVQsQ0FBMEJnQixNQUExQixFQUFrQ0MsTUFBbEMsRUFBMENDLFFBQTFDLEVBQW9EO0FBQ3pELE1BQUlQLFVBQVUsOEVBQWdCTyxRQUFoQixFQUEwQixFQUFDTCxrQkFBa0IsSUFBbkIsRUFBMUIsQ0FBZDtBQUNBLFNBQU9aLFNBQVNrQixJQUFULENBQWNILE1BQWQsRUFBc0JDLE1BQXRCLEVBQThCTixPQUE5QixDQUFQO0FBQ0QiLCJmaWxlIjoibGluZS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5pbXBvcnQge2dlbmVyYXRlT3B0aW9uc30gZnJvbSAnLi4vdXRpbC9wYXJhbXMnO1xuXG5leHBvcnQgY29uc3QgbGluZURpZmYgPSBuZXcgRGlmZigpO1xubGluZURpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICBsZXQgcmV0TGluZXMgPSBbXSxcbiAgICAgIGxpbmVzQW5kTmV3bGluZXMgPSB2YWx1ZS5zcGxpdCgvKFxcbnxcXHJcXG4pLyk7XG5cbiAgLy8gSWdub3JlIHRoZSBmaW5hbCBlbXB0eSB0b2tlbiB0aGF0IG9jY3VycyBpZiB0aGUgc3RyaW5nIGVuZHMgd2l0aCBhIG5ldyBsaW5lXG4gIGlmICghbGluZXNBbmROZXdsaW5lc1tsaW5lc0FuZE5ld2xpbmVzLmxlbmd0aCAtIDFdKSB7XG4gICAgbGluZXNBbmROZXdsaW5lcy5wb3AoKTtcbiAgfVxuXG4gIC8vIE1lcmdlIHRoZSBjb250ZW50IGFuZCBsaW5lIHNlcGFyYXRvcnMgaW50byBzaW5nbGUgdG9rZW5zXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgbGluZXNBbmROZXdsaW5lcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBsaW5lID0gbGluZXNBbmROZXdsaW5lc1tpXTtcblxuICAgIGlmIChpICUgMiAmJiAhdGhpcy5vcHRpb25zLm5ld2xpbmVJc1Rva2VuKSB7XG4gICAgICByZXRMaW5lc1tyZXRMaW5lcy5sZW5ndGggLSAxXSArPSBsaW5lO1xuICAgIH0gZWxzZSB7XG4gICAgICBpZiAodGhpcy5vcHRpb25zLmlnbm9yZVdoaXRlc3BhY2UpIHtcbiAgICAgICAgbGluZSA9IGxpbmUudHJpbSgpO1xuICAgICAgfVxuICAgICAgcmV0TGluZXMucHVzaChsaW5lKTtcbiAgICB9XG4gIH1cblxuICByZXR1cm4gcmV0TGluZXM7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkxpbmVzKG9sZFN0ciwgbmV3U3RyLCBjYWxsYmFjaykgeyByZXR1cm4gbGluZURpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spOyB9XG5leHBvcnQgZnVuY3Rpb24gZGlmZlRyaW1tZWRMaW5lcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHtcbiAgbGV0IG9wdGlvbnMgPSBnZW5lcmF0ZU9wdGlvbnMoY2FsbGJhY2ssIHtpZ25vcmVXaGl0ZXNwYWNlOiB0cnVlfSk7XG4gIHJldHVybiBsaW5lRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbn1cbiJdfQ==
+
+
+/***/ }),
+/* 6 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.sentenceDiff = undefined;
+	exports. /*istanbul ignore end*/diffSentences = diffSentences;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var sentenceDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/sentenceDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	sentenceDiff.tokenize = function (value) {
+	  return value.split(/(\S.+?[.!?])(?=\s+|$)/);
+	};
+
+	function diffSentences(oldStr, newStr, callback) {
+	  return sentenceDiff.diff(oldStr, newStr, callback);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL3NlbnRlbmNlLmpzIl0sIm5hbWVzIjpbImRpZmZTZW50ZW5jZXMiLCJzZW50ZW5jZURpZmYiLCJ0b2tlbml6ZSIsInZhbHVlIiwic3BsaXQiLCJvbGRTdHIiLCJuZXdTdHIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBUWdCQSxhLEdBQUFBLGE7O0FBUmhCOzs7Ozs7dUJBR08sSUFBTUMsdUZBQWUsd0VBQXJCO0FBQ1BBLGFBQWFDLFFBQWIsR0FBd0IsVUFBU0MsS0FBVCxFQUFnQjtBQUN0QyxTQUFPQSxNQUFNQyxLQUFOLENBQVksdUJBQVosQ0FBUDtBQUNELENBRkQ7O0FBSU8sU0FBU0osYUFBVCxDQUF1QkssTUFBdkIsRUFBK0JDLE1BQS9CLEVBQXVDQyxRQUF2QyxFQUFpRDtBQUFFLFNBQU9OLGFBQWFPLElBQWIsQ0FBa0JILE1BQWxCLEVBQTBCQyxNQUExQixFQUFrQ0MsUUFBbEMsQ0FBUDtBQUFxRCIsImZpbGUiOiJzZW50ZW5jZS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cblxuZXhwb3J0IGNvbnN0IHNlbnRlbmNlRGlmZiA9IG5ldyBEaWZmKCk7XG5zZW50ZW5jZURpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWUuc3BsaXQoLyhcXFMuKz9bLiE/XSkoPz1cXHMrfCQpLyk7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZlNlbnRlbmNlcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHsgcmV0dXJuIHNlbnRlbmNlRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBjYWxsYmFjayk7IH1cbiJdfQ==
+
+
+/***/ }),
+/* 7 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.cssDiff = undefined;
+	exports. /*istanbul ignore end*/diffCss = diffCss;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var cssDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/cssDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	cssDiff.tokenize = function (value) {
+	  return value.split(/([{}:;,]|\s+)/);
+	};
+
+	function diffCss(oldStr, newStr, callback) {
+	  return cssDiff.diff(oldStr, newStr, callback);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2Nzcy5qcyJdLCJuYW1lcyI6WyJkaWZmQ3NzIiwiY3NzRGlmZiIsInRva2VuaXplIiwidmFsdWUiLCJzcGxpdCIsIm9sZFN0ciIsIm5ld1N0ciIsImNhbGxiYWNrIiwiZGlmZiJdLCJtYXBwaW5ncyI6Ijs7OztnQ0FPZ0JBLE8sR0FBQUEsTzs7QUFQaEI7Ozs7Ozt1QkFFTyxJQUFNQyw2RUFBVSx3RUFBaEI7QUFDUEEsUUFBUUMsUUFBUixHQUFtQixVQUFTQyxLQUFULEVBQWdCO0FBQ2pDLFNBQU9BLE1BQU1DLEtBQU4sQ0FBWSxlQUFaLENBQVA7QUFDRCxDQUZEOztBQUlPLFNBQVNKLE9BQVQsQ0FBaUJLLE1BQWpCLEVBQXlCQyxNQUF6QixFQUFpQ0MsUUFBakMsRUFBMkM7QUFBRSxTQUFPTixRQUFRTyxJQUFSLENBQWFILE1BQWIsRUFBcUJDLE1BQXJCLEVBQTZCQyxRQUE3QixDQUFQO0FBQWdEIiwiZmlsZSI6ImNzcy5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cbmV4cG9ydCBjb25zdCBjc3NEaWZmID0gbmV3IERpZmYoKTtcbmNzc0RpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWUuc3BsaXQoLyhbe306OyxdfFxccyspLyk7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkNzcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHsgcmV0dXJuIGNzc0RpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spOyB9XG4iXX0=
+
+
+/***/ }),
+/* 8 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.jsonDiff = undefined;
+
+	var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
+
+	exports. /*istanbul ignore end*/diffJson = diffJson;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = canonicalize;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	/*istanbul ignore end*/var /*istanbul ignore start*/_line = __webpack_require__(5) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var objectPrototypeToString = Object.prototype.toString;
+
+	var jsonDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/jsonDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	// Discriminate between two lines of pretty-printed, serialized JSON where one of them has a
+	// dangling comma and the other doesn't. Turns out including the dangling comma yields the nicest output:
+	jsonDiff.useLongestToken = true;
+
+	jsonDiff.tokenize = /*istanbul ignore start*/_line.lineDiff /*istanbul ignore end*/.tokenize;
+	jsonDiff.castInput = function (value) {
+	  /*istanbul ignore start*/var _options = /*istanbul ignore end*/this.options,
+	      undefinedReplacement = _options.undefinedReplacement,
+	      _options$stringifyRep = _options.stringifyReplacer,
+	      stringifyReplacer = _options$stringifyRep === undefined ? function (k, v) /*istanbul ignore start*/{
+	    return (/*istanbul ignore end*/typeof v === 'undefined' ? undefinedReplacement : v
+	    );
+	  } : _options$stringifyRep;
+
+
+	  return typeof value === 'string' ? value : JSON.stringify(canonicalize(value, null, null, stringifyReplacer), stringifyReplacer, '  ');
+	};
+	jsonDiff.equals = function (left, right) {
+	  return (/*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/.prototype.equals.call(jsonDiff, left.replace(/,([\r\n])/g, '$1'), right.replace(/,([\r\n])/g, '$1'))
+	  );
+	};
+
+	function diffJson(oldObj, newObj, options) {
+	  return jsonDiff.diff(oldObj, newObj, options);
+	}
+
+	// This function handles the presence of circular references by bailing out when encountering an
+	// object that is already on the "stack" of items being processed. Accepts an optional replacer
+	function canonicalize(obj, stack, replacementStack, replacer, key) {
+	  stack = stack || [];
+	  replacementStack = replacementStack || [];
+
+	  if (replacer) {
+	    obj = replacer(key, obj);
+	  }
+
+	  var i = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+	  for (i = 0; i < stack.length; i += 1) {
+	    if (stack[i] === obj) {
+	      return replacementStack[i];
+	    }
+	  }
+
+	  var canonicalizedObj = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+	  if ('[object Array]' === objectPrototypeToString.call(obj)) {
+	    stack.push(obj);
+	    canonicalizedObj = new Array(obj.length);
+	    replacementStack.push(canonicalizedObj);
+	    for (i = 0; i < obj.length; i += 1) {
+	      canonicalizedObj[i] = canonicalize(obj[i], stack, replacementStack, replacer, key);
+	    }
+	    stack.pop();
+	    replacementStack.pop();
+	    return canonicalizedObj;
+	  }
+
+	  if (obj && obj.toJSON) {
+	    obj = obj.toJSON();
+	  }
+
+	  if ( /*istanbul ignore start*/(typeof /*istanbul ignore end*/obj === 'undefined' ? 'undefined' : _typeof(obj)) === 'object' && obj !== null) {
+	    stack.push(obj);
+	    canonicalizedObj = {};
+	    replacementStack.push(canonicalizedObj);
+	    var sortedKeys = [],
+	        _key = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+	    for (_key in obj) {
+	      /* istanbul ignore else */
+	      if (obj.hasOwnProperty(_key)) {
+	        sortedKeys.push(_key);
+	      }
+	    }
+	    sortedKeys.sort();
+	    for (i = 0; i < sortedKeys.length; i += 1) {
+	      _key = sortedKeys[i];
+	      canonicalizedObj[_key] = canonicalize(obj[_key], stack, replacementStack, replacer, _key);
+	    }
+	    stack.pop();
+	    replacementStack.pop();
+	  } else {
+	    canonicalizedObj = obj;
+	  }
+	  return canonicalizedObj;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2pzb24uanMiXSwibmFtZXMiOlsiZGlmZkpzb24iLCJjYW5vbmljYWxpemUiLCJvYmplY3RQcm90b3R5cGVUb1N0cmluZyIsIk9iamVjdCIsInByb3RvdHlwZSIsInRvU3RyaW5nIiwianNvbkRpZmYiLCJ1c2VMb25nZXN0VG9rZW4iLCJ0b2tlbml6ZSIsImNhc3RJbnB1dCIsInZhbHVlIiwib3B0aW9ucyIsInVuZGVmaW5lZFJlcGxhY2VtZW50Iiwic3RyaW5naWZ5UmVwbGFjZXIiLCJrIiwidiIsIkpTT04iLCJzdHJpbmdpZnkiLCJlcXVhbHMiLCJsZWZ0IiwicmlnaHQiLCJjYWxsIiwicmVwbGFjZSIsIm9sZE9iaiIsIm5ld09iaiIsImRpZmYiLCJvYmoiLCJzdGFjayIsInJlcGxhY2VtZW50U3RhY2siLCJyZXBsYWNlciIsImtleSIsImkiLCJsZW5ndGgiLCJjYW5vbmljYWxpemVkT2JqIiwicHVzaCIsIkFycmF5IiwicG9wIiwidG9KU09OIiwic29ydGVkS2V5cyIsImhhc093blByb3BlcnR5Iiwic29ydCJdLCJtYXBwaW5ncyI6Ijs7Ozs7OztnQ0FxQmdCQSxRLEdBQUFBLFE7eURBSUFDLFksR0FBQUEsWTs7QUF6QmhCOzs7O3VCQUNBOzs7O3VCQUVBLElBQU1DLDBCQUEwQkMsT0FBT0MsU0FBUCxDQUFpQkMsUUFBakQ7O0FBR08sSUFBTUMsK0VBQVcsd0VBQWpCO0FBQ1A7QUFDQTtBQUNBQSxTQUFTQyxlQUFULEdBQTJCLElBQTNCOztBQUVBRCxTQUFTRSxRQUFULEdBQW9CLGdFQUFTQSxRQUE3QjtBQUNBRixTQUFTRyxTQUFULEdBQXFCLFVBQVNDLEtBQVQsRUFBZ0I7QUFBQSxpRUFDK0UsS0FBS0MsT0FEcEY7QUFBQSxNQUM1QkMsb0JBRDRCLFlBQzVCQSxvQkFENEI7QUFBQSx1Q0FDTkMsaUJBRE07QUFBQSxNQUNOQSxpQkFETSx5Q0FDYyxVQUFDQyxDQUFELEVBQUlDLENBQUo7QUFBQSxtQ0FBVSxPQUFPQSxDQUFQLEtBQWEsV0FBYixHQUEyQkgsb0JBQTNCLEdBQWtERztBQUE1RDtBQUFBLEdBRGQ7OztBQUduQyxTQUFPLE9BQU9MLEtBQVAsS0FBaUIsUUFBakIsR0FBNEJBLEtBQTVCLEdBQW9DTSxLQUFLQyxTQUFMLENBQWVoQixhQUFhUyxLQUFiLEVBQW9CLElBQXBCLEVBQTBCLElBQTFCLEVBQWdDRyxpQkFBaEMsQ0FBZixFQUFtRUEsaUJBQW5FLEVBQXNGLElBQXRGLENBQTNDO0FBQ0QsQ0FKRDtBQUtBUCxTQUFTWSxNQUFULEdBQWtCLFVBQVNDLElBQVQsRUFBZUMsS0FBZixFQUFzQjtBQUN0QyxTQUFPLG9FQUFLaEIsU0FBTCxDQUFlYyxNQUFmLENBQXNCRyxJQUF0QixDQUEyQmYsUUFBM0IsRUFBcUNhLEtBQUtHLE9BQUwsQ0FBYSxZQUFiLEVBQTJCLElBQTNCLENBQXJDLEVBQXVFRixNQUFNRSxPQUFOLENBQWMsWUFBZCxFQUE0QixJQUE1QixDQUF2RTtBQUFQO0FBQ0QsQ0FGRDs7QUFJTyxTQUFTdEIsUUFBVCxDQUFrQnVCLE1BQWxCLEVBQTBCQyxNQUExQixFQUFrQ2IsT0FBbEMsRUFBMkM7QUFBRSxTQUFPTCxTQUFTbUIsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUFnRDs7QUFFcEc7QUFDQTtBQUNPLFNBQVNWLFlBQVQsQ0FBc0J5QixHQUF0QixFQUEyQkMsS0FBM0IsRUFBa0NDLGdCQUFsQyxFQUFvREMsUUFBcEQsRUFBOERDLEdBQTlELEVBQW1FO0FBQ3hFSCxVQUFRQSxTQUFTLEVBQWpCO0FBQ0FDLHFCQUFtQkEsb0JBQW9CLEVBQXZDOztBQUVBLE1BQUlDLFFBQUosRUFBYztBQUNaSCxVQUFNRyxTQUFTQyxHQUFULEVBQWNKLEdBQWQsQ0FBTjtBQUNEOztBQUVELE1BQUlLLG1DQUFKOztBQUVBLE9BQUtBLElBQUksQ0FBVCxFQUFZQSxJQUFJSixNQUFNSyxNQUF0QixFQUE4QkQsS0FBSyxDQUFuQyxFQUFzQztBQUNwQyxRQUFJSixNQUFNSSxDQUFOLE1BQWFMLEdBQWpCLEVBQXNCO0FBQ3BCLGFBQU9FLGlCQUFpQkcsQ0FBakIsQ0FBUDtBQUNEO0FBQ0Y7O0FBRUQsTUFBSUUsa0RBQUo7O0FBRUEsTUFBSSxxQkFBcUIvQix3QkFBd0JtQixJQUF4QixDQUE2QkssR0FBN0IsQ0FBekIsRUFBNEQ7QUFDMURDLFVBQU1PLElBQU4sQ0FBV1IsR0FBWDtBQUNBTyx1QkFBbUIsSUFBSUUsS0FBSixDQUFVVCxJQUFJTSxNQUFkLENBQW5CO0FBQ0FKLHFCQUFpQk0sSUFBakIsQ0FBc0JELGdCQUF0QjtBQUNBLFNBQUtGLElBQUksQ0FBVCxFQUFZQSxJQUFJTCxJQUFJTSxNQUFwQixFQUE0QkQsS0FBSyxDQUFqQyxFQUFvQztBQUNsQ0UsdUJBQWlCRixDQUFqQixJQUFzQjlCLGFBQWF5QixJQUFJSyxDQUFKLENBQWIsRUFBcUJKLEtBQXJCLEVBQTRCQyxnQkFBNUIsRUFBOENDLFFBQTlDLEVBQXdEQyxHQUF4RCxDQUF0QjtBQUNEO0FBQ0RILFVBQU1TLEdBQU47QUFDQVIscUJBQWlCUSxHQUFqQjtBQUNBLFdBQU9ILGdCQUFQO0FBQ0Q7O0FBRUQsTUFBSVAsT0FBT0EsSUFBSVcsTUFBZixFQUF1QjtBQUNyQlgsVUFBTUEsSUFBSVcsTUFBSixFQUFOO0FBQ0Q7O0FBRUQsTUFBSSx5REFBT1gsR0FBUCx5Q0FBT0EsR0FBUCxPQUFlLFFBQWYsSUFBMkJBLFFBQVEsSUFBdkMsRUFBNkM7QUFDM0NDLFVBQU1PLElBQU4sQ0FBV1IsR0FBWDtBQUNBTyx1QkFBbUIsRUFBbkI7QUFDQUwscUJBQWlCTSxJQUFqQixDQUFzQkQsZ0JBQXRCO0FBQ0EsUUFBSUssYUFBYSxFQUFqQjtBQUFBLFFBQ0lSLHNDQURKO0FBRUEsU0FBS0EsSUFBTCxJQUFZSixHQUFaLEVBQWlCO0FBQ2Y7QUFDQSxVQUFJQSxJQUFJYSxjQUFKLENBQW1CVCxJQUFuQixDQUFKLEVBQTZCO0FBQzNCUSxtQkFBV0osSUFBWCxDQUFnQkosSUFBaEI7QUFDRDtBQUNGO0FBQ0RRLGVBQVdFLElBQVg7QUFDQSxTQUFLVCxJQUFJLENBQVQsRUFBWUEsSUFBSU8sV0FBV04sTUFBM0IsRUFBbUNELEtBQUssQ0FBeEMsRUFBMkM7QUFDekNELGFBQU1RLFdBQVdQLENBQVgsQ0FBTjtBQUNBRSx1QkFBaUJILElBQWpCLElBQXdCN0IsYUFBYXlCLElBQUlJLElBQUosQ0FBYixFQUF1QkgsS0FBdkIsRUFBOEJDLGdCQUE5QixFQUFnREMsUUFBaEQsRUFBMERDLElBQTFELENBQXhCO0FBQ0Q7QUFDREgsVUFBTVMsR0FBTjtBQUNBUixxQkFBaUJRLEdBQWpCO0FBQ0QsR0FuQkQsTUFtQk87QUFDTEgsdUJBQW1CUCxHQUFuQjtBQUNEO0FBQ0QsU0FBT08sZ0JBQVA7QUFDRCIsImZpbGUiOiJqc29uLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IERpZmYgZnJvbSAnLi9iYXNlJztcbmltcG9ydCB7bGluZURpZmZ9IGZyb20gJy4vbGluZSc7XG5cbmNvbnN0IG9iamVjdFByb3RvdHlwZVRvU3RyaW5nID0gT2JqZWN0LnByb3RvdHlwZS50b1N0cmluZztcblxuXG5leHBvcnQgY29uc3QganNvbkRpZmYgPSBuZXcgRGlmZigpO1xuLy8gRGlzY3JpbWluYXRlIGJldHdlZW4gdHdvIGxpbmVzIG9mIHByZXR0eS1wcmludGVkLCBzZXJpYWxpemVkIEpTT04gd2hlcmUgb25lIG9mIHRoZW0gaGFzIGFcbi8vIGRhbmdsaW5nIGNvbW1hIGFuZCB0aGUgb3RoZXIgZG9lc24ndC4gVHVybnMgb3V0IGluY2x1ZGluZyB0aGUgZGFuZ2xpbmcgY29tbWEgeWllbGRzIHRoZSBuaWNlc3Qgb3V0cHV0OlxuanNvbkRpZmYudXNlTG9uZ2VzdFRva2VuID0gdHJ1ZTtcblxuanNvbkRpZmYudG9rZW5pemUgPSBsaW5lRGlmZi50b2tlbml6ZTtcbmpzb25EaWZmLmNhc3RJbnB1dCA9IGZ1bmN0aW9uKHZhbHVlKSB7XG4gIGNvbnN0IHt1bmRlZmluZWRSZXBsYWNlbWVudCwgc3RyaW5naWZ5UmVwbGFjZXIgPSAoaywgdikgPT4gdHlwZW9mIHYgPT09ICd1bmRlZmluZWQnID8gdW5kZWZpbmVkUmVwbGFjZW1lbnQgOiB2fSA9IHRoaXMub3B0aW9ucztcblxuICByZXR1cm4gdHlwZW9mIHZhbHVlID09PSAnc3RyaW5nJyA/IHZhbHVlIDogSlNPTi5zdHJpbmdpZnkoY2Fub25pY2FsaXplKHZhbHVlLCBudWxsLCBudWxsLCBzdHJpbmdpZnlSZXBsYWNlciksIHN0cmluZ2lmeVJlcGxhY2VyLCAnICAnKTtcbn07XG5qc29uRGlmZi5lcXVhbHMgPSBmdW5jdGlvbihsZWZ0LCByaWdodCkge1xuICByZXR1cm4gRGlmZi5wcm90b3R5cGUuZXF1YWxzLmNhbGwoanNvbkRpZmYsIGxlZnQucmVwbGFjZSgvLChbXFxyXFxuXSkvZywgJyQxJyksIHJpZ2h0LnJlcGxhY2UoLywoW1xcclxcbl0pL2csICckMScpKTtcbn07XG5cbmV4cG9ydCBmdW5jdGlvbiBkaWZmSnNvbihvbGRPYmosIG5ld09iaiwgb3B0aW9ucykgeyByZXR1cm4ganNvbkRpZmYuZGlmZihvbGRPYmosIG5ld09iaiwgb3B0aW9ucyk7IH1cblxuLy8gVGhpcyBmdW5jdGlvbiBoYW5kbGVzIHRoZSBwcmVzZW5jZSBvZiBjaXJjdWxhciByZWZlcmVuY2VzIGJ5IGJhaWxpbmcgb3V0IHdoZW4gZW5jb3VudGVyaW5nIGFuXG4vLyBvYmplY3QgdGhhdCBpcyBhbHJlYWR5IG9uIHRoZSBcInN0YWNrXCIgb2YgaXRlbXMgYmVpbmcgcHJvY2Vzc2VkLiBBY2NlcHRzIGFuIG9wdGlvbmFsIHJlcGxhY2VyXG5leHBvcnQgZnVuY3Rpb24gY2Fub25pY2FsaXplKG9iaiwgc3RhY2ssIHJlcGxhY2VtZW50U3RhY2ssIHJlcGxhY2VyLCBrZXkpIHtcbiAgc3RhY2sgPSBzdGFjayB8fCBbXTtcbiAgcmVwbGFjZW1lbnRTdGFjayA9IHJlcGxhY2VtZW50U3RhY2sgfHwgW107XG5cbiAgaWYgKHJlcGxhY2VyKSB7XG4gICAgb2JqID0gcmVwbGFjZXIoa2V5LCBvYmopO1xuICB9XG5cbiAgbGV0IGk7XG5cbiAgZm9yIChpID0gMDsgaSA8IHN0YWNrLmxlbmd0aDsgaSArPSAxKSB7XG4gICAgaWYgKHN0YWNrW2ldID09PSBvYmopIHtcbiAgICAgIHJldHVybiByZXBsYWNlbWVudFN0YWNrW2ldO1xuICAgIH1cbiAgfVxuXG4gIGxldCBjYW5vbmljYWxpemVkT2JqO1xuXG4gIGlmICgnW29iamVjdCBBcnJheV0nID09PSBvYmplY3RQcm90b3R5cGVUb1N0cmluZy5jYWxsKG9iaikpIHtcbiAgICBzdGFjay5wdXNoKG9iaik7XG4gICAgY2Fub25pY2FsaXplZE9iaiA9IG5ldyBBcnJheShvYmoubGVuZ3RoKTtcbiAgICByZXBsYWNlbWVudFN0YWNrLnB1c2goY2Fub25pY2FsaXplZE9iaik7XG4gICAgZm9yIChpID0gMDsgaSA8IG9iai5sZW5ndGg7IGkgKz0gMSkge1xuICAgICAgY2Fub25pY2FsaXplZE9ialtpXSA9IGNhbm9uaWNhbGl6ZShvYmpbaV0sIHN0YWNrLCByZXBsYWNlbWVudFN0YWNrLCByZXBsYWNlciwga2V5KTtcbiAgICB9XG4gICAgc3RhY2sucG9wKCk7XG4gICAgcmVwbGFjZW1lbnRTdGFjay5wb3AoKTtcbiAgICByZXR1cm4gY2Fub25pY2FsaXplZE9iajtcbiAgfVxuXG4gIGlmIChvYmogJiYgb2JqLnRvSlNPTikge1xuICAgIG9iaiA9IG9iai50b0pTT04oKTtcbiAgfVxuXG4gIGlmICh0eXBlb2Ygb2JqID09PSAnb2JqZWN0JyAmJiBvYmogIT09IG51bGwpIHtcbiAgICBzdGFjay5wdXNoKG9iaik7XG4gICAgY2Fub25pY2FsaXplZE9iaiA9IHt9O1xuICAgIHJlcGxhY2VtZW50U3RhY2sucHVzaChjYW5vbmljYWxpemVkT2JqKTtcbiAgICBsZXQgc29ydGVkS2V5cyA9IFtdLFxuICAgICAgICBrZXk7XG4gICAgZm9yIChrZXkgaW4gb2JqKSB7XG4gICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgZWxzZSAqL1xuICAgICAgaWYgKG9iai5oYXNPd25Qcm9wZXJ0eShrZXkpKSB7XG4gICAgICAgIHNvcnRlZEtleXMucHVzaChrZXkpO1xuICAgICAgfVxuICAgIH1cbiAgICBzb3J0ZWRLZXlzLnNvcnQoKTtcbiAgICBmb3IgKGkgPSAwOyBpIDwgc29ydGVkS2V5cy5sZW5ndGg7IGkgKz0gMSkge1xuICAgICAga2V5ID0gc29ydGVkS2V5c1tpXTtcbiAgICAgIGNhbm9uaWNhbGl6ZWRPYmpba2V5XSA9IGNhbm9uaWNhbGl6ZShvYmpba2V5XSwgc3RhY2ssIHJlcGxhY2VtZW50U3RhY2ssIHJlcGxhY2VyLCBrZXkpO1xuICAgIH1cbiAgICBzdGFjay5wb3AoKTtcbiAgICByZXBsYWNlbWVudFN0YWNrLnBvcCgpO1xuICB9IGVsc2Uge1xuICAgIGNhbm9uaWNhbGl6ZWRPYmogPSBvYmo7XG4gIH1cbiAgcmV0dXJuIGNhbm9uaWNhbGl6ZWRPYmo7XG59XG4iXX0=
+
+
+/***/ }),
+/* 9 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports.arrayDiff = undefined;
+	exports. /*istanbul ignore end*/diffArrays = diffArrays;
+
+	var /*istanbul ignore start*/_base = __webpack_require__(1) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/var arrayDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/arrayDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+	arrayDiff.tokenize = function (value) {
+	  return value.slice();
+	};
+	arrayDiff.join = arrayDiff.removeEmpty = function (value) {
+	  return value;
+	};
+
+	function diffArrays(oldArr, newArr, callback) {
+	  return arrayDiff.diff(oldArr, newArr, callback);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2FycmF5LmpzIl0sIm5hbWVzIjpbImRpZmZBcnJheXMiLCJhcnJheURpZmYiLCJ0b2tlbml6ZSIsInZhbHVlIiwic2xpY2UiLCJqb2luIiwicmVtb3ZlRW1wdHkiLCJvbGRBcnIiLCJuZXdBcnIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBVWdCQSxVLEdBQUFBLFU7O0FBVmhCOzs7Ozs7dUJBRU8sSUFBTUMsaUZBQVksd0VBQWxCO0FBQ1BBLFVBQVVDLFFBQVYsR0FBcUIsVUFBU0MsS0FBVCxFQUFnQjtBQUNuQyxTQUFPQSxNQUFNQyxLQUFOLEVBQVA7QUFDRCxDQUZEO0FBR0FILFVBQVVJLElBQVYsR0FBaUJKLFVBQVVLLFdBQVYsR0FBd0IsVUFBU0gsS0FBVCxFQUFnQjtBQUN2RCxTQUFPQSxLQUFQO0FBQ0QsQ0FGRDs7QUFJTyxTQUFTSCxVQUFULENBQW9CTyxNQUFwQixFQUE0QkMsTUFBNUIsRUFBb0NDLFFBQXBDLEVBQThDO0FBQUUsU0FBT1IsVUFBVVMsSUFBVixDQUFlSCxNQUFmLEVBQXVCQyxNQUF2QixFQUErQkMsUUFBL0IsQ0FBUDtBQUFrRCIsImZpbGUiOiJhcnJheS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cbmV4cG9ydCBjb25zdCBhcnJheURpZmYgPSBuZXcgRGlmZigpO1xuYXJyYXlEaWZmLnRva2VuaXplID0gZnVuY3Rpb24odmFsdWUpIHtcbiAgcmV0dXJuIHZhbHVlLnNsaWNlKCk7XG59O1xuYXJyYXlEaWZmLmpvaW4gPSBhcnJheURpZmYucmVtb3ZlRW1wdHkgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWU7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkFycmF5cyhvbGRBcnIsIG5ld0FyciwgY2FsbGJhY2spIHsgcmV0dXJuIGFycmF5RGlmZi5kaWZmKG9sZEFyciwgbmV3QXJyLCBjYWxsYmFjayk7IH1cbiJdfQ==
+
+
+/***/ }),
+/* 10 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/applyPatch = applyPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = applyPatches;
+
+	var /*istanbul ignore start*/_parse = __webpack_require__(11) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_distanceIterator = __webpack_require__(12) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/var _distanceIterator2 = _interopRequireDefault(_distanceIterator);
+
+	function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+	/*istanbul ignore end*/function applyPatch(source, uniDiff) {
+	  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+	  if (typeof uniDiff === 'string') {
+	    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+	  }
+
+	  if (Array.isArray(uniDiff)) {
+	    if (uniDiff.length > 1) {
+	      throw new Error('applyPatch only works with a single input.');
+	    }
+
+	    uniDiff = uniDiff[0];
+	  }
+
+	  // Apply the diff to the input
+	  var lines = source.split(/\r\n|[\n\v\f\r\x85]/),
+	      delimiters = source.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+	      hunks = uniDiff.hunks,
+	      compareLine = options.compareLine || function (lineNumber, line, operation, patchContent) /*istanbul ignore start*/{
+	    return (/*istanbul ignore end*/line === patchContent
+	    );
+	  },
+	      errorCount = 0,
+	      fuzzFactor = options.fuzzFactor || 0,
+	      minLine = 0,
+	      offset = 0,
+	      removeEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+	      addEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+	  /**
+	   * Checks if the hunk exactly fits on the provided location
+	   */
+	  function hunkFits(hunk, toPos) {
+	    for (var j = 0; j < hunk.lines.length; j++) {
+	      var line = hunk.lines[j],
+	          operation = line.length > 0 ? line[0] : ' ',
+	          content = line.length > 0 ? line.substr(1) : line;
+
+	      if (operation === ' ' || operation === '-') {
+	        // Context sanity check
+	        if (!compareLine(toPos + 1, lines[toPos], operation, content)) {
+	          errorCount++;
+
+	          if (errorCount > fuzzFactor) {
+	            return false;
+	          }
+	        }
+	        toPos++;
+	      }
+	    }
+
+	    return true;
+	  }
+
+	  // Search best fit offsets for each hunk based on the previous ones
+	  for (var i = 0; i < hunks.length; i++) {
+	    var hunk = hunks[i],
+	        maxLine = lines.length - hunk.oldLines,
+	        localOffset = 0,
+	        toPos = offset + hunk.oldStart - 1;
+
+	    var iterator = /*istanbul ignore start*/(0, _distanceIterator2['default']) /*istanbul ignore end*/(toPos, minLine, maxLine);
+
+	    for (; localOffset !== undefined; localOffset = iterator()) {
+	      if (hunkFits(hunk, toPos + localOffset)) {
+	        hunk.offset = offset += localOffset;
+	        break;
+	      }
+	    }
+
+	    if (localOffset === undefined) {
+	      return false;
+	    }
+
+	    // Set lower text limit to end of the current hunk, so next ones don't try
+	    // to fit over already patched text
+	    minLine = hunk.offset + hunk.oldStart + hunk.oldLines;
+	  }
+
+	  // Apply patch hunks
+	  var diffOffset = 0;
+	  for (var _i = 0; _i < hunks.length; _i++) {
+	    var _hunk = hunks[_i],
+	        _toPos = _hunk.oldStart + _hunk.offset + diffOffset - 1;
+	    diffOffset += _hunk.newLines - _hunk.oldLines;
+
+	    if (_toPos < 0) {
+	      // Creating a new file
+	      _toPos = 0;
+	    }
+
+	    for (var j = 0; j < _hunk.lines.length; j++) {
+	      var line = _hunk.lines[j],
+	          operation = line.length > 0 ? line[0] : ' ',
+	          content = line.length > 0 ? line.substr(1) : line,
+	          delimiter = _hunk.linedelimiters[j];
+
+	      if (operation === ' ') {
+	        _toPos++;
+	      } else if (operation === '-') {
+	        lines.splice(_toPos, 1);
+	        delimiters.splice(_toPos, 1);
+	        /* istanbul ignore else */
+	      } else if (operation === '+') {
+	        lines.splice(_toPos, 0, content);
+	        delimiters.splice(_toPos, 0, delimiter);
+	        _toPos++;
+	      } else if (operation === '\\') {
+	        var previousOperation = _hunk.lines[j - 1] ? _hunk.lines[j - 1][0] : null;
+	        if (previousOperation === '+') {
+	          removeEOFNL = true;
+	        } else if (previousOperation === '-') {
+	          addEOFNL = true;
+	        }
+	      }
+	    }
+	  }
+
+	  // Handle EOFNL insertion/removal
+	  if (removeEOFNL) {
+	    while (!lines[lines.length - 1]) {
+	      lines.pop();
+	      delimiters.pop();
+	    }
+	  } else if (addEOFNL) {
+	    lines.push('');
+	    delimiters.push('\n');
+	  }
+	  for (var _k = 0; _k < lines.length - 1; _k++) {
+	    lines[_k] = lines[_k] + delimiters[_k];
+	  }
+	  return lines.join('');
+	}
+
+	// Wrapper that supports multiple file patches via callbacks.
+	function applyPatches(uniDiff, options) {
+	  if (typeof uniDiff === 'string') {
+	    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+	  }
+
+	  var currentIndex = 0;
+	  function processIndex() {
+	    var index = uniDiff[currentIndex++];
+	    if (!index) {
+	      return options.complete();
+	    }
+
+	    options.loadFile(index, function (err, data) {
+	      if (err) {
+	        return options.complete(err);
+	      }
+
+	      var updatedContent = applyPatch(data, index, options);
+	      options.patched(index, updatedContent, function (err) {
+	        if (err) {
+	          return options.complete(err);
+	        }
+
+	        processIndex();
+	      });
+	    });
+	  }
+	  processIndex();
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9hcHBseS5qcyJdLCJuYW1lcyI6WyJhcHBseVBhdGNoIiwiYXBwbHlQYXRjaGVzIiwic291cmNlIiwidW5pRGlmZiIsIm9wdGlvbnMiLCJBcnJheSIsImlzQXJyYXkiLCJsZW5ndGgiLCJFcnJvciIsImxpbmVzIiwic3BsaXQiLCJkZWxpbWl0ZXJzIiwibWF0Y2giLCJodW5rcyIsImNvbXBhcmVMaW5lIiwibGluZU51bWJlciIsImxpbmUiLCJvcGVyYXRpb24iLCJwYXRjaENvbnRlbnQiLCJlcnJvckNvdW50IiwiZnV6ekZhY3RvciIsIm1pbkxpbmUiLCJvZmZzZXQiLCJyZW1vdmVFT0ZOTCIsImFkZEVPRk5MIiwiaHVua0ZpdHMiLCJodW5rIiwidG9Qb3MiLCJqIiwiY29udGVudCIsInN1YnN0ciIsImkiLCJtYXhMaW5lIiwib2xkTGluZXMiLCJsb2NhbE9mZnNldCIsIm9sZFN0YXJ0IiwiaXRlcmF0b3IiLCJ1bmRlZmluZWQiLCJkaWZmT2Zmc2V0IiwibmV3TGluZXMiLCJkZWxpbWl0ZXIiLCJsaW5lZGVsaW1pdGVycyIsInNwbGljZSIsInByZXZpb3VzT3BlcmF0aW9uIiwicG9wIiwicHVzaCIsIl9rIiwiam9pbiIsImN1cnJlbnRJbmRleCIsInByb2Nlc3NJbmRleCIsImluZGV4IiwiY29tcGxldGUiLCJsb2FkRmlsZSIsImVyciIsImRhdGEiLCJ1cGRhdGVkQ29udGVudCIsInBhdGNoZWQiXSwibWFwcGluZ3MiOiI7OztnQ0FHZ0JBLFUsR0FBQUEsVTt5REFvSUFDLFksR0FBQUEsWTs7QUF2SWhCOztBQUNBOzs7Ozs7dUJBRU8sU0FBU0QsVUFBVCxDQUFvQkUsTUFBcEIsRUFBNEJDLE9BQTVCLEVBQW1EO0FBQUEsc0RBQWRDLE9BQWMsdUVBQUosRUFBSTs7QUFDeEQsTUFBSSxPQUFPRCxPQUFQLEtBQW1CLFFBQXZCLEVBQWlDO0FBQy9CQSxjQUFVLHdFQUFXQSxPQUFYLENBQVY7QUFDRDs7QUFFRCxNQUFJRSxNQUFNQyxPQUFOLENBQWNILE9BQWQsQ0FBSixFQUE0QjtBQUMxQixRQUFJQSxRQUFRSSxNQUFSLEdBQWlCLENBQXJCLEVBQXdCO0FBQ3RCLFlBQU0sSUFBSUMsS0FBSixDQUFVLDRDQUFWLENBQU47QUFDRDs7QUFFREwsY0FBVUEsUUFBUSxDQUFSLENBQVY7QUFDRDs7QUFFRDtBQUNBLE1BQUlNLFFBQVFQLE9BQU9RLEtBQVAsQ0FBYSxxQkFBYixDQUFaO0FBQUEsTUFDSUMsYUFBYVQsT0FBT1UsS0FBUCxDQUFhLHNCQUFiLEtBQXdDLEVBRHpEO0FBQUEsTUFFSUMsUUFBUVYsUUFBUVUsS0FGcEI7QUFBQSxNQUlJQyxjQUFjVixRQUFRVSxXQUFSLElBQXdCLFVBQUNDLFVBQUQsRUFBYUMsSUFBYixFQUFtQkMsU0FBbkIsRUFBOEJDLFlBQTlCO0FBQUEsbUNBQStDRixTQUFTRTtBQUF4RDtBQUFBLEdBSjFDO0FBQUEsTUFLSUMsYUFBYSxDQUxqQjtBQUFBLE1BTUlDLGFBQWFoQixRQUFRZ0IsVUFBUixJQUFzQixDQU52QztBQUFBLE1BT0lDLFVBQVUsQ0FQZDtBQUFBLE1BUUlDLFNBQVMsQ0FSYjtBQUFBLE1BVUlDLDZDQVZKO0FBQUEsTUFXSUMsMENBWEo7O0FBYUE7OztBQUdBLFdBQVNDLFFBQVQsQ0FBa0JDLElBQWxCLEVBQXdCQyxLQUF4QixFQUErQjtBQUM3QixTQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUYsS0FBS2pCLEtBQUwsQ0FBV0YsTUFBL0IsRUFBdUNxQixHQUF2QyxFQUE0QztBQUMxQyxVQUFJWixPQUFPVSxLQUFLakIsS0FBTCxDQUFXbUIsQ0FBWCxDQUFYO0FBQUEsVUFDSVgsWUFBYUQsS0FBS1QsTUFBTCxHQUFjLENBQWQsR0FBa0JTLEtBQUssQ0FBTCxDQUFsQixHQUE0QixHQUQ3QztBQUFBLFVBRUlhLFVBQVdiLEtBQUtULE1BQUwsR0FBYyxDQUFkLEdBQWtCUyxLQUFLYyxNQUFMLENBQVksQ0FBWixDQUFsQixHQUFtQ2QsSUFGbEQ7O0FBSUEsVUFBSUMsY0FBYyxHQUFkLElBQXFCQSxjQUFjLEdBQXZDLEVBQTRDO0FBQzFDO0FBQ0EsWUFBSSxDQUFDSCxZQUFZYSxRQUFRLENBQXBCLEVBQXVCbEIsTUFBTWtCLEtBQU4sQ0FBdkIsRUFBcUNWLFNBQXJDLEVBQWdEWSxPQUFoRCxDQUFMLEVBQStEO0FBQzdEVjs7QUFFQSxjQUFJQSxhQUFhQyxVQUFqQixFQUE2QjtBQUMzQixtQkFBTyxLQUFQO0FBQ0Q7QUFDRjtBQUNETztBQUNEO0FBQ0Y7O0FBRUQsV0FBTyxJQUFQO0FBQ0Q7O0FBRUQ7QUFDQSxPQUFLLElBQUlJLElBQUksQ0FBYixFQUFnQkEsSUFBSWxCLE1BQU1OLE1BQTFCLEVBQWtDd0IsR0FBbEMsRUFBdUM7QUFDckMsUUFBSUwsT0FBT2IsTUFBTWtCLENBQU4sQ0FBWDtBQUFBLFFBQ0lDLFVBQVV2QixNQUFNRixNQUFOLEdBQWVtQixLQUFLTyxRQURsQztBQUFBLFFBRUlDLGNBQWMsQ0FGbEI7QUFBQSxRQUdJUCxRQUFRTCxTQUFTSSxLQUFLUyxRQUFkLEdBQXlCLENBSHJDOztBQUtBLFFBQUlDLFdBQVcsb0ZBQWlCVCxLQUFqQixFQUF3Qk4sT0FBeEIsRUFBaUNXLE9BQWpDLENBQWY7O0FBRUEsV0FBT0UsZ0JBQWdCRyxTQUF2QixFQUFrQ0gsY0FBY0UsVUFBaEQsRUFBNEQ7QUFDMUQsVUFBSVgsU0FBU0MsSUFBVCxFQUFlQyxRQUFRTyxXQUF2QixDQUFKLEVBQXlDO0FBQ3ZDUixhQUFLSixNQUFMLEdBQWNBLFVBQVVZLFdBQXhCO0FBQ0E7QUFDRDtBQUNGOztBQUVELFFBQUlBLGdCQUFnQkcsU0FBcEIsRUFBK0I7QUFDN0IsYUFBTyxLQUFQO0FBQ0Q7O0FBRUQ7QUFDQTtBQUNBaEIsY0FBVUssS0FBS0osTUFBTCxHQUFjSSxLQUFLUyxRQUFuQixHQUE4QlQsS0FBS08sUUFBN0M7QUFDRDs7QUFFRDtBQUNBLE1BQUlLLGFBQWEsQ0FBakI7QUFDQSxPQUFLLElBQUlQLEtBQUksQ0FBYixFQUFnQkEsS0FBSWxCLE1BQU1OLE1BQTFCLEVBQWtDd0IsSUFBbEMsRUFBdUM7QUFDckMsUUFBSUwsUUFBT2IsTUFBTWtCLEVBQU4sQ0FBWDtBQUFBLFFBQ0lKLFNBQVFELE1BQUtTLFFBQUwsR0FBZ0JULE1BQUtKLE1BQXJCLEdBQThCZ0IsVUFBOUIsR0FBMkMsQ0FEdkQ7QUFFQUEsa0JBQWNaLE1BQUthLFFBQUwsR0FBZ0JiLE1BQUtPLFFBQW5DOztBQUVBLFFBQUlOLFNBQVEsQ0FBWixFQUFlO0FBQUU7QUFDZkEsZUFBUSxDQUFSO0FBQ0Q7O0FBRUQsU0FBSyxJQUFJQyxJQUFJLENBQWIsRUFBZ0JBLElBQUlGLE1BQUtqQixLQUFMLENBQVdGLE1BQS9CLEVBQXVDcUIsR0FBdkMsRUFBNEM7QUFDMUMsVUFBSVosT0FBT1UsTUFBS2pCLEtBQUwsQ0FBV21CLENBQVgsQ0FBWDtBQUFBLFVBQ0lYLFlBQWFELEtBQUtULE1BQUwsR0FBYyxDQUFkLEdBQWtCUyxLQUFLLENBQUwsQ0FBbEIsR0FBNEIsR0FEN0M7QUFBQSxVQUVJYSxVQUFXYixLQUFLVCxNQUFMLEdBQWMsQ0FBZCxHQUFrQlMsS0FBS2MsTUFBTCxDQUFZLENBQVosQ0FBbEIsR0FBbUNkLElBRmxEO0FBQUEsVUFHSXdCLFlBQVlkLE1BQUtlLGNBQUwsQ0FBb0JiLENBQXBCLENBSGhCOztBQUtBLFVBQUlYLGNBQWMsR0FBbEIsRUFBdUI7QUFDckJVO0FBQ0QsT0FGRCxNQUVPLElBQUlWLGNBQWMsR0FBbEIsRUFBdUI7QUFDNUJSLGNBQU1pQyxNQUFOLENBQWFmLE1BQWIsRUFBb0IsQ0FBcEI7QUFDQWhCLG1CQUFXK0IsTUFBWCxDQUFrQmYsTUFBbEIsRUFBeUIsQ0FBekI7QUFDRjtBQUNDLE9BSk0sTUFJQSxJQUFJVixjQUFjLEdBQWxCLEVBQXVCO0FBQzVCUixjQUFNaUMsTUFBTixDQUFhZixNQUFiLEVBQW9CLENBQXBCLEVBQXVCRSxPQUF2QjtBQUNBbEIsbUJBQVcrQixNQUFYLENBQWtCZixNQUFsQixFQUF5QixDQUF6QixFQUE0QmEsU0FBNUI7QUFDQWI7QUFDRCxPQUpNLE1BSUEsSUFBSVYsY0FBYyxJQUFsQixFQUF3QjtBQUM3QixZQUFJMEIsb0JBQW9CakIsTUFBS2pCLEtBQUwsQ0FBV21CLElBQUksQ0FBZixJQUFvQkYsTUFBS2pCLEtBQUwsQ0FBV21CLElBQUksQ0FBZixFQUFrQixDQUFsQixDQUFwQixHQUEyQyxJQUFuRTtBQUNBLFlBQUllLHNCQUFzQixHQUExQixFQUErQjtBQUM3QnBCLHdCQUFjLElBQWQ7QUFDRCxTQUZELE1BRU8sSUFBSW9CLHNCQUFzQixHQUExQixFQUErQjtBQUNwQ25CLHFCQUFXLElBQVg7QUFDRDtBQUNGO0FBQ0Y7QUFDRjs7QUFFRDtBQUNBLE1BQUlELFdBQUosRUFBaUI7QUFDZixXQUFPLENBQUNkLE1BQU1BLE1BQU1GLE1BQU4sR0FBZSxDQUFyQixDQUFSLEVBQWlDO0FBQy9CRSxZQUFNbUMsR0FBTjtBQUNBakMsaUJBQVdpQyxHQUFYO0FBQ0Q7QUFDRixHQUxELE1BS08sSUFBSXBCLFFBQUosRUFBYztBQUNuQmYsVUFBTW9DLElBQU4sQ0FBVyxFQUFYO0FBQ0FsQyxlQUFXa0MsSUFBWCxDQUFnQixJQUFoQjtBQUNEO0FBQ0QsT0FBSyxJQUFJQyxLQUFLLENBQWQsRUFBaUJBLEtBQUtyQyxNQUFNRixNQUFOLEdBQWUsQ0FBckMsRUFBd0N1QyxJQUF4QyxFQUE4QztBQUM1Q3JDLFVBQU1xQyxFQUFOLElBQVlyQyxNQUFNcUMsRUFBTixJQUFZbkMsV0FBV21DLEVBQVgsQ0FBeEI7QUFDRDtBQUNELFNBQU9yQyxNQUFNc0MsSUFBTixDQUFXLEVBQVgsQ0FBUDtBQUNEOztBQUVEO0FBQ08sU0FBUzlDLFlBQVQsQ0FBc0JFLE9BQXRCLEVBQStCQyxPQUEvQixFQUF3QztBQUM3QyxNQUFJLE9BQU9ELE9BQVAsS0FBbUIsUUFBdkIsRUFBaUM7QUFDL0JBLGNBQVUsd0VBQVdBLE9BQVgsQ0FBVjtBQUNEOztBQUVELE1BQUk2QyxlQUFlLENBQW5CO0FBQ0EsV0FBU0MsWUFBVCxHQUF3QjtBQUN0QixRQUFJQyxRQUFRL0MsUUFBUTZDLGNBQVIsQ0FBWjtBQUNBLFFBQUksQ0FBQ0UsS0FBTCxFQUFZO0FBQ1YsYUFBTzlDLFFBQVErQyxRQUFSLEVBQVA7QUFDRDs7QUFFRC9DLFlBQVFnRCxRQUFSLENBQWlCRixLQUFqQixFQUF3QixVQUFTRyxHQUFULEVBQWNDLElBQWQsRUFBb0I7QUFDMUMsVUFBSUQsR0FBSixFQUFTO0FBQ1AsZUFBT2pELFFBQVErQyxRQUFSLENBQWlCRSxHQUFqQixDQUFQO0FBQ0Q7O0FBRUQsVUFBSUUsaUJBQWlCdkQsV0FBV3NELElBQVgsRUFBaUJKLEtBQWpCLEVBQXdCOUMsT0FBeEIsQ0FBckI7QUFDQUEsY0FBUW9ELE9BQVIsQ0FBZ0JOLEtBQWhCLEVBQXVCSyxjQUF2QixFQUF1QyxVQUFTRixHQUFULEVBQWM7QUFDbkQsWUFBSUEsR0FBSixFQUFTO0FBQ1AsaUJBQU9qRCxRQUFRK0MsUUFBUixDQUFpQkUsR0FBakIsQ0FBUDtBQUNEOztBQUVESjtBQUNELE9BTkQ7QUFPRCxLQWJEO0FBY0Q7QUFDREE7QUFDRCIsImZpbGUiOiJhcHBseS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCB7cGFyc2VQYXRjaH0gZnJvbSAnLi9wYXJzZSc7XG5pbXBvcnQgZGlzdGFuY2VJdGVyYXRvciBmcm9tICcuLi91dGlsL2Rpc3RhbmNlLWl0ZXJhdG9yJztcblxuZXhwb3J0IGZ1bmN0aW9uIGFwcGx5UGF0Y2goc291cmNlLCB1bmlEaWZmLCBvcHRpb25zID0ge30pIHtcbiAgaWYgKHR5cGVvZiB1bmlEaWZmID09PSAnc3RyaW5nJykge1xuICAgIHVuaURpZmYgPSBwYXJzZVBhdGNoKHVuaURpZmYpO1xuICB9XG5cbiAgaWYgKEFycmF5LmlzQXJyYXkodW5pRGlmZikpIHtcbiAgICBpZiAodW5pRGlmZi5sZW5ndGggPiAxKSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoJ2FwcGx5UGF0Y2ggb25seSB3b3JrcyB3aXRoIGEgc2luZ2xlIGlucHV0LicpO1xuICAgIH1cblxuICAgIHVuaURpZmYgPSB1bmlEaWZmWzBdO1xuICB9XG5cbiAgLy8gQXBwbHkgdGhlIGRpZmYgdG8gdGhlIGlucHV0XG4gIGxldCBsaW5lcyA9IHNvdXJjZS5zcGxpdCgvXFxyXFxufFtcXG5cXHZcXGZcXHJcXHg4NV0vKSxcbiAgICAgIGRlbGltaXRlcnMgPSBzb3VyY2UubWF0Y2goL1xcclxcbnxbXFxuXFx2XFxmXFxyXFx4ODVdL2cpIHx8IFtdLFxuICAgICAgaHVua3MgPSB1bmlEaWZmLmh1bmtzLFxuXG4gICAgICBjb21wYXJlTGluZSA9IG9wdGlvbnMuY29tcGFyZUxpbmUgfHwgKChsaW5lTnVtYmVyLCBsaW5lLCBvcGVyYXRpb24sIHBhdGNoQ29udGVudCkgPT4gbGluZSA9PT0gcGF0Y2hDb250ZW50KSxcbiAgICAgIGVycm9yQ291bnQgPSAwLFxuICAgICAgZnV6ekZhY3RvciA9IG9wdGlvbnMuZnV6ekZhY3RvciB8fCAwLFxuICAgICAgbWluTGluZSA9IDAsXG4gICAgICBvZmZzZXQgPSAwLFxuXG4gICAgICByZW1vdmVFT0ZOTCxcbiAgICAgIGFkZEVPRk5MO1xuXG4gIC8qKlxuICAgKiBDaGVja3MgaWYgdGhlIGh1bmsgZXhhY3RseSBmaXRzIG9uIHRoZSBwcm92aWRlZCBsb2NhdGlvblxuICAgKi9cbiAgZnVuY3Rpb24gaHVua0ZpdHMoaHVuaywgdG9Qb3MpIHtcbiAgICBmb3IgKGxldCBqID0gMDsgaiA8IGh1bmsubGluZXMubGVuZ3RoOyBqKyspIHtcbiAgICAgIGxldCBsaW5lID0gaHVuay5saW5lc1tqXSxcbiAgICAgICAgICBvcGVyYXRpb24gPSAobGluZS5sZW5ndGggPiAwID8gbGluZVswXSA6ICcgJyksXG4gICAgICAgICAgY29udGVudCA9IChsaW5lLmxlbmd0aCA+IDAgPyBsaW5lLnN1YnN0cigxKSA6IGxpbmUpO1xuXG4gICAgICBpZiAob3BlcmF0aW9uID09PSAnICcgfHwgb3BlcmF0aW9uID09PSAnLScpIHtcbiAgICAgICAgLy8gQ29udGV4dCBzYW5pdHkgY2hlY2tcbiAgICAgICAgaWYgKCFjb21wYXJlTGluZSh0b1BvcyArIDEsIGxpbmVzW3RvUG9zXSwgb3BlcmF0aW9uLCBjb250ZW50KSkge1xuICAgICAgICAgIGVycm9yQ291bnQrKztcblxuICAgICAgICAgIGlmIChlcnJvckNvdW50ID4gZnV6ekZhY3Rvcikge1xuICAgICAgICAgICAgcmV0dXJuIGZhbHNlO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuICAgICAgICB0b1BvcysrO1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiB0cnVlO1xuICB9XG5cbiAgLy8gU2VhcmNoIGJlc3QgZml0IG9mZnNldHMgZm9yIGVhY2ggaHVuayBiYXNlZCBvbiB0aGUgcHJldmlvdXMgb25lc1xuICBmb3IgKGxldCBpID0gMDsgaSA8IGh1bmtzLmxlbmd0aDsgaSsrKSB7XG4gICAgbGV0IGh1bmsgPSBodW5rc1tpXSxcbiAgICAgICAgbWF4TGluZSA9IGxpbmVzLmxlbmd0aCAtIGh1bmsub2xkTGluZXMsXG4gICAgICAgIGxvY2FsT2Zmc2V0ID0gMCxcbiAgICAgICAgdG9Qb3MgPSBvZmZzZXQgKyBodW5rLm9sZFN0YXJ0IC0gMTtcblxuICAgIGxldCBpdGVyYXRvciA9IGRpc3RhbmNlSXRlcmF0b3IodG9Qb3MsIG1pbkxpbmUsIG1heExpbmUpO1xuXG4gICAgZm9yICg7IGxvY2FsT2Zmc2V0ICE9PSB1bmRlZmluZWQ7IGxvY2FsT2Zmc2V0ID0gaXRlcmF0b3IoKSkge1xuICAgICAgaWYgKGh1bmtGaXRzKGh1bmssIHRvUG9zICsgbG9jYWxPZmZzZXQpKSB7XG4gICAgICAgIGh1bmsub2Zmc2V0ID0gb2Zmc2V0ICs9IGxvY2FsT2Zmc2V0O1xuICAgICAgICBicmVhaztcbiAgICAgIH1cbiAgICB9XG5cbiAgICBpZiAobG9jYWxPZmZzZXQgPT09IHVuZGVmaW5lZCkge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cblxuICAgIC8vIFNldCBsb3dlciB0ZXh0IGxpbWl0IHRvIGVuZCBvZiB0aGUgY3VycmVudCBodW5rLCBzbyBuZXh0IG9uZXMgZG9uJ3QgdHJ5XG4gICAgLy8gdG8gZml0IG92ZXIgYWxyZWFkeSBwYXRjaGVkIHRleHRcbiAgICBtaW5MaW5lID0gaHVuay5vZmZzZXQgKyBodW5rLm9sZFN0YXJ0ICsgaHVuay5vbGRMaW5lcztcbiAgfVxuXG4gIC8vIEFwcGx5IHBhdGNoIGh1bmtzXG4gIGxldCBkaWZmT2Zmc2V0ID0gMDtcbiAgZm9yIChsZXQgaSA9IDA7IGkgPCBodW5rcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBodW5rID0gaHVua3NbaV0sXG4gICAgICAgIHRvUG9zID0gaHVuay5vbGRTdGFydCArIGh1bmsub2Zmc2V0ICsgZGlmZk9mZnNldCAtIDE7XG4gICAgZGlmZk9mZnNldCArPSBodW5rLm5ld0xpbmVzIC0gaHVuay5vbGRMaW5lcztcblxuICAgIGlmICh0b1BvcyA8IDApIHsgLy8gQ3JlYXRpbmcgYSBuZXcgZmlsZVxuICAgICAgdG9Qb3MgPSAwO1xuICAgIH1cblxuICAgIGZvciAobGV0IGogPSAwOyBqIDwgaHVuay5saW5lcy5sZW5ndGg7IGorKykge1xuICAgICAgbGV0IGxpbmUgPSBodW5rLmxpbmVzW2pdLFxuICAgICAgICAgIG9wZXJhdGlvbiA9IChsaW5lLmxlbmd0aCA+IDAgPyBsaW5lWzBdIDogJyAnKSxcbiAgICAgICAgICBjb250ZW50ID0gKGxpbmUubGVuZ3RoID4gMCA/IGxpbmUuc3Vic3RyKDEpIDogbGluZSksXG4gICAgICAgICAgZGVsaW1pdGVyID0gaHVuay5saW5lZGVsaW1pdGVyc1tqXTtcblxuICAgICAgaWYgKG9wZXJhdGlvbiA9PT0gJyAnKSB7XG4gICAgICAgIHRvUG9zKys7XG4gICAgICB9IGVsc2UgaWYgKG9wZXJhdGlvbiA9PT0gJy0nKSB7XG4gICAgICAgIGxpbmVzLnNwbGljZSh0b1BvcywgMSk7XG4gICAgICAgIGRlbGltaXRlcnMuc3BsaWNlKHRvUG9zLCAxKTtcbiAgICAgIC8qIGlzdGFuYnVsIGlnbm9yZSBlbHNlICovXG4gICAgICB9IGVsc2UgaWYgKG9wZXJhdGlvbiA9PT0gJysnKSB7XG4gICAgICAgIGxpbmVzLnNwbGljZSh0b1BvcywgMCwgY29udGVudCk7XG4gICAgICAgIGRlbGltaXRlcnMuc3BsaWNlKHRvUG9zLCAwLCBkZWxpbWl0ZXIpO1xuICAgICAgICB0b1BvcysrO1xuICAgICAgfSBlbHNlIGlmIChvcGVyYXRpb24gPT09ICdcXFxcJykge1xuICAgICAgICBsZXQgcHJldmlvdXNPcGVyYXRpb24gPSBodW5rLmxpbmVzW2ogLSAxXSA/IGh1bmsubGluZXNbaiAtIDFdWzBdIDogbnVsbDtcbiAgICAgICAgaWYgKHByZXZpb3VzT3BlcmF0aW9uID09PSAnKycpIHtcbiAgICAgICAgICByZW1vdmVFT0ZOTCA9IHRydWU7XG4gICAgICAgIH0gZWxzZSBpZiAocHJldmlvdXNPcGVyYXRpb24gPT09ICctJykge1xuICAgICAgICAgIGFkZEVPRk5MID0gdHJ1ZTtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH1cbiAgfVxuXG4gIC8vIEhhbmRsZSBFT0ZOTCBpbnNlcnRpb24vcmVtb3ZhbFxuICBpZiAocmVtb3ZlRU9GTkwpIHtcbiAgICB3aGlsZSAoIWxpbmVzW2xpbmVzLmxlbmd0aCAtIDFdKSB7XG4gICAgICBsaW5lcy5wb3AoKTtcbiAgICAgIGRlbGltaXRlcnMucG9wKCk7XG4gICAgfVxuICB9IGVsc2UgaWYgKGFkZEVPRk5MKSB7XG4gICAgbGluZXMucHVzaCgnJyk7XG4gICAgZGVsaW1pdGVycy5wdXNoKCdcXG4nKTtcbiAgfVxuICBmb3IgKGxldCBfayA9IDA7IF9rIDwgbGluZXMubGVuZ3RoIC0gMTsgX2srKykge1xuICAgIGxpbmVzW19rXSA9IGxpbmVzW19rXSArIGRlbGltaXRlcnNbX2tdO1xuICB9XG4gIHJldHVybiBsaW5lcy5qb2luKCcnKTtcbn1cblxuLy8gV3JhcHBlciB0aGF0IHN1cHBvcnRzIG11bHRpcGxlIGZpbGUgcGF0Y2hlcyB2aWEgY2FsbGJhY2tzLlxuZXhwb3J0IGZ1bmN0aW9uIGFwcGx5UGF0Y2hlcyh1bmlEaWZmLCBvcHRpb25zKSB7XG4gIGlmICh0eXBlb2YgdW5pRGlmZiA9PT0gJ3N0cmluZycpIHtcbiAgICB1bmlEaWZmID0gcGFyc2VQYXRjaCh1bmlEaWZmKTtcbiAgfVxuXG4gIGxldCBjdXJyZW50SW5kZXggPSAwO1xuICBmdW5jdGlvbiBwcm9jZXNzSW5kZXgoKSB7XG4gICAgbGV0IGluZGV4ID0gdW5pRGlmZltjdXJyZW50SW5kZXgrK107XG4gICAgaWYgKCFpbmRleCkge1xuICAgICAgcmV0dXJuIG9wdGlvbnMuY29tcGxldGUoKTtcbiAgICB9XG5cbiAgICBvcHRpb25zLmxvYWRGaWxlKGluZGV4LCBmdW5jdGlvbihlcnIsIGRhdGEpIHtcbiAgICAgIGlmIChlcnIpIHtcbiAgICAgICAgcmV0dXJuIG9wdGlvbnMuY29tcGxldGUoZXJyKTtcbiAgICAgIH1cblxuICAgICAgbGV0IHVwZGF0ZWRDb250ZW50ID0gYXBwbHlQYXRjaChkYXRhLCBpbmRleCwgb3B0aW9ucyk7XG4gICAgICBvcHRpb25zLnBhdGNoZWQoaW5kZXgsIHVwZGF0ZWRDb250ZW50LCBmdW5jdGlvbihlcnIpIHtcbiAgICAgICAgaWYgKGVycikge1xuICAgICAgICAgIHJldHVybiBvcHRpb25zLmNvbXBsZXRlKGVycik7XG4gICAgICAgIH1cblxuICAgICAgICBwcm9jZXNzSW5kZXgoKTtcbiAgICAgIH0pO1xuICAgIH0pO1xuICB9XG4gIHByb2Nlc3NJbmRleCgpO1xufVxuIl19
+
+
+/***/ }),
+/* 11 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/parsePatch = parsePatch;
+	function parsePatch(uniDiff) {
+	  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
+
+	  var diffstr = uniDiff.split(/\r\n|[\n\v\f\r\x85]/),
+	      delimiters = uniDiff.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+	      list = [],
+	      i = 0;
+
+	  function parseIndex() {
+	    var index = {};
+	    list.push(index);
+
+	    // Parse diff metadata
+	    while (i < diffstr.length) {
+	      var line = diffstr[i];
+
+	      // File header found, end parsing diff metadata
+	      if (/^(\-\-\-|\+\+\+|@@)\s/.test(line)) {
+	        break;
+	      }
+
+	      // Diff index
+	      var header = /^(?:Index:|diff(?: -r \w+)+)\s+(.+?)\s*$/.exec(line);
+	      if (header) {
+	        index.index = header[1];
+	      }
+
+	      i++;
+	    }
+
+	    // Parse file headers if they are defined. Unified diff requires them, but
+	    // there's no technical issues to have an isolated hunk without file header
+	    parseFileHeader(index);
+	    parseFileHeader(index);
+
+	    // Parse hunks
+	    index.hunks = [];
+
+	    while (i < diffstr.length) {
+	      var _line = diffstr[i];
+
+	      if (/^(Index:|diff|\-\-\-|\+\+\+)\s/.test(_line)) {
+	        break;
+	      } else if (/^@@/.test(_line)) {
+	        index.hunks.push(parseHunk());
+	      } else if (_line && options.strict) {
+	        // Ignore unexpected content unless in strict mode
+	        throw new Error('Unknown line ' + (i + 1) + ' ' + JSON.stringify(_line));
+	      } else {
+	        i++;
+	      }
+	    }
+	  }
+
+	  // Parses the --- and +++ headers, if none are found, no lines
+	  // are consumed.
+	  function parseFileHeader(index) {
+	    var fileHeader = /^(---|\+\+\+)\s+(.*)$/.exec(diffstr[i]);
+	    if (fileHeader) {
+	      var keyPrefix = fileHeader[1] === '---' ? 'old' : 'new';
+	      var data = fileHeader[2].split('\t', 2);
+	      var fileName = data[0].replace(/\\\\/g, '\\');
+	      if (/^".*"$/.test(fileName)) {
+	        fileName = fileName.substr(1, fileName.length - 2);
+	      }
+	      index[keyPrefix + 'FileName'] = fileName;
+	      index[keyPrefix + 'Header'] = (data[1] || '').trim();
+
+	      i++;
+	    }
+	  }
+
+	  // Parses a hunk
+	  // This assumes that we are at the start of a hunk.
+	  function parseHunk() {
+	    var chunkHeaderIndex = i,
+	        chunkHeaderLine = diffstr[i++],
+	        chunkHeader = chunkHeaderLine.split(/@@ -(\d+)(?:,(\d+))? \+(\d+)(?:,(\d+))? @@/);
+
+	    var hunk = {
+	      oldStart: +chunkHeader[1],
+	      oldLines: +chunkHeader[2] || 1,
+	      newStart: +chunkHeader[3],
+	      newLines: +chunkHeader[4] || 1,
+	      lines: [],
+	      linedelimiters: []
+	    };
+
+	    var addCount = 0,
+	        removeCount = 0;
+	    for (; i < diffstr.length; i++) {
+	      // Lines starting with '---' could be mistaken for the "remove line" operation
+	      // But they could be the header for the next file. Therefore prune such cases out.
+	      if (diffstr[i].indexOf('--- ') === 0 && i + 2 < diffstr.length && diffstr[i + 1].indexOf('+++ ') === 0 && diffstr[i + 2].indexOf('@@') === 0) {
+	        break;
+	      }
+	      var operation = diffstr[i].length == 0 && i != diffstr.length - 1 ? ' ' : diffstr[i][0];
+
+	      if (operation === '+' || operation === '-' || operation === ' ' || operation === '\\') {
+	        hunk.lines.push(diffstr[i]);
+	        hunk.linedelimiters.push(delimiters[i] || '\n');
+
+	        if (operation === '+') {
+	          addCount++;
+	        } else if (operation === '-') {
+	          removeCount++;
+	        } else if (operation === ' ') {
+	          addCount++;
+	          removeCount++;
+	        }
+	      } else {
+	        break;
+	      }
+	    }
+
+	    // Handle the empty block count case
+	    if (!addCount && hunk.newLines === 1) {
+	      hunk.newLines = 0;
+	    }
+	    if (!removeCount && hunk.oldLines === 1) {
+	      hunk.oldLines = 0;
+	    }
+
+	    // Perform optional sanity checking
+	    if (options.strict) {
+	      if (addCount !== hunk.newLines) {
+	        throw new Error('Added line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+	      }
+	      if (removeCount !== hunk.oldLines) {
+	        throw new Error('Removed line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+	      }
+	    }
+
+	    return hunk;
+	  }
+
+	  while (i < diffstr.length) {
+	    parseIndex();
+	  }
+
+	  return list;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9wYXJzZS5qcyJdLCJuYW1lcyI6WyJwYXJzZVBhdGNoIiwidW5pRGlmZiIsIm9wdGlvbnMiLCJkaWZmc3RyIiwic3BsaXQiLCJkZWxpbWl0ZXJzIiwibWF0Y2giLCJsaXN0IiwiaSIsInBhcnNlSW5kZXgiLCJpbmRleCIsInB1c2giLCJsZW5ndGgiLCJsaW5lIiwidGVzdCIsImhlYWRlciIsImV4ZWMiLCJwYXJzZUZpbGVIZWFkZXIiLCJodW5rcyIsInBhcnNlSHVuayIsInN0cmljdCIsIkVycm9yIiwiSlNPTiIsInN0cmluZ2lmeSIsImZpbGVIZWFkZXIiLCJrZXlQcmVmaXgiLCJkYXRhIiwiZmlsZU5hbWUiLCJyZXBsYWNlIiwic3Vic3RyIiwidHJpbSIsImNodW5rSGVhZGVySW5kZXgiLCJjaHVua0hlYWRlckxpbmUiLCJjaHVua0hlYWRlciIsImh1bmsiLCJvbGRTdGFydCIsIm9sZExpbmVzIiwibmV3U3RhcnQiLCJuZXdMaW5lcyIsImxpbmVzIiwibGluZWRlbGltaXRlcnMiLCJhZGRDb3VudCIsInJlbW92ZUNvdW50IiwiaW5kZXhPZiIsIm9wZXJhdGlvbiJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsVSxHQUFBQSxVO0FBQVQsU0FBU0EsVUFBVCxDQUFvQkMsT0FBcEIsRUFBMkM7QUFBQSxzREFBZEMsT0FBYyx1RUFBSixFQUFJOztBQUNoRCxNQUFJQyxVQUFVRixRQUFRRyxLQUFSLENBQWMscUJBQWQsQ0FBZDtBQUFBLE1BQ0lDLGFBQWFKLFFBQVFLLEtBQVIsQ0FBYyxzQkFBZCxLQUF5QyxFQUQxRDtBQUFBLE1BRUlDLE9BQU8sRUFGWDtBQUFBLE1BR0lDLElBQUksQ0FIUjs7QUFLQSxXQUFTQyxVQUFULEdBQXNCO0FBQ3BCLFFBQUlDLFFBQVEsRUFBWjtBQUNBSCxTQUFLSSxJQUFMLENBQVVELEtBQVY7O0FBRUE7QUFDQSxXQUFPRixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6QixVQUFJQyxPQUFPVixRQUFRSyxDQUFSLENBQVg7O0FBRUE7QUFDQSxVQUFJLHdCQUF3Qk0sSUFBeEIsQ0FBNkJELElBQTdCLENBQUosRUFBd0M7QUFDdEM7QUFDRDs7QUFFRDtBQUNBLFVBQUlFLFNBQVUsMENBQUQsQ0FBNkNDLElBQTdDLENBQWtESCxJQUFsRCxDQUFiO0FBQ0EsVUFBSUUsTUFBSixFQUFZO0FBQ1ZMLGNBQU1BLEtBQU4sR0FBY0ssT0FBTyxDQUFQLENBQWQ7QUFDRDs7QUFFRFA7QUFDRDs7QUFFRDtBQUNBO0FBQ0FTLG9CQUFnQlAsS0FBaEI7QUFDQU8sb0JBQWdCUCxLQUFoQjs7QUFFQTtBQUNBQSxVQUFNUSxLQUFOLEdBQWMsRUFBZDs7QUFFQSxXQUFPVixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6QixVQUFJQyxRQUFPVixRQUFRSyxDQUFSLENBQVg7O0FBRUEsVUFBSSxpQ0FBaUNNLElBQWpDLENBQXNDRCxLQUF0QyxDQUFKLEVBQWlEO0FBQy9DO0FBQ0QsT0FGRCxNQUVPLElBQUksTUFBTUMsSUFBTixDQUFXRCxLQUFYLENBQUosRUFBc0I7QUFDM0JILGNBQU1RLEtBQU4sQ0FBWVAsSUFBWixDQUFpQlEsV0FBakI7QUFDRCxPQUZNLE1BRUEsSUFBSU4sU0FBUVgsUUFBUWtCLE1BQXBCLEVBQTRCO0FBQ2pDO0FBQ0EsY0FBTSxJQUFJQyxLQUFKLENBQVUsbUJBQW1CYixJQUFJLENBQXZCLElBQTRCLEdBQTVCLEdBQWtDYyxLQUFLQyxTQUFMLENBQWVWLEtBQWYsQ0FBNUMsQ0FBTjtBQUNELE9BSE0sTUFHQTtBQUNMTDtBQUNEO0FBQ0Y7QUFDRjs7QUFFRDtBQUNBO0FBQ0EsV0FBU1MsZUFBVCxDQUF5QlAsS0FBekIsRUFBZ0M7QUFDOUIsUUFBTWMsYUFBYyx1QkFBRCxDQUEwQlIsSUFBMUIsQ0FBK0JiLFFBQVFLLENBQVIsQ0FBL0IsQ0FBbkI7QUFDQSxRQUFJZ0IsVUFBSixFQUFnQjtBQUNkLFVBQUlDLFlBQVlELFdBQVcsQ0FBWCxNQUFrQixLQUFsQixHQUEwQixLQUExQixHQUFrQyxLQUFsRDtBQUNBLFVBQU1FLE9BQU9GLFdBQVcsQ0FBWCxFQUFjcEIsS0FBZCxDQUFvQixJQUFwQixFQUEwQixDQUExQixDQUFiO0FBQ0EsVUFBSXVCLFdBQVdELEtBQUssQ0FBTCxFQUFRRSxPQUFSLENBQWdCLE9BQWhCLEVBQXlCLElBQXpCLENBQWY7QUFDQSxVQUFJLFNBQVNkLElBQVQsQ0FBY2EsUUFBZCxDQUFKLEVBQTZCO0FBQzNCQSxtQkFBV0EsU0FBU0UsTUFBVCxDQUFnQixDQUFoQixFQUFtQkYsU0FBU2YsTUFBVCxHQUFrQixDQUFyQyxDQUFYO0FBQ0Q7QUFDREYsWUFBTWUsWUFBWSxVQUFsQixJQUFnQ0UsUUFBaEM7QUFDQWpCLFlBQU1lLFlBQVksUUFBbEIsSUFBOEIsQ0FBQ0MsS0FBSyxDQUFMLEtBQVcsRUFBWixFQUFnQkksSUFBaEIsRUFBOUI7O0FBRUF0QjtBQUNEO0FBQ0Y7O0FBRUQ7QUFDQTtBQUNBLFdBQVNXLFNBQVQsR0FBcUI7QUFDbkIsUUFBSVksbUJBQW1CdkIsQ0FBdkI7QUFBQSxRQUNJd0Isa0JBQWtCN0IsUUFBUUssR0FBUixDQUR0QjtBQUFBLFFBRUl5QixjQUFjRCxnQkFBZ0I1QixLQUFoQixDQUFzQiw0Q0FBdEIsQ0FGbEI7O0FBSUEsUUFBSThCLE9BQU87QUFDVEMsZ0JBQVUsQ0FBQ0YsWUFBWSxDQUFaLENBREY7QUFFVEcsZ0JBQVUsQ0FBQ0gsWUFBWSxDQUFaLENBQUQsSUFBbUIsQ0FGcEI7QUFHVEksZ0JBQVUsQ0FBQ0osWUFBWSxDQUFaLENBSEY7QUFJVEssZ0JBQVUsQ0FBQ0wsWUFBWSxDQUFaLENBQUQsSUFBbUIsQ0FKcEI7QUFLVE0sYUFBTyxFQUxFO0FBTVRDLHNCQUFnQjtBQU5QLEtBQVg7O0FBU0EsUUFBSUMsV0FBVyxDQUFmO0FBQUEsUUFDSUMsY0FBYyxDQURsQjtBQUVBLFdBQU9sQyxJQUFJTCxRQUFRUyxNQUFuQixFQUEyQkosR0FBM0IsRUFBZ0M7QUFDOUI7QUFDQTtBQUNBLFVBQUlMLFFBQVFLLENBQVIsRUFBV21DLE9BQVgsQ0FBbUIsTUFBbkIsTUFBK0IsQ0FBL0IsSUFDTW5DLElBQUksQ0FBSixHQUFRTCxRQUFRUyxNQUR0QixJQUVLVCxRQUFRSyxJQUFJLENBQVosRUFBZW1DLE9BQWYsQ0FBdUIsTUFBdkIsTUFBbUMsQ0FGeEMsSUFHS3hDLFFBQVFLLElBQUksQ0FBWixFQUFlbUMsT0FBZixDQUF1QixJQUF2QixNQUFpQyxDQUgxQyxFQUc2QztBQUN6QztBQUNIO0FBQ0QsVUFBSUMsWUFBYXpDLFFBQVFLLENBQVIsRUFBV0ksTUFBWCxJQUFxQixDQUFyQixJQUEwQkosS0FBTUwsUUFBUVMsTUFBUixHQUFpQixDQUFsRCxHQUF3RCxHQUF4RCxHQUE4RFQsUUFBUUssQ0FBUixFQUFXLENBQVgsQ0FBOUU7O0FBRUEsVUFBSW9DLGNBQWMsR0FBZCxJQUFxQkEsY0FBYyxHQUFuQyxJQUEwQ0EsY0FBYyxHQUF4RCxJQUErREEsY0FBYyxJQUFqRixFQUF1RjtBQUNyRlYsYUFBS0ssS0FBTCxDQUFXNUIsSUFBWCxDQUFnQlIsUUFBUUssQ0FBUixDQUFoQjtBQUNBMEIsYUFBS00sY0FBTCxDQUFvQjdCLElBQXBCLENBQXlCTixXQUFXRyxDQUFYLEtBQWlCLElBQTFDOztBQUVBLFlBQUlvQyxjQUFjLEdBQWxCLEVBQXVCO0FBQ3JCSDtBQUNELFNBRkQsTUFFTyxJQUFJRyxjQUFjLEdBQWxCLEVBQXVCO0FBQzVCRjtBQUNELFNBRk0sTUFFQSxJQUFJRSxjQUFjLEdBQWxCLEVBQXVCO0FBQzVCSDtBQUNBQztBQUNEO0FBQ0YsT0FaRCxNQVlPO0FBQ0w7QUFDRDtBQUNGOztBQUVEO0FBQ0EsUUFBSSxDQUFDRCxRQUFELElBQWFQLEtBQUtJLFFBQUwsS0FBa0IsQ0FBbkMsRUFBc0M7QUFDcENKLFdBQUtJLFFBQUwsR0FBZ0IsQ0FBaEI7QUFDRDtBQUNELFFBQUksQ0FBQ0ksV0FBRCxJQUFnQlIsS0FBS0UsUUFBTCxLQUFrQixDQUF0QyxFQUF5QztBQUN2Q0YsV0FBS0UsUUFBTCxHQUFnQixDQUFoQjtBQUNEOztBQUVEO0FBQ0EsUUFBSWxDLFFBQVFrQixNQUFaLEVBQW9CO0FBQ2xCLFVBQUlxQixhQUFhUCxLQUFLSSxRQUF0QixFQUFnQztBQUM5QixjQUFNLElBQUlqQixLQUFKLENBQVUsc0RBQXNEVSxtQkFBbUIsQ0FBekUsQ0FBVixDQUFOO0FBQ0Q7QUFDRCxVQUFJVyxnQkFBZ0JSLEtBQUtFLFFBQXpCLEVBQW1DO0FBQ2pDLGNBQU0sSUFBSWYsS0FBSixDQUFVLHdEQUF3RFUsbUJBQW1CLENBQTNFLENBQVYsQ0FBTjtBQUNEO0FBQ0Y7O0FBRUQsV0FBT0csSUFBUDtBQUNEOztBQUVELFNBQU8xQixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6Qkg7QUFDRDs7QUFFRCxTQUFPRixJQUFQO0FBQ0QiLCJmaWxlIjoicGFyc2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZnVuY3Rpb24gcGFyc2VQYXRjaCh1bmlEaWZmLCBvcHRpb25zID0ge30pIHtcbiAgbGV0IGRpZmZzdHIgPSB1bmlEaWZmLnNwbGl0KC9cXHJcXG58W1xcblxcdlxcZlxcclxceDg1XS8pLFxuICAgICAgZGVsaW1pdGVycyA9IHVuaURpZmYubWF0Y2goL1xcclxcbnxbXFxuXFx2XFxmXFxyXFx4ODVdL2cpIHx8IFtdLFxuICAgICAgbGlzdCA9IFtdLFxuICAgICAgaSA9IDA7XG5cbiAgZnVuY3Rpb24gcGFyc2VJbmRleCgpIHtcbiAgICBsZXQgaW5kZXggPSB7fTtcbiAgICBsaXN0LnB1c2goaW5kZXgpO1xuXG4gICAgLy8gUGFyc2UgZGlmZiBtZXRhZGF0YVxuICAgIHdoaWxlIChpIDwgZGlmZnN0ci5sZW5ndGgpIHtcbiAgICAgIGxldCBsaW5lID0gZGlmZnN0cltpXTtcblxuICAgICAgLy8gRmlsZSBoZWFkZXIgZm91bmQsIGVuZCBwYXJzaW5nIGRpZmYgbWV0YWRhdGFcbiAgICAgIGlmICgvXihcXC1cXC1cXC18XFwrXFwrXFwrfEBAKVxccy8udGVzdChsaW5lKSkge1xuICAgICAgICBicmVhaztcbiAgICAgIH1cblxuICAgICAgLy8gRGlmZiBpbmRleFxuICAgICAgbGV0IGhlYWRlciA9ICgvXig/OkluZGV4OnxkaWZmKD86IC1yIFxcdyspKylcXHMrKC4rPylcXHMqJC8pLmV4ZWMobGluZSk7XG4gICAgICBpZiAoaGVhZGVyKSB7XG4gICAgICAgIGluZGV4LmluZGV4ID0gaGVhZGVyWzFdO1xuICAgICAgfVxuXG4gICAgICBpKys7XG4gICAgfVxuXG4gICAgLy8gUGFyc2UgZmlsZSBoZWFkZXJzIGlmIHRoZXkgYXJlIGRlZmluZWQuIFVuaWZpZWQgZGlmZiByZXF1aXJlcyB0aGVtLCBidXRcbiAgICAvLyB0aGVyZSdzIG5vIHRlY2huaWNhbCBpc3N1ZXMgdG8gaGF2ZSBhbiBpc29sYXRlZCBodW5rIHdpdGhvdXQgZmlsZSBoZWFkZXJcbiAgICBwYXJzZUZpbGVIZWFkZXIoaW5kZXgpO1xuICAgIHBhcnNlRmlsZUhlYWRlcihpbmRleCk7XG5cbiAgICAvLyBQYXJzZSBodW5rc1xuICAgIGluZGV4Lmh1bmtzID0gW107XG5cbiAgICB3aGlsZSAoaSA8IGRpZmZzdHIubGVuZ3RoKSB7XG4gICAgICBsZXQgbGluZSA9IGRpZmZzdHJbaV07XG5cbiAgICAgIGlmICgvXihJbmRleDp8ZGlmZnxcXC1cXC1cXC18XFwrXFwrXFwrKVxccy8udGVzdChsaW5lKSkge1xuICAgICAgICBicmVhaztcbiAgICAgIH0gZWxzZSBpZiAoL15AQC8udGVzdChsaW5lKSkge1xuICAgICAgICBpbmRleC5odW5rcy5wdXNoKHBhcnNlSHVuaygpKTtcbiAgICAgIH0gZWxzZSBpZiAobGluZSAmJiBvcHRpb25zLnN0cmljdCkge1xuICAgICAgICAvLyBJZ25vcmUgdW5leHBlY3RlZCBjb250ZW50IHVubGVzcyBpbiBzdHJpY3QgbW9kZVxuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ1Vua25vd24gbGluZSAnICsgKGkgKyAxKSArICcgJyArIEpTT04uc3RyaW5naWZ5KGxpbmUpKTtcbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIGkrKztcbiAgICAgIH1cbiAgICB9XG4gIH1cblxuICAvLyBQYXJzZXMgdGhlIC0tLSBhbmQgKysrIGhlYWRlcnMsIGlmIG5vbmUgYXJlIGZvdW5kLCBubyBsaW5lc1xuICAvLyBhcmUgY29uc3VtZWQuXG4gIGZ1bmN0aW9uIHBhcnNlRmlsZUhlYWRlcihpbmRleCkge1xuICAgIGNvbnN0IGZpbGVIZWFkZXIgPSAoL14oLS0tfFxcK1xcK1xcKylcXHMrKC4qKSQvKS5leGVjKGRpZmZzdHJbaV0pO1xuICAgIGlmIChmaWxlSGVhZGVyKSB7XG4gICAgICBsZXQga2V5UHJlZml4ID0gZmlsZUhlYWRlclsxXSA9PT0gJy0tLScgPyAnb2xkJyA6ICduZXcnO1xuICAgICAgY29uc3QgZGF0YSA9IGZpbGVIZWFkZXJbMl0uc3BsaXQoJ1xcdCcsIDIpO1xuICAgICAgbGV0IGZpbGVOYW1lID0gZGF0YVswXS5yZXBsYWNlKC9cXFxcXFxcXC9nLCAnXFxcXCcpO1xuICAgICAgaWYgKC9eXCIuKlwiJC8udGVzdChmaWxlTmFtZSkpIHtcbiAgICAgICAgZmlsZU5hbWUgPSBmaWxlTmFtZS5zdWJzdHIoMSwgZmlsZU5hbWUubGVuZ3RoIC0gMik7XG4gICAgICB9XG4gICAgICBpbmRleFtrZXlQcmVmaXggKyAnRmlsZU5hbWUnXSA9IGZpbGVOYW1lO1xuICAgICAgaW5kZXhba2V5UHJlZml4ICsgJ0hlYWRlciddID0gKGRhdGFbMV0gfHwgJycpLnRyaW0oKTtcblxuICAgICAgaSsrO1xuICAgIH1cbiAgfVxuXG4gIC8vIFBhcnNlcyBhIGh1bmtcbiAgLy8gVGhpcyBhc3N1bWVzIHRoYXQgd2UgYXJlIGF0IHRoZSBzdGFydCBvZiBhIGh1bmsuXG4gIGZ1bmN0aW9uIHBhcnNlSHVuaygpIHtcbiAgICBsZXQgY2h1bmtIZWFkZXJJbmRleCA9IGksXG4gICAgICAgIGNodW5rSGVhZGVyTGluZSA9IGRpZmZzdHJbaSsrXSxcbiAgICAgICAgY2h1bmtIZWFkZXIgPSBjaHVua0hlYWRlckxpbmUuc3BsaXQoL0BAIC0oXFxkKykoPzosKFxcZCspKT8gXFwrKFxcZCspKD86LChcXGQrKSk/IEBALyk7XG5cbiAgICBsZXQgaHVuayA9IHtcbiAgICAgIG9sZFN0YXJ0OiArY2h1bmtIZWFkZXJbMV0sXG4gICAgICBvbGRMaW5lczogK2NodW5rSGVhZGVyWzJdIHx8IDEsXG4gICAgICBuZXdTdGFydDogK2NodW5rSGVhZGVyWzNdLFxuICAgICAgbmV3TGluZXM6ICtjaHVua0hlYWRlcls0XSB8fCAxLFxuICAgICAgbGluZXM6IFtdLFxuICAgICAgbGluZWRlbGltaXRlcnM6IFtdXG4gICAgfTtcblxuICAgIGxldCBhZGRDb3VudCA9IDAsXG4gICAgICAgIHJlbW92ZUNvdW50ID0gMDtcbiAgICBmb3IgKDsgaSA8IGRpZmZzdHIubGVuZ3RoOyBpKyspIHtcbiAgICAgIC8vIExpbmVzIHN0YXJ0aW5nIHdpdGggJy0tLScgY291bGQgYmUgbWlzdGFrZW4gZm9yIHRoZSBcInJlbW92ZSBsaW5lXCIgb3BlcmF0aW9uXG4gICAgICAvLyBCdXQgdGhleSBjb3VsZCBiZSB0aGUgaGVhZGVyIGZvciB0aGUgbmV4dCBmaWxlLiBUaGVyZWZvcmUgcHJ1bmUgc3VjaCBjYXNlcyBvdXQuXG4gICAgICBpZiAoZGlmZnN0cltpXS5pbmRleE9mKCctLS0gJykgPT09IDBcbiAgICAgICAgICAgICYmIChpICsgMiA8IGRpZmZzdHIubGVuZ3RoKVxuICAgICAgICAgICAgJiYgZGlmZnN0cltpICsgMV0uaW5kZXhPZignKysrICcpID09PSAwXG4gICAgICAgICAgICAmJiBkaWZmc3RyW2kgKyAyXS5pbmRleE9mKCdAQCcpID09PSAwKSB7XG4gICAgICAgICAgYnJlYWs7XG4gICAgICB9XG4gICAgICBsZXQgb3BlcmF0aW9uID0gKGRpZmZzdHJbaV0ubGVuZ3RoID09IDAgJiYgaSAhPSAoZGlmZnN0ci5sZW5ndGggLSAxKSkgPyAnICcgOiBkaWZmc3RyW2ldWzBdO1xuXG4gICAgICBpZiAob3BlcmF0aW9uID09PSAnKycgfHwgb3BlcmF0aW9uID09PSAnLScgfHwgb3BlcmF0aW9uID09PSAnICcgfHwgb3BlcmF0aW9uID09PSAnXFxcXCcpIHtcbiAgICAgICAgaHVuay5saW5lcy5wdXNoKGRpZmZzdHJbaV0pO1xuICAgICAgICBodW5rLmxpbmVkZWxpbWl0ZXJzLnB1c2goZGVsaW1pdGVyc1tpXSB8fCAnXFxuJyk7XG5cbiAgICAgICAgaWYgKG9wZXJhdGlvbiA9PT0gJysnKSB7XG4gICAgICAgICAgYWRkQ291bnQrKztcbiAgICAgICAgfSBlbHNlIGlmIChvcGVyYXRpb24gPT09ICctJykge1xuICAgICAgICAgIHJlbW92ZUNvdW50Kys7XG4gICAgICAgIH0gZWxzZSBpZiAob3BlcmF0aW9uID09PSAnICcpIHtcbiAgICAgICAgICBhZGRDb3VudCsrO1xuICAgICAgICAgIHJlbW92ZUNvdW50Kys7XG4gICAgICAgIH1cbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIGJyZWFrO1xuICAgICAgfVxuICAgIH1cblxuICAgIC8vIEhhbmRsZSB0aGUgZW1wdHkgYmxvY2sgY291bnQgY2FzZVxuICAgIGlmICghYWRkQ291bnQgJiYgaHVuay5uZXdMaW5lcyA9PT0gMSkge1xuICAgICAgaHVuay5uZXdMaW5lcyA9IDA7XG4gICAgfVxuICAgIGlmICghcmVtb3ZlQ291bnQgJiYgaHVuay5vbGRMaW5lcyA9PT0gMSkge1xuICAgICAgaHVuay5vbGRMaW5lcyA9IDA7XG4gICAgfVxuXG4gICAgLy8gUGVyZm9ybSBvcHRpb25hbCBzYW5pdHkgY2hlY2tpbmdcbiAgICBpZiAob3B0aW9ucy5zdHJpY3QpIHtcbiAgICAgIGlmIChhZGRDb3VudCAhPT0gaHVuay5uZXdMaW5lcykge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0FkZGVkIGxpbmUgY291bnQgZGlkIG5vdCBtYXRjaCBmb3IgaHVuayBhdCBsaW5lICcgKyAoY2h1bmtIZWFkZXJJbmRleCArIDEpKTtcbiAgICAgIH1cbiAgICAgIGlmIChyZW1vdmVDb3VudCAhPT0gaHVuay5vbGRMaW5lcykge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ1JlbW92ZWQgbGluZSBjb3VudCBkaWQgbm90IG1hdGNoIGZvciBodW5rIGF0IGxpbmUgJyArIChjaHVua0hlYWRlckluZGV4ICsgMSkpO1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiBodW5rO1xuICB9XG5cbiAgd2hpbGUgKGkgPCBkaWZmc3RyLmxlbmd0aCkge1xuICAgIHBhcnNlSW5kZXgoKTtcbiAgfVxuXG4gIHJldHVybiBsaXN0O1xufVxuIl19
+
+
+/***/ }),
+/* 12 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/"use strict";
+
+	exports.__esModule = true;
+
+	exports["default"] = /*istanbul ignore end*/function (start, minLine, maxLine) {
+	  var wantForward = true,
+	      backwardExhausted = false,
+	      forwardExhausted = false,
+	      localOffset = 1;
+
+	  return function iterator() {
+	    if (wantForward && !forwardExhausted) {
+	      if (backwardExhausted) {
+	        localOffset++;
+	      } else {
+	        wantForward = false;
+	      }
+
+	      // Check if trying to fit beyond text length, and if not, check it fits
+	      // after offset location (or desired location on first iteration)
+	      if (start + localOffset <= maxLine) {
+	        return localOffset;
+	      }
+
+	      forwardExhausted = true;
+	    }
+
+	    if (!backwardExhausted) {
+	      if (!forwardExhausted) {
+	        wantForward = true;
+	      }
+
+	      // Check if trying to fit before text beginning, and if not, check it fits
+	      // before offset location
+	      if (minLine <= start - localOffset) {
+	        return -localOffset++;
+	      }
+
+	      backwardExhausted = true;
+	      return iterator();
+	    }
+
+	    // We tried to fit hunk before text beginning and beyond text length, then
+	    // hunk can't fit on the text. Return undefined
+	  };
+	};
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL2Rpc3RhbmNlLWl0ZXJhdG9yLmpzIl0sIm5hbWVzIjpbInN0YXJ0IiwibWluTGluZSIsIm1heExpbmUiLCJ3YW50Rm9yd2FyZCIsImJhY2t3YXJkRXhoYXVzdGVkIiwiZm9yd2FyZEV4aGF1c3RlZCIsImxvY2FsT2Zmc2V0IiwiaXRlcmF0b3IiXSwibWFwcGluZ3MiOiI7Ozs7NENBR2UsVUFBU0EsS0FBVCxFQUFnQkMsT0FBaEIsRUFBeUJDLE9BQXpCLEVBQWtDO0FBQy9DLE1BQUlDLGNBQWMsSUFBbEI7QUFBQSxNQUNJQyxvQkFBb0IsS0FEeEI7QUFBQSxNQUVJQyxtQkFBbUIsS0FGdkI7QUFBQSxNQUdJQyxjQUFjLENBSGxCOztBQUtBLFNBQU8sU0FBU0MsUUFBVCxHQUFvQjtBQUN6QixRQUFJSixlQUFlLENBQUNFLGdCQUFwQixFQUFzQztBQUNwQyxVQUFJRCxpQkFBSixFQUF1QjtBQUNyQkU7QUFDRCxPQUZELE1BRU87QUFDTEgsc0JBQWMsS0FBZDtBQUNEOztBQUVEO0FBQ0E7QUFDQSxVQUFJSCxRQUFRTSxXQUFSLElBQXVCSixPQUEzQixFQUFvQztBQUNsQyxlQUFPSSxXQUFQO0FBQ0Q7O0FBRURELHlCQUFtQixJQUFuQjtBQUNEOztBQUVELFFBQUksQ0FBQ0QsaUJBQUwsRUFBd0I7QUFDdEIsVUFBSSxDQUFDQyxnQkFBTCxFQUF1QjtBQUNyQkYsc0JBQWMsSUFBZDtBQUNEOztBQUVEO0FBQ0E7QUFDQSxVQUFJRixXQUFXRCxRQUFRTSxXQUF2QixFQUFvQztBQUNsQyxlQUFPLENBQUNBLGFBQVI7QUFDRDs7QUFFREYsMEJBQW9CLElBQXBCO0FBQ0EsYUFBT0csVUFBUDtBQUNEOztBQUVEO0FBQ0E7QUFDRCxHQWxDRDtBQW1DRCxDIiwiZmlsZSI6ImRpc3RhbmNlLWl0ZXJhdG9yLmpzIiwic291cmNlc0NvbnRlbnQiOlsiLy8gSXRlcmF0b3IgdGhhdCB0cmF2ZXJzZXMgaW4gdGhlIHJhbmdlIG9mIFttaW4sIG1heF0sIHN0ZXBwaW5nXG4vLyBieSBkaXN0YW5jZSBmcm9tIGEgZ2l2ZW4gc3RhcnQgcG9zaXRpb24uIEkuZS4gZm9yIFswLCA0XSwgd2l0aFxuLy8gc3RhcnQgb2YgMiwgdGhpcyB3aWxsIGl0ZXJhdGUgMiwgMywgMSwgNCwgMC5cbmV4cG9ydCBkZWZhdWx0IGZ1bmN0aW9uKHN0YXJ0LCBtaW5MaW5lLCBtYXhMaW5lKSB7XG4gIGxldCB3YW50Rm9yd2FyZCA9IHRydWUsXG4gICAgICBiYWNrd2FyZEV4aGF1c3RlZCA9IGZhbHNlLFxuICAgICAgZm9yd2FyZEV4aGF1c3RlZCA9IGZhbHNlLFxuICAgICAgbG9jYWxPZmZzZXQgPSAxO1xuXG4gIHJldHVybiBmdW5jdGlvbiBpdGVyYXRvcigpIHtcbiAgICBpZiAod2FudEZvcndhcmQgJiYgIWZvcndhcmRFeGhhdXN0ZWQpIHtcbiAgICAgIGlmIChiYWNrd2FyZEV4aGF1c3RlZCkge1xuICAgICAgICBsb2NhbE9mZnNldCsrO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgd2FudEZvcndhcmQgPSBmYWxzZTtcbiAgICAgIH1cblxuICAgICAgLy8gQ2hlY2sgaWYgdHJ5aW5nIHRvIGZpdCBiZXlvbmQgdGV4dCBsZW5ndGgsIGFuZCBpZiBub3QsIGNoZWNrIGl0IGZpdHNcbiAgICAgIC8vIGFmdGVyIG9mZnNldCBsb2NhdGlvbiAob3IgZGVzaXJlZCBsb2NhdGlvbiBvbiBmaXJzdCBpdGVyYXRpb24pXG4gICAgICBpZiAoc3RhcnQgKyBsb2NhbE9mZnNldCA8PSBtYXhMaW5lKSB7XG4gICAgICAgIHJldHVybiBsb2NhbE9mZnNldDtcbiAgICAgIH1cblxuICAgICAgZm9yd2FyZEV4aGF1c3RlZCA9IHRydWU7XG4gICAgfVxuXG4gICAgaWYgKCFiYWNrd2FyZEV4aGF1c3RlZCkge1xuICAgICAgaWYgKCFmb3J3YXJkRXhoYXVzdGVkKSB7XG4gICAgICAgIHdhbnRGb3J3YXJkID0gdHJ1ZTtcbiAgICAgIH1cblxuICAgICAgLy8gQ2hlY2sgaWYgdHJ5aW5nIHRvIGZpdCBiZWZvcmUgdGV4dCBiZWdpbm5pbmcsIGFuZCBpZiBub3QsIGNoZWNrIGl0IGZpdHNcbiAgICAgIC8vIGJlZm9yZSBvZmZzZXQgbG9jYXRpb25cbiAgICAgIGlmIChtaW5MaW5lIDw9IHN0YXJ0IC0gbG9jYWxPZmZzZXQpIHtcbiAgICAgICAgcmV0dXJuIC1sb2NhbE9mZnNldCsrO1xuICAgICAgfVxuXG4gICAgICBiYWNrd2FyZEV4aGF1c3RlZCA9IHRydWU7XG4gICAgICByZXR1cm4gaXRlcmF0b3IoKTtcbiAgICB9XG5cbiAgICAvLyBXZSB0cmllZCB0byBmaXQgaHVuayBiZWZvcmUgdGV4dCBiZWdpbm5pbmcgYW5kIGJleW9uZCB0ZXh0IGxlbmd0aCwgdGhlblxuICAgIC8vIGh1bmsgY2FuJ3QgZml0IG9uIHRoZSB0ZXh0LiBSZXR1cm4gdW5kZWZpbmVkXG4gIH07XG59XG4iXX0=
+
+
+/***/ }),
+/* 13 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/calcLineCount = calcLineCount;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = merge;
+
+	var /*istanbul ignore start*/_create = __webpack_require__(14) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_parse = __webpack_require__(11) /*istanbul ignore end*/;
+
+	var /*istanbul ignore start*/_array = __webpack_require__(15) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+	/*istanbul ignore end*/function calcLineCount(hunk) {
+	  /*istanbul ignore start*/var _calcOldNewLineCount = /*istanbul ignore end*/calcOldNewLineCount(hunk.lines),
+	      oldLines = _calcOldNewLineCount.oldLines,
+	      newLines = _calcOldNewLineCount.newLines;
+
+	  if (oldLines !== undefined) {
+	    hunk.oldLines = oldLines;
+	  } else {
+	    delete hunk.oldLines;
+	  }
+
+	  if (newLines !== undefined) {
+	    hunk.newLines = newLines;
+	  } else {
+	    delete hunk.newLines;
+	  }
+	}
+
+	function merge(mine, theirs, base) {
+	  mine = loadPatch(mine, base);
+	  theirs = loadPatch(theirs, base);
+
+	  var ret = {};
+
+	  // For index we just let it pass through as it doesn't have any necessary meaning.
+	  // Leaving sanity checks on this to the API consumer that may know more about the
+	  // meaning in their own context.
+	  if (mine.index || theirs.index) {
+	    ret.index = mine.index || theirs.index;
+	  }
+
+	  if (mine.newFileName || theirs.newFileName) {
+	    if (!fileNameChanged(mine)) {
+	      // No header or no change in ours, use theirs (and ours if theirs does not exist)
+	      ret.oldFileName = theirs.oldFileName || mine.oldFileName;
+	      ret.newFileName = theirs.newFileName || mine.newFileName;
+	      ret.oldHeader = theirs.oldHeader || mine.oldHeader;
+	      ret.newHeader = theirs.newHeader || mine.newHeader;
+	    } else if (!fileNameChanged(theirs)) {
+	      // No header or no change in theirs, use ours
+	      ret.oldFileName = mine.oldFileName;
+	      ret.newFileName = mine.newFileName;
+	      ret.oldHeader = mine.oldHeader;
+	      ret.newHeader = mine.newHeader;
+	    } else {
+	      // Both changed... figure it out
+	      ret.oldFileName = selectField(ret, mine.oldFileName, theirs.oldFileName);
+	      ret.newFileName = selectField(ret, mine.newFileName, theirs.newFileName);
+	      ret.oldHeader = selectField(ret, mine.oldHeader, theirs.oldHeader);
+	      ret.newHeader = selectField(ret, mine.newHeader, theirs.newHeader);
+	    }
+	  }
+
+	  ret.hunks = [];
+
+	  var mineIndex = 0,
+	      theirsIndex = 0,
+	      mineOffset = 0,
+	      theirsOffset = 0;
+
+	  while (mineIndex < mine.hunks.length || theirsIndex < theirs.hunks.length) {
+	    var mineCurrent = mine.hunks[mineIndex] || { oldStart: Infinity },
+	        theirsCurrent = theirs.hunks[theirsIndex] || { oldStart: Infinity };
+
+	    if (hunkBefore(mineCurrent, theirsCurrent)) {
+	      // This patch does not overlap with any of the others, yay.
+	      ret.hunks.push(cloneHunk(mineCurrent, mineOffset));
+	      mineIndex++;
+	      theirsOffset += mineCurrent.newLines - mineCurrent.oldLines;
+	    } else if (hunkBefore(theirsCurrent, mineCurrent)) {
+	      // This patch does not overlap with any of the others, yay.
+	      ret.hunks.push(cloneHunk(theirsCurrent, theirsOffset));
+	      theirsIndex++;
+	      mineOffset += theirsCurrent.newLines - theirsCurrent.oldLines;
+	    } else {
+	      // Overlap, merge as best we can
+	      var mergedHunk = {
+	        oldStart: Math.min(mineCurrent.oldStart, theirsCurrent.oldStart),
+	        oldLines: 0,
+	        newStart: Math.min(mineCurrent.newStart + mineOffset, theirsCurrent.oldStart + theirsOffset),
+	        newLines: 0,
+	        lines: []
+	      };
+	      mergeLines(mergedHunk, mineCurrent.oldStart, mineCurrent.lines, theirsCurrent.oldStart, theirsCurrent.lines);
+	      theirsIndex++;
+	      mineIndex++;
+
+	      ret.hunks.push(mergedHunk);
+	    }
+	  }
+
+	  return ret;
+	}
+
+	function loadPatch(param, base) {
+	  if (typeof param === 'string') {
+	    if (/^@@/m.test(param) || /^Index:/m.test(param)) {
+	      return (/*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(param)[0]
+	      );
+	    }
+
+	    if (!base) {
+	      throw new Error('Must provide a base reference or pass in a patch');
+	    }
+	    return (/*istanbul ignore start*/(0, _create.structuredPatch) /*istanbul ignore end*/(undefined, undefined, base, param)
+	    );
+	  }
+
+	  return param;
+	}
+
+	function fileNameChanged(patch) {
+	  return patch.newFileName && patch.newFileName !== patch.oldFileName;
+	}
+
+	function selectField(index, mine, theirs) {
+	  if (mine === theirs) {
+	    return mine;
+	  } else {
+	    index.conflict = true;
+	    return { mine: mine, theirs: theirs };
+	  }
+	}
+
+	function hunkBefore(test, check) {
+	  return test.oldStart < check.oldStart && test.oldStart + test.oldLines < check.oldStart;
+	}
+
+	function cloneHunk(hunk, offset) {
+	  return {
+	    oldStart: hunk.oldStart, oldLines: hunk.oldLines,
+	    newStart: hunk.newStart + offset, newLines: hunk.newLines,
+	    lines: hunk.lines
+	  };
+	}
+
+	function mergeLines(hunk, mineOffset, mineLines, theirOffset, theirLines) {
+	  // This will generally result in a conflicted hunk, but there are cases where the context
+	  // is the only overlap where we can successfully merge the content here.
+	  var mine = { offset: mineOffset, lines: mineLines, index: 0 },
+	      their = { offset: theirOffset, lines: theirLines, index: 0 };
+
+	  // Handle any leading content
+	  insertLeading(hunk, mine, their);
+	  insertLeading(hunk, their, mine);
+
+	  // Now in the overlap content. Scan through and select the best changes from each.
+	  while (mine.index < mine.lines.length && their.index < their.lines.length) {
+	    var mineCurrent = mine.lines[mine.index],
+	        theirCurrent = their.lines[their.index];
+
+	    if ((mineCurrent[0] === '-' || mineCurrent[0] === '+') && (theirCurrent[0] === '-' || theirCurrent[0] === '+')) {
+	      // Both modified ...
+	      mutualChange(hunk, mine, their);
+	    } else if (mineCurrent[0] === '+' && theirCurrent[0] === ' ') {
+	      /*istanbul ignore start*/var _hunk$lines;
+
+	      /*istanbul ignore end*/ // Mine inserted
+	      /*istanbul ignore start*/(_hunk$lines = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(mine)));
+	    } else if (theirCurrent[0] === '+' && mineCurrent[0] === ' ') {
+	      /*istanbul ignore start*/var _hunk$lines2;
+
+	      /*istanbul ignore end*/ // Theirs inserted
+	      /*istanbul ignore start*/(_hunk$lines2 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(their)));
+	    } else if (mineCurrent[0] === '-' && theirCurrent[0] === ' ') {
+	      // Mine removed or edited
+	      removal(hunk, mine, their);
+	    } else if (theirCurrent[0] === '-' && mineCurrent[0] === ' ') {
+	      // Their removed or edited
+	      removal(hunk, their, mine, true);
+	    } else if (mineCurrent === theirCurrent) {
+	      // Context identity
+	      hunk.lines.push(mineCurrent);
+	      mine.index++;
+	      their.index++;
+	    } else {
+	      // Context mismatch
+	      conflict(hunk, collectChange(mine), collectChange(their));
+	    }
+	  }
+
+	  // Now push anything that may be remaining
+	  insertTrailing(hunk, mine);
+	  insertTrailing(hunk, their);
+
+	  calcLineCount(hunk);
+	}
+
+	function mutualChange(hunk, mine, their) {
+	  var myChanges = collectChange(mine),
+	      theirChanges = collectChange(their);
+
+	  if (allRemoves(myChanges) && allRemoves(theirChanges)) {
+	    // Special case for remove changes that are supersets of one another
+	    if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(myChanges, theirChanges) && skipRemoveSuperset(their, myChanges, myChanges.length - theirChanges.length)) {
+	      /*istanbul ignore start*/var _hunk$lines3;
+
+	      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines3 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+	      return;
+	    } else if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(theirChanges, myChanges) && skipRemoveSuperset(mine, theirChanges, theirChanges.length - myChanges.length)) {
+	      /*istanbul ignore start*/var _hunk$lines4;
+
+	      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines4 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines4 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges));
+	      return;
+	    }
+	  } else if ( /*istanbul ignore start*/(0, _array.arrayEqual) /*istanbul ignore end*/(myChanges, theirChanges)) {
+	    /*istanbul ignore start*/var _hunk$lines5;
+
+	    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines5 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines5 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+	    return;
+	  }
+
+	  conflict(hunk, myChanges, theirChanges);
+	}
+
+	function removal(hunk, mine, their, swap) {
+	  var myChanges = collectChange(mine),
+	      theirChanges = collectContext(their, myChanges);
+	  if (theirChanges.merged) {
+	    /*istanbul ignore start*/var _hunk$lines6;
+
+	    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines6 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines6 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges.merged));
+	  } else {
+	    conflict(hunk, swap ? theirChanges : myChanges, swap ? myChanges : theirChanges);
+	  }
+	}
+
+	function conflict(hunk, mine, their) {
+	  hunk.conflict = true;
+	  hunk.lines.push({
+	    conflict: true,
+	    mine: mine,
+	    theirs: their
+	  });
+	}
+
+	function insertLeading(hunk, insert, their) {
+	  while (insert.offset < their.offset && insert.index < insert.lines.length) {
+	    var line = insert.lines[insert.index++];
+	    hunk.lines.push(line);
+	    insert.offset++;
+	  }
+	}
+	function insertTrailing(hunk, insert) {
+	  while (insert.index < insert.lines.length) {
+	    var line = insert.lines[insert.index++];
+	    hunk.lines.push(line);
+	  }
+	}
+
+	function collectChange(state) {
+	  var ret = [],
+	      operation = state.lines[state.index][0];
+	  while (state.index < state.lines.length) {
+	    var line = state.lines[state.index];
+
+	    // Group additions that are immediately after subtractions and treat them as one "atomic" modify change.
+	    if (operation === '-' && line[0] === '+') {
+	      operation = '+';
+	    }
+
+	    if (operation === line[0]) {
+	      ret.push(line);
+	      state.index++;
+	    } else {
+	      break;
+	    }
+	  }
+
+	  return ret;
+	}
+	function collectContext(state, matchChanges) {
+	  var changes = [],
+	      merged = [],
+	      matchIndex = 0,
+	      contextChanges = false,
+	      conflicted = false;
+	  while (matchIndex < matchChanges.length && state.index < state.lines.length) {
+	    var change = state.lines[state.index],
+	        match = matchChanges[matchIndex];
+
+	    // Once we've hit our add, then we are done
+	    if (match[0] === '+') {
+	      break;
+	    }
+
+	    contextChanges = contextChanges || change[0] !== ' ';
+
+	    merged.push(match);
+	    matchIndex++;
+
+	    // Consume any additions in the other block as a conflict to attempt
+	    // to pull in the remaining context after this
+	    if (change[0] === '+') {
+	      conflicted = true;
+
+	      while (change[0] === '+') {
+	        changes.push(change);
+	        change = state.lines[++state.index];
+	      }
+	    }
+
+	    if (match.substr(1) === change.substr(1)) {
+	      changes.push(change);
+	      state.index++;
+	    } else {
+	      conflicted = true;
+	    }
+	  }
+
+	  if ((matchChanges[matchIndex] || '')[0] === '+' && contextChanges) {
+	    conflicted = true;
+	  }
+
+	  if (conflicted) {
+	    return changes;
+	  }
+
+	  while (matchIndex < matchChanges.length) {
+	    merged.push(matchChanges[matchIndex++]);
+	  }
+
+	  return {
+	    merged: merged,
+	    changes: changes
+	  };
+	}
+
+	function allRemoves(changes) {
+	  return changes.reduce(function (prev, change) {
+	    return prev && change[0] === '-';
+	  }, true);
+	}
+	function skipRemoveSuperset(state, removeChanges, delta) {
+	  for (var i = 0; i < delta; i++) {
+	    var changeContent = removeChanges[removeChanges.length - delta + i].substr(1);
+	    if (state.lines[state.index + i] !== ' ' + changeContent) {
+	      return false;
+	    }
+	  }
+
+	  state.index += delta;
+	  return true;
+	}
+
+	function calcOldNewLineCount(lines) {
+	  var oldLines = 0;
+	  var newLines = 0;
+
+	  lines.forEach(function (line) {
+	    if (typeof line !== 'string') {
+	      var myCount = calcOldNewLineCount(line.mine);
+	      var theirCount = calcOldNewLineCount(line.theirs);
+
+	      if (oldLines !== undefined) {
+	        if (myCount.oldLines === theirCount.oldLines) {
+	          oldLines += myCount.oldLines;
+	        } else {
+	          oldLines = undefined;
+	        }
+	      }
+
+	      if (newLines !== undefined) {
+	        if (myCount.newLines === theirCount.newLines) {
+	          newLines += myCount.newLines;
+	        } else {
+	          newLines = undefined;
+	        }
+	      }
+	    } else {
+	      if (newLines !== undefined && (line[0] === '+' || line[0] === ' ')) {
+	        newLines++;
+	      }
+	      if (oldLines !== undefined && (line[0] === '-' || line[0] === ' ')) {
+	        oldLines++;
+	      }
+	    }
+	  });
+
+	  return { oldLines: oldLines, newLines: newLines };
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9tZXJnZS5qcyJdLCJuYW1lcyI6WyJjYWxjTGluZUNvdW50IiwibWVyZ2UiLCJodW5rIiwiY2FsY09sZE5ld0xpbmVDb3VudCIsImxpbmVzIiwib2xkTGluZXMiLCJuZXdMaW5lcyIsInVuZGVmaW5lZCIsIm1pbmUiLCJ0aGVpcnMiLCJiYXNlIiwibG9hZFBhdGNoIiwicmV0IiwiaW5kZXgiLCJuZXdGaWxlTmFtZSIsImZpbGVOYW1lQ2hhbmdlZCIsIm9sZEZpbGVOYW1lIiwib2xkSGVhZGVyIiwibmV3SGVhZGVyIiwic2VsZWN0RmllbGQiLCJodW5rcyIsIm1pbmVJbmRleCIsInRoZWlyc0luZGV4IiwibWluZU9mZnNldCIsInRoZWlyc09mZnNldCIsImxlbmd0aCIsIm1pbmVDdXJyZW50Iiwib2xkU3RhcnQiLCJJbmZpbml0eSIsInRoZWlyc0N1cnJlbnQiLCJodW5rQmVmb3JlIiwicHVzaCIsImNsb25lSHVuayIsIm1lcmdlZEh1bmsiLCJNYXRoIiwibWluIiwibmV3U3RhcnQiLCJtZXJnZUxpbmVzIiwicGFyYW0iLCJ0ZXN0IiwiRXJyb3IiLCJwYXRjaCIsImNvbmZsaWN0IiwiY2hlY2siLCJvZmZzZXQiLCJtaW5lTGluZXMiLCJ0aGVpck9mZnNldCIsInRoZWlyTGluZXMiLCJ0aGVpciIsImluc2VydExlYWRpbmciLCJ0aGVpckN1cnJlbnQiLCJtdXR1YWxDaGFuZ2UiLCJjb2xsZWN0Q2hhbmdlIiwicmVtb3ZhbCIsImluc2VydFRyYWlsaW5nIiwibXlDaGFuZ2VzIiwidGhlaXJDaGFuZ2VzIiwiYWxsUmVtb3ZlcyIsInNraXBSZW1vdmVTdXBlcnNldCIsInN3YXAiLCJjb2xsZWN0Q29udGV4dCIsIm1lcmdlZCIsImluc2VydCIsImxpbmUiLCJzdGF0ZSIsIm9wZXJhdGlvbiIsIm1hdGNoQ2hhbmdlcyIsImNoYW5nZXMiLCJtYXRjaEluZGV4IiwiY29udGV4dENoYW5nZXMiLCJjb25mbGljdGVkIiwiY2hhbmdlIiwibWF0Y2giLCJzdWJzdHIiLCJyZWR1Y2UiLCJwcmV2IiwicmVtb3ZlQ2hhbmdlcyIsImRlbHRhIiwiaSIsImNoYW5nZUNvbnRlbnQiLCJmb3JFYWNoIiwibXlDb3VudCIsInRoZWlyQ291bnQiXSwibWFwcGluZ3MiOiI7OztnQ0FLZ0JBLGEsR0FBQUEsYTt5REFnQkFDLEssR0FBQUEsSzs7QUFyQmhCOztBQUNBOztBQUVBOzs7O3VCQUVPLFNBQVNELGFBQVQsQ0FBdUJFLElBQXZCLEVBQTZCO0FBQUEsNkVBQ0xDLG9CQUFvQkQsS0FBS0UsS0FBekIsQ0FESztBQUFBLE1BQzNCQyxRQUQyQix3QkFDM0JBLFFBRDJCO0FBQUEsTUFDakJDLFFBRGlCLHdCQUNqQkEsUUFEaUI7O0FBR2xDLE1BQUlELGFBQWFFLFNBQWpCLEVBQTRCO0FBQzFCTCxTQUFLRyxRQUFMLEdBQWdCQSxRQUFoQjtBQUNELEdBRkQsTUFFTztBQUNMLFdBQU9ILEtBQUtHLFFBQVo7QUFDRDs7QUFFRCxNQUFJQyxhQUFhQyxTQUFqQixFQUE0QjtBQUMxQkwsU0FBS0ksUUFBTCxHQUFnQkEsUUFBaEI7QUFDRCxHQUZELE1BRU87QUFDTCxXQUFPSixLQUFLSSxRQUFaO0FBQ0Q7QUFDRjs7QUFFTSxTQUFTTCxLQUFULENBQWVPLElBQWYsRUFBcUJDLE1BQXJCLEVBQTZCQyxJQUE3QixFQUFtQztBQUN4Q0YsU0FBT0csVUFBVUgsSUFBVixFQUFnQkUsSUFBaEIsQ0FBUDtBQUNBRCxXQUFTRSxVQUFVRixNQUFWLEVBQWtCQyxJQUFsQixDQUFUOztBQUVBLE1BQUlFLE1BQU0sRUFBVjs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxNQUFJSixLQUFLSyxLQUFMLElBQWNKLE9BQU9JLEtBQXpCLEVBQWdDO0FBQzlCRCxRQUFJQyxLQUFKLEdBQVlMLEtBQUtLLEtBQUwsSUFBY0osT0FBT0ksS0FBakM7QUFDRDs7QUFFRCxNQUFJTCxLQUFLTSxXQUFMLElBQW9CTCxPQUFPSyxXQUEvQixFQUE0QztBQUMxQyxRQUFJLENBQUNDLGdCQUFnQlAsSUFBaEIsQ0FBTCxFQUE0QjtBQUMxQjtBQUNBSSxVQUFJSSxXQUFKLEdBQWtCUCxPQUFPTyxXQUFQLElBQXNCUixLQUFLUSxXQUE3QztBQUNBSixVQUFJRSxXQUFKLEdBQWtCTCxPQUFPSyxXQUFQLElBQXNCTixLQUFLTSxXQUE3QztBQUNBRixVQUFJSyxTQUFKLEdBQWdCUixPQUFPUSxTQUFQLElBQW9CVCxLQUFLUyxTQUF6QztBQUNBTCxVQUFJTSxTQUFKLEdBQWdCVCxPQUFPUyxTQUFQLElBQW9CVixLQUFLVSxTQUF6QztBQUNELEtBTkQsTUFNTyxJQUFJLENBQUNILGdCQUFnQk4sTUFBaEIsQ0FBTCxFQUE4QjtBQUNuQztBQUNBRyxVQUFJSSxXQUFKLEdBQWtCUixLQUFLUSxXQUF2QjtBQUNBSixVQUFJRSxXQUFKLEdBQWtCTixLQUFLTSxXQUF2QjtBQUNBRixVQUFJSyxTQUFKLEdBQWdCVCxLQUFLUyxTQUFyQjtBQUNBTCxVQUFJTSxTQUFKLEdBQWdCVixLQUFLVSxTQUFyQjtBQUNELEtBTk0sTUFNQTtBQUNMO0FBQ0FOLFVBQUlJLFdBQUosR0FBa0JHLFlBQVlQLEdBQVosRUFBaUJKLEtBQUtRLFdBQXRCLEVBQW1DUCxPQUFPTyxXQUExQyxDQUFsQjtBQUNBSixVQUFJRSxXQUFKLEdBQWtCSyxZQUFZUCxHQUFaLEVBQWlCSixLQUFLTSxXQUF0QixFQUFtQ0wsT0FBT0ssV0FBMUMsQ0FBbEI7QUFDQUYsVUFBSUssU0FBSixHQUFnQkUsWUFBWVAsR0FBWixFQUFpQkosS0FBS1MsU0FBdEIsRUFBaUNSLE9BQU9RLFNBQXhDLENBQWhCO0FBQ0FMLFVBQUlNLFNBQUosR0FBZ0JDLFlBQVlQLEdBQVosRUFBaUJKLEtBQUtVLFNBQXRCLEVBQWlDVCxPQUFPUyxTQUF4QyxDQUFoQjtBQUNEO0FBQ0Y7O0FBRUROLE1BQUlRLEtBQUosR0FBWSxFQUFaOztBQUVBLE1BQUlDLFlBQVksQ0FBaEI7QUFBQSxNQUNJQyxjQUFjLENBRGxCO0FBQUEsTUFFSUMsYUFBYSxDQUZqQjtBQUFBLE1BR0lDLGVBQWUsQ0FIbkI7O0FBS0EsU0FBT0gsWUFBWWIsS0FBS1ksS0FBTCxDQUFXSyxNQUF2QixJQUFpQ0gsY0FBY2IsT0FBT1csS0FBUCxDQUFhSyxNQUFuRSxFQUEyRTtBQUN6RSxRQUFJQyxjQUFjbEIsS0FBS1ksS0FBTCxDQUFXQyxTQUFYLEtBQXlCLEVBQUNNLFVBQVVDLFFBQVgsRUFBM0M7QUFBQSxRQUNJQyxnQkFBZ0JwQixPQUFPVyxLQUFQLENBQWFFLFdBQWIsS0FBNkIsRUFBQ0ssVUFBVUMsUUFBWCxFQURqRDs7QUFHQSxRQUFJRSxXQUFXSixXQUFYLEVBQXdCRyxhQUF4QixDQUFKLEVBQTRDO0FBQzFDO0FBQ0FqQixVQUFJUSxLQUFKLENBQVVXLElBQVYsQ0FBZUMsVUFBVU4sV0FBVixFQUF1QkgsVUFBdkIsQ0FBZjtBQUNBRjtBQUNBRyxzQkFBZ0JFLFlBQVlwQixRQUFaLEdBQXVCb0IsWUFBWXJCLFFBQW5EO0FBQ0QsS0FMRCxNQUtPLElBQUl5QixXQUFXRCxhQUFYLEVBQTBCSCxXQUExQixDQUFKLEVBQTRDO0FBQ2pEO0FBQ0FkLFVBQUlRLEtBQUosQ0FBVVcsSUFBVixDQUFlQyxVQUFVSCxhQUFWLEVBQXlCTCxZQUF6QixDQUFmO0FBQ0FGO0FBQ0FDLG9CQUFjTSxjQUFjdkIsUUFBZCxHQUF5QnVCLGNBQWN4QixRQUFyRDtBQUNELEtBTE0sTUFLQTtBQUNMO0FBQ0EsVUFBSTRCLGFBQWE7QUFDZk4sa0JBQVVPLEtBQUtDLEdBQUwsQ0FBU1QsWUFBWUMsUUFBckIsRUFBK0JFLGNBQWNGLFFBQTdDLENBREs7QUFFZnRCLGtCQUFVLENBRks7QUFHZitCLGtCQUFVRixLQUFLQyxHQUFMLENBQVNULFlBQVlVLFFBQVosR0FBdUJiLFVBQWhDLEVBQTRDTSxjQUFjRixRQUFkLEdBQXlCSCxZQUFyRSxDQUhLO0FBSWZsQixrQkFBVSxDQUpLO0FBS2ZGLGVBQU87QUFMUSxPQUFqQjtBQU9BaUMsaUJBQVdKLFVBQVgsRUFBdUJQLFlBQVlDLFFBQW5DLEVBQTZDRCxZQUFZdEIsS0FBekQsRUFBZ0V5QixjQUFjRixRQUE5RSxFQUF3RkUsY0FBY3pCLEtBQXRHO0FBQ0FrQjtBQUNBRDs7QUFFQVQsVUFBSVEsS0FBSixDQUFVVyxJQUFWLENBQWVFLFVBQWY7QUFDRDtBQUNGOztBQUVELFNBQU9yQixHQUFQO0FBQ0Q7O0FBRUQsU0FBU0QsU0FBVCxDQUFtQjJCLEtBQW5CLEVBQTBCNUIsSUFBMUIsRUFBZ0M7QUFDOUIsTUFBSSxPQUFPNEIsS0FBUCxLQUFpQixRQUFyQixFQUErQjtBQUM3QixRQUFJLE9BQU9DLElBQVAsQ0FBWUQsS0FBWixLQUF1QixXQUFXQyxJQUFYLENBQWdCRCxLQUFoQixDQUEzQixFQUFvRDtBQUNsRCxhQUFPLHlFQUFXQSxLQUFYLEVBQWtCLENBQWxCO0FBQVA7QUFDRDs7QUFFRCxRQUFJLENBQUM1QixJQUFMLEVBQVc7QUFDVCxZQUFNLElBQUk4QixLQUFKLENBQVUsa0RBQVYsQ0FBTjtBQUNEO0FBQ0QsV0FBTywrRUFBZ0JqQyxTQUFoQixFQUEyQkEsU0FBM0IsRUFBc0NHLElBQXRDLEVBQTRDNEIsS0FBNUM7QUFBUDtBQUNEOztBQUVELFNBQU9BLEtBQVA7QUFDRDs7QUFFRCxTQUFTdkIsZUFBVCxDQUF5QjBCLEtBQXpCLEVBQWdDO0FBQzlCLFNBQU9BLE1BQU0zQixXQUFOLElBQXFCMkIsTUFBTTNCLFdBQU4sS0FBc0IyQixNQUFNekIsV0FBeEQ7QUFDRDs7QUFFRCxTQUFTRyxXQUFULENBQXFCTixLQUFyQixFQUE0QkwsSUFBNUIsRUFBa0NDLE1BQWxDLEVBQTBDO0FBQ3hDLE1BQUlELFNBQVNDLE1BQWIsRUFBcUI7QUFDbkIsV0FBT0QsSUFBUDtBQUNELEdBRkQsTUFFTztBQUNMSyxVQUFNNkIsUUFBTixHQUFpQixJQUFqQjtBQUNBLFdBQU8sRUFBQ2xDLFVBQUQsRUFBT0MsY0FBUCxFQUFQO0FBQ0Q7QUFDRjs7QUFFRCxTQUFTcUIsVUFBVCxDQUFvQlMsSUFBcEIsRUFBMEJJLEtBQTFCLEVBQWlDO0FBQy9CLFNBQU9KLEtBQUtaLFFBQUwsR0FBZ0JnQixNQUFNaEIsUUFBdEIsSUFDRFksS0FBS1osUUFBTCxHQUFnQlksS0FBS2xDLFFBQXRCLEdBQWtDc0MsTUFBTWhCLFFBRDdDO0FBRUQ7O0FBRUQsU0FBU0ssU0FBVCxDQUFtQjlCLElBQW5CLEVBQXlCMEMsTUFBekIsRUFBaUM7QUFDL0IsU0FBTztBQUNMakIsY0FBVXpCLEtBQUt5QixRQURWLEVBQ29CdEIsVUFBVUgsS0FBS0csUUFEbkM7QUFFTCtCLGNBQVVsQyxLQUFLa0MsUUFBTCxHQUFnQlEsTUFGckIsRUFFNkJ0QyxVQUFVSixLQUFLSSxRQUY1QztBQUdMRixXQUFPRixLQUFLRTtBQUhQLEdBQVA7QUFLRDs7QUFFRCxTQUFTaUMsVUFBVCxDQUFvQm5DLElBQXBCLEVBQTBCcUIsVUFBMUIsRUFBc0NzQixTQUF0QyxFQUFpREMsV0FBakQsRUFBOERDLFVBQTlELEVBQTBFO0FBQ3hFO0FBQ0E7QUFDQSxNQUFJdkMsT0FBTyxFQUFDb0MsUUFBUXJCLFVBQVQsRUFBcUJuQixPQUFPeUMsU0FBNUIsRUFBdUNoQyxPQUFPLENBQTlDLEVBQVg7QUFBQSxNQUNJbUMsUUFBUSxFQUFDSixRQUFRRSxXQUFULEVBQXNCMUMsT0FBTzJDLFVBQTdCLEVBQXlDbEMsT0FBTyxDQUFoRCxFQURaOztBQUdBO0FBQ0FvQyxnQkFBYy9DLElBQWQsRUFBb0JNLElBQXBCLEVBQTBCd0MsS0FBMUI7QUFDQUMsZ0JBQWMvQyxJQUFkLEVBQW9COEMsS0FBcEIsRUFBMkJ4QyxJQUEzQjs7QUFFQTtBQUNBLFNBQU9BLEtBQUtLLEtBQUwsR0FBYUwsS0FBS0osS0FBTCxDQUFXcUIsTUFBeEIsSUFBa0N1QixNQUFNbkMsS0FBTixHQUFjbUMsTUFBTTVDLEtBQU4sQ0FBWXFCLE1BQW5FLEVBQTJFO0FBQ3pFLFFBQUlDLGNBQWNsQixLQUFLSixLQUFMLENBQVdJLEtBQUtLLEtBQWhCLENBQWxCO0FBQUEsUUFDSXFDLGVBQWVGLE1BQU01QyxLQUFOLENBQVk0QyxNQUFNbkMsS0FBbEIsQ0FEbkI7O0FBR0EsUUFBSSxDQUFDYSxZQUFZLENBQVosTUFBbUIsR0FBbkIsSUFBMEJBLFlBQVksQ0FBWixNQUFtQixHQUE5QyxNQUNJd0IsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCQSxhQUFhLENBQWIsTUFBb0IsR0FEbkQsQ0FBSixFQUM2RDtBQUMzRDtBQUNBQyxtQkFBYWpELElBQWIsRUFBbUJNLElBQW5CLEVBQXlCd0MsS0FBekI7QUFDRCxLQUpELE1BSU8sSUFBSXRCLFlBQVksQ0FBWixNQUFtQixHQUFuQixJQUEwQndCLGFBQWEsQ0FBYixNQUFvQixHQUFsRCxFQUF1RDtBQUFBOztBQUFBLDhCQUM1RDtBQUNBLDBFQUFLOUMsS0FBTCxFQUFXMkIsSUFBWCw0TEFBb0JxQixjQUFjNUMsSUFBZCxDQUFwQjtBQUNELEtBSE0sTUFHQSxJQUFJMEMsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCeEIsWUFBWSxDQUFaLE1BQW1CLEdBQWxELEVBQXVEO0FBQUE7O0FBQUEsOEJBQzVEO0FBQ0EsMkVBQUt0QixLQUFMLEVBQVcyQixJQUFYLDZMQUFvQnFCLGNBQWNKLEtBQWQsQ0FBcEI7QUFDRCxLQUhNLE1BR0EsSUFBSXRCLFlBQVksQ0FBWixNQUFtQixHQUFuQixJQUEwQndCLGFBQWEsQ0FBYixNQUFvQixHQUFsRCxFQUF1RDtBQUM1RDtBQUNBRyxjQUFRbkQsSUFBUixFQUFjTSxJQUFkLEVBQW9Cd0MsS0FBcEI7QUFDRCxLQUhNLE1BR0EsSUFBSUUsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCeEIsWUFBWSxDQUFaLE1BQW1CLEdBQWxELEVBQXVEO0FBQzVEO0FBQ0EyQixjQUFRbkQsSUFBUixFQUFjOEMsS0FBZCxFQUFxQnhDLElBQXJCLEVBQTJCLElBQTNCO0FBQ0QsS0FITSxNQUdBLElBQUlrQixnQkFBZ0J3QixZQUFwQixFQUFrQztBQUN2QztBQUNBaEQsV0FBS0UsS0FBTCxDQUFXMkIsSUFBWCxDQUFnQkwsV0FBaEI7QUFDQWxCLFdBQUtLLEtBQUw7QUFDQW1DLFlBQU1uQyxLQUFOO0FBQ0QsS0FMTSxNQUtBO0FBQ0w7QUFDQTZCLGVBQVN4QyxJQUFULEVBQWVrRCxjQUFjNUMsSUFBZCxDQUFmLEVBQW9DNEMsY0FBY0osS0FBZCxDQUFwQztBQUNEO0FBQ0Y7O0FBRUQ7QUFDQU0saUJBQWVwRCxJQUFmLEVBQXFCTSxJQUFyQjtBQUNBOEMsaUJBQWVwRCxJQUFmLEVBQXFCOEMsS0FBckI7O0FBRUFoRCxnQkFBY0UsSUFBZDtBQUNEOztBQUVELFNBQVNpRCxZQUFULENBQXNCakQsSUFBdEIsRUFBNEJNLElBQTVCLEVBQWtDd0MsS0FBbEMsRUFBeUM7QUFDdkMsTUFBSU8sWUFBWUgsY0FBYzVDLElBQWQsQ0FBaEI7QUFBQSxNQUNJZ0QsZUFBZUosY0FBY0osS0FBZCxDQURuQjs7QUFHQSxNQUFJUyxXQUFXRixTQUFYLEtBQXlCRSxXQUFXRCxZQUFYLENBQTdCLEVBQXVEO0FBQ3JEO0FBQ0EsUUFBSSw4RUFBZ0JELFNBQWhCLEVBQTJCQyxZQUEzQixLQUNHRSxtQkFBbUJWLEtBQW5CLEVBQTBCTyxTQUExQixFQUFxQ0EsVUFBVTlCLE1BQVYsR0FBbUIrQixhQUFhL0IsTUFBckUsQ0FEUCxFQUNxRjtBQUFBOztBQUFBLDZCQUNuRixzRUFBS3JCLEtBQUwsRUFBVzJCLElBQVgsNkxBQW9Cd0IsU0FBcEI7QUFDQTtBQUNELEtBSkQsTUFJTyxJQUFJLDhFQUFnQkMsWUFBaEIsRUFBOEJELFNBQTlCLEtBQ0pHLG1CQUFtQmxELElBQW5CLEVBQXlCZ0QsWUFBekIsRUFBdUNBLGFBQWEvQixNQUFiLEdBQXNCOEIsVUFBVTlCLE1BQXZFLENBREEsRUFDZ0Y7QUFBQTs7QUFBQSw2QkFDckYsc0VBQUtyQixLQUFMLEVBQVcyQixJQUFYLDZMQUFvQnlCLFlBQXBCO0FBQ0E7QUFDRDtBQUNGLEdBWEQsTUFXTyxJQUFJLHlFQUFXRCxTQUFYLEVBQXNCQyxZQUF0QixDQUFKLEVBQXlDO0FBQUE7O0FBQUEsMkJBQzlDLHNFQUFLcEQsS0FBTCxFQUFXMkIsSUFBWCw2TEFBb0J3QixTQUFwQjtBQUNBO0FBQ0Q7O0FBRURiLFdBQVN4QyxJQUFULEVBQWVxRCxTQUFmLEVBQTBCQyxZQUExQjtBQUNEOztBQUVELFNBQVNILE9BQVQsQ0FBaUJuRCxJQUFqQixFQUF1Qk0sSUFBdkIsRUFBNkJ3QyxLQUE3QixFQUFvQ1csSUFBcEMsRUFBMEM7QUFDeEMsTUFBSUosWUFBWUgsY0FBYzVDLElBQWQsQ0FBaEI7QUFBQSxNQUNJZ0QsZUFBZUksZUFBZVosS0FBZixFQUFzQk8sU0FBdEIsQ0FEbkI7QUFFQSxNQUFJQyxhQUFhSyxNQUFqQixFQUF5QjtBQUFBOztBQUFBLDJCQUN2QixzRUFBS3pELEtBQUwsRUFBVzJCLElBQVgsNkxBQW9CeUIsYUFBYUssTUFBakM7QUFDRCxHQUZELE1BRU87QUFDTG5CLGFBQVN4QyxJQUFULEVBQWV5RCxPQUFPSCxZQUFQLEdBQXNCRCxTQUFyQyxFQUFnREksT0FBT0osU0FBUCxHQUFtQkMsWUFBbkU7QUFDRDtBQUNGOztBQUVELFNBQVNkLFFBQVQsQ0FBa0J4QyxJQUFsQixFQUF3Qk0sSUFBeEIsRUFBOEJ3QyxLQUE5QixFQUFxQztBQUNuQzlDLE9BQUt3QyxRQUFMLEdBQWdCLElBQWhCO0FBQ0F4QyxPQUFLRSxLQUFMLENBQVcyQixJQUFYLENBQWdCO0FBQ2RXLGNBQVUsSUFESTtBQUVkbEMsVUFBTUEsSUFGUTtBQUdkQyxZQUFRdUM7QUFITSxHQUFoQjtBQUtEOztBQUVELFNBQVNDLGFBQVQsQ0FBdUIvQyxJQUF2QixFQUE2QjRELE1BQTdCLEVBQXFDZCxLQUFyQyxFQUE0QztBQUMxQyxTQUFPYyxPQUFPbEIsTUFBUCxHQUFnQkksTUFBTUosTUFBdEIsSUFBZ0NrQixPQUFPakQsS0FBUCxHQUFlaUQsT0FBTzFELEtBQVAsQ0FBYXFCLE1BQW5FLEVBQTJFO0FBQ3pFLFFBQUlzQyxPQUFPRCxPQUFPMUQsS0FBUCxDQUFhMEQsT0FBT2pELEtBQVAsRUFBYixDQUFYO0FBQ0FYLFNBQUtFLEtBQUwsQ0FBVzJCLElBQVgsQ0FBZ0JnQyxJQUFoQjtBQUNBRCxXQUFPbEIsTUFBUDtBQUNEO0FBQ0Y7QUFDRCxTQUFTVSxjQUFULENBQXdCcEQsSUFBeEIsRUFBOEI0RCxNQUE5QixFQUFzQztBQUNwQyxTQUFPQSxPQUFPakQsS0FBUCxHQUFlaUQsT0FBTzFELEtBQVAsQ0FBYXFCLE1BQW5DLEVBQTJDO0FBQ3pDLFFBQUlzQyxPQUFPRCxPQUFPMUQsS0FBUCxDQUFhMEQsT0FBT2pELEtBQVAsRUFBYixDQUFYO0FBQ0FYLFNBQUtFLEtBQUwsQ0FBVzJCLElBQVgsQ0FBZ0JnQyxJQUFoQjtBQUNEO0FBQ0Y7O0FBRUQsU0FBU1gsYUFBVCxDQUF1QlksS0FBdkIsRUFBOEI7QUFDNUIsTUFBSXBELE1BQU0sRUFBVjtBQUFBLE1BQ0lxRCxZQUFZRCxNQUFNNUQsS0FBTixDQUFZNEQsTUFBTW5ELEtBQWxCLEVBQXlCLENBQXpCLENBRGhCO0FBRUEsU0FBT21ELE1BQU1uRCxLQUFOLEdBQWNtRCxNQUFNNUQsS0FBTixDQUFZcUIsTUFBakMsRUFBeUM7QUFDdkMsUUFBSXNDLE9BQU9DLE1BQU01RCxLQUFOLENBQVk0RCxNQUFNbkQsS0FBbEIsQ0FBWDs7QUFFQTtBQUNBLFFBQUlvRCxjQUFjLEdBQWQsSUFBcUJGLEtBQUssQ0FBTCxNQUFZLEdBQXJDLEVBQTBDO0FBQ3hDRSxrQkFBWSxHQUFaO0FBQ0Q7O0FBRUQsUUFBSUEsY0FBY0YsS0FBSyxDQUFMLENBQWxCLEVBQTJCO0FBQ3pCbkQsVUFBSW1CLElBQUosQ0FBU2dDLElBQVQ7QUFDQUMsWUFBTW5ELEtBQU47QUFDRCxLQUhELE1BR087QUFDTDtBQUNEO0FBQ0Y7O0FBRUQsU0FBT0QsR0FBUDtBQUNEO0FBQ0QsU0FBU2dELGNBQVQsQ0FBd0JJLEtBQXhCLEVBQStCRSxZQUEvQixFQUE2QztBQUMzQyxNQUFJQyxVQUFVLEVBQWQ7QUFBQSxNQUNJTixTQUFTLEVBRGI7QUFBQSxNQUVJTyxhQUFhLENBRmpCO0FBQUEsTUFHSUMsaUJBQWlCLEtBSHJCO0FBQUEsTUFJSUMsYUFBYSxLQUpqQjtBQUtBLFNBQU9GLGFBQWFGLGFBQWF6QyxNQUExQixJQUNFdUMsTUFBTW5ELEtBQU4sR0FBY21ELE1BQU01RCxLQUFOLENBQVlxQixNQURuQyxFQUMyQztBQUN6QyxRQUFJOEMsU0FBU1AsTUFBTTVELEtBQU4sQ0FBWTRELE1BQU1uRCxLQUFsQixDQUFiO0FBQUEsUUFDSTJELFFBQVFOLGFBQWFFLFVBQWIsQ0FEWjs7QUFHQTtBQUNBLFFBQUlJLE1BQU0sQ0FBTixNQUFhLEdBQWpCLEVBQXNCO0FBQ3BCO0FBQ0Q7O0FBRURILHFCQUFpQkEsa0JBQWtCRSxPQUFPLENBQVAsTUFBYyxHQUFqRDs7QUFFQVYsV0FBTzlCLElBQVAsQ0FBWXlDLEtBQVo7QUFDQUo7O0FBRUE7QUFDQTtBQUNBLFFBQUlHLE9BQU8sQ0FBUCxNQUFjLEdBQWxCLEVBQXVCO0FBQ3JCRCxtQkFBYSxJQUFiOztBQUVBLGFBQU9DLE9BQU8sQ0FBUCxNQUFjLEdBQXJCLEVBQTBCO0FBQ3hCSixnQkFBUXBDLElBQVIsQ0FBYXdDLE1BQWI7QUFDQUEsaUJBQVNQLE1BQU01RCxLQUFOLENBQVksRUFBRTRELE1BQU1uRCxLQUFwQixDQUFUO0FBQ0Q7QUFDRjs7QUFFRCxRQUFJMkQsTUFBTUMsTUFBTixDQUFhLENBQWIsTUFBb0JGLE9BQU9FLE1BQVAsQ0FBYyxDQUFkLENBQXhCLEVBQTBDO0FBQ3hDTixjQUFRcEMsSUFBUixDQUFhd0MsTUFBYjtBQUNBUCxZQUFNbkQsS0FBTjtBQUNELEtBSEQsTUFHTztBQUNMeUQsbUJBQWEsSUFBYjtBQUNEO0FBQ0Y7O0FBRUQsTUFBSSxDQUFDSixhQUFhRSxVQUFiLEtBQTRCLEVBQTdCLEVBQWlDLENBQWpDLE1BQXdDLEdBQXhDLElBQ0dDLGNBRFAsRUFDdUI7QUFDckJDLGlCQUFhLElBQWI7QUFDRDs7QUFFRCxNQUFJQSxVQUFKLEVBQWdCO0FBQ2QsV0FBT0gsT0FBUDtBQUNEOztBQUVELFNBQU9DLGFBQWFGLGFBQWF6QyxNQUFqQyxFQUF5QztBQUN2Q29DLFdBQU85QixJQUFQLENBQVltQyxhQUFhRSxZQUFiLENBQVo7QUFDRDs7QUFFRCxTQUFPO0FBQ0xQLGtCQURLO0FBRUxNO0FBRkssR0FBUDtBQUlEOztBQUVELFNBQVNWLFVBQVQsQ0FBb0JVLE9BQXBCLEVBQTZCO0FBQzNCLFNBQU9BLFFBQVFPLE1BQVIsQ0FBZSxVQUFTQyxJQUFULEVBQWVKLE1BQWYsRUFBdUI7QUFDM0MsV0FBT0ksUUFBUUosT0FBTyxDQUFQLE1BQWMsR0FBN0I7QUFDRCxHQUZNLEVBRUosSUFGSSxDQUFQO0FBR0Q7QUFDRCxTQUFTYixrQkFBVCxDQUE0Qk0sS0FBNUIsRUFBbUNZLGFBQW5DLEVBQWtEQyxLQUFsRCxFQUF5RDtBQUN2RCxPQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsS0FBcEIsRUFBMkJDLEdBQTNCLEVBQWdDO0FBQzlCLFFBQUlDLGdCQUFnQkgsY0FBY0EsY0FBY25ELE1BQWQsR0FBdUJvRCxLQUF2QixHQUErQkMsQ0FBN0MsRUFBZ0RMLE1BQWhELENBQXVELENBQXZELENBQXBCO0FBQ0EsUUFBSVQsTUFBTTVELEtBQU4sQ0FBWTRELE1BQU1uRCxLQUFOLEdBQWNpRSxDQUExQixNQUFpQyxNQUFNQyxhQUEzQyxFQUEwRDtBQUN4RCxhQUFPLEtBQVA7QUFDRDtBQUNGOztBQUVEZixRQUFNbkQsS0FBTixJQUFlZ0UsS0FBZjtBQUNBLFNBQU8sSUFBUDtBQUNEOztBQUVELFNBQVMxRSxtQkFBVCxDQUE2QkMsS0FBN0IsRUFBb0M7QUFDbEMsTUFBSUMsV0FBVyxDQUFmO0FBQ0EsTUFBSUMsV0FBVyxDQUFmOztBQUVBRixRQUFNNEUsT0FBTixDQUFjLFVBQVNqQixJQUFULEVBQWU7QUFDM0IsUUFBSSxPQUFPQSxJQUFQLEtBQWdCLFFBQXBCLEVBQThCO0FBQzVCLFVBQUlrQixVQUFVOUUsb0JBQW9CNEQsS0FBS3ZELElBQXpCLENBQWQ7QUFDQSxVQUFJMEUsYUFBYS9FLG9CQUFvQjRELEtBQUt0RCxNQUF6QixDQUFqQjs7QUFFQSxVQUFJSixhQUFhRSxTQUFqQixFQUE0QjtBQUMxQixZQUFJMEUsUUFBUTVFLFFBQVIsS0FBcUI2RSxXQUFXN0UsUUFBcEMsRUFBOEM7QUFDNUNBLHNCQUFZNEUsUUFBUTVFLFFBQXBCO0FBQ0QsU0FGRCxNQUVPO0FBQ0xBLHFCQUFXRSxTQUFYO0FBQ0Q7QUFDRjs7QUFFRCxVQUFJRCxhQUFhQyxTQUFqQixFQUE0QjtBQUMxQixZQUFJMEUsUUFBUTNFLFFBQVIsS0FBcUI0RSxXQUFXNUUsUUFBcEMsRUFBOEM7QUFDNUNBLHNCQUFZMkUsUUFBUTNFLFFBQXBCO0FBQ0QsU0FGRCxNQUVPO0FBQ0xBLHFCQUFXQyxTQUFYO0FBQ0Q7QUFDRjtBQUNGLEtBbkJELE1BbUJPO0FBQ0wsVUFBSUQsYUFBYUMsU0FBYixLQUEyQndELEtBQUssQ0FBTCxNQUFZLEdBQVosSUFBbUJBLEtBQUssQ0FBTCxNQUFZLEdBQTFELENBQUosRUFBb0U7QUFDbEV6RDtBQUNEO0FBQ0QsVUFBSUQsYUFBYUUsU0FBYixLQUEyQndELEtBQUssQ0FBTCxNQUFZLEdBQVosSUFBbUJBLEtBQUssQ0FBTCxNQUFZLEdBQTFELENBQUosRUFBb0U7QUFDbEUxRDtBQUNEO0FBQ0Y7QUFDRixHQTVCRDs7QUE4QkEsU0FBTyxFQUFDQSxrQkFBRCxFQUFXQyxrQkFBWCxFQUFQO0FBQ0QiLCJmaWxlIjoibWVyZ2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJpbXBvcnQge3N0cnVjdHVyZWRQYXRjaH0gZnJvbSAnLi9jcmVhdGUnO1xuaW1wb3J0IHtwYXJzZVBhdGNofSBmcm9tICcuL3BhcnNlJztcblxuaW1wb3J0IHthcnJheUVxdWFsLCBhcnJheVN0YXJ0c1dpdGh9IGZyb20gJy4uL3V0aWwvYXJyYXknO1xuXG5leHBvcnQgZnVuY3Rpb24gY2FsY0xpbmVDb3VudChodW5rKSB7XG4gIGNvbnN0IHtvbGRMaW5lcywgbmV3TGluZXN9ID0gY2FsY09sZE5ld0xpbmVDb3VudChodW5rLmxpbmVzKTtcblxuICBpZiAob2xkTGluZXMgIT09IHVuZGVmaW5lZCkge1xuICAgIGh1bmsub2xkTGluZXMgPSBvbGRMaW5lcztcbiAgfSBlbHNlIHtcbiAgICBkZWxldGUgaHVuay5vbGRMaW5lcztcbiAgfVxuXG4gIGlmIChuZXdMaW5lcyAhPT0gdW5kZWZpbmVkKSB7XG4gICAgaHVuay5uZXdMaW5lcyA9IG5ld0xpbmVzO1xuICB9IGVsc2Uge1xuICAgIGRlbGV0ZSBodW5rLm5ld0xpbmVzO1xuICB9XG59XG5cbmV4cG9ydCBmdW5jdGlvbiBtZXJnZShtaW5lLCB0aGVpcnMsIGJhc2UpIHtcbiAgbWluZSA9IGxvYWRQYXRjaChtaW5lLCBiYXNlKTtcbiAgdGhlaXJzID0gbG9hZFBhdGNoKHRoZWlycywgYmFzZSk7XG5cbiAgbGV0IHJldCA9IHt9O1xuXG4gIC8vIEZvciBpbmRleCB3ZSBqdXN0IGxldCBpdCBwYXNzIHRocm91Z2ggYXMgaXQgZG9lc24ndCBoYXZlIGFueSBuZWNlc3NhcnkgbWVhbmluZy5cbiAgLy8gTGVhdmluZyBzYW5pdHkgY2hlY2tzIG9uIHRoaXMgdG8gdGhlIEFQSSBjb25zdW1lciB0aGF0IG1heSBrbm93IG1vcmUgYWJvdXQgdGhlXG4gIC8vIG1lYW5pbmcgaW4gdGhlaXIgb3duIGNvbnRleHQuXG4gIGlmIChtaW5lLmluZGV4IHx8IHRoZWlycy5pbmRleCkge1xuICAgIHJldC5pbmRleCA9IG1pbmUuaW5kZXggfHwgdGhlaXJzLmluZGV4O1xuICB9XG5cbiAgaWYgKG1pbmUubmV3RmlsZU5hbWUgfHwgdGhlaXJzLm5ld0ZpbGVOYW1lKSB7XG4gICAgaWYgKCFmaWxlTmFtZUNoYW5nZWQobWluZSkpIHtcbiAgICAgIC8vIE5vIGhlYWRlciBvciBubyBjaGFuZ2UgaW4gb3VycywgdXNlIHRoZWlycyAoYW5kIG91cnMgaWYgdGhlaXJzIGRvZXMgbm90IGV4aXN0KVxuICAgICAgcmV0Lm9sZEZpbGVOYW1lID0gdGhlaXJzLm9sZEZpbGVOYW1lIHx8IG1pbmUub2xkRmlsZU5hbWU7XG4gICAgICByZXQubmV3RmlsZU5hbWUgPSB0aGVpcnMubmV3RmlsZU5hbWUgfHwgbWluZS5uZXdGaWxlTmFtZTtcbiAgICAgIHJldC5vbGRIZWFkZXIgPSB0aGVpcnMub2xkSGVhZGVyIHx8IG1pbmUub2xkSGVhZGVyO1xuICAgICAgcmV0Lm5ld0hlYWRlciA9IHRoZWlycy5uZXdIZWFkZXIgfHwgbWluZS5uZXdIZWFkZXI7XG4gICAgfSBlbHNlIGlmICghZmlsZU5hbWVDaGFuZ2VkKHRoZWlycykpIHtcbiAgICAgIC8vIE5vIGhlYWRlciBvciBubyBjaGFuZ2UgaW4gdGhlaXJzLCB1c2Ugb3Vyc1xuICAgICAgcmV0Lm9sZEZpbGVOYW1lID0gbWluZS5vbGRGaWxlTmFtZTtcbiAgICAgIHJldC5uZXdGaWxlTmFtZSA9IG1pbmUubmV3RmlsZU5hbWU7XG4gICAgICByZXQub2xkSGVhZGVyID0gbWluZS5vbGRIZWFkZXI7XG4gICAgICByZXQubmV3SGVhZGVyID0gbWluZS5uZXdIZWFkZXI7XG4gICAgfSBlbHNlIHtcbiAgICAgIC8vIEJvdGggY2hhbmdlZC4uLiBmaWd1cmUgaXQgb3V0XG4gICAgICByZXQub2xkRmlsZU5hbWUgPSBzZWxlY3RGaWVsZChyZXQsIG1pbmUub2xkRmlsZU5hbWUsIHRoZWlycy5vbGRGaWxlTmFtZSk7XG4gICAgICByZXQubmV3RmlsZU5hbWUgPSBzZWxlY3RGaWVsZChyZXQsIG1pbmUubmV3RmlsZU5hbWUsIHRoZWlycy5uZXdGaWxlTmFtZSk7XG4gICAgICByZXQub2xkSGVhZGVyID0gc2VsZWN0RmllbGQocmV0LCBtaW5lLm9sZEhlYWRlciwgdGhlaXJzLm9sZEhlYWRlcik7XG4gICAgICByZXQubmV3SGVhZGVyID0gc2VsZWN0RmllbGQocmV0LCBtaW5lLm5ld0hlYWRlciwgdGhlaXJzLm5ld0hlYWRlcik7XG4gICAgfVxuICB9XG5cbiAgcmV0Lmh1bmtzID0gW107XG5cbiAgbGV0IG1pbmVJbmRleCA9IDAsXG4gICAgICB0aGVpcnNJbmRleCA9IDAsXG4gICAgICBtaW5lT2Zmc2V0ID0gMCxcbiAgICAgIHRoZWlyc09mZnNldCA9IDA7XG5cbiAgd2hpbGUgKG1pbmVJbmRleCA8IG1pbmUuaHVua3MubGVuZ3RoIHx8IHRoZWlyc0luZGV4IDwgdGhlaXJzLmh1bmtzLmxlbmd0aCkge1xuICAgIGxldCBtaW5lQ3VycmVudCA9IG1pbmUuaHVua3NbbWluZUluZGV4XSB8fCB7b2xkU3RhcnQ6IEluZmluaXR5fSxcbiAgICAgICAgdGhlaXJzQ3VycmVudCA9IHRoZWlycy5odW5rc1t0aGVpcnNJbmRleF0gfHwge29sZFN0YXJ0OiBJbmZpbml0eX07XG5cbiAgICBpZiAoaHVua0JlZm9yZShtaW5lQ3VycmVudCwgdGhlaXJzQ3VycmVudCkpIHtcbiAgICAgIC8vIFRoaXMgcGF0Y2ggZG9lcyBub3Qgb3ZlcmxhcCB3aXRoIGFueSBvZiB0aGUgb3RoZXJzLCB5YXkuXG4gICAgICByZXQuaHVua3MucHVzaChjbG9uZUh1bmsobWluZUN1cnJlbnQsIG1pbmVPZmZzZXQpKTtcbiAgICAgIG1pbmVJbmRleCsrO1xuICAgICAgdGhlaXJzT2Zmc2V0ICs9IG1pbmVDdXJyZW50Lm5ld0xpbmVzIC0gbWluZUN1cnJlbnQub2xkTGluZXM7XG4gICAgfSBlbHNlIGlmIChodW5rQmVmb3JlKHRoZWlyc0N1cnJlbnQsIG1pbmVDdXJyZW50KSkge1xuICAgICAgLy8gVGhpcyBwYXRjaCBkb2VzIG5vdCBvdmVybGFwIHdpdGggYW55IG9mIHRoZSBvdGhlcnMsIHlheS5cbiAgICAgIHJldC5odW5rcy5wdXNoKGNsb25lSHVuayh0aGVpcnNDdXJyZW50LCB0aGVpcnNPZmZzZXQpKTtcbiAgICAgIHRoZWlyc0luZGV4Kys7XG4gICAgICBtaW5lT2Zmc2V0ICs9IHRoZWlyc0N1cnJlbnQubmV3TGluZXMgLSB0aGVpcnNDdXJyZW50Lm9sZExpbmVzO1xuICAgIH0gZWxzZSB7XG4gICAgICAvLyBPdmVybGFwLCBtZXJnZSBhcyBiZXN0IHdlIGNhblxuICAgICAgbGV0IG1lcmdlZEh1bmsgPSB7XG4gICAgICAgIG9sZFN0YXJ0OiBNYXRoLm1pbihtaW5lQ3VycmVudC5vbGRTdGFydCwgdGhlaXJzQ3VycmVudC5vbGRTdGFydCksXG4gICAgICAgIG9sZExpbmVzOiAwLFxuICAgICAgICBuZXdTdGFydDogTWF0aC5taW4obWluZUN1cnJlbnQubmV3U3RhcnQgKyBtaW5lT2Zmc2V0LCB0aGVpcnNDdXJyZW50Lm9sZFN0YXJ0ICsgdGhlaXJzT2Zmc2V0KSxcbiAgICAgICAgbmV3TGluZXM6IDAsXG4gICAgICAgIGxpbmVzOiBbXVxuICAgICAgfTtcbiAgICAgIG1lcmdlTGluZXMobWVyZ2VkSHVuaywgbWluZUN1cnJlbnQub2xkU3RhcnQsIG1pbmVDdXJyZW50LmxpbmVzLCB0aGVpcnNDdXJyZW50Lm9sZFN0YXJ0LCB0aGVpcnNDdXJyZW50LmxpbmVzKTtcbiAgICAgIHRoZWlyc0luZGV4Kys7XG4gICAgICBtaW5lSW5kZXgrKztcblxuICAgICAgcmV0Lmh1bmtzLnB1c2gobWVyZ2VkSHVuayk7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIHJldDtcbn1cblxuZnVuY3Rpb24gbG9hZFBhdGNoKHBhcmFtLCBiYXNlKSB7XG4gIGlmICh0eXBlb2YgcGFyYW0gPT09ICdzdHJpbmcnKSB7XG4gICAgaWYgKC9eQEAvbS50ZXN0KHBhcmFtKSB8fCAoL15JbmRleDovbS50ZXN0KHBhcmFtKSkpIHtcbiAgICAgIHJldHVybiBwYXJzZVBhdGNoKHBhcmFtKVswXTtcbiAgICB9XG5cbiAgICBpZiAoIWJhc2UpIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcignTXVzdCBwcm92aWRlIGEgYmFzZSByZWZlcmVuY2Ugb3IgcGFzcyBpbiBhIHBhdGNoJyk7XG4gICAgfVxuICAgIHJldHVybiBzdHJ1Y3R1cmVkUGF0Y2godW5kZWZpbmVkLCB1bmRlZmluZWQsIGJhc2UsIHBhcmFtKTtcbiAgfVxuXG4gIHJldHVybiBwYXJhbTtcbn1cblxuZnVuY3Rpb24gZmlsZU5hbWVDaGFuZ2VkKHBhdGNoKSB7XG4gIHJldHVybiBwYXRjaC5uZXdGaWxlTmFtZSAmJiBwYXRjaC5uZXdGaWxlTmFtZSAhPT0gcGF0Y2gub2xkRmlsZU5hbWU7XG59XG5cbmZ1bmN0aW9uIHNlbGVjdEZpZWxkKGluZGV4LCBtaW5lLCB0aGVpcnMpIHtcbiAgaWYgKG1pbmUgPT09IHRoZWlycykge1xuICAgIHJldHVybiBtaW5lO1xuICB9IGVsc2Uge1xuICAgIGluZGV4LmNvbmZsaWN0ID0gdHJ1ZTtcbiAgICByZXR1cm4ge21pbmUsIHRoZWlyc307XG4gIH1cbn1cblxuZnVuY3Rpb24gaHVua0JlZm9yZSh0ZXN0LCBjaGVjaykge1xuICByZXR1cm4gdGVzdC5vbGRTdGFydCA8IGNoZWNrLm9sZFN0YXJ0XG4gICAgJiYgKHRlc3Qub2xkU3RhcnQgKyB0ZXN0Lm9sZExpbmVzKSA8IGNoZWNrLm9sZFN0YXJ0O1xufVxuXG5mdW5jdGlvbiBjbG9uZUh1bmsoaHVuaywgb2Zmc2V0KSB7XG4gIHJldHVybiB7XG4gICAgb2xkU3RhcnQ6IGh1bmsub2xkU3RhcnQsIG9sZExpbmVzOiBodW5rLm9sZExpbmVzLFxuICAgIG5ld1N0YXJ0OiBodW5rLm5ld1N0YXJ0ICsgb2Zmc2V0LCBuZXdMaW5lczogaHVuay5uZXdMaW5lcyxcbiAgICBsaW5lczogaHVuay5saW5lc1xuICB9O1xufVxuXG5mdW5jdGlvbiBtZXJnZUxpbmVzKGh1bmssIG1pbmVPZmZzZXQsIG1pbmVMaW5lcywgdGhlaXJPZmZzZXQsIHRoZWlyTGluZXMpIHtcbiAgLy8gVGhpcyB3aWxsIGdlbmVyYWxseSByZXN1bHQgaW4gYSBjb25mbGljdGVkIGh1bmssIGJ1dCB0aGVyZSBhcmUgY2FzZXMgd2hlcmUgdGhlIGNvbnRleHRcbiAgLy8gaXMgdGhlIG9ubHkgb3ZlcmxhcCB3aGVyZSB3ZSBjYW4gc3VjY2Vzc2Z1bGx5IG1lcmdlIHRoZSBjb250ZW50IGhlcmUuXG4gIGxldCBtaW5lID0ge29mZnNldDogbWluZU9mZnNldCwgbGluZXM6IG1pbmVMaW5lcywgaW5kZXg6IDB9LFxuICAgICAgdGhlaXIgPSB7b2Zmc2V0OiB0aGVpck9mZnNldCwgbGluZXM6IHRoZWlyTGluZXMsIGluZGV4OiAwfTtcblxuICAvLyBIYW5kbGUgYW55IGxlYWRpbmcgY29udGVudFxuICBpbnNlcnRMZWFkaW5nKGh1bmssIG1pbmUsIHRoZWlyKTtcbiAgaW5zZXJ0TGVhZGluZyhodW5rLCB0aGVpciwgbWluZSk7XG5cbiAgLy8gTm93IGluIHRoZSBvdmVybGFwIGNvbnRlbnQuIFNjYW4gdGhyb3VnaCBhbmQgc2VsZWN0IHRoZSBiZXN0IGNoYW5nZXMgZnJvbSBlYWNoLlxuICB3aGlsZSAobWluZS5pbmRleCA8IG1pbmUubGluZXMubGVuZ3RoICYmIHRoZWlyLmluZGV4IDwgdGhlaXIubGluZXMubGVuZ3RoKSB7XG4gICAgbGV0IG1pbmVDdXJyZW50ID0gbWluZS5saW5lc1ttaW5lLmluZGV4XSxcbiAgICAgICAgdGhlaXJDdXJyZW50ID0gdGhlaXIubGluZXNbdGhlaXIuaW5kZXhdO1xuXG4gICAgaWYgKChtaW5lQ3VycmVudFswXSA9PT0gJy0nIHx8IG1pbmVDdXJyZW50WzBdID09PSAnKycpXG4gICAgICAgICYmICh0aGVpckN1cnJlbnRbMF0gPT09ICctJyB8fCB0aGVpckN1cnJlbnRbMF0gPT09ICcrJykpIHtcbiAgICAgIC8vIEJvdGggbW9kaWZpZWQgLi4uXG4gICAgICBtdXR1YWxDaGFuZ2UoaHVuaywgbWluZSwgdGhlaXIpO1xuICAgIH0gZWxzZSBpZiAobWluZUN1cnJlbnRbMF0gPT09ICcrJyAmJiB0aGVpckN1cnJlbnRbMF0gPT09ICcgJykge1xuICAgICAgLy8gTWluZSBpbnNlcnRlZFxuICAgICAgaHVuay5saW5lcy5wdXNoKC4uLiBjb2xsZWN0Q2hhbmdlKG1pbmUpKTtcbiAgICB9IGVsc2UgaWYgKHRoZWlyQ3VycmVudFswXSA9PT0gJysnICYmIG1pbmVDdXJyZW50WzBdID09PSAnICcpIHtcbiAgICAgIC8vIFRoZWlycyBpbnNlcnRlZFxuICAgICAgaHVuay5saW5lcy5wdXNoKC4uLiBjb2xsZWN0Q2hhbmdlKHRoZWlyKSk7XG4gICAgfSBlbHNlIGlmIChtaW5lQ3VycmVudFswXSA9PT0gJy0nICYmIHRoZWlyQ3VycmVudFswXSA9PT0gJyAnKSB7XG4gICAgICAvLyBNaW5lIHJlbW92ZWQgb3IgZWRpdGVkXG4gICAgICByZW1vdmFsKGh1bmssIG1pbmUsIHRoZWlyKTtcbiAgICB9IGVsc2UgaWYgKHRoZWlyQ3VycmVudFswXSA9PT0gJy0nICYmIG1pbmVDdXJyZW50WzBdID09PSAnICcpIHtcbiAgICAgIC8vIFRoZWlyIHJlbW92ZWQgb3IgZWRpdGVkXG4gICAgICByZW1vdmFsKGh1bmssIHRoZWlyLCBtaW5lLCB0cnVlKTtcbiAgICB9IGVsc2UgaWYgKG1pbmVDdXJyZW50ID09PSB0aGVpckN1cnJlbnQpIHtcbiAgICAgIC8vIENvbnRleHQgaWRlbnRpdHlcbiAgICAgIGh1bmsubGluZXMucHVzaChtaW5lQ3VycmVudCk7XG4gICAgICBtaW5lLmluZGV4Kys7XG4gICAgICB0aGVpci5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICAvLyBDb250ZXh0IG1pc21hdGNoXG4gICAgICBjb25mbGljdChodW5rLCBjb2xsZWN0Q2hhbmdlKG1pbmUpLCBjb2xsZWN0Q2hhbmdlKHRoZWlyKSk7XG4gICAgfVxuICB9XG5cbiAgLy8gTm93IHB1c2ggYW55dGhpbmcgdGhhdCBtYXkgYmUgcmVtYWluaW5nXG4gIGluc2VydFRyYWlsaW5nKGh1bmssIG1pbmUpO1xuICBpbnNlcnRUcmFpbGluZyhodW5rLCB0aGVpcik7XG5cbiAgY2FsY0xpbmVDb3VudChodW5rKTtcbn1cblxuZnVuY3Rpb24gbXV0dWFsQ2hhbmdlKGh1bmssIG1pbmUsIHRoZWlyKSB7XG4gIGxldCBteUNoYW5nZXMgPSBjb2xsZWN0Q2hhbmdlKG1pbmUpLFxuICAgICAgdGhlaXJDaGFuZ2VzID0gY29sbGVjdENoYW5nZSh0aGVpcik7XG5cbiAgaWYgKGFsbFJlbW92ZXMobXlDaGFuZ2VzKSAmJiBhbGxSZW1vdmVzKHRoZWlyQ2hhbmdlcykpIHtcbiAgICAvLyBTcGVjaWFsIGNhc2UgZm9yIHJlbW92ZSBjaGFuZ2VzIHRoYXQgYXJlIHN1cGVyc2V0cyBvZiBvbmUgYW5vdGhlclxuICAgIGlmIChhcnJheVN0YXJ0c1dpdGgobXlDaGFuZ2VzLCB0aGVpckNoYW5nZXMpXG4gICAgICAgICYmIHNraXBSZW1vdmVTdXBlcnNldCh0aGVpciwgbXlDaGFuZ2VzLCBteUNoYW5nZXMubGVuZ3RoIC0gdGhlaXJDaGFuZ2VzLmxlbmd0aCkpIHtcbiAgICAgIGh1bmsubGluZXMucHVzaCguLi4gbXlDaGFuZ2VzKTtcbiAgICAgIHJldHVybjtcbiAgICB9IGVsc2UgaWYgKGFycmF5U3RhcnRzV2l0aCh0aGVpckNoYW5nZXMsIG15Q2hhbmdlcylcbiAgICAgICAgJiYgc2tpcFJlbW92ZVN1cGVyc2V0KG1pbmUsIHRoZWlyQ2hhbmdlcywgdGhlaXJDaGFuZ2VzLmxlbmd0aCAtIG15Q2hhbmdlcy5sZW5ndGgpKSB7XG4gICAgICBodW5rLmxpbmVzLnB1c2goLi4uIHRoZWlyQ2hhbmdlcyk7XG4gICAgICByZXR1cm47XG4gICAgfVxuICB9IGVsc2UgaWYgKGFycmF5RXF1YWwobXlDaGFuZ2VzLCB0aGVpckNoYW5nZXMpKSB7XG4gICAgaHVuay5saW5lcy5wdXNoKC4uLiBteUNoYW5nZXMpO1xuICAgIHJldHVybjtcbiAgfVxuXG4gIGNvbmZsaWN0KGh1bmssIG15Q2hhbmdlcywgdGhlaXJDaGFuZ2VzKTtcbn1cblxuZnVuY3Rpb24gcmVtb3ZhbChodW5rLCBtaW5lLCB0aGVpciwgc3dhcCkge1xuICBsZXQgbXlDaGFuZ2VzID0gY29sbGVjdENoYW5nZShtaW5lKSxcbiAgICAgIHRoZWlyQ2hhbmdlcyA9IGNvbGxlY3RDb250ZXh0KHRoZWlyLCBteUNoYW5nZXMpO1xuICBpZiAodGhlaXJDaGFuZ2VzLm1lcmdlZCkge1xuICAgIGh1bmsubGluZXMucHVzaCguLi4gdGhlaXJDaGFuZ2VzLm1lcmdlZCk7XG4gIH0gZWxzZSB7XG4gICAgY29uZmxpY3QoaHVuaywgc3dhcCA/IHRoZWlyQ2hhbmdlcyA6IG15Q2hhbmdlcywgc3dhcCA/IG15Q2hhbmdlcyA6IHRoZWlyQ2hhbmdlcyk7XG4gIH1cbn1cblxuZnVuY3Rpb24gY29uZmxpY3QoaHVuaywgbWluZSwgdGhlaXIpIHtcbiAgaHVuay5jb25mbGljdCA9IHRydWU7XG4gIGh1bmsubGluZXMucHVzaCh7XG4gICAgY29uZmxpY3Q6IHRydWUsXG4gICAgbWluZTogbWluZSxcbiAgICB0aGVpcnM6IHRoZWlyXG4gIH0pO1xufVxuXG5mdW5jdGlvbiBpbnNlcnRMZWFkaW5nKGh1bmssIGluc2VydCwgdGhlaXIpIHtcbiAgd2hpbGUgKGluc2VydC5vZmZzZXQgPCB0aGVpci5vZmZzZXQgJiYgaW5zZXJ0LmluZGV4IDwgaW5zZXJ0LmxpbmVzLmxlbmd0aCkge1xuICAgIGxldCBsaW5lID0gaW5zZXJ0LmxpbmVzW2luc2VydC5pbmRleCsrXTtcbiAgICBodW5rLmxpbmVzLnB1c2gobGluZSk7XG4gICAgaW5zZXJ0Lm9mZnNldCsrO1xuICB9XG59XG5mdW5jdGlvbiBpbnNlcnRUcmFpbGluZyhodW5rLCBpbnNlcnQpIHtcbiAgd2hpbGUgKGluc2VydC5pbmRleCA8IGluc2VydC5saW5lcy5sZW5ndGgpIHtcbiAgICBsZXQgbGluZSA9IGluc2VydC5saW5lc1tpbnNlcnQuaW5kZXgrK107XG4gICAgaHVuay5saW5lcy5wdXNoKGxpbmUpO1xuICB9XG59XG5cbmZ1bmN0aW9uIGNvbGxlY3RDaGFuZ2Uoc3RhdGUpIHtcbiAgbGV0IHJldCA9IFtdLFxuICAgICAgb3BlcmF0aW9uID0gc3RhdGUubGluZXNbc3RhdGUuaW5kZXhdWzBdO1xuICB3aGlsZSAoc3RhdGUuaW5kZXggPCBzdGF0ZS5saW5lcy5sZW5ndGgpIHtcbiAgICBsZXQgbGluZSA9IHN0YXRlLmxpbmVzW3N0YXRlLmluZGV4XTtcblxuICAgIC8vIEdyb3VwIGFkZGl0aW9ucyB0aGF0IGFyZSBpbW1lZGlhdGVseSBhZnRlciBzdWJ0cmFjdGlvbnMgYW5kIHRyZWF0IHRoZW0gYXMgb25lIFwiYXRvbWljXCIgbW9kaWZ5IGNoYW5nZS5cbiAgICBpZiAob3BlcmF0aW9uID09PSAnLScgJiYgbGluZVswXSA9PT0gJysnKSB7XG4gICAgICBvcGVyYXRpb24gPSAnKyc7XG4gICAgfVxuXG4gICAgaWYgKG9wZXJhdGlvbiA9PT0gbGluZVswXSkge1xuICAgICAgcmV0LnB1c2gobGluZSk7XG4gICAgICBzdGF0ZS5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICBicmVhaztcbiAgICB9XG4gIH1cblxuICByZXR1cm4gcmV0O1xufVxuZnVuY3Rpb24gY29sbGVjdENvbnRleHQoc3RhdGUsIG1hdGNoQ2hhbmdlcykge1xuICBsZXQgY2hhbmdlcyA9IFtdLFxuICAgICAgbWVyZ2VkID0gW10sXG4gICAgICBtYXRjaEluZGV4ID0gMCxcbiAgICAgIGNvbnRleHRDaGFuZ2VzID0gZmFsc2UsXG4gICAgICBjb25mbGljdGVkID0gZmFsc2U7XG4gIHdoaWxlIChtYXRjaEluZGV4IDwgbWF0Y2hDaGFuZ2VzLmxlbmd0aFxuICAgICAgICAmJiBzdGF0ZS5pbmRleCA8IHN0YXRlLmxpbmVzLmxlbmd0aCkge1xuICAgIGxldCBjaGFuZ2UgPSBzdGF0ZS5saW5lc1tzdGF0ZS5pbmRleF0sXG4gICAgICAgIG1hdGNoID0gbWF0Y2hDaGFuZ2VzW21hdGNoSW5kZXhdO1xuXG4gICAgLy8gT25jZSB3ZSd2ZSBoaXQgb3VyIGFkZCwgdGhlbiB3ZSBhcmUgZG9uZVxuICAgIGlmIChtYXRjaFswXSA9PT0gJysnKSB7XG4gICAgICBicmVhaztcbiAgICB9XG5cbiAgICBjb250ZXh0Q2hhbmdlcyA9IGNvbnRleHRDaGFuZ2VzIHx8IGNoYW5nZVswXSAhPT0gJyAnO1xuXG4gICAgbWVyZ2VkLnB1c2gobWF0Y2gpO1xuICAgIG1hdGNoSW5kZXgrKztcblxuICAgIC8vIENvbnN1bWUgYW55IGFkZGl0aW9ucyBpbiB0aGUgb3RoZXIgYmxvY2sgYXMgYSBjb25mbGljdCB0byBhdHRlbXB0XG4gICAgLy8gdG8gcHVsbCBpbiB0aGUgcmVtYWluaW5nIGNvbnRleHQgYWZ0ZXIgdGhpc1xuICAgIGlmIChjaGFuZ2VbMF0gPT09ICcrJykge1xuICAgICAgY29uZmxpY3RlZCA9IHRydWU7XG5cbiAgICAgIHdoaWxlIChjaGFuZ2VbMF0gPT09ICcrJykge1xuICAgICAgICBjaGFuZ2VzLnB1c2goY2hhbmdlKTtcbiAgICAgICAgY2hhbmdlID0gc3RhdGUubGluZXNbKytzdGF0ZS5pbmRleF07XG4gICAgICB9XG4gICAgfVxuXG4gICAgaWYgKG1hdGNoLnN1YnN0cigxKSA9PT0gY2hhbmdlLnN1YnN0cigxKSkge1xuICAgICAgY2hhbmdlcy5wdXNoKGNoYW5nZSk7XG4gICAgICBzdGF0ZS5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICBjb25mbGljdGVkID0gdHJ1ZTtcbiAgICB9XG4gIH1cblxuICBpZiAoKG1hdGNoQ2hhbmdlc1ttYXRjaEluZGV4XSB8fCAnJylbMF0gPT09ICcrJ1xuICAgICAgJiYgY29udGV4dENoYW5nZXMpIHtcbiAgICBjb25mbGljdGVkID0gdHJ1ZTtcbiAgfVxuXG4gIGlmIChjb25mbGljdGVkKSB7XG4gICAgcmV0dXJuIGNoYW5nZXM7XG4gIH1cblxuICB3aGlsZSAobWF0Y2hJbmRleCA8IG1hdGNoQ2hhbmdlcy5sZW5ndGgpIHtcbiAgICBtZXJnZWQucHVzaChtYXRjaENoYW5nZXNbbWF0Y2hJbmRleCsrXSk7XG4gIH1cblxuICByZXR1cm4ge1xuICAgIG1lcmdlZCxcbiAgICBjaGFuZ2VzXG4gIH07XG59XG5cbmZ1bmN0aW9uIGFsbFJlbW92ZXMoY2hhbmdlcykge1xuICByZXR1cm4gY2hhbmdlcy5yZWR1Y2UoZnVuY3Rpb24ocHJldiwgY2hhbmdlKSB7XG4gICAgcmV0dXJuIHByZXYgJiYgY2hhbmdlWzBdID09PSAnLSc7XG4gIH0sIHRydWUpO1xufVxuZnVuY3Rpb24gc2tpcFJlbW92ZVN1cGVyc2V0KHN0YXRlLCByZW1vdmVDaGFuZ2VzLCBkZWx0YSkge1xuICBmb3IgKGxldCBpID0gMDsgaSA8IGRlbHRhOyBpKyspIHtcbiAgICBsZXQgY2hhbmdlQ29udGVudCA9IHJlbW92ZUNoYW5nZXNbcmVtb3ZlQ2hhbmdlcy5sZW5ndGggLSBkZWx0YSArIGldLnN1YnN0cigxKTtcbiAgICBpZiAoc3RhdGUubGluZXNbc3RhdGUuaW5kZXggKyBpXSAhPT0gJyAnICsgY2hhbmdlQ29udGVudCkge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cbiAgfVxuXG4gIHN0YXRlLmluZGV4ICs9IGRlbHRhO1xuICByZXR1cm4gdHJ1ZTtcbn1cblxuZnVuY3Rpb24gY2FsY09sZE5ld0xpbmVDb3VudChsaW5lcykge1xuICBsZXQgb2xkTGluZXMgPSAwO1xuICBsZXQgbmV3TGluZXMgPSAwO1xuXG4gIGxpbmVzLmZvckVhY2goZnVuY3Rpb24obGluZSkge1xuICAgIGlmICh0eXBlb2YgbGluZSAhPT0gJ3N0cmluZycpIHtcbiAgICAgIGxldCBteUNvdW50ID0gY2FsY09sZE5ld0xpbmVDb3VudChsaW5lLm1pbmUpO1xuICAgICAgbGV0IHRoZWlyQ291bnQgPSBjYWxjT2xkTmV3TGluZUNvdW50KGxpbmUudGhlaXJzKTtcblxuICAgICAgaWYgKG9sZExpbmVzICE9PSB1bmRlZmluZWQpIHtcbiAgICAgICAgaWYgKG15Q291bnQub2xkTGluZXMgPT09IHRoZWlyQ291bnQub2xkTGluZXMpIHtcbiAgICAgICAgICBvbGRMaW5lcyArPSBteUNvdW50Lm9sZExpbmVzO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIG9sZExpbmVzID0gdW5kZWZpbmVkO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIGlmIChuZXdMaW5lcyAhPT0gdW5kZWZpbmVkKSB7XG4gICAgICAgIGlmIChteUNvdW50Lm5ld0xpbmVzID09PSB0aGVpckNvdW50Lm5ld0xpbmVzKSB7XG4gICAgICAgICAgbmV3TGluZXMgKz0gbXlDb3VudC5uZXdMaW5lcztcbiAgICAgICAgfSBlbHNlIHtcbiAgICAgICAgICBuZXdMaW5lcyA9IHVuZGVmaW5lZDtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH0gZWxzZSB7XG4gICAgICBpZiAobmV3TGluZXMgIT09IHVuZGVmaW5lZCAmJiAobGluZVswXSA9PT0gJysnIHx8IGxpbmVbMF0gPT09ICcgJykpIHtcbiAgICAgICAgbmV3TGluZXMrKztcbiAgICAgIH1cbiAgICAgIGlmIChvbGRMaW5lcyAhPT0gdW5kZWZpbmVkICYmIChsaW5lWzBdID09PSAnLScgfHwgbGluZVswXSA9PT0gJyAnKSkge1xuICAgICAgICBvbGRMaW5lcysrO1xuICAgICAgfVxuICAgIH1cbiAgfSk7XG5cbiAgcmV0dXJuIHtvbGRMaW5lcywgbmV3TGluZXN9O1xufVxuIl19
+
+
+/***/ }),
+/* 14 */
+/***/ (function(module, exports, __webpack_require__) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/structuredPatch = structuredPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = createTwoFilesPatch;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = createPatch;
+
+	var /*istanbul ignore start*/_line = __webpack_require__(5) /*istanbul ignore end*/;
+
+	/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+	/*istanbul ignore end*/function structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+	  if (!options) {
+	    options = {};
+	  }
+	  if (typeof options.context === 'undefined') {
+	    options.context = 4;
+	  }
+
+	  var diff = /*istanbul ignore start*/(0, _line.diffLines) /*istanbul ignore end*/(oldStr, newStr, options);
+	  diff.push({ value: '', lines: [] }); // Append an empty value to make cleanup easier
+
+	  function contextLines(lines) {
+	    return lines.map(function (entry) {
+	      return ' ' + entry;
+	    });
+	  }
+
+	  var hunks = [];
+	  var oldRangeStart = 0,
+	      newRangeStart = 0,
+	      curRange = [],
+	      oldLine = 1,
+	      newLine = 1;
+
+	  /*istanbul ignore start*/var _loop = function _loop( /*istanbul ignore end*/i) {
+	    var current = diff[i],
+	        lines = current.lines || current.value.replace(/\n$/, '').split('\n');
+	    current.lines = lines;
+
+	    if (current.added || current.removed) {
+	      /*istanbul ignore start*/var _curRange;
+
+	      /*istanbul ignore end*/ // If we have previous context, start with that
+	      if (!oldRangeStart) {
+	        var prev = diff[i - 1];
+	        oldRangeStart = oldLine;
+	        newRangeStart = newLine;
+
+	        if (prev) {
+	          curRange = options.context > 0 ? contextLines(prev.lines.slice(-options.context)) : [];
+	          oldRangeStart -= curRange.length;
+	          newRangeStart -= curRange.length;
+	        }
+	      }
+
+	      // Output our changes
+	      /*istanbul ignore start*/(_curRange = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/lines.map(function (entry) {
+	        return (current.added ? '+' : '-') + entry;
+	      })));
+
+	      // Track the updated file position
+	      if (current.added) {
+	        newLine += lines.length;
+	      } else {
+	        oldLine += lines.length;
+	      }
+	    } else {
+	      // Identical context lines. Track line changes
+	      if (oldRangeStart) {
+	        // Close out any changes that have been output (or join overlapping)
+	        if (lines.length <= options.context * 2 && i < diff.length - 2) {
+	          /*istanbul ignore start*/var _curRange2;
+
+	          /*istanbul ignore end*/ // Overlapping
+	          /*istanbul ignore start*/(_curRange2 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines)));
+	        } else {
+	          /*istanbul ignore start*/var _curRange3;
+
+	          /*istanbul ignore end*/ // end the range and output
+	          var contextSize = Math.min(lines.length, options.context);
+	          /*istanbul ignore start*/(_curRange3 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines.slice(0, contextSize))));
+
+	          var hunk = {
+	            oldStart: oldRangeStart,
+	            oldLines: oldLine - oldRangeStart + contextSize,
+	            newStart: newRangeStart,
+	            newLines: newLine - newRangeStart + contextSize,
+	            lines: curRange
+	          };
+	          if (i >= diff.length - 2 && lines.length <= options.context) {
+	            // EOF is inside this hunk
+	            var oldEOFNewline = /\n$/.test(oldStr);
+	            var newEOFNewline = /\n$/.test(newStr);
+	            if (lines.length == 0 && !oldEOFNewline) {
+	              // special case: old has no eol and no trailing context; no-nl can end up before adds
+	              curRange.splice(hunk.oldLines, 0, '\\ No newline at end of file');
+	            } else if (!oldEOFNewline || !newEOFNewline) {
+	              curRange.push('\\ No newline at end of file');
+	            }
+	          }
+	          hunks.push(hunk);
+
+	          oldRangeStart = 0;
+	          newRangeStart = 0;
+	          curRange = [];
+	        }
+	      }
+	      oldLine += lines.length;
+	      newLine += lines.length;
+	    }
+	  };
+
+	  for (var i = 0; i < diff.length; i++) {
+	    /*istanbul ignore start*/_loop( /*istanbul ignore end*/i);
+	  }
+
+	  return {
+	    oldFileName: oldFileName, newFileName: newFileName,
+	    oldHeader: oldHeader, newHeader: newHeader,
+	    hunks: hunks
+	  };
+	}
+
+	function createTwoFilesPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+	  var diff = structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options);
+
+	  var ret = [];
+	  if (oldFileName == newFileName) {
+	    ret.push('Index: ' + oldFileName);
+	  }
+	  ret.push('===================================================================');
+	  ret.push('--- ' + diff.oldFileName + (typeof diff.oldHeader === 'undefined' ? '' : '\t' + diff.oldHeader));
+	  ret.push('+++ ' + diff.newFileName + (typeof diff.newHeader === 'undefined' ? '' : '\t' + diff.newHeader));
+
+	  for (var i = 0; i < diff.hunks.length; i++) {
+	    var hunk = diff.hunks[i];
+	    ret.push('@@ -' + hunk.oldStart + ',' + hunk.oldLines + ' +' + hunk.newStart + ',' + hunk.newLines + ' @@');
+	    ret.push.apply(ret, hunk.lines);
+	  }
+
+	  return ret.join('\n') + '\n';
+	}
+
+	function createPatch(fileName, oldStr, newStr, oldHeader, newHeader, options) {
+	  return createTwoFilesPatch(fileName, fileName, oldStr, newStr, oldHeader, newHeader, options);
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9jcmVhdGUuanMiXSwibmFtZXMiOlsic3RydWN0dXJlZFBhdGNoIiwiY3JlYXRlVHdvRmlsZXNQYXRjaCIsImNyZWF0ZVBhdGNoIiwib2xkRmlsZU5hbWUiLCJuZXdGaWxlTmFtZSIsIm9sZFN0ciIsIm5ld1N0ciIsIm9sZEhlYWRlciIsIm5ld0hlYWRlciIsIm9wdGlvbnMiLCJjb250ZXh0IiwiZGlmZiIsInB1c2giLCJ2YWx1ZSIsImxpbmVzIiwiY29udGV4dExpbmVzIiwibWFwIiwiZW50cnkiLCJodW5rcyIsIm9sZFJhbmdlU3RhcnQiLCJuZXdSYW5nZVN0YXJ0IiwiY3VyUmFuZ2UiLCJvbGRMaW5lIiwibmV3TGluZSIsImkiLCJjdXJyZW50IiwicmVwbGFjZSIsInNwbGl0IiwiYWRkZWQiLCJyZW1vdmVkIiwicHJldiIsInNsaWNlIiwibGVuZ3RoIiwiY29udGV4dFNpemUiLCJNYXRoIiwibWluIiwiaHVuayIsIm9sZFN0YXJ0Iiwib2xkTGluZXMiLCJuZXdTdGFydCIsIm5ld0xpbmVzIiwib2xkRU9GTmV3bGluZSIsInRlc3QiLCJuZXdFT0ZOZXdsaW5lIiwic3BsaWNlIiwicmV0IiwiYXBwbHkiLCJqb2luIiwiZmlsZU5hbWUiXSwibWFwcGluZ3MiOiI7OztnQ0FFZ0JBLGUsR0FBQUEsZTt5REFpR0FDLG1CLEdBQUFBLG1CO3lEQXdCQUMsVyxHQUFBQSxXOztBQTNIaEI7Ozs7dUJBRU8sU0FBU0YsZUFBVCxDQUF5QkcsV0FBekIsRUFBc0NDLFdBQXRDLEVBQW1EQyxNQUFuRCxFQUEyREMsTUFBM0QsRUFBbUVDLFNBQW5FLEVBQThFQyxTQUE5RSxFQUF5RkMsT0FBekYsRUFBa0c7QUFDdkcsTUFBSSxDQUFDQSxPQUFMLEVBQWM7QUFDWkEsY0FBVSxFQUFWO0FBQ0Q7QUFDRCxNQUFJLE9BQU9BLFFBQVFDLE9BQWYsS0FBMkIsV0FBL0IsRUFBNEM7QUFDMUNELFlBQVFDLE9BQVIsR0FBa0IsQ0FBbEI7QUFDRDs7QUFFRCxNQUFNQyxPQUFPLHNFQUFVTixNQUFWLEVBQWtCQyxNQUFsQixFQUEwQkcsT0FBMUIsQ0FBYjtBQUNBRSxPQUFLQyxJQUFMLENBQVUsRUFBQ0MsT0FBTyxFQUFSLEVBQVlDLE9BQU8sRUFBbkIsRUFBVixFQVR1RyxDQVNsRTs7QUFFckMsV0FBU0MsWUFBVCxDQUFzQkQsS0FBdEIsRUFBNkI7QUFDM0IsV0FBT0EsTUFBTUUsR0FBTixDQUFVLFVBQVNDLEtBQVQsRUFBZ0I7QUFBRSxhQUFPLE1BQU1BLEtBQWI7QUFBcUIsS0FBakQsQ0FBUDtBQUNEOztBQUVELE1BQUlDLFFBQVEsRUFBWjtBQUNBLE1BQUlDLGdCQUFnQixDQUFwQjtBQUFBLE1BQXVCQyxnQkFBZ0IsQ0FBdkM7QUFBQSxNQUEwQ0MsV0FBVyxFQUFyRDtBQUFBLE1BQ0lDLFVBQVUsQ0FEZDtBQUFBLE1BQ2lCQyxVQUFVLENBRDNCOztBQWhCdUcsOEVBa0I5RkMsQ0FsQjhGO0FBbUJyRyxRQUFNQyxVQUFVZCxLQUFLYSxDQUFMLENBQWhCO0FBQUEsUUFDTVYsUUFBUVcsUUFBUVgsS0FBUixJQUFpQlcsUUFBUVosS0FBUixDQUFjYSxPQUFkLENBQXNCLEtBQXRCLEVBQTZCLEVBQTdCLEVBQWlDQyxLQUFqQyxDQUF1QyxJQUF2QyxDQUQvQjtBQUVBRixZQUFRWCxLQUFSLEdBQWdCQSxLQUFoQjs7QUFFQSxRQUFJVyxRQUFRRyxLQUFSLElBQWlCSCxRQUFRSSxPQUE3QixFQUFzQztBQUFBOztBQUFBLDhCQUNwQztBQUNBLFVBQUksQ0FBQ1YsYUFBTCxFQUFvQjtBQUNsQixZQUFNVyxPQUFPbkIsS0FBS2EsSUFBSSxDQUFULENBQWI7QUFDQUwsd0JBQWdCRyxPQUFoQjtBQUNBRix3QkFBZ0JHLE9BQWhCOztBQUVBLFlBQUlPLElBQUosRUFBVTtBQUNSVCxxQkFBV1osUUFBUUMsT0FBUixHQUFrQixDQUFsQixHQUFzQkssYUFBYWUsS0FBS2hCLEtBQUwsQ0FBV2lCLEtBQVgsQ0FBaUIsQ0FBQ3RCLFFBQVFDLE9BQTFCLENBQWIsQ0FBdEIsR0FBeUUsRUFBcEY7QUFDQVMsMkJBQWlCRSxTQUFTVyxNQUExQjtBQUNBWiwyQkFBaUJDLFNBQVNXLE1BQTFCO0FBQ0Q7QUFDRjs7QUFFRDtBQUNBLDZFQUFTcEIsSUFBVCwwTEFBa0JFLE1BQU1FLEdBQU4sQ0FBVSxVQUFTQyxLQUFULEVBQWdCO0FBQzFDLGVBQU8sQ0FBQ1EsUUFBUUcsS0FBUixHQUFnQixHQUFoQixHQUFzQixHQUF2QixJQUE4QlgsS0FBckM7QUFDRCxPQUZpQixDQUFsQjs7QUFJQTtBQUNBLFVBQUlRLFFBQVFHLEtBQVosRUFBbUI7QUFDakJMLG1CQUFXVCxNQUFNa0IsTUFBakI7QUFDRCxPQUZELE1BRU87QUFDTFYsbUJBQVdSLE1BQU1rQixNQUFqQjtBQUNEO0FBQ0YsS0F6QkQsTUF5Qk87QUFDTDtBQUNBLFVBQUliLGFBQUosRUFBbUI7QUFDakI7QUFDQSxZQUFJTCxNQUFNa0IsTUFBTixJQUFnQnZCLFFBQVFDLE9BQVIsR0FBa0IsQ0FBbEMsSUFBdUNjLElBQUliLEtBQUtxQixNQUFMLEdBQWMsQ0FBN0QsRUFBZ0U7QUFBQTs7QUFBQSxrQ0FDOUQ7QUFDQSxrRkFBU3BCLElBQVQsMkxBQWtCRyxhQUFhRCxLQUFiLENBQWxCO0FBQ0QsU0FIRCxNQUdPO0FBQUE7O0FBQUEsa0NBQ0w7QUFDQSxjQUFJbUIsY0FBY0MsS0FBS0MsR0FBTCxDQUFTckIsTUFBTWtCLE1BQWYsRUFBdUJ2QixRQUFRQyxPQUEvQixDQUFsQjtBQUNBLGtGQUFTRSxJQUFULDJMQUFrQkcsYUFBYUQsTUFBTWlCLEtBQU4sQ0FBWSxDQUFaLEVBQWVFLFdBQWYsQ0FBYixDQUFsQjs7QUFFQSxjQUFJRyxPQUFPO0FBQ1RDLHNCQUFVbEIsYUFERDtBQUVUbUIsc0JBQVdoQixVQUFVSCxhQUFWLEdBQTBCYyxXQUY1QjtBQUdUTSxzQkFBVW5CLGFBSEQ7QUFJVG9CLHNCQUFXakIsVUFBVUgsYUFBVixHQUEwQmEsV0FKNUI7QUFLVG5CLG1CQUFPTztBQUxFLFdBQVg7QUFPQSxjQUFJRyxLQUFLYixLQUFLcUIsTUFBTCxHQUFjLENBQW5CLElBQXdCbEIsTUFBTWtCLE1BQU4sSUFBZ0J2QixRQUFRQyxPQUFwRCxFQUE2RDtBQUMzRDtBQUNBLGdCQUFJK0IsZ0JBQWlCLE1BQU1DLElBQU4sQ0FBV3JDLE1BQVgsQ0FBckI7QUFDQSxnQkFBSXNDLGdCQUFpQixNQUFNRCxJQUFOLENBQVdwQyxNQUFYLENBQXJCO0FBQ0EsZ0JBQUlRLE1BQU1rQixNQUFOLElBQWdCLENBQWhCLElBQXFCLENBQUNTLGFBQTFCLEVBQXlDO0FBQ3ZDO0FBQ0FwQix1QkFBU3VCLE1BQVQsQ0FBZ0JSLEtBQUtFLFFBQXJCLEVBQStCLENBQS9CLEVBQWtDLDhCQUFsQztBQUNELGFBSEQsTUFHTyxJQUFJLENBQUNHLGFBQUQsSUFBa0IsQ0FBQ0UsYUFBdkIsRUFBc0M7QUFDM0N0Qix1QkFBU1QsSUFBVCxDQUFjLDhCQUFkO0FBQ0Q7QUFDRjtBQUNETSxnQkFBTU4sSUFBTixDQUFXd0IsSUFBWDs7QUFFQWpCLDBCQUFnQixDQUFoQjtBQUNBQywwQkFBZ0IsQ0FBaEI7QUFDQUMscUJBQVcsRUFBWDtBQUNEO0FBQ0Y7QUFDREMsaUJBQVdSLE1BQU1rQixNQUFqQjtBQUNBVCxpQkFBV1QsTUFBTWtCLE1BQWpCO0FBQ0Q7QUF2Rm9HOztBQWtCdkcsT0FBSyxJQUFJUixJQUFJLENBQWIsRUFBZ0JBLElBQUliLEtBQUtxQixNQUF6QixFQUFpQ1IsR0FBakMsRUFBc0M7QUFBQSwyREFBN0JBLENBQTZCO0FBc0VyQzs7QUFFRCxTQUFPO0FBQ0xyQixpQkFBYUEsV0FEUixFQUNxQkMsYUFBYUEsV0FEbEM7QUFFTEcsZUFBV0EsU0FGTixFQUVpQkMsV0FBV0EsU0FGNUI7QUFHTFUsV0FBT0E7QUFIRixHQUFQO0FBS0Q7O0FBRU0sU0FBU2pCLG1CQUFULENBQTZCRSxXQUE3QixFQUEwQ0MsV0FBMUMsRUFBdURDLE1BQXZELEVBQStEQyxNQUEvRCxFQUF1RUMsU0FBdkUsRUFBa0ZDLFNBQWxGLEVBQTZGQyxPQUE3RixFQUFzRztBQUMzRyxNQUFNRSxPQUFPWCxnQkFBZ0JHLFdBQWhCLEVBQTZCQyxXQUE3QixFQUEwQ0MsTUFBMUMsRUFBa0RDLE1BQWxELEVBQTBEQyxTQUExRCxFQUFxRUMsU0FBckUsRUFBZ0ZDLE9BQWhGLENBQWI7O0FBRUEsTUFBTW9DLE1BQU0sRUFBWjtBQUNBLE1BQUkxQyxlQUFlQyxXQUFuQixFQUFnQztBQUM5QnlDLFFBQUlqQyxJQUFKLENBQVMsWUFBWVQsV0FBckI7QUFDRDtBQUNEMEMsTUFBSWpDLElBQUosQ0FBUyxxRUFBVDtBQUNBaUMsTUFBSWpDLElBQUosQ0FBUyxTQUFTRCxLQUFLUixXQUFkLElBQTZCLE9BQU9RLEtBQUtKLFNBQVosS0FBMEIsV0FBMUIsR0FBd0MsRUFBeEMsR0FBNkMsT0FBT0ksS0FBS0osU0FBdEYsQ0FBVDtBQUNBc0MsTUFBSWpDLElBQUosQ0FBUyxTQUFTRCxLQUFLUCxXQUFkLElBQTZCLE9BQU9PLEtBQUtILFNBQVosS0FBMEIsV0FBMUIsR0FBd0MsRUFBeEMsR0FBNkMsT0FBT0csS0FBS0gsU0FBdEYsQ0FBVDs7QUFFQSxPQUFLLElBQUlnQixJQUFJLENBQWIsRUFBZ0JBLElBQUliLEtBQUtPLEtBQUwsQ0FBV2MsTUFBL0IsRUFBdUNSLEdBQXZDLEVBQTRDO0FBQzFDLFFBQU1ZLE9BQU96QixLQUFLTyxLQUFMLENBQVdNLENBQVgsQ0FBYjtBQUNBcUIsUUFBSWpDLElBQUosQ0FDRSxTQUFTd0IsS0FBS0MsUUFBZCxHQUF5QixHQUF6QixHQUErQkQsS0FBS0UsUUFBcEMsR0FDRSxJQURGLEdBQ1NGLEtBQUtHLFFBRGQsR0FDeUIsR0FEekIsR0FDK0JILEtBQUtJLFFBRHBDLEdBRUUsS0FISjtBQUtBSyxRQUFJakMsSUFBSixDQUFTa0MsS0FBVCxDQUFlRCxHQUFmLEVBQW9CVCxLQUFLdEIsS0FBekI7QUFDRDs7QUFFRCxTQUFPK0IsSUFBSUUsSUFBSixDQUFTLElBQVQsSUFBaUIsSUFBeEI7QUFDRDs7QUFFTSxTQUFTN0MsV0FBVCxDQUFxQjhDLFFBQXJCLEVBQStCM0MsTUFBL0IsRUFBdUNDLE1BQXZDLEVBQStDQyxTQUEvQyxFQUEwREMsU0FBMUQsRUFBcUVDLE9BQXJFLEVBQThFO0FBQ25GLFNBQU9SLG9CQUFvQitDLFFBQXBCLEVBQThCQSxRQUE5QixFQUF3QzNDLE1BQXhDLEVBQWdEQyxNQUFoRCxFQUF3REMsU0FBeEQsRUFBbUVDLFNBQW5FLEVBQThFQyxPQUE5RSxDQUFQO0FBQ0QiLCJmaWxlIjoiY3JlYXRlLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IHtkaWZmTGluZXN9IGZyb20gJy4uL2RpZmYvbGluZSc7XG5cbmV4cG9ydCBmdW5jdGlvbiBzdHJ1Y3R1cmVkUGF0Y2gob2xkRmlsZU5hbWUsIG5ld0ZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpIHtcbiAgaWYgKCFvcHRpb25zKSB7XG4gICAgb3B0aW9ucyA9IHt9O1xuICB9XG4gIGlmICh0eXBlb2Ygb3B0aW9ucy5jb250ZXh0ID09PSAndW5kZWZpbmVkJykge1xuICAgIG9wdGlvbnMuY29udGV4dCA9IDQ7XG4gIH1cblxuICBjb25zdCBkaWZmID0gZGlmZkxpbmVzKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbiAgZGlmZi5wdXNoKHt2YWx1ZTogJycsIGxpbmVzOiBbXX0pOyAgIC8vIEFwcGVuZCBhbiBlbXB0eSB2YWx1ZSB0byBtYWtlIGNsZWFudXAgZWFzaWVyXG5cbiAgZnVuY3Rpb24gY29udGV4dExpbmVzKGxpbmVzKSB7XG4gICAgcmV0dXJuIGxpbmVzLm1hcChmdW5jdGlvbihlbnRyeSkgeyByZXR1cm4gJyAnICsgZW50cnk7IH0pO1xuICB9XG5cbiAgbGV0IGh1bmtzID0gW107XG4gIGxldCBvbGRSYW5nZVN0YXJ0ID0gMCwgbmV3UmFuZ2VTdGFydCA9IDAsIGN1clJhbmdlID0gW10sXG4gICAgICBvbGRMaW5lID0gMSwgbmV3TGluZSA9IDE7XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgZGlmZi5sZW5ndGg7IGkrKykge1xuICAgIGNvbnN0IGN1cnJlbnQgPSBkaWZmW2ldLFxuICAgICAgICAgIGxpbmVzID0gY3VycmVudC5saW5lcyB8fCBjdXJyZW50LnZhbHVlLnJlcGxhY2UoL1xcbiQvLCAnJykuc3BsaXQoJ1xcbicpO1xuICAgIGN1cnJlbnQubGluZXMgPSBsaW5lcztcblxuICAgIGlmIChjdXJyZW50LmFkZGVkIHx8IGN1cnJlbnQucmVtb3ZlZCkge1xuICAgICAgLy8gSWYgd2UgaGF2ZSBwcmV2aW91cyBjb250ZXh0LCBzdGFydCB3aXRoIHRoYXRcbiAgICAgIGlmICghb2xkUmFuZ2VTdGFydCkge1xuICAgICAgICBjb25zdCBwcmV2ID0gZGlmZltpIC0gMV07XG4gICAgICAgIG9sZFJhbmdlU3RhcnQgPSBvbGRMaW5lO1xuICAgICAgICBuZXdSYW5nZVN0YXJ0ID0gbmV3TGluZTtcblxuICAgICAgICBpZiAocHJldikge1xuICAgICAgICAgIGN1clJhbmdlID0gb3B0aW9ucy5jb250ZXh0ID4gMCA/IGNvbnRleHRMaW5lcyhwcmV2LmxpbmVzLnNsaWNlKC1vcHRpb25zLmNvbnRleHQpKSA6IFtdO1xuICAgICAgICAgIG9sZFJhbmdlU3RhcnQgLT0gY3VyUmFuZ2UubGVuZ3RoO1xuICAgICAgICAgIG5ld1JhbmdlU3RhcnQgLT0gY3VyUmFuZ2UubGVuZ3RoO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIC8vIE91dHB1dCBvdXIgY2hhbmdlc1xuICAgICAgY3VyUmFuZ2UucHVzaCguLi4gbGluZXMubWFwKGZ1bmN0aW9uKGVudHJ5KSB7XG4gICAgICAgIHJldHVybiAoY3VycmVudC5hZGRlZCA/ICcrJyA6ICctJykgKyBlbnRyeTtcbiAgICAgIH0pKTtcblxuICAgICAgLy8gVHJhY2sgdGhlIHVwZGF0ZWQgZmlsZSBwb3NpdGlvblxuICAgICAgaWYgKGN1cnJlbnQuYWRkZWQpIHtcbiAgICAgICAgbmV3TGluZSArPSBsaW5lcy5sZW5ndGg7XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBvbGRMaW5lICs9IGxpbmVzLmxlbmd0aDtcbiAgICAgIH1cbiAgICB9IGVsc2Uge1xuICAgICAgLy8gSWRlbnRpY2FsIGNvbnRleHQgbGluZXMuIFRyYWNrIGxpbmUgY2hhbmdlc1xuICAgICAgaWYgKG9sZFJhbmdlU3RhcnQpIHtcbiAgICAgICAgLy8gQ2xvc2Ugb3V0IGFueSBjaGFuZ2VzIHRoYXQgaGF2ZSBiZWVuIG91dHB1dCAob3Igam9pbiBvdmVybGFwcGluZylcbiAgICAgICAgaWYgKGxpbmVzLmxlbmd0aCA8PSBvcHRpb25zLmNvbnRleHQgKiAyICYmIGkgPCBkaWZmLmxlbmd0aCAtIDIpIHtcbiAgICAgICAgICAvLyBPdmVybGFwcGluZ1xuICAgICAgICAgIGN1clJhbmdlLnB1c2goLi4uIGNvbnRleHRMaW5lcyhsaW5lcykpO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIGVuZCB0aGUgcmFuZ2UgYW5kIG91dHB1dFxuICAgICAgICAgIGxldCBjb250ZXh0U2l6ZSA9IE1hdGgubWluKGxpbmVzLmxlbmd0aCwgb3B0aW9ucy5jb250ZXh0KTtcbiAgICAgICAgICBjdXJSYW5nZS5wdXNoKC4uLiBjb250ZXh0TGluZXMobGluZXMuc2xpY2UoMCwgY29udGV4dFNpemUpKSk7XG5cbiAgICAgICAgICBsZXQgaHVuayA9IHtcbiAgICAgICAgICAgIG9sZFN0YXJ0OiBvbGRSYW5nZVN0YXJ0LFxuICAgICAgICAgICAgb2xkTGluZXM6IChvbGRMaW5lIC0gb2xkUmFuZ2VTdGFydCArIGNvbnRleHRTaXplKSxcbiAgICAgICAgICAgIG5ld1N0YXJ0OiBuZXdSYW5nZVN0YXJ0LFxuICAgICAgICAgICAgbmV3TGluZXM6IChuZXdMaW5lIC0gbmV3UmFuZ2VTdGFydCArIGNvbnRleHRTaXplKSxcbiAgICAgICAgICAgIGxpbmVzOiBjdXJSYW5nZVxuICAgICAgICAgIH07XG4gICAgICAgICAgaWYgKGkgPj0gZGlmZi5sZW5ndGggLSAyICYmIGxpbmVzLmxlbmd0aCA8PSBvcHRpb25zLmNvbnRleHQpIHtcbiAgICAgICAgICAgIC8vIEVPRiBpcyBpbnNpZGUgdGhpcyBodW5rXG4gICAgICAgICAgICBsZXQgb2xkRU9GTmV3bGluZSA9ICgvXFxuJC8udGVzdChvbGRTdHIpKTtcbiAgICAgICAgICAgIGxldCBuZXdFT0ZOZXdsaW5lID0gKC9cXG4kLy50ZXN0KG5ld1N0cikpO1xuICAgICAgICAgICAgaWYgKGxpbmVzLmxlbmd0aCA9PSAwICYmICFvbGRFT0ZOZXdsaW5lKSB7XG4gICAgICAgICAgICAgIC8vIHNwZWNpYWwgY2FzZTogb2xkIGhhcyBubyBlb2wgYW5kIG5vIHRyYWlsaW5nIGNvbnRleHQ7IG5vLW5sIGNhbiBlbmQgdXAgYmVmb3JlIGFkZHNcbiAgICAgICAgICAgICAgY3VyUmFuZ2Uuc3BsaWNlKGh1bmsub2xkTGluZXMsIDAsICdcXFxcIE5vIG5ld2xpbmUgYXQgZW5kIG9mIGZpbGUnKTtcbiAgICAgICAgICAgIH0gZWxzZSBpZiAoIW9sZEVPRk5ld2xpbmUgfHwgIW5ld0VPRk5ld2xpbmUpIHtcbiAgICAgICAgICAgICAgY3VyUmFuZ2UucHVzaCgnXFxcXCBObyBuZXdsaW5lIGF0IGVuZCBvZiBmaWxlJyk7XG4gICAgICAgICAgICB9XG4gICAgICAgICAgfVxuICAgICAgICAgIGh1bmtzLnB1c2goaHVuayk7XG5cbiAgICAgICAgICBvbGRSYW5nZVN0YXJ0ID0gMDtcbiAgICAgICAgICBuZXdSYW5nZVN0YXJ0ID0gMDtcbiAgICAgICAgICBjdXJSYW5nZSA9IFtdO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgICBvbGRMaW5lICs9IGxpbmVzLmxlbmd0aDtcbiAgICAgIG5ld0xpbmUgKz0gbGluZXMubGVuZ3RoO1xuICAgIH1cbiAgfVxuXG4gIHJldHVybiB7XG4gICAgb2xkRmlsZU5hbWU6IG9sZEZpbGVOYW1lLCBuZXdGaWxlTmFtZTogbmV3RmlsZU5hbWUsXG4gICAgb2xkSGVhZGVyOiBvbGRIZWFkZXIsIG5ld0hlYWRlcjogbmV3SGVhZGVyLFxuICAgIGh1bmtzOiBodW5rc1xuICB9O1xufVxuXG5leHBvcnQgZnVuY3Rpb24gY3JlYXRlVHdvRmlsZXNQYXRjaChvbGRGaWxlTmFtZSwgbmV3RmlsZU5hbWUsIG9sZFN0ciwgbmV3U3RyLCBvbGRIZWFkZXIsIG5ld0hlYWRlciwgb3B0aW9ucykge1xuICBjb25zdCBkaWZmID0gc3RydWN0dXJlZFBhdGNoKG9sZEZpbGVOYW1lLCBuZXdGaWxlTmFtZSwgb2xkU3RyLCBuZXdTdHIsIG9sZEhlYWRlciwgbmV3SGVhZGVyLCBvcHRpb25zKTtcblxuICBjb25zdCByZXQgPSBbXTtcbiAgaWYgKG9sZEZpbGVOYW1lID09IG5ld0ZpbGVOYW1lKSB7XG4gICAgcmV0LnB1c2goJ0luZGV4OiAnICsgb2xkRmlsZU5hbWUpO1xuICB9XG4gIHJldC5wdXNoKCc9PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09Jyk7XG4gIHJldC5wdXNoKCctLS0gJyArIGRpZmYub2xkRmlsZU5hbWUgKyAodHlwZW9mIGRpZmYub2xkSGVhZGVyID09PSAndW5kZWZpbmVkJyA/ICcnIDogJ1xcdCcgKyBkaWZmLm9sZEhlYWRlcikpO1xuICByZXQucHVzaCgnKysrICcgKyBkaWZmLm5ld0ZpbGVOYW1lICsgKHR5cGVvZiBkaWZmLm5ld0hlYWRlciA9PT0gJ3VuZGVmaW5lZCcgPyAnJyA6ICdcXHQnICsgZGlmZi5uZXdIZWFkZXIpKTtcblxuICBmb3IgKGxldCBpID0gMDsgaSA8IGRpZmYuaHVua3MubGVuZ3RoOyBpKyspIHtcbiAgICBjb25zdCBodW5rID0gZGlmZi5odW5rc1tpXTtcbiAgICByZXQucHVzaChcbiAgICAgICdAQCAtJyArIGh1bmsub2xkU3RhcnQgKyAnLCcgKyBodW5rLm9sZExpbmVzXG4gICAgICArICcgKycgKyBodW5rLm5ld1N0YXJ0ICsgJywnICsgaHVuay5uZXdMaW5lc1xuICAgICAgKyAnIEBAJ1xuICAgICk7XG4gICAgcmV0LnB1c2guYXBwbHkocmV0LCBodW5rLmxpbmVzKTtcbiAgfVxuXG4gIHJldHVybiByZXQuam9pbignXFxuJykgKyAnXFxuJztcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGNyZWF0ZVBhdGNoKGZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpIHtcbiAgcmV0dXJuIGNyZWF0ZVR3b0ZpbGVzUGF0Y2goZmlsZU5hbWUsIGZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpO1xufVxuIl19
+
+
+/***/ }),
+/* 15 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/"use strict";
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/arrayEqual = arrayEqual;
+	/*istanbul ignore start*/exports. /*istanbul ignore end*/arrayStartsWith = arrayStartsWith;
+	function arrayEqual(a, b) {
+	  if (a.length !== b.length) {
+	    return false;
+	  }
+
+	  return arrayStartsWith(a, b);
+	}
+
+	function arrayStartsWith(array, start) {
+	  if (start.length > array.length) {
+	    return false;
+	  }
+
+	  for (var i = 0; i < start.length; i++) {
+	    if (start[i] !== array[i]) {
+	      return false;
+	    }
+	  }
+
+	  return true;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL2FycmF5LmpzIl0sIm5hbWVzIjpbImFycmF5RXF1YWwiLCJhcnJheVN0YXJ0c1dpdGgiLCJhIiwiYiIsImxlbmd0aCIsImFycmF5Iiwic3RhcnQiLCJpIl0sIm1hcHBpbmdzIjoiOzs7Z0NBQWdCQSxVLEdBQUFBLFU7eURBUUFDLGUsR0FBQUEsZTtBQVJULFNBQVNELFVBQVQsQ0FBb0JFLENBQXBCLEVBQXVCQyxDQUF2QixFQUEwQjtBQUMvQixNQUFJRCxFQUFFRSxNQUFGLEtBQWFELEVBQUVDLE1BQW5CLEVBQTJCO0FBQ3pCLFdBQU8sS0FBUDtBQUNEOztBQUVELFNBQU9ILGdCQUFnQkMsQ0FBaEIsRUFBbUJDLENBQW5CLENBQVA7QUFDRDs7QUFFTSxTQUFTRixlQUFULENBQXlCSSxLQUF6QixFQUFnQ0MsS0FBaEMsRUFBdUM7QUFDNUMsTUFBSUEsTUFBTUYsTUFBTixHQUFlQyxNQUFNRCxNQUF6QixFQUFpQztBQUMvQixXQUFPLEtBQVA7QUFDRDs7QUFFRCxPQUFLLElBQUlHLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsTUFBTUYsTUFBMUIsRUFBa0NHLEdBQWxDLEVBQXVDO0FBQ3JDLFFBQUlELE1BQU1DLENBQU4sTUFBYUYsTUFBTUUsQ0FBTixDQUFqQixFQUEyQjtBQUN6QixhQUFPLEtBQVA7QUFDRDtBQUNGOztBQUVELFNBQU8sSUFBUDtBQUNEIiwiZmlsZSI6ImFycmF5LmpzIiwic291cmNlc0NvbnRlbnQiOlsiZXhwb3J0IGZ1bmN0aW9uIGFycmF5RXF1YWwoYSwgYikge1xuICBpZiAoYS5sZW5ndGggIT09IGIubGVuZ3RoKSB7XG4gICAgcmV0dXJuIGZhbHNlO1xuICB9XG5cbiAgcmV0dXJuIGFycmF5U3RhcnRzV2l0aChhLCBiKTtcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGFycmF5U3RhcnRzV2l0aChhcnJheSwgc3RhcnQpIHtcbiAgaWYgKHN0YXJ0Lmxlbmd0aCA+IGFycmF5Lmxlbmd0aCkge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgc3RhcnQubGVuZ3RoOyBpKyspIHtcbiAgICBpZiAoc3RhcnRbaV0gIT09IGFycmF5W2ldKSB7XG4gICAgICByZXR1cm4gZmFsc2U7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIHRydWU7XG59XG4iXX0=
+
+
+/***/ }),
+/* 16 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/"use strict";
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/convertChangesToDMP = convertChangesToDMP;
+	// See: http://code.google.com/p/google-diff-match-patch/wiki/API
+	function convertChangesToDMP(changes) {
+	  var ret = [],
+	      change = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+	      operation = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+	  for (var i = 0; i < changes.length; i++) {
+	    change = changes[i];
+	    if (change.added) {
+	      operation = 1;
+	    } else if (change.removed) {
+	      operation = -1;
+	    } else {
+	      operation = 0;
+	    }
+
+	    ret.push([operation, change.value]);
+	  }
+	  return ret;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9jb252ZXJ0L2RtcC5qcyJdLCJuYW1lcyI6WyJjb252ZXJ0Q2hhbmdlc1RvRE1QIiwiY2hhbmdlcyIsInJldCIsImNoYW5nZSIsIm9wZXJhdGlvbiIsImkiLCJsZW5ndGgiLCJhZGRlZCIsInJlbW92ZWQiLCJwdXNoIiwidmFsdWUiXSwibWFwcGluZ3MiOiI7OztnQ0FDZ0JBLG1CLEdBQUFBLG1CO0FBRGhCO0FBQ08sU0FBU0EsbUJBQVQsQ0FBNkJDLE9BQTdCLEVBQXNDO0FBQzNDLE1BQUlDLE1BQU0sRUFBVjtBQUFBLE1BQ0lDLHdDQURKO0FBQUEsTUFFSUMsMkNBRko7QUFHQSxPQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUosUUFBUUssTUFBNUIsRUFBb0NELEdBQXBDLEVBQXlDO0FBQ3ZDRixhQUFTRixRQUFRSSxDQUFSLENBQVQ7QUFDQSxRQUFJRixPQUFPSSxLQUFYLEVBQWtCO0FBQ2hCSCxrQkFBWSxDQUFaO0FBQ0QsS0FGRCxNQUVPLElBQUlELE9BQU9LLE9BQVgsRUFBb0I7QUFDekJKLGtCQUFZLENBQUMsQ0FBYjtBQUNELEtBRk0sTUFFQTtBQUNMQSxrQkFBWSxDQUFaO0FBQ0Q7O0FBRURGLFFBQUlPLElBQUosQ0FBUyxDQUFDTCxTQUFELEVBQVlELE9BQU9PLEtBQW5CLENBQVQ7QUFDRDtBQUNELFNBQU9SLEdBQVA7QUFDRCIsImZpbGUiOiJkbXAuanMiLCJzb3VyY2VzQ29udGVudCI6WyIvLyBTZWU6IGh0dHA6Ly9jb2RlLmdvb2dsZS5jb20vcC9nb29nbGUtZGlmZi1tYXRjaC1wYXRjaC93aWtpL0FQSVxuZXhwb3J0IGZ1bmN0aW9uIGNvbnZlcnRDaGFuZ2VzVG9ETVAoY2hhbmdlcykge1xuICBsZXQgcmV0ID0gW10sXG4gICAgICBjaGFuZ2UsXG4gICAgICBvcGVyYXRpb247XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgY2hhbmdlcy5sZW5ndGg7IGkrKykge1xuICAgIGNoYW5nZSA9IGNoYW5nZXNbaV07XG4gICAgaWYgKGNoYW5nZS5hZGRlZCkge1xuICAgICAgb3BlcmF0aW9uID0gMTtcbiAgICB9IGVsc2UgaWYgKGNoYW5nZS5yZW1vdmVkKSB7XG4gICAgICBvcGVyYXRpb24gPSAtMTtcbiAgICB9IGVsc2Uge1xuICAgICAgb3BlcmF0aW9uID0gMDtcbiAgICB9XG5cbiAgICByZXQucHVzaChbb3BlcmF0aW9uLCBjaGFuZ2UudmFsdWVdKTtcbiAgfVxuICByZXR1cm4gcmV0O1xufVxuIl19
+
+
+/***/ }),
+/* 17 */
+/***/ (function(module, exports) {
+
+	/*istanbul ignore start*/'use strict';
+
+	exports.__esModule = true;
+	exports. /*istanbul ignore end*/convertChangesToXML = convertChangesToXML;
+	function convertChangesToXML(changes) {
+	  var ret = [];
+	  for (var i = 0; i < changes.length; i++) {
+	    var change = changes[i];
+	    if (change.added) {
+	      ret.push('<ins>');
+	    } else if (change.removed) {
+	      ret.push('<del>');
+	    }
+
+	    ret.push(escapeHTML(change.value));
+
+	    if (change.added) {
+	      ret.push('</ins>');
+	    } else if (change.removed) {
+	      ret.push('</del>');
+	    }
+	  }
+	  return ret.join('');
+	}
+
+	function escapeHTML(s) {
+	  var n = s;
+	  n = n.replace(/&/g, '&amp;');
+	  n = n.replace(/</g, '&lt;');
+	  n = n.replace(/>/g, '&gt;');
+	  n = n.replace(/"/g, '&quot;');
+
+	  return n;
+	}
+	//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9jb252ZXJ0L3htbC5qcyJdLCJuYW1lcyI6WyJjb252ZXJ0Q2hhbmdlc1RvWE1MIiwiY2hhbmdlcyIsInJldCIsImkiLCJsZW5ndGgiLCJjaGFuZ2UiLCJhZGRlZCIsInB1c2giLCJyZW1vdmVkIiwiZXNjYXBlSFRNTCIsInZhbHVlIiwiam9pbiIsInMiLCJuIiwicmVwbGFjZSJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsbUIsR0FBQUEsbUI7QUFBVCxTQUFTQSxtQkFBVCxDQUE2QkMsT0FBN0IsRUFBc0M7QUFDM0MsTUFBSUMsTUFBTSxFQUFWO0FBQ0EsT0FBSyxJQUFJQyxJQUFJLENBQWIsRUFBZ0JBLElBQUlGLFFBQVFHLE1BQTVCLEVBQW9DRCxHQUFwQyxFQUF5QztBQUN2QyxRQUFJRSxTQUFTSixRQUFRRSxDQUFSLENBQWI7QUFDQSxRQUFJRSxPQUFPQyxLQUFYLEVBQWtCO0FBQ2hCSixVQUFJSyxJQUFKLENBQVMsT0FBVDtBQUNELEtBRkQsTUFFTyxJQUFJRixPQUFPRyxPQUFYLEVBQW9CO0FBQ3pCTixVQUFJSyxJQUFKLENBQVMsT0FBVDtBQUNEOztBQUVETCxRQUFJSyxJQUFKLENBQVNFLFdBQVdKLE9BQU9LLEtBQWxCLENBQVQ7O0FBRUEsUUFBSUwsT0FBT0MsS0FBWCxFQUFrQjtBQUNoQkosVUFBSUssSUFBSixDQUFTLFFBQVQ7QUFDRCxLQUZELE1BRU8sSUFBSUYsT0FBT0csT0FBWCxFQUFvQjtBQUN6Qk4sVUFBSUssSUFBSixDQUFTLFFBQVQ7QUFDRDtBQUNGO0FBQ0QsU0FBT0wsSUFBSVMsSUFBSixDQUFTLEVBQVQsQ0FBUDtBQUNEOztBQUVELFNBQVNGLFVBQVQsQ0FBb0JHLENBQXBCLEVBQXVCO0FBQ3JCLE1BQUlDLElBQUlELENBQVI7QUFDQUMsTUFBSUEsRUFBRUMsT0FBRixDQUFVLElBQVYsRUFBZ0IsT0FBaEIsQ0FBSjtBQUNBRCxNQUFJQSxFQUFFQyxPQUFGLENBQVUsSUFBVixFQUFnQixNQUFoQixDQUFKO0FBQ0FELE1BQUlBLEVBQUVDLE9BQUYsQ0FBVSxJQUFWLEVBQWdCLE1BQWhCLENBQUo7QUFDQUQsTUFBSUEsRUFBRUMsT0FBRixDQUFVLElBQVYsRUFBZ0IsUUFBaEIsQ0FBSjs7QUFFQSxTQUFPRCxDQUFQO0FBQ0QiLCJmaWxlIjoieG1sLmpzIiwic291cmNlc0NvbnRlbnQiOlsiZXhwb3J0IGZ1bmN0aW9uIGNvbnZlcnRDaGFuZ2VzVG9YTUwoY2hhbmdlcykge1xuICBsZXQgcmV0ID0gW107XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgY2hhbmdlcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBjaGFuZ2UgPSBjaGFuZ2VzW2ldO1xuICAgIGlmIChjaGFuZ2UuYWRkZWQpIHtcbiAgICAgIHJldC5wdXNoKCc8aW5zPicpO1xuICAgIH0gZWxzZSBpZiAoY2hhbmdlLnJlbW92ZWQpIHtcbiAgICAgIHJldC5wdXNoKCc8ZGVsPicpO1xuICAgIH1cblxuICAgIHJldC5wdXNoKGVzY2FwZUhUTUwoY2hhbmdlLnZhbHVlKSk7XG5cbiAgICBpZiAoY2hhbmdlLmFkZGVkKSB7XG4gICAgICByZXQucHVzaCgnPC9pbnM+Jyk7XG4gICAgfSBlbHNlIGlmIChjaGFuZ2UucmVtb3ZlZCkge1xuICAgICAgcmV0LnB1c2goJzwvZGVsPicpO1xuICAgIH1cbiAgfVxuICByZXR1cm4gcmV0LmpvaW4oJycpO1xufVxuXG5mdW5jdGlvbiBlc2NhcGVIVE1MKHMpIHtcbiAgbGV0IG4gPSBzO1xuICBuID0gbi5yZXBsYWNlKC8mL2csICcmYW1wOycpO1xuICBuID0gbi5yZXBsYWNlKC88L2csICcmbHQ7Jyk7XG4gIG4gPSBuLnJlcGxhY2UoLz4vZywgJyZndDsnKTtcbiAgbiA9IG4ucmVwbGFjZSgvXCIvZywgJyZxdW90OycpO1xuXG4gIHJldHVybiBuO1xufVxuIl19
+
+
+/***/ })
+/******/ ])
+});
+;
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/dist/diff.min.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/dist/diff.min.js
new file mode 100644
index 00000000000..5049f84871b
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/dist/diff.min.js
@@ -0,0 +1,416 @@
+/*!
+
+ diff v3.5.0
+
+Software License Agreement (BSD License)
+
+Copyright (c) 2009-2015, Kevin Decker <kpdecker@gmail.com>
+
+All rights reserved.
+
+Redistribution and use of this software in source and binary forms, with or without modification,
+are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above
+  copyright notice, this list of conditions and the
+  following disclaimer.
+
+* Redistributions in binary form must reproduce the above
+  copyright notice, this list of conditions and the
+  following disclaimer in the documentation and/or other
+  materials provided with the distribution.
+
+* Neither the name of Kevin Decker nor the names of its
+  contributors may be used to endorse or promote products
+  derived from this software without specific prior
+  written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND
+FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR
+CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER
+IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT
+OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+@license
+*/
+!function(a,b){"object"==typeof exports&&"object"==typeof module?module.exports=b():"function"==typeof define&&define.amd?define([],b):"object"==typeof exports?exports.JsDiff=b():a.JsDiff=b()}(this,function(){/******/
+return function(a){/******/
+// The require function
+/******/
+function b(d){/******/
+// Check if module is in cache
+/******/
+if(c[d])/******/
+return c[d].exports;/******/
+// Create a new module (and put it into the cache)
+/******/
+var e=c[d]={/******/
+exports:{},/******/
+id:d,/******/
+loaded:!1};/******/
+// Return the exports of the module
+/******/
+/******/
+// Execute the module function
+/******/
+/******/
+// Flag the module as loaded
+/******/
+return a[d].call(e.exports,e,e.exports,b),e.loaded=!0,e.exports}// webpackBootstrap
+/******/
+// The module cache
+/******/
+var c={};/******/
+// Load entry module and return exports
+/******/
+/******/
+// expose the modules object (__webpack_modules__)
+/******/
+/******/
+// expose the module cache
+/******/
+/******/
+// __webpack_public_path__
+/******/
+return b.m=a,b.c=c,b.p="",b(0)}([/* 0 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";/*istanbul ignore start*/
+function d(a){return a&&a.__esModule?a:{"default":a}}b.__esModule=!0,b.canonicalize=b.convertChangesToXML=b.convertChangesToDMP=b.merge=b.parsePatch=b.applyPatches=b.applyPatch=b.createPatch=b.createTwoFilesPatch=b.structuredPatch=b.diffArrays=b.diffJson=b.diffCss=b.diffSentences=b.diffTrimmedLines=b.diffLines=b.diffWordsWithSpace=b.diffWords=b.diffChars=b.Diff=void 0;/*istanbul ignore end*/
+var/*istanbul ignore start*/e=c(1),f=d(e),/*istanbul ignore start*/g=c(2),/*istanbul ignore start*/h=c(3),/*istanbul ignore start*/i=c(5),/*istanbul ignore start*/j=c(6),/*istanbul ignore start*/k=c(7),/*istanbul ignore start*/l=c(8),/*istanbul ignore start*/m=c(9),/*istanbul ignore start*/n=c(10),/*istanbul ignore start*/o=c(11),/*istanbul ignore start*/p=c(13),/*istanbul ignore start*/q=c(14),/*istanbul ignore start*/r=c(16),/*istanbul ignore start*/s=c(17);/* See LICENSE file for terms of use */
+/*
+	 * Text diff implementation.
+	 *
+	 * This library supports the following APIS:
+	 * JsDiff.diffChars: Character by character diff
+	 * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace
+	 * JsDiff.diffLines: Line based diff
+	 *
+	 * JsDiff.diffCss: Diff targeted at CSS content
+	 *
+	 * These methods are based on the implementation proposed in
+	 * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986).
+	 * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927
+	 */
+b.Diff=f["default"],/*istanbul ignore start*/
+b.diffChars=g.diffChars,/*istanbul ignore start*/
+b.diffWords=h.diffWords,/*istanbul ignore start*/
+b.diffWordsWithSpace=h.diffWordsWithSpace,/*istanbul ignore start*/
+b.diffLines=i.diffLines,/*istanbul ignore start*/
+b.diffTrimmedLines=i.diffTrimmedLines,/*istanbul ignore start*/
+b.diffSentences=j.diffSentences,/*istanbul ignore start*/
+b.diffCss=k.diffCss,/*istanbul ignore start*/
+b.diffJson=l.diffJson,/*istanbul ignore start*/
+b.diffArrays=m.diffArrays,/*istanbul ignore start*/
+b.structuredPatch=q.structuredPatch,/*istanbul ignore start*/
+b.createTwoFilesPatch=q.createTwoFilesPatch,/*istanbul ignore start*/
+b.createPatch=q.createPatch,/*istanbul ignore start*/
+b.applyPatch=n.applyPatch,/*istanbul ignore start*/
+b.applyPatches=n.applyPatches,/*istanbul ignore start*/
+b.parsePatch=o.parsePatch,/*istanbul ignore start*/
+b.merge=p.merge,/*istanbul ignore start*/
+b.convertChangesToDMP=r.convertChangesToDMP,/*istanbul ignore start*/
+b.convertChangesToXML=s.convertChangesToXML,/*istanbul ignore start*/
+b.canonicalize=l.canonicalize},/* 1 */
+/***/
+function(a,b){/*istanbul ignore start*/
+"use strict";function c(){}function d(a,b,c,d,e){for(var f=0,g=b.length,h=0,i=0;f<g;f++){var j=b[f];if(j.removed){
+// Reverse add and remove so removes are output first to match common convention
+// The diffing algorithm is tied to add then remove output and this is the simplest
+// route to get the desired output with minimal overhead.
+if(j.value=a.join(d.slice(i,i+j.count)),i+=j.count,f&&b[f-1].added){var k=b[f-1];b[f-1]=b[f],b[f]=k}}else{if(!j.added&&e){var l=c.slice(h,h+j.count);l=l.map(function(a,b){var c=d[i+b];return c.length>a.length?c:a}),j.value=a.join(l)}else j.value=a.join(c.slice(h,h+j.count));h+=j.count,
+// Common case
+j.added||(i+=j.count)}}
+// Special case handle for when one terminal is ignored (i.e. whitespace).
+// For this case we merge the terminal into the prior string and drop the change.
+// This is only available for string mode.
+var m=b[g-1];return g>1&&"string"==typeof m.value&&(m.added||m.removed)&&a.equals("",m.value)&&(b[g-2].value+=m.value,b.pop()),b}function e(a){return{newPos:a.newPos,components:a.components.slice(0)}}b.__esModule=!0,b["default"]=/*istanbul ignore end*/c,c.prototype={/*istanbul ignore start*/
+/*istanbul ignore end*/
+diff:function(a,b){function c(a){return h?(setTimeout(function(){h(void 0,a)},0),!0):a}
+// Main worker method. checks all permutations of a given edit length for acceptance.
+function f(){for(var f=-1*l;f<=l;f+=2){var g=/*istanbul ignore start*/void 0,h=n[f-1],m=n[f+1],o=(m?m.newPos:0)-f;h&&(
+// No one else is going to attempt to use this value, clear it
+n[f-1]=void 0);var p=h&&h.newPos+1<j,q=m&&0<=o&&o<k;if(p||q){
+// If we have hit the end of both strings, then we are done
+if(
+// Select the diagonal that we want to branch from. We select the prior
+// path whose position in the new string is the farthest from the origin
+// and does not pass the bounds of the diff graph
+!p||q&&h.newPos<m.newPos?(g=e(m),i.pushComponent(g.components,void 0,!0)):(g=h,// No need to clone, we've pulled it from the list
+g.newPos++,i.pushComponent(g.components,!0,void 0)),o=i.extractCommon(g,b,a,f),g.newPos+1>=j&&o+1>=k)return c(d(i,g.components,b,a,i.useLongestToken));
+// Otherwise track this path as a potential candidate and continue.
+n[f]=g}else
+// If this path is a terminal then prune
+n[f]=void 0}l++}/*istanbul ignore start*/
+var/*istanbul ignore end*/g=arguments.length>2&&void 0!==arguments[2]?arguments[2]:{},h=g.callback;"function"==typeof g&&(h=g,g={}),this.options=g;var i=this;
+// Allow subclasses to massage the input prior to running
+a=this.castInput(a),b=this.castInput(b),a=this.removeEmpty(this.tokenize(a)),b=this.removeEmpty(this.tokenize(b));var j=b.length,k=a.length,l=1,m=j+k,n=[{newPos:-1,components:[]}],o=this.extractCommon(n[0],b,a,0);if(n[0].newPos+1>=j&&o+1>=k)
+// Identity per the equality and tokenizer
+return c([{value:this.join(b),count:b.length}]);
+// Performs the length of edit iteration. Is a bit fugly as this has to support the
+// sync and async mode which is never fun. Loops over execEditLength until a value
+// is produced.
+if(h)!function q(){setTimeout(function(){
+// This should not happen, but we want to be safe.
+/* istanbul ignore next */
+// This should not happen, but we want to be safe.
+/* istanbul ignore next */
+return l>m?h():void(f()||q())},0)}();else for(;l<=m;){var p=f();if(p)return p}},/*istanbul ignore start*/
+/*istanbul ignore end*/
+pushComponent:function(a,b,c){var d=a[a.length-1];d&&d.added===b&&d.removed===c?
+// We need to clone here as the component clone operation is just
+// as shallow array clone
+a[a.length-1]={count:d.count+1,added:b,removed:c}:a.push({count:1,added:b,removed:c})},/*istanbul ignore start*/
+/*istanbul ignore end*/
+extractCommon:function(a,b,c,d){for(var e=b.length,f=c.length,g=a.newPos,h=g-d,i=0;g+1<e&&h+1<f&&this.equals(b[g+1],c[h+1]);)g++,h++,i++;return i&&a.components.push({count:i}),a.newPos=g,h},/*istanbul ignore start*/
+/*istanbul ignore end*/
+equals:function(a,b){return this.options.comparator?this.options.comparator(a,b):a===b||this.options.ignoreCase&&a.toLowerCase()===b.toLowerCase()},/*istanbul ignore start*/
+/*istanbul ignore end*/
+removeEmpty:function(a){for(var b=[],c=0;c<a.length;c++)a[c]&&b.push(a[c]);return b},/*istanbul ignore start*/
+/*istanbul ignore end*/
+castInput:function(a){return a},/*istanbul ignore start*/
+/*istanbul ignore end*/
+tokenize:function(a){return a.split("")},/*istanbul ignore start*/
+/*istanbul ignore end*/
+join:function(a){return a.join("")}}},/* 2 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";function d(a){return a&&a.__esModule?a:{"default":a}}function e(a,b,c){return h.diff(a,b,c)}b.__esModule=!0,b.characterDiff=void 0,b.diffChars=e;var/*istanbul ignore start*/f=c(1),g=d(f),h=/*istanbul ignore start*/b.characterDiff=new/*istanbul ignore start*/g["default"]},/* 3 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";/*istanbul ignore start*/
+function d(a){return a&&a.__esModule?a:{"default":a}}function e(a,b,c){/*istanbul ignore start*/
+return c=(0,i.generateOptions)(c,{ignoreWhitespace:!0}),l.diff(a,b,c)}function f(a,b,c){return l.diff(a,b,c)}b.__esModule=!0,b.wordDiff=void 0,b.diffWords=e,/*istanbul ignore start*/
+b.diffWordsWithSpace=f;var/*istanbul ignore start*/g=c(1),h=d(g),/*istanbul ignore start*/i=c(4),j=/^[A-Za-z\xC0-\u02C6\u02C8-\u02D7\u02DE-\u02FF\u1E00-\u1EFF]+$/,k=/\S/,l=/*istanbul ignore start*/b.wordDiff=new/*istanbul ignore start*/h["default"];l.equals=function(a,b){return this.options.ignoreCase&&(a=a.toLowerCase(),b=b.toLowerCase()),a===b||this.options.ignoreWhitespace&&!k.test(a)&&!k.test(b)},l.tokenize=function(a){
+// Join the boundary splits that we do not consider to be boundaries. This is primarily the extended Latin character set.
+for(var b=a.split(/(\s+|\b)/),c=0;c<b.length-1;c++)
+// If we have an empty string in the next field and we have only word chars before and after, merge
+!b[c+1]&&b[c+2]&&j.test(b[c])&&j.test(b[c+2])&&(b[c]+=b[c+2],b.splice(c+1,2),c--);return b}},/* 4 */
+/***/
+function(a,b){/*istanbul ignore start*/
+"use strict";function c(a,b){if("function"==typeof a)b.callback=a;else if(a)for(var c in a)/* istanbul ignore else */
+a.hasOwnProperty(c)&&(b[c]=a[c]);return b}b.__esModule=!0,b.generateOptions=c},/* 5 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";/*istanbul ignore start*/
+function d(a){return a&&a.__esModule?a:{"default":a}}function e(a,b,c){return j.diff(a,b,c)}function f(a,b,c){var d=/*istanbul ignore start*/(0,i.generateOptions)(c,{ignoreWhitespace:!0});return j.diff(a,b,d)}b.__esModule=!0,b.lineDiff=void 0,b.diffLines=e,/*istanbul ignore start*/
+b.diffTrimmedLines=f;var/*istanbul ignore start*/g=c(1),h=d(g),/*istanbul ignore start*/i=c(4),j=/*istanbul ignore start*/b.lineDiff=new/*istanbul ignore start*/h["default"];j.tokenize=function(a){var b=[],c=a.split(/(\n|\r\n)/);
+// Ignore the final empty token that occurs if the string ends with a new line
+c[c.length-1]||c.pop();
+// Merge the content and line separators into single tokens
+for(var d=0;d<c.length;d++){var e=c[d];d%2&&!this.options.newlineIsToken?b[b.length-1]+=e:(this.options.ignoreWhitespace&&(e=e.trim()),b.push(e))}return b}},/* 6 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";function d(a){return a&&a.__esModule?a:{"default":a}}function e(a,b,c){return h.diff(a,b,c)}b.__esModule=!0,b.sentenceDiff=void 0,b.diffSentences=e;var/*istanbul ignore start*/f=c(1),g=d(f),h=/*istanbul ignore start*/b.sentenceDiff=new/*istanbul ignore start*/g["default"];h.tokenize=function(a){return a.split(/(\S.+?[.!?])(?=\s+|$)/)}},/* 7 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";function d(a){return a&&a.__esModule?a:{"default":a}}function e(a,b,c){return h.diff(a,b,c)}b.__esModule=!0,b.cssDiff=void 0,b.diffCss=e;var/*istanbul ignore start*/f=c(1),g=d(f),h=/*istanbul ignore start*/b.cssDiff=new/*istanbul ignore start*/g["default"];h.tokenize=function(a){return a.split(/([{}:;,]|\s+)/)}},/* 8 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";/*istanbul ignore start*/
+function d(a){return a&&a.__esModule?a:{"default":a}}function e(a,b,c){return l.diff(a,b,c)}
+// This function handles the presence of circular references by bailing out when encountering an
+// object that is already on the "stack" of items being processed. Accepts an optional replacer
+function f(a,b,c,d,e){b=b||[],c=c||[],d&&(a=d(e,a));var h=/*istanbul ignore start*/void 0;for(h=0;h<b.length;h+=1)if(b[h]===a)return c[h];var i=/*istanbul ignore start*/void 0;if("[object Array]"===k.call(a)){for(b.push(a),i=new Array(a.length),c.push(i),h=0;h<a.length;h+=1)i[h]=f(a[h],b,c,d,e);return b.pop(),c.pop(),i}if(a&&a.toJSON&&(a=a.toJSON()),/*istanbul ignore start*/"object"===("undefined"==typeof/*istanbul ignore end*/a?"undefined":g(a))&&null!==a){b.push(a),i={},c.push(i);var j=[],l=/*istanbul ignore start*/void 0;for(l in a)/* istanbul ignore else */
+a.hasOwnProperty(l)&&j.push(l);for(j.sort(),h=0;h<j.length;h+=1)l=j[h],i[l]=f(a[l],b,c,d,l);b.pop(),c.pop()}else i=a;return i}b.__esModule=!0,b.jsonDiff=void 0;var g="function"==typeof Symbol&&"symbol"==typeof Symbol.iterator?function(a){return typeof a}:function(a){return a&&"function"==typeof Symbol&&a.constructor===Symbol&&a!==Symbol.prototype?"symbol":typeof a};b.diffJson=e,/*istanbul ignore start*/
+b.canonicalize=f;var/*istanbul ignore start*/h=c(1),i=d(h),/*istanbul ignore start*/j=c(5),k=Object.prototype.toString,l=/*istanbul ignore start*/b.jsonDiff=new/*istanbul ignore start*/i["default"];
+// Discriminate between two lines of pretty-printed, serialized JSON where one of them has a
+// dangling comma and the other doesn't. Turns out including the dangling comma yields the nicest output:
+l.useLongestToken=!0,l.tokenize=/*istanbul ignore start*/j.lineDiff.tokenize,l.castInput=function(a){/*istanbul ignore start*/
+var b=/*istanbul ignore end*/this.options,c=b.undefinedReplacement,d=b.stringifyReplacer,e=void 0===d?function(a,b){/*istanbul ignore end*/
+return"undefined"==typeof b?c:b}:d;return"string"==typeof a?a:JSON.stringify(f(a,null,null,e),e,"  ")},l.equals=function(a,b){/*istanbul ignore start*/
+return i["default"].prototype.equals.call(l,a.replace(/,([\r\n])/g,"$1"),b.replace(/,([\r\n])/g,"$1"))}},/* 9 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";function d(a){return a&&a.__esModule?a:{"default":a}}function e(a,b,c){return h.diff(a,b,c)}b.__esModule=!0,b.arrayDiff=void 0,b.diffArrays=e;var/*istanbul ignore start*/f=c(1),g=d(f),h=/*istanbul ignore start*/b.arrayDiff=new/*istanbul ignore start*/g["default"];h.tokenize=function(a){return a.slice()},h.join=h.removeEmpty=function(a){return a}},/* 10 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";function d(a){return a&&a.__esModule?a:{"default":a}}/*istanbul ignore end*/
+function e(a,b){/**
+	   * Checks if the hunk exactly fits on the provided location
+	   */
+function c(a,b){for(var c=0;c<a.lines.length;c++){var d=a.lines[c],f=d.length>0?d[0]:" ",g=d.length>0?d.substr(1):d;if(" "===f||"-"===f){
+// Context sanity check
+if(!j(b+1,e[b],f,g)&&(k++,k>l))return!1;b++}}return!0}/*istanbul ignore start*/
+var/*istanbul ignore end*/d=arguments.length>2&&void 0!==arguments[2]?arguments[2]:{};if("string"==typeof b&&(b=/*istanbul ignore start*/(0,g.parsePatch)(b)),Array.isArray(b)){if(b.length>1)throw new Error("applyPatch only works with a single input.");b=b[0]}
+// Search best fit offsets for each hunk based on the previous ones
+for(var e=a.split(/\r\n|[\n\v\f\r\x85]/),f=a.match(/\r\n|[\n\v\f\r\x85]/g)||[],h=b.hunks,j=d.compareLine||function(a,b,c,d){/*istanbul ignore end*/
+return b===d},k=0,l=d.fuzzFactor||0,m=0,n=0,o=/*istanbul ignore start*/void 0,p=/*istanbul ignore start*/void 0,q=0;q<h.length;q++){for(var r=h[q],s=e.length-r.oldLines,t=0,u=n+r.oldStart-1,v=/*istanbul ignore start*/(0,i["default"])(u,m,s);void 0!==t;t=v())if(c(r,u+t)){r.offset=n+=t;break}if(void 0===t)return!1;
+// Set lower text limit to end of the current hunk, so next ones don't try
+// to fit over already patched text
+m=r.offset+r.oldStart+r.oldLines}for(var w=0,x=0;x<h.length;x++){var y=h[x],z=y.oldStart+y.offset+w-1;w+=y.newLines-y.oldLines,z<0&&(
+// Creating a new file
+z=0);for(var A=0;A<y.lines.length;A++){var B=y.lines[A],C=B.length>0?B[0]:" ",D=B.length>0?B.substr(1):B,E=y.linedelimiters[A];if(" "===C)z++;else if("-"===C)e.splice(z,1),f.splice(z,1);else if("+"===C)e.splice(z,0,D),f.splice(z,0,E),z++;else if("\\"===C){var F=y.lines[A-1]?y.lines[A-1][0]:null;"+"===F?o=!0:"-"===F&&(p=!0)}}}
+// Handle EOFNL insertion/removal
+if(o)for(;!e[e.length-1];)e.pop(),f.pop();else p&&(e.push(""),f.push("\n"));for(var G=0;G<e.length-1;G++)e[G]=e[G]+f[G];return e.join("")}
+// Wrapper that supports multiple file patches via callbacks.
+function f(a,b){function c(){var f=a[d++];return f?void b.loadFile(f,function(a,d){if(a)return b.complete(a);var g=e(d,f,b);b.patched(f,g,function(a){return a?b.complete(a):void c()})}):b.complete()}"string"==typeof a&&(a=/*istanbul ignore start*/(0,g.parsePatch)(a));var d=0;c()}b.__esModule=!0,b.applyPatch=e,/*istanbul ignore start*/
+b.applyPatches=f;var/*istanbul ignore start*/g=c(11),/*istanbul ignore start*/h=c(12),i=d(h)},/* 11 */
+/***/
+function(a,b){/*istanbul ignore start*/
+"use strict";function c(a){function b(){var a={};
+// Parse diff metadata
+for(h.push(a);i<f.length;){var b=f[i];
+// File header found, end parsing diff metadata
+if(/^(\-\-\-|\+\+\+|@@)\s/.test(b))break;
+// Diff index
+var g=/^(?:Index:|diff(?: -r \w+)+)\s+(.+?)\s*$/.exec(b);g&&(a.index=g[1]),i++}for(
+// Parse file headers if they are defined. Unified diff requires them, but
+// there's no technical issues to have an isolated hunk without file header
+c(a),c(a),
+// Parse hunks
+a.hunks=[];i<f.length;){var j=f[i];if(/^(Index:|diff|\-\-\-|\+\+\+)\s/.test(j))break;if(/^@@/.test(j))a.hunks.push(d());else{if(j&&e.strict)
+// Ignore unexpected content unless in strict mode
+throw new Error("Unknown line "+(i+1)+" "+JSON.stringify(j));i++}}}
+// Parses the --- and +++ headers, if none are found, no lines
+// are consumed.
+function c(a){var b=/^(---|\+\+\+)\s+(.*)$/.exec(f[i]);if(b){var c="---"===b[1]?"old":"new",d=b[2].split("\t",2),e=d[0].replace(/\\\\/g,"\\");/^".*"$/.test(e)&&(e=e.substr(1,e.length-2)),a[c+"FileName"]=e,a[c+"Header"]=(d[1]||"").trim(),i++}}
+// Parses a hunk
+// This assumes that we are at the start of a hunk.
+function d(){for(var a=i,b=f[i++],c=b.split(/@@ -(\d+)(?:,(\d+))? \+(\d+)(?:,(\d+))? @@/),d={oldStart:+c[1],oldLines:+c[2]||1,newStart:+c[3],newLines:+c[4]||1,lines:[],linedelimiters:[]},h=0,j=0;i<f.length&&!(0===f[i].indexOf("--- ")&&i+2<f.length&&0===f[i+1].indexOf("+++ ")&&0===f[i+2].indexOf("@@"));i++){var k=0==f[i].length&&i!=f.length-1?" ":f[i][0];if("+"!==k&&"-"!==k&&" "!==k&&"\\"!==k)break;d.lines.push(f[i]),d.linedelimiters.push(g[i]||"\n"),"+"===k?h++:"-"===k?j++:" "===k&&(h++,j++)}
+// Perform optional sanity checking
+if(
+// Handle the empty block count case
+h||1!==d.newLines||(d.newLines=0),j||1!==d.oldLines||(d.oldLines=0),e.strict){if(h!==d.newLines)throw new Error("Added line count did not match for hunk at line "+(a+1));if(j!==d.oldLines)throw new Error("Removed line count did not match for hunk at line "+(a+1))}return d}for(/*istanbul ignore start*/
+var/*istanbul ignore end*/e=arguments.length>1&&void 0!==arguments[1]?arguments[1]:{},f=a.split(/\r\n|[\n\v\f\r\x85]/),g=a.match(/\r\n|[\n\v\f\r\x85]/g)||[],h=[],i=0;i<f.length;)b();return h}b.__esModule=!0,b.parsePatch=c},/* 12 */
+/***/
+function(a,b){/*istanbul ignore start*/
+"use strict";b.__esModule=!0,b["default"]=/*istanbul ignore end*/function(a,b,c){var d=!0,e=!1,f=!1,g=1;return function h(){if(d&&!f){
+// Check if trying to fit beyond text length, and if not, check it fits
+// after offset location (or desired location on first iteration)
+if(e?g++:d=!1,a+g<=c)return g;f=!0}if(!e)
+// Check if trying to fit before text beginning, and if not, check it fits
+// before offset location
+// Check if trying to fit before text beginning, and if not, check it fits
+// before offset location
+return f||(d=!0),b<=a-g?-g++:(e=!0,h())}}},/* 13 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";/*istanbul ignore start*/
+function d(a){if(Array.isArray(a)){for(var b=0,c=Array(a.length);b<a.length;b++)c[b]=a[b];return c}return Array.from(a)}/*istanbul ignore end*/
+function e(a){/*istanbul ignore start*/
+var b=/*istanbul ignore end*/v(a.lines),c=b.oldLines,d=b.newLines;void 0!==c?a.oldLines=c:delete a.oldLines,void 0!==d?a.newLines=d:delete a.newLines}function f(a,b,c){a=g(a,c),b=g(b,c);var d={};
+// For index we just let it pass through as it doesn't have any necessary meaning.
+// Leaving sanity checks on this to the API consumer that may know more about the
+// meaning in their own context.
+(a.index||b.index)&&(d.index=a.index||b.index),(a.newFileName||b.newFileName)&&(h(a)?h(b)?(
+// Both changed... figure it out
+d.oldFileName=i(d,a.oldFileName,b.oldFileName),d.newFileName=i(d,a.newFileName,b.newFileName),d.oldHeader=i(d,a.oldHeader,b.oldHeader),d.newHeader=i(d,a.newHeader,b.newHeader)):(
+// No header or no change in theirs, use ours
+d.oldFileName=a.oldFileName,d.newFileName=a.newFileName,d.oldHeader=a.oldHeader,d.newHeader=a.newHeader):(
+// No header or no change in ours, use theirs (and ours if theirs does not exist)
+d.oldFileName=b.oldFileName||a.oldFileName,d.newFileName=b.newFileName||a.newFileName,d.oldHeader=b.oldHeader||a.oldHeader,d.newHeader=b.newHeader||a.newHeader)),d.hunks=[];for(var e=0,f=0,m=0,n=0;e<a.hunks.length||f<b.hunks.length;){var o=a.hunks[e]||{oldStart:1/0},p=b.hunks[f]||{oldStart:1/0};if(j(o,p))
+// This patch does not overlap with any of the others, yay.
+d.hunks.push(k(o,m)),e++,n+=o.newLines-o.oldLines;else if(j(p,o))
+// This patch does not overlap with any of the others, yay.
+d.hunks.push(k(p,n)),f++,m+=p.newLines-p.oldLines;else{
+// Overlap, merge as best we can
+var q={oldStart:Math.min(o.oldStart,p.oldStart),oldLines:0,newStart:Math.min(o.newStart+m,p.oldStart+n),newLines:0,lines:[]};l(q,o.oldStart,o.lines,p.oldStart,p.lines),f++,e++,d.hunks.push(q)}}return d}function g(a,b){if("string"==typeof a){if(/^@@/m.test(a)||/^Index:/m.test(a))/*istanbul ignore start*/
+return(0,x.parsePatch)(a)[0];if(!b)throw new Error("Must provide a base reference or pass in a patch");/*istanbul ignore start*/
+return(0,w.structuredPatch)(void 0,void 0,b,a)}return a}function h(a){return a.newFileName&&a.newFileName!==a.oldFileName}function i(a,b,c){return b===c?b:(a.conflict=!0,{mine:b,theirs:c})}function j(a,b){return a.oldStart<b.oldStart&&a.oldStart+a.oldLines<b.oldStart}function k(a,b){return{oldStart:a.oldStart,oldLines:a.oldLines,newStart:a.newStart+b,newLines:a.newLines,lines:a.lines}}function l(a,b,c,f,g){
+// This will generally result in a conflicted hunk, but there are cases where the context
+// is the only overlap where we can successfully merge the content here.
+var h={offset:b,lines:c,index:0},i={offset:f,lines:g,index:0};
+// Now in the overlap content. Scan through and select the best changes from each.
+for(
+// Handle any leading content
+p(a,h,i),p(a,i,h);h.index<h.lines.length&&i.index<i.lines.length;){var j=h.lines[h.index],k=i.lines[i.index];if("-"!==j[0]&&"+"!==j[0]||"-"!==k[0]&&"+"!==k[0])if("+"===j[0]&&" "===k[0]){/*istanbul ignore start*/
+var l;/*istanbul ignore end*/
+// Mine inserted
+/*istanbul ignore start*/
+(l=/*istanbul ignore end*/a.lines).push.apply(/*istanbul ignore start*/l,/*istanbul ignore start*/d(/*istanbul ignore end*/r(h)))}else if("+"===k[0]&&" "===j[0]){/*istanbul ignore start*/
+var s;/*istanbul ignore end*/
+// Theirs inserted
+/*istanbul ignore start*/
+(s=/*istanbul ignore end*/a.lines).push.apply(/*istanbul ignore start*/s,/*istanbul ignore start*/d(/*istanbul ignore end*/r(i)))}else"-"===j[0]&&" "===k[0]?
+// Mine removed or edited
+n(a,h,i):"-"===k[0]&&" "===j[0]?
+// Their removed or edited
+n(a,i,h,!0):j===k?(
+// Context identity
+a.lines.push(j),h.index++,i.index++):
+// Context mismatch
+o(a,r(h),r(i));else
+// Both modified ...
+m(a,h,i)}
+// Now push anything that may be remaining
+q(a,h),q(a,i),e(a)}function m(a,b,c){var e=r(b),f=r(c);if(t(e)&&t(f)){
+// Special case for remove changes that are supersets of one another
+if(/*istanbul ignore start*/(0,y.arrayStartsWith)(e,f)&&u(c,e,e.length-f.length)){/*istanbul ignore start*/
+var g;/*istanbul ignore end*/
+/*istanbul ignore start*/
+/*istanbul ignore end*/
+/*istanbul ignore start*/
+/*istanbul ignore start*/
+/*istanbul ignore end*/
+return void(g=a.lines).push.apply(g,d(e))}if(/*istanbul ignore start*/(0,y.arrayStartsWith)(f,e)&&u(b,f,f.length-e.length)){/*istanbul ignore start*/
+var h;/*istanbul ignore end*/
+/*istanbul ignore start*/
+/*istanbul ignore end*/
+/*istanbul ignore start*/
+/*istanbul ignore start*/
+/*istanbul ignore end*/
+return void(h=a.lines).push.apply(h,d(f))}}else if(/*istanbul ignore start*/(0,y.arrayEqual)(e,f)){/*istanbul ignore start*/
+var i;/*istanbul ignore end*/
+/*istanbul ignore start*/
+/*istanbul ignore end*/
+/*istanbul ignore start*/
+/*istanbul ignore start*/
+/*istanbul ignore end*/
+return void(i=a.lines).push.apply(i,d(e))}o(a,e,f)}function n(a,b,c,e){var f=r(b),g=s(c,f);if(g.merged){/*istanbul ignore start*/
+var h;/*istanbul ignore end*/
+/*istanbul ignore start*/
+(h=/*istanbul ignore end*/a.lines).push.apply(/*istanbul ignore start*/h,/*istanbul ignore start*/d(/*istanbul ignore end*/g.merged))}else o(a,e?g:f,e?f:g)}function o(a,b,c){a.conflict=!0,a.lines.push({conflict:!0,mine:b,theirs:c})}function p(a,b,c){for(;b.offset<c.offset&&b.index<b.lines.length;){var d=b.lines[b.index++];a.lines.push(d),b.offset++}}function q(a,b){for(;b.index<b.lines.length;){var c=b.lines[b.index++];a.lines.push(c)}}function r(a){for(var b=[],c=a.lines[a.index][0];a.index<a.lines.length;){var d=a.lines[a.index];if(
+// Group additions that are immediately after subtractions and treat them as one "atomic" modify change.
+"-"===c&&"+"===d[0]&&(c="+"),c!==d[0])break;b.push(d),a.index++}return b}function s(a,b){for(var c=[],d=[],e=0,f=!1,g=!1;e<b.length&&a.index<a.lines.length;){var h=a.lines[a.index],i=b[e];
+// Once we've hit our add, then we are done
+if("+"===i[0])break;
+// Consume any additions in the other block as a conflict to attempt
+// to pull in the remaining context after this
+if(f=f||" "!==h[0],d.push(i),e++,"+"===h[0])for(g=!0;"+"===h[0];)c.push(h),h=a.lines[++a.index];i.substr(1)===h.substr(1)?(c.push(h),a.index++):g=!0}if("+"===(b[e]||"")[0]&&f&&(g=!0),g)return c;for(;e<b.length;)d.push(b[e++]);return{merged:d,changes:c}}function t(a){return a.reduce(function(a,b){return a&&"-"===b[0]},!0)}function u(a,b,c){for(var d=0;d<c;d++){var e=b[b.length-c+d].substr(1);if(a.lines[a.index+d]!==" "+e)return!1}return a.index+=c,!0}function v(a){var b=0,c=0;return a.forEach(function(a){if("string"!=typeof a){var d=v(a.mine),e=v(a.theirs);void 0!==b&&(d.oldLines===e.oldLines?b+=d.oldLines:b=void 0),void 0!==c&&(d.newLines===e.newLines?c+=d.newLines:c=void 0)}else void 0===c||"+"!==a[0]&&" "!==a[0]||c++,void 0===b||"-"!==a[0]&&" "!==a[0]||b++}),{oldLines:b,newLines:c}}b.__esModule=!0,b.calcLineCount=e,/*istanbul ignore start*/
+b.merge=f;var/*istanbul ignore start*/w=c(14),/*istanbul ignore start*/x=c(11),/*istanbul ignore start*/y=c(15)},/* 14 */
+/***/
+function(a,b,c){/*istanbul ignore start*/
+"use strict";/*istanbul ignore start*/
+function d(a){if(Array.isArray(a)){for(var b=0,c=Array(a.length);b<a.length;b++)c[b]=a[b];return c}return Array.from(a)}/*istanbul ignore end*/
+function e(a,b,c,e,f,g,i){// Append an empty value to make cleanup easier
+function j(a){return a.map(function(a){return" "+a})}i||(i={}),"undefined"==typeof i.context&&(i.context=4);var k=/*istanbul ignore start*/(0,h.diffLines)(c,e,i);k.push({value:"",lines:[]});for(var l=[],m=0,n=0,o=[],p=1,q=1,r=function(/*istanbul ignore end*/a){var b=k[a],f=b.lines||b.value.replace(/\n$/,"").split("\n");if(b.lines=f,b.added||b.removed){/*istanbul ignore start*/
+var g;/*istanbul ignore end*/
+// If we have previous context, start with that
+if(!m){var h=k[a-1];m=p,n=q,h&&(o=i.context>0?j(h.lines.slice(-i.context)):[],m-=o.length,n-=o.length)}
+// Output our changes
+/*istanbul ignore start*/
+(g=/*istanbul ignore end*/o).push.apply(/*istanbul ignore start*/g,/*istanbul ignore start*/d(/*istanbul ignore end*/f.map(function(a){return(b.added?"+":"-")+a}))),
+// Track the updated file position
+b.added?q+=f.length:p+=f.length}else{
+// Identical context lines. Track line changes
+if(m)
+// Close out any changes that have been output (or join overlapping)
+if(f.length<=2*i.context&&a<k.length-2){/*istanbul ignore start*/
+var r;/*istanbul ignore end*/
+// Overlapping
+/*istanbul ignore start*/
+(r=/*istanbul ignore end*/o).push.apply(/*istanbul ignore start*/r,/*istanbul ignore start*/d(/*istanbul ignore end*/j(f)))}else{/*istanbul ignore start*/
+var s,t=Math.min(f.length,i.context);/*istanbul ignore start*/
+(s=/*istanbul ignore end*/o).push.apply(/*istanbul ignore start*/s,/*istanbul ignore start*/d(/*istanbul ignore end*/j(f.slice(0,t))));var u={oldStart:m,oldLines:p-m+t,newStart:n,newLines:q-n+t,lines:o};if(a>=k.length-2&&f.length<=i.context){
+// EOF is inside this hunk
+var v=/\n$/.test(c),w=/\n$/.test(e);0!=f.length||v?v&&w||o.push("\\ No newline at end of file"):
+// special case: old has no eol and no trailing context; no-nl can end up before adds
+o.splice(u.oldLines,0,"\\ No newline at end of file")}l.push(u),m=0,n=0,o=[]}p+=f.length,q+=f.length}},s=0;s<k.length;s++)/*istanbul ignore start*/
+r(/*istanbul ignore end*/s);return{oldFileName:a,newFileName:b,oldHeader:f,newHeader:g,hunks:l}}function f(a,b,c,d,f,g,h){var i=e(a,b,c,d,f,g,h),j=[];a==b&&j.push("Index: "+a),j.push("==================================================================="),j.push("--- "+i.oldFileName+("undefined"==typeof i.oldHeader?"":"\t"+i.oldHeader)),j.push("+++ "+i.newFileName+("undefined"==typeof i.newHeader?"":"\t"+i.newHeader));for(var k=0;k<i.hunks.length;k++){var l=i.hunks[k];j.push("@@ -"+l.oldStart+","+l.oldLines+" +"+l.newStart+","+l.newLines+" @@"),j.push.apply(j,l.lines)}return j.join("\n")+"\n"}function g(a,b,c,d,e,g){return f(a,a,b,c,d,e,g)}b.__esModule=!0,b.structuredPatch=e,/*istanbul ignore start*/
+b.createTwoFilesPatch=f,/*istanbul ignore start*/
+b.createPatch=g;var/*istanbul ignore start*/h=c(5)},/* 15 */
+/***/
+function(a,b){/*istanbul ignore start*/
+"use strict";function c(a,b){return a.length===b.length&&d(a,b)}function d(a,b){if(b.length>a.length)return!1;for(var c=0;c<b.length;c++)if(b[c]!==a[c])return!1;return!0}b.__esModule=!0,b.arrayEqual=c,/*istanbul ignore start*/
+b.arrayStartsWith=d},/* 16 */
+/***/
+function(a,b){/*istanbul ignore start*/
+"use strict";
+// See: http://code.google.com/p/google-diff-match-patch/wiki/API
+function c(a){for(var b=[],c=/*istanbul ignore start*/void 0,d=/*istanbul ignore start*/void 0,e=0;e<a.length;e++)c=a[e],d=c.added?1:c.removed?-1:0,b.push([d,c.value]);return b}b.__esModule=!0,b.convertChangesToDMP=c},/* 17 */
+/***/
+function(a,b){/*istanbul ignore start*/
+"use strict";function c(a){for(var b=[],c=0;c<a.length;c++){var e=a[c];e.added?b.push("<ins>"):e.removed&&b.push("<del>"),b.push(d(e.value)),e.added?b.push("</ins>"):e.removed&&b.push("</del>")}return b.join("")}function d(a){var b=a;return b=b.replace(/&/g,"&amp;"),b=b.replace(/</g,"&lt;"),b=b.replace(/>/g,"&gt;"),b=b.replace(/"/g,"&quot;")}b.__esModule=!0,b.convertChangesToXML=c}])});
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/convert/dmp.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/convert/dmp.js
new file mode 100644
index 00000000000..b9b646f00e9
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/convert/dmp.js
@@ -0,0 +1,24 @@
+/*istanbul ignore start*/"use strict";
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/convertChangesToDMP = convertChangesToDMP;
+// See: http://code.google.com/p/google-diff-match-patch/wiki/API
+function convertChangesToDMP(changes) {
+  var ret = [],
+      change = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+      operation = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+  for (var i = 0; i < changes.length; i++) {
+    change = changes[i];
+    if (change.added) {
+      operation = 1;
+    } else if (change.removed) {
+      operation = -1;
+    } else {
+      operation = 0;
+    }
+
+    ret.push([operation, change.value]);
+  }
+  return ret;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9jb252ZXJ0L2RtcC5qcyJdLCJuYW1lcyI6WyJjb252ZXJ0Q2hhbmdlc1RvRE1QIiwiY2hhbmdlcyIsInJldCIsImNoYW5nZSIsIm9wZXJhdGlvbiIsImkiLCJsZW5ndGgiLCJhZGRlZCIsInJlbW92ZWQiLCJwdXNoIiwidmFsdWUiXSwibWFwcGluZ3MiOiI7OztnQ0FDZ0JBLG1CLEdBQUFBLG1CO0FBRGhCO0FBQ08sU0FBU0EsbUJBQVQsQ0FBNkJDLE9BQTdCLEVBQXNDO0FBQzNDLE1BQUlDLE1BQU0sRUFBVjtBQUFBLE1BQ0lDLHdDQURKO0FBQUEsTUFFSUMsMkNBRko7QUFHQSxPQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUosUUFBUUssTUFBNUIsRUFBb0NELEdBQXBDLEVBQXlDO0FBQ3ZDRixhQUFTRixRQUFRSSxDQUFSLENBQVQ7QUFDQSxRQUFJRixPQUFPSSxLQUFYLEVBQWtCO0FBQ2hCSCxrQkFBWSxDQUFaO0FBQ0QsS0FGRCxNQUVPLElBQUlELE9BQU9LLE9BQVgsRUFBb0I7QUFDekJKLGtCQUFZLENBQUMsQ0FBYjtBQUNELEtBRk0sTUFFQTtBQUNMQSxrQkFBWSxDQUFaO0FBQ0Q7O0FBRURGLFFBQUlPLElBQUosQ0FBUyxDQUFDTCxTQUFELEVBQVlELE9BQU9PLEtBQW5CLENBQVQ7QUFDRDtBQUNELFNBQU9SLEdBQVA7QUFDRCIsImZpbGUiOiJkbXAuanMiLCJzb3VyY2VzQ29udGVudCI6WyIvLyBTZWU6IGh0dHA6Ly9jb2RlLmdvb2dsZS5jb20vcC9nb29nbGUtZGlmZi1tYXRjaC1wYXRjaC93aWtpL0FQSVxuZXhwb3J0IGZ1bmN0aW9uIGNvbnZlcnRDaGFuZ2VzVG9ETVAoY2hhbmdlcykge1xuICBsZXQgcmV0ID0gW10sXG4gICAgICBjaGFuZ2UsXG4gICAgICBvcGVyYXRpb247XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgY2hhbmdlcy5sZW5ndGg7IGkrKykge1xuICAgIGNoYW5nZSA9IGNoYW5nZXNbaV07XG4gICAgaWYgKGNoYW5nZS5hZGRlZCkge1xuICAgICAgb3BlcmF0aW9uID0gMTtcbiAgICB9IGVsc2UgaWYgKGNoYW5nZS5yZW1vdmVkKSB7XG4gICAgICBvcGVyYXRpb24gPSAtMTtcbiAgICB9IGVsc2Uge1xuICAgICAgb3BlcmF0aW9uID0gMDtcbiAgICB9XG5cbiAgICByZXQucHVzaChbb3BlcmF0aW9uLCBjaGFuZ2UudmFsdWVdKTtcbiAgfVxuICByZXR1cm4gcmV0O1xufVxuIl19
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/convert/xml.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/convert/xml.js
new file mode 100644
index 00000000000..331827a1cd5
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/convert/xml.js
@@ -0,0 +1,35 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/convertChangesToXML = convertChangesToXML;
+function convertChangesToXML(changes) {
+  var ret = [];
+  for (var i = 0; i < changes.length; i++) {
+    var change = changes[i];
+    if (change.added) {
+      ret.push('<ins>');
+    } else if (change.removed) {
+      ret.push('<del>');
+    }
+
+    ret.push(escapeHTML(change.value));
+
+    if (change.added) {
+      ret.push('</ins>');
+    } else if (change.removed) {
+      ret.push('</del>');
+    }
+  }
+  return ret.join('');
+}
+
+function escapeHTML(s) {
+  var n = s;
+  n = n.replace(/&/g, '&amp;');
+  n = n.replace(/</g, '&lt;');
+  n = n.replace(/>/g, '&gt;');
+  n = n.replace(/"/g, '&quot;');
+
+  return n;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9jb252ZXJ0L3htbC5qcyJdLCJuYW1lcyI6WyJjb252ZXJ0Q2hhbmdlc1RvWE1MIiwiY2hhbmdlcyIsInJldCIsImkiLCJsZW5ndGgiLCJjaGFuZ2UiLCJhZGRlZCIsInB1c2giLCJyZW1vdmVkIiwiZXNjYXBlSFRNTCIsInZhbHVlIiwiam9pbiIsInMiLCJuIiwicmVwbGFjZSJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsbUIsR0FBQUEsbUI7QUFBVCxTQUFTQSxtQkFBVCxDQUE2QkMsT0FBN0IsRUFBc0M7QUFDM0MsTUFBSUMsTUFBTSxFQUFWO0FBQ0EsT0FBSyxJQUFJQyxJQUFJLENBQWIsRUFBZ0JBLElBQUlGLFFBQVFHLE1BQTVCLEVBQW9DRCxHQUFwQyxFQUF5QztBQUN2QyxRQUFJRSxTQUFTSixRQUFRRSxDQUFSLENBQWI7QUFDQSxRQUFJRSxPQUFPQyxLQUFYLEVBQWtCO0FBQ2hCSixVQUFJSyxJQUFKLENBQVMsT0FBVDtBQUNELEtBRkQsTUFFTyxJQUFJRixPQUFPRyxPQUFYLEVBQW9CO0FBQ3pCTixVQUFJSyxJQUFKLENBQVMsT0FBVDtBQUNEOztBQUVETCxRQUFJSyxJQUFKLENBQVNFLFdBQVdKLE9BQU9LLEtBQWxCLENBQVQ7O0FBRUEsUUFBSUwsT0FBT0MsS0FBWCxFQUFrQjtBQUNoQkosVUFBSUssSUFBSixDQUFTLFFBQVQ7QUFDRCxLQUZELE1BRU8sSUFBSUYsT0FBT0csT0FBWCxFQUFvQjtBQUN6Qk4sVUFBSUssSUFBSixDQUFTLFFBQVQ7QUFDRDtBQUNGO0FBQ0QsU0FBT0wsSUFBSVMsSUFBSixDQUFTLEVBQVQsQ0FBUDtBQUNEOztBQUVELFNBQVNGLFVBQVQsQ0FBb0JHLENBQXBCLEVBQXVCO0FBQ3JCLE1BQUlDLElBQUlELENBQVI7QUFDQUMsTUFBSUEsRUFBRUMsT0FBRixDQUFVLElBQVYsRUFBZ0IsT0FBaEIsQ0FBSjtBQUNBRCxNQUFJQSxFQUFFQyxPQUFGLENBQVUsSUFBVixFQUFnQixNQUFoQixDQUFKO0FBQ0FELE1BQUlBLEVBQUVDLE9BQUYsQ0FBVSxJQUFWLEVBQWdCLE1BQWhCLENBQUo7QUFDQUQsTUFBSUEsRUFBRUMsT0FBRixDQUFVLElBQVYsRUFBZ0IsUUFBaEIsQ0FBSjs7QUFFQSxTQUFPRCxDQUFQO0FBQ0QiLCJmaWxlIjoieG1sLmpzIiwic291cmNlc0NvbnRlbnQiOlsiZXhwb3J0IGZ1bmN0aW9uIGNvbnZlcnRDaGFuZ2VzVG9YTUwoY2hhbmdlcykge1xuICBsZXQgcmV0ID0gW107XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgY2hhbmdlcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBjaGFuZ2UgPSBjaGFuZ2VzW2ldO1xuICAgIGlmIChjaGFuZ2UuYWRkZWQpIHtcbiAgICAgIHJldC5wdXNoKCc8aW5zPicpO1xuICAgIH0gZWxzZSBpZiAoY2hhbmdlLnJlbW92ZWQpIHtcbiAgICAgIHJldC5wdXNoKCc8ZGVsPicpO1xuICAgIH1cblxuICAgIHJldC5wdXNoKGVzY2FwZUhUTUwoY2hhbmdlLnZhbHVlKSk7XG5cbiAgICBpZiAoY2hhbmdlLmFkZGVkKSB7XG4gICAgICByZXQucHVzaCgnPC9pbnM+Jyk7XG4gICAgfSBlbHNlIGlmIChjaGFuZ2UucmVtb3ZlZCkge1xuICAgICAgcmV0LnB1c2goJzwvZGVsPicpO1xuICAgIH1cbiAgfVxuICByZXR1cm4gcmV0LmpvaW4oJycpO1xufVxuXG5mdW5jdGlvbiBlc2NhcGVIVE1MKHMpIHtcbiAgbGV0IG4gPSBzO1xuICBuID0gbi5yZXBsYWNlKC8mL2csICcmYW1wOycpO1xuICBuID0gbi5yZXBsYWNlKC88L2csICcmbHQ7Jyk7XG4gIG4gPSBuLnJlcGxhY2UoLz4vZywgJyZndDsnKTtcbiAgbiA9IG4ucmVwbGFjZSgvXCIvZywgJyZxdW90OycpO1xuXG4gIHJldHVybiBuO1xufVxuIl19
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/array.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/array.js
new file mode 100644
index 00000000000..f3daa4edb5d
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/array.js
@@ -0,0 +1,24 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.arrayDiff = undefined;
+exports. /*istanbul ignore end*/diffArrays = diffArrays;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var arrayDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/arrayDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+arrayDiff.tokenize = function (value) {
+  return value.slice();
+};
+arrayDiff.join = arrayDiff.removeEmpty = function (value) {
+  return value;
+};
+
+function diffArrays(oldArr, newArr, callback) {
+  return arrayDiff.diff(oldArr, newArr, callback);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2FycmF5LmpzIl0sIm5hbWVzIjpbImRpZmZBcnJheXMiLCJhcnJheURpZmYiLCJ0b2tlbml6ZSIsInZhbHVlIiwic2xpY2UiLCJqb2luIiwicmVtb3ZlRW1wdHkiLCJvbGRBcnIiLCJuZXdBcnIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBVWdCQSxVLEdBQUFBLFU7O0FBVmhCOzs7Ozs7dUJBRU8sSUFBTUMsaUZBQVksd0VBQWxCO0FBQ1BBLFVBQVVDLFFBQVYsR0FBcUIsVUFBU0MsS0FBVCxFQUFnQjtBQUNuQyxTQUFPQSxNQUFNQyxLQUFOLEVBQVA7QUFDRCxDQUZEO0FBR0FILFVBQVVJLElBQVYsR0FBaUJKLFVBQVVLLFdBQVYsR0FBd0IsVUFBU0gsS0FBVCxFQUFnQjtBQUN2RCxTQUFPQSxLQUFQO0FBQ0QsQ0FGRDs7QUFJTyxTQUFTSCxVQUFULENBQW9CTyxNQUFwQixFQUE0QkMsTUFBNUIsRUFBb0NDLFFBQXBDLEVBQThDO0FBQUUsU0FBT1IsVUFBVVMsSUFBVixDQUFlSCxNQUFmLEVBQXVCQyxNQUF2QixFQUErQkMsUUFBL0IsQ0FBUDtBQUFrRCIsImZpbGUiOiJhcnJheS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cbmV4cG9ydCBjb25zdCBhcnJheURpZmYgPSBuZXcgRGlmZigpO1xuYXJyYXlEaWZmLnRva2VuaXplID0gZnVuY3Rpb24odmFsdWUpIHtcbiAgcmV0dXJuIHZhbHVlLnNsaWNlKCk7XG59O1xuYXJyYXlEaWZmLmpvaW4gPSBhcnJheURpZmYucmVtb3ZlRW1wdHkgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWU7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkFycmF5cyhvbGRBcnIsIG5ld0FyciwgY2FsbGJhY2spIHsgcmV0dXJuIGFycmF5RGlmZi5kaWZmKG9sZEFyciwgbmV3QXJyLCBjYWxsYmFjayk7IH1cbiJdfQ==
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/base.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/base.js
new file mode 100644
index 00000000000..763daec6d2d
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/base.js
@@ -0,0 +1,235 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports['default'] = /*istanbul ignore end*/Diff;
+function Diff() {}
+
+Diff.prototype = {
+  /*istanbul ignore start*/ /*istanbul ignore end*/diff: function diff(oldString, newString) {
+    /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+    var callback = options.callback;
+    if (typeof options === 'function') {
+      callback = options;
+      options = {};
+    }
+    this.options = options;
+
+    var self = this;
+
+    function done(value) {
+      if (callback) {
+        setTimeout(function () {
+          callback(undefined, value);
+        }, 0);
+        return true;
+      } else {
+        return value;
+      }
+    }
+
+    // Allow subclasses to massage the input prior to running
+    oldString = this.castInput(oldString);
+    newString = this.castInput(newString);
+
+    oldString = this.removeEmpty(this.tokenize(oldString));
+    newString = this.removeEmpty(this.tokenize(newString));
+
+    var newLen = newString.length,
+        oldLen = oldString.length;
+    var editLength = 1;
+    var maxEditLength = newLen + oldLen;
+    var bestPath = [{ newPos: -1, components: [] }];
+
+    // Seed editLength = 0, i.e. the content starts with the same values
+    var oldPos = this.extractCommon(bestPath[0], newString, oldString, 0);
+    if (bestPath[0].newPos + 1 >= newLen && oldPos + 1 >= oldLen) {
+      // Identity per the equality and tokenizer
+      return done([{ value: this.join(newString), count: newString.length }]);
+    }
+
+    // Main worker method. checks all permutations of a given edit length for acceptance.
+    function execEditLength() {
+      for (var diagonalPath = -1 * editLength; diagonalPath <= editLength; diagonalPath += 2) {
+        var basePath = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+        var addPath = bestPath[diagonalPath - 1],
+            removePath = bestPath[diagonalPath + 1],
+            _oldPos = (removePath ? removePath.newPos : 0) - diagonalPath;
+        if (addPath) {
+          // No one else is going to attempt to use this value, clear it
+          bestPath[diagonalPath - 1] = undefined;
+        }
+
+        var canAdd = addPath && addPath.newPos + 1 < newLen,
+            canRemove = removePath && 0 <= _oldPos && _oldPos < oldLen;
+        if (!canAdd && !canRemove) {
+          // If this path is a terminal then prune
+          bestPath[diagonalPath] = undefined;
+          continue;
+        }
+
+        // Select the diagonal that we want to branch from. We select the prior
+        // path whose position in the new string is the farthest from the origin
+        // and does not pass the bounds of the diff graph
+        if (!canAdd || canRemove && addPath.newPos < removePath.newPos) {
+          basePath = clonePath(removePath);
+          self.pushComponent(basePath.components, undefined, true);
+        } else {
+          basePath = addPath; // No need to clone, we've pulled it from the list
+          basePath.newPos++;
+          self.pushComponent(basePath.components, true, undefined);
+        }
+
+        _oldPos = self.extractCommon(basePath, newString, oldString, diagonalPath);
+
+        // If we have hit the end of both strings, then we are done
+        if (basePath.newPos + 1 >= newLen && _oldPos + 1 >= oldLen) {
+          return done(buildValues(self, basePath.components, newString, oldString, self.useLongestToken));
+        } else {
+          // Otherwise track this path as a potential candidate and continue.
+          bestPath[diagonalPath] = basePath;
+        }
+      }
+
+      editLength++;
+    }
+
+    // Performs the length of edit iteration. Is a bit fugly as this has to support the
+    // sync and async mode which is never fun. Loops over execEditLength until a value
+    // is produced.
+    if (callback) {
+      (function exec() {
+        setTimeout(function () {
+          // This should not happen, but we want to be safe.
+          /* istanbul ignore next */
+          if (editLength > maxEditLength) {
+            return callback();
+          }
+
+          if (!execEditLength()) {
+            exec();
+          }
+        }, 0);
+      })();
+    } else {
+      while (editLength <= maxEditLength) {
+        var ret = execEditLength();
+        if (ret) {
+          return ret;
+        }
+      }
+    }
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/pushComponent: function pushComponent(components, added, removed) {
+    var last = components[components.length - 1];
+    if (last && last.added === added && last.removed === removed) {
+      // We need to clone here as the component clone operation is just
+      // as shallow array clone
+      components[components.length - 1] = { count: last.count + 1, added: added, removed: removed };
+    } else {
+      components.push({ count: 1, added: added, removed: removed });
+    }
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/extractCommon: function extractCommon(basePath, newString, oldString, diagonalPath) {
+    var newLen = newString.length,
+        oldLen = oldString.length,
+        newPos = basePath.newPos,
+        oldPos = newPos - diagonalPath,
+        commonCount = 0;
+    while (newPos + 1 < newLen && oldPos + 1 < oldLen && this.equals(newString[newPos + 1], oldString[oldPos + 1])) {
+      newPos++;
+      oldPos++;
+      commonCount++;
+    }
+
+    if (commonCount) {
+      basePath.components.push({ count: commonCount });
+    }
+
+    basePath.newPos = newPos;
+    return oldPos;
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/equals: function equals(left, right) {
+    if (this.options.comparator) {
+      return this.options.comparator(left, right);
+    } else {
+      return left === right || this.options.ignoreCase && left.toLowerCase() === right.toLowerCase();
+    }
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/removeEmpty: function removeEmpty(array) {
+    var ret = [];
+    for (var i = 0; i < array.length; i++) {
+      if (array[i]) {
+        ret.push(array[i]);
+      }
+    }
+    return ret;
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/castInput: function castInput(value) {
+    return value;
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/tokenize: function tokenize(value) {
+    return value.split('');
+  },
+  /*istanbul ignore start*/ /*istanbul ignore end*/join: function join(chars) {
+    return chars.join('');
+  }
+};
+
+function buildValues(diff, components, newString, oldString, useLongestToken) {
+  var componentPos = 0,
+      componentLen = components.length,
+      newPos = 0,
+      oldPos = 0;
+
+  for (; componentPos < componentLen; componentPos++) {
+    var component = components[componentPos];
+    if (!component.removed) {
+      if (!component.added && useLongestToken) {
+        var value = newString.slice(newPos, newPos + component.count);
+        value = value.map(function (value, i) {
+          var oldValue = oldString[oldPos + i];
+          return oldValue.length > value.length ? oldValue : value;
+        });
+
+        component.value = diff.join(value);
+      } else {
+        component.value = diff.join(newString.slice(newPos, newPos + component.count));
+      }
+      newPos += component.count;
+
+      // Common case
+      if (!component.added) {
+        oldPos += component.count;
+      }
+    } else {
+      component.value = diff.join(oldString.slice(oldPos, oldPos + component.count));
+      oldPos += component.count;
+
+      // Reverse add and remove so removes are output first to match common convention
+      // The diffing algorithm is tied to add then remove output and this is the simplest
+      // route to get the desired output with minimal overhead.
+      if (componentPos && components[componentPos - 1].added) {
+        var tmp = components[componentPos - 1];
+        components[componentPos - 1] = components[componentPos];
+        components[componentPos] = tmp;
+      }
+    }
+  }
+
+  // Special case handle for when one terminal is ignored (i.e. whitespace).
+  // For this case we merge the terminal into the prior string and drop the change.
+  // This is only available for string mode.
+  var lastComponent = components[componentLen - 1];
+  if (componentLen > 1 && typeof lastComponent.value === 'string' && (lastComponent.added || lastComponent.removed) && diff.equals('', lastComponent.value)) {
+    components[componentLen - 2].value += lastComponent.value;
+    components.pop();
+  }
+
+  return components;
+}
+
+function clonePath(path) {
+  return { newPos: path.newPos, components: path.components.slice(0) };
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2Jhc2UuanMiXSwibmFtZXMiOlsiRGlmZiIsInByb3RvdHlwZSIsImRpZmYiLCJvbGRTdHJpbmciLCJuZXdTdHJpbmciLCJvcHRpb25zIiwiY2FsbGJhY2siLCJzZWxmIiwiZG9uZSIsInZhbHVlIiwic2V0VGltZW91dCIsInVuZGVmaW5lZCIsImNhc3RJbnB1dCIsInJlbW92ZUVtcHR5IiwidG9rZW5pemUiLCJuZXdMZW4iLCJsZW5ndGgiLCJvbGRMZW4iLCJlZGl0TGVuZ3RoIiwibWF4RWRpdExlbmd0aCIsImJlc3RQYXRoIiwibmV3UG9zIiwiY29tcG9uZW50cyIsIm9sZFBvcyIsImV4dHJhY3RDb21tb24iLCJqb2luIiwiY291bnQiLCJleGVjRWRpdExlbmd0aCIsImRpYWdvbmFsUGF0aCIsImJhc2VQYXRoIiwiYWRkUGF0aCIsInJlbW92ZVBhdGgiLCJjYW5BZGQiLCJjYW5SZW1vdmUiLCJjbG9uZVBhdGgiLCJwdXNoQ29tcG9uZW50IiwiYnVpbGRWYWx1ZXMiLCJ1c2VMb25nZXN0VG9rZW4iLCJleGVjIiwicmV0IiwiYWRkZWQiLCJyZW1vdmVkIiwibGFzdCIsInB1c2giLCJjb21tb25Db3VudCIsImVxdWFscyIsImxlZnQiLCJyaWdodCIsImNvbXBhcmF0b3IiLCJpZ25vcmVDYXNlIiwidG9Mb3dlckNhc2UiLCJhcnJheSIsImkiLCJzcGxpdCIsImNoYXJzIiwiY29tcG9uZW50UG9zIiwiY29tcG9uZW50TGVuIiwiY29tcG9uZW50Iiwic2xpY2UiLCJtYXAiLCJvbGRWYWx1ZSIsInRtcCIsImxhc3RDb21wb25lbnQiLCJwb3AiLCJwYXRoIl0sIm1hcHBpbmdzIjoiOzs7NENBQXdCQSxJO0FBQVQsU0FBU0EsSUFBVCxHQUFnQixDQUFFOztBQUVqQ0EsS0FBS0MsU0FBTCxHQUFpQjtBQUFBLG1EQUNmQyxJQURlLGdCQUNWQyxTQURVLEVBQ0NDLFNBREQsRUFDMEI7QUFBQSx3REFBZEMsT0FBYyx1RUFBSixFQUFJOztBQUN2QyxRQUFJQyxXQUFXRCxRQUFRQyxRQUF2QjtBQUNBLFFBQUksT0FBT0QsT0FBUCxLQUFtQixVQUF2QixFQUFtQztBQUNqQ0MsaUJBQVdELE9BQVg7QUFDQUEsZ0JBQVUsRUFBVjtBQUNEO0FBQ0QsU0FBS0EsT0FBTCxHQUFlQSxPQUFmOztBQUVBLFFBQUlFLE9BQU8sSUFBWDs7QUFFQSxhQUFTQyxJQUFULENBQWNDLEtBQWQsRUFBcUI7QUFDbkIsVUFBSUgsUUFBSixFQUFjO0FBQ1pJLG1CQUFXLFlBQVc7QUFBRUosbUJBQVNLLFNBQVQsRUFBb0JGLEtBQXBCO0FBQTZCLFNBQXJELEVBQXVELENBQXZEO0FBQ0EsZUFBTyxJQUFQO0FBQ0QsT0FIRCxNQUdPO0FBQ0wsZUFBT0EsS0FBUDtBQUNEO0FBQ0Y7O0FBRUQ7QUFDQU4sZ0JBQVksS0FBS1MsU0FBTCxDQUFlVCxTQUFmLENBQVo7QUFDQUMsZ0JBQVksS0FBS1EsU0FBTCxDQUFlUixTQUFmLENBQVo7O0FBRUFELGdCQUFZLEtBQUtVLFdBQUwsQ0FBaUIsS0FBS0MsUUFBTCxDQUFjWCxTQUFkLENBQWpCLENBQVo7QUFDQUMsZ0JBQVksS0FBS1MsV0FBTCxDQUFpQixLQUFLQyxRQUFMLENBQWNWLFNBQWQsQ0FBakIsQ0FBWjs7QUFFQSxRQUFJVyxTQUFTWCxVQUFVWSxNQUF2QjtBQUFBLFFBQStCQyxTQUFTZCxVQUFVYSxNQUFsRDtBQUNBLFFBQUlFLGFBQWEsQ0FBakI7QUFDQSxRQUFJQyxnQkFBZ0JKLFNBQVNFLE1BQTdCO0FBQ0EsUUFBSUcsV0FBVyxDQUFDLEVBQUVDLFFBQVEsQ0FBQyxDQUFYLEVBQWNDLFlBQVksRUFBMUIsRUFBRCxDQUFmOztBQUVBO0FBQ0EsUUFBSUMsU0FBUyxLQUFLQyxhQUFMLENBQW1CSixTQUFTLENBQVQsQ0FBbkIsRUFBZ0NoQixTQUFoQyxFQUEyQ0QsU0FBM0MsRUFBc0QsQ0FBdEQsQ0FBYjtBQUNBLFFBQUlpQixTQUFTLENBQVQsRUFBWUMsTUFBWixHQUFxQixDQUFyQixJQUEwQk4sTUFBMUIsSUFBb0NRLFNBQVMsQ0FBVCxJQUFjTixNQUF0RCxFQUE4RDtBQUM1RDtBQUNBLGFBQU9ULEtBQUssQ0FBQyxFQUFDQyxPQUFPLEtBQUtnQixJQUFMLENBQVVyQixTQUFWLENBQVIsRUFBOEJzQixPQUFPdEIsVUFBVVksTUFBL0MsRUFBRCxDQUFMLENBQVA7QUFDRDs7QUFFRDtBQUNBLGFBQVNXLGNBQVQsR0FBMEI7QUFDeEIsV0FBSyxJQUFJQyxlQUFlLENBQUMsQ0FBRCxHQUFLVixVQUE3QixFQUF5Q1UsZ0JBQWdCVixVQUF6RCxFQUFxRVUsZ0JBQWdCLENBQXJGLEVBQXdGO0FBQ3RGLFlBQUlDLDBDQUFKO0FBQ0EsWUFBSUMsVUFBVVYsU0FBU1EsZUFBZSxDQUF4QixDQUFkO0FBQUEsWUFDSUcsYUFBYVgsU0FBU1EsZUFBZSxDQUF4QixDQURqQjtBQUFBLFlBRUlMLFVBQVMsQ0FBQ1EsYUFBYUEsV0FBV1YsTUFBeEIsR0FBaUMsQ0FBbEMsSUFBdUNPLFlBRnBEO0FBR0EsWUFBSUUsT0FBSixFQUFhO0FBQ1g7QUFDQVYsbUJBQVNRLGVBQWUsQ0FBeEIsSUFBNkJqQixTQUE3QjtBQUNEOztBQUVELFlBQUlxQixTQUFTRixXQUFXQSxRQUFRVCxNQUFSLEdBQWlCLENBQWpCLEdBQXFCTixNQUE3QztBQUFBLFlBQ0lrQixZQUFZRixjQUFjLEtBQUtSLE9BQW5CLElBQTZCQSxVQUFTTixNQUR0RDtBQUVBLFlBQUksQ0FBQ2UsTUFBRCxJQUFXLENBQUNDLFNBQWhCLEVBQTJCO0FBQ3pCO0FBQ0FiLG1CQUFTUSxZQUFULElBQXlCakIsU0FBekI7QUFDQTtBQUNEOztBQUVEO0FBQ0E7QUFDQTtBQUNBLFlBQUksQ0FBQ3FCLE1BQUQsSUFBWUMsYUFBYUgsUUFBUVQsTUFBUixHQUFpQlUsV0FBV1YsTUFBekQsRUFBa0U7QUFDaEVRLHFCQUFXSyxVQUFVSCxVQUFWLENBQVg7QUFDQXhCLGVBQUs0QixhQUFMLENBQW1CTixTQUFTUCxVQUE1QixFQUF3Q1gsU0FBeEMsRUFBbUQsSUFBbkQ7QUFDRCxTQUhELE1BR087QUFDTGtCLHFCQUFXQyxPQUFYLENBREssQ0FDaUI7QUFDdEJELG1CQUFTUixNQUFUO0FBQ0FkLGVBQUs0QixhQUFMLENBQW1CTixTQUFTUCxVQUE1QixFQUF3QyxJQUF4QyxFQUE4Q1gsU0FBOUM7QUFDRDs7QUFFRFksa0JBQVNoQixLQUFLaUIsYUFBTCxDQUFtQkssUUFBbkIsRUFBNkJ6QixTQUE3QixFQUF3Q0QsU0FBeEMsRUFBbUR5QixZQUFuRCxDQUFUOztBQUVBO0FBQ0EsWUFBSUMsU0FBU1IsTUFBVCxHQUFrQixDQUFsQixJQUF1Qk4sTUFBdkIsSUFBaUNRLFVBQVMsQ0FBVCxJQUFjTixNQUFuRCxFQUEyRDtBQUN6RCxpQkFBT1QsS0FBSzRCLFlBQVk3QixJQUFaLEVBQWtCc0IsU0FBU1AsVUFBM0IsRUFBdUNsQixTQUF2QyxFQUFrREQsU0FBbEQsRUFBNkRJLEtBQUs4QixlQUFsRSxDQUFMLENBQVA7QUFDRCxTQUZELE1BRU87QUFDTDtBQUNBakIsbUJBQVNRLFlBQVQsSUFBeUJDLFFBQXpCO0FBQ0Q7QUFDRjs7QUFFRFg7QUFDRDs7QUFFRDtBQUNBO0FBQ0E7QUFDQSxRQUFJWixRQUFKLEVBQWM7QUFDWCxnQkFBU2dDLElBQVQsR0FBZ0I7QUFDZjVCLG1CQUFXLFlBQVc7QUFDcEI7QUFDQTtBQUNBLGNBQUlRLGFBQWFDLGFBQWpCLEVBQWdDO0FBQzlCLG1CQUFPYixVQUFQO0FBQ0Q7O0FBRUQsY0FBSSxDQUFDcUIsZ0JBQUwsRUFBdUI7QUFDckJXO0FBQ0Q7QUFDRixTQVZELEVBVUcsQ0FWSDtBQVdELE9BWkEsR0FBRDtBQWFELEtBZEQsTUFjTztBQUNMLGFBQU9wQixjQUFjQyxhQUFyQixFQUFvQztBQUNsQyxZQUFJb0IsTUFBTVosZ0JBQVY7QUFDQSxZQUFJWSxHQUFKLEVBQVM7QUFDUCxpQkFBT0EsR0FBUDtBQUNEO0FBQ0Y7QUFDRjtBQUNGLEdBOUdjO0FBQUEsbURBZ0hmSixhQWhIZSx5QkFnSERiLFVBaEhDLEVBZ0hXa0IsS0FoSFgsRUFnSGtCQyxPQWhIbEIsRUFnSDJCO0FBQ3hDLFFBQUlDLE9BQU9wQixXQUFXQSxXQUFXTixNQUFYLEdBQW9CLENBQS9CLENBQVg7QUFDQSxRQUFJMEIsUUFBUUEsS0FBS0YsS0FBTCxLQUFlQSxLQUF2QixJQUFnQ0UsS0FBS0QsT0FBTCxLQUFpQkEsT0FBckQsRUFBOEQ7QUFDNUQ7QUFDQTtBQUNBbkIsaUJBQVdBLFdBQVdOLE1BQVgsR0FBb0IsQ0FBL0IsSUFBb0MsRUFBQ1UsT0FBT2dCLEtBQUtoQixLQUFMLEdBQWEsQ0FBckIsRUFBd0JjLE9BQU9BLEtBQS9CLEVBQXNDQyxTQUFTQSxPQUEvQyxFQUFwQztBQUNELEtBSkQsTUFJTztBQUNMbkIsaUJBQVdxQixJQUFYLENBQWdCLEVBQUNqQixPQUFPLENBQVIsRUFBV2MsT0FBT0EsS0FBbEIsRUFBeUJDLFNBQVNBLE9BQWxDLEVBQWhCO0FBQ0Q7QUFDRixHQXpIYztBQUFBLG1EQTBIZmpCLGFBMUhlLHlCQTBIREssUUExSEMsRUEwSFN6QixTQTFIVCxFQTBIb0JELFNBMUhwQixFQTBIK0J5QixZQTFIL0IsRUEwSDZDO0FBQzFELFFBQUliLFNBQVNYLFVBQVVZLE1BQXZCO0FBQUEsUUFDSUMsU0FBU2QsVUFBVWEsTUFEdkI7QUFBQSxRQUVJSyxTQUFTUSxTQUFTUixNQUZ0QjtBQUFBLFFBR0lFLFNBQVNGLFNBQVNPLFlBSHRCO0FBQUEsUUFLSWdCLGNBQWMsQ0FMbEI7QUFNQSxXQUFPdkIsU0FBUyxDQUFULEdBQWFOLE1BQWIsSUFBdUJRLFNBQVMsQ0FBVCxHQUFhTixNQUFwQyxJQUE4QyxLQUFLNEIsTUFBTCxDQUFZekMsVUFBVWlCLFNBQVMsQ0FBbkIsQ0FBWixFQUFtQ2xCLFVBQVVvQixTQUFTLENBQW5CLENBQW5DLENBQXJELEVBQWdIO0FBQzlHRjtBQUNBRTtBQUNBcUI7QUFDRDs7QUFFRCxRQUFJQSxXQUFKLEVBQWlCO0FBQ2ZmLGVBQVNQLFVBQVQsQ0FBb0JxQixJQUFwQixDQUF5QixFQUFDakIsT0FBT2tCLFdBQVIsRUFBekI7QUFDRDs7QUFFRGYsYUFBU1IsTUFBVCxHQUFrQkEsTUFBbEI7QUFDQSxXQUFPRSxNQUFQO0FBQ0QsR0E3SWM7QUFBQSxtREErSWZzQixNQS9JZSxrQkErSVJDLElBL0lRLEVBK0lGQyxLQS9JRSxFQStJSztBQUNsQixRQUFJLEtBQUsxQyxPQUFMLENBQWEyQyxVQUFqQixFQUE2QjtBQUMzQixhQUFPLEtBQUszQyxPQUFMLENBQWEyQyxVQUFiLENBQXdCRixJQUF4QixFQUE4QkMsS0FBOUIsQ0FBUDtBQUNELEtBRkQsTUFFTztBQUNMLGFBQU9ELFNBQVNDLEtBQVQsSUFDRCxLQUFLMUMsT0FBTCxDQUFhNEMsVUFBYixJQUEyQkgsS0FBS0ksV0FBTCxPQUF1QkgsTUFBTUcsV0FBTixFQUR4RDtBQUVEO0FBQ0YsR0F0SmM7QUFBQSxtREF1SmZyQyxXQXZKZSx1QkF1SkhzQyxLQXZKRyxFQXVKSTtBQUNqQixRQUFJWixNQUFNLEVBQVY7QUFDQSxTQUFLLElBQUlhLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsTUFBTW5DLE1BQTFCLEVBQWtDb0MsR0FBbEMsRUFBdUM7QUFDckMsVUFBSUQsTUFBTUMsQ0FBTixDQUFKLEVBQWM7QUFDWmIsWUFBSUksSUFBSixDQUFTUSxNQUFNQyxDQUFOLENBQVQ7QUFDRDtBQUNGO0FBQ0QsV0FBT2IsR0FBUDtBQUNELEdBL0pjO0FBQUEsbURBZ0tmM0IsU0FoS2UscUJBZ0tMSCxLQWhLSyxFQWdLRTtBQUNmLFdBQU9BLEtBQVA7QUFDRCxHQWxLYztBQUFBLG1EQW1LZkssUUFuS2Usb0JBbUtOTCxLQW5LTSxFQW1LQztBQUNkLFdBQU9BLE1BQU00QyxLQUFOLENBQVksRUFBWixDQUFQO0FBQ0QsR0FyS2M7QUFBQSxtREFzS2Y1QixJQXRLZSxnQkFzS1Y2QixLQXRLVSxFQXNLSDtBQUNWLFdBQU9BLE1BQU03QixJQUFOLENBQVcsRUFBWCxDQUFQO0FBQ0Q7QUF4S2MsQ0FBakI7O0FBMktBLFNBQVNXLFdBQVQsQ0FBcUJsQyxJQUFyQixFQUEyQm9CLFVBQTNCLEVBQXVDbEIsU0FBdkMsRUFBa0RELFNBQWxELEVBQTZEa0MsZUFBN0QsRUFBOEU7QUFDNUUsTUFBSWtCLGVBQWUsQ0FBbkI7QUFBQSxNQUNJQyxlQUFlbEMsV0FBV04sTUFEOUI7QUFBQSxNQUVJSyxTQUFTLENBRmI7QUFBQSxNQUdJRSxTQUFTLENBSGI7O0FBS0EsU0FBT2dDLGVBQWVDLFlBQXRCLEVBQW9DRCxjQUFwQyxFQUFvRDtBQUNsRCxRQUFJRSxZQUFZbkMsV0FBV2lDLFlBQVgsQ0FBaEI7QUFDQSxRQUFJLENBQUNFLFVBQVVoQixPQUFmLEVBQXdCO0FBQ3RCLFVBQUksQ0FBQ2dCLFVBQVVqQixLQUFYLElBQW9CSCxlQUF4QixFQUF5QztBQUN2QyxZQUFJNUIsUUFBUUwsVUFBVXNELEtBQVYsQ0FBZ0JyQyxNQUFoQixFQUF3QkEsU0FBU29DLFVBQVUvQixLQUEzQyxDQUFaO0FBQ0FqQixnQkFBUUEsTUFBTWtELEdBQU4sQ0FBVSxVQUFTbEQsS0FBVCxFQUFnQjJDLENBQWhCLEVBQW1CO0FBQ25DLGNBQUlRLFdBQVd6RCxVQUFVb0IsU0FBUzZCLENBQW5CLENBQWY7QUFDQSxpQkFBT1EsU0FBUzVDLE1BQVQsR0FBa0JQLE1BQU1PLE1BQXhCLEdBQWlDNEMsUUFBakMsR0FBNENuRCxLQUFuRDtBQUNELFNBSE8sQ0FBUjs7QUFLQWdELGtCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVWhCLEtBQVYsQ0FBbEI7QUFDRCxPQVJELE1BUU87QUFDTGdELGtCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVXJCLFVBQVVzRCxLQUFWLENBQWdCckMsTUFBaEIsRUFBd0JBLFNBQVNvQyxVQUFVL0IsS0FBM0MsQ0FBVixDQUFsQjtBQUNEO0FBQ0RMLGdCQUFVb0MsVUFBVS9CLEtBQXBCOztBQUVBO0FBQ0EsVUFBSSxDQUFDK0IsVUFBVWpCLEtBQWYsRUFBc0I7QUFDcEJqQixrQkFBVWtDLFVBQVUvQixLQUFwQjtBQUNEO0FBQ0YsS0FsQkQsTUFrQk87QUFDTCtCLGdCQUFVaEQsS0FBVixHQUFrQlAsS0FBS3VCLElBQUwsQ0FBVXRCLFVBQVV1RCxLQUFWLENBQWdCbkMsTUFBaEIsRUFBd0JBLFNBQVNrQyxVQUFVL0IsS0FBM0MsQ0FBVixDQUFsQjtBQUNBSCxnQkFBVWtDLFVBQVUvQixLQUFwQjs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxVQUFJNkIsZ0JBQWdCakMsV0FBV2lDLGVBQWUsQ0FBMUIsRUFBNkJmLEtBQWpELEVBQXdEO0FBQ3RELFlBQUlxQixNQUFNdkMsV0FBV2lDLGVBQWUsQ0FBMUIsQ0FBVjtBQUNBakMsbUJBQVdpQyxlQUFlLENBQTFCLElBQStCakMsV0FBV2lDLFlBQVgsQ0FBL0I7QUFDQWpDLG1CQUFXaUMsWUFBWCxJQUEyQk0sR0FBM0I7QUFDRDtBQUNGO0FBQ0Y7O0FBRUQ7QUFDQTtBQUNBO0FBQ0EsTUFBSUMsZ0JBQWdCeEMsV0FBV2tDLGVBQWUsQ0FBMUIsQ0FBcEI7QUFDQSxNQUFJQSxlQUFlLENBQWYsSUFDRyxPQUFPTSxjQUFjckQsS0FBckIsS0FBK0IsUUFEbEMsS0FFSXFELGNBQWN0QixLQUFkLElBQXVCc0IsY0FBY3JCLE9BRnpDLEtBR0d2QyxLQUFLMkMsTUFBTCxDQUFZLEVBQVosRUFBZ0JpQixjQUFjckQsS0FBOUIsQ0FIUCxFQUc2QztBQUMzQ2EsZUFBV2tDLGVBQWUsQ0FBMUIsRUFBNkIvQyxLQUE3QixJQUFzQ3FELGNBQWNyRCxLQUFwRDtBQUNBYSxlQUFXeUMsR0FBWDtBQUNEOztBQUVELFNBQU96QyxVQUFQO0FBQ0Q7O0FBRUQsU0FBU1ksU0FBVCxDQUFtQjhCLElBQW5CLEVBQXlCO0FBQ3ZCLFNBQU8sRUFBRTNDLFFBQVEyQyxLQUFLM0MsTUFBZixFQUF1QkMsWUFBWTBDLEtBQUsxQyxVQUFMLENBQWdCb0MsS0FBaEIsQ0FBc0IsQ0FBdEIsQ0FBbkMsRUFBUDtBQUNEIiwiZmlsZSI6ImJhc2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZGVmYXVsdCBmdW5jdGlvbiBEaWZmKCkge31cblxuRGlmZi5wcm90b3R5cGUgPSB7XG4gIGRpZmYob2xkU3RyaW5nLCBuZXdTdHJpbmcsIG9wdGlvbnMgPSB7fSkge1xuICAgIGxldCBjYWxsYmFjayA9IG9wdGlvbnMuY2FsbGJhY2s7XG4gICAgaWYgKHR5cGVvZiBvcHRpb25zID09PSAnZnVuY3Rpb24nKSB7XG4gICAgICBjYWxsYmFjayA9IG9wdGlvbnM7XG4gICAgICBvcHRpb25zID0ge307XG4gICAgfVxuICAgIHRoaXMub3B0aW9ucyA9IG9wdGlvbnM7XG5cbiAgICBsZXQgc2VsZiA9IHRoaXM7XG5cbiAgICBmdW5jdGlvbiBkb25lKHZhbHVlKSB7XG4gICAgICBpZiAoY2FsbGJhY2spIHtcbiAgICAgICAgc2V0VGltZW91dChmdW5jdGlvbigpIHsgY2FsbGJhY2sodW5kZWZpbmVkLCB2YWx1ZSk7IH0sIDApO1xuICAgICAgICByZXR1cm4gdHJ1ZTtcbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIHJldHVybiB2YWx1ZTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICAvLyBBbGxvdyBzdWJjbGFzc2VzIHRvIG1hc3NhZ2UgdGhlIGlucHV0IHByaW9yIHRvIHJ1bm5pbmdcbiAgICBvbGRTdHJpbmcgPSB0aGlzLmNhc3RJbnB1dChvbGRTdHJpbmcpO1xuICAgIG5ld1N0cmluZyA9IHRoaXMuY2FzdElucHV0KG5ld1N0cmluZyk7XG5cbiAgICBvbGRTdHJpbmcgPSB0aGlzLnJlbW92ZUVtcHR5KHRoaXMudG9rZW5pemUob2xkU3RyaW5nKSk7XG4gICAgbmV3U3RyaW5nID0gdGhpcy5yZW1vdmVFbXB0eSh0aGlzLnRva2VuaXplKG5ld1N0cmluZykpO1xuXG4gICAgbGV0IG5ld0xlbiA9IG5ld1N0cmluZy5sZW5ndGgsIG9sZExlbiA9IG9sZFN0cmluZy5sZW5ndGg7XG4gICAgbGV0IGVkaXRMZW5ndGggPSAxO1xuICAgIGxldCBtYXhFZGl0TGVuZ3RoID0gbmV3TGVuICsgb2xkTGVuO1xuICAgIGxldCBiZXN0UGF0aCA9IFt7IG5ld1BvczogLTEsIGNvbXBvbmVudHM6IFtdIH1dO1xuXG4gICAgLy8gU2VlZCBlZGl0TGVuZ3RoID0gMCwgaS5lLiB0aGUgY29udGVudCBzdGFydHMgd2l0aCB0aGUgc2FtZSB2YWx1ZXNcbiAgICBsZXQgb2xkUG9zID0gdGhpcy5leHRyYWN0Q29tbW9uKGJlc3RQYXRoWzBdLCBuZXdTdHJpbmcsIG9sZFN0cmluZywgMCk7XG4gICAgaWYgKGJlc3RQYXRoWzBdLm5ld1BvcyArIDEgPj0gbmV3TGVuICYmIG9sZFBvcyArIDEgPj0gb2xkTGVuKSB7XG4gICAgICAvLyBJZGVudGl0eSBwZXIgdGhlIGVxdWFsaXR5IGFuZCB0b2tlbml6ZXJcbiAgICAgIHJldHVybiBkb25lKFt7dmFsdWU6IHRoaXMuam9pbihuZXdTdHJpbmcpLCBjb3VudDogbmV3U3RyaW5nLmxlbmd0aH1dKTtcbiAgICB9XG5cbiAgICAvLyBNYWluIHdvcmtlciBtZXRob2QuIGNoZWNrcyBhbGwgcGVybXV0YXRpb25zIG9mIGEgZ2l2ZW4gZWRpdCBsZW5ndGggZm9yIGFjY2VwdGFuY2UuXG4gICAgZnVuY3Rpb24gZXhlY0VkaXRMZW5ndGgoKSB7XG4gICAgICBmb3IgKGxldCBkaWFnb25hbFBhdGggPSAtMSAqIGVkaXRMZW5ndGg7IGRpYWdvbmFsUGF0aCA8PSBlZGl0TGVuZ3RoOyBkaWFnb25hbFBhdGggKz0gMikge1xuICAgICAgICBsZXQgYmFzZVBhdGg7XG4gICAgICAgIGxldCBhZGRQYXRoID0gYmVzdFBhdGhbZGlhZ29uYWxQYXRoIC0gMV0sXG4gICAgICAgICAgICByZW1vdmVQYXRoID0gYmVzdFBhdGhbZGlhZ29uYWxQYXRoICsgMV0sXG4gICAgICAgICAgICBvbGRQb3MgPSAocmVtb3ZlUGF0aCA/IHJlbW92ZVBhdGgubmV3UG9zIDogMCkgLSBkaWFnb25hbFBhdGg7XG4gICAgICAgIGlmIChhZGRQYXRoKSB7XG4gICAgICAgICAgLy8gTm8gb25lIGVsc2UgaXMgZ29pbmcgdG8gYXR0ZW1wdCB0byB1c2UgdGhpcyB2YWx1ZSwgY2xlYXIgaXRcbiAgICAgICAgICBiZXN0UGF0aFtkaWFnb25hbFBhdGggLSAxXSA9IHVuZGVmaW5lZDtcbiAgICAgICAgfVxuXG4gICAgICAgIGxldCBjYW5BZGQgPSBhZGRQYXRoICYmIGFkZFBhdGgubmV3UG9zICsgMSA8IG5ld0xlbixcbiAgICAgICAgICAgIGNhblJlbW92ZSA9IHJlbW92ZVBhdGggJiYgMCA8PSBvbGRQb3MgJiYgb2xkUG9zIDwgb2xkTGVuO1xuICAgICAgICBpZiAoIWNhbkFkZCAmJiAhY2FuUmVtb3ZlKSB7XG4gICAgICAgICAgLy8gSWYgdGhpcyBwYXRoIGlzIGEgdGVybWluYWwgdGhlbiBwcnVuZVxuICAgICAgICAgIGJlc3RQYXRoW2RpYWdvbmFsUGF0aF0gPSB1bmRlZmluZWQ7XG4gICAgICAgICAgY29udGludWU7XG4gICAgICAgIH1cblxuICAgICAgICAvLyBTZWxlY3QgdGhlIGRpYWdvbmFsIHRoYXQgd2Ugd2FudCB0byBicmFuY2ggZnJvbS4gV2Ugc2VsZWN0IHRoZSBwcmlvclxuICAgICAgICAvLyBwYXRoIHdob3NlIHBvc2l0aW9uIGluIHRoZSBuZXcgc3RyaW5nIGlzIHRoZSBmYXJ0aGVzdCBmcm9tIHRoZSBvcmlnaW5cbiAgICAgICAgLy8gYW5kIGRvZXMgbm90IHBhc3MgdGhlIGJvdW5kcyBvZiB0aGUgZGlmZiBncmFwaFxuICAgICAgICBpZiAoIWNhbkFkZCB8fCAoY2FuUmVtb3ZlICYmIGFkZFBhdGgubmV3UG9zIDwgcmVtb3ZlUGF0aC5uZXdQb3MpKSB7XG4gICAgICAgICAgYmFzZVBhdGggPSBjbG9uZVBhdGgocmVtb3ZlUGF0aCk7XG4gICAgICAgICAgc2VsZi5wdXNoQ29tcG9uZW50KGJhc2VQYXRoLmNvbXBvbmVudHMsIHVuZGVmaW5lZCwgdHJ1ZSk7XG4gICAgICAgIH0gZWxzZSB7XG4gICAgICAgICAgYmFzZVBhdGggPSBhZGRQYXRoOyAgIC8vIE5vIG5lZWQgdG8gY2xvbmUsIHdlJ3ZlIHB1bGxlZCBpdCBmcm9tIHRoZSBsaXN0XG4gICAgICAgICAgYmFzZVBhdGgubmV3UG9zKys7XG4gICAgICAgICAgc2VsZi5wdXNoQ29tcG9uZW50KGJhc2VQYXRoLmNvbXBvbmVudHMsIHRydWUsIHVuZGVmaW5lZCk7XG4gICAgICAgIH1cblxuICAgICAgICBvbGRQb3MgPSBzZWxmLmV4dHJhY3RDb21tb24oYmFzZVBhdGgsIG5ld1N0cmluZywgb2xkU3RyaW5nLCBkaWFnb25hbFBhdGgpO1xuXG4gICAgICAgIC8vIElmIHdlIGhhdmUgaGl0IHRoZSBlbmQgb2YgYm90aCBzdHJpbmdzLCB0aGVuIHdlIGFyZSBkb25lXG4gICAgICAgIGlmIChiYXNlUGF0aC5uZXdQb3MgKyAxID49IG5ld0xlbiAmJiBvbGRQb3MgKyAxID49IG9sZExlbikge1xuICAgICAgICAgIHJldHVybiBkb25lKGJ1aWxkVmFsdWVzKHNlbGYsIGJhc2VQYXRoLmNvbXBvbmVudHMsIG5ld1N0cmluZywgb2xkU3RyaW5nLCBzZWxmLnVzZUxvbmdlc3RUb2tlbikpO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIE90aGVyd2lzZSB0cmFjayB0aGlzIHBhdGggYXMgYSBwb3RlbnRpYWwgY2FuZGlkYXRlIGFuZCBjb250aW51ZS5cbiAgICAgICAgICBiZXN0UGF0aFtkaWFnb25hbFBhdGhdID0gYmFzZVBhdGg7XG4gICAgICAgIH1cbiAgICAgIH1cblxuICAgICAgZWRpdExlbmd0aCsrO1xuICAgIH1cblxuICAgIC8vIFBlcmZvcm1zIHRoZSBsZW5ndGggb2YgZWRpdCBpdGVyYXRpb24uIElzIGEgYml0IGZ1Z2x5IGFzIHRoaXMgaGFzIHRvIHN1cHBvcnQgdGhlXG4gICAgLy8gc3luYyBhbmQgYXN5bmMgbW9kZSB3aGljaCBpcyBuZXZlciBmdW4uIExvb3BzIG92ZXIgZXhlY0VkaXRMZW5ndGggdW50aWwgYSB2YWx1ZVxuICAgIC8vIGlzIHByb2R1Y2VkLlxuICAgIGlmIChjYWxsYmFjaykge1xuICAgICAgKGZ1bmN0aW9uIGV4ZWMoKSB7XG4gICAgICAgIHNldFRpbWVvdXQoZnVuY3Rpb24oKSB7XG4gICAgICAgICAgLy8gVGhpcyBzaG91bGQgbm90IGhhcHBlbiwgYnV0IHdlIHdhbnQgdG8gYmUgc2FmZS5cbiAgICAgICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgbmV4dCAqL1xuICAgICAgICAgIGlmIChlZGl0TGVuZ3RoID4gbWF4RWRpdExlbmd0aCkge1xuICAgICAgICAgICAgcmV0dXJuIGNhbGxiYWNrKCk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKCFleGVjRWRpdExlbmd0aCgpKSB7XG4gICAgICAgICAgICBleGVjKCk7XG4gICAgICAgICAgfVxuICAgICAgICB9LCAwKTtcbiAgICAgIH0oKSk7XG4gICAgfSBlbHNlIHtcbiAgICAgIHdoaWxlIChlZGl0TGVuZ3RoIDw9IG1heEVkaXRMZW5ndGgpIHtcbiAgICAgICAgbGV0IHJldCA9IGV4ZWNFZGl0TGVuZ3RoKCk7XG4gICAgICAgIGlmIChyZXQpIHtcbiAgICAgICAgICByZXR1cm4gcmV0O1xuICAgICAgICB9XG4gICAgICB9XG4gICAgfVxuICB9LFxuXG4gIHB1c2hDb21wb25lbnQoY29tcG9uZW50cywgYWRkZWQsIHJlbW92ZWQpIHtcbiAgICBsZXQgbGFzdCA9IGNvbXBvbmVudHNbY29tcG9uZW50cy5sZW5ndGggLSAxXTtcbiAgICBpZiAobGFzdCAmJiBsYXN0LmFkZGVkID09PSBhZGRlZCAmJiBsYXN0LnJlbW92ZWQgPT09IHJlbW92ZWQpIHtcbiAgICAgIC8vIFdlIG5lZWQgdG8gY2xvbmUgaGVyZSBhcyB0aGUgY29tcG9uZW50IGNsb25lIG9wZXJhdGlvbiBpcyBqdXN0XG4gICAgICAvLyBhcyBzaGFsbG93IGFycmF5IGNsb25lXG4gICAgICBjb21wb25lbnRzW2NvbXBvbmVudHMubGVuZ3RoIC0gMV0gPSB7Y291bnQ6IGxhc3QuY291bnQgKyAxLCBhZGRlZDogYWRkZWQsIHJlbW92ZWQ6IHJlbW92ZWQgfTtcbiAgICB9IGVsc2Uge1xuICAgICAgY29tcG9uZW50cy5wdXNoKHtjb3VudDogMSwgYWRkZWQ6IGFkZGVkLCByZW1vdmVkOiByZW1vdmVkIH0pO1xuICAgIH1cbiAgfSxcbiAgZXh0cmFjdENvbW1vbihiYXNlUGF0aCwgbmV3U3RyaW5nLCBvbGRTdHJpbmcsIGRpYWdvbmFsUGF0aCkge1xuICAgIGxldCBuZXdMZW4gPSBuZXdTdHJpbmcubGVuZ3RoLFxuICAgICAgICBvbGRMZW4gPSBvbGRTdHJpbmcubGVuZ3RoLFxuICAgICAgICBuZXdQb3MgPSBiYXNlUGF0aC5uZXdQb3MsXG4gICAgICAgIG9sZFBvcyA9IG5ld1BvcyAtIGRpYWdvbmFsUGF0aCxcblxuICAgICAgICBjb21tb25Db3VudCA9IDA7XG4gICAgd2hpbGUgKG5ld1BvcyArIDEgPCBuZXdMZW4gJiYgb2xkUG9zICsgMSA8IG9sZExlbiAmJiB0aGlzLmVxdWFscyhuZXdTdHJpbmdbbmV3UG9zICsgMV0sIG9sZFN0cmluZ1tvbGRQb3MgKyAxXSkpIHtcbiAgICAgIG5ld1BvcysrO1xuICAgICAgb2xkUG9zKys7XG4gICAgICBjb21tb25Db3VudCsrO1xuICAgIH1cblxuICAgIGlmIChjb21tb25Db3VudCkge1xuICAgICAgYmFzZVBhdGguY29tcG9uZW50cy5wdXNoKHtjb3VudDogY29tbW9uQ291bnR9KTtcbiAgICB9XG5cbiAgICBiYXNlUGF0aC5uZXdQb3MgPSBuZXdQb3M7XG4gICAgcmV0dXJuIG9sZFBvcztcbiAgfSxcblxuICBlcXVhbHMobGVmdCwgcmlnaHQpIHtcbiAgICBpZiAodGhpcy5vcHRpb25zLmNvbXBhcmF0b3IpIHtcbiAgICAgIHJldHVybiB0aGlzLm9wdGlvbnMuY29tcGFyYXRvcihsZWZ0LCByaWdodCk7XG4gICAgfSBlbHNlIHtcbiAgICAgIHJldHVybiBsZWZ0ID09PSByaWdodFxuICAgICAgICB8fCAodGhpcy5vcHRpb25zLmlnbm9yZUNhc2UgJiYgbGVmdC50b0xvd2VyQ2FzZSgpID09PSByaWdodC50b0xvd2VyQ2FzZSgpKTtcbiAgICB9XG4gIH0sXG4gIHJlbW92ZUVtcHR5KGFycmF5KSB7XG4gICAgbGV0IHJldCA9IFtdO1xuICAgIGZvciAobGV0IGkgPSAwOyBpIDwgYXJyYXkubGVuZ3RoOyBpKyspIHtcbiAgICAgIGlmIChhcnJheVtpXSkge1xuICAgICAgICByZXQucHVzaChhcnJheVtpXSk7XG4gICAgICB9XG4gICAgfVxuICAgIHJldHVybiByZXQ7XG4gIH0sXG4gIGNhc3RJbnB1dCh2YWx1ZSkge1xuICAgIHJldHVybiB2YWx1ZTtcbiAgfSxcbiAgdG9rZW5pemUodmFsdWUpIHtcbiAgICByZXR1cm4gdmFsdWUuc3BsaXQoJycpO1xuICB9LFxuICBqb2luKGNoYXJzKSB7XG4gICAgcmV0dXJuIGNoYXJzLmpvaW4oJycpO1xuICB9XG59O1xuXG5mdW5jdGlvbiBidWlsZFZhbHVlcyhkaWZmLCBjb21wb25lbnRzLCBuZXdTdHJpbmcsIG9sZFN0cmluZywgdXNlTG9uZ2VzdFRva2VuKSB7XG4gIGxldCBjb21wb25lbnRQb3MgPSAwLFxuICAgICAgY29tcG9uZW50TGVuID0gY29tcG9uZW50cy5sZW5ndGgsXG4gICAgICBuZXdQb3MgPSAwLFxuICAgICAgb2xkUG9zID0gMDtcblxuICBmb3IgKDsgY29tcG9uZW50UG9zIDwgY29tcG9uZW50TGVuOyBjb21wb25lbnRQb3MrKykge1xuICAgIGxldCBjb21wb25lbnQgPSBjb21wb25lbnRzW2NvbXBvbmVudFBvc107XG4gICAgaWYgKCFjb21wb25lbnQucmVtb3ZlZCkge1xuICAgICAgaWYgKCFjb21wb25lbnQuYWRkZWQgJiYgdXNlTG9uZ2VzdFRva2VuKSB7XG4gICAgICAgIGxldCB2YWx1ZSA9IG5ld1N0cmluZy5zbGljZShuZXdQb3MsIG5ld1BvcyArIGNvbXBvbmVudC5jb3VudCk7XG4gICAgICAgIHZhbHVlID0gdmFsdWUubWFwKGZ1bmN0aW9uKHZhbHVlLCBpKSB7XG4gICAgICAgICAgbGV0IG9sZFZhbHVlID0gb2xkU3RyaW5nW29sZFBvcyArIGldO1xuICAgICAgICAgIHJldHVybiBvbGRWYWx1ZS5sZW5ndGggPiB2YWx1ZS5sZW5ndGggPyBvbGRWYWx1ZSA6IHZhbHVlO1xuICAgICAgICB9KTtcblxuICAgICAgICBjb21wb25lbnQudmFsdWUgPSBkaWZmLmpvaW4odmFsdWUpO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgY29tcG9uZW50LnZhbHVlID0gZGlmZi5qb2luKG5ld1N0cmluZy5zbGljZShuZXdQb3MsIG5ld1BvcyArIGNvbXBvbmVudC5jb3VudCkpO1xuICAgICAgfVxuICAgICAgbmV3UG9zICs9IGNvbXBvbmVudC5jb3VudDtcblxuICAgICAgLy8gQ29tbW9uIGNhc2VcbiAgICAgIGlmICghY29tcG9uZW50LmFkZGVkKSB7XG4gICAgICAgIG9sZFBvcyArPSBjb21wb25lbnQuY291bnQ7XG4gICAgICB9XG4gICAgfSBlbHNlIHtcbiAgICAgIGNvbXBvbmVudC52YWx1ZSA9IGRpZmYuam9pbihvbGRTdHJpbmcuc2xpY2Uob2xkUG9zLCBvbGRQb3MgKyBjb21wb25lbnQuY291bnQpKTtcbiAgICAgIG9sZFBvcyArPSBjb21wb25lbnQuY291bnQ7XG5cbiAgICAgIC8vIFJldmVyc2UgYWRkIGFuZCByZW1vdmUgc28gcmVtb3ZlcyBhcmUgb3V0cHV0IGZpcnN0IHRvIG1hdGNoIGNvbW1vbiBjb252ZW50aW9uXG4gICAgICAvLyBUaGUgZGlmZmluZyBhbGdvcml0aG0gaXMgdGllZCB0byBhZGQgdGhlbiByZW1vdmUgb3V0cHV0IGFuZCB0aGlzIGlzIHRoZSBzaW1wbGVzdFxuICAgICAgLy8gcm91dGUgdG8gZ2V0IHRoZSBkZXNpcmVkIG91dHB1dCB3aXRoIG1pbmltYWwgb3ZlcmhlYWQuXG4gICAgICBpZiAoY29tcG9uZW50UG9zICYmIGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV0uYWRkZWQpIHtcbiAgICAgICAgbGV0IHRtcCA9IGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV07XG4gICAgICAgIGNvbXBvbmVudHNbY29tcG9uZW50UG9zIC0gMV0gPSBjb21wb25lbnRzW2NvbXBvbmVudFBvc107XG4gICAgICAgIGNvbXBvbmVudHNbY29tcG9uZW50UG9zXSA9IHRtcDtcbiAgICAgIH1cbiAgICB9XG4gIH1cblxuICAvLyBTcGVjaWFsIGNhc2UgaGFuZGxlIGZvciB3aGVuIG9uZSB0ZXJtaW5hbCBpcyBpZ25vcmVkIChpLmUuIHdoaXRlc3BhY2UpLlxuICAvLyBGb3IgdGhpcyBjYXNlIHdlIG1lcmdlIHRoZSB0ZXJtaW5hbCBpbnRvIHRoZSBwcmlvciBzdHJpbmcgYW5kIGRyb3AgdGhlIGNoYW5nZS5cbiAgLy8gVGhpcyBpcyBvbmx5IGF2YWlsYWJsZSBmb3Igc3RyaW5nIG1vZGUuXG4gIGxldCBsYXN0Q29tcG9uZW50ID0gY29tcG9uZW50c1tjb21wb25lbnRMZW4gLSAxXTtcbiAgaWYgKGNvbXBvbmVudExlbiA+IDFcbiAgICAgICYmIHR5cGVvZiBsYXN0Q29tcG9uZW50LnZhbHVlID09PSAnc3RyaW5nJ1xuICAgICAgJiYgKGxhc3RDb21wb25lbnQuYWRkZWQgfHwgbGFzdENvbXBvbmVudC5yZW1vdmVkKVxuICAgICAgJiYgZGlmZi5lcXVhbHMoJycsIGxhc3RDb21wb25lbnQudmFsdWUpKSB7XG4gICAgY29tcG9uZW50c1tjb21wb25lbnRMZW4gLSAyXS52YWx1ZSArPSBsYXN0Q29tcG9uZW50LnZhbHVlO1xuICAgIGNvbXBvbmVudHMucG9wKCk7XG4gIH1cblxuICByZXR1cm4gY29tcG9uZW50cztcbn1cblxuZnVuY3Rpb24gY2xvbmVQYXRoKHBhdGgpIHtcbiAgcmV0dXJuIHsgbmV3UG9zOiBwYXRoLm5ld1BvcywgY29tcG9uZW50czogcGF0aC5jb21wb25lbnRzLnNsaWNlKDApIH07XG59XG4iXX0=
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/character.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/character.js
new file mode 100644
index 00000000000..e15da7a164c
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/character.js
@@ -0,0 +1,17 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.characterDiff = undefined;
+exports. /*istanbul ignore end*/diffChars = diffChars;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var characterDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/characterDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+function diffChars(oldStr, newStr, options) {
+  return characterDiff.diff(oldStr, newStr, options);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2NoYXJhY3Rlci5qcyJdLCJuYW1lcyI6WyJkaWZmQ2hhcnMiLCJjaGFyYWN0ZXJEaWZmIiwib2xkU3RyIiwibmV3U3RyIiwib3B0aW9ucyIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBR2dCQSxTLEdBQUFBLFM7O0FBSGhCOzs7Ozs7dUJBRU8sSUFBTUMseUZBQWdCLHdFQUF0QjtBQUNBLFNBQVNELFNBQVQsQ0FBbUJFLE1BQW5CLEVBQTJCQyxNQUEzQixFQUFtQ0MsT0FBbkMsRUFBNEM7QUFBRSxTQUFPSCxjQUFjSSxJQUFkLENBQW1CSCxNQUFuQixFQUEyQkMsTUFBM0IsRUFBbUNDLE9BQW5DLENBQVA7QUFBcUQiLCJmaWxlIjoiY2hhcmFjdGVyLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IERpZmYgZnJvbSAnLi9iYXNlJztcblxuZXhwb3J0IGNvbnN0IGNoYXJhY3RlckRpZmYgPSBuZXcgRGlmZigpO1xuZXhwb3J0IGZ1bmN0aW9uIGRpZmZDaGFycyhvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykgeyByZXR1cm4gY2hhcmFjdGVyRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTsgfVxuIl19
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/css.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/css.js
new file mode 100644
index 00000000000..640af5e168e
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/css.js
@@ -0,0 +1,21 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.cssDiff = undefined;
+exports. /*istanbul ignore end*/diffCss = diffCss;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var cssDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/cssDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+cssDiff.tokenize = function (value) {
+  return value.split(/([{}:;,]|\s+)/);
+};
+
+function diffCss(oldStr, newStr, callback) {
+  return cssDiff.diff(oldStr, newStr, callback);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2Nzcy5qcyJdLCJuYW1lcyI6WyJkaWZmQ3NzIiwiY3NzRGlmZiIsInRva2VuaXplIiwidmFsdWUiLCJzcGxpdCIsIm9sZFN0ciIsIm5ld1N0ciIsImNhbGxiYWNrIiwiZGlmZiJdLCJtYXBwaW5ncyI6Ijs7OztnQ0FPZ0JBLE8sR0FBQUEsTzs7QUFQaEI7Ozs7Ozt1QkFFTyxJQUFNQyw2RUFBVSx3RUFBaEI7QUFDUEEsUUFBUUMsUUFBUixHQUFtQixVQUFTQyxLQUFULEVBQWdCO0FBQ2pDLFNBQU9BLE1BQU1DLEtBQU4sQ0FBWSxlQUFaLENBQVA7QUFDRCxDQUZEOztBQUlPLFNBQVNKLE9BQVQsQ0FBaUJLLE1BQWpCLEVBQXlCQyxNQUF6QixFQUFpQ0MsUUFBakMsRUFBMkM7QUFBRSxTQUFPTixRQUFRTyxJQUFSLENBQWFILE1BQWIsRUFBcUJDLE1BQXJCLEVBQTZCQyxRQUE3QixDQUFQO0FBQWdEIiwiZmlsZSI6ImNzcy5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cbmV4cG9ydCBjb25zdCBjc3NEaWZmID0gbmV3IERpZmYoKTtcbmNzc0RpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWUuc3BsaXQoLyhbe306OyxdfFxccyspLyk7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkNzcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHsgcmV0dXJuIGNzc0RpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spOyB9XG4iXX0=
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/json.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/json.js
new file mode 100644
index 00000000000..ca21739a5aa
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/json.js
@@ -0,0 +1,108 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.jsonDiff = undefined;
+
+var _typeof = typeof Symbol === "function" && typeof Symbol.iterator === "symbol" ? function (obj) { return typeof obj; } : function (obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; };
+
+exports. /*istanbul ignore end*/diffJson = diffJson;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = canonicalize;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_line = require('./line') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var objectPrototypeToString = Object.prototype.toString;
+
+var jsonDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/jsonDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+// Discriminate between two lines of pretty-printed, serialized JSON where one of them has a
+// dangling comma and the other doesn't. Turns out including the dangling comma yields the nicest output:
+jsonDiff.useLongestToken = true;
+
+jsonDiff.tokenize = /*istanbul ignore start*/_line.lineDiff /*istanbul ignore end*/.tokenize;
+jsonDiff.castInput = function (value) {
+  /*istanbul ignore start*/var _options = /*istanbul ignore end*/this.options,
+      undefinedReplacement = _options.undefinedReplacement,
+      _options$stringifyRep = _options.stringifyReplacer,
+      stringifyReplacer = _options$stringifyRep === undefined ? function (k, v) /*istanbul ignore start*/{
+    return (/*istanbul ignore end*/typeof v === 'undefined' ? undefinedReplacement : v
+    );
+  } : _options$stringifyRep;
+
+
+  return typeof value === 'string' ? value : JSON.stringify(canonicalize(value, null, null, stringifyReplacer), stringifyReplacer, '  ');
+};
+jsonDiff.equals = function (left, right) {
+  return (/*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/.prototype.equals.call(jsonDiff, left.replace(/,([\r\n])/g, '$1'), right.replace(/,([\r\n])/g, '$1'))
+  );
+};
+
+function diffJson(oldObj, newObj, options) {
+  return jsonDiff.diff(oldObj, newObj, options);
+}
+
+// This function handles the presence of circular references by bailing out when encountering an
+// object that is already on the "stack" of items being processed. Accepts an optional replacer
+function canonicalize(obj, stack, replacementStack, replacer, key) {
+  stack = stack || [];
+  replacementStack = replacementStack || [];
+
+  if (replacer) {
+    obj = replacer(key, obj);
+  }
+
+  var i = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+  for (i = 0; i < stack.length; i += 1) {
+    if (stack[i] === obj) {
+      return replacementStack[i];
+    }
+  }
+
+  var canonicalizedObj = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+  if ('[object Array]' === objectPrototypeToString.call(obj)) {
+    stack.push(obj);
+    canonicalizedObj = new Array(obj.length);
+    replacementStack.push(canonicalizedObj);
+    for (i = 0; i < obj.length; i += 1) {
+      canonicalizedObj[i] = canonicalize(obj[i], stack, replacementStack, replacer, key);
+    }
+    stack.pop();
+    replacementStack.pop();
+    return canonicalizedObj;
+  }
+
+  if (obj && obj.toJSON) {
+    obj = obj.toJSON();
+  }
+
+  if ( /*istanbul ignore start*/(typeof /*istanbul ignore end*/obj === 'undefined' ? 'undefined' : _typeof(obj)) === 'object' && obj !== null) {
+    stack.push(obj);
+    canonicalizedObj = {};
+    replacementStack.push(canonicalizedObj);
+    var sortedKeys = [],
+        _key = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+    for (_key in obj) {
+      /* istanbul ignore else */
+      if (obj.hasOwnProperty(_key)) {
+        sortedKeys.push(_key);
+      }
+    }
+    sortedKeys.sort();
+    for (i = 0; i < sortedKeys.length; i += 1) {
+      _key = sortedKeys[i];
+      canonicalizedObj[_key] = canonicalize(obj[_key], stack, replacementStack, replacer, _key);
+    }
+    stack.pop();
+    replacementStack.pop();
+  } else {
+    canonicalizedObj = obj;
+  }
+  return canonicalizedObj;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2pzb24uanMiXSwibmFtZXMiOlsiZGlmZkpzb24iLCJjYW5vbmljYWxpemUiLCJvYmplY3RQcm90b3R5cGVUb1N0cmluZyIsIk9iamVjdCIsInByb3RvdHlwZSIsInRvU3RyaW5nIiwianNvbkRpZmYiLCJ1c2VMb25nZXN0VG9rZW4iLCJ0b2tlbml6ZSIsImNhc3RJbnB1dCIsInZhbHVlIiwib3B0aW9ucyIsInVuZGVmaW5lZFJlcGxhY2VtZW50Iiwic3RyaW5naWZ5UmVwbGFjZXIiLCJrIiwidiIsIkpTT04iLCJzdHJpbmdpZnkiLCJlcXVhbHMiLCJsZWZ0IiwicmlnaHQiLCJjYWxsIiwicmVwbGFjZSIsIm9sZE9iaiIsIm5ld09iaiIsImRpZmYiLCJvYmoiLCJzdGFjayIsInJlcGxhY2VtZW50U3RhY2siLCJyZXBsYWNlciIsImtleSIsImkiLCJsZW5ndGgiLCJjYW5vbmljYWxpemVkT2JqIiwicHVzaCIsIkFycmF5IiwicG9wIiwidG9KU09OIiwic29ydGVkS2V5cyIsImhhc093blByb3BlcnR5Iiwic29ydCJdLCJtYXBwaW5ncyI6Ijs7Ozs7OztnQ0FxQmdCQSxRLEdBQUFBLFE7eURBSUFDLFksR0FBQUEsWTs7QUF6QmhCOzs7O3VCQUNBOzs7O3VCQUVBLElBQU1DLDBCQUEwQkMsT0FBT0MsU0FBUCxDQUFpQkMsUUFBakQ7O0FBR08sSUFBTUMsK0VBQVcsd0VBQWpCO0FBQ1A7QUFDQTtBQUNBQSxTQUFTQyxlQUFULEdBQTJCLElBQTNCOztBQUVBRCxTQUFTRSxRQUFULEdBQW9CLGdFQUFTQSxRQUE3QjtBQUNBRixTQUFTRyxTQUFULEdBQXFCLFVBQVNDLEtBQVQsRUFBZ0I7QUFBQSxpRUFDK0UsS0FBS0MsT0FEcEY7QUFBQSxNQUM1QkMsb0JBRDRCLFlBQzVCQSxvQkFENEI7QUFBQSx1Q0FDTkMsaUJBRE07QUFBQSxNQUNOQSxpQkFETSx5Q0FDYyxVQUFDQyxDQUFELEVBQUlDLENBQUo7QUFBQSxtQ0FBVSxPQUFPQSxDQUFQLEtBQWEsV0FBYixHQUEyQkgsb0JBQTNCLEdBQWtERztBQUE1RDtBQUFBLEdBRGQ7OztBQUduQyxTQUFPLE9BQU9MLEtBQVAsS0FBaUIsUUFBakIsR0FBNEJBLEtBQTVCLEdBQW9DTSxLQUFLQyxTQUFMLENBQWVoQixhQUFhUyxLQUFiLEVBQW9CLElBQXBCLEVBQTBCLElBQTFCLEVBQWdDRyxpQkFBaEMsQ0FBZixFQUFtRUEsaUJBQW5FLEVBQXNGLElBQXRGLENBQTNDO0FBQ0QsQ0FKRDtBQUtBUCxTQUFTWSxNQUFULEdBQWtCLFVBQVNDLElBQVQsRUFBZUMsS0FBZixFQUFzQjtBQUN0QyxTQUFPLG9FQUFLaEIsU0FBTCxDQUFlYyxNQUFmLENBQXNCRyxJQUF0QixDQUEyQmYsUUFBM0IsRUFBcUNhLEtBQUtHLE9BQUwsQ0FBYSxZQUFiLEVBQTJCLElBQTNCLENBQXJDLEVBQXVFRixNQUFNRSxPQUFOLENBQWMsWUFBZCxFQUE0QixJQUE1QixDQUF2RTtBQUFQO0FBQ0QsQ0FGRDs7QUFJTyxTQUFTdEIsUUFBVCxDQUFrQnVCLE1BQWxCLEVBQTBCQyxNQUExQixFQUFrQ2IsT0FBbEMsRUFBMkM7QUFBRSxTQUFPTCxTQUFTbUIsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUFnRDs7QUFFcEc7QUFDQTtBQUNPLFNBQVNWLFlBQVQsQ0FBc0J5QixHQUF0QixFQUEyQkMsS0FBM0IsRUFBa0NDLGdCQUFsQyxFQUFvREMsUUFBcEQsRUFBOERDLEdBQTlELEVBQW1FO0FBQ3hFSCxVQUFRQSxTQUFTLEVBQWpCO0FBQ0FDLHFCQUFtQkEsb0JBQW9CLEVBQXZDOztBQUVBLE1BQUlDLFFBQUosRUFBYztBQUNaSCxVQUFNRyxTQUFTQyxHQUFULEVBQWNKLEdBQWQsQ0FBTjtBQUNEOztBQUVELE1BQUlLLG1DQUFKOztBQUVBLE9BQUtBLElBQUksQ0FBVCxFQUFZQSxJQUFJSixNQUFNSyxNQUF0QixFQUE4QkQsS0FBSyxDQUFuQyxFQUFzQztBQUNwQyxRQUFJSixNQUFNSSxDQUFOLE1BQWFMLEdBQWpCLEVBQXNCO0FBQ3BCLGFBQU9FLGlCQUFpQkcsQ0FBakIsQ0FBUDtBQUNEO0FBQ0Y7O0FBRUQsTUFBSUUsa0RBQUo7O0FBRUEsTUFBSSxxQkFBcUIvQix3QkFBd0JtQixJQUF4QixDQUE2QkssR0FBN0IsQ0FBekIsRUFBNEQ7QUFDMURDLFVBQU1PLElBQU4sQ0FBV1IsR0FBWDtBQUNBTyx1QkFBbUIsSUFBSUUsS0FBSixDQUFVVCxJQUFJTSxNQUFkLENBQW5CO0FBQ0FKLHFCQUFpQk0sSUFBakIsQ0FBc0JELGdCQUF0QjtBQUNBLFNBQUtGLElBQUksQ0FBVCxFQUFZQSxJQUFJTCxJQUFJTSxNQUFwQixFQUE0QkQsS0FBSyxDQUFqQyxFQUFvQztBQUNsQ0UsdUJBQWlCRixDQUFqQixJQUFzQjlCLGFBQWF5QixJQUFJSyxDQUFKLENBQWIsRUFBcUJKLEtBQXJCLEVBQTRCQyxnQkFBNUIsRUFBOENDLFFBQTlDLEVBQXdEQyxHQUF4RCxDQUF0QjtBQUNEO0FBQ0RILFVBQU1TLEdBQU47QUFDQVIscUJBQWlCUSxHQUFqQjtBQUNBLFdBQU9ILGdCQUFQO0FBQ0Q7O0FBRUQsTUFBSVAsT0FBT0EsSUFBSVcsTUFBZixFQUF1QjtBQUNyQlgsVUFBTUEsSUFBSVcsTUFBSixFQUFOO0FBQ0Q7O0FBRUQsTUFBSSx5REFBT1gsR0FBUCx5Q0FBT0EsR0FBUCxPQUFlLFFBQWYsSUFBMkJBLFFBQVEsSUFBdkMsRUFBNkM7QUFDM0NDLFVBQU1PLElBQU4sQ0FBV1IsR0FBWDtBQUNBTyx1QkFBbUIsRUFBbkI7QUFDQUwscUJBQWlCTSxJQUFqQixDQUFzQkQsZ0JBQXRCO0FBQ0EsUUFBSUssYUFBYSxFQUFqQjtBQUFBLFFBQ0lSLHNDQURKO0FBRUEsU0FBS0EsSUFBTCxJQUFZSixHQUFaLEVBQWlCO0FBQ2Y7QUFDQSxVQUFJQSxJQUFJYSxjQUFKLENBQW1CVCxJQUFuQixDQUFKLEVBQTZCO0FBQzNCUSxtQkFBV0osSUFBWCxDQUFnQkosSUFBaEI7QUFDRDtBQUNGO0FBQ0RRLGVBQVdFLElBQVg7QUFDQSxTQUFLVCxJQUFJLENBQVQsRUFBWUEsSUFBSU8sV0FBV04sTUFBM0IsRUFBbUNELEtBQUssQ0FBeEMsRUFBMkM7QUFDekNELGFBQU1RLFdBQVdQLENBQVgsQ0FBTjtBQUNBRSx1QkFBaUJILElBQWpCLElBQXdCN0IsYUFBYXlCLElBQUlJLElBQUosQ0FBYixFQUF1QkgsS0FBdkIsRUFBOEJDLGdCQUE5QixFQUFnREMsUUFBaEQsRUFBMERDLElBQTFELENBQXhCO0FBQ0Q7QUFDREgsVUFBTVMsR0FBTjtBQUNBUixxQkFBaUJRLEdBQWpCO0FBQ0QsR0FuQkQsTUFtQk87QUFDTEgsdUJBQW1CUCxHQUFuQjtBQUNEO0FBQ0QsU0FBT08sZ0JBQVA7QUFDRCIsImZpbGUiOiJqc29uLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IERpZmYgZnJvbSAnLi9iYXNlJztcbmltcG9ydCB7bGluZURpZmZ9IGZyb20gJy4vbGluZSc7XG5cbmNvbnN0IG9iamVjdFByb3RvdHlwZVRvU3RyaW5nID0gT2JqZWN0LnByb3RvdHlwZS50b1N0cmluZztcblxuXG5leHBvcnQgY29uc3QganNvbkRpZmYgPSBuZXcgRGlmZigpO1xuLy8gRGlzY3JpbWluYXRlIGJldHdlZW4gdHdvIGxpbmVzIG9mIHByZXR0eS1wcmludGVkLCBzZXJpYWxpemVkIEpTT04gd2hlcmUgb25lIG9mIHRoZW0gaGFzIGFcbi8vIGRhbmdsaW5nIGNvbW1hIGFuZCB0aGUgb3RoZXIgZG9lc24ndC4gVHVybnMgb3V0IGluY2x1ZGluZyB0aGUgZGFuZ2xpbmcgY29tbWEgeWllbGRzIHRoZSBuaWNlc3Qgb3V0cHV0OlxuanNvbkRpZmYudXNlTG9uZ2VzdFRva2VuID0gdHJ1ZTtcblxuanNvbkRpZmYudG9rZW5pemUgPSBsaW5lRGlmZi50b2tlbml6ZTtcbmpzb25EaWZmLmNhc3RJbnB1dCA9IGZ1bmN0aW9uKHZhbHVlKSB7XG4gIGNvbnN0IHt1bmRlZmluZWRSZXBsYWNlbWVudCwgc3RyaW5naWZ5UmVwbGFjZXIgPSAoaywgdikgPT4gdHlwZW9mIHYgPT09ICd1bmRlZmluZWQnID8gdW5kZWZpbmVkUmVwbGFjZW1lbnQgOiB2fSA9IHRoaXMub3B0aW9ucztcblxuICByZXR1cm4gdHlwZW9mIHZhbHVlID09PSAnc3RyaW5nJyA/IHZhbHVlIDogSlNPTi5zdHJpbmdpZnkoY2Fub25pY2FsaXplKHZhbHVlLCBudWxsLCBudWxsLCBzdHJpbmdpZnlSZXBsYWNlciksIHN0cmluZ2lmeVJlcGxhY2VyLCAnICAnKTtcbn07XG5qc29uRGlmZi5lcXVhbHMgPSBmdW5jdGlvbihsZWZ0LCByaWdodCkge1xuICByZXR1cm4gRGlmZi5wcm90b3R5cGUuZXF1YWxzLmNhbGwoanNvbkRpZmYsIGxlZnQucmVwbGFjZSgvLChbXFxyXFxuXSkvZywgJyQxJyksIHJpZ2h0LnJlcGxhY2UoLywoW1xcclxcbl0pL2csICckMScpKTtcbn07XG5cbmV4cG9ydCBmdW5jdGlvbiBkaWZmSnNvbihvbGRPYmosIG5ld09iaiwgb3B0aW9ucykgeyByZXR1cm4ganNvbkRpZmYuZGlmZihvbGRPYmosIG5ld09iaiwgb3B0aW9ucyk7IH1cblxuLy8gVGhpcyBmdW5jdGlvbiBoYW5kbGVzIHRoZSBwcmVzZW5jZSBvZiBjaXJjdWxhciByZWZlcmVuY2VzIGJ5IGJhaWxpbmcgb3V0IHdoZW4gZW5jb3VudGVyaW5nIGFuXG4vLyBvYmplY3QgdGhhdCBpcyBhbHJlYWR5IG9uIHRoZSBcInN0YWNrXCIgb2YgaXRlbXMgYmVpbmcgcHJvY2Vzc2VkLiBBY2NlcHRzIGFuIG9wdGlvbmFsIHJlcGxhY2VyXG5leHBvcnQgZnVuY3Rpb24gY2Fub25pY2FsaXplKG9iaiwgc3RhY2ssIHJlcGxhY2VtZW50U3RhY2ssIHJlcGxhY2VyLCBrZXkpIHtcbiAgc3RhY2sgPSBzdGFjayB8fCBbXTtcbiAgcmVwbGFjZW1lbnRTdGFjayA9IHJlcGxhY2VtZW50U3RhY2sgfHwgW107XG5cbiAgaWYgKHJlcGxhY2VyKSB7XG4gICAgb2JqID0gcmVwbGFjZXIoa2V5LCBvYmopO1xuICB9XG5cbiAgbGV0IGk7XG5cbiAgZm9yIChpID0gMDsgaSA8IHN0YWNrLmxlbmd0aDsgaSArPSAxKSB7XG4gICAgaWYgKHN0YWNrW2ldID09PSBvYmopIHtcbiAgICAgIHJldHVybiByZXBsYWNlbWVudFN0YWNrW2ldO1xuICAgIH1cbiAgfVxuXG4gIGxldCBjYW5vbmljYWxpemVkT2JqO1xuXG4gIGlmICgnW29iamVjdCBBcnJheV0nID09PSBvYmplY3RQcm90b3R5cGVUb1N0cmluZy5jYWxsKG9iaikpIHtcbiAgICBzdGFjay5wdXNoKG9iaik7XG4gICAgY2Fub25pY2FsaXplZE9iaiA9IG5ldyBBcnJheShvYmoubGVuZ3RoKTtcbiAgICByZXBsYWNlbWVudFN0YWNrLnB1c2goY2Fub25pY2FsaXplZE9iaik7XG4gICAgZm9yIChpID0gMDsgaSA8IG9iai5sZW5ndGg7IGkgKz0gMSkge1xuICAgICAgY2Fub25pY2FsaXplZE9ialtpXSA9IGNhbm9uaWNhbGl6ZShvYmpbaV0sIHN0YWNrLCByZXBsYWNlbWVudFN0YWNrLCByZXBsYWNlciwga2V5KTtcbiAgICB9XG4gICAgc3RhY2sucG9wKCk7XG4gICAgcmVwbGFjZW1lbnRTdGFjay5wb3AoKTtcbiAgICByZXR1cm4gY2Fub25pY2FsaXplZE9iajtcbiAgfVxuXG4gIGlmIChvYmogJiYgb2JqLnRvSlNPTikge1xuICAgIG9iaiA9IG9iai50b0pTT04oKTtcbiAgfVxuXG4gIGlmICh0eXBlb2Ygb2JqID09PSAnb2JqZWN0JyAmJiBvYmogIT09IG51bGwpIHtcbiAgICBzdGFjay5wdXNoKG9iaik7XG4gICAgY2Fub25pY2FsaXplZE9iaiA9IHt9O1xuICAgIHJlcGxhY2VtZW50U3RhY2sucHVzaChjYW5vbmljYWxpemVkT2JqKTtcbiAgICBsZXQgc29ydGVkS2V5cyA9IFtdLFxuICAgICAgICBrZXk7XG4gICAgZm9yIChrZXkgaW4gb2JqKSB7XG4gICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgZWxzZSAqL1xuICAgICAgaWYgKG9iai5oYXNPd25Qcm9wZXJ0eShrZXkpKSB7XG4gICAgICAgIHNvcnRlZEtleXMucHVzaChrZXkpO1xuICAgICAgfVxuICAgIH1cbiAgICBzb3J0ZWRLZXlzLnNvcnQoKTtcbiAgICBmb3IgKGkgPSAwOyBpIDwgc29ydGVkS2V5cy5sZW5ndGg7IGkgKz0gMSkge1xuICAgICAga2V5ID0gc29ydGVkS2V5c1tpXTtcbiAgICAgIGNhbm9uaWNhbGl6ZWRPYmpba2V5XSA9IGNhbm9uaWNhbGl6ZShvYmpba2V5XSwgc3RhY2ssIHJlcGxhY2VtZW50U3RhY2ssIHJlcGxhY2VyLCBrZXkpO1xuICAgIH1cbiAgICBzdGFjay5wb3AoKTtcbiAgICByZXBsYWNlbWVudFN0YWNrLnBvcCgpO1xuICB9IGVsc2Uge1xuICAgIGNhbm9uaWNhbGl6ZWRPYmogPSBvYmo7XG4gIH1cbiAgcmV0dXJuIGNhbm9uaWNhbGl6ZWRPYmo7XG59XG4iXX0=
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/line.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/line.js
new file mode 100644
index 00000000000..f03eedbd1f3
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/line.js
@@ -0,0 +1,50 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.lineDiff = undefined;
+exports. /*istanbul ignore end*/diffLines = diffLines;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = diffTrimmedLines;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_params = require('../util/params') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var lineDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/lineDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+lineDiff.tokenize = function (value) {
+  var retLines = [],
+      linesAndNewlines = value.split(/(\n|\r\n)/);
+
+  // Ignore the final empty token that occurs if the string ends with a new line
+  if (!linesAndNewlines[linesAndNewlines.length - 1]) {
+    linesAndNewlines.pop();
+  }
+
+  // Merge the content and line separators into single tokens
+  for (var i = 0; i < linesAndNewlines.length; i++) {
+    var line = linesAndNewlines[i];
+
+    if (i % 2 && !this.options.newlineIsToken) {
+      retLines[retLines.length - 1] += line;
+    } else {
+      if (this.options.ignoreWhitespace) {
+        line = line.trim();
+      }
+      retLines.push(line);
+    }
+  }
+
+  return retLines;
+};
+
+function diffLines(oldStr, newStr, callback) {
+  return lineDiff.diff(oldStr, newStr, callback);
+}
+function diffTrimmedLines(oldStr, newStr, callback) {
+  var options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(callback, { ignoreWhitespace: true });
+  return lineDiff.diff(oldStr, newStr, options);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL2xpbmUuanMiXSwibmFtZXMiOlsiZGlmZkxpbmVzIiwiZGlmZlRyaW1tZWRMaW5lcyIsImxpbmVEaWZmIiwidG9rZW5pemUiLCJ2YWx1ZSIsInJldExpbmVzIiwibGluZXNBbmROZXdsaW5lcyIsInNwbGl0IiwibGVuZ3RoIiwicG9wIiwiaSIsImxpbmUiLCJvcHRpb25zIiwibmV3bGluZUlzVG9rZW4iLCJpZ25vcmVXaGl0ZXNwYWNlIiwidHJpbSIsInB1c2giLCJvbGRTdHIiLCJuZXdTdHIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBOEJnQkEsUyxHQUFBQSxTO3lEQUNBQyxnQixHQUFBQSxnQjs7QUEvQmhCOzs7O3VCQUNBOzs7O3VCQUVPLElBQU1DLCtFQUFXLHdFQUFqQjtBQUNQQSxTQUFTQyxRQUFULEdBQW9CLFVBQVNDLEtBQVQsRUFBZ0I7QUFDbEMsTUFBSUMsV0FBVyxFQUFmO0FBQUEsTUFDSUMsbUJBQW1CRixNQUFNRyxLQUFOLENBQVksV0FBWixDQUR2Qjs7QUFHQTtBQUNBLE1BQUksQ0FBQ0QsaUJBQWlCQSxpQkFBaUJFLE1BQWpCLEdBQTBCLENBQTNDLENBQUwsRUFBb0Q7QUFDbERGLHFCQUFpQkcsR0FBakI7QUFDRDs7QUFFRDtBQUNBLE9BQUssSUFBSUMsSUFBSSxDQUFiLEVBQWdCQSxJQUFJSixpQkFBaUJFLE1BQXJDLEVBQTZDRSxHQUE3QyxFQUFrRDtBQUNoRCxRQUFJQyxPQUFPTCxpQkFBaUJJLENBQWpCLENBQVg7O0FBRUEsUUFBSUEsSUFBSSxDQUFKLElBQVMsQ0FBQyxLQUFLRSxPQUFMLENBQWFDLGNBQTNCLEVBQTJDO0FBQ3pDUixlQUFTQSxTQUFTRyxNQUFULEdBQWtCLENBQTNCLEtBQWlDRyxJQUFqQztBQUNELEtBRkQsTUFFTztBQUNMLFVBQUksS0FBS0MsT0FBTCxDQUFhRSxnQkFBakIsRUFBbUM7QUFDakNILGVBQU9BLEtBQUtJLElBQUwsRUFBUDtBQUNEO0FBQ0RWLGVBQVNXLElBQVQsQ0FBY0wsSUFBZDtBQUNEO0FBQ0Y7O0FBRUQsU0FBT04sUUFBUDtBQUNELENBeEJEOztBQTBCTyxTQUFTTCxTQUFULENBQW1CaUIsTUFBbkIsRUFBMkJDLE1BQTNCLEVBQW1DQyxRQUFuQyxFQUE2QztBQUFFLFNBQU9qQixTQUFTa0IsSUFBVCxDQUFjSCxNQUFkLEVBQXNCQyxNQUF0QixFQUE4QkMsUUFBOUIsQ0FBUDtBQUFpRDtBQUNoRyxTQUFTbEIsZ0JBQVQsQ0FBMEJnQixNQUExQixFQUFrQ0MsTUFBbEMsRUFBMENDLFFBQTFDLEVBQW9EO0FBQ3pELE1BQUlQLFVBQVUsOEVBQWdCTyxRQUFoQixFQUEwQixFQUFDTCxrQkFBa0IsSUFBbkIsRUFBMUIsQ0FBZDtBQUNBLFNBQU9aLFNBQVNrQixJQUFULENBQWNILE1BQWQsRUFBc0JDLE1BQXRCLEVBQThCTixPQUE5QixDQUFQO0FBQ0QiLCJmaWxlIjoibGluZS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5pbXBvcnQge2dlbmVyYXRlT3B0aW9uc30gZnJvbSAnLi4vdXRpbC9wYXJhbXMnO1xuXG5leHBvcnQgY29uc3QgbGluZURpZmYgPSBuZXcgRGlmZigpO1xubGluZURpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICBsZXQgcmV0TGluZXMgPSBbXSxcbiAgICAgIGxpbmVzQW5kTmV3bGluZXMgPSB2YWx1ZS5zcGxpdCgvKFxcbnxcXHJcXG4pLyk7XG5cbiAgLy8gSWdub3JlIHRoZSBmaW5hbCBlbXB0eSB0b2tlbiB0aGF0IG9jY3VycyBpZiB0aGUgc3RyaW5nIGVuZHMgd2l0aCBhIG5ldyBsaW5lXG4gIGlmICghbGluZXNBbmROZXdsaW5lc1tsaW5lc0FuZE5ld2xpbmVzLmxlbmd0aCAtIDFdKSB7XG4gICAgbGluZXNBbmROZXdsaW5lcy5wb3AoKTtcbiAgfVxuXG4gIC8vIE1lcmdlIHRoZSBjb250ZW50IGFuZCBsaW5lIHNlcGFyYXRvcnMgaW50byBzaW5nbGUgdG9rZW5zXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgbGluZXNBbmROZXdsaW5lcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBsaW5lID0gbGluZXNBbmROZXdsaW5lc1tpXTtcblxuICAgIGlmIChpICUgMiAmJiAhdGhpcy5vcHRpb25zLm5ld2xpbmVJc1Rva2VuKSB7XG4gICAgICByZXRMaW5lc1tyZXRMaW5lcy5sZW5ndGggLSAxXSArPSBsaW5lO1xuICAgIH0gZWxzZSB7XG4gICAgICBpZiAodGhpcy5vcHRpb25zLmlnbm9yZVdoaXRlc3BhY2UpIHtcbiAgICAgICAgbGluZSA9IGxpbmUudHJpbSgpO1xuICAgICAgfVxuICAgICAgcmV0TGluZXMucHVzaChsaW5lKTtcbiAgICB9XG4gIH1cblxuICByZXR1cm4gcmV0TGluZXM7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZkxpbmVzKG9sZFN0ciwgbmV3U3RyLCBjYWxsYmFjaykgeyByZXR1cm4gbGluZURpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spOyB9XG5leHBvcnQgZnVuY3Rpb24gZGlmZlRyaW1tZWRMaW5lcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHtcbiAgbGV0IG9wdGlvbnMgPSBnZW5lcmF0ZU9wdGlvbnMoY2FsbGJhY2ssIHtpZ25vcmVXaGl0ZXNwYWNlOiB0cnVlfSk7XG4gIHJldHVybiBsaW5lRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbn1cbiJdfQ==
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/sentence.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/sentence.js
new file mode 100644
index 00000000000..c1dcb204cf1
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/sentence.js
@@ -0,0 +1,21 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.sentenceDiff = undefined;
+exports. /*istanbul ignore end*/diffSentences = diffSentences;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/var sentenceDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/sentenceDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+sentenceDiff.tokenize = function (value) {
+  return value.split(/(\S.+?[.!?])(?=\s+|$)/);
+};
+
+function diffSentences(oldStr, newStr, callback) {
+  return sentenceDiff.diff(oldStr, newStr, callback);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL3NlbnRlbmNlLmpzIl0sIm5hbWVzIjpbImRpZmZTZW50ZW5jZXMiLCJzZW50ZW5jZURpZmYiLCJ0b2tlbml6ZSIsInZhbHVlIiwic3BsaXQiLCJvbGRTdHIiLCJuZXdTdHIiLCJjYWxsYmFjayIsImRpZmYiXSwibWFwcGluZ3MiOiI7Ozs7Z0NBUWdCQSxhLEdBQUFBLGE7O0FBUmhCOzs7Ozs7dUJBR08sSUFBTUMsdUZBQWUsd0VBQXJCO0FBQ1BBLGFBQWFDLFFBQWIsR0FBd0IsVUFBU0MsS0FBVCxFQUFnQjtBQUN0QyxTQUFPQSxNQUFNQyxLQUFOLENBQVksdUJBQVosQ0FBUDtBQUNELENBRkQ7O0FBSU8sU0FBU0osYUFBVCxDQUF1QkssTUFBdkIsRUFBK0JDLE1BQS9CLEVBQXVDQyxRQUF2QyxFQUFpRDtBQUFFLFNBQU9OLGFBQWFPLElBQWIsQ0FBa0JILE1BQWxCLEVBQTBCQyxNQUExQixFQUFrQ0MsUUFBbEMsQ0FBUDtBQUFxRCIsImZpbGUiOiJzZW50ZW5jZS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCBEaWZmIGZyb20gJy4vYmFzZSc7XG5cblxuZXhwb3J0IGNvbnN0IHNlbnRlbmNlRGlmZiA9IG5ldyBEaWZmKCk7XG5zZW50ZW5jZURpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICByZXR1cm4gdmFsdWUuc3BsaXQoLyhcXFMuKz9bLiE/XSkoPz1cXHMrfCQpLyk7XG59O1xuXG5leHBvcnQgZnVuY3Rpb24gZGlmZlNlbnRlbmNlcyhvbGRTdHIsIG5ld1N0ciwgY2FsbGJhY2spIHsgcmV0dXJuIHNlbnRlbmNlRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBjYWxsYmFjayk7IH1cbiJdfQ==
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/word.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/word.js
new file mode 100644
index 00000000000..4af1b05d4e4
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/diff/word.js
@@ -0,0 +1,70 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.wordDiff = undefined;
+exports. /*istanbul ignore end*/diffWords = diffWords;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = diffWordsWithSpace;
+
+var /*istanbul ignore start*/_base = require('./base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_params = require('../util/params') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/ // Based on https://en.wikipedia.org/wiki/Latin_script_in_Unicode
+//
+// Ranges and exceptions:
+// Latin-1 Supplement, 0080–00FF
+//  - U+00D7  × Multiplication sign
+//  - U+00F7  ÷ Division sign
+// Latin Extended-A, 0100–017F
+// Latin Extended-B, 0180–024F
+// IPA Extensions, 0250–02AF
+// Spacing Modifier Letters, 02B0–02FF
+//  - U+02C7  ˇ &#711;  Caron
+//  - U+02D8  ˘ &#728;  Breve
+//  - U+02D9  ˙ &#729;  Dot Above
+//  - U+02DA  ˚ &#730;  Ring Above
+//  - U+02DB  ˛ &#731;  Ogonek
+//  - U+02DC  ˜ &#732;  Small Tilde
+//  - U+02DD  ˝ &#733;  Double Acute Accent
+// Latin Extended Additional, 1E00–1EFF
+var extendedWordChars = /^[A-Za-z\xC0-\u02C6\u02C8-\u02D7\u02DE-\u02FF\u1E00-\u1EFF]+$/;
+
+var reWhitespace = /\S/;
+
+var wordDiff = /*istanbul ignore start*/exports. /*istanbul ignore end*/wordDiff = new /*istanbul ignore start*/_base2['default'] /*istanbul ignore end*/();
+wordDiff.equals = function (left, right) {
+  if (this.options.ignoreCase) {
+    left = left.toLowerCase();
+    right = right.toLowerCase();
+  }
+  return left === right || this.options.ignoreWhitespace && !reWhitespace.test(left) && !reWhitespace.test(right);
+};
+wordDiff.tokenize = function (value) {
+  var tokens = value.split(/(\s+|\b)/);
+
+  // Join the boundary splits that we do not consider to be boundaries. This is primarily the extended Latin character set.
+  for (var i = 0; i < tokens.length - 1; i++) {
+    // If we have an empty string in the next field and we have only word chars before and after, merge
+    if (!tokens[i + 1] && tokens[i + 2] && extendedWordChars.test(tokens[i]) && extendedWordChars.test(tokens[i + 2])) {
+      tokens[i] += tokens[i + 2];
+      tokens.splice(i + 1, 2);
+      i--;
+    }
+  }
+
+  return tokens;
+};
+
+function diffWords(oldStr, newStr, options) {
+  options = /*istanbul ignore start*/(0, _params.generateOptions) /*istanbul ignore end*/(options, { ignoreWhitespace: true });
+  return wordDiff.diff(oldStr, newStr, options);
+}
+
+function diffWordsWithSpace(oldStr, newStr, options) {
+  return wordDiff.diff(oldStr, newStr, options);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9kaWZmL3dvcmQuanMiXSwibmFtZXMiOlsiZGlmZldvcmRzIiwiZGlmZldvcmRzV2l0aFNwYWNlIiwiZXh0ZW5kZWRXb3JkQ2hhcnMiLCJyZVdoaXRlc3BhY2UiLCJ3b3JkRGlmZiIsImVxdWFscyIsImxlZnQiLCJyaWdodCIsIm9wdGlvbnMiLCJpZ25vcmVDYXNlIiwidG9Mb3dlckNhc2UiLCJpZ25vcmVXaGl0ZXNwYWNlIiwidGVzdCIsInRva2VuaXplIiwidmFsdWUiLCJ0b2tlbnMiLCJzcGxpdCIsImkiLCJsZW5ndGgiLCJzcGxpY2UiLCJvbGRTdHIiLCJuZXdTdHIiLCJkaWZmIl0sIm1hcHBpbmdzIjoiOzs7O2dDQW1EZ0JBLFMsR0FBQUEsUzt5REFLQUMsa0IsR0FBQUEsa0I7O0FBeERoQjs7Ozt1QkFDQTs7Ozt3QkFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxJQUFNQyxvQkFBb0IsK0RBQTFCOztBQUVBLElBQU1DLGVBQWUsSUFBckI7O0FBRU8sSUFBTUMsK0VBQVcsd0VBQWpCO0FBQ1BBLFNBQVNDLE1BQVQsR0FBa0IsVUFBU0MsSUFBVCxFQUFlQyxLQUFmLEVBQXNCO0FBQ3RDLE1BQUksS0FBS0MsT0FBTCxDQUFhQyxVQUFqQixFQUE2QjtBQUMzQkgsV0FBT0EsS0FBS0ksV0FBTCxFQUFQO0FBQ0FILFlBQVFBLE1BQU1HLFdBQU4sRUFBUjtBQUNEO0FBQ0QsU0FBT0osU0FBU0MsS0FBVCxJQUFtQixLQUFLQyxPQUFMLENBQWFHLGdCQUFiLElBQWlDLENBQUNSLGFBQWFTLElBQWIsQ0FBa0JOLElBQWxCLENBQWxDLElBQTZELENBQUNILGFBQWFTLElBQWIsQ0FBa0JMLEtBQWxCLENBQXhGO0FBQ0QsQ0FORDtBQU9BSCxTQUFTUyxRQUFULEdBQW9CLFVBQVNDLEtBQVQsRUFBZ0I7QUFDbEMsTUFBSUMsU0FBU0QsTUFBTUUsS0FBTixDQUFZLFVBQVosQ0FBYjs7QUFFQTtBQUNBLE9BQUssSUFBSUMsSUFBSSxDQUFiLEVBQWdCQSxJQUFJRixPQUFPRyxNQUFQLEdBQWdCLENBQXBDLEVBQXVDRCxHQUF2QyxFQUE0QztBQUMxQztBQUNBLFFBQUksQ0FBQ0YsT0FBT0UsSUFBSSxDQUFYLENBQUQsSUFBa0JGLE9BQU9FLElBQUksQ0FBWCxDQUFsQixJQUNLZixrQkFBa0JVLElBQWxCLENBQXVCRyxPQUFPRSxDQUFQLENBQXZCLENBREwsSUFFS2Ysa0JBQWtCVSxJQUFsQixDQUF1QkcsT0FBT0UsSUFBSSxDQUFYLENBQXZCLENBRlQsRUFFZ0Q7QUFDOUNGLGFBQU9FLENBQVAsS0FBYUYsT0FBT0UsSUFBSSxDQUFYLENBQWI7QUFDQUYsYUFBT0ksTUFBUCxDQUFjRixJQUFJLENBQWxCLEVBQXFCLENBQXJCO0FBQ0FBO0FBQ0Q7QUFDRjs7QUFFRCxTQUFPRixNQUFQO0FBQ0QsQ0FoQkQ7O0FBa0JPLFNBQVNmLFNBQVQsQ0FBbUJvQixNQUFuQixFQUEyQkMsTUFBM0IsRUFBbUNiLE9BQW5DLEVBQTRDO0FBQ2pEQSxZQUFVLDhFQUFnQkEsT0FBaEIsRUFBeUIsRUFBQ0csa0JBQWtCLElBQW5CLEVBQXpCLENBQVY7QUFDQSxTQUFPUCxTQUFTa0IsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUNEOztBQUVNLFNBQVNQLGtCQUFULENBQTRCbUIsTUFBNUIsRUFBb0NDLE1BQXBDLEVBQTRDYixPQUE1QyxFQUFxRDtBQUMxRCxTQUFPSixTQUFTa0IsSUFBVCxDQUFjRixNQUFkLEVBQXNCQyxNQUF0QixFQUE4QmIsT0FBOUIsQ0FBUDtBQUNEIiwiZmlsZSI6IndvcmQuanMiLCJzb3VyY2VzQ29udGVudCI6WyJpbXBvcnQgRGlmZiBmcm9tICcuL2Jhc2UnO1xuaW1wb3J0IHtnZW5lcmF0ZU9wdGlvbnN9IGZyb20gJy4uL3V0aWwvcGFyYW1zJztcblxuLy8gQmFzZWQgb24gaHR0cHM6Ly9lbi53aWtpcGVkaWEub3JnL3dpa2kvTGF0aW5fc2NyaXB0X2luX1VuaWNvZGVcbi8vXG4vLyBSYW5nZXMgYW5kIGV4Y2VwdGlvbnM6XG4vLyBMYXRpbi0xIFN1cHBsZW1lbnQsIDAwODDigJMwMEZGXG4vLyAgLSBVKzAwRDcgIMOXIE11bHRpcGxpY2F0aW9uIHNpZ25cbi8vICAtIFUrMDBGNyAgw7cgRGl2aXNpb24gc2lnblxuLy8gTGF0aW4gRXh0ZW5kZWQtQSwgMDEwMOKAkzAxN0Zcbi8vIExhdGluIEV4dGVuZGVkLUIsIDAxODDigJMwMjRGXG4vLyBJUEEgRXh0ZW5zaW9ucywgMDI1MOKAkzAyQUZcbi8vIFNwYWNpbmcgTW9kaWZpZXIgTGV0dGVycywgMDJCMOKAkzAyRkZcbi8vICAtIFUrMDJDNyAgy4cgJiM3MTE7ICBDYXJvblxuLy8gIC0gVSswMkQ4ICDLmCAmIzcyODsgIEJyZXZlXG4vLyAgLSBVKzAyRDkgIMuZICYjNzI5OyAgRG90IEFib3ZlXG4vLyAgLSBVKzAyREEgIMuaICYjNzMwOyAgUmluZyBBYm92ZVxuLy8gIC0gVSswMkRCICDLmyAmIzczMTsgIE9nb25la1xuLy8gIC0gVSswMkRDICDLnCAmIzczMjsgIFNtYWxsIFRpbGRlXG4vLyAgLSBVKzAyREQgIMudICYjNzMzOyAgRG91YmxlIEFjdXRlIEFjY2VudFxuLy8gTGF0aW4gRXh0ZW5kZWQgQWRkaXRpb25hbCwgMUUwMOKAkzFFRkZcbmNvbnN0IGV4dGVuZGVkV29yZENoYXJzID0gL15bYS16QS1aXFx1e0MwfS1cXHV7RkZ9XFx1e0Q4fS1cXHV7RjZ9XFx1e0Y4fS1cXHV7MkM2fVxcdXsyQzh9LVxcdXsyRDd9XFx1ezJERX0tXFx1ezJGRn1cXHV7MUUwMH0tXFx1ezFFRkZ9XSskL3U7XG5cbmNvbnN0IHJlV2hpdGVzcGFjZSA9IC9cXFMvO1xuXG5leHBvcnQgY29uc3Qgd29yZERpZmYgPSBuZXcgRGlmZigpO1xud29yZERpZmYuZXF1YWxzID0gZnVuY3Rpb24obGVmdCwgcmlnaHQpIHtcbiAgaWYgKHRoaXMub3B0aW9ucy5pZ25vcmVDYXNlKSB7XG4gICAgbGVmdCA9IGxlZnQudG9Mb3dlckNhc2UoKTtcbiAgICByaWdodCA9IHJpZ2h0LnRvTG93ZXJDYXNlKCk7XG4gIH1cbiAgcmV0dXJuIGxlZnQgPT09IHJpZ2h0IHx8ICh0aGlzLm9wdGlvbnMuaWdub3JlV2hpdGVzcGFjZSAmJiAhcmVXaGl0ZXNwYWNlLnRlc3QobGVmdCkgJiYgIXJlV2hpdGVzcGFjZS50ZXN0KHJpZ2h0KSk7XG59O1xud29yZERpZmYudG9rZW5pemUgPSBmdW5jdGlvbih2YWx1ZSkge1xuICBsZXQgdG9rZW5zID0gdmFsdWUuc3BsaXQoLyhcXHMrfFxcYikvKTtcblxuICAvLyBKb2luIHRoZSBib3VuZGFyeSBzcGxpdHMgdGhhdCB3ZSBkbyBub3QgY29uc2lkZXIgdG8gYmUgYm91bmRhcmllcy4gVGhpcyBpcyBwcmltYXJpbHkgdGhlIGV4dGVuZGVkIExhdGluIGNoYXJhY3RlciBzZXQuXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgdG9rZW5zLmxlbmd0aCAtIDE7IGkrKykge1xuICAgIC8vIElmIHdlIGhhdmUgYW4gZW1wdHkgc3RyaW5nIGluIHRoZSBuZXh0IGZpZWxkIGFuZCB3ZSBoYXZlIG9ubHkgd29yZCBjaGFycyBiZWZvcmUgYW5kIGFmdGVyLCBtZXJnZVxuICAgIGlmICghdG9rZW5zW2kgKyAxXSAmJiB0b2tlbnNbaSArIDJdXG4gICAgICAgICAgJiYgZXh0ZW5kZWRXb3JkQ2hhcnMudGVzdCh0b2tlbnNbaV0pXG4gICAgICAgICAgJiYgZXh0ZW5kZWRXb3JkQ2hhcnMudGVzdCh0b2tlbnNbaSArIDJdKSkge1xuICAgICAgdG9rZW5zW2ldICs9IHRva2Vuc1tpICsgMl07XG4gICAgICB0b2tlbnMuc3BsaWNlKGkgKyAxLCAyKTtcbiAgICAgIGktLTtcbiAgICB9XG4gIH1cblxuICByZXR1cm4gdG9rZW5zO1xufTtcblxuZXhwb3J0IGZ1bmN0aW9uIGRpZmZXb3JkcyhvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykge1xuICBvcHRpb25zID0gZ2VuZXJhdGVPcHRpb25zKG9wdGlvbnMsIHtpZ25vcmVXaGl0ZXNwYWNlOiB0cnVlfSk7XG4gIHJldHVybiB3b3JkRGlmZi5kaWZmKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGRpZmZXb3Jkc1dpdGhTcGFjZShvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucykge1xuICByZXR1cm4gd29yZERpZmYuZGlmZihvbGRTdHIsIG5ld1N0ciwgb3B0aW9ucyk7XG59XG4iXX0=
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/index.js
new file mode 100644
index 00000000000..8608cafc3b7
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/index.js
@@ -0,0 +1,74 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports.canonicalize = exports.convertChangesToXML = exports.convertChangesToDMP = exports.merge = exports.parsePatch = exports.applyPatches = exports.applyPatch = exports.createPatch = exports.createTwoFilesPatch = exports.structuredPatch = exports.diffArrays = exports.diffJson = exports.diffCss = exports.diffSentences = exports.diffTrimmedLines = exports.diffLines = exports.diffWordsWithSpace = exports.diffWords = exports.diffChars = exports.Diff = undefined;
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_base = require('./diff/base') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _base2 = _interopRequireDefault(_base);
+
+/*istanbul ignore end*/var /*istanbul ignore start*/_character = require('./diff/character') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_word = require('./diff/word') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_line = require('./diff/line') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_sentence = require('./diff/sentence') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_css = require('./diff/css') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_json = require('./diff/json') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_array = require('./diff/array') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_apply = require('./patch/apply') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_parse = require('./patch/parse') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_merge = require('./patch/merge') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_create = require('./patch/create') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_dmp = require('./convert/dmp') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_xml = require('./convert/xml') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/* See LICENSE file for terms of use */
+
+/*
+ * Text diff implementation.
+ *
+ * This library supports the following APIS:
+ * JsDiff.diffChars: Character by character diff
+ * JsDiff.diffWords: Word (as defined by \b regex) diff which ignores whitespace
+ * JsDiff.diffLines: Line based diff
+ *
+ * JsDiff.diffCss: Diff targeted at CSS content
+ *
+ * These methods are based on the implementation proposed in
+ * "An O(ND) Difference Algorithm and its Variations" (Myers, 1986).
+ * http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.4.6927
+ */
+exports. /*istanbul ignore end*/Diff = _base2['default'];
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffChars = _character.diffChars;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWords = _word.diffWords;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffWordsWithSpace = _word.diffWordsWithSpace;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffLines = _line.diffLines;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffTrimmedLines = _line.diffTrimmedLines;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffSentences = _sentence.diffSentences;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffCss = _css.diffCss;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffJson = _json.diffJson;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/diffArrays = _array.diffArrays;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/structuredPatch = _create.structuredPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = _create.createTwoFilesPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = _create.createPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatch = _apply.applyPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = _apply.applyPatches;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/parsePatch = _parse.parsePatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = _merge.merge;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToDMP = _dmp.convertChangesToDMP;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/convertChangesToXML = _xml.convertChangesToXML;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/canonicalize = _json.canonicalize;
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uL3NyYy9pbmRleC5qcyJdLCJuYW1lcyI6WyJEaWZmIiwiZGlmZkNoYXJzIiwiZGlmZldvcmRzIiwiZGlmZldvcmRzV2l0aFNwYWNlIiwiZGlmZkxpbmVzIiwiZGlmZlRyaW1tZWRMaW5lcyIsImRpZmZTZW50ZW5jZXMiLCJkaWZmQ3NzIiwiZGlmZkpzb24iLCJkaWZmQXJyYXlzIiwic3RydWN0dXJlZFBhdGNoIiwiY3JlYXRlVHdvRmlsZXNQYXRjaCIsImNyZWF0ZVBhdGNoIiwiYXBwbHlQYXRjaCIsImFwcGx5UGF0Y2hlcyIsInBhcnNlUGF0Y2giLCJtZXJnZSIsImNvbnZlcnRDaGFuZ2VzVG9ETVAiLCJjb252ZXJ0Q2hhbmdlc1RvWE1MIiwiY2Fub25pY2FsaXplIl0sIm1hcHBpbmdzIjoiOzs7Ozt1QkFnQkE7Ozs7dUJBQ0E7O0FBQ0E7O0FBQ0E7O0FBQ0E7O0FBRUE7O0FBQ0E7O0FBRUE7O0FBRUE7O0FBQ0E7O0FBQ0E7O0FBQ0E7O0FBRUE7O0FBQ0E7Ozs7QUFqQ0E7O0FBRUE7Ozs7Ozs7Ozs7Ozs7O2dDQWtDRUEsSTt5REFFQUMsUzt5REFDQUMsUzt5REFDQUMsa0I7eURBQ0FDLFM7eURBQ0FDLGdCO3lEQUNBQyxhO3lEQUVBQyxPO3lEQUNBQyxRO3lEQUVBQyxVO3lEQUVBQyxlO3lEQUNBQyxtQjt5REFDQUMsVzt5REFDQUMsVTt5REFDQUMsWTt5REFDQUMsVTt5REFDQUMsSzt5REFDQUMsbUI7eURBQ0FDLG1CO3lEQUNBQyxZIiwiZmlsZSI6ImluZGV4LmpzIiwic291cmNlc0NvbnRlbnQiOlsiLyogU2VlIExJQ0VOU0UgZmlsZSBmb3IgdGVybXMgb2YgdXNlICovXG5cbi8qXG4gKiBUZXh0IGRpZmYgaW1wbGVtZW50YXRpb24uXG4gKlxuICogVGhpcyBsaWJyYXJ5IHN1cHBvcnRzIHRoZSBmb2xsb3dpbmcgQVBJUzpcbiAqIEpzRGlmZi5kaWZmQ2hhcnM6IENoYXJhY3RlciBieSBjaGFyYWN0ZXIgZGlmZlxuICogSnNEaWZmLmRpZmZXb3JkczogV29yZCAoYXMgZGVmaW5lZCBieSBcXGIgcmVnZXgpIGRpZmYgd2hpY2ggaWdub3JlcyB3aGl0ZXNwYWNlXG4gKiBKc0RpZmYuZGlmZkxpbmVzOiBMaW5lIGJhc2VkIGRpZmZcbiAqXG4gKiBKc0RpZmYuZGlmZkNzczogRGlmZiB0YXJnZXRlZCBhdCBDU1MgY29udGVudFxuICpcbiAqIFRoZXNlIG1ldGhvZHMgYXJlIGJhc2VkIG9uIHRoZSBpbXBsZW1lbnRhdGlvbiBwcm9wb3NlZCBpblxuICogXCJBbiBPKE5EKSBEaWZmZXJlbmNlIEFsZ29yaXRobSBhbmQgaXRzIFZhcmlhdGlvbnNcIiAoTXllcnMsIDE5ODYpLlxuICogaHR0cDovL2NpdGVzZWVyeC5pc3QucHN1LmVkdS92aWV3ZG9jL3N1bW1hcnk/ZG9pPTEwLjEuMS40LjY5MjdcbiAqL1xuaW1wb3J0IERpZmYgZnJvbSAnLi9kaWZmL2Jhc2UnO1xuaW1wb3J0IHtkaWZmQ2hhcnN9IGZyb20gJy4vZGlmZi9jaGFyYWN0ZXInO1xuaW1wb3J0IHtkaWZmV29yZHMsIGRpZmZXb3Jkc1dpdGhTcGFjZX0gZnJvbSAnLi9kaWZmL3dvcmQnO1xuaW1wb3J0IHtkaWZmTGluZXMsIGRpZmZUcmltbWVkTGluZXN9IGZyb20gJy4vZGlmZi9saW5lJztcbmltcG9ydCB7ZGlmZlNlbnRlbmNlc30gZnJvbSAnLi9kaWZmL3NlbnRlbmNlJztcblxuaW1wb3J0IHtkaWZmQ3NzfSBmcm9tICcuL2RpZmYvY3NzJztcbmltcG9ydCB7ZGlmZkpzb24sIGNhbm9uaWNhbGl6ZX0gZnJvbSAnLi9kaWZmL2pzb24nO1xuXG5pbXBvcnQge2RpZmZBcnJheXN9IGZyb20gJy4vZGlmZi9hcnJheSc7XG5cbmltcG9ydCB7YXBwbHlQYXRjaCwgYXBwbHlQYXRjaGVzfSBmcm9tICcuL3BhdGNoL2FwcGx5JztcbmltcG9ydCB7cGFyc2VQYXRjaH0gZnJvbSAnLi9wYXRjaC9wYXJzZSc7XG5pbXBvcnQge21lcmdlfSBmcm9tICcuL3BhdGNoL21lcmdlJztcbmltcG9ydCB7c3RydWN0dXJlZFBhdGNoLCBjcmVhdGVUd29GaWxlc1BhdGNoLCBjcmVhdGVQYXRjaH0gZnJvbSAnLi9wYXRjaC9jcmVhdGUnO1xuXG5pbXBvcnQge2NvbnZlcnRDaGFuZ2VzVG9ETVB9IGZyb20gJy4vY29udmVydC9kbXAnO1xuaW1wb3J0IHtjb252ZXJ0Q2hhbmdlc1RvWE1MfSBmcm9tICcuL2NvbnZlcnQveG1sJztcblxuZXhwb3J0IHtcbiAgRGlmZixcblxuICBkaWZmQ2hhcnMsXG4gIGRpZmZXb3JkcyxcbiAgZGlmZldvcmRzV2l0aFNwYWNlLFxuICBkaWZmTGluZXMsXG4gIGRpZmZUcmltbWVkTGluZXMsXG4gIGRpZmZTZW50ZW5jZXMsXG5cbiAgZGlmZkNzcyxcbiAgZGlmZkpzb24sXG5cbiAgZGlmZkFycmF5cyxcblxuICBzdHJ1Y3R1cmVkUGF0Y2gsXG4gIGNyZWF0ZVR3b0ZpbGVzUGF0Y2gsXG4gIGNyZWF0ZVBhdGNoLFxuICBhcHBseVBhdGNoLFxuICBhcHBseVBhdGNoZXMsXG4gIHBhcnNlUGF0Y2gsXG4gIG1lcmdlLFxuICBjb252ZXJ0Q2hhbmdlc1RvRE1QLFxuICBjb252ZXJ0Q2hhbmdlc1RvWE1MLFxuICBjYW5vbmljYWxpemVcbn07XG4iXX0=
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/apply.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/apply.js
new file mode 100644
index 00000000000..fa8301534d2
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/apply.js
@@ -0,0 +1,180 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/applyPatch = applyPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/applyPatches = applyPatches;
+
+var /*istanbul ignore start*/_parse = require('./parse') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_distanceIterator = require('../util/distance-iterator') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/var _distanceIterator2 = _interopRequireDefault(_distanceIterator);
+
+function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { 'default': obj }; }
+
+/*istanbul ignore end*/function applyPatch(source, uniDiff) {
+  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
+
+  if (typeof uniDiff === 'string') {
+    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+  }
+
+  if (Array.isArray(uniDiff)) {
+    if (uniDiff.length > 1) {
+      throw new Error('applyPatch only works with a single input.');
+    }
+
+    uniDiff = uniDiff[0];
+  }
+
+  // Apply the diff to the input
+  var lines = source.split(/\r\n|[\n\v\f\r\x85]/),
+      delimiters = source.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+      hunks = uniDiff.hunks,
+      compareLine = options.compareLine || function (lineNumber, line, operation, patchContent) /*istanbul ignore start*/{
+    return (/*istanbul ignore end*/line === patchContent
+    );
+  },
+      errorCount = 0,
+      fuzzFactor = options.fuzzFactor || 0,
+      minLine = 0,
+      offset = 0,
+      removeEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/,
+      addEOFNL = /*istanbul ignore start*/void 0 /*istanbul ignore end*/;
+
+  /**
+   * Checks if the hunk exactly fits on the provided location
+   */
+  function hunkFits(hunk, toPos) {
+    for (var j = 0; j < hunk.lines.length; j++) {
+      var line = hunk.lines[j],
+          operation = line.length > 0 ? line[0] : ' ',
+          content = line.length > 0 ? line.substr(1) : line;
+
+      if (operation === ' ' || operation === '-') {
+        // Context sanity check
+        if (!compareLine(toPos + 1, lines[toPos], operation, content)) {
+          errorCount++;
+
+          if (errorCount > fuzzFactor) {
+            return false;
+          }
+        }
+        toPos++;
+      }
+    }
+
+    return true;
+  }
+
+  // Search best fit offsets for each hunk based on the previous ones
+  for (var i = 0; i < hunks.length; i++) {
+    var hunk = hunks[i],
+        maxLine = lines.length - hunk.oldLines,
+        localOffset = 0,
+        toPos = offset + hunk.oldStart - 1;
+
+    var iterator = /*istanbul ignore start*/(0, _distanceIterator2['default']) /*istanbul ignore end*/(toPos, minLine, maxLine);
+
+    for (; localOffset !== undefined; localOffset = iterator()) {
+      if (hunkFits(hunk, toPos + localOffset)) {
+        hunk.offset = offset += localOffset;
+        break;
+      }
+    }
+
+    if (localOffset === undefined) {
+      return false;
+    }
+
+    // Set lower text limit to end of the current hunk, so next ones don't try
+    // to fit over already patched text
+    minLine = hunk.offset + hunk.oldStart + hunk.oldLines;
+  }
+
+  // Apply patch hunks
+  var diffOffset = 0;
+  for (var _i = 0; _i < hunks.length; _i++) {
+    var _hunk = hunks[_i],
+        _toPos = _hunk.oldStart + _hunk.offset + diffOffset - 1;
+    diffOffset += _hunk.newLines - _hunk.oldLines;
+
+    if (_toPos < 0) {
+      // Creating a new file
+      _toPos = 0;
+    }
+
+    for (var j = 0; j < _hunk.lines.length; j++) {
+      var line = _hunk.lines[j],
+          operation = line.length > 0 ? line[0] : ' ',
+          content = line.length > 0 ? line.substr(1) : line,
+          delimiter = _hunk.linedelimiters[j];
+
+      if (operation === ' ') {
+        _toPos++;
+      } else if (operation === '-') {
+        lines.splice(_toPos, 1);
+        delimiters.splice(_toPos, 1);
+        /* istanbul ignore else */
+      } else if (operation === '+') {
+        lines.splice(_toPos, 0, content);
+        delimiters.splice(_toPos, 0, delimiter);
+        _toPos++;
+      } else if (operation === '\\') {
+        var previousOperation = _hunk.lines[j - 1] ? _hunk.lines[j - 1][0] : null;
+        if (previousOperation === '+') {
+          removeEOFNL = true;
+        } else if (previousOperation === '-') {
+          addEOFNL = true;
+        }
+      }
+    }
+  }
+
+  // Handle EOFNL insertion/removal
+  if (removeEOFNL) {
+    while (!lines[lines.length - 1]) {
+      lines.pop();
+      delimiters.pop();
+    }
+  } else if (addEOFNL) {
+    lines.push('');
+    delimiters.push('\n');
+  }
+  for (var _k = 0; _k < lines.length - 1; _k++) {
+    lines[_k] = lines[_k] + delimiters[_k];
+  }
+  return lines.join('');
+}
+
+// Wrapper that supports multiple file patches via callbacks.
+function applyPatches(uniDiff, options) {
+  if (typeof uniDiff === 'string') {
+    uniDiff = /*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(uniDiff);
+  }
+
+  var currentIndex = 0;
+  function processIndex() {
+    var index = uniDiff[currentIndex++];
+    if (!index) {
+      return options.complete();
+    }
+
+    options.loadFile(index, function (err, data) {
+      if (err) {
+        return options.complete(err);
+      }
+
+      var updatedContent = applyPatch(data, index, options);
+      options.patched(index, updatedContent, function (err) {
+        if (err) {
+          return options.complete(err);
+        }
+
+        processIndex();
+      });
+    });
+  }
+  processIndex();
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9hcHBseS5qcyJdLCJuYW1lcyI6WyJhcHBseVBhdGNoIiwiYXBwbHlQYXRjaGVzIiwic291cmNlIiwidW5pRGlmZiIsIm9wdGlvbnMiLCJBcnJheSIsImlzQXJyYXkiLCJsZW5ndGgiLCJFcnJvciIsImxpbmVzIiwic3BsaXQiLCJkZWxpbWl0ZXJzIiwibWF0Y2giLCJodW5rcyIsImNvbXBhcmVMaW5lIiwibGluZU51bWJlciIsImxpbmUiLCJvcGVyYXRpb24iLCJwYXRjaENvbnRlbnQiLCJlcnJvckNvdW50IiwiZnV6ekZhY3RvciIsIm1pbkxpbmUiLCJvZmZzZXQiLCJyZW1vdmVFT0ZOTCIsImFkZEVPRk5MIiwiaHVua0ZpdHMiLCJodW5rIiwidG9Qb3MiLCJqIiwiY29udGVudCIsInN1YnN0ciIsImkiLCJtYXhMaW5lIiwib2xkTGluZXMiLCJsb2NhbE9mZnNldCIsIm9sZFN0YXJ0IiwiaXRlcmF0b3IiLCJ1bmRlZmluZWQiLCJkaWZmT2Zmc2V0IiwibmV3TGluZXMiLCJkZWxpbWl0ZXIiLCJsaW5lZGVsaW1pdGVycyIsInNwbGljZSIsInByZXZpb3VzT3BlcmF0aW9uIiwicG9wIiwicHVzaCIsIl9rIiwiam9pbiIsImN1cnJlbnRJbmRleCIsInByb2Nlc3NJbmRleCIsImluZGV4IiwiY29tcGxldGUiLCJsb2FkRmlsZSIsImVyciIsImRhdGEiLCJ1cGRhdGVkQ29udGVudCIsInBhdGNoZWQiXSwibWFwcGluZ3MiOiI7OztnQ0FHZ0JBLFUsR0FBQUEsVTt5REFvSUFDLFksR0FBQUEsWTs7QUF2SWhCOztBQUNBOzs7Ozs7dUJBRU8sU0FBU0QsVUFBVCxDQUFvQkUsTUFBcEIsRUFBNEJDLE9BQTVCLEVBQW1EO0FBQUEsc0RBQWRDLE9BQWMsdUVBQUosRUFBSTs7QUFDeEQsTUFBSSxPQUFPRCxPQUFQLEtBQW1CLFFBQXZCLEVBQWlDO0FBQy9CQSxjQUFVLHdFQUFXQSxPQUFYLENBQVY7QUFDRDs7QUFFRCxNQUFJRSxNQUFNQyxPQUFOLENBQWNILE9BQWQsQ0FBSixFQUE0QjtBQUMxQixRQUFJQSxRQUFRSSxNQUFSLEdBQWlCLENBQXJCLEVBQXdCO0FBQ3RCLFlBQU0sSUFBSUMsS0FBSixDQUFVLDRDQUFWLENBQU47QUFDRDs7QUFFREwsY0FBVUEsUUFBUSxDQUFSLENBQVY7QUFDRDs7QUFFRDtBQUNBLE1BQUlNLFFBQVFQLE9BQU9RLEtBQVAsQ0FBYSxxQkFBYixDQUFaO0FBQUEsTUFDSUMsYUFBYVQsT0FBT1UsS0FBUCxDQUFhLHNCQUFiLEtBQXdDLEVBRHpEO0FBQUEsTUFFSUMsUUFBUVYsUUFBUVUsS0FGcEI7QUFBQSxNQUlJQyxjQUFjVixRQUFRVSxXQUFSLElBQXdCLFVBQUNDLFVBQUQsRUFBYUMsSUFBYixFQUFtQkMsU0FBbkIsRUFBOEJDLFlBQTlCO0FBQUEsbUNBQStDRixTQUFTRTtBQUF4RDtBQUFBLEdBSjFDO0FBQUEsTUFLSUMsYUFBYSxDQUxqQjtBQUFBLE1BTUlDLGFBQWFoQixRQUFRZ0IsVUFBUixJQUFzQixDQU52QztBQUFBLE1BT0lDLFVBQVUsQ0FQZDtBQUFBLE1BUUlDLFNBQVMsQ0FSYjtBQUFBLE1BVUlDLDZDQVZKO0FBQUEsTUFXSUMsMENBWEo7O0FBYUE7OztBQUdBLFdBQVNDLFFBQVQsQ0FBa0JDLElBQWxCLEVBQXdCQyxLQUF4QixFQUErQjtBQUM3QixTQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUYsS0FBS2pCLEtBQUwsQ0FBV0YsTUFBL0IsRUFBdUNxQixHQUF2QyxFQUE0QztBQUMxQyxVQUFJWixPQUFPVSxLQUFLakIsS0FBTCxDQUFXbUIsQ0FBWCxDQUFYO0FBQUEsVUFDSVgsWUFBYUQsS0FBS1QsTUFBTCxHQUFjLENBQWQsR0FBa0JTLEtBQUssQ0FBTCxDQUFsQixHQUE0QixHQUQ3QztBQUFBLFVBRUlhLFVBQVdiLEtBQUtULE1BQUwsR0FBYyxDQUFkLEdBQWtCUyxLQUFLYyxNQUFMLENBQVksQ0FBWixDQUFsQixHQUFtQ2QsSUFGbEQ7O0FBSUEsVUFBSUMsY0FBYyxHQUFkLElBQXFCQSxjQUFjLEdBQXZDLEVBQTRDO0FBQzFDO0FBQ0EsWUFBSSxDQUFDSCxZQUFZYSxRQUFRLENBQXBCLEVBQXVCbEIsTUFBTWtCLEtBQU4sQ0FBdkIsRUFBcUNWLFNBQXJDLEVBQWdEWSxPQUFoRCxDQUFMLEVBQStEO0FBQzdEVjs7QUFFQSxjQUFJQSxhQUFhQyxVQUFqQixFQUE2QjtBQUMzQixtQkFBTyxLQUFQO0FBQ0Q7QUFDRjtBQUNETztBQUNEO0FBQ0Y7O0FBRUQsV0FBTyxJQUFQO0FBQ0Q7O0FBRUQ7QUFDQSxPQUFLLElBQUlJLElBQUksQ0FBYixFQUFnQkEsSUFBSWxCLE1BQU1OLE1BQTFCLEVBQWtDd0IsR0FBbEMsRUFBdUM7QUFDckMsUUFBSUwsT0FBT2IsTUFBTWtCLENBQU4sQ0FBWDtBQUFBLFFBQ0lDLFVBQVV2QixNQUFNRixNQUFOLEdBQWVtQixLQUFLTyxRQURsQztBQUFBLFFBRUlDLGNBQWMsQ0FGbEI7QUFBQSxRQUdJUCxRQUFRTCxTQUFTSSxLQUFLUyxRQUFkLEdBQXlCLENBSHJDOztBQUtBLFFBQUlDLFdBQVcsb0ZBQWlCVCxLQUFqQixFQUF3Qk4sT0FBeEIsRUFBaUNXLE9BQWpDLENBQWY7O0FBRUEsV0FBT0UsZ0JBQWdCRyxTQUF2QixFQUFrQ0gsY0FBY0UsVUFBaEQsRUFBNEQ7QUFDMUQsVUFBSVgsU0FBU0MsSUFBVCxFQUFlQyxRQUFRTyxXQUF2QixDQUFKLEVBQXlDO0FBQ3ZDUixhQUFLSixNQUFMLEdBQWNBLFVBQVVZLFdBQXhCO0FBQ0E7QUFDRDtBQUNGOztBQUVELFFBQUlBLGdCQUFnQkcsU0FBcEIsRUFBK0I7QUFDN0IsYUFBTyxLQUFQO0FBQ0Q7O0FBRUQ7QUFDQTtBQUNBaEIsY0FBVUssS0FBS0osTUFBTCxHQUFjSSxLQUFLUyxRQUFuQixHQUE4QlQsS0FBS08sUUFBN0M7QUFDRDs7QUFFRDtBQUNBLE1BQUlLLGFBQWEsQ0FBakI7QUFDQSxPQUFLLElBQUlQLEtBQUksQ0FBYixFQUFnQkEsS0FBSWxCLE1BQU1OLE1BQTFCLEVBQWtDd0IsSUFBbEMsRUFBdUM7QUFDckMsUUFBSUwsUUFBT2IsTUFBTWtCLEVBQU4sQ0FBWDtBQUFBLFFBQ0lKLFNBQVFELE1BQUtTLFFBQUwsR0FBZ0JULE1BQUtKLE1BQXJCLEdBQThCZ0IsVUFBOUIsR0FBMkMsQ0FEdkQ7QUFFQUEsa0JBQWNaLE1BQUthLFFBQUwsR0FBZ0JiLE1BQUtPLFFBQW5DOztBQUVBLFFBQUlOLFNBQVEsQ0FBWixFQUFlO0FBQUU7QUFDZkEsZUFBUSxDQUFSO0FBQ0Q7O0FBRUQsU0FBSyxJQUFJQyxJQUFJLENBQWIsRUFBZ0JBLElBQUlGLE1BQUtqQixLQUFMLENBQVdGLE1BQS9CLEVBQXVDcUIsR0FBdkMsRUFBNEM7QUFDMUMsVUFBSVosT0FBT1UsTUFBS2pCLEtBQUwsQ0FBV21CLENBQVgsQ0FBWDtBQUFBLFVBQ0lYLFlBQWFELEtBQUtULE1BQUwsR0FBYyxDQUFkLEdBQWtCUyxLQUFLLENBQUwsQ0FBbEIsR0FBNEIsR0FEN0M7QUFBQSxVQUVJYSxVQUFXYixLQUFLVCxNQUFMLEdBQWMsQ0FBZCxHQUFrQlMsS0FBS2MsTUFBTCxDQUFZLENBQVosQ0FBbEIsR0FBbUNkLElBRmxEO0FBQUEsVUFHSXdCLFlBQVlkLE1BQUtlLGNBQUwsQ0FBb0JiLENBQXBCLENBSGhCOztBQUtBLFVBQUlYLGNBQWMsR0FBbEIsRUFBdUI7QUFDckJVO0FBQ0QsT0FGRCxNQUVPLElBQUlWLGNBQWMsR0FBbEIsRUFBdUI7QUFDNUJSLGNBQU1pQyxNQUFOLENBQWFmLE1BQWIsRUFBb0IsQ0FBcEI7QUFDQWhCLG1CQUFXK0IsTUFBWCxDQUFrQmYsTUFBbEIsRUFBeUIsQ0FBekI7QUFDRjtBQUNDLE9BSk0sTUFJQSxJQUFJVixjQUFjLEdBQWxCLEVBQXVCO0FBQzVCUixjQUFNaUMsTUFBTixDQUFhZixNQUFiLEVBQW9CLENBQXBCLEVBQXVCRSxPQUF2QjtBQUNBbEIsbUJBQVcrQixNQUFYLENBQWtCZixNQUFsQixFQUF5QixDQUF6QixFQUE0QmEsU0FBNUI7QUFDQWI7QUFDRCxPQUpNLE1BSUEsSUFBSVYsY0FBYyxJQUFsQixFQUF3QjtBQUM3QixZQUFJMEIsb0JBQW9CakIsTUFBS2pCLEtBQUwsQ0FBV21CLElBQUksQ0FBZixJQUFvQkYsTUFBS2pCLEtBQUwsQ0FBV21CLElBQUksQ0FBZixFQUFrQixDQUFsQixDQUFwQixHQUEyQyxJQUFuRTtBQUNBLFlBQUllLHNCQUFzQixHQUExQixFQUErQjtBQUM3QnBCLHdCQUFjLElBQWQ7QUFDRCxTQUZELE1BRU8sSUFBSW9CLHNCQUFzQixHQUExQixFQUErQjtBQUNwQ25CLHFCQUFXLElBQVg7QUFDRDtBQUNGO0FBQ0Y7QUFDRjs7QUFFRDtBQUNBLE1BQUlELFdBQUosRUFBaUI7QUFDZixXQUFPLENBQUNkLE1BQU1BLE1BQU1GLE1BQU4sR0FBZSxDQUFyQixDQUFSLEVBQWlDO0FBQy9CRSxZQUFNbUMsR0FBTjtBQUNBakMsaUJBQVdpQyxHQUFYO0FBQ0Q7QUFDRixHQUxELE1BS08sSUFBSXBCLFFBQUosRUFBYztBQUNuQmYsVUFBTW9DLElBQU4sQ0FBVyxFQUFYO0FBQ0FsQyxlQUFXa0MsSUFBWCxDQUFnQixJQUFoQjtBQUNEO0FBQ0QsT0FBSyxJQUFJQyxLQUFLLENBQWQsRUFBaUJBLEtBQUtyQyxNQUFNRixNQUFOLEdBQWUsQ0FBckMsRUFBd0N1QyxJQUF4QyxFQUE4QztBQUM1Q3JDLFVBQU1xQyxFQUFOLElBQVlyQyxNQUFNcUMsRUFBTixJQUFZbkMsV0FBV21DLEVBQVgsQ0FBeEI7QUFDRDtBQUNELFNBQU9yQyxNQUFNc0MsSUFBTixDQUFXLEVBQVgsQ0FBUDtBQUNEOztBQUVEO0FBQ08sU0FBUzlDLFlBQVQsQ0FBc0JFLE9BQXRCLEVBQStCQyxPQUEvQixFQUF3QztBQUM3QyxNQUFJLE9BQU9ELE9BQVAsS0FBbUIsUUFBdkIsRUFBaUM7QUFDL0JBLGNBQVUsd0VBQVdBLE9BQVgsQ0FBVjtBQUNEOztBQUVELE1BQUk2QyxlQUFlLENBQW5CO0FBQ0EsV0FBU0MsWUFBVCxHQUF3QjtBQUN0QixRQUFJQyxRQUFRL0MsUUFBUTZDLGNBQVIsQ0FBWjtBQUNBLFFBQUksQ0FBQ0UsS0FBTCxFQUFZO0FBQ1YsYUFBTzlDLFFBQVErQyxRQUFSLEVBQVA7QUFDRDs7QUFFRC9DLFlBQVFnRCxRQUFSLENBQWlCRixLQUFqQixFQUF3QixVQUFTRyxHQUFULEVBQWNDLElBQWQsRUFBb0I7QUFDMUMsVUFBSUQsR0FBSixFQUFTO0FBQ1AsZUFBT2pELFFBQVErQyxRQUFSLENBQWlCRSxHQUFqQixDQUFQO0FBQ0Q7O0FBRUQsVUFBSUUsaUJBQWlCdkQsV0FBV3NELElBQVgsRUFBaUJKLEtBQWpCLEVBQXdCOUMsT0FBeEIsQ0FBckI7QUFDQUEsY0FBUW9ELE9BQVIsQ0FBZ0JOLEtBQWhCLEVBQXVCSyxjQUF2QixFQUF1QyxVQUFTRixHQUFULEVBQWM7QUFDbkQsWUFBSUEsR0FBSixFQUFTO0FBQ1AsaUJBQU9qRCxRQUFRK0MsUUFBUixDQUFpQkUsR0FBakIsQ0FBUDtBQUNEOztBQUVESjtBQUNELE9BTkQ7QUFPRCxLQWJEO0FBY0Q7QUFDREE7QUFDRCIsImZpbGUiOiJhcHBseS5qcyIsInNvdXJjZXNDb250ZW50IjpbImltcG9ydCB7cGFyc2VQYXRjaH0gZnJvbSAnLi9wYXJzZSc7XG5pbXBvcnQgZGlzdGFuY2VJdGVyYXRvciBmcm9tICcuLi91dGlsL2Rpc3RhbmNlLWl0ZXJhdG9yJztcblxuZXhwb3J0IGZ1bmN0aW9uIGFwcGx5UGF0Y2goc291cmNlLCB1bmlEaWZmLCBvcHRpb25zID0ge30pIHtcbiAgaWYgKHR5cGVvZiB1bmlEaWZmID09PSAnc3RyaW5nJykge1xuICAgIHVuaURpZmYgPSBwYXJzZVBhdGNoKHVuaURpZmYpO1xuICB9XG5cbiAgaWYgKEFycmF5LmlzQXJyYXkodW5pRGlmZikpIHtcbiAgICBpZiAodW5pRGlmZi5sZW5ndGggPiAxKSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoJ2FwcGx5UGF0Y2ggb25seSB3b3JrcyB3aXRoIGEgc2luZ2xlIGlucHV0LicpO1xuICAgIH1cblxuICAgIHVuaURpZmYgPSB1bmlEaWZmWzBdO1xuICB9XG5cbiAgLy8gQXBwbHkgdGhlIGRpZmYgdG8gdGhlIGlucHV0XG4gIGxldCBsaW5lcyA9IHNvdXJjZS5zcGxpdCgvXFxyXFxufFtcXG5cXHZcXGZcXHJcXHg4NV0vKSxcbiAgICAgIGRlbGltaXRlcnMgPSBzb3VyY2UubWF0Y2goL1xcclxcbnxbXFxuXFx2XFxmXFxyXFx4ODVdL2cpIHx8IFtdLFxuICAgICAgaHVua3MgPSB1bmlEaWZmLmh1bmtzLFxuXG4gICAgICBjb21wYXJlTGluZSA9IG9wdGlvbnMuY29tcGFyZUxpbmUgfHwgKChsaW5lTnVtYmVyLCBsaW5lLCBvcGVyYXRpb24sIHBhdGNoQ29udGVudCkgPT4gbGluZSA9PT0gcGF0Y2hDb250ZW50KSxcbiAgICAgIGVycm9yQ291bnQgPSAwLFxuICAgICAgZnV6ekZhY3RvciA9IG9wdGlvbnMuZnV6ekZhY3RvciB8fCAwLFxuICAgICAgbWluTGluZSA9IDAsXG4gICAgICBvZmZzZXQgPSAwLFxuXG4gICAgICByZW1vdmVFT0ZOTCxcbiAgICAgIGFkZEVPRk5MO1xuXG4gIC8qKlxuICAgKiBDaGVja3MgaWYgdGhlIGh1bmsgZXhhY3RseSBmaXRzIG9uIHRoZSBwcm92aWRlZCBsb2NhdGlvblxuICAgKi9cbiAgZnVuY3Rpb24gaHVua0ZpdHMoaHVuaywgdG9Qb3MpIHtcbiAgICBmb3IgKGxldCBqID0gMDsgaiA8IGh1bmsubGluZXMubGVuZ3RoOyBqKyspIHtcbiAgICAgIGxldCBsaW5lID0gaHVuay5saW5lc1tqXSxcbiAgICAgICAgICBvcGVyYXRpb24gPSAobGluZS5sZW5ndGggPiAwID8gbGluZVswXSA6ICcgJyksXG4gICAgICAgICAgY29udGVudCA9IChsaW5lLmxlbmd0aCA+IDAgPyBsaW5lLnN1YnN0cigxKSA6IGxpbmUpO1xuXG4gICAgICBpZiAob3BlcmF0aW9uID09PSAnICcgfHwgb3BlcmF0aW9uID09PSAnLScpIHtcbiAgICAgICAgLy8gQ29udGV4dCBzYW5pdHkgY2hlY2tcbiAgICAgICAgaWYgKCFjb21wYXJlTGluZSh0b1BvcyArIDEsIGxpbmVzW3RvUG9zXSwgb3BlcmF0aW9uLCBjb250ZW50KSkge1xuICAgICAgICAgIGVycm9yQ291bnQrKztcblxuICAgICAgICAgIGlmIChlcnJvckNvdW50ID4gZnV6ekZhY3Rvcikge1xuICAgICAgICAgICAgcmV0dXJuIGZhbHNlO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuICAgICAgICB0b1BvcysrO1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiB0cnVlO1xuICB9XG5cbiAgLy8gU2VhcmNoIGJlc3QgZml0IG9mZnNldHMgZm9yIGVhY2ggaHVuayBiYXNlZCBvbiB0aGUgcHJldmlvdXMgb25lc1xuICBmb3IgKGxldCBpID0gMDsgaSA8IGh1bmtzLmxlbmd0aDsgaSsrKSB7XG4gICAgbGV0IGh1bmsgPSBodW5rc1tpXSxcbiAgICAgICAgbWF4TGluZSA9IGxpbmVzLmxlbmd0aCAtIGh1bmsub2xkTGluZXMsXG4gICAgICAgIGxvY2FsT2Zmc2V0ID0gMCxcbiAgICAgICAgdG9Qb3MgPSBvZmZzZXQgKyBodW5rLm9sZFN0YXJ0IC0gMTtcblxuICAgIGxldCBpdGVyYXRvciA9IGRpc3RhbmNlSXRlcmF0b3IodG9Qb3MsIG1pbkxpbmUsIG1heExpbmUpO1xuXG4gICAgZm9yICg7IGxvY2FsT2Zmc2V0ICE9PSB1bmRlZmluZWQ7IGxvY2FsT2Zmc2V0ID0gaXRlcmF0b3IoKSkge1xuICAgICAgaWYgKGh1bmtGaXRzKGh1bmssIHRvUG9zICsgbG9jYWxPZmZzZXQpKSB7XG4gICAgICAgIGh1bmsub2Zmc2V0ID0gb2Zmc2V0ICs9IGxvY2FsT2Zmc2V0O1xuICAgICAgICBicmVhaztcbiAgICAgIH1cbiAgICB9XG5cbiAgICBpZiAobG9jYWxPZmZzZXQgPT09IHVuZGVmaW5lZCkge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cblxuICAgIC8vIFNldCBsb3dlciB0ZXh0IGxpbWl0IHRvIGVuZCBvZiB0aGUgY3VycmVudCBodW5rLCBzbyBuZXh0IG9uZXMgZG9uJ3QgdHJ5XG4gICAgLy8gdG8gZml0IG92ZXIgYWxyZWFkeSBwYXRjaGVkIHRleHRcbiAgICBtaW5MaW5lID0gaHVuay5vZmZzZXQgKyBodW5rLm9sZFN0YXJ0ICsgaHVuay5vbGRMaW5lcztcbiAgfVxuXG4gIC8vIEFwcGx5IHBhdGNoIGh1bmtzXG4gIGxldCBkaWZmT2Zmc2V0ID0gMDtcbiAgZm9yIChsZXQgaSA9IDA7IGkgPCBodW5rcy5sZW5ndGg7IGkrKykge1xuICAgIGxldCBodW5rID0gaHVua3NbaV0sXG4gICAgICAgIHRvUG9zID0gaHVuay5vbGRTdGFydCArIGh1bmsub2Zmc2V0ICsgZGlmZk9mZnNldCAtIDE7XG4gICAgZGlmZk9mZnNldCArPSBodW5rLm5ld0xpbmVzIC0gaHVuay5vbGRMaW5lcztcblxuICAgIGlmICh0b1BvcyA8IDApIHsgLy8gQ3JlYXRpbmcgYSBuZXcgZmlsZVxuICAgICAgdG9Qb3MgPSAwO1xuICAgIH1cblxuICAgIGZvciAobGV0IGogPSAwOyBqIDwgaHVuay5saW5lcy5sZW5ndGg7IGorKykge1xuICAgICAgbGV0IGxpbmUgPSBodW5rLmxpbmVzW2pdLFxuICAgICAgICAgIG9wZXJhdGlvbiA9IChsaW5lLmxlbmd0aCA+IDAgPyBsaW5lWzBdIDogJyAnKSxcbiAgICAgICAgICBjb250ZW50ID0gKGxpbmUubGVuZ3RoID4gMCA/IGxpbmUuc3Vic3RyKDEpIDogbGluZSksXG4gICAgICAgICAgZGVsaW1pdGVyID0gaHVuay5saW5lZGVsaW1pdGVyc1tqXTtcblxuICAgICAgaWYgKG9wZXJhdGlvbiA9PT0gJyAnKSB7XG4gICAgICAgIHRvUG9zKys7XG4gICAgICB9IGVsc2UgaWYgKG9wZXJhdGlvbiA9PT0gJy0nKSB7XG4gICAgICAgIGxpbmVzLnNwbGljZSh0b1BvcywgMSk7XG4gICAgICAgIGRlbGltaXRlcnMuc3BsaWNlKHRvUG9zLCAxKTtcbiAgICAgIC8qIGlzdGFuYnVsIGlnbm9yZSBlbHNlICovXG4gICAgICB9IGVsc2UgaWYgKG9wZXJhdGlvbiA9PT0gJysnKSB7XG4gICAgICAgIGxpbmVzLnNwbGljZSh0b1BvcywgMCwgY29udGVudCk7XG4gICAgICAgIGRlbGltaXRlcnMuc3BsaWNlKHRvUG9zLCAwLCBkZWxpbWl0ZXIpO1xuICAgICAgICB0b1BvcysrO1xuICAgICAgfSBlbHNlIGlmIChvcGVyYXRpb24gPT09ICdcXFxcJykge1xuICAgICAgICBsZXQgcHJldmlvdXNPcGVyYXRpb24gPSBodW5rLmxpbmVzW2ogLSAxXSA/IGh1bmsubGluZXNbaiAtIDFdWzBdIDogbnVsbDtcbiAgICAgICAgaWYgKHByZXZpb3VzT3BlcmF0aW9uID09PSAnKycpIHtcbiAgICAgICAgICByZW1vdmVFT0ZOTCA9IHRydWU7XG4gICAgICAgIH0gZWxzZSBpZiAocHJldmlvdXNPcGVyYXRpb24gPT09ICctJykge1xuICAgICAgICAgIGFkZEVPRk5MID0gdHJ1ZTtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH1cbiAgfVxuXG4gIC8vIEhhbmRsZSBFT0ZOTCBpbnNlcnRpb24vcmVtb3ZhbFxuICBpZiAocmVtb3ZlRU9GTkwpIHtcbiAgICB3aGlsZSAoIWxpbmVzW2xpbmVzLmxlbmd0aCAtIDFdKSB7XG4gICAgICBsaW5lcy5wb3AoKTtcbiAgICAgIGRlbGltaXRlcnMucG9wKCk7XG4gICAgfVxuICB9IGVsc2UgaWYgKGFkZEVPRk5MKSB7XG4gICAgbGluZXMucHVzaCgnJyk7XG4gICAgZGVsaW1pdGVycy5wdXNoKCdcXG4nKTtcbiAgfVxuICBmb3IgKGxldCBfayA9IDA7IF9rIDwgbGluZXMubGVuZ3RoIC0gMTsgX2srKykge1xuICAgIGxpbmVzW19rXSA9IGxpbmVzW19rXSArIGRlbGltaXRlcnNbX2tdO1xuICB9XG4gIHJldHVybiBsaW5lcy5qb2luKCcnKTtcbn1cblxuLy8gV3JhcHBlciB0aGF0IHN1cHBvcnRzIG11bHRpcGxlIGZpbGUgcGF0Y2hlcyB2aWEgY2FsbGJhY2tzLlxuZXhwb3J0IGZ1bmN0aW9uIGFwcGx5UGF0Y2hlcyh1bmlEaWZmLCBvcHRpb25zKSB7XG4gIGlmICh0eXBlb2YgdW5pRGlmZiA9PT0gJ3N0cmluZycpIHtcbiAgICB1bmlEaWZmID0gcGFyc2VQYXRjaCh1bmlEaWZmKTtcbiAgfVxuXG4gIGxldCBjdXJyZW50SW5kZXggPSAwO1xuICBmdW5jdGlvbiBwcm9jZXNzSW5kZXgoKSB7XG4gICAgbGV0IGluZGV4ID0gdW5pRGlmZltjdXJyZW50SW5kZXgrK107XG4gICAgaWYgKCFpbmRleCkge1xuICAgICAgcmV0dXJuIG9wdGlvbnMuY29tcGxldGUoKTtcbiAgICB9XG5cbiAgICBvcHRpb25zLmxvYWRGaWxlKGluZGV4LCBmdW5jdGlvbihlcnIsIGRhdGEpIHtcbiAgICAgIGlmIChlcnIpIHtcbiAgICAgICAgcmV0dXJuIG9wdGlvbnMuY29tcGxldGUoZXJyKTtcbiAgICAgIH1cblxuICAgICAgbGV0IHVwZGF0ZWRDb250ZW50ID0gYXBwbHlQYXRjaChkYXRhLCBpbmRleCwgb3B0aW9ucyk7XG4gICAgICBvcHRpb25zLnBhdGNoZWQoaW5kZXgsIHVwZGF0ZWRDb250ZW50LCBmdW5jdGlvbihlcnIpIHtcbiAgICAgICAgaWYgKGVycikge1xuICAgICAgICAgIHJldHVybiBvcHRpb25zLmNvbXBsZXRlKGVycik7XG4gICAgICAgIH1cblxuICAgICAgICBwcm9jZXNzSW5kZXgoKTtcbiAgICAgIH0pO1xuICAgIH0pO1xuICB9XG4gIHByb2Nlc3NJbmRleCgpO1xufVxuIl19
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/create.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/create.js
new file mode 100644
index 00000000000..be4d1876ecd
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/create.js
@@ -0,0 +1,148 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/structuredPatch = structuredPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/createTwoFilesPatch = createTwoFilesPatch;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/createPatch = createPatch;
+
+var /*istanbul ignore start*/_line = require('../diff/line') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+/*istanbul ignore end*/function structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+  if (!options) {
+    options = {};
+  }
+  if (typeof options.context === 'undefined') {
+    options.context = 4;
+  }
+
+  var diff = /*istanbul ignore start*/(0, _line.diffLines) /*istanbul ignore end*/(oldStr, newStr, options);
+  diff.push({ value: '', lines: [] }); // Append an empty value to make cleanup easier
+
+  function contextLines(lines) {
+    return lines.map(function (entry) {
+      return ' ' + entry;
+    });
+  }
+
+  var hunks = [];
+  var oldRangeStart = 0,
+      newRangeStart = 0,
+      curRange = [],
+      oldLine = 1,
+      newLine = 1;
+
+  /*istanbul ignore start*/var _loop = function _loop( /*istanbul ignore end*/i) {
+    var current = diff[i],
+        lines = current.lines || current.value.replace(/\n$/, '').split('\n');
+    current.lines = lines;
+
+    if (current.added || current.removed) {
+      /*istanbul ignore start*/var _curRange;
+
+      /*istanbul ignore end*/ // If we have previous context, start with that
+      if (!oldRangeStart) {
+        var prev = diff[i - 1];
+        oldRangeStart = oldLine;
+        newRangeStart = newLine;
+
+        if (prev) {
+          curRange = options.context > 0 ? contextLines(prev.lines.slice(-options.context)) : [];
+          oldRangeStart -= curRange.length;
+          newRangeStart -= curRange.length;
+        }
+      }
+
+      // Output our changes
+      /*istanbul ignore start*/(_curRange = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/lines.map(function (entry) {
+        return (current.added ? '+' : '-') + entry;
+      })));
+
+      // Track the updated file position
+      if (current.added) {
+        newLine += lines.length;
+      } else {
+        oldLine += lines.length;
+      }
+    } else {
+      // Identical context lines. Track line changes
+      if (oldRangeStart) {
+        // Close out any changes that have been output (or join overlapping)
+        if (lines.length <= options.context * 2 && i < diff.length - 2) {
+          /*istanbul ignore start*/var _curRange2;
+
+          /*istanbul ignore end*/ // Overlapping
+          /*istanbul ignore start*/(_curRange2 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines)));
+        } else {
+          /*istanbul ignore start*/var _curRange3;
+
+          /*istanbul ignore end*/ // end the range and output
+          var contextSize = Math.min(lines.length, options.context);
+          /*istanbul ignore start*/(_curRange3 = /*istanbul ignore end*/curRange).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_curRange3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/contextLines(lines.slice(0, contextSize))));
+
+          var hunk = {
+            oldStart: oldRangeStart,
+            oldLines: oldLine - oldRangeStart + contextSize,
+            newStart: newRangeStart,
+            newLines: newLine - newRangeStart + contextSize,
+            lines: curRange
+          };
+          if (i >= diff.length - 2 && lines.length <= options.context) {
+            // EOF is inside this hunk
+            var oldEOFNewline = /\n$/.test(oldStr);
+            var newEOFNewline = /\n$/.test(newStr);
+            if (lines.length == 0 && !oldEOFNewline) {
+              // special case: old has no eol and no trailing context; no-nl can end up before adds
+              curRange.splice(hunk.oldLines, 0, '\\ No newline at end of file');
+            } else if (!oldEOFNewline || !newEOFNewline) {
+              curRange.push('\\ No newline at end of file');
+            }
+          }
+          hunks.push(hunk);
+
+          oldRangeStart = 0;
+          newRangeStart = 0;
+          curRange = [];
+        }
+      }
+      oldLine += lines.length;
+      newLine += lines.length;
+    }
+  };
+
+  for (var i = 0; i < diff.length; i++) {
+    /*istanbul ignore start*/_loop( /*istanbul ignore end*/i);
+  }
+
+  return {
+    oldFileName: oldFileName, newFileName: newFileName,
+    oldHeader: oldHeader, newHeader: newHeader,
+    hunks: hunks
+  };
+}
+
+function createTwoFilesPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options) {
+  var diff = structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, newHeader, options);
+
+  var ret = [];
+  if (oldFileName == newFileName) {
+    ret.push('Index: ' + oldFileName);
+  }
+  ret.push('===================================================================');
+  ret.push('--- ' + diff.oldFileName + (typeof diff.oldHeader === 'undefined' ? '' : '\t' + diff.oldHeader));
+  ret.push('+++ ' + diff.newFileName + (typeof diff.newHeader === 'undefined' ? '' : '\t' + diff.newHeader));
+
+  for (var i = 0; i < diff.hunks.length; i++) {
+    var hunk = diff.hunks[i];
+    ret.push('@@ -' + hunk.oldStart + ',' + hunk.oldLines + ' +' + hunk.newStart + ',' + hunk.newLines + ' @@');
+    ret.push.apply(ret, hunk.lines);
+  }
+
+  return ret.join('\n') + '\n';
+}
+
+function createPatch(fileName, oldStr, newStr, oldHeader, newHeader, options) {
+  return createTwoFilesPatch(fileName, fileName, oldStr, newStr, oldHeader, newHeader, options);
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9jcmVhdGUuanMiXSwibmFtZXMiOlsic3RydWN0dXJlZFBhdGNoIiwiY3JlYXRlVHdvRmlsZXNQYXRjaCIsImNyZWF0ZVBhdGNoIiwib2xkRmlsZU5hbWUiLCJuZXdGaWxlTmFtZSIsIm9sZFN0ciIsIm5ld1N0ciIsIm9sZEhlYWRlciIsIm5ld0hlYWRlciIsIm9wdGlvbnMiLCJjb250ZXh0IiwiZGlmZiIsInB1c2giLCJ2YWx1ZSIsImxpbmVzIiwiY29udGV4dExpbmVzIiwibWFwIiwiZW50cnkiLCJodW5rcyIsIm9sZFJhbmdlU3RhcnQiLCJuZXdSYW5nZVN0YXJ0IiwiY3VyUmFuZ2UiLCJvbGRMaW5lIiwibmV3TGluZSIsImkiLCJjdXJyZW50IiwicmVwbGFjZSIsInNwbGl0IiwiYWRkZWQiLCJyZW1vdmVkIiwicHJldiIsInNsaWNlIiwibGVuZ3RoIiwiY29udGV4dFNpemUiLCJNYXRoIiwibWluIiwiaHVuayIsIm9sZFN0YXJ0Iiwib2xkTGluZXMiLCJuZXdTdGFydCIsIm5ld0xpbmVzIiwib2xkRU9GTmV3bGluZSIsInRlc3QiLCJuZXdFT0ZOZXdsaW5lIiwic3BsaWNlIiwicmV0IiwiYXBwbHkiLCJqb2luIiwiZmlsZU5hbWUiXSwibWFwcGluZ3MiOiI7OztnQ0FFZ0JBLGUsR0FBQUEsZTt5REFpR0FDLG1CLEdBQUFBLG1CO3lEQXdCQUMsVyxHQUFBQSxXOztBQTNIaEI7Ozs7dUJBRU8sU0FBU0YsZUFBVCxDQUF5QkcsV0FBekIsRUFBc0NDLFdBQXRDLEVBQW1EQyxNQUFuRCxFQUEyREMsTUFBM0QsRUFBbUVDLFNBQW5FLEVBQThFQyxTQUE5RSxFQUF5RkMsT0FBekYsRUFBa0c7QUFDdkcsTUFBSSxDQUFDQSxPQUFMLEVBQWM7QUFDWkEsY0FBVSxFQUFWO0FBQ0Q7QUFDRCxNQUFJLE9BQU9BLFFBQVFDLE9BQWYsS0FBMkIsV0FBL0IsRUFBNEM7QUFDMUNELFlBQVFDLE9BQVIsR0FBa0IsQ0FBbEI7QUFDRDs7QUFFRCxNQUFNQyxPQUFPLHNFQUFVTixNQUFWLEVBQWtCQyxNQUFsQixFQUEwQkcsT0FBMUIsQ0FBYjtBQUNBRSxPQUFLQyxJQUFMLENBQVUsRUFBQ0MsT0FBTyxFQUFSLEVBQVlDLE9BQU8sRUFBbkIsRUFBVixFQVR1RyxDQVNsRTs7QUFFckMsV0FBU0MsWUFBVCxDQUFzQkQsS0FBdEIsRUFBNkI7QUFDM0IsV0FBT0EsTUFBTUUsR0FBTixDQUFVLFVBQVNDLEtBQVQsRUFBZ0I7QUFBRSxhQUFPLE1BQU1BLEtBQWI7QUFBcUIsS0FBakQsQ0FBUDtBQUNEOztBQUVELE1BQUlDLFFBQVEsRUFBWjtBQUNBLE1BQUlDLGdCQUFnQixDQUFwQjtBQUFBLE1BQXVCQyxnQkFBZ0IsQ0FBdkM7QUFBQSxNQUEwQ0MsV0FBVyxFQUFyRDtBQUFBLE1BQ0lDLFVBQVUsQ0FEZDtBQUFBLE1BQ2lCQyxVQUFVLENBRDNCOztBQWhCdUcsOEVBa0I5RkMsQ0FsQjhGO0FBbUJyRyxRQUFNQyxVQUFVZCxLQUFLYSxDQUFMLENBQWhCO0FBQUEsUUFDTVYsUUFBUVcsUUFBUVgsS0FBUixJQUFpQlcsUUFBUVosS0FBUixDQUFjYSxPQUFkLENBQXNCLEtBQXRCLEVBQTZCLEVBQTdCLEVBQWlDQyxLQUFqQyxDQUF1QyxJQUF2QyxDQUQvQjtBQUVBRixZQUFRWCxLQUFSLEdBQWdCQSxLQUFoQjs7QUFFQSxRQUFJVyxRQUFRRyxLQUFSLElBQWlCSCxRQUFRSSxPQUE3QixFQUFzQztBQUFBOztBQUFBLDhCQUNwQztBQUNBLFVBQUksQ0FBQ1YsYUFBTCxFQUFvQjtBQUNsQixZQUFNVyxPQUFPbkIsS0FBS2EsSUFBSSxDQUFULENBQWI7QUFDQUwsd0JBQWdCRyxPQUFoQjtBQUNBRix3QkFBZ0JHLE9BQWhCOztBQUVBLFlBQUlPLElBQUosRUFBVTtBQUNSVCxxQkFBV1osUUFBUUMsT0FBUixHQUFrQixDQUFsQixHQUFzQkssYUFBYWUsS0FBS2hCLEtBQUwsQ0FBV2lCLEtBQVgsQ0FBaUIsQ0FBQ3RCLFFBQVFDLE9BQTFCLENBQWIsQ0FBdEIsR0FBeUUsRUFBcEY7QUFDQVMsMkJBQWlCRSxTQUFTVyxNQUExQjtBQUNBWiwyQkFBaUJDLFNBQVNXLE1BQTFCO0FBQ0Q7QUFDRjs7QUFFRDtBQUNBLDZFQUFTcEIsSUFBVCwwTEFBa0JFLE1BQU1FLEdBQU4sQ0FBVSxVQUFTQyxLQUFULEVBQWdCO0FBQzFDLGVBQU8sQ0FBQ1EsUUFBUUcsS0FBUixHQUFnQixHQUFoQixHQUFzQixHQUF2QixJQUE4QlgsS0FBckM7QUFDRCxPQUZpQixDQUFsQjs7QUFJQTtBQUNBLFVBQUlRLFFBQVFHLEtBQVosRUFBbUI7QUFDakJMLG1CQUFXVCxNQUFNa0IsTUFBakI7QUFDRCxPQUZELE1BRU87QUFDTFYsbUJBQVdSLE1BQU1rQixNQUFqQjtBQUNEO0FBQ0YsS0F6QkQsTUF5Qk87QUFDTDtBQUNBLFVBQUliLGFBQUosRUFBbUI7QUFDakI7QUFDQSxZQUFJTCxNQUFNa0IsTUFBTixJQUFnQnZCLFFBQVFDLE9BQVIsR0FBa0IsQ0FBbEMsSUFBdUNjLElBQUliLEtBQUtxQixNQUFMLEdBQWMsQ0FBN0QsRUFBZ0U7QUFBQTs7QUFBQSxrQ0FDOUQ7QUFDQSxrRkFBU3BCLElBQVQsMkxBQWtCRyxhQUFhRCxLQUFiLENBQWxCO0FBQ0QsU0FIRCxNQUdPO0FBQUE7O0FBQUEsa0NBQ0w7QUFDQSxjQUFJbUIsY0FBY0MsS0FBS0MsR0FBTCxDQUFTckIsTUFBTWtCLE1BQWYsRUFBdUJ2QixRQUFRQyxPQUEvQixDQUFsQjtBQUNBLGtGQUFTRSxJQUFULDJMQUFrQkcsYUFBYUQsTUFBTWlCLEtBQU4sQ0FBWSxDQUFaLEVBQWVFLFdBQWYsQ0FBYixDQUFsQjs7QUFFQSxjQUFJRyxPQUFPO0FBQ1RDLHNCQUFVbEIsYUFERDtBQUVUbUIsc0JBQVdoQixVQUFVSCxhQUFWLEdBQTBCYyxXQUY1QjtBQUdUTSxzQkFBVW5CLGFBSEQ7QUFJVG9CLHNCQUFXakIsVUFBVUgsYUFBVixHQUEwQmEsV0FKNUI7QUFLVG5CLG1CQUFPTztBQUxFLFdBQVg7QUFPQSxjQUFJRyxLQUFLYixLQUFLcUIsTUFBTCxHQUFjLENBQW5CLElBQXdCbEIsTUFBTWtCLE1BQU4sSUFBZ0J2QixRQUFRQyxPQUFwRCxFQUE2RDtBQUMzRDtBQUNBLGdCQUFJK0IsZ0JBQWlCLE1BQU1DLElBQU4sQ0FBV3JDLE1BQVgsQ0FBckI7QUFDQSxnQkFBSXNDLGdCQUFpQixNQUFNRCxJQUFOLENBQVdwQyxNQUFYLENBQXJCO0FBQ0EsZ0JBQUlRLE1BQU1rQixNQUFOLElBQWdCLENBQWhCLElBQXFCLENBQUNTLGFBQTFCLEVBQXlDO0FBQ3ZDO0FBQ0FwQix1QkFBU3VCLE1BQVQsQ0FBZ0JSLEtBQUtFLFFBQXJCLEVBQStCLENBQS9CLEVBQWtDLDhCQUFsQztBQUNELGFBSEQsTUFHTyxJQUFJLENBQUNHLGFBQUQsSUFBa0IsQ0FBQ0UsYUFBdkIsRUFBc0M7QUFDM0N0Qix1QkFBU1QsSUFBVCxDQUFjLDhCQUFkO0FBQ0Q7QUFDRjtBQUNETSxnQkFBTU4sSUFBTixDQUFXd0IsSUFBWDs7QUFFQWpCLDBCQUFnQixDQUFoQjtBQUNBQywwQkFBZ0IsQ0FBaEI7QUFDQUMscUJBQVcsRUFBWDtBQUNEO0FBQ0Y7QUFDREMsaUJBQVdSLE1BQU1rQixNQUFqQjtBQUNBVCxpQkFBV1QsTUFBTWtCLE1BQWpCO0FBQ0Q7QUF2Rm9HOztBQWtCdkcsT0FBSyxJQUFJUixJQUFJLENBQWIsRUFBZ0JBLElBQUliLEtBQUtxQixNQUF6QixFQUFpQ1IsR0FBakMsRUFBc0M7QUFBQSwyREFBN0JBLENBQTZCO0FBc0VyQzs7QUFFRCxTQUFPO0FBQ0xyQixpQkFBYUEsV0FEUixFQUNxQkMsYUFBYUEsV0FEbEM7QUFFTEcsZUFBV0EsU0FGTixFQUVpQkMsV0FBV0EsU0FGNUI7QUFHTFUsV0FBT0E7QUFIRixHQUFQO0FBS0Q7O0FBRU0sU0FBU2pCLG1CQUFULENBQTZCRSxXQUE3QixFQUEwQ0MsV0FBMUMsRUFBdURDLE1BQXZELEVBQStEQyxNQUEvRCxFQUF1RUMsU0FBdkUsRUFBa0ZDLFNBQWxGLEVBQTZGQyxPQUE3RixFQUFzRztBQUMzRyxNQUFNRSxPQUFPWCxnQkFBZ0JHLFdBQWhCLEVBQTZCQyxXQUE3QixFQUEwQ0MsTUFBMUMsRUFBa0RDLE1BQWxELEVBQTBEQyxTQUExRCxFQUFxRUMsU0FBckUsRUFBZ0ZDLE9BQWhGLENBQWI7O0FBRUEsTUFBTW9DLE1BQU0sRUFBWjtBQUNBLE1BQUkxQyxlQUFlQyxXQUFuQixFQUFnQztBQUM5QnlDLFFBQUlqQyxJQUFKLENBQVMsWUFBWVQsV0FBckI7QUFDRDtBQUNEMEMsTUFBSWpDLElBQUosQ0FBUyxxRUFBVDtBQUNBaUMsTUFBSWpDLElBQUosQ0FBUyxTQUFTRCxLQUFLUixXQUFkLElBQTZCLE9BQU9RLEtBQUtKLFNBQVosS0FBMEIsV0FBMUIsR0FBd0MsRUFBeEMsR0FBNkMsT0FBT0ksS0FBS0osU0FBdEYsQ0FBVDtBQUNBc0MsTUFBSWpDLElBQUosQ0FBUyxTQUFTRCxLQUFLUCxXQUFkLElBQTZCLE9BQU9PLEtBQUtILFNBQVosS0FBMEIsV0FBMUIsR0FBd0MsRUFBeEMsR0FBNkMsT0FBT0csS0FBS0gsU0FBdEYsQ0FBVDs7QUFFQSxPQUFLLElBQUlnQixJQUFJLENBQWIsRUFBZ0JBLElBQUliLEtBQUtPLEtBQUwsQ0FBV2MsTUFBL0IsRUFBdUNSLEdBQXZDLEVBQTRDO0FBQzFDLFFBQU1ZLE9BQU96QixLQUFLTyxLQUFMLENBQVdNLENBQVgsQ0FBYjtBQUNBcUIsUUFBSWpDLElBQUosQ0FDRSxTQUFTd0IsS0FBS0MsUUFBZCxHQUF5QixHQUF6QixHQUErQkQsS0FBS0UsUUFBcEMsR0FDRSxJQURGLEdBQ1NGLEtBQUtHLFFBRGQsR0FDeUIsR0FEekIsR0FDK0JILEtBQUtJLFFBRHBDLEdBRUUsS0FISjtBQUtBSyxRQUFJakMsSUFBSixDQUFTa0MsS0FBVCxDQUFlRCxHQUFmLEVBQW9CVCxLQUFLdEIsS0FBekI7QUFDRDs7QUFFRCxTQUFPK0IsSUFBSUUsSUFBSixDQUFTLElBQVQsSUFBaUIsSUFBeEI7QUFDRDs7QUFFTSxTQUFTN0MsV0FBVCxDQUFxQjhDLFFBQXJCLEVBQStCM0MsTUFBL0IsRUFBdUNDLE1BQXZDLEVBQStDQyxTQUEvQyxFQUEwREMsU0FBMUQsRUFBcUVDLE9BQXJFLEVBQThFO0FBQ25GLFNBQU9SLG9CQUFvQitDLFFBQXBCLEVBQThCQSxRQUE5QixFQUF3QzNDLE1BQXhDLEVBQWdEQyxNQUFoRCxFQUF3REMsU0FBeEQsRUFBbUVDLFNBQW5FLEVBQThFQyxPQUE5RSxDQUFQO0FBQ0QiLCJmaWxlIjoiY3JlYXRlLmpzIiwic291cmNlc0NvbnRlbnQiOlsiaW1wb3J0IHtkaWZmTGluZXN9IGZyb20gJy4uL2RpZmYvbGluZSc7XG5cbmV4cG9ydCBmdW5jdGlvbiBzdHJ1Y3R1cmVkUGF0Y2gob2xkRmlsZU5hbWUsIG5ld0ZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpIHtcbiAgaWYgKCFvcHRpb25zKSB7XG4gICAgb3B0aW9ucyA9IHt9O1xuICB9XG4gIGlmICh0eXBlb2Ygb3B0aW9ucy5jb250ZXh0ID09PSAndW5kZWZpbmVkJykge1xuICAgIG9wdGlvbnMuY29udGV4dCA9IDQ7XG4gIH1cblxuICBjb25zdCBkaWZmID0gZGlmZkxpbmVzKG9sZFN0ciwgbmV3U3RyLCBvcHRpb25zKTtcbiAgZGlmZi5wdXNoKHt2YWx1ZTogJycsIGxpbmVzOiBbXX0pOyAgIC8vIEFwcGVuZCBhbiBlbXB0eSB2YWx1ZSB0byBtYWtlIGNsZWFudXAgZWFzaWVyXG5cbiAgZnVuY3Rpb24gY29udGV4dExpbmVzKGxpbmVzKSB7XG4gICAgcmV0dXJuIGxpbmVzLm1hcChmdW5jdGlvbihlbnRyeSkgeyByZXR1cm4gJyAnICsgZW50cnk7IH0pO1xuICB9XG5cbiAgbGV0IGh1bmtzID0gW107XG4gIGxldCBvbGRSYW5nZVN0YXJ0ID0gMCwgbmV3UmFuZ2VTdGFydCA9IDAsIGN1clJhbmdlID0gW10sXG4gICAgICBvbGRMaW5lID0gMSwgbmV3TGluZSA9IDE7XG4gIGZvciAobGV0IGkgPSAwOyBpIDwgZGlmZi5sZW5ndGg7IGkrKykge1xuICAgIGNvbnN0IGN1cnJlbnQgPSBkaWZmW2ldLFxuICAgICAgICAgIGxpbmVzID0gY3VycmVudC5saW5lcyB8fCBjdXJyZW50LnZhbHVlLnJlcGxhY2UoL1xcbiQvLCAnJykuc3BsaXQoJ1xcbicpO1xuICAgIGN1cnJlbnQubGluZXMgPSBsaW5lcztcblxuICAgIGlmIChjdXJyZW50LmFkZGVkIHx8IGN1cnJlbnQucmVtb3ZlZCkge1xuICAgICAgLy8gSWYgd2UgaGF2ZSBwcmV2aW91cyBjb250ZXh0LCBzdGFydCB3aXRoIHRoYXRcbiAgICAgIGlmICghb2xkUmFuZ2VTdGFydCkge1xuICAgICAgICBjb25zdCBwcmV2ID0gZGlmZltpIC0gMV07XG4gICAgICAgIG9sZFJhbmdlU3RhcnQgPSBvbGRMaW5lO1xuICAgICAgICBuZXdSYW5nZVN0YXJ0ID0gbmV3TGluZTtcblxuICAgICAgICBpZiAocHJldikge1xuICAgICAgICAgIGN1clJhbmdlID0gb3B0aW9ucy5jb250ZXh0ID4gMCA/IGNvbnRleHRMaW5lcyhwcmV2LmxpbmVzLnNsaWNlKC1vcHRpb25zLmNvbnRleHQpKSA6IFtdO1xuICAgICAgICAgIG9sZFJhbmdlU3RhcnQgLT0gY3VyUmFuZ2UubGVuZ3RoO1xuICAgICAgICAgIG5ld1JhbmdlU3RhcnQgLT0gY3VyUmFuZ2UubGVuZ3RoO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIC8vIE91dHB1dCBvdXIgY2hhbmdlc1xuICAgICAgY3VyUmFuZ2UucHVzaCguLi4gbGluZXMubWFwKGZ1bmN0aW9uKGVudHJ5KSB7XG4gICAgICAgIHJldHVybiAoY3VycmVudC5hZGRlZCA/ICcrJyA6ICctJykgKyBlbnRyeTtcbiAgICAgIH0pKTtcblxuICAgICAgLy8gVHJhY2sgdGhlIHVwZGF0ZWQgZmlsZSBwb3NpdGlvblxuICAgICAgaWYgKGN1cnJlbnQuYWRkZWQpIHtcbiAgICAgICAgbmV3TGluZSArPSBsaW5lcy5sZW5ndGg7XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBvbGRMaW5lICs9IGxpbmVzLmxlbmd0aDtcbiAgICAgIH1cbiAgICB9IGVsc2Uge1xuICAgICAgLy8gSWRlbnRpY2FsIGNvbnRleHQgbGluZXMuIFRyYWNrIGxpbmUgY2hhbmdlc1xuICAgICAgaWYgKG9sZFJhbmdlU3RhcnQpIHtcbiAgICAgICAgLy8gQ2xvc2Ugb3V0IGFueSBjaGFuZ2VzIHRoYXQgaGF2ZSBiZWVuIG91dHB1dCAob3Igam9pbiBvdmVybGFwcGluZylcbiAgICAgICAgaWYgKGxpbmVzLmxlbmd0aCA8PSBvcHRpb25zLmNvbnRleHQgKiAyICYmIGkgPCBkaWZmLmxlbmd0aCAtIDIpIHtcbiAgICAgICAgICAvLyBPdmVybGFwcGluZ1xuICAgICAgICAgIGN1clJhbmdlLnB1c2goLi4uIGNvbnRleHRMaW5lcyhsaW5lcykpO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIGVuZCB0aGUgcmFuZ2UgYW5kIG91dHB1dFxuICAgICAgICAgIGxldCBjb250ZXh0U2l6ZSA9IE1hdGgubWluKGxpbmVzLmxlbmd0aCwgb3B0aW9ucy5jb250ZXh0KTtcbiAgICAgICAgICBjdXJSYW5nZS5wdXNoKC4uLiBjb250ZXh0TGluZXMobGluZXMuc2xpY2UoMCwgY29udGV4dFNpemUpKSk7XG5cbiAgICAgICAgICBsZXQgaHVuayA9IHtcbiAgICAgICAgICAgIG9sZFN0YXJ0OiBvbGRSYW5nZVN0YXJ0LFxuICAgICAgICAgICAgb2xkTGluZXM6IChvbGRMaW5lIC0gb2xkUmFuZ2VTdGFydCArIGNvbnRleHRTaXplKSxcbiAgICAgICAgICAgIG5ld1N0YXJ0OiBuZXdSYW5nZVN0YXJ0LFxuICAgICAgICAgICAgbmV3TGluZXM6IChuZXdMaW5lIC0gbmV3UmFuZ2VTdGFydCArIGNvbnRleHRTaXplKSxcbiAgICAgICAgICAgIGxpbmVzOiBjdXJSYW5nZVxuICAgICAgICAgIH07XG4gICAgICAgICAgaWYgKGkgPj0gZGlmZi5sZW5ndGggLSAyICYmIGxpbmVzLmxlbmd0aCA8PSBvcHRpb25zLmNvbnRleHQpIHtcbiAgICAgICAgICAgIC8vIEVPRiBpcyBpbnNpZGUgdGhpcyBodW5rXG4gICAgICAgICAgICBsZXQgb2xkRU9GTmV3bGluZSA9ICgvXFxuJC8udGVzdChvbGRTdHIpKTtcbiAgICAgICAgICAgIGxldCBuZXdFT0ZOZXdsaW5lID0gKC9cXG4kLy50ZXN0KG5ld1N0cikpO1xuICAgICAgICAgICAgaWYgKGxpbmVzLmxlbmd0aCA9PSAwICYmICFvbGRFT0ZOZXdsaW5lKSB7XG4gICAgICAgICAgICAgIC8vIHNwZWNpYWwgY2FzZTogb2xkIGhhcyBubyBlb2wgYW5kIG5vIHRyYWlsaW5nIGNvbnRleHQ7IG5vLW5sIGNhbiBlbmQgdXAgYmVmb3JlIGFkZHNcbiAgICAgICAgICAgICAgY3VyUmFuZ2Uuc3BsaWNlKGh1bmsub2xkTGluZXMsIDAsICdcXFxcIE5vIG5ld2xpbmUgYXQgZW5kIG9mIGZpbGUnKTtcbiAgICAgICAgICAgIH0gZWxzZSBpZiAoIW9sZEVPRk5ld2xpbmUgfHwgIW5ld0VPRk5ld2xpbmUpIHtcbiAgICAgICAgICAgICAgY3VyUmFuZ2UucHVzaCgnXFxcXCBObyBuZXdsaW5lIGF0IGVuZCBvZiBmaWxlJyk7XG4gICAgICAgICAgICB9XG4gICAgICAgICAgfVxuICAgICAgICAgIGh1bmtzLnB1c2goaHVuayk7XG5cbiAgICAgICAgICBvbGRSYW5nZVN0YXJ0ID0gMDtcbiAgICAgICAgICBuZXdSYW5nZVN0YXJ0ID0gMDtcbiAgICAgICAgICBjdXJSYW5nZSA9IFtdO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgICBvbGRMaW5lICs9IGxpbmVzLmxlbmd0aDtcbiAgICAgIG5ld0xpbmUgKz0gbGluZXMubGVuZ3RoO1xuICAgIH1cbiAgfVxuXG4gIHJldHVybiB7XG4gICAgb2xkRmlsZU5hbWU6IG9sZEZpbGVOYW1lLCBuZXdGaWxlTmFtZTogbmV3RmlsZU5hbWUsXG4gICAgb2xkSGVhZGVyOiBvbGRIZWFkZXIsIG5ld0hlYWRlcjogbmV3SGVhZGVyLFxuICAgIGh1bmtzOiBodW5rc1xuICB9O1xufVxuXG5leHBvcnQgZnVuY3Rpb24gY3JlYXRlVHdvRmlsZXNQYXRjaChvbGRGaWxlTmFtZSwgbmV3RmlsZU5hbWUsIG9sZFN0ciwgbmV3U3RyLCBvbGRIZWFkZXIsIG5ld0hlYWRlciwgb3B0aW9ucykge1xuICBjb25zdCBkaWZmID0gc3RydWN0dXJlZFBhdGNoKG9sZEZpbGVOYW1lLCBuZXdGaWxlTmFtZSwgb2xkU3RyLCBuZXdTdHIsIG9sZEhlYWRlciwgbmV3SGVhZGVyLCBvcHRpb25zKTtcblxuICBjb25zdCByZXQgPSBbXTtcbiAgaWYgKG9sZEZpbGVOYW1lID09IG5ld0ZpbGVOYW1lKSB7XG4gICAgcmV0LnB1c2goJ0luZGV4OiAnICsgb2xkRmlsZU5hbWUpO1xuICB9XG4gIHJldC5wdXNoKCc9PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09PT09Jyk7XG4gIHJldC5wdXNoKCctLS0gJyArIGRpZmYub2xkRmlsZU5hbWUgKyAodHlwZW9mIGRpZmYub2xkSGVhZGVyID09PSAndW5kZWZpbmVkJyA/ICcnIDogJ1xcdCcgKyBkaWZmLm9sZEhlYWRlcikpO1xuICByZXQucHVzaCgnKysrICcgKyBkaWZmLm5ld0ZpbGVOYW1lICsgKHR5cGVvZiBkaWZmLm5ld0hlYWRlciA9PT0gJ3VuZGVmaW5lZCcgPyAnJyA6ICdcXHQnICsgZGlmZi5uZXdIZWFkZXIpKTtcblxuICBmb3IgKGxldCBpID0gMDsgaSA8IGRpZmYuaHVua3MubGVuZ3RoOyBpKyspIHtcbiAgICBjb25zdCBodW5rID0gZGlmZi5odW5rc1tpXTtcbiAgICByZXQucHVzaChcbiAgICAgICdAQCAtJyArIGh1bmsub2xkU3RhcnQgKyAnLCcgKyBodW5rLm9sZExpbmVzXG4gICAgICArICcgKycgKyBodW5rLm5ld1N0YXJ0ICsgJywnICsgaHVuay5uZXdMaW5lc1xuICAgICAgKyAnIEBAJ1xuICAgICk7XG4gICAgcmV0LnB1c2guYXBwbHkocmV0LCBodW5rLmxpbmVzKTtcbiAgfVxuXG4gIHJldHVybiByZXQuam9pbignXFxuJykgKyAnXFxuJztcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGNyZWF0ZVBhdGNoKGZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpIHtcbiAgcmV0dXJuIGNyZWF0ZVR3b0ZpbGVzUGF0Y2goZmlsZU5hbWUsIGZpbGVOYW1lLCBvbGRTdHIsIG5ld1N0ciwgb2xkSGVhZGVyLCBuZXdIZWFkZXIsIG9wdGlvbnMpO1xufVxuIl19
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/merge.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/merge.js
new file mode 100644
index 00000000000..074c4bc9d21
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/merge.js
@@ -0,0 +1,396 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/calcLineCount = calcLineCount;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/merge = merge;
+
+var /*istanbul ignore start*/_create = require('./create') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_parse = require('./parse') /*istanbul ignore end*/;
+
+var /*istanbul ignore start*/_array = require('../util/array') /*istanbul ignore end*/;
+
+/*istanbul ignore start*/function _toConsumableArray(arr) { if (Array.isArray(arr)) { for (var i = 0, arr2 = Array(arr.length); i < arr.length; i++) { arr2[i] = arr[i]; } return arr2; } else { return Array.from(arr); } }
+
+/*istanbul ignore end*/function calcLineCount(hunk) {
+  /*istanbul ignore start*/var _calcOldNewLineCount = /*istanbul ignore end*/calcOldNewLineCount(hunk.lines),
+      oldLines = _calcOldNewLineCount.oldLines,
+      newLines = _calcOldNewLineCount.newLines;
+
+  if (oldLines !== undefined) {
+    hunk.oldLines = oldLines;
+  } else {
+    delete hunk.oldLines;
+  }
+
+  if (newLines !== undefined) {
+    hunk.newLines = newLines;
+  } else {
+    delete hunk.newLines;
+  }
+}
+
+function merge(mine, theirs, base) {
+  mine = loadPatch(mine, base);
+  theirs = loadPatch(theirs, base);
+
+  var ret = {};
+
+  // For index we just let it pass through as it doesn't have any necessary meaning.
+  // Leaving sanity checks on this to the API consumer that may know more about the
+  // meaning in their own context.
+  if (mine.index || theirs.index) {
+    ret.index = mine.index || theirs.index;
+  }
+
+  if (mine.newFileName || theirs.newFileName) {
+    if (!fileNameChanged(mine)) {
+      // No header or no change in ours, use theirs (and ours if theirs does not exist)
+      ret.oldFileName = theirs.oldFileName || mine.oldFileName;
+      ret.newFileName = theirs.newFileName || mine.newFileName;
+      ret.oldHeader = theirs.oldHeader || mine.oldHeader;
+      ret.newHeader = theirs.newHeader || mine.newHeader;
+    } else if (!fileNameChanged(theirs)) {
+      // No header or no change in theirs, use ours
+      ret.oldFileName = mine.oldFileName;
+      ret.newFileName = mine.newFileName;
+      ret.oldHeader = mine.oldHeader;
+      ret.newHeader = mine.newHeader;
+    } else {
+      // Both changed... figure it out
+      ret.oldFileName = selectField(ret, mine.oldFileName, theirs.oldFileName);
+      ret.newFileName = selectField(ret, mine.newFileName, theirs.newFileName);
+      ret.oldHeader = selectField(ret, mine.oldHeader, theirs.oldHeader);
+      ret.newHeader = selectField(ret, mine.newHeader, theirs.newHeader);
+    }
+  }
+
+  ret.hunks = [];
+
+  var mineIndex = 0,
+      theirsIndex = 0,
+      mineOffset = 0,
+      theirsOffset = 0;
+
+  while (mineIndex < mine.hunks.length || theirsIndex < theirs.hunks.length) {
+    var mineCurrent = mine.hunks[mineIndex] || { oldStart: Infinity },
+        theirsCurrent = theirs.hunks[theirsIndex] || { oldStart: Infinity };
+
+    if (hunkBefore(mineCurrent, theirsCurrent)) {
+      // This patch does not overlap with any of the others, yay.
+      ret.hunks.push(cloneHunk(mineCurrent, mineOffset));
+      mineIndex++;
+      theirsOffset += mineCurrent.newLines - mineCurrent.oldLines;
+    } else if (hunkBefore(theirsCurrent, mineCurrent)) {
+      // This patch does not overlap with any of the others, yay.
+      ret.hunks.push(cloneHunk(theirsCurrent, theirsOffset));
+      theirsIndex++;
+      mineOffset += theirsCurrent.newLines - theirsCurrent.oldLines;
+    } else {
+      // Overlap, merge as best we can
+      var mergedHunk = {
+        oldStart: Math.min(mineCurrent.oldStart, theirsCurrent.oldStart),
+        oldLines: 0,
+        newStart: Math.min(mineCurrent.newStart + mineOffset, theirsCurrent.oldStart + theirsOffset),
+        newLines: 0,
+        lines: []
+      };
+      mergeLines(mergedHunk, mineCurrent.oldStart, mineCurrent.lines, theirsCurrent.oldStart, theirsCurrent.lines);
+      theirsIndex++;
+      mineIndex++;
+
+      ret.hunks.push(mergedHunk);
+    }
+  }
+
+  return ret;
+}
+
+function loadPatch(param, base) {
+  if (typeof param === 'string') {
+    if (/^@@/m.test(param) || /^Index:/m.test(param)) {
+      return (/*istanbul ignore start*/(0, _parse.parsePatch) /*istanbul ignore end*/(param)[0]
+      );
+    }
+
+    if (!base) {
+      throw new Error('Must provide a base reference or pass in a patch');
+    }
+    return (/*istanbul ignore start*/(0, _create.structuredPatch) /*istanbul ignore end*/(undefined, undefined, base, param)
+    );
+  }
+
+  return param;
+}
+
+function fileNameChanged(patch) {
+  return patch.newFileName && patch.newFileName !== patch.oldFileName;
+}
+
+function selectField(index, mine, theirs) {
+  if (mine === theirs) {
+    return mine;
+  } else {
+    index.conflict = true;
+    return { mine: mine, theirs: theirs };
+  }
+}
+
+function hunkBefore(test, check) {
+  return test.oldStart < check.oldStart && test.oldStart + test.oldLines < check.oldStart;
+}
+
+function cloneHunk(hunk, offset) {
+  return {
+    oldStart: hunk.oldStart, oldLines: hunk.oldLines,
+    newStart: hunk.newStart + offset, newLines: hunk.newLines,
+    lines: hunk.lines
+  };
+}
+
+function mergeLines(hunk, mineOffset, mineLines, theirOffset, theirLines) {
+  // This will generally result in a conflicted hunk, but there are cases where the context
+  // is the only overlap where we can successfully merge the content here.
+  var mine = { offset: mineOffset, lines: mineLines, index: 0 },
+      their = { offset: theirOffset, lines: theirLines, index: 0 };
+
+  // Handle any leading content
+  insertLeading(hunk, mine, their);
+  insertLeading(hunk, their, mine);
+
+  // Now in the overlap content. Scan through and select the best changes from each.
+  while (mine.index < mine.lines.length && their.index < their.lines.length) {
+    var mineCurrent = mine.lines[mine.index],
+        theirCurrent = their.lines[their.index];
+
+    if ((mineCurrent[0] === '-' || mineCurrent[0] === '+') && (theirCurrent[0] === '-' || theirCurrent[0] === '+')) {
+      // Both modified ...
+      mutualChange(hunk, mine, their);
+    } else if (mineCurrent[0] === '+' && theirCurrent[0] === ' ') {
+      /*istanbul ignore start*/var _hunk$lines;
+
+      /*istanbul ignore end*/ // Mine inserted
+      /*istanbul ignore start*/(_hunk$lines = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(mine)));
+    } else if (theirCurrent[0] === '+' && mineCurrent[0] === ' ') {
+      /*istanbul ignore start*/var _hunk$lines2;
+
+      /*istanbul ignore end*/ // Theirs inserted
+      /*istanbul ignore start*/(_hunk$lines2 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines2 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/collectChange(their)));
+    } else if (mineCurrent[0] === '-' && theirCurrent[0] === ' ') {
+      // Mine removed or edited
+      removal(hunk, mine, their);
+    } else if (theirCurrent[0] === '-' && mineCurrent[0] === ' ') {
+      // Their removed or edited
+      removal(hunk, their, mine, true);
+    } else if (mineCurrent === theirCurrent) {
+      // Context identity
+      hunk.lines.push(mineCurrent);
+      mine.index++;
+      their.index++;
+    } else {
+      // Context mismatch
+      conflict(hunk, collectChange(mine), collectChange(their));
+    }
+  }
+
+  // Now push anything that may be remaining
+  insertTrailing(hunk, mine);
+  insertTrailing(hunk, their);
+
+  calcLineCount(hunk);
+}
+
+function mutualChange(hunk, mine, their) {
+  var myChanges = collectChange(mine),
+      theirChanges = collectChange(their);
+
+  if (allRemoves(myChanges) && allRemoves(theirChanges)) {
+    // Special case for remove changes that are supersets of one another
+    if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(myChanges, theirChanges) && skipRemoveSuperset(their, myChanges, myChanges.length - theirChanges.length)) {
+      /*istanbul ignore start*/var _hunk$lines3;
+
+      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines3 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines3 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+      return;
+    } else if ( /*istanbul ignore start*/(0, _array.arrayStartsWith) /*istanbul ignore end*/(theirChanges, myChanges) && skipRemoveSuperset(mine, theirChanges, theirChanges.length - myChanges.length)) {
+      /*istanbul ignore start*/var _hunk$lines4;
+
+      /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines4 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines4 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges));
+      return;
+    }
+  } else if ( /*istanbul ignore start*/(0, _array.arrayEqual) /*istanbul ignore end*/(myChanges, theirChanges)) {
+    /*istanbul ignore start*/var _hunk$lines5;
+
+    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines5 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines5 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/myChanges));
+    return;
+  }
+
+  conflict(hunk, myChanges, theirChanges);
+}
+
+function removal(hunk, mine, their, swap) {
+  var myChanges = collectChange(mine),
+      theirChanges = collectContext(their, myChanges);
+  if (theirChanges.merged) {
+    /*istanbul ignore start*/var _hunk$lines6;
+
+    /*istanbul ignore end*/ /*istanbul ignore start*/(_hunk$lines6 = /*istanbul ignore end*/hunk.lines).push. /*istanbul ignore start*/apply /*istanbul ignore end*/( /*istanbul ignore start*/_hunk$lines6 /*istanbul ignore end*/, /*istanbul ignore start*/_toConsumableArray( /*istanbul ignore end*/theirChanges.merged));
+  } else {
+    conflict(hunk, swap ? theirChanges : myChanges, swap ? myChanges : theirChanges);
+  }
+}
+
+function conflict(hunk, mine, their) {
+  hunk.conflict = true;
+  hunk.lines.push({
+    conflict: true,
+    mine: mine,
+    theirs: their
+  });
+}
+
+function insertLeading(hunk, insert, their) {
+  while (insert.offset < their.offset && insert.index < insert.lines.length) {
+    var line = insert.lines[insert.index++];
+    hunk.lines.push(line);
+    insert.offset++;
+  }
+}
+function insertTrailing(hunk, insert) {
+  while (insert.index < insert.lines.length) {
+    var line = insert.lines[insert.index++];
+    hunk.lines.push(line);
+  }
+}
+
+function collectChange(state) {
+  var ret = [],
+      operation = state.lines[state.index][0];
+  while (state.index < state.lines.length) {
+    var line = state.lines[state.index];
+
+    // Group additions that are immediately after subtractions and treat them as one "atomic" modify change.
+    if (operation === '-' && line[0] === '+') {
+      operation = '+';
+    }
+
+    if (operation === line[0]) {
+      ret.push(line);
+      state.index++;
+    } else {
+      break;
+    }
+  }
+
+  return ret;
+}
+function collectContext(state, matchChanges) {
+  var changes = [],
+      merged = [],
+      matchIndex = 0,
+      contextChanges = false,
+      conflicted = false;
+  while (matchIndex < matchChanges.length && state.index < state.lines.length) {
+    var change = state.lines[state.index],
+        match = matchChanges[matchIndex];
+
+    // Once we've hit our add, then we are done
+    if (match[0] === '+') {
+      break;
+    }
+
+    contextChanges = contextChanges || change[0] !== ' ';
+
+    merged.push(match);
+    matchIndex++;
+
+    // Consume any additions in the other block as a conflict to attempt
+    // to pull in the remaining context after this
+    if (change[0] === '+') {
+      conflicted = true;
+
+      while (change[0] === '+') {
+        changes.push(change);
+        change = state.lines[++state.index];
+      }
+    }
+
+    if (match.substr(1) === change.substr(1)) {
+      changes.push(change);
+      state.index++;
+    } else {
+      conflicted = true;
+    }
+  }
+
+  if ((matchChanges[matchIndex] || '')[0] === '+' && contextChanges) {
+    conflicted = true;
+  }
+
+  if (conflicted) {
+    return changes;
+  }
+
+  while (matchIndex < matchChanges.length) {
+    merged.push(matchChanges[matchIndex++]);
+  }
+
+  return {
+    merged: merged,
+    changes: changes
+  };
+}
+
+function allRemoves(changes) {
+  return changes.reduce(function (prev, change) {
+    return prev && change[0] === '-';
+  }, true);
+}
+function skipRemoveSuperset(state, removeChanges, delta) {
+  for (var i = 0; i < delta; i++) {
+    var changeContent = removeChanges[removeChanges.length - delta + i].substr(1);
+    if (state.lines[state.index + i] !== ' ' + changeContent) {
+      return false;
+    }
+  }
+
+  state.index += delta;
+  return true;
+}
+
+function calcOldNewLineCount(lines) {
+  var oldLines = 0;
+  var newLines = 0;
+
+  lines.forEach(function (line) {
+    if (typeof line !== 'string') {
+      var myCount = calcOldNewLineCount(line.mine);
+      var theirCount = calcOldNewLineCount(line.theirs);
+
+      if (oldLines !== undefined) {
+        if (myCount.oldLines === theirCount.oldLines) {
+          oldLines += myCount.oldLines;
+        } else {
+          oldLines = undefined;
+        }
+      }
+
+      if (newLines !== undefined) {
+        if (myCount.newLines === theirCount.newLines) {
+          newLines += myCount.newLines;
+        } else {
+          newLines = undefined;
+        }
+      }
+    } else {
+      if (newLines !== undefined && (line[0] === '+' || line[0] === ' ')) {
+        newLines++;
+      }
+      if (oldLines !== undefined && (line[0] === '-' || line[0] === ' ')) {
+        oldLines++;
+      }
+    }
+  });
+
+  return { oldLines: oldLines, newLines: newLines };
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9tZXJnZS5qcyJdLCJuYW1lcyI6WyJjYWxjTGluZUNvdW50IiwibWVyZ2UiLCJodW5rIiwiY2FsY09sZE5ld0xpbmVDb3VudCIsImxpbmVzIiwib2xkTGluZXMiLCJuZXdMaW5lcyIsInVuZGVmaW5lZCIsIm1pbmUiLCJ0aGVpcnMiLCJiYXNlIiwibG9hZFBhdGNoIiwicmV0IiwiaW5kZXgiLCJuZXdGaWxlTmFtZSIsImZpbGVOYW1lQ2hhbmdlZCIsIm9sZEZpbGVOYW1lIiwib2xkSGVhZGVyIiwibmV3SGVhZGVyIiwic2VsZWN0RmllbGQiLCJodW5rcyIsIm1pbmVJbmRleCIsInRoZWlyc0luZGV4IiwibWluZU9mZnNldCIsInRoZWlyc09mZnNldCIsImxlbmd0aCIsIm1pbmVDdXJyZW50Iiwib2xkU3RhcnQiLCJJbmZpbml0eSIsInRoZWlyc0N1cnJlbnQiLCJodW5rQmVmb3JlIiwicHVzaCIsImNsb25lSHVuayIsIm1lcmdlZEh1bmsiLCJNYXRoIiwibWluIiwibmV3U3RhcnQiLCJtZXJnZUxpbmVzIiwicGFyYW0iLCJ0ZXN0IiwiRXJyb3IiLCJwYXRjaCIsImNvbmZsaWN0IiwiY2hlY2siLCJvZmZzZXQiLCJtaW5lTGluZXMiLCJ0aGVpck9mZnNldCIsInRoZWlyTGluZXMiLCJ0aGVpciIsImluc2VydExlYWRpbmciLCJ0aGVpckN1cnJlbnQiLCJtdXR1YWxDaGFuZ2UiLCJjb2xsZWN0Q2hhbmdlIiwicmVtb3ZhbCIsImluc2VydFRyYWlsaW5nIiwibXlDaGFuZ2VzIiwidGhlaXJDaGFuZ2VzIiwiYWxsUmVtb3ZlcyIsInNraXBSZW1vdmVTdXBlcnNldCIsInN3YXAiLCJjb2xsZWN0Q29udGV4dCIsIm1lcmdlZCIsImluc2VydCIsImxpbmUiLCJzdGF0ZSIsIm9wZXJhdGlvbiIsIm1hdGNoQ2hhbmdlcyIsImNoYW5nZXMiLCJtYXRjaEluZGV4IiwiY29udGV4dENoYW5nZXMiLCJjb25mbGljdGVkIiwiY2hhbmdlIiwibWF0Y2giLCJzdWJzdHIiLCJyZWR1Y2UiLCJwcmV2IiwicmVtb3ZlQ2hhbmdlcyIsImRlbHRhIiwiaSIsImNoYW5nZUNvbnRlbnQiLCJmb3JFYWNoIiwibXlDb3VudCIsInRoZWlyQ291bnQiXSwibWFwcGluZ3MiOiI7OztnQ0FLZ0JBLGEsR0FBQUEsYTt5REFnQkFDLEssR0FBQUEsSzs7QUFyQmhCOztBQUNBOztBQUVBOzs7O3VCQUVPLFNBQVNELGFBQVQsQ0FBdUJFLElBQXZCLEVBQTZCO0FBQUEsNkVBQ0xDLG9CQUFvQkQsS0FBS0UsS0FBekIsQ0FESztBQUFBLE1BQzNCQyxRQUQyQix3QkFDM0JBLFFBRDJCO0FBQUEsTUFDakJDLFFBRGlCLHdCQUNqQkEsUUFEaUI7O0FBR2xDLE1BQUlELGFBQWFFLFNBQWpCLEVBQTRCO0FBQzFCTCxTQUFLRyxRQUFMLEdBQWdCQSxRQUFoQjtBQUNELEdBRkQsTUFFTztBQUNMLFdBQU9ILEtBQUtHLFFBQVo7QUFDRDs7QUFFRCxNQUFJQyxhQUFhQyxTQUFqQixFQUE0QjtBQUMxQkwsU0FBS0ksUUFBTCxHQUFnQkEsUUFBaEI7QUFDRCxHQUZELE1BRU87QUFDTCxXQUFPSixLQUFLSSxRQUFaO0FBQ0Q7QUFDRjs7QUFFTSxTQUFTTCxLQUFULENBQWVPLElBQWYsRUFBcUJDLE1BQXJCLEVBQTZCQyxJQUE3QixFQUFtQztBQUN4Q0YsU0FBT0csVUFBVUgsSUFBVixFQUFnQkUsSUFBaEIsQ0FBUDtBQUNBRCxXQUFTRSxVQUFVRixNQUFWLEVBQWtCQyxJQUFsQixDQUFUOztBQUVBLE1BQUlFLE1BQU0sRUFBVjs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxNQUFJSixLQUFLSyxLQUFMLElBQWNKLE9BQU9JLEtBQXpCLEVBQWdDO0FBQzlCRCxRQUFJQyxLQUFKLEdBQVlMLEtBQUtLLEtBQUwsSUFBY0osT0FBT0ksS0FBakM7QUFDRDs7QUFFRCxNQUFJTCxLQUFLTSxXQUFMLElBQW9CTCxPQUFPSyxXQUEvQixFQUE0QztBQUMxQyxRQUFJLENBQUNDLGdCQUFnQlAsSUFBaEIsQ0FBTCxFQUE0QjtBQUMxQjtBQUNBSSxVQUFJSSxXQUFKLEdBQWtCUCxPQUFPTyxXQUFQLElBQXNCUixLQUFLUSxXQUE3QztBQUNBSixVQUFJRSxXQUFKLEdBQWtCTCxPQUFPSyxXQUFQLElBQXNCTixLQUFLTSxXQUE3QztBQUNBRixVQUFJSyxTQUFKLEdBQWdCUixPQUFPUSxTQUFQLElBQW9CVCxLQUFLUyxTQUF6QztBQUNBTCxVQUFJTSxTQUFKLEdBQWdCVCxPQUFPUyxTQUFQLElBQW9CVixLQUFLVSxTQUF6QztBQUNELEtBTkQsTUFNTyxJQUFJLENBQUNILGdCQUFnQk4sTUFBaEIsQ0FBTCxFQUE4QjtBQUNuQztBQUNBRyxVQUFJSSxXQUFKLEdBQWtCUixLQUFLUSxXQUF2QjtBQUNBSixVQUFJRSxXQUFKLEdBQWtCTixLQUFLTSxXQUF2QjtBQUNBRixVQUFJSyxTQUFKLEdBQWdCVCxLQUFLUyxTQUFyQjtBQUNBTCxVQUFJTSxTQUFKLEdBQWdCVixLQUFLVSxTQUFyQjtBQUNELEtBTk0sTUFNQTtBQUNMO0FBQ0FOLFVBQUlJLFdBQUosR0FBa0JHLFlBQVlQLEdBQVosRUFBaUJKLEtBQUtRLFdBQXRCLEVBQW1DUCxPQUFPTyxXQUExQyxDQUFsQjtBQUNBSixVQUFJRSxXQUFKLEdBQWtCSyxZQUFZUCxHQUFaLEVBQWlCSixLQUFLTSxXQUF0QixFQUFtQ0wsT0FBT0ssV0FBMUMsQ0FBbEI7QUFDQUYsVUFBSUssU0FBSixHQUFnQkUsWUFBWVAsR0FBWixFQUFpQkosS0FBS1MsU0FBdEIsRUFBaUNSLE9BQU9RLFNBQXhDLENBQWhCO0FBQ0FMLFVBQUlNLFNBQUosR0FBZ0JDLFlBQVlQLEdBQVosRUFBaUJKLEtBQUtVLFNBQXRCLEVBQWlDVCxPQUFPUyxTQUF4QyxDQUFoQjtBQUNEO0FBQ0Y7O0FBRUROLE1BQUlRLEtBQUosR0FBWSxFQUFaOztBQUVBLE1BQUlDLFlBQVksQ0FBaEI7QUFBQSxNQUNJQyxjQUFjLENBRGxCO0FBQUEsTUFFSUMsYUFBYSxDQUZqQjtBQUFBLE1BR0lDLGVBQWUsQ0FIbkI7O0FBS0EsU0FBT0gsWUFBWWIsS0FBS1ksS0FBTCxDQUFXSyxNQUF2QixJQUFpQ0gsY0FBY2IsT0FBT1csS0FBUCxDQUFhSyxNQUFuRSxFQUEyRTtBQUN6RSxRQUFJQyxjQUFjbEIsS0FBS1ksS0FBTCxDQUFXQyxTQUFYLEtBQXlCLEVBQUNNLFVBQVVDLFFBQVgsRUFBM0M7QUFBQSxRQUNJQyxnQkFBZ0JwQixPQUFPVyxLQUFQLENBQWFFLFdBQWIsS0FBNkIsRUFBQ0ssVUFBVUMsUUFBWCxFQURqRDs7QUFHQSxRQUFJRSxXQUFXSixXQUFYLEVBQXdCRyxhQUF4QixDQUFKLEVBQTRDO0FBQzFDO0FBQ0FqQixVQUFJUSxLQUFKLENBQVVXLElBQVYsQ0FBZUMsVUFBVU4sV0FBVixFQUF1QkgsVUFBdkIsQ0FBZjtBQUNBRjtBQUNBRyxzQkFBZ0JFLFlBQVlwQixRQUFaLEdBQXVCb0IsWUFBWXJCLFFBQW5EO0FBQ0QsS0FMRCxNQUtPLElBQUl5QixXQUFXRCxhQUFYLEVBQTBCSCxXQUExQixDQUFKLEVBQTRDO0FBQ2pEO0FBQ0FkLFVBQUlRLEtBQUosQ0FBVVcsSUFBVixDQUFlQyxVQUFVSCxhQUFWLEVBQXlCTCxZQUF6QixDQUFmO0FBQ0FGO0FBQ0FDLG9CQUFjTSxjQUFjdkIsUUFBZCxHQUF5QnVCLGNBQWN4QixRQUFyRDtBQUNELEtBTE0sTUFLQTtBQUNMO0FBQ0EsVUFBSTRCLGFBQWE7QUFDZk4sa0JBQVVPLEtBQUtDLEdBQUwsQ0FBU1QsWUFBWUMsUUFBckIsRUFBK0JFLGNBQWNGLFFBQTdDLENBREs7QUFFZnRCLGtCQUFVLENBRks7QUFHZitCLGtCQUFVRixLQUFLQyxHQUFMLENBQVNULFlBQVlVLFFBQVosR0FBdUJiLFVBQWhDLEVBQTRDTSxjQUFjRixRQUFkLEdBQXlCSCxZQUFyRSxDQUhLO0FBSWZsQixrQkFBVSxDQUpLO0FBS2ZGLGVBQU87QUFMUSxPQUFqQjtBQU9BaUMsaUJBQVdKLFVBQVgsRUFBdUJQLFlBQVlDLFFBQW5DLEVBQTZDRCxZQUFZdEIsS0FBekQsRUFBZ0V5QixjQUFjRixRQUE5RSxFQUF3RkUsY0FBY3pCLEtBQXRHO0FBQ0FrQjtBQUNBRDs7QUFFQVQsVUFBSVEsS0FBSixDQUFVVyxJQUFWLENBQWVFLFVBQWY7QUFDRDtBQUNGOztBQUVELFNBQU9yQixHQUFQO0FBQ0Q7O0FBRUQsU0FBU0QsU0FBVCxDQUFtQjJCLEtBQW5CLEVBQTBCNUIsSUFBMUIsRUFBZ0M7QUFDOUIsTUFBSSxPQUFPNEIsS0FBUCxLQUFpQixRQUFyQixFQUErQjtBQUM3QixRQUFJLE9BQU9DLElBQVAsQ0FBWUQsS0FBWixLQUF1QixXQUFXQyxJQUFYLENBQWdCRCxLQUFoQixDQUEzQixFQUFvRDtBQUNsRCxhQUFPLHlFQUFXQSxLQUFYLEVBQWtCLENBQWxCO0FBQVA7QUFDRDs7QUFFRCxRQUFJLENBQUM1QixJQUFMLEVBQVc7QUFDVCxZQUFNLElBQUk4QixLQUFKLENBQVUsa0RBQVYsQ0FBTjtBQUNEO0FBQ0QsV0FBTywrRUFBZ0JqQyxTQUFoQixFQUEyQkEsU0FBM0IsRUFBc0NHLElBQXRDLEVBQTRDNEIsS0FBNUM7QUFBUDtBQUNEOztBQUVELFNBQU9BLEtBQVA7QUFDRDs7QUFFRCxTQUFTdkIsZUFBVCxDQUF5QjBCLEtBQXpCLEVBQWdDO0FBQzlCLFNBQU9BLE1BQU0zQixXQUFOLElBQXFCMkIsTUFBTTNCLFdBQU4sS0FBc0IyQixNQUFNekIsV0FBeEQ7QUFDRDs7QUFFRCxTQUFTRyxXQUFULENBQXFCTixLQUFyQixFQUE0QkwsSUFBNUIsRUFBa0NDLE1BQWxDLEVBQTBDO0FBQ3hDLE1BQUlELFNBQVNDLE1BQWIsRUFBcUI7QUFDbkIsV0FBT0QsSUFBUDtBQUNELEdBRkQsTUFFTztBQUNMSyxVQUFNNkIsUUFBTixHQUFpQixJQUFqQjtBQUNBLFdBQU8sRUFBQ2xDLFVBQUQsRUFBT0MsY0FBUCxFQUFQO0FBQ0Q7QUFDRjs7QUFFRCxTQUFTcUIsVUFBVCxDQUFvQlMsSUFBcEIsRUFBMEJJLEtBQTFCLEVBQWlDO0FBQy9CLFNBQU9KLEtBQUtaLFFBQUwsR0FBZ0JnQixNQUFNaEIsUUFBdEIsSUFDRFksS0FBS1osUUFBTCxHQUFnQlksS0FBS2xDLFFBQXRCLEdBQWtDc0MsTUFBTWhCLFFBRDdDO0FBRUQ7O0FBRUQsU0FBU0ssU0FBVCxDQUFtQjlCLElBQW5CLEVBQXlCMEMsTUFBekIsRUFBaUM7QUFDL0IsU0FBTztBQUNMakIsY0FBVXpCLEtBQUt5QixRQURWLEVBQ29CdEIsVUFBVUgsS0FBS0csUUFEbkM7QUFFTCtCLGNBQVVsQyxLQUFLa0MsUUFBTCxHQUFnQlEsTUFGckIsRUFFNkJ0QyxVQUFVSixLQUFLSSxRQUY1QztBQUdMRixXQUFPRixLQUFLRTtBQUhQLEdBQVA7QUFLRDs7QUFFRCxTQUFTaUMsVUFBVCxDQUFvQm5DLElBQXBCLEVBQTBCcUIsVUFBMUIsRUFBc0NzQixTQUF0QyxFQUFpREMsV0FBakQsRUFBOERDLFVBQTlELEVBQTBFO0FBQ3hFO0FBQ0E7QUFDQSxNQUFJdkMsT0FBTyxFQUFDb0MsUUFBUXJCLFVBQVQsRUFBcUJuQixPQUFPeUMsU0FBNUIsRUFBdUNoQyxPQUFPLENBQTlDLEVBQVg7QUFBQSxNQUNJbUMsUUFBUSxFQUFDSixRQUFRRSxXQUFULEVBQXNCMUMsT0FBTzJDLFVBQTdCLEVBQXlDbEMsT0FBTyxDQUFoRCxFQURaOztBQUdBO0FBQ0FvQyxnQkFBYy9DLElBQWQsRUFBb0JNLElBQXBCLEVBQTBCd0MsS0FBMUI7QUFDQUMsZ0JBQWMvQyxJQUFkLEVBQW9COEMsS0FBcEIsRUFBMkJ4QyxJQUEzQjs7QUFFQTtBQUNBLFNBQU9BLEtBQUtLLEtBQUwsR0FBYUwsS0FBS0osS0FBTCxDQUFXcUIsTUFBeEIsSUFBa0N1QixNQUFNbkMsS0FBTixHQUFjbUMsTUFBTTVDLEtBQU4sQ0FBWXFCLE1BQW5FLEVBQTJFO0FBQ3pFLFFBQUlDLGNBQWNsQixLQUFLSixLQUFMLENBQVdJLEtBQUtLLEtBQWhCLENBQWxCO0FBQUEsUUFDSXFDLGVBQWVGLE1BQU01QyxLQUFOLENBQVk0QyxNQUFNbkMsS0FBbEIsQ0FEbkI7O0FBR0EsUUFBSSxDQUFDYSxZQUFZLENBQVosTUFBbUIsR0FBbkIsSUFBMEJBLFlBQVksQ0FBWixNQUFtQixHQUE5QyxNQUNJd0IsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCQSxhQUFhLENBQWIsTUFBb0IsR0FEbkQsQ0FBSixFQUM2RDtBQUMzRDtBQUNBQyxtQkFBYWpELElBQWIsRUFBbUJNLElBQW5CLEVBQXlCd0MsS0FBekI7QUFDRCxLQUpELE1BSU8sSUFBSXRCLFlBQVksQ0FBWixNQUFtQixHQUFuQixJQUEwQndCLGFBQWEsQ0FBYixNQUFvQixHQUFsRCxFQUF1RDtBQUFBOztBQUFBLDhCQUM1RDtBQUNBLDBFQUFLOUMsS0FBTCxFQUFXMkIsSUFBWCw0TEFBb0JxQixjQUFjNUMsSUFBZCxDQUFwQjtBQUNELEtBSE0sTUFHQSxJQUFJMEMsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCeEIsWUFBWSxDQUFaLE1BQW1CLEdBQWxELEVBQXVEO0FBQUE7O0FBQUEsOEJBQzVEO0FBQ0EsMkVBQUt0QixLQUFMLEVBQVcyQixJQUFYLDZMQUFvQnFCLGNBQWNKLEtBQWQsQ0FBcEI7QUFDRCxLQUhNLE1BR0EsSUFBSXRCLFlBQVksQ0FBWixNQUFtQixHQUFuQixJQUEwQndCLGFBQWEsQ0FBYixNQUFvQixHQUFsRCxFQUF1RDtBQUM1RDtBQUNBRyxjQUFRbkQsSUFBUixFQUFjTSxJQUFkLEVBQW9Cd0MsS0FBcEI7QUFDRCxLQUhNLE1BR0EsSUFBSUUsYUFBYSxDQUFiLE1BQW9CLEdBQXBCLElBQTJCeEIsWUFBWSxDQUFaLE1BQW1CLEdBQWxELEVBQXVEO0FBQzVEO0FBQ0EyQixjQUFRbkQsSUFBUixFQUFjOEMsS0FBZCxFQUFxQnhDLElBQXJCLEVBQTJCLElBQTNCO0FBQ0QsS0FITSxNQUdBLElBQUlrQixnQkFBZ0J3QixZQUFwQixFQUFrQztBQUN2QztBQUNBaEQsV0FBS0UsS0FBTCxDQUFXMkIsSUFBWCxDQUFnQkwsV0FBaEI7QUFDQWxCLFdBQUtLLEtBQUw7QUFDQW1DLFlBQU1uQyxLQUFOO0FBQ0QsS0FMTSxNQUtBO0FBQ0w7QUFDQTZCLGVBQVN4QyxJQUFULEVBQWVrRCxjQUFjNUMsSUFBZCxDQUFmLEVBQW9DNEMsY0FBY0osS0FBZCxDQUFwQztBQUNEO0FBQ0Y7O0FBRUQ7QUFDQU0saUJBQWVwRCxJQUFmLEVBQXFCTSxJQUFyQjtBQUNBOEMsaUJBQWVwRCxJQUFmLEVBQXFCOEMsS0FBckI7O0FBRUFoRCxnQkFBY0UsSUFBZDtBQUNEOztBQUVELFNBQVNpRCxZQUFULENBQXNCakQsSUFBdEIsRUFBNEJNLElBQTVCLEVBQWtDd0MsS0FBbEMsRUFBeUM7QUFDdkMsTUFBSU8sWUFBWUgsY0FBYzVDLElBQWQsQ0FBaEI7QUFBQSxNQUNJZ0QsZUFBZUosY0FBY0osS0FBZCxDQURuQjs7QUFHQSxNQUFJUyxXQUFXRixTQUFYLEtBQXlCRSxXQUFXRCxZQUFYLENBQTdCLEVBQXVEO0FBQ3JEO0FBQ0EsUUFBSSw4RUFBZ0JELFNBQWhCLEVBQTJCQyxZQUEzQixLQUNHRSxtQkFBbUJWLEtBQW5CLEVBQTBCTyxTQUExQixFQUFxQ0EsVUFBVTlCLE1BQVYsR0FBbUIrQixhQUFhL0IsTUFBckUsQ0FEUCxFQUNxRjtBQUFBOztBQUFBLDZCQUNuRixzRUFBS3JCLEtBQUwsRUFBVzJCLElBQVgsNkxBQW9Cd0IsU0FBcEI7QUFDQTtBQUNELEtBSkQsTUFJTyxJQUFJLDhFQUFnQkMsWUFBaEIsRUFBOEJELFNBQTlCLEtBQ0pHLG1CQUFtQmxELElBQW5CLEVBQXlCZ0QsWUFBekIsRUFBdUNBLGFBQWEvQixNQUFiLEdBQXNCOEIsVUFBVTlCLE1BQXZFLENBREEsRUFDZ0Y7QUFBQTs7QUFBQSw2QkFDckYsc0VBQUtyQixLQUFMLEVBQVcyQixJQUFYLDZMQUFvQnlCLFlBQXBCO0FBQ0E7QUFDRDtBQUNGLEdBWEQsTUFXTyxJQUFJLHlFQUFXRCxTQUFYLEVBQXNCQyxZQUF0QixDQUFKLEVBQXlDO0FBQUE7O0FBQUEsMkJBQzlDLHNFQUFLcEQsS0FBTCxFQUFXMkIsSUFBWCw2TEFBb0J3QixTQUFwQjtBQUNBO0FBQ0Q7O0FBRURiLFdBQVN4QyxJQUFULEVBQWVxRCxTQUFmLEVBQTBCQyxZQUExQjtBQUNEOztBQUVELFNBQVNILE9BQVQsQ0FBaUJuRCxJQUFqQixFQUF1Qk0sSUFBdkIsRUFBNkJ3QyxLQUE3QixFQUFvQ1csSUFBcEMsRUFBMEM7QUFDeEMsTUFBSUosWUFBWUgsY0FBYzVDLElBQWQsQ0FBaEI7QUFBQSxNQUNJZ0QsZUFBZUksZUFBZVosS0FBZixFQUFzQk8sU0FBdEIsQ0FEbkI7QUFFQSxNQUFJQyxhQUFhSyxNQUFqQixFQUF5QjtBQUFBOztBQUFBLDJCQUN2QixzRUFBS3pELEtBQUwsRUFBVzJCLElBQVgsNkxBQW9CeUIsYUFBYUssTUFBakM7QUFDRCxHQUZELE1BRU87QUFDTG5CLGFBQVN4QyxJQUFULEVBQWV5RCxPQUFPSCxZQUFQLEdBQXNCRCxTQUFyQyxFQUFnREksT0FBT0osU0FBUCxHQUFtQkMsWUFBbkU7QUFDRDtBQUNGOztBQUVELFNBQVNkLFFBQVQsQ0FBa0J4QyxJQUFsQixFQUF3Qk0sSUFBeEIsRUFBOEJ3QyxLQUE5QixFQUFxQztBQUNuQzlDLE9BQUt3QyxRQUFMLEdBQWdCLElBQWhCO0FBQ0F4QyxPQUFLRSxLQUFMLENBQVcyQixJQUFYLENBQWdCO0FBQ2RXLGNBQVUsSUFESTtBQUVkbEMsVUFBTUEsSUFGUTtBQUdkQyxZQUFRdUM7QUFITSxHQUFoQjtBQUtEOztBQUVELFNBQVNDLGFBQVQsQ0FBdUIvQyxJQUF2QixFQUE2QjRELE1BQTdCLEVBQXFDZCxLQUFyQyxFQUE0QztBQUMxQyxTQUFPYyxPQUFPbEIsTUFBUCxHQUFnQkksTUFBTUosTUFBdEIsSUFBZ0NrQixPQUFPakQsS0FBUCxHQUFlaUQsT0FBTzFELEtBQVAsQ0FBYXFCLE1BQW5FLEVBQTJFO0FBQ3pFLFFBQUlzQyxPQUFPRCxPQUFPMUQsS0FBUCxDQUFhMEQsT0FBT2pELEtBQVAsRUFBYixDQUFYO0FBQ0FYLFNBQUtFLEtBQUwsQ0FBVzJCLElBQVgsQ0FBZ0JnQyxJQUFoQjtBQUNBRCxXQUFPbEIsTUFBUDtBQUNEO0FBQ0Y7QUFDRCxTQUFTVSxjQUFULENBQXdCcEQsSUFBeEIsRUFBOEI0RCxNQUE5QixFQUFzQztBQUNwQyxTQUFPQSxPQUFPakQsS0FBUCxHQUFlaUQsT0FBTzFELEtBQVAsQ0FBYXFCLE1BQW5DLEVBQTJDO0FBQ3pDLFFBQUlzQyxPQUFPRCxPQUFPMUQsS0FBUCxDQUFhMEQsT0FBT2pELEtBQVAsRUFBYixDQUFYO0FBQ0FYLFNBQUtFLEtBQUwsQ0FBVzJCLElBQVgsQ0FBZ0JnQyxJQUFoQjtBQUNEO0FBQ0Y7O0FBRUQsU0FBU1gsYUFBVCxDQUF1QlksS0FBdkIsRUFBOEI7QUFDNUIsTUFBSXBELE1BQU0sRUFBVjtBQUFBLE1BQ0lxRCxZQUFZRCxNQUFNNUQsS0FBTixDQUFZNEQsTUFBTW5ELEtBQWxCLEVBQXlCLENBQXpCLENBRGhCO0FBRUEsU0FBT21ELE1BQU1uRCxLQUFOLEdBQWNtRCxNQUFNNUQsS0FBTixDQUFZcUIsTUFBakMsRUFBeUM7QUFDdkMsUUFBSXNDLE9BQU9DLE1BQU01RCxLQUFOLENBQVk0RCxNQUFNbkQsS0FBbEIsQ0FBWDs7QUFFQTtBQUNBLFFBQUlvRCxjQUFjLEdBQWQsSUFBcUJGLEtBQUssQ0FBTCxNQUFZLEdBQXJDLEVBQTBDO0FBQ3hDRSxrQkFBWSxHQUFaO0FBQ0Q7O0FBRUQsUUFBSUEsY0FBY0YsS0FBSyxDQUFMLENBQWxCLEVBQTJCO0FBQ3pCbkQsVUFBSW1CLElBQUosQ0FBU2dDLElBQVQ7QUFDQUMsWUFBTW5ELEtBQU47QUFDRCxLQUhELE1BR087QUFDTDtBQUNEO0FBQ0Y7O0FBRUQsU0FBT0QsR0FBUDtBQUNEO0FBQ0QsU0FBU2dELGNBQVQsQ0FBd0JJLEtBQXhCLEVBQStCRSxZQUEvQixFQUE2QztBQUMzQyxNQUFJQyxVQUFVLEVBQWQ7QUFBQSxNQUNJTixTQUFTLEVBRGI7QUFBQSxNQUVJTyxhQUFhLENBRmpCO0FBQUEsTUFHSUMsaUJBQWlCLEtBSHJCO0FBQUEsTUFJSUMsYUFBYSxLQUpqQjtBQUtBLFNBQU9GLGFBQWFGLGFBQWF6QyxNQUExQixJQUNFdUMsTUFBTW5ELEtBQU4sR0FBY21ELE1BQU01RCxLQUFOLENBQVlxQixNQURuQyxFQUMyQztBQUN6QyxRQUFJOEMsU0FBU1AsTUFBTTVELEtBQU4sQ0FBWTRELE1BQU1uRCxLQUFsQixDQUFiO0FBQUEsUUFDSTJELFFBQVFOLGFBQWFFLFVBQWIsQ0FEWjs7QUFHQTtBQUNBLFFBQUlJLE1BQU0sQ0FBTixNQUFhLEdBQWpCLEVBQXNCO0FBQ3BCO0FBQ0Q7O0FBRURILHFCQUFpQkEsa0JBQWtCRSxPQUFPLENBQVAsTUFBYyxHQUFqRDs7QUFFQVYsV0FBTzlCLElBQVAsQ0FBWXlDLEtBQVo7QUFDQUo7O0FBRUE7QUFDQTtBQUNBLFFBQUlHLE9BQU8sQ0FBUCxNQUFjLEdBQWxCLEVBQXVCO0FBQ3JCRCxtQkFBYSxJQUFiOztBQUVBLGFBQU9DLE9BQU8sQ0FBUCxNQUFjLEdBQXJCLEVBQTBCO0FBQ3hCSixnQkFBUXBDLElBQVIsQ0FBYXdDLE1BQWI7QUFDQUEsaUJBQVNQLE1BQU01RCxLQUFOLENBQVksRUFBRTRELE1BQU1uRCxLQUFwQixDQUFUO0FBQ0Q7QUFDRjs7QUFFRCxRQUFJMkQsTUFBTUMsTUFBTixDQUFhLENBQWIsTUFBb0JGLE9BQU9FLE1BQVAsQ0FBYyxDQUFkLENBQXhCLEVBQTBDO0FBQ3hDTixjQUFRcEMsSUFBUixDQUFhd0MsTUFBYjtBQUNBUCxZQUFNbkQsS0FBTjtBQUNELEtBSEQsTUFHTztBQUNMeUQsbUJBQWEsSUFBYjtBQUNEO0FBQ0Y7O0FBRUQsTUFBSSxDQUFDSixhQUFhRSxVQUFiLEtBQTRCLEVBQTdCLEVBQWlDLENBQWpDLE1BQXdDLEdBQXhDLElBQ0dDLGNBRFAsRUFDdUI7QUFDckJDLGlCQUFhLElBQWI7QUFDRDs7QUFFRCxNQUFJQSxVQUFKLEVBQWdCO0FBQ2QsV0FBT0gsT0FBUDtBQUNEOztBQUVELFNBQU9DLGFBQWFGLGFBQWF6QyxNQUFqQyxFQUF5QztBQUN2Q29DLFdBQU85QixJQUFQLENBQVltQyxhQUFhRSxZQUFiLENBQVo7QUFDRDs7QUFFRCxTQUFPO0FBQ0xQLGtCQURLO0FBRUxNO0FBRkssR0FBUDtBQUlEOztBQUVELFNBQVNWLFVBQVQsQ0FBb0JVLE9BQXBCLEVBQTZCO0FBQzNCLFNBQU9BLFFBQVFPLE1BQVIsQ0FBZSxVQUFTQyxJQUFULEVBQWVKLE1BQWYsRUFBdUI7QUFDM0MsV0FBT0ksUUFBUUosT0FBTyxDQUFQLE1BQWMsR0FBN0I7QUFDRCxHQUZNLEVBRUosSUFGSSxDQUFQO0FBR0Q7QUFDRCxTQUFTYixrQkFBVCxDQUE0Qk0sS0FBNUIsRUFBbUNZLGFBQW5DLEVBQWtEQyxLQUFsRCxFQUF5RDtBQUN2RCxPQUFLLElBQUlDLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsS0FBcEIsRUFBMkJDLEdBQTNCLEVBQWdDO0FBQzlCLFFBQUlDLGdCQUFnQkgsY0FBY0EsY0FBY25ELE1BQWQsR0FBdUJvRCxLQUF2QixHQUErQkMsQ0FBN0MsRUFBZ0RMLE1BQWhELENBQXVELENBQXZELENBQXBCO0FBQ0EsUUFBSVQsTUFBTTVELEtBQU4sQ0FBWTRELE1BQU1uRCxLQUFOLEdBQWNpRSxDQUExQixNQUFpQyxNQUFNQyxhQUEzQyxFQUEwRDtBQUN4RCxhQUFPLEtBQVA7QUFDRDtBQUNGOztBQUVEZixRQUFNbkQsS0FBTixJQUFlZ0UsS0FBZjtBQUNBLFNBQU8sSUFBUDtBQUNEOztBQUVELFNBQVMxRSxtQkFBVCxDQUE2QkMsS0FBN0IsRUFBb0M7QUFDbEMsTUFBSUMsV0FBVyxDQUFmO0FBQ0EsTUFBSUMsV0FBVyxDQUFmOztBQUVBRixRQUFNNEUsT0FBTixDQUFjLFVBQVNqQixJQUFULEVBQWU7QUFDM0IsUUFBSSxPQUFPQSxJQUFQLEtBQWdCLFFBQXBCLEVBQThCO0FBQzVCLFVBQUlrQixVQUFVOUUsb0JBQW9CNEQsS0FBS3ZELElBQXpCLENBQWQ7QUFDQSxVQUFJMEUsYUFBYS9FLG9CQUFvQjRELEtBQUt0RCxNQUF6QixDQUFqQjs7QUFFQSxVQUFJSixhQUFhRSxTQUFqQixFQUE0QjtBQUMxQixZQUFJMEUsUUFBUTVFLFFBQVIsS0FBcUI2RSxXQUFXN0UsUUFBcEMsRUFBOEM7QUFDNUNBLHNCQUFZNEUsUUFBUTVFLFFBQXBCO0FBQ0QsU0FGRCxNQUVPO0FBQ0xBLHFCQUFXRSxTQUFYO0FBQ0Q7QUFDRjs7QUFFRCxVQUFJRCxhQUFhQyxTQUFqQixFQUE0QjtBQUMxQixZQUFJMEUsUUFBUTNFLFFBQVIsS0FBcUI0RSxXQUFXNUUsUUFBcEMsRUFBOEM7QUFDNUNBLHNCQUFZMkUsUUFBUTNFLFFBQXBCO0FBQ0QsU0FGRCxNQUVPO0FBQ0xBLHFCQUFXQyxTQUFYO0FBQ0Q7QUFDRjtBQUNGLEtBbkJELE1BbUJPO0FBQ0wsVUFBSUQsYUFBYUMsU0FBYixLQUEyQndELEtBQUssQ0FBTCxNQUFZLEdBQVosSUFBbUJBLEtBQUssQ0FBTCxNQUFZLEdBQTFELENBQUosRUFBb0U7QUFDbEV6RDtBQUNEO0FBQ0QsVUFBSUQsYUFBYUUsU0FBYixLQUEyQndELEtBQUssQ0FBTCxNQUFZLEdBQVosSUFBbUJBLEtBQUssQ0FBTCxNQUFZLEdBQTFELENBQUosRUFBb0U7QUFDbEUxRDtBQUNEO0FBQ0Y7QUFDRixHQTVCRDs7QUE4QkEsU0FBTyxFQUFDQSxrQkFBRCxFQUFXQyxrQkFBWCxFQUFQO0FBQ0QiLCJmaWxlIjoibWVyZ2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJpbXBvcnQge3N0cnVjdHVyZWRQYXRjaH0gZnJvbSAnLi9jcmVhdGUnO1xuaW1wb3J0IHtwYXJzZVBhdGNofSBmcm9tICcuL3BhcnNlJztcblxuaW1wb3J0IHthcnJheUVxdWFsLCBhcnJheVN0YXJ0c1dpdGh9IGZyb20gJy4uL3V0aWwvYXJyYXknO1xuXG5leHBvcnQgZnVuY3Rpb24gY2FsY0xpbmVDb3VudChodW5rKSB7XG4gIGNvbnN0IHtvbGRMaW5lcywgbmV3TGluZXN9ID0gY2FsY09sZE5ld0xpbmVDb3VudChodW5rLmxpbmVzKTtcblxuICBpZiAob2xkTGluZXMgIT09IHVuZGVmaW5lZCkge1xuICAgIGh1bmsub2xkTGluZXMgPSBvbGRMaW5lcztcbiAgfSBlbHNlIHtcbiAgICBkZWxldGUgaHVuay5vbGRMaW5lcztcbiAgfVxuXG4gIGlmIChuZXdMaW5lcyAhPT0gdW5kZWZpbmVkKSB7XG4gICAgaHVuay5uZXdMaW5lcyA9IG5ld0xpbmVzO1xuICB9IGVsc2Uge1xuICAgIGRlbGV0ZSBodW5rLm5ld0xpbmVzO1xuICB9XG59XG5cbmV4cG9ydCBmdW5jdGlvbiBtZXJnZShtaW5lLCB0aGVpcnMsIGJhc2UpIHtcbiAgbWluZSA9IGxvYWRQYXRjaChtaW5lLCBiYXNlKTtcbiAgdGhlaXJzID0gbG9hZFBhdGNoKHRoZWlycywgYmFzZSk7XG5cbiAgbGV0IHJldCA9IHt9O1xuXG4gIC8vIEZvciBpbmRleCB3ZSBqdXN0IGxldCBpdCBwYXNzIHRocm91Z2ggYXMgaXQgZG9lc24ndCBoYXZlIGFueSBuZWNlc3NhcnkgbWVhbmluZy5cbiAgLy8gTGVhdmluZyBzYW5pdHkgY2hlY2tzIG9uIHRoaXMgdG8gdGhlIEFQSSBjb25zdW1lciB0aGF0IG1heSBrbm93IG1vcmUgYWJvdXQgdGhlXG4gIC8vIG1lYW5pbmcgaW4gdGhlaXIgb3duIGNvbnRleHQuXG4gIGlmIChtaW5lLmluZGV4IHx8IHRoZWlycy5pbmRleCkge1xuICAgIHJldC5pbmRleCA9IG1pbmUuaW5kZXggfHwgdGhlaXJzLmluZGV4O1xuICB9XG5cbiAgaWYgKG1pbmUubmV3RmlsZU5hbWUgfHwgdGhlaXJzLm5ld0ZpbGVOYW1lKSB7XG4gICAgaWYgKCFmaWxlTmFtZUNoYW5nZWQobWluZSkpIHtcbiAgICAgIC8vIE5vIGhlYWRlciBvciBubyBjaGFuZ2UgaW4gb3VycywgdXNlIHRoZWlycyAoYW5kIG91cnMgaWYgdGhlaXJzIGRvZXMgbm90IGV4aXN0KVxuICAgICAgcmV0Lm9sZEZpbGVOYW1lID0gdGhlaXJzLm9sZEZpbGVOYW1lIHx8IG1pbmUub2xkRmlsZU5hbWU7XG4gICAgICByZXQubmV3RmlsZU5hbWUgPSB0aGVpcnMubmV3RmlsZU5hbWUgfHwgbWluZS5uZXdGaWxlTmFtZTtcbiAgICAgIHJldC5vbGRIZWFkZXIgPSB0aGVpcnMub2xkSGVhZGVyIHx8IG1pbmUub2xkSGVhZGVyO1xuICAgICAgcmV0Lm5ld0hlYWRlciA9IHRoZWlycy5uZXdIZWFkZXIgfHwgbWluZS5uZXdIZWFkZXI7XG4gICAgfSBlbHNlIGlmICghZmlsZU5hbWVDaGFuZ2VkKHRoZWlycykpIHtcbiAgICAgIC8vIE5vIGhlYWRlciBvciBubyBjaGFuZ2UgaW4gdGhlaXJzLCB1c2Ugb3Vyc1xuICAgICAgcmV0Lm9sZEZpbGVOYW1lID0gbWluZS5vbGRGaWxlTmFtZTtcbiAgICAgIHJldC5uZXdGaWxlTmFtZSA9IG1pbmUubmV3RmlsZU5hbWU7XG4gICAgICByZXQub2xkSGVhZGVyID0gbWluZS5vbGRIZWFkZXI7XG4gICAgICByZXQubmV3SGVhZGVyID0gbWluZS5uZXdIZWFkZXI7XG4gICAgfSBlbHNlIHtcbiAgICAgIC8vIEJvdGggY2hhbmdlZC4uLiBmaWd1cmUgaXQgb3V0XG4gICAgICByZXQub2xkRmlsZU5hbWUgPSBzZWxlY3RGaWVsZChyZXQsIG1pbmUub2xkRmlsZU5hbWUsIHRoZWlycy5vbGRGaWxlTmFtZSk7XG4gICAgICByZXQubmV3RmlsZU5hbWUgPSBzZWxlY3RGaWVsZChyZXQsIG1pbmUubmV3RmlsZU5hbWUsIHRoZWlycy5uZXdGaWxlTmFtZSk7XG4gICAgICByZXQub2xkSGVhZGVyID0gc2VsZWN0RmllbGQocmV0LCBtaW5lLm9sZEhlYWRlciwgdGhlaXJzLm9sZEhlYWRlcik7XG4gICAgICByZXQubmV3SGVhZGVyID0gc2VsZWN0RmllbGQocmV0LCBtaW5lLm5ld0hlYWRlciwgdGhlaXJzLm5ld0hlYWRlcik7XG4gICAgfVxuICB9XG5cbiAgcmV0Lmh1bmtzID0gW107XG5cbiAgbGV0IG1pbmVJbmRleCA9IDAsXG4gICAgICB0aGVpcnNJbmRleCA9IDAsXG4gICAgICBtaW5lT2Zmc2V0ID0gMCxcbiAgICAgIHRoZWlyc09mZnNldCA9IDA7XG5cbiAgd2hpbGUgKG1pbmVJbmRleCA8IG1pbmUuaHVua3MubGVuZ3RoIHx8IHRoZWlyc0luZGV4IDwgdGhlaXJzLmh1bmtzLmxlbmd0aCkge1xuICAgIGxldCBtaW5lQ3VycmVudCA9IG1pbmUuaHVua3NbbWluZUluZGV4XSB8fCB7b2xkU3RhcnQ6IEluZmluaXR5fSxcbiAgICAgICAgdGhlaXJzQ3VycmVudCA9IHRoZWlycy5odW5rc1t0aGVpcnNJbmRleF0gfHwge29sZFN0YXJ0OiBJbmZpbml0eX07XG5cbiAgICBpZiAoaHVua0JlZm9yZShtaW5lQ3VycmVudCwgdGhlaXJzQ3VycmVudCkpIHtcbiAgICAgIC8vIFRoaXMgcGF0Y2ggZG9lcyBub3Qgb3ZlcmxhcCB3aXRoIGFueSBvZiB0aGUgb3RoZXJzLCB5YXkuXG4gICAgICByZXQuaHVua3MucHVzaChjbG9uZUh1bmsobWluZUN1cnJlbnQsIG1pbmVPZmZzZXQpKTtcbiAgICAgIG1pbmVJbmRleCsrO1xuICAgICAgdGhlaXJzT2Zmc2V0ICs9IG1pbmVDdXJyZW50Lm5ld0xpbmVzIC0gbWluZUN1cnJlbnQub2xkTGluZXM7XG4gICAgfSBlbHNlIGlmIChodW5rQmVmb3JlKHRoZWlyc0N1cnJlbnQsIG1pbmVDdXJyZW50KSkge1xuICAgICAgLy8gVGhpcyBwYXRjaCBkb2VzIG5vdCBvdmVybGFwIHdpdGggYW55IG9mIHRoZSBvdGhlcnMsIHlheS5cbiAgICAgIHJldC5odW5rcy5wdXNoKGNsb25lSHVuayh0aGVpcnNDdXJyZW50LCB0aGVpcnNPZmZzZXQpKTtcbiAgICAgIHRoZWlyc0luZGV4Kys7XG4gICAgICBtaW5lT2Zmc2V0ICs9IHRoZWlyc0N1cnJlbnQubmV3TGluZXMgLSB0aGVpcnNDdXJyZW50Lm9sZExpbmVzO1xuICAgIH0gZWxzZSB7XG4gICAgICAvLyBPdmVybGFwLCBtZXJnZSBhcyBiZXN0IHdlIGNhblxuICAgICAgbGV0IG1lcmdlZEh1bmsgPSB7XG4gICAgICAgIG9sZFN0YXJ0OiBNYXRoLm1pbihtaW5lQ3VycmVudC5vbGRTdGFydCwgdGhlaXJzQ3VycmVudC5vbGRTdGFydCksXG4gICAgICAgIG9sZExpbmVzOiAwLFxuICAgICAgICBuZXdTdGFydDogTWF0aC5taW4obWluZUN1cnJlbnQubmV3U3RhcnQgKyBtaW5lT2Zmc2V0LCB0aGVpcnNDdXJyZW50Lm9sZFN0YXJ0ICsgdGhlaXJzT2Zmc2V0KSxcbiAgICAgICAgbmV3TGluZXM6IDAsXG4gICAgICAgIGxpbmVzOiBbXVxuICAgICAgfTtcbiAgICAgIG1lcmdlTGluZXMobWVyZ2VkSHVuaywgbWluZUN1cnJlbnQub2xkU3RhcnQsIG1pbmVDdXJyZW50LmxpbmVzLCB0aGVpcnNDdXJyZW50Lm9sZFN0YXJ0LCB0aGVpcnNDdXJyZW50LmxpbmVzKTtcbiAgICAgIHRoZWlyc0luZGV4Kys7XG4gICAgICBtaW5lSW5kZXgrKztcblxuICAgICAgcmV0Lmh1bmtzLnB1c2gobWVyZ2VkSHVuayk7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIHJldDtcbn1cblxuZnVuY3Rpb24gbG9hZFBhdGNoKHBhcmFtLCBiYXNlKSB7XG4gIGlmICh0eXBlb2YgcGFyYW0gPT09ICdzdHJpbmcnKSB7XG4gICAgaWYgKC9eQEAvbS50ZXN0KHBhcmFtKSB8fCAoL15JbmRleDovbS50ZXN0KHBhcmFtKSkpIHtcbiAgICAgIHJldHVybiBwYXJzZVBhdGNoKHBhcmFtKVswXTtcbiAgICB9XG5cbiAgICBpZiAoIWJhc2UpIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcignTXVzdCBwcm92aWRlIGEgYmFzZSByZWZlcmVuY2Ugb3IgcGFzcyBpbiBhIHBhdGNoJyk7XG4gICAgfVxuICAgIHJldHVybiBzdHJ1Y3R1cmVkUGF0Y2godW5kZWZpbmVkLCB1bmRlZmluZWQsIGJhc2UsIHBhcmFtKTtcbiAgfVxuXG4gIHJldHVybiBwYXJhbTtcbn1cblxuZnVuY3Rpb24gZmlsZU5hbWVDaGFuZ2VkKHBhdGNoKSB7XG4gIHJldHVybiBwYXRjaC5uZXdGaWxlTmFtZSAmJiBwYXRjaC5uZXdGaWxlTmFtZSAhPT0gcGF0Y2gub2xkRmlsZU5hbWU7XG59XG5cbmZ1bmN0aW9uIHNlbGVjdEZpZWxkKGluZGV4LCBtaW5lLCB0aGVpcnMpIHtcbiAgaWYgKG1pbmUgPT09IHRoZWlycykge1xuICAgIHJldHVybiBtaW5lO1xuICB9IGVsc2Uge1xuICAgIGluZGV4LmNvbmZsaWN0ID0gdHJ1ZTtcbiAgICByZXR1cm4ge21pbmUsIHRoZWlyc307XG4gIH1cbn1cblxuZnVuY3Rpb24gaHVua0JlZm9yZSh0ZXN0LCBjaGVjaykge1xuICByZXR1cm4gdGVzdC5vbGRTdGFydCA8IGNoZWNrLm9sZFN0YXJ0XG4gICAgJiYgKHRlc3Qub2xkU3RhcnQgKyB0ZXN0Lm9sZExpbmVzKSA8IGNoZWNrLm9sZFN0YXJ0O1xufVxuXG5mdW5jdGlvbiBjbG9uZUh1bmsoaHVuaywgb2Zmc2V0KSB7XG4gIHJldHVybiB7XG4gICAgb2xkU3RhcnQ6IGh1bmsub2xkU3RhcnQsIG9sZExpbmVzOiBodW5rLm9sZExpbmVzLFxuICAgIG5ld1N0YXJ0OiBodW5rLm5ld1N0YXJ0ICsgb2Zmc2V0LCBuZXdMaW5lczogaHVuay5uZXdMaW5lcyxcbiAgICBsaW5lczogaHVuay5saW5lc1xuICB9O1xufVxuXG5mdW5jdGlvbiBtZXJnZUxpbmVzKGh1bmssIG1pbmVPZmZzZXQsIG1pbmVMaW5lcywgdGhlaXJPZmZzZXQsIHRoZWlyTGluZXMpIHtcbiAgLy8gVGhpcyB3aWxsIGdlbmVyYWxseSByZXN1bHQgaW4gYSBjb25mbGljdGVkIGh1bmssIGJ1dCB0aGVyZSBhcmUgY2FzZXMgd2hlcmUgdGhlIGNvbnRleHRcbiAgLy8gaXMgdGhlIG9ubHkgb3ZlcmxhcCB3aGVyZSB3ZSBjYW4gc3VjY2Vzc2Z1bGx5IG1lcmdlIHRoZSBjb250ZW50IGhlcmUuXG4gIGxldCBtaW5lID0ge29mZnNldDogbWluZU9mZnNldCwgbGluZXM6IG1pbmVMaW5lcywgaW5kZXg6IDB9LFxuICAgICAgdGhlaXIgPSB7b2Zmc2V0OiB0aGVpck9mZnNldCwgbGluZXM6IHRoZWlyTGluZXMsIGluZGV4OiAwfTtcblxuICAvLyBIYW5kbGUgYW55IGxlYWRpbmcgY29udGVudFxuICBpbnNlcnRMZWFkaW5nKGh1bmssIG1pbmUsIHRoZWlyKTtcbiAgaW5zZXJ0TGVhZGluZyhodW5rLCB0aGVpciwgbWluZSk7XG5cbiAgLy8gTm93IGluIHRoZSBvdmVybGFwIGNvbnRlbnQuIFNjYW4gdGhyb3VnaCBhbmQgc2VsZWN0IHRoZSBiZXN0IGNoYW5nZXMgZnJvbSBlYWNoLlxuICB3aGlsZSAobWluZS5pbmRleCA8IG1pbmUubGluZXMubGVuZ3RoICYmIHRoZWlyLmluZGV4IDwgdGhlaXIubGluZXMubGVuZ3RoKSB7XG4gICAgbGV0IG1pbmVDdXJyZW50ID0gbWluZS5saW5lc1ttaW5lLmluZGV4XSxcbiAgICAgICAgdGhlaXJDdXJyZW50ID0gdGhlaXIubGluZXNbdGhlaXIuaW5kZXhdO1xuXG4gICAgaWYgKChtaW5lQ3VycmVudFswXSA9PT0gJy0nIHx8IG1pbmVDdXJyZW50WzBdID09PSAnKycpXG4gICAgICAgICYmICh0aGVpckN1cnJlbnRbMF0gPT09ICctJyB8fCB0aGVpckN1cnJlbnRbMF0gPT09ICcrJykpIHtcbiAgICAgIC8vIEJvdGggbW9kaWZpZWQgLi4uXG4gICAgICBtdXR1YWxDaGFuZ2UoaHVuaywgbWluZSwgdGhlaXIpO1xuICAgIH0gZWxzZSBpZiAobWluZUN1cnJlbnRbMF0gPT09ICcrJyAmJiB0aGVpckN1cnJlbnRbMF0gPT09ICcgJykge1xuICAgICAgLy8gTWluZSBpbnNlcnRlZFxuICAgICAgaHVuay5saW5lcy5wdXNoKC4uLiBjb2xsZWN0Q2hhbmdlKG1pbmUpKTtcbiAgICB9IGVsc2UgaWYgKHRoZWlyQ3VycmVudFswXSA9PT0gJysnICYmIG1pbmVDdXJyZW50WzBdID09PSAnICcpIHtcbiAgICAgIC8vIFRoZWlycyBpbnNlcnRlZFxuICAgICAgaHVuay5saW5lcy5wdXNoKC4uLiBjb2xsZWN0Q2hhbmdlKHRoZWlyKSk7XG4gICAgfSBlbHNlIGlmIChtaW5lQ3VycmVudFswXSA9PT0gJy0nICYmIHRoZWlyQ3VycmVudFswXSA9PT0gJyAnKSB7XG4gICAgICAvLyBNaW5lIHJlbW92ZWQgb3IgZWRpdGVkXG4gICAgICByZW1vdmFsKGh1bmssIG1pbmUsIHRoZWlyKTtcbiAgICB9IGVsc2UgaWYgKHRoZWlyQ3VycmVudFswXSA9PT0gJy0nICYmIG1pbmVDdXJyZW50WzBdID09PSAnICcpIHtcbiAgICAgIC8vIFRoZWlyIHJlbW92ZWQgb3IgZWRpdGVkXG4gICAgICByZW1vdmFsKGh1bmssIHRoZWlyLCBtaW5lLCB0cnVlKTtcbiAgICB9IGVsc2UgaWYgKG1pbmVDdXJyZW50ID09PSB0aGVpckN1cnJlbnQpIHtcbiAgICAgIC8vIENvbnRleHQgaWRlbnRpdHlcbiAgICAgIGh1bmsubGluZXMucHVzaChtaW5lQ3VycmVudCk7XG4gICAgICBtaW5lLmluZGV4Kys7XG4gICAgICB0aGVpci5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICAvLyBDb250ZXh0IG1pc21hdGNoXG4gICAgICBjb25mbGljdChodW5rLCBjb2xsZWN0Q2hhbmdlKG1pbmUpLCBjb2xsZWN0Q2hhbmdlKHRoZWlyKSk7XG4gICAgfVxuICB9XG5cbiAgLy8gTm93IHB1c2ggYW55dGhpbmcgdGhhdCBtYXkgYmUgcmVtYWluaW5nXG4gIGluc2VydFRyYWlsaW5nKGh1bmssIG1pbmUpO1xuICBpbnNlcnRUcmFpbGluZyhodW5rLCB0aGVpcik7XG5cbiAgY2FsY0xpbmVDb3VudChodW5rKTtcbn1cblxuZnVuY3Rpb24gbXV0dWFsQ2hhbmdlKGh1bmssIG1pbmUsIHRoZWlyKSB7XG4gIGxldCBteUNoYW5nZXMgPSBjb2xsZWN0Q2hhbmdlKG1pbmUpLFxuICAgICAgdGhlaXJDaGFuZ2VzID0gY29sbGVjdENoYW5nZSh0aGVpcik7XG5cbiAgaWYgKGFsbFJlbW92ZXMobXlDaGFuZ2VzKSAmJiBhbGxSZW1vdmVzKHRoZWlyQ2hhbmdlcykpIHtcbiAgICAvLyBTcGVjaWFsIGNhc2UgZm9yIHJlbW92ZSBjaGFuZ2VzIHRoYXQgYXJlIHN1cGVyc2V0cyBvZiBvbmUgYW5vdGhlclxuICAgIGlmIChhcnJheVN0YXJ0c1dpdGgobXlDaGFuZ2VzLCB0aGVpckNoYW5nZXMpXG4gICAgICAgICYmIHNraXBSZW1vdmVTdXBlcnNldCh0aGVpciwgbXlDaGFuZ2VzLCBteUNoYW5nZXMubGVuZ3RoIC0gdGhlaXJDaGFuZ2VzLmxlbmd0aCkpIHtcbiAgICAgIGh1bmsubGluZXMucHVzaCguLi4gbXlDaGFuZ2VzKTtcbiAgICAgIHJldHVybjtcbiAgICB9IGVsc2UgaWYgKGFycmF5U3RhcnRzV2l0aCh0aGVpckNoYW5nZXMsIG15Q2hhbmdlcylcbiAgICAgICAgJiYgc2tpcFJlbW92ZVN1cGVyc2V0KG1pbmUsIHRoZWlyQ2hhbmdlcywgdGhlaXJDaGFuZ2VzLmxlbmd0aCAtIG15Q2hhbmdlcy5sZW5ndGgpKSB7XG4gICAgICBodW5rLmxpbmVzLnB1c2goLi4uIHRoZWlyQ2hhbmdlcyk7XG4gICAgICByZXR1cm47XG4gICAgfVxuICB9IGVsc2UgaWYgKGFycmF5RXF1YWwobXlDaGFuZ2VzLCB0aGVpckNoYW5nZXMpKSB7XG4gICAgaHVuay5saW5lcy5wdXNoKC4uLiBteUNoYW5nZXMpO1xuICAgIHJldHVybjtcbiAgfVxuXG4gIGNvbmZsaWN0KGh1bmssIG15Q2hhbmdlcywgdGhlaXJDaGFuZ2VzKTtcbn1cblxuZnVuY3Rpb24gcmVtb3ZhbChodW5rLCBtaW5lLCB0aGVpciwgc3dhcCkge1xuICBsZXQgbXlDaGFuZ2VzID0gY29sbGVjdENoYW5nZShtaW5lKSxcbiAgICAgIHRoZWlyQ2hhbmdlcyA9IGNvbGxlY3RDb250ZXh0KHRoZWlyLCBteUNoYW5nZXMpO1xuICBpZiAodGhlaXJDaGFuZ2VzLm1lcmdlZCkge1xuICAgIGh1bmsubGluZXMucHVzaCguLi4gdGhlaXJDaGFuZ2VzLm1lcmdlZCk7XG4gIH0gZWxzZSB7XG4gICAgY29uZmxpY3QoaHVuaywgc3dhcCA/IHRoZWlyQ2hhbmdlcyA6IG15Q2hhbmdlcywgc3dhcCA/IG15Q2hhbmdlcyA6IHRoZWlyQ2hhbmdlcyk7XG4gIH1cbn1cblxuZnVuY3Rpb24gY29uZmxpY3QoaHVuaywgbWluZSwgdGhlaXIpIHtcbiAgaHVuay5jb25mbGljdCA9IHRydWU7XG4gIGh1bmsubGluZXMucHVzaCh7XG4gICAgY29uZmxpY3Q6IHRydWUsXG4gICAgbWluZTogbWluZSxcbiAgICB0aGVpcnM6IHRoZWlyXG4gIH0pO1xufVxuXG5mdW5jdGlvbiBpbnNlcnRMZWFkaW5nKGh1bmssIGluc2VydCwgdGhlaXIpIHtcbiAgd2hpbGUgKGluc2VydC5vZmZzZXQgPCB0aGVpci5vZmZzZXQgJiYgaW5zZXJ0LmluZGV4IDwgaW5zZXJ0LmxpbmVzLmxlbmd0aCkge1xuICAgIGxldCBsaW5lID0gaW5zZXJ0LmxpbmVzW2luc2VydC5pbmRleCsrXTtcbiAgICBodW5rLmxpbmVzLnB1c2gobGluZSk7XG4gICAgaW5zZXJ0Lm9mZnNldCsrO1xuICB9XG59XG5mdW5jdGlvbiBpbnNlcnRUcmFpbGluZyhodW5rLCBpbnNlcnQpIHtcbiAgd2hpbGUgKGluc2VydC5pbmRleCA8IGluc2VydC5saW5lcy5sZW5ndGgpIHtcbiAgICBsZXQgbGluZSA9IGluc2VydC5saW5lc1tpbnNlcnQuaW5kZXgrK107XG4gICAgaHVuay5saW5lcy5wdXNoKGxpbmUpO1xuICB9XG59XG5cbmZ1bmN0aW9uIGNvbGxlY3RDaGFuZ2Uoc3RhdGUpIHtcbiAgbGV0IHJldCA9IFtdLFxuICAgICAgb3BlcmF0aW9uID0gc3RhdGUubGluZXNbc3RhdGUuaW5kZXhdWzBdO1xuICB3aGlsZSAoc3RhdGUuaW5kZXggPCBzdGF0ZS5saW5lcy5sZW5ndGgpIHtcbiAgICBsZXQgbGluZSA9IHN0YXRlLmxpbmVzW3N0YXRlLmluZGV4XTtcblxuICAgIC8vIEdyb3VwIGFkZGl0aW9ucyB0aGF0IGFyZSBpbW1lZGlhdGVseSBhZnRlciBzdWJ0cmFjdGlvbnMgYW5kIHRyZWF0IHRoZW0gYXMgb25lIFwiYXRvbWljXCIgbW9kaWZ5IGNoYW5nZS5cbiAgICBpZiAob3BlcmF0aW9uID09PSAnLScgJiYgbGluZVswXSA9PT0gJysnKSB7XG4gICAgICBvcGVyYXRpb24gPSAnKyc7XG4gICAgfVxuXG4gICAgaWYgKG9wZXJhdGlvbiA9PT0gbGluZVswXSkge1xuICAgICAgcmV0LnB1c2gobGluZSk7XG4gICAgICBzdGF0ZS5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICBicmVhaztcbiAgICB9XG4gIH1cblxuICByZXR1cm4gcmV0O1xufVxuZnVuY3Rpb24gY29sbGVjdENvbnRleHQoc3RhdGUsIG1hdGNoQ2hhbmdlcykge1xuICBsZXQgY2hhbmdlcyA9IFtdLFxuICAgICAgbWVyZ2VkID0gW10sXG4gICAgICBtYXRjaEluZGV4ID0gMCxcbiAgICAgIGNvbnRleHRDaGFuZ2VzID0gZmFsc2UsXG4gICAgICBjb25mbGljdGVkID0gZmFsc2U7XG4gIHdoaWxlIChtYXRjaEluZGV4IDwgbWF0Y2hDaGFuZ2VzLmxlbmd0aFxuICAgICAgICAmJiBzdGF0ZS5pbmRleCA8IHN0YXRlLmxpbmVzLmxlbmd0aCkge1xuICAgIGxldCBjaGFuZ2UgPSBzdGF0ZS5saW5lc1tzdGF0ZS5pbmRleF0sXG4gICAgICAgIG1hdGNoID0gbWF0Y2hDaGFuZ2VzW21hdGNoSW5kZXhdO1xuXG4gICAgLy8gT25jZSB3ZSd2ZSBoaXQgb3VyIGFkZCwgdGhlbiB3ZSBhcmUgZG9uZVxuICAgIGlmIChtYXRjaFswXSA9PT0gJysnKSB7XG4gICAgICBicmVhaztcbiAgICB9XG5cbiAgICBjb250ZXh0Q2hhbmdlcyA9IGNvbnRleHRDaGFuZ2VzIHx8IGNoYW5nZVswXSAhPT0gJyAnO1xuXG4gICAgbWVyZ2VkLnB1c2gobWF0Y2gpO1xuICAgIG1hdGNoSW5kZXgrKztcblxuICAgIC8vIENvbnN1bWUgYW55IGFkZGl0aW9ucyBpbiB0aGUgb3RoZXIgYmxvY2sgYXMgYSBjb25mbGljdCB0byBhdHRlbXB0XG4gICAgLy8gdG8gcHVsbCBpbiB0aGUgcmVtYWluaW5nIGNvbnRleHQgYWZ0ZXIgdGhpc1xuICAgIGlmIChjaGFuZ2VbMF0gPT09ICcrJykge1xuICAgICAgY29uZmxpY3RlZCA9IHRydWU7XG5cbiAgICAgIHdoaWxlIChjaGFuZ2VbMF0gPT09ICcrJykge1xuICAgICAgICBjaGFuZ2VzLnB1c2goY2hhbmdlKTtcbiAgICAgICAgY2hhbmdlID0gc3RhdGUubGluZXNbKytzdGF0ZS5pbmRleF07XG4gICAgICB9XG4gICAgfVxuXG4gICAgaWYgKG1hdGNoLnN1YnN0cigxKSA9PT0gY2hhbmdlLnN1YnN0cigxKSkge1xuICAgICAgY2hhbmdlcy5wdXNoKGNoYW5nZSk7XG4gICAgICBzdGF0ZS5pbmRleCsrO1xuICAgIH0gZWxzZSB7XG4gICAgICBjb25mbGljdGVkID0gdHJ1ZTtcbiAgICB9XG4gIH1cblxuICBpZiAoKG1hdGNoQ2hhbmdlc1ttYXRjaEluZGV4XSB8fCAnJylbMF0gPT09ICcrJ1xuICAgICAgJiYgY29udGV4dENoYW5nZXMpIHtcbiAgICBjb25mbGljdGVkID0gdHJ1ZTtcbiAgfVxuXG4gIGlmIChjb25mbGljdGVkKSB7XG4gICAgcmV0dXJuIGNoYW5nZXM7XG4gIH1cblxuICB3aGlsZSAobWF0Y2hJbmRleCA8IG1hdGNoQ2hhbmdlcy5sZW5ndGgpIHtcbiAgICBtZXJnZWQucHVzaChtYXRjaENoYW5nZXNbbWF0Y2hJbmRleCsrXSk7XG4gIH1cblxuICByZXR1cm4ge1xuICAgIG1lcmdlZCxcbiAgICBjaGFuZ2VzXG4gIH07XG59XG5cbmZ1bmN0aW9uIGFsbFJlbW92ZXMoY2hhbmdlcykge1xuICByZXR1cm4gY2hhbmdlcy5yZWR1Y2UoZnVuY3Rpb24ocHJldiwgY2hhbmdlKSB7XG4gICAgcmV0dXJuIHByZXYgJiYgY2hhbmdlWzBdID09PSAnLSc7XG4gIH0sIHRydWUpO1xufVxuZnVuY3Rpb24gc2tpcFJlbW92ZVN1cGVyc2V0KHN0YXRlLCByZW1vdmVDaGFuZ2VzLCBkZWx0YSkge1xuICBmb3IgKGxldCBpID0gMDsgaSA8IGRlbHRhOyBpKyspIHtcbiAgICBsZXQgY2hhbmdlQ29udGVudCA9IHJlbW92ZUNoYW5nZXNbcmVtb3ZlQ2hhbmdlcy5sZW5ndGggLSBkZWx0YSArIGldLnN1YnN0cigxKTtcbiAgICBpZiAoc3RhdGUubGluZXNbc3RhdGUuaW5kZXggKyBpXSAhPT0gJyAnICsgY2hhbmdlQ29udGVudCkge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cbiAgfVxuXG4gIHN0YXRlLmluZGV4ICs9IGRlbHRhO1xuICByZXR1cm4gdHJ1ZTtcbn1cblxuZnVuY3Rpb24gY2FsY09sZE5ld0xpbmVDb3VudChsaW5lcykge1xuICBsZXQgb2xkTGluZXMgPSAwO1xuICBsZXQgbmV3TGluZXMgPSAwO1xuXG4gIGxpbmVzLmZvckVhY2goZnVuY3Rpb24obGluZSkge1xuICAgIGlmICh0eXBlb2YgbGluZSAhPT0gJ3N0cmluZycpIHtcbiAgICAgIGxldCBteUNvdW50ID0gY2FsY09sZE5ld0xpbmVDb3VudChsaW5lLm1pbmUpO1xuICAgICAgbGV0IHRoZWlyQ291bnQgPSBjYWxjT2xkTmV3TGluZUNvdW50KGxpbmUudGhlaXJzKTtcblxuICAgICAgaWYgKG9sZExpbmVzICE9PSB1bmRlZmluZWQpIHtcbiAgICAgICAgaWYgKG15Q291bnQub2xkTGluZXMgPT09IHRoZWlyQ291bnQub2xkTGluZXMpIHtcbiAgICAgICAgICBvbGRMaW5lcyArPSBteUNvdW50Lm9sZExpbmVzO1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIG9sZExpbmVzID0gdW5kZWZpbmVkO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIGlmIChuZXdMaW5lcyAhPT0gdW5kZWZpbmVkKSB7XG4gICAgICAgIGlmIChteUNvdW50Lm5ld0xpbmVzID09PSB0aGVpckNvdW50Lm5ld0xpbmVzKSB7XG4gICAgICAgICAgbmV3TGluZXMgKz0gbXlDb3VudC5uZXdMaW5lcztcbiAgICAgICAgfSBlbHNlIHtcbiAgICAgICAgICBuZXdMaW5lcyA9IHVuZGVmaW5lZDtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH0gZWxzZSB7XG4gICAgICBpZiAobmV3TGluZXMgIT09IHVuZGVmaW5lZCAmJiAobGluZVswXSA9PT0gJysnIHx8IGxpbmVbMF0gPT09ICcgJykpIHtcbiAgICAgICAgbmV3TGluZXMrKztcbiAgICAgIH1cbiAgICAgIGlmIChvbGRMaW5lcyAhPT0gdW5kZWZpbmVkICYmIChsaW5lWzBdID09PSAnLScgfHwgbGluZVswXSA9PT0gJyAnKSkge1xuICAgICAgICBvbGRMaW5lcysrO1xuICAgICAgfVxuICAgIH1cbiAgfSk7XG5cbiAgcmV0dXJuIHtvbGRMaW5lcywgbmV3TGluZXN9O1xufVxuIl19
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/parse.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/parse.js
new file mode 100644
index 00000000000..e5f17301a8f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/patch/parse.js
@@ -0,0 +1,147 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/parsePatch = parsePatch;
+function parsePatch(uniDiff) {
+  /*istanbul ignore start*/var /*istanbul ignore end*/options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
+
+  var diffstr = uniDiff.split(/\r\n|[\n\v\f\r\x85]/),
+      delimiters = uniDiff.match(/\r\n|[\n\v\f\r\x85]/g) || [],
+      list = [],
+      i = 0;
+
+  function parseIndex() {
+    var index = {};
+    list.push(index);
+
+    // Parse diff metadata
+    while (i < diffstr.length) {
+      var line = diffstr[i];
+
+      // File header found, end parsing diff metadata
+      if (/^(\-\-\-|\+\+\+|@@)\s/.test(line)) {
+        break;
+      }
+
+      // Diff index
+      var header = /^(?:Index:|diff(?: -r \w+)+)\s+(.+?)\s*$/.exec(line);
+      if (header) {
+        index.index = header[1];
+      }
+
+      i++;
+    }
+
+    // Parse file headers if they are defined. Unified diff requires them, but
+    // there's no technical issues to have an isolated hunk without file header
+    parseFileHeader(index);
+    parseFileHeader(index);
+
+    // Parse hunks
+    index.hunks = [];
+
+    while (i < diffstr.length) {
+      var _line = diffstr[i];
+
+      if (/^(Index:|diff|\-\-\-|\+\+\+)\s/.test(_line)) {
+        break;
+      } else if (/^@@/.test(_line)) {
+        index.hunks.push(parseHunk());
+      } else if (_line && options.strict) {
+        // Ignore unexpected content unless in strict mode
+        throw new Error('Unknown line ' + (i + 1) + ' ' + JSON.stringify(_line));
+      } else {
+        i++;
+      }
+    }
+  }
+
+  // Parses the --- and +++ headers, if none are found, no lines
+  // are consumed.
+  function parseFileHeader(index) {
+    var fileHeader = /^(---|\+\+\+)\s+(.*)$/.exec(diffstr[i]);
+    if (fileHeader) {
+      var keyPrefix = fileHeader[1] === '---' ? 'old' : 'new';
+      var data = fileHeader[2].split('\t', 2);
+      var fileName = data[0].replace(/\\\\/g, '\\');
+      if (/^".*"$/.test(fileName)) {
+        fileName = fileName.substr(1, fileName.length - 2);
+      }
+      index[keyPrefix + 'FileName'] = fileName;
+      index[keyPrefix + 'Header'] = (data[1] || '').trim();
+
+      i++;
+    }
+  }
+
+  // Parses a hunk
+  // This assumes that we are at the start of a hunk.
+  function parseHunk() {
+    var chunkHeaderIndex = i,
+        chunkHeaderLine = diffstr[i++],
+        chunkHeader = chunkHeaderLine.split(/@@ -(\d+)(?:,(\d+))? \+(\d+)(?:,(\d+))? @@/);
+
+    var hunk = {
+      oldStart: +chunkHeader[1],
+      oldLines: +chunkHeader[2] || 1,
+      newStart: +chunkHeader[3],
+      newLines: +chunkHeader[4] || 1,
+      lines: [],
+      linedelimiters: []
+    };
+
+    var addCount = 0,
+        removeCount = 0;
+    for (; i < diffstr.length; i++) {
+      // Lines starting with '---' could be mistaken for the "remove line" operation
+      // But they could be the header for the next file. Therefore prune such cases out.
+      if (diffstr[i].indexOf('--- ') === 0 && i + 2 < diffstr.length && diffstr[i + 1].indexOf('+++ ') === 0 && diffstr[i + 2].indexOf('@@') === 0) {
+        break;
+      }
+      var operation = diffstr[i].length == 0 && i != diffstr.length - 1 ? ' ' : diffstr[i][0];
+
+      if (operation === '+' || operation === '-' || operation === ' ' || operation === '\\') {
+        hunk.lines.push(diffstr[i]);
+        hunk.linedelimiters.push(delimiters[i] || '\n');
+
+        if (operation === '+') {
+          addCount++;
+        } else if (operation === '-') {
+          removeCount++;
+        } else if (operation === ' ') {
+          addCount++;
+          removeCount++;
+        }
+      } else {
+        break;
+      }
+    }
+
+    // Handle the empty block count case
+    if (!addCount && hunk.newLines === 1) {
+      hunk.newLines = 0;
+    }
+    if (!removeCount && hunk.oldLines === 1) {
+      hunk.oldLines = 0;
+    }
+
+    // Perform optional sanity checking
+    if (options.strict) {
+      if (addCount !== hunk.newLines) {
+        throw new Error('Added line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+      }
+      if (removeCount !== hunk.oldLines) {
+        throw new Error('Removed line count did not match for hunk at line ' + (chunkHeaderIndex + 1));
+      }
+    }
+
+    return hunk;
+  }
+
+  while (i < diffstr.length) {
+    parseIndex();
+  }
+
+  return list;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy9wYXRjaC9wYXJzZS5qcyJdLCJuYW1lcyI6WyJwYXJzZVBhdGNoIiwidW5pRGlmZiIsIm9wdGlvbnMiLCJkaWZmc3RyIiwic3BsaXQiLCJkZWxpbWl0ZXJzIiwibWF0Y2giLCJsaXN0IiwiaSIsInBhcnNlSW5kZXgiLCJpbmRleCIsInB1c2giLCJsZW5ndGgiLCJsaW5lIiwidGVzdCIsImhlYWRlciIsImV4ZWMiLCJwYXJzZUZpbGVIZWFkZXIiLCJodW5rcyIsInBhcnNlSHVuayIsInN0cmljdCIsIkVycm9yIiwiSlNPTiIsInN0cmluZ2lmeSIsImZpbGVIZWFkZXIiLCJrZXlQcmVmaXgiLCJkYXRhIiwiZmlsZU5hbWUiLCJyZXBsYWNlIiwic3Vic3RyIiwidHJpbSIsImNodW5rSGVhZGVySW5kZXgiLCJjaHVua0hlYWRlckxpbmUiLCJjaHVua0hlYWRlciIsImh1bmsiLCJvbGRTdGFydCIsIm9sZExpbmVzIiwibmV3U3RhcnQiLCJuZXdMaW5lcyIsImxpbmVzIiwibGluZWRlbGltaXRlcnMiLCJhZGRDb3VudCIsInJlbW92ZUNvdW50IiwiaW5kZXhPZiIsIm9wZXJhdGlvbiJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsVSxHQUFBQSxVO0FBQVQsU0FBU0EsVUFBVCxDQUFvQkMsT0FBcEIsRUFBMkM7QUFBQSxzREFBZEMsT0FBYyx1RUFBSixFQUFJOztBQUNoRCxNQUFJQyxVQUFVRixRQUFRRyxLQUFSLENBQWMscUJBQWQsQ0FBZDtBQUFBLE1BQ0lDLGFBQWFKLFFBQVFLLEtBQVIsQ0FBYyxzQkFBZCxLQUF5QyxFQUQxRDtBQUFBLE1BRUlDLE9BQU8sRUFGWDtBQUFBLE1BR0lDLElBQUksQ0FIUjs7QUFLQSxXQUFTQyxVQUFULEdBQXNCO0FBQ3BCLFFBQUlDLFFBQVEsRUFBWjtBQUNBSCxTQUFLSSxJQUFMLENBQVVELEtBQVY7O0FBRUE7QUFDQSxXQUFPRixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6QixVQUFJQyxPQUFPVixRQUFRSyxDQUFSLENBQVg7O0FBRUE7QUFDQSxVQUFJLHdCQUF3Qk0sSUFBeEIsQ0FBNkJELElBQTdCLENBQUosRUFBd0M7QUFDdEM7QUFDRDs7QUFFRDtBQUNBLFVBQUlFLFNBQVUsMENBQUQsQ0FBNkNDLElBQTdDLENBQWtESCxJQUFsRCxDQUFiO0FBQ0EsVUFBSUUsTUFBSixFQUFZO0FBQ1ZMLGNBQU1BLEtBQU4sR0FBY0ssT0FBTyxDQUFQLENBQWQ7QUFDRDs7QUFFRFA7QUFDRDs7QUFFRDtBQUNBO0FBQ0FTLG9CQUFnQlAsS0FBaEI7QUFDQU8sb0JBQWdCUCxLQUFoQjs7QUFFQTtBQUNBQSxVQUFNUSxLQUFOLEdBQWMsRUFBZDs7QUFFQSxXQUFPVixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6QixVQUFJQyxRQUFPVixRQUFRSyxDQUFSLENBQVg7O0FBRUEsVUFBSSxpQ0FBaUNNLElBQWpDLENBQXNDRCxLQUF0QyxDQUFKLEVBQWlEO0FBQy9DO0FBQ0QsT0FGRCxNQUVPLElBQUksTUFBTUMsSUFBTixDQUFXRCxLQUFYLENBQUosRUFBc0I7QUFDM0JILGNBQU1RLEtBQU4sQ0FBWVAsSUFBWixDQUFpQlEsV0FBakI7QUFDRCxPQUZNLE1BRUEsSUFBSU4sU0FBUVgsUUFBUWtCLE1BQXBCLEVBQTRCO0FBQ2pDO0FBQ0EsY0FBTSxJQUFJQyxLQUFKLENBQVUsbUJBQW1CYixJQUFJLENBQXZCLElBQTRCLEdBQTVCLEdBQWtDYyxLQUFLQyxTQUFMLENBQWVWLEtBQWYsQ0FBNUMsQ0FBTjtBQUNELE9BSE0sTUFHQTtBQUNMTDtBQUNEO0FBQ0Y7QUFDRjs7QUFFRDtBQUNBO0FBQ0EsV0FBU1MsZUFBVCxDQUF5QlAsS0FBekIsRUFBZ0M7QUFDOUIsUUFBTWMsYUFBYyx1QkFBRCxDQUEwQlIsSUFBMUIsQ0FBK0JiLFFBQVFLLENBQVIsQ0FBL0IsQ0FBbkI7QUFDQSxRQUFJZ0IsVUFBSixFQUFnQjtBQUNkLFVBQUlDLFlBQVlELFdBQVcsQ0FBWCxNQUFrQixLQUFsQixHQUEwQixLQUExQixHQUFrQyxLQUFsRDtBQUNBLFVBQU1FLE9BQU9GLFdBQVcsQ0FBWCxFQUFjcEIsS0FBZCxDQUFvQixJQUFwQixFQUEwQixDQUExQixDQUFiO0FBQ0EsVUFBSXVCLFdBQVdELEtBQUssQ0FBTCxFQUFRRSxPQUFSLENBQWdCLE9BQWhCLEVBQXlCLElBQXpCLENBQWY7QUFDQSxVQUFJLFNBQVNkLElBQVQsQ0FBY2EsUUFBZCxDQUFKLEVBQTZCO0FBQzNCQSxtQkFBV0EsU0FBU0UsTUFBVCxDQUFnQixDQUFoQixFQUFtQkYsU0FBU2YsTUFBVCxHQUFrQixDQUFyQyxDQUFYO0FBQ0Q7QUFDREYsWUFBTWUsWUFBWSxVQUFsQixJQUFnQ0UsUUFBaEM7QUFDQWpCLFlBQU1lLFlBQVksUUFBbEIsSUFBOEIsQ0FBQ0MsS0FBSyxDQUFMLEtBQVcsRUFBWixFQUFnQkksSUFBaEIsRUFBOUI7O0FBRUF0QjtBQUNEO0FBQ0Y7O0FBRUQ7QUFDQTtBQUNBLFdBQVNXLFNBQVQsR0FBcUI7QUFDbkIsUUFBSVksbUJBQW1CdkIsQ0FBdkI7QUFBQSxRQUNJd0Isa0JBQWtCN0IsUUFBUUssR0FBUixDQUR0QjtBQUFBLFFBRUl5QixjQUFjRCxnQkFBZ0I1QixLQUFoQixDQUFzQiw0Q0FBdEIsQ0FGbEI7O0FBSUEsUUFBSThCLE9BQU87QUFDVEMsZ0JBQVUsQ0FBQ0YsWUFBWSxDQUFaLENBREY7QUFFVEcsZ0JBQVUsQ0FBQ0gsWUFBWSxDQUFaLENBQUQsSUFBbUIsQ0FGcEI7QUFHVEksZ0JBQVUsQ0FBQ0osWUFBWSxDQUFaLENBSEY7QUFJVEssZ0JBQVUsQ0FBQ0wsWUFBWSxDQUFaLENBQUQsSUFBbUIsQ0FKcEI7QUFLVE0sYUFBTyxFQUxFO0FBTVRDLHNCQUFnQjtBQU5QLEtBQVg7O0FBU0EsUUFBSUMsV0FBVyxDQUFmO0FBQUEsUUFDSUMsY0FBYyxDQURsQjtBQUVBLFdBQU9sQyxJQUFJTCxRQUFRUyxNQUFuQixFQUEyQkosR0FBM0IsRUFBZ0M7QUFDOUI7QUFDQTtBQUNBLFVBQUlMLFFBQVFLLENBQVIsRUFBV21DLE9BQVgsQ0FBbUIsTUFBbkIsTUFBK0IsQ0FBL0IsSUFDTW5DLElBQUksQ0FBSixHQUFRTCxRQUFRUyxNQUR0QixJQUVLVCxRQUFRSyxJQUFJLENBQVosRUFBZW1DLE9BQWYsQ0FBdUIsTUFBdkIsTUFBbUMsQ0FGeEMsSUFHS3hDLFFBQVFLLElBQUksQ0FBWixFQUFlbUMsT0FBZixDQUF1QixJQUF2QixNQUFpQyxDQUgxQyxFQUc2QztBQUN6QztBQUNIO0FBQ0QsVUFBSUMsWUFBYXpDLFFBQVFLLENBQVIsRUFBV0ksTUFBWCxJQUFxQixDQUFyQixJQUEwQkosS0FBTUwsUUFBUVMsTUFBUixHQUFpQixDQUFsRCxHQUF3RCxHQUF4RCxHQUE4RFQsUUFBUUssQ0FBUixFQUFXLENBQVgsQ0FBOUU7O0FBRUEsVUFBSW9DLGNBQWMsR0FBZCxJQUFxQkEsY0FBYyxHQUFuQyxJQUEwQ0EsY0FBYyxHQUF4RCxJQUErREEsY0FBYyxJQUFqRixFQUF1RjtBQUNyRlYsYUFBS0ssS0FBTCxDQUFXNUIsSUFBWCxDQUFnQlIsUUFBUUssQ0FBUixDQUFoQjtBQUNBMEIsYUFBS00sY0FBTCxDQUFvQjdCLElBQXBCLENBQXlCTixXQUFXRyxDQUFYLEtBQWlCLElBQTFDOztBQUVBLFlBQUlvQyxjQUFjLEdBQWxCLEVBQXVCO0FBQ3JCSDtBQUNELFNBRkQsTUFFTyxJQUFJRyxjQUFjLEdBQWxCLEVBQXVCO0FBQzVCRjtBQUNELFNBRk0sTUFFQSxJQUFJRSxjQUFjLEdBQWxCLEVBQXVCO0FBQzVCSDtBQUNBQztBQUNEO0FBQ0YsT0FaRCxNQVlPO0FBQ0w7QUFDRDtBQUNGOztBQUVEO0FBQ0EsUUFBSSxDQUFDRCxRQUFELElBQWFQLEtBQUtJLFFBQUwsS0FBa0IsQ0FBbkMsRUFBc0M7QUFDcENKLFdBQUtJLFFBQUwsR0FBZ0IsQ0FBaEI7QUFDRDtBQUNELFFBQUksQ0FBQ0ksV0FBRCxJQUFnQlIsS0FBS0UsUUFBTCxLQUFrQixDQUF0QyxFQUF5QztBQUN2Q0YsV0FBS0UsUUFBTCxHQUFnQixDQUFoQjtBQUNEOztBQUVEO0FBQ0EsUUFBSWxDLFFBQVFrQixNQUFaLEVBQW9CO0FBQ2xCLFVBQUlxQixhQUFhUCxLQUFLSSxRQUF0QixFQUFnQztBQUM5QixjQUFNLElBQUlqQixLQUFKLENBQVUsc0RBQXNEVSxtQkFBbUIsQ0FBekUsQ0FBVixDQUFOO0FBQ0Q7QUFDRCxVQUFJVyxnQkFBZ0JSLEtBQUtFLFFBQXpCLEVBQW1DO0FBQ2pDLGNBQU0sSUFBSWYsS0FBSixDQUFVLHdEQUF3RFUsbUJBQW1CLENBQTNFLENBQVYsQ0FBTjtBQUNEO0FBQ0Y7O0FBRUQsV0FBT0csSUFBUDtBQUNEOztBQUVELFNBQU8xQixJQUFJTCxRQUFRUyxNQUFuQixFQUEyQjtBQUN6Qkg7QUFDRDs7QUFFRCxTQUFPRixJQUFQO0FBQ0QiLCJmaWxlIjoicGFyc2UuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZnVuY3Rpb24gcGFyc2VQYXRjaCh1bmlEaWZmLCBvcHRpb25zID0ge30pIHtcbiAgbGV0IGRpZmZzdHIgPSB1bmlEaWZmLnNwbGl0KC9cXHJcXG58W1xcblxcdlxcZlxcclxceDg1XS8pLFxuICAgICAgZGVsaW1pdGVycyA9IHVuaURpZmYubWF0Y2goL1xcclxcbnxbXFxuXFx2XFxmXFxyXFx4ODVdL2cpIHx8IFtdLFxuICAgICAgbGlzdCA9IFtdLFxuICAgICAgaSA9IDA7XG5cbiAgZnVuY3Rpb24gcGFyc2VJbmRleCgpIHtcbiAgICBsZXQgaW5kZXggPSB7fTtcbiAgICBsaXN0LnB1c2goaW5kZXgpO1xuXG4gICAgLy8gUGFyc2UgZGlmZiBtZXRhZGF0YVxuICAgIHdoaWxlIChpIDwgZGlmZnN0ci5sZW5ndGgpIHtcbiAgICAgIGxldCBsaW5lID0gZGlmZnN0cltpXTtcblxuICAgICAgLy8gRmlsZSBoZWFkZXIgZm91bmQsIGVuZCBwYXJzaW5nIGRpZmYgbWV0YWRhdGFcbiAgICAgIGlmICgvXihcXC1cXC1cXC18XFwrXFwrXFwrfEBAKVxccy8udGVzdChsaW5lKSkge1xuICAgICAgICBicmVhaztcbiAgICAgIH1cblxuICAgICAgLy8gRGlmZiBpbmRleFxuICAgICAgbGV0IGhlYWRlciA9ICgvXig/OkluZGV4OnxkaWZmKD86IC1yIFxcdyspKylcXHMrKC4rPylcXHMqJC8pLmV4ZWMobGluZSk7XG4gICAgICBpZiAoaGVhZGVyKSB7XG4gICAgICAgIGluZGV4LmluZGV4ID0gaGVhZGVyWzFdO1xuICAgICAgfVxuXG4gICAgICBpKys7XG4gICAgfVxuXG4gICAgLy8gUGFyc2UgZmlsZSBoZWFkZXJzIGlmIHRoZXkgYXJlIGRlZmluZWQuIFVuaWZpZWQgZGlmZiByZXF1aXJlcyB0aGVtLCBidXRcbiAgICAvLyB0aGVyZSdzIG5vIHRlY2huaWNhbCBpc3N1ZXMgdG8gaGF2ZSBhbiBpc29sYXRlZCBodW5rIHdpdGhvdXQgZmlsZSBoZWFkZXJcbiAgICBwYXJzZUZpbGVIZWFkZXIoaW5kZXgpO1xuICAgIHBhcnNlRmlsZUhlYWRlcihpbmRleCk7XG5cbiAgICAvLyBQYXJzZSBodW5rc1xuICAgIGluZGV4Lmh1bmtzID0gW107XG5cbiAgICB3aGlsZSAoaSA8IGRpZmZzdHIubGVuZ3RoKSB7XG4gICAgICBsZXQgbGluZSA9IGRpZmZzdHJbaV07XG5cbiAgICAgIGlmICgvXihJbmRleDp8ZGlmZnxcXC1cXC1cXC18XFwrXFwrXFwrKVxccy8udGVzdChsaW5lKSkge1xuICAgICAgICBicmVhaztcbiAgICAgIH0gZWxzZSBpZiAoL15AQC8udGVzdChsaW5lKSkge1xuICAgICAgICBpbmRleC5odW5rcy5wdXNoKHBhcnNlSHVuaygpKTtcbiAgICAgIH0gZWxzZSBpZiAobGluZSAmJiBvcHRpb25zLnN0cmljdCkge1xuICAgICAgICAvLyBJZ25vcmUgdW5leHBlY3RlZCBjb250ZW50IHVubGVzcyBpbiBzdHJpY3QgbW9kZVxuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ1Vua25vd24gbGluZSAnICsgKGkgKyAxKSArICcgJyArIEpTT04uc3RyaW5naWZ5KGxpbmUpKTtcbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIGkrKztcbiAgICAgIH1cbiAgICB9XG4gIH1cblxuICAvLyBQYXJzZXMgdGhlIC0tLSBhbmQgKysrIGhlYWRlcnMsIGlmIG5vbmUgYXJlIGZvdW5kLCBubyBsaW5lc1xuICAvLyBhcmUgY29uc3VtZWQuXG4gIGZ1bmN0aW9uIHBhcnNlRmlsZUhlYWRlcihpbmRleCkge1xuICAgIGNvbnN0IGZpbGVIZWFkZXIgPSAoL14oLS0tfFxcK1xcK1xcKylcXHMrKC4qKSQvKS5leGVjKGRpZmZzdHJbaV0pO1xuICAgIGlmIChmaWxlSGVhZGVyKSB7XG4gICAgICBsZXQga2V5UHJlZml4ID0gZmlsZUhlYWRlclsxXSA9PT0gJy0tLScgPyAnb2xkJyA6ICduZXcnO1xuICAgICAgY29uc3QgZGF0YSA9IGZpbGVIZWFkZXJbMl0uc3BsaXQoJ1xcdCcsIDIpO1xuICAgICAgbGV0IGZpbGVOYW1lID0gZGF0YVswXS5yZXBsYWNlKC9cXFxcXFxcXC9nLCAnXFxcXCcpO1xuICAgICAgaWYgKC9eXCIuKlwiJC8udGVzdChmaWxlTmFtZSkpIHtcbiAgICAgICAgZmlsZU5hbWUgPSBmaWxlTmFtZS5zdWJzdHIoMSwgZmlsZU5hbWUubGVuZ3RoIC0gMik7XG4gICAgICB9XG4gICAgICBpbmRleFtrZXlQcmVmaXggKyAnRmlsZU5hbWUnXSA9IGZpbGVOYW1lO1xuICAgICAgaW5kZXhba2V5UHJlZml4ICsgJ0hlYWRlciddID0gKGRhdGFbMV0gfHwgJycpLnRyaW0oKTtcblxuICAgICAgaSsrO1xuICAgIH1cbiAgfVxuXG4gIC8vIFBhcnNlcyBhIGh1bmtcbiAgLy8gVGhpcyBhc3N1bWVzIHRoYXQgd2UgYXJlIGF0IHRoZSBzdGFydCBvZiBhIGh1bmsuXG4gIGZ1bmN0aW9uIHBhcnNlSHVuaygpIHtcbiAgICBsZXQgY2h1bmtIZWFkZXJJbmRleCA9IGksXG4gICAgICAgIGNodW5rSGVhZGVyTGluZSA9IGRpZmZzdHJbaSsrXSxcbiAgICAgICAgY2h1bmtIZWFkZXIgPSBjaHVua0hlYWRlckxpbmUuc3BsaXQoL0BAIC0oXFxkKykoPzosKFxcZCspKT8gXFwrKFxcZCspKD86LChcXGQrKSk/IEBALyk7XG5cbiAgICBsZXQgaHVuayA9IHtcbiAgICAgIG9sZFN0YXJ0OiArY2h1bmtIZWFkZXJbMV0sXG4gICAgICBvbGRMaW5lczogK2NodW5rSGVhZGVyWzJdIHx8IDEsXG4gICAgICBuZXdTdGFydDogK2NodW5rSGVhZGVyWzNdLFxuICAgICAgbmV3TGluZXM6ICtjaHVua0hlYWRlcls0XSB8fCAxLFxuICAgICAgbGluZXM6IFtdLFxuICAgICAgbGluZWRlbGltaXRlcnM6IFtdXG4gICAgfTtcblxuICAgIGxldCBhZGRDb3VudCA9IDAsXG4gICAgICAgIHJlbW92ZUNvdW50ID0gMDtcbiAgICBmb3IgKDsgaSA8IGRpZmZzdHIubGVuZ3RoOyBpKyspIHtcbiAgICAgIC8vIExpbmVzIHN0YXJ0aW5nIHdpdGggJy0tLScgY291bGQgYmUgbWlzdGFrZW4gZm9yIHRoZSBcInJlbW92ZSBsaW5lXCIgb3BlcmF0aW9uXG4gICAgICAvLyBCdXQgdGhleSBjb3VsZCBiZSB0aGUgaGVhZGVyIGZvciB0aGUgbmV4dCBmaWxlLiBUaGVyZWZvcmUgcHJ1bmUgc3VjaCBjYXNlcyBvdXQuXG4gICAgICBpZiAoZGlmZnN0cltpXS5pbmRleE9mKCctLS0gJykgPT09IDBcbiAgICAgICAgICAgICYmIChpICsgMiA8IGRpZmZzdHIubGVuZ3RoKVxuICAgICAgICAgICAgJiYgZGlmZnN0cltpICsgMV0uaW5kZXhPZignKysrICcpID09PSAwXG4gICAgICAgICAgICAmJiBkaWZmc3RyW2kgKyAyXS5pbmRleE9mKCdAQCcpID09PSAwKSB7XG4gICAgICAgICAgYnJlYWs7XG4gICAgICB9XG4gICAgICBsZXQgb3BlcmF0aW9uID0gKGRpZmZzdHJbaV0ubGVuZ3RoID09IDAgJiYgaSAhPSAoZGlmZnN0ci5sZW5ndGggLSAxKSkgPyAnICcgOiBkaWZmc3RyW2ldWzBdO1xuXG4gICAgICBpZiAob3BlcmF0aW9uID09PSAnKycgfHwgb3BlcmF0aW9uID09PSAnLScgfHwgb3BlcmF0aW9uID09PSAnICcgfHwgb3BlcmF0aW9uID09PSAnXFxcXCcpIHtcbiAgICAgICAgaHVuay5saW5lcy5wdXNoKGRpZmZzdHJbaV0pO1xuICAgICAgICBodW5rLmxpbmVkZWxpbWl0ZXJzLnB1c2goZGVsaW1pdGVyc1tpXSB8fCAnXFxuJyk7XG5cbiAgICAgICAgaWYgKG9wZXJhdGlvbiA9PT0gJysnKSB7XG4gICAgICAgICAgYWRkQ291bnQrKztcbiAgICAgICAgfSBlbHNlIGlmIChvcGVyYXRpb24gPT09ICctJykge1xuICAgICAgICAgIHJlbW92ZUNvdW50Kys7XG4gICAgICAgIH0gZWxzZSBpZiAob3BlcmF0aW9uID09PSAnICcpIHtcbiAgICAgICAgICBhZGRDb3VudCsrO1xuICAgICAgICAgIHJlbW92ZUNvdW50Kys7XG4gICAgICAgIH1cbiAgICAgIH0gZWxzZSB7XG4gICAgICAgIGJyZWFrO1xuICAgICAgfVxuICAgIH1cblxuICAgIC8vIEhhbmRsZSB0aGUgZW1wdHkgYmxvY2sgY291bnQgY2FzZVxuICAgIGlmICghYWRkQ291bnQgJiYgaHVuay5uZXdMaW5lcyA9PT0gMSkge1xuICAgICAgaHVuay5uZXdMaW5lcyA9IDA7XG4gICAgfVxuICAgIGlmICghcmVtb3ZlQ291bnQgJiYgaHVuay5vbGRMaW5lcyA9PT0gMSkge1xuICAgICAgaHVuay5vbGRMaW5lcyA9IDA7XG4gICAgfVxuXG4gICAgLy8gUGVyZm9ybSBvcHRpb25hbCBzYW5pdHkgY2hlY2tpbmdcbiAgICBpZiAob3B0aW9ucy5zdHJpY3QpIHtcbiAgICAgIGlmIChhZGRDb3VudCAhPT0gaHVuay5uZXdMaW5lcykge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0FkZGVkIGxpbmUgY291bnQgZGlkIG5vdCBtYXRjaCBmb3IgaHVuayBhdCBsaW5lICcgKyAoY2h1bmtIZWFkZXJJbmRleCArIDEpKTtcbiAgICAgIH1cbiAgICAgIGlmIChyZW1vdmVDb3VudCAhPT0gaHVuay5vbGRMaW5lcykge1xuICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ1JlbW92ZWQgbGluZSBjb3VudCBkaWQgbm90IG1hdGNoIGZvciBodW5rIGF0IGxpbmUgJyArIChjaHVua0hlYWRlckluZGV4ICsgMSkpO1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiBodW5rO1xuICB9XG5cbiAgd2hpbGUgKGkgPCBkaWZmc3RyLmxlbmd0aCkge1xuICAgIHBhcnNlSW5kZXgoKTtcbiAgfVxuXG4gIHJldHVybiBsaXN0O1xufVxuIl19
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/util/array.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/util/array.js
new file mode 100644
index 00000000000..1bb42562c65
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/util/array.js
@@ -0,0 +1,27 @@
+/*istanbul ignore start*/"use strict";
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/arrayEqual = arrayEqual;
+/*istanbul ignore start*/exports. /*istanbul ignore end*/arrayStartsWith = arrayStartsWith;
+function arrayEqual(a, b) {
+  if (a.length !== b.length) {
+    return false;
+  }
+
+  return arrayStartsWith(a, b);
+}
+
+function arrayStartsWith(array, start) {
+  if (start.length > array.length) {
+    return false;
+  }
+
+  for (var i = 0; i < start.length; i++) {
+    if (start[i] !== array[i]) {
+      return false;
+    }
+  }
+
+  return true;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL2FycmF5LmpzIl0sIm5hbWVzIjpbImFycmF5RXF1YWwiLCJhcnJheVN0YXJ0c1dpdGgiLCJhIiwiYiIsImxlbmd0aCIsImFycmF5Iiwic3RhcnQiLCJpIl0sIm1hcHBpbmdzIjoiOzs7Z0NBQWdCQSxVLEdBQUFBLFU7eURBUUFDLGUsR0FBQUEsZTtBQVJULFNBQVNELFVBQVQsQ0FBb0JFLENBQXBCLEVBQXVCQyxDQUF2QixFQUEwQjtBQUMvQixNQUFJRCxFQUFFRSxNQUFGLEtBQWFELEVBQUVDLE1BQW5CLEVBQTJCO0FBQ3pCLFdBQU8sS0FBUDtBQUNEOztBQUVELFNBQU9ILGdCQUFnQkMsQ0FBaEIsRUFBbUJDLENBQW5CLENBQVA7QUFDRDs7QUFFTSxTQUFTRixlQUFULENBQXlCSSxLQUF6QixFQUFnQ0MsS0FBaEMsRUFBdUM7QUFDNUMsTUFBSUEsTUFBTUYsTUFBTixHQUFlQyxNQUFNRCxNQUF6QixFQUFpQztBQUMvQixXQUFPLEtBQVA7QUFDRDs7QUFFRCxPQUFLLElBQUlHLElBQUksQ0FBYixFQUFnQkEsSUFBSUQsTUFBTUYsTUFBMUIsRUFBa0NHLEdBQWxDLEVBQXVDO0FBQ3JDLFFBQUlELE1BQU1DLENBQU4sTUFBYUYsTUFBTUUsQ0FBTixDQUFqQixFQUEyQjtBQUN6QixhQUFPLEtBQVA7QUFDRDtBQUNGOztBQUVELFNBQU8sSUFBUDtBQUNEIiwiZmlsZSI6ImFycmF5LmpzIiwic291cmNlc0NvbnRlbnQiOlsiZXhwb3J0IGZ1bmN0aW9uIGFycmF5RXF1YWwoYSwgYikge1xuICBpZiAoYS5sZW5ndGggIT09IGIubGVuZ3RoKSB7XG4gICAgcmV0dXJuIGZhbHNlO1xuICB9XG5cbiAgcmV0dXJuIGFycmF5U3RhcnRzV2l0aChhLCBiKTtcbn1cblxuZXhwb3J0IGZ1bmN0aW9uIGFycmF5U3RhcnRzV2l0aChhcnJheSwgc3RhcnQpIHtcbiAgaWYgKHN0YXJ0Lmxlbmd0aCA+IGFycmF5Lmxlbmd0aCkge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIGZvciAobGV0IGkgPSAwOyBpIDwgc3RhcnQubGVuZ3RoOyBpKyspIHtcbiAgICBpZiAoc3RhcnRbaV0gIT09IGFycmF5W2ldKSB7XG4gICAgICByZXR1cm4gZmFsc2U7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIHRydWU7XG59XG4iXX0=
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/util/distance-iterator.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/util/distance-iterator.js
new file mode 100644
index 00000000000..95e4675dd95
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/util/distance-iterator.js
@@ -0,0 +1,47 @@
+/*istanbul ignore start*/"use strict";
+
+exports.__esModule = true;
+
+exports["default"] = /*istanbul ignore end*/function (start, minLine, maxLine) {
+  var wantForward = true,
+      backwardExhausted = false,
+      forwardExhausted = false,
+      localOffset = 1;
+
+  return function iterator() {
+    if (wantForward && !forwardExhausted) {
+      if (backwardExhausted) {
+        localOffset++;
+      } else {
+        wantForward = false;
+      }
+
+      // Check if trying to fit beyond text length, and if not, check it fits
+      // after offset location (or desired location on first iteration)
+      if (start + localOffset <= maxLine) {
+        return localOffset;
+      }
+
+      forwardExhausted = true;
+    }
+
+    if (!backwardExhausted) {
+      if (!forwardExhausted) {
+        wantForward = true;
+      }
+
+      // Check if trying to fit before text beginning, and if not, check it fits
+      // before offset location
+      if (minLine <= start - localOffset) {
+        return -localOffset++;
+      }
+
+      backwardExhausted = true;
+      return iterator();
+    }
+
+    // We tried to fit hunk before text beginning and beyond text length, then
+    // hunk can't fit on the text. Return undefined
+  };
+};
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL2Rpc3RhbmNlLWl0ZXJhdG9yLmpzIl0sIm5hbWVzIjpbInN0YXJ0IiwibWluTGluZSIsIm1heExpbmUiLCJ3YW50Rm9yd2FyZCIsImJhY2t3YXJkRXhoYXVzdGVkIiwiZm9yd2FyZEV4aGF1c3RlZCIsImxvY2FsT2Zmc2V0IiwiaXRlcmF0b3IiXSwibWFwcGluZ3MiOiI7Ozs7NENBR2UsVUFBU0EsS0FBVCxFQUFnQkMsT0FBaEIsRUFBeUJDLE9BQXpCLEVBQWtDO0FBQy9DLE1BQUlDLGNBQWMsSUFBbEI7QUFBQSxNQUNJQyxvQkFBb0IsS0FEeEI7QUFBQSxNQUVJQyxtQkFBbUIsS0FGdkI7QUFBQSxNQUdJQyxjQUFjLENBSGxCOztBQUtBLFNBQU8sU0FBU0MsUUFBVCxHQUFvQjtBQUN6QixRQUFJSixlQUFlLENBQUNFLGdCQUFwQixFQUFzQztBQUNwQyxVQUFJRCxpQkFBSixFQUF1QjtBQUNyQkU7QUFDRCxPQUZELE1BRU87QUFDTEgsc0JBQWMsS0FBZDtBQUNEOztBQUVEO0FBQ0E7QUFDQSxVQUFJSCxRQUFRTSxXQUFSLElBQXVCSixPQUEzQixFQUFvQztBQUNsQyxlQUFPSSxXQUFQO0FBQ0Q7O0FBRURELHlCQUFtQixJQUFuQjtBQUNEOztBQUVELFFBQUksQ0FBQ0QsaUJBQUwsRUFBd0I7QUFDdEIsVUFBSSxDQUFDQyxnQkFBTCxFQUF1QjtBQUNyQkYsc0JBQWMsSUFBZDtBQUNEOztBQUVEO0FBQ0E7QUFDQSxVQUFJRixXQUFXRCxRQUFRTSxXQUF2QixFQUFvQztBQUNsQyxlQUFPLENBQUNBLGFBQVI7QUFDRDs7QUFFREYsMEJBQW9CLElBQXBCO0FBQ0EsYUFBT0csVUFBUDtBQUNEOztBQUVEO0FBQ0E7QUFDRCxHQWxDRDtBQW1DRCxDIiwiZmlsZSI6ImRpc3RhbmNlLWl0ZXJhdG9yLmpzIiwic291cmNlc0NvbnRlbnQiOlsiLy8gSXRlcmF0b3IgdGhhdCB0cmF2ZXJzZXMgaW4gdGhlIHJhbmdlIG9mIFttaW4sIG1heF0sIHN0ZXBwaW5nXG4vLyBieSBkaXN0YW5jZSBmcm9tIGEgZ2l2ZW4gc3RhcnQgcG9zaXRpb24uIEkuZS4gZm9yIFswLCA0XSwgd2l0aFxuLy8gc3RhcnQgb2YgMiwgdGhpcyB3aWxsIGl0ZXJhdGUgMiwgMywgMSwgNCwgMC5cbmV4cG9ydCBkZWZhdWx0IGZ1bmN0aW9uKHN0YXJ0LCBtaW5MaW5lLCBtYXhMaW5lKSB7XG4gIGxldCB3YW50Rm9yd2FyZCA9IHRydWUsXG4gICAgICBiYWNrd2FyZEV4aGF1c3RlZCA9IGZhbHNlLFxuICAgICAgZm9yd2FyZEV4aGF1c3RlZCA9IGZhbHNlLFxuICAgICAgbG9jYWxPZmZzZXQgPSAxO1xuXG4gIHJldHVybiBmdW5jdGlvbiBpdGVyYXRvcigpIHtcbiAgICBpZiAod2FudEZvcndhcmQgJiYgIWZvcndhcmRFeGhhdXN0ZWQpIHtcbiAgICAgIGlmIChiYWNrd2FyZEV4aGF1c3RlZCkge1xuICAgICAgICBsb2NhbE9mZnNldCsrO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgd2FudEZvcndhcmQgPSBmYWxzZTtcbiAgICAgIH1cblxuICAgICAgLy8gQ2hlY2sgaWYgdHJ5aW5nIHRvIGZpdCBiZXlvbmQgdGV4dCBsZW5ndGgsIGFuZCBpZiBub3QsIGNoZWNrIGl0IGZpdHNcbiAgICAgIC8vIGFmdGVyIG9mZnNldCBsb2NhdGlvbiAob3IgZGVzaXJlZCBsb2NhdGlvbiBvbiBmaXJzdCBpdGVyYXRpb24pXG4gICAgICBpZiAoc3RhcnQgKyBsb2NhbE9mZnNldCA8PSBtYXhMaW5lKSB7XG4gICAgICAgIHJldHVybiBsb2NhbE9mZnNldDtcbiAgICAgIH1cblxuICAgICAgZm9yd2FyZEV4aGF1c3RlZCA9IHRydWU7XG4gICAgfVxuXG4gICAgaWYgKCFiYWNrd2FyZEV4aGF1c3RlZCkge1xuICAgICAgaWYgKCFmb3J3YXJkRXhoYXVzdGVkKSB7XG4gICAgICAgIHdhbnRGb3J3YXJkID0gdHJ1ZTtcbiAgICAgIH1cblxuICAgICAgLy8gQ2hlY2sgaWYgdHJ5aW5nIHRvIGZpdCBiZWZvcmUgdGV4dCBiZWdpbm5pbmcsIGFuZCBpZiBub3QsIGNoZWNrIGl0IGZpdHNcbiAgICAgIC8vIGJlZm9yZSBvZmZzZXQgbG9jYXRpb25cbiAgICAgIGlmIChtaW5MaW5lIDw9IHN0YXJ0IC0gbG9jYWxPZmZzZXQpIHtcbiAgICAgICAgcmV0dXJuIC1sb2NhbE9mZnNldCsrO1xuICAgICAgfVxuXG4gICAgICBiYWNrd2FyZEV4aGF1c3RlZCA9IHRydWU7XG4gICAgICByZXR1cm4gaXRlcmF0b3IoKTtcbiAgICB9XG5cbiAgICAvLyBXZSB0cmllZCB0byBmaXQgaHVuayBiZWZvcmUgdGV4dCBiZWdpbm5pbmcgYW5kIGJleW9uZCB0ZXh0IGxlbmd0aCwgdGhlblxuICAgIC8vIGh1bmsgY2FuJ3QgZml0IG9uIHRoZSB0ZXh0LiBSZXR1cm4gdW5kZWZpbmVkXG4gIH07XG59XG4iXX0=
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/util/params.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/util/params.js
new file mode 100644
index 00000000000..6ff04832a63
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/lib/util/params.js
@@ -0,0 +1,18 @@
+/*istanbul ignore start*/'use strict';
+
+exports.__esModule = true;
+exports. /*istanbul ignore end*/generateOptions = generateOptions;
+function generateOptions(options, defaults) {
+  if (typeof options === 'function') {
+    defaults.callback = options;
+  } else if (options) {
+    for (var name in options) {
+      /* istanbul ignore else */
+      if (options.hasOwnProperty(name)) {
+        defaults[name] = options[name];
+      }
+    }
+  }
+  return defaults;
+}
+//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIi4uLy4uL3NyYy91dGlsL3BhcmFtcy5qcyJdLCJuYW1lcyI6WyJnZW5lcmF0ZU9wdGlvbnMiLCJvcHRpb25zIiwiZGVmYXVsdHMiLCJjYWxsYmFjayIsIm5hbWUiLCJoYXNPd25Qcm9wZXJ0eSJdLCJtYXBwaW5ncyI6Ijs7O2dDQUFnQkEsZSxHQUFBQSxlO0FBQVQsU0FBU0EsZUFBVCxDQUF5QkMsT0FBekIsRUFBa0NDLFFBQWxDLEVBQTRDO0FBQ2pELE1BQUksT0FBT0QsT0FBUCxLQUFtQixVQUF2QixFQUFtQztBQUNqQ0MsYUFBU0MsUUFBVCxHQUFvQkYsT0FBcEI7QUFDRCxHQUZELE1BRU8sSUFBSUEsT0FBSixFQUFhO0FBQ2xCLFNBQUssSUFBSUcsSUFBVCxJQUFpQkgsT0FBakIsRUFBMEI7QUFDeEI7QUFDQSxVQUFJQSxRQUFRSSxjQUFSLENBQXVCRCxJQUF2QixDQUFKLEVBQWtDO0FBQ2hDRixpQkFBU0UsSUFBVCxJQUFpQkgsUUFBUUcsSUFBUixDQUFqQjtBQUNEO0FBQ0Y7QUFDRjtBQUNELFNBQU9GLFFBQVA7QUFDRCIsImZpbGUiOiJwYXJhbXMuanMiLCJzb3VyY2VzQ29udGVudCI6WyJleHBvcnQgZnVuY3Rpb24gZ2VuZXJhdGVPcHRpb25zKG9wdGlvbnMsIGRlZmF1bHRzKSB7XG4gIGlmICh0eXBlb2Ygb3B0aW9ucyA9PT0gJ2Z1bmN0aW9uJykge1xuICAgIGRlZmF1bHRzLmNhbGxiYWNrID0gb3B0aW9ucztcbiAgfSBlbHNlIGlmIChvcHRpb25zKSB7XG4gICAgZm9yIChsZXQgbmFtZSBpbiBvcHRpb25zKSB7XG4gICAgICAvKiBpc3RhbmJ1bCBpZ25vcmUgZWxzZSAqL1xuICAgICAgaWYgKG9wdGlvbnMuaGFzT3duUHJvcGVydHkobmFtZSkpIHtcbiAgICAgICAgZGVmYXVsdHNbbmFtZV0gPSBvcHRpb25zW25hbWVdO1xuICAgICAgfVxuICAgIH1cbiAgfVxuICByZXR1cm4gZGVmYXVsdHM7XG59XG4iXX0=
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/package.json b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/package.json
new file mode 100644
index 00000000000..7a23d557570
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/package.json
@@ -0,0 +1,67 @@
+{
+  "browser": "./dist/diff.js", 
+  "bugs": {
+    "email": "kpdecker@gmail.com", 
+    "url": "http://github.com/kpdecker/jsdiff/issues"
+  }, 
+  "dependencies": {}, 
+  "description": "A javascript text diff implementation.", 
+  "devDependencies": {
+    "async": "^1.4.2", 
+    "babel-core": "^6.0.0", 
+    "babel-loader": "^6.0.0", 
+    "babel-preset-es2015-mod": "^6.3.13", 
+    "babel-preset-es3": "^1.0.1", 
+    "chai": "^3.3.0", 
+    "colors": "^1.1.2", 
+    "eslint": "^1.6.0", 
+    "grunt": "^0.4.5", 
+    "grunt-babel": "^6.0.0", 
+    "grunt-clean": "^0.4.0", 
+    "grunt-cli": "^0.1.13", 
+    "grunt-contrib-clean": "^1.0.0", 
+    "grunt-contrib-copy": "^1.0.0", 
+    "grunt-contrib-uglify": "^1.0.0", 
+    "grunt-contrib-watch": "^1.0.0", 
+    "grunt-eslint": "^17.3.1", 
+    "grunt-karma": "^0.12.1", 
+    "grunt-mocha-istanbul": "^3.0.1", 
+    "grunt-mocha-test": "^0.12.7", 
+    "grunt-webpack": "^1.0.11", 
+    "istanbul": "github:kpdecker/istanbul", 
+    "karma": "^0.13.11", 
+    "karma-mocha": "^0.2.0", 
+    "karma-mocha-reporter": "^2.0.0", 
+    "karma-phantomjs-launcher": "^1.0.0", 
+    "karma-sauce-launcher": "^0.3.0", 
+    "karma-sourcemap-loader": "^0.3.6", 
+    "karma-webpack": "^1.7.0", 
+    "mocha": "^2.3.3", 
+    "phantomjs-prebuilt": "^2.1.5", 
+    "semver": "^5.0.3", 
+    "webpack": "^1.12.2", 
+    "webpack-dev-server": "^1.12.0"
+  }, 
+  "engines": {
+    "node": ">=0.3.1"
+  }, 
+  "keywords": [
+    "diff", 
+    "javascript"
+  ], 
+  "license": "BSD-3-Clause", 
+  "main": "./lib", 
+  "maintainers": [
+    "Kevin Decker <kpdecker@gmail.com> (http://incaseofstairs.com)"
+  ], 
+  "name": "diff", 
+  "optionalDependencies": {}, 
+  "repository": {
+    "type": "git", 
+    "url": "git://github.com/kpdecker/jsdiff.git"
+  }, 
+  "scripts": {
+    "test": "grunt"
+  }, 
+  "version": "3.5.0"
+}
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/release-notes.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/release-notes.md
new file mode 100644
index 00000000000..0116a2b73f5
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/release-notes.md
@@ -0,0 +1,247 @@
+# Release Notes
+
+## Development
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.5.0...master)
+
+## v3.5.0 - March 4th, 2018
+- Omit redundant slice in join method of diffArrays - 1023590
+- Support patches with empty lines - fb0f208
+- Accept a custom JSON replacer function for JSON diffing - 69c7f0a
+- Optimize parch header parser - 2aec429
+- Fix typos - e89c832
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.5.0...v3.5.0)
+
+## v3.5.0 - March 4th, 2018
+- Omit redundant slice in join method of diffArrays - 1023590
+- Support patches with empty lines - fb0f208
+- Accept a custom JSON replacer function for JSON diffing - 69c7f0a
+- Optimize parch header parser - 2aec429
+- Fix typos - e89c832
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.4.0...v3.5.0)
+
+## v3.4.0 - October 7th, 2017
+- [#183](https://github.com/kpdecker/jsdiff/issues/183) - Feature request: ability to specify a custom equality checker for `diffArrays`
+- [#173](https://github.com/kpdecker/jsdiff/issues/173) - Bug: diffArrays gives wrong result on array of booleans
+- [#158](https://github.com/kpdecker/jsdiff/issues/158) - diffArrays will not compare the empty string in array?
+- comparator for custom equality checks - 30e141e
+- count oldLines and newLines when there are conflicts - 53bf384
+- Fix: diffArrays can compare falsey items - 9e24284
+- Docs: Replace grunt with npm test - 00e2f94
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.3.1...v3.4.0)
+
+## v3.3.1 - September 3rd, 2017
+- [#141](https://github.com/kpdecker/jsdiff/issues/141) - Cannot apply patch because my file delimiter is "/r/n" instead of "/n"
+- [#192](https://github.com/kpdecker/jsdiff/pull/192) - Fix: Bad merge when adding new files (#189)
+- correct spelling mistake - 21fa478
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.3.0...v3.3.1)
+
+## v3.3.0 - July 5th, 2017
+- [#114](https://github.com/kpdecker/jsdiff/issues/114) - /patch/merge not exported
+- Gracefully accept invalid newStart in hunks, same as patch(1) does. - d8a3635
+- Use regex rather than starts/ends with for parsePatch - 6cab62c
+- Add browser flag - e64f674
+- refactor: simplified code a bit more - 8f8e0f2
+- refactor: simplified code a bit - b094a6f
+- fix: some corrections re ignoreCase option - 3c78fd0
+- ignoreCase option - 3cbfbb5
+- Sanitize filename while parsing patches - 2fe8129
+- Added better installation methods - aced50b
+- Simple export of functionality - 8690f31
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.2.0...v3.3.0)
+
+## v3.2.0 - December 26th, 2016
+- [#156](https://github.com/kpdecker/jsdiff/pull/156) - Add `undefinedReplacement` option to `diffJson` ([@ewnd9](https://api.github.com/users/ewnd9))
+- [#154](https://github.com/kpdecker/jsdiff/pull/154) - Add `examples` and `images` to `.npmignore`. ([@wtgtybhertgeghgtwtg](https://api.github.com/users/wtgtybhertgeghgtwtg))
+- [#153](https://github.com/kpdecker/jsdiff/pull/153) - feat(structuredPatch): Pass options to diffLines ([@Kiougar](https://api.github.com/users/Kiougar))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.1.0...v3.2.0)
+
+## v3.1.0 - November 27th, 2016
+- [#146](https://github.com/kpdecker/jsdiff/pull/146) - JsDiff.diffArrays to compare arrays ([@wvanderdeijl](https://api.github.com/users/wvanderdeijl))
+- [#144](https://github.com/kpdecker/jsdiff/pull/144) - Split file using all possible line delimiter instead of hard-coded "/n" and join lines back using the original delimiters ([@soulbeing](https://api.github.com/users/soulbeing))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.0.1...v3.1.0)
+
+## v3.0.1 - October 9th, 2016
+- [#139](https://github.com/kpdecker/jsdiff/pull/139) - Make README.md look nicer in npmjs.com ([@takenspc](https://api.github.com/users/takenspc))
+- [#135](https://github.com/kpdecker/jsdiff/issues/135) - parsePatch combines patches from multiple files into a single IUniDiff when there is no "Index" line ([@ramya-rao-a](https://api.github.com/users/ramya-rao-a))
+- [#124](https://github.com/kpdecker/jsdiff/issues/124) - IE7/IE8 failure since 2.0.0 ([@boneskull](https://api.github.com/users/boneskull))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v3.0.0...v3.0.1)
+
+## v3.0.0 - August 23rd, 2016
+- [#130](https://github.com/kpdecker/jsdiff/pull/130) - Add callback argument to applyPatches `patched` option ([@piranna](https://api.github.com/users/piranna))
+- [#120](https://github.com/kpdecker/jsdiff/pull/120) - Correctly handle file names containing spaces ([@adius](https://api.github.com/users/adius))
+- [#119](https://github.com/kpdecker/jsdiff/pull/119) - Do single reflow ([@wifiextender](https://api.github.com/users/wifiextender))
+- [#117](https://github.com/kpdecker/jsdiff/pull/117) - Make more usable with long strings. ([@abnbgist](https://api.github.com/users/abnbgist))
+
+Compatibility notes:
+- applyPatches patch callback now is async and requires the callback be called to continue operation
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.3...v3.0.0)
+
+## v2.2.3 - May 31st, 2016
+- [#118](https://github.com/kpdecker/jsdiff/pull/118) - Add a fix for applying 0-length destination patches ([@chaaz](https://api.github.com/users/chaaz))
+- [#115](https://github.com/kpdecker/jsdiff/pull/115) - Fixed grammar in README ([@krizalys](https://api.github.com/users/krizalys))
+- [#113](https://github.com/kpdecker/jsdiff/pull/113) - fix typo ([@vmazare](https://api.github.com/users/vmazare))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.2...v2.2.3)
+
+## v2.2.2 - March 13th, 2016
+- [#102](https://github.com/kpdecker/jsdiff/issues/102) - diffJson with dates, returns empty curly braces  ([@dr-dimitru](https://api.github.com/users/dr-dimitru))
+- [#97](https://github.com/kpdecker/jsdiff/issues/97) - Whitespaces & diffWords ([@faiwer](https://api.github.com/users/faiwer))
+- [#92](https://github.com/kpdecker/jsdiff/pull/92) - Fixes typo in the readme ([@bg451](https://api.github.com/users/bg451))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.1...v2.2.2)
+
+## v2.2.1 - November 12th, 2015
+- [#89](https://github.com/kpdecker/jsdiff/pull/89) - add in display selector to readme ([@FranDias](https://api.github.com/users/FranDias))
+- [#88](https://github.com/kpdecker/jsdiff/pull/88) - Split diffs based on file headers instead of 'Index:' metadata ([@piranna](https://api.github.com/users/piranna))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.0...v2.2.1)
+
+## v2.2.0 - October 29th, 2015
+- [#80](https://github.com/kpdecker/jsdiff/pull/80) - Fix a typo: applyPath ->  applyPatch ([@fluxxu](https://api.github.com/users/fluxxu))
+- [#83](https://github.com/kpdecker/jsdiff/pull/83) - Add basic fuzzy matching to applyPatch ([@piranna](https://github.com/piranna))
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.2.0...v2.2.0)
+
+## v2.2.0 - October 29th, 2015
+- [#80](https://github.com/kpdecker/jsdiff/pull/80) - Fix a typo: applyPath ->  applyPatch ([@fluxxu](https://api.github.com/users/fluxxu))
+- [#83](https://github.com/kpdecker/jsdiff/pull/83) - Add basic fuzzy matching to applyPatch ([@piranna](https://github.com/piranna))
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.1.3...v2.2.0)
+
+## v2.1.3 - September 30th, 2015
+- [#78](https://github.com/kpdecker/jsdiff/pull/78) - fix: error throwing when apply patch to empty string ([@21paradox](https://api.github.com/users/21paradox))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.1.2...v2.1.3)
+
+## v2.1.2 - September 23rd, 2015
+- [#76](https://github.com/kpdecker/jsdiff/issues/76) - diff headers give error ([@piranna](https://api.github.com/users/piranna))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.1.1...v2.1.2)
+
+## v2.1.1 - September 9th, 2015
+- [#73](https://github.com/kpdecker/jsdiff/issues/73) - Is applyPatches() exposed in the API? ([@davidparsson](https://api.github.com/users/davidparsson))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.1.0...v2.1.1)
+
+## v2.1.0 - August 27th, 2015
+- [#72](https://github.com/kpdecker/jsdiff/issues/72) - Consider using options object API for flag permutations ([@kpdecker](https://api.github.com/users/kpdecker))
+- [#70](https://github.com/kpdecker/jsdiff/issues/70) - diffWords treats \n at the end as significant whitespace ([@nesQuick](https://api.github.com/users/nesQuick))
+- [#69](https://github.com/kpdecker/jsdiff/issues/69) - Missing count ([@wfalkwallace](https://api.github.com/users/wfalkwallace))
+- [#68](https://github.com/kpdecker/jsdiff/issues/68) - diffLines seems broken ([@wfalkwallace](https://api.github.com/users/wfalkwallace))
+- [#60](https://github.com/kpdecker/jsdiff/issues/60) - Support multiple diff hunks ([@piranna](https://api.github.com/users/piranna))
+- [#54](https://github.com/kpdecker/jsdiff/issues/54) - Feature Request: 3-way merge ([@mog422](https://api.github.com/users/mog422))
+- [#42](https://github.com/kpdecker/jsdiff/issues/42) - Fuzz factor for applyPatch ([@stuartpb](https://api.github.com/users/stuartpb))
+- Move whitespace ignore out of equals method - 542063c
+- Include source maps in babel output - 7f7ab21
+- Merge diff/line and diff/patch implementations - 1597705
+- Drop map utility method - 1ddc939
+- Documentation for parsePatch and applyPatches - 27c4b77
+
+Compatibility notes:
+- The undocumented ignoreWhitespace flag has been removed from the Diff equality check directly. This implementation may be copied to diff utilities if dependencies existed on this functionality.
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.0.2...v2.1.0)
+
+## v2.0.2 - August 8th, 2015
+- [#67](https://github.com/kpdecker/jsdiff/issues/67) - cannot require from npm module in node ([@commenthol](https://api.github.com/users/commenthol))
+- Convert to chai since we don’t support IE8 - a96bbad
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.0.1...v2.0.2)
+
+## v2.0.1 - August 7th, 2015
+- Add release build at proper step - 57542fd
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v2.0.0...v2.0.1)
+
+## v2.0.0 - August 7th, 2015
+- [#66](https://github.com/kpdecker/jsdiff/issues/66) - Add karma and sauce tests ([@kpdecker](https://api.github.com/users/kpdecker))
+- [#65](https://github.com/kpdecker/jsdiff/issues/65) - Create component repository for bower ([@kpdecker](https://api.github.com/users/kpdecker))
+- [#64](https://github.com/kpdecker/jsdiff/issues/64) - Automatically call removeEmpty for all tokenizer calls ([@kpdecker](https://api.github.com/users/kpdecker))
+- [#62](https://github.com/kpdecker/jsdiff/pull/62) - Allow access to structured object representation of patch data ([@bittrance](https://api.github.com/users/bittrance))
+- [#61](https://github.com/kpdecker/jsdiff/pull/61) - Use svg instead of png to get better image quality ([@PeterDaveHello](https://api.github.com/users/PeterDaveHello))
+- [#29](https://github.com/kpdecker/jsdiff/issues/29) - word tokenizer works only for 7 bit ascii ([@plasmagunman](https://api.github.com/users/plasmagunman))
+
+Compatibility notes:
+- `this.removeEmpty` is now called automatically for all instances. If this is not desired, this may be overridden on a per instance basis.
+- The library has been refactored to use some ES6 features. The external APIs should remain the same, but bower projects that directly referenced the repository will now have to point to the [components/jsdiff](https://github.com/components/jsdiff) repository.
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.4.0...v2.0.0)
+
+## v1.4.0 - May 6th, 2015
+- [#57](https://github.com/kpdecker/jsdiff/issues/57) - createPatch -> applyPatch failed. ([@mog422](https://api.github.com/users/mog422))
+- [#56](https://github.com/kpdecker/jsdiff/pull/56) - Two files patch ([@rgeissert](https://api.github.com/users/rgeissert))
+- [#14](https://github.com/kpdecker/jsdiff/issues/14) - Flip added and removed order? ([@jakesandlund](https://api.github.com/users/jakesandlund))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.3.2...v1.4.0)
+
+## v1.3.2 - March 30th, 2015
+- [#53](https://github.com/kpdecker/jsdiff/pull/53) - Updated README.MD with Bower installation instructions ([@ofbriggs](https://api.github.com/users/ofbriggs))
+- [#49](https://github.com/kpdecker/jsdiff/issues/49) - Cannot read property 'oldlines' of undefined ([@nwtn](https://api.github.com/users/nwtn))
+- [#44](https://github.com/kpdecker/jsdiff/issues/44) - invalid-meta jsdiff is missing "main" entry in bower.json
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.3.1...v1.3.2)
+
+## v1.3.1 - March 13th, 2015
+- [#52](https://github.com/kpdecker/jsdiff/pull/52) - Fix for #51 Wrong result of JsDiff.diffLines ([@felicienfrancois](https://api.github.com/users/felicienfrancois))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.3.0...v1.3.1)
+
+## v1.3.0 - March 2nd, 2015
+- [#47](https://github.com/kpdecker/jsdiff/pull/47) - Adding Diff Trimmed Lines ([@JamesGould123](https://api.github.com/users/JamesGould123))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.2.2...v1.3.0)
+
+## v1.2.2 - January 26th, 2015
+- [#45](https://github.com/kpdecker/jsdiff/pull/45) - Fix AMD module loading ([@pedrocarrico](https://api.github.com/users/pedrocarrico))
+- [#43](https://github.com/kpdecker/jsdiff/pull/43) - added a bower file ([@nbrustein](https://api.github.com/users/nbrustein))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.2.1...v1.2.2)
+
+## v1.2.1 - December 26th, 2014
+- [#41](https://github.com/kpdecker/jsdiff/pull/41) - change condition of using node export system. ([@ironhee](https://api.github.com/users/ironhee))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.2.0...v1.2.1)
+
+## v1.2.0 - November 29th, 2014
+- [#37](https://github.com/kpdecker/jsdiff/pull/37) - Add support for sentences. ([@vmariano](https://api.github.com/users/vmariano))
+- [#28](https://github.com/kpdecker/jsdiff/pull/28) - Implemented diffJson ([@papandreou](https://api.github.com/users/papandreou))
+- [#27](https://github.com/kpdecker/jsdiff/issues/27) - Slow to execute over diffs with a large number of changes ([@termi](https://api.github.com/users/termi))
+- Allow for optional async diffing - 19385b9
+- Fix diffChars implementation - eaa44ed
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.1.0...v1.2.0)
+
+## v1.1.0 - November 25th, 2014
+- [#33](https://github.com/kpdecker/jsdiff/pull/33) - AMD and global exports ([@ovcharik](https://api.github.com/users/ovcharik))
+- [#32](https://github.com/kpdecker/jsdiff/pull/32) - Add support for component ([@vmariano](https://api.github.com/users/vmariano))
+- [#31](https://github.com/kpdecker/jsdiff/pull/31) - Don't rely on Array.prototype.map ([@papandreou](https://api.github.com/users/papandreou))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.0.8...v1.1.0)
+
+## v1.0.8 - December 22nd, 2013
+- [#24](https://github.com/kpdecker/jsdiff/pull/24) - Handle windows newlines on non windows machines. ([@benogle](https://api.github.com/users/benogle))
+- [#23](https://github.com/kpdecker/jsdiff/pull/23) - Prettied up the API formatting a little, and added basic node and web examples ([@airportyh](https://api.github.com/users/airportyh))
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.0.7...v1.0.8)
+
+## v1.0.7 - September 11th, 2013
+
+- [#22](https://github.com/kpdecker/jsdiff/pull/22) - Added variant of WordDiff that doesn't ignore whitespace differences ([@papandreou](https://api.github.com/users/papandreou)
+
+- Add 0.10 to travis tests - 243a526
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.0.6...v1.0.7)
+
+## v1.0.6 - August 30th, 2013
+
+- [#19](https://github.com/kpdecker/jsdiff/pull/19) - Explicitly define contents of npm package ([@sindresorhus](https://api.github.com/users/sindresorhus)
+
+[Commits](https://github.com/kpdecker/jsdiff/compare/v1.0.5...v1.0.6)
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/runtime.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/runtime.js
new file mode 100644
index 00000000000..fd8ca6ea249
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/runtime.js
@@ -0,0 +1,3 @@
+require('babel-core/register')({
+  ignore: /\/lib\/|\/node_modules\//
+});
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/yarn.lock b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/yarn.lock
new file mode 100644
index 00000000000..29e3ab317ef
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/diff/yarn.lock
@@ -0,0 +1,5729 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+abbrev@1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.1.1.tgz#f8f2c887ad10bf67f634f005b6987fed3179aac8"
+
+abbrev@1.0.x:
+  version "1.0.9"
+  resolved "https://registry.yarnpkg.com/abbrev/-/abbrev-1.0.9.tgz#91b4792588a7738c25f35dd6f63752a2f8776135"
+
+accepts@1.3.3:
+  version "1.3.3"
+  resolved "https://registry.yarnpkg.com/accepts/-/accepts-1.3.3.tgz#c3ca7434938648c3e0d9c1e328dd68b622c284ca"
+  dependencies:
+    mime-types "~2.1.11"
+    negotiator "0.6.1"
+
+accepts@~1.3.4:
+  version "1.3.5"
+  resolved "https://registry.yarnpkg.com/accepts/-/accepts-1.3.5.tgz#eb777df6011723a3b14e8a72c0805c8e86746bd2"
+  dependencies:
+    mime-types "~2.1.18"
+    negotiator "0.6.1"
+
+acorn@^3.0.0:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/acorn/-/acorn-3.3.0.tgz#45e37fb39e8da3f25baee3ff5369e2bb5f22017a"
+
+adm-zip@~0.4.3:
+  version "0.4.7"
+  resolved "https://registry.yarnpkg.com/adm-zip/-/adm-zip-0.4.7.tgz#8606c2cbf1c426ce8c8ec00174447fd49b6eafc1"
+
+after@0.8.2:
+  version "0.8.2"
+  resolved "https://registry.yarnpkg.com/after/-/after-0.8.2.tgz#fedb394f9f0e02aa9768e702bda23b505fae7e1f"
+
+agent-base@2:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/agent-base/-/agent-base-2.1.1.tgz#d6de10d5af6132d5bd692427d46fc538539094c7"
+  dependencies:
+    extend "~3.0.0"
+    semver "~5.0.1"
+
+ajv@^4.9.1:
+  version "4.11.8"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-4.11.8.tgz#82ffb02b29e662ae53bdc20af15947706739c536"
+  dependencies:
+    co "^4.6.0"
+    json-stable-stringify "^1.0.1"
+
+ajv@^5.1.0:
+  version "5.5.2"
+  resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.5.2.tgz#73b5eeca3fab653e3d3f9422b341ad42205dc965"
+  dependencies:
+    co "^4.6.0"
+    fast-deep-equal "^1.0.0"
+    fast-json-stable-stringify "^2.0.0"
+    json-schema-traverse "^0.3.0"
+
+align-text@^0.1.1, align-text@^0.1.3:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/align-text/-/align-text-0.1.4.tgz#0cd90a561093f35d0a99256c22b7069433fad117"
+  dependencies:
+    kind-of "^3.0.2"
+    longest "^1.0.1"
+    repeat-string "^1.5.2"
+
+amdefine@>=0.0.4:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/amdefine/-/amdefine-1.0.1.tgz#4a5282ac164729e93619bcfd3ad151f817ce91f5"
+
+ansi-escapes@^1.1.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-1.4.0.tgz#d3a8a83b319aa67793662b13e761c7911422306e"
+
+ansi-regex@^2.0.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-2.1.1.tgz#c3b33ab5ee360d86e0e628f0468ae7ef27d654df"
+
+ansi-regex@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-3.0.0.tgz#ed0317c322064f79466c02966bddb605ab37d998"
+
+ansi-styles@^2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-2.2.1.tgz#b432dd3358b634cf75e1e4664368240533c1ddbe"
+
+ansi-styles@^3.2.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d"
+  dependencies:
+    color-convert "^1.9.0"
+
+anymatch@^1.3.0:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-1.3.2.tgz#553dcb8f91e3c889845dfdba34c77721b90b9d7a"
+  dependencies:
+    micromatch "^2.1.5"
+    normalize-path "^2.0.0"
+
+append-transform@^0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/append-transform/-/append-transform-0.4.0.tgz#d76ebf8ca94d276e247a36bad44a4b74ab611991"
+  dependencies:
+    default-require-extensions "^1.0.0"
+
+aproba@^1.0.3:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/aproba/-/aproba-1.2.0.tgz#6802e6264efd18c790a1b0d517f0f2627bf2c94a"
+
+archiver@~0.14.0:
+  version "0.14.4"
+  resolved "https://registry.yarnpkg.com/archiver/-/archiver-0.14.4.tgz#5b9ddb9f5ee1ceef21cb8f3b020e6240ecb4315c"
+  dependencies:
+    async "~0.9.0"
+    buffer-crc32 "~0.2.1"
+    glob "~4.3.0"
+    lazystream "~0.1.0"
+    lodash "~3.2.0"
+    readable-stream "~1.0.26"
+    tar-stream "~1.1.0"
+    zip-stream "~0.5.0"
+
+archy@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/archy/-/archy-1.0.0.tgz#f9c8c13757cc1dd7bc379ac77b2c62a5c2868c40"
+
+are-we-there-yet@~1.1.2:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/are-we-there-yet/-/are-we-there-yet-1.1.4.tgz#bb5dca382bb94f05e15194373d16fd3ba1ca110d"
+  dependencies:
+    delegates "^1.0.0"
+    readable-stream "^2.0.6"
+
+argparse@^1.0.2, argparse@^1.0.7:
+  version "1.0.10"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911"
+  dependencies:
+    sprintf-js "~1.0.2"
+
+"argparse@~ 0.1.11":
+  version "0.1.16"
+  resolved "https://registry.yarnpkg.com/argparse/-/argparse-0.1.16.tgz#cfd01e0fbba3d6caed049fbd758d40f65196f57c"
+  dependencies:
+    underscore "~1.7.0"
+    underscore.string "~2.4.0"
+
+arr-diff@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/arr-diff/-/arr-diff-2.0.0.tgz#8f3b827f955a8bd669697e4a4256ac3ceae356cf"
+  dependencies:
+    arr-flatten "^1.0.1"
+
+arr-flatten@^1.0.1:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.1.0.tgz#36048bbff4e7b47e136644316c99669ea5ae91f1"
+
+array-find-index@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/array-find-index/-/array-find-index-1.0.2.tgz#df010aa1287e164bbda6f9723b0a96a1ec4187a1"
+
+array-flatten@1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/array-flatten/-/array-flatten-1.1.1.tgz#9a5f699051b1e7073328f2a008968b64ea2955d2"
+
+array-slice@^0.2.3:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/array-slice/-/array-slice-0.2.3.tgz#dd3cfb80ed7973a75117cdac69b0b99ec86186f5"
+
+array-union@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/array-union/-/array-union-1.0.2.tgz#9a34410e4f4e3da23dea375be5be70f24778ec39"
+  dependencies:
+    array-uniq "^1.0.1"
+
+array-uniq@^1.0.1:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/array-uniq/-/array-uniq-1.0.3.tgz#af6ac877a25cc7f74e058894753858dfdb24fdb6"
+
+array-unique@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.2.1.tgz#a1d97ccafcbc2625cc70fadceb36a50c58b01a53"
+
+arraybuffer.slice@0.0.6:
+  version "0.0.6"
+  resolved "https://registry.yarnpkg.com/arraybuffer.slice/-/arraybuffer.slice-0.0.6.tgz#f33b2159f0532a3f3107a272c0ccfbd1ad2979ca"
+
+arrify@^1.0.0, arrify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/arrify/-/arrify-1.0.1.tgz#898508da2226f380df904728456849c1501a4b0d"
+
+asn1@0.1.11:
+  version "0.1.11"
+  resolved "https://registry.yarnpkg.com/asn1/-/asn1-0.1.11.tgz#559be18376d08a4ec4dbe80877d27818639b2df7"
+
+asn1@~0.2.3:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/asn1/-/asn1-0.2.3.tgz#dac8787713c9966849fc8180777ebe9c1ddf3b86"
+
+assert-plus@1.0.0, assert-plus@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-1.0.0.tgz#f12e0f3c5d77b0b1cdd9146942e4e96c1e4dd525"
+
+assert-plus@^0.1.5:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-0.1.5.tgz#ee74009413002d84cec7219c6ac811812e723160"
+
+assert-plus@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/assert-plus/-/assert-plus-0.2.0.tgz#d74e1b87e7affc0db8aadb7021f3fe48101ab234"
+
+assert@^1.1.1:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/assert/-/assert-1.4.1.tgz#99912d591836b5a6f5b345c0f07eefc08fc65d91"
+  dependencies:
+    util "0.10.3"
+
+assertion-error@^1.0.1:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/assertion-error/-/assertion-error-1.1.0.tgz#e60b6b0e8f301bd97e5375215bda406c85118c0b"
+
+async-each@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/async-each/-/async-each-1.0.1.tgz#19d386a1d9edc6e7c1c85d388aedbcc56d33602d"
+
+async@0.1.x, async@~0.1.18, async@~0.1.22:
+  version "0.1.22"
+  resolved "https://registry.yarnpkg.com/async/-/async-0.1.22.tgz#0fc1aaa088a0e3ef0ebe2d8831bab0dcf8845061"
+
+async@1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/async/-/async-1.4.0.tgz#35f86f83c59e0421d099cd9a91d8278fb578c00d"
+
+async@1.x, async@^1.3.0, async@^1.4.0, async@^1.4.2, async@^1.5.0, async@^1.5.2:
+  version "1.5.2"
+  resolved "https://registry.yarnpkg.com/async/-/async-1.5.2.tgz#ec6a61ae56480c0c3cb241c95618e20892f9672a"
+
+async@^0.9.0, async@~0.9.0:
+  version "0.9.2"
+  resolved "https://registry.yarnpkg.com/async/-/async-0.9.2.tgz#aea74d5e61c1f899613bf64bda66d4c78f2fd17d"
+
+async@~0.2.6:
+  version "0.2.10"
+  resolved "https://registry.yarnpkg.com/async/-/async-0.2.10.tgz#b6bbe0b0674b9d719708ca38de8c237cb526c3d1"
+
+async@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/async/-/async-1.0.0.tgz#f8fc04ca3a13784ade9e1641af98578cfbd647a9"
+
+asynckit@^0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/asynckit/-/asynckit-0.4.0.tgz#c79ed97f7f34cb8f2ba1bc9790bcc366474b4b79"
+
+aws-sign2@~0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.5.0.tgz#c57103f7a17fc037f02d7c2e64b602ea223f7d63"
+
+aws-sign2@~0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.6.0.tgz#14342dd38dbcc94d0e5b87d763cd63612c0e794f"
+
+aws-sign2@~0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/aws-sign2/-/aws-sign2-0.7.0.tgz#b46e890934a9591f2d2f6f86d7e6a9f1b3fe76a8"
+
+aws4@^1.2.1, aws4@^1.6.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/aws4/-/aws4-1.6.0.tgz#83ef5ca860b2b32e4a0deedee8c771b9db57471e"
+
+babel-code-frame@^6.26.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-code-frame/-/babel-code-frame-6.26.0.tgz#63fd43f7dc1e3bb7ce35947db8fe369a3f58c74b"
+  dependencies:
+    chalk "^1.1.3"
+    esutils "^2.0.2"
+    js-tokens "^3.0.2"
+
+babel-core@^6.0.0, babel-core@^6.0.12, babel-core@^6.26.0, babel-core@^6.6.5:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-core/-/babel-core-6.26.0.tgz#af32f78b31a6fcef119c87b0fd8d9753f03a0bb8"
+  dependencies:
+    babel-code-frame "^6.26.0"
+    babel-generator "^6.26.0"
+    babel-helpers "^6.24.1"
+    babel-messages "^6.23.0"
+    babel-register "^6.26.0"
+    babel-runtime "^6.26.0"
+    babel-template "^6.26.0"
+    babel-traverse "^6.26.0"
+    babel-types "^6.26.0"
+    babylon "^6.18.0"
+    convert-source-map "^1.5.0"
+    debug "^2.6.8"
+    json5 "^0.5.1"
+    lodash "^4.17.4"
+    minimatch "^3.0.4"
+    path-is-absolute "^1.0.1"
+    private "^0.1.7"
+    slash "^1.0.0"
+    source-map "^0.5.6"
+
+babel-generator@^6.18.0, babel-generator@^6.26.0:
+  version "6.26.1"
+  resolved "https://registry.yarnpkg.com/babel-generator/-/babel-generator-6.26.1.tgz#1844408d3b8f0d35a404ea7ac180f087a601bd90"
+  dependencies:
+    babel-messages "^6.23.0"
+    babel-runtime "^6.26.0"
+    babel-types "^6.26.0"
+    detect-indent "^4.0.0"
+    jsesc "^1.3.0"
+    lodash "^4.17.4"
+    source-map "^0.5.7"
+    trim-right "^1.0.1"
+
+babel-helper-call-delegate@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-call-delegate/-/babel-helper-call-delegate-6.24.1.tgz#ece6aacddc76e41c3461f88bfc575bd0daa2df8d"
+  dependencies:
+    babel-helper-hoist-variables "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-helper-define-map@^6.24.1:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-helper-define-map/-/babel-helper-define-map-6.26.0.tgz#a5f56dab41a25f97ecb498c7ebaca9819f95be5f"
+  dependencies:
+    babel-helper-function-name "^6.24.1"
+    babel-runtime "^6.26.0"
+    babel-types "^6.26.0"
+    lodash "^4.17.4"
+
+babel-helper-function-name@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-function-name/-/babel-helper-function-name-6.24.1.tgz#d3475b8c03ed98242a25b48351ab18399d3580a9"
+  dependencies:
+    babel-helper-get-function-arity "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-helper-get-function-arity@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-get-function-arity/-/babel-helper-get-function-arity-6.24.1.tgz#8f7782aa93407c41d3aa50908f89b031b1b6853d"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-helper-hoist-variables@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-hoist-variables/-/babel-helper-hoist-variables-6.24.1.tgz#1ecb27689c9d25513eadbc9914a73f5408be7a76"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-helper-optimise-call-expression@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-optimise-call-expression/-/babel-helper-optimise-call-expression-6.24.1.tgz#f7a13427ba9f73f8f4fa993c54a97882d1244257"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-helper-regex@^6.24.1:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-helper-regex/-/babel-helper-regex-6.26.0.tgz#325c59f902f82f24b74faceed0363954f6495e72"
+  dependencies:
+    babel-runtime "^6.26.0"
+    babel-types "^6.26.0"
+    lodash "^4.17.4"
+
+babel-helper-replace-supers@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helper-replace-supers/-/babel-helper-replace-supers-6.24.1.tgz#bf6dbfe43938d17369a213ca8a8bf74b6a90ab1a"
+  dependencies:
+    babel-helper-optimise-call-expression "^6.24.1"
+    babel-messages "^6.23.0"
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-helpers@^6.24.1:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-helpers/-/babel-helpers-6.24.1.tgz#3471de9caec388e5c850e597e58a26ddf37602b2"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+
+babel-loader@^6.0.0:
+  version "6.4.1"
+  resolved "https://registry.yarnpkg.com/babel-loader/-/babel-loader-6.4.1.tgz#0b34112d5b0748a8dcdbf51acf6f9bd42d50b8ca"
+  dependencies:
+    find-cache-dir "^0.1.1"
+    loader-utils "^0.2.16"
+    mkdirp "^0.5.1"
+    object-assign "^4.0.1"
+
+babel-messages@^6.23.0:
+  version "6.23.0"
+  resolved "https://registry.yarnpkg.com/babel-messages/-/babel-messages-6.23.0.tgz#f3cdf4703858035b2a2951c6ec5edf6c62f2630e"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-check-es2015-constants@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-check-es2015-constants/-/babel-plugin-check-es2015-constants-6.22.0.tgz#35157b101426fd2ffd3da3f75c7d1e91835bbf8a"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-syntax-async-functions@^6.3.13:
+  version "6.13.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-syntax-async-functions/-/babel-plugin-syntax-async-functions-6.13.0.tgz#cad9cad1191b5ad634bf30ae0872391e0647be95"
+
+babel-plugin-transform-es2015-arrow-functions@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-arrow-functions/-/babel-plugin-transform-es2015-arrow-functions-6.22.0.tgz#452692cb711d5f79dc7f85e440ce41b9f244d221"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-block-scoped-functions@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-block-scoped-functions/-/babel-plugin-transform-es2015-block-scoped-functions-6.22.0.tgz#bbc51b49f964d70cb8d8e0b94e820246ce3a6141"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-block-scoping@^6.6.0, babel-plugin-transform-es2015-block-scoping@^6.6.5:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-block-scoping/-/babel-plugin-transform-es2015-block-scoping-6.26.0.tgz#d70f5299c1308d05c12f463813b0a09e73b1895f"
+  dependencies:
+    babel-runtime "^6.26.0"
+    babel-template "^6.26.0"
+    babel-traverse "^6.26.0"
+    babel-types "^6.26.0"
+    lodash "^4.17.4"
+
+babel-plugin-transform-es2015-classes@^6.6.0:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-classes/-/babel-plugin-transform-es2015-classes-6.24.1.tgz#5a4c58a50c9c9461e564b4b2a3bfabc97a2584db"
+  dependencies:
+    babel-helper-define-map "^6.24.1"
+    babel-helper-function-name "^6.24.1"
+    babel-helper-optimise-call-expression "^6.24.1"
+    babel-helper-replace-supers "^6.24.1"
+    babel-messages "^6.23.0"
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-computed-properties@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-computed-properties/-/babel-plugin-transform-es2015-computed-properties-6.24.1.tgz#6fe2a8d16895d5634f4cd999b6d3480a308159b3"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+
+babel-plugin-transform-es2015-destructuring@^6.6.0:
+  version "6.23.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-destructuring/-/babel-plugin-transform-es2015-destructuring-6.23.0.tgz#997bb1f1ab967f682d2b0876fe358d60e765c56d"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-duplicate-keys@^6.6.0:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-duplicate-keys/-/babel-plugin-transform-es2015-duplicate-keys-6.24.1.tgz#73eb3d310ca969e3ef9ec91c53741a6f1576423e"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-for-of@^6.6.0:
+  version "6.23.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-for-of/-/babel-plugin-transform-es2015-for-of-6.23.0.tgz#f47c95b2b613df1d3ecc2fdb7573623c75248691"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-function-name@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-function-name/-/babel-plugin-transform-es2015-function-name-6.24.1.tgz#834c89853bc36b1af0f3a4c5dbaa94fd8eacaa8b"
+  dependencies:
+    babel-helper-function-name "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-literals@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-literals/-/babel-plugin-transform-es2015-literals-6.22.0.tgz#4f54a02d6cd66cf915280019a31d31925377ca2e"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-modules-commonjs@6.7.7:
+  version "6.7.7"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.7.7.tgz#fa5ca2016617c4d712123d8cfc15787fcaa83f33"
+  dependencies:
+    babel-plugin-transform-strict-mode "^6.6.5"
+    babel-runtime "^5.0.0"
+    babel-template "^6.7.0"
+    babel-types "^6.7.7"
+
+babel-plugin-transform-es2015-modules-commonjs@^6.6.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-modules-commonjs/-/babel-plugin-transform-es2015-modules-commonjs-6.26.0.tgz#0d8394029b7dc6abe1a97ef181e00758dd2e5d8a"
+  dependencies:
+    babel-plugin-transform-strict-mode "^6.24.1"
+    babel-runtime "^6.26.0"
+    babel-template "^6.26.0"
+    babel-types "^6.26.0"
+
+babel-plugin-transform-es2015-object-super@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-object-super/-/babel-plugin-transform-es2015-object-super-6.24.1.tgz#24cef69ae21cb83a7f8603dad021f572eb278f8d"
+  dependencies:
+    babel-helper-replace-supers "^6.24.1"
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-parameters@^6.6.0:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-parameters/-/babel-plugin-transform-es2015-parameters-6.24.1.tgz#57ac351ab49caf14a97cd13b09f66fdf0a625f2b"
+  dependencies:
+    babel-helper-call-delegate "^6.24.1"
+    babel-helper-get-function-arity "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-template "^6.24.1"
+    babel-traverse "^6.24.1"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-shorthand-properties@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-shorthand-properties/-/babel-plugin-transform-es2015-shorthand-properties-6.24.1.tgz#24f875d6721c87661bbd99a4622e51f14de38aa0"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-spread@^6.3.13:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-spread/-/babel-plugin-transform-es2015-spread-6.22.0.tgz#d6d68a99f89aedc4536c81a542e8dd9f1746f8d1"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-sticky-regex@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-sticky-regex/-/babel-plugin-transform-es2015-sticky-regex-6.24.1.tgz#00c1cdb1aca71112cdf0cf6126c2ed6b457ccdbc"
+  dependencies:
+    babel-helper-regex "^6.24.1"
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-plugin-transform-es2015-template-literals@^6.6.0:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-template-literals/-/babel-plugin-transform-es2015-template-literals-6.22.0.tgz#a84b3450f7e9f8f1f6839d6d687da84bb1236d8d"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-typeof-symbol@^6.6.0:
+  version "6.23.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-typeof-symbol/-/babel-plugin-transform-es2015-typeof-symbol-6.23.0.tgz#dec09f1cddff94b52ac73d505c84df59dcceb372"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es2015-unicode-regex@^6.3.13:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es2015-unicode-regex/-/babel-plugin-transform-es2015-unicode-regex-6.24.1.tgz#d38b12f42ea7323f729387f18a7c5ae1faeb35e9"
+  dependencies:
+    babel-helper-regex "^6.24.1"
+    babel-runtime "^6.22.0"
+    regexpu-core "^2.0.0"
+
+babel-plugin-transform-es3-member-expression-literals@^6.8.0:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es3-member-expression-literals/-/babel-plugin-transform-es3-member-expression-literals-6.22.0.tgz#733d3444f3ecc41bef8ed1a6a4e09657b8969ebb"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-es3-property-literals@^6.8.0:
+  version "6.22.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-es3-property-literals/-/babel-plugin-transform-es3-property-literals-6.22.0.tgz#b2078d5842e22abf40f73e8cde9cd3711abd5758"
+  dependencies:
+    babel-runtime "^6.22.0"
+
+babel-plugin-transform-regenerator@6.6.5:
+  version "6.6.5"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-regenerator/-/babel-plugin-transform-regenerator-6.6.5.tgz#079a982bd56e2235e31ee3b17ad54aeba898d4e7"
+  dependencies:
+    babel-core "^6.6.5"
+    babel-plugin-syntax-async-functions "^6.3.13"
+    babel-plugin-transform-es2015-block-scoping "^6.6.5"
+    babel-plugin-transform-es2015-for-of "^6.6.0"
+    babel-runtime "^5.0.0"
+    babel-traverse "^6.6.5"
+    babel-types "^6.6.5"
+    babylon "^6.6.5"
+    private "~0.1.5"
+
+babel-plugin-transform-regenerator@^6.6.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-regenerator/-/babel-plugin-transform-regenerator-6.26.0.tgz#e0703696fbde27f0a3efcacf8b4dca2f7b3a8f2f"
+  dependencies:
+    regenerator-transform "^0.10.0"
+
+babel-plugin-transform-strict-mode@^6.24.1, babel-plugin-transform-strict-mode@^6.6.5:
+  version "6.24.1"
+  resolved "https://registry.yarnpkg.com/babel-plugin-transform-strict-mode/-/babel-plugin-transform-strict-mode-6.24.1.tgz#d5faf7aa578a65bbe591cf5edae04a0c67020758"
+  dependencies:
+    babel-runtime "^6.22.0"
+    babel-types "^6.24.1"
+
+babel-preset-es2015-mod@^6.3.13:
+  version "6.6.0"
+  resolved "https://registry.yarnpkg.com/babel-preset-es2015-mod/-/babel-preset-es2015-mod-6.6.0.tgz#e105b62eb7c1001090ab86225298904cf90c1e8e"
+  dependencies:
+    babel-plugin-transform-es2015-modules-commonjs "6.7.7"
+    babel-plugin-transform-regenerator "6.6.5"
+    babel-preset-es2015 "6.6.0"
+    modify-babel-preset "2.0.2"
+
+babel-preset-es2015@6.6.0:
+  version "6.6.0"
+  resolved "https://registry.yarnpkg.com/babel-preset-es2015/-/babel-preset-es2015-6.6.0.tgz#88b33e58fec94c6ebde58dc65ece5d14e0ec2568"
+  dependencies:
+    babel-plugin-check-es2015-constants "^6.3.13"
+    babel-plugin-transform-es2015-arrow-functions "^6.3.13"
+    babel-plugin-transform-es2015-block-scoped-functions "^6.3.13"
+    babel-plugin-transform-es2015-block-scoping "^6.6.0"
+    babel-plugin-transform-es2015-classes "^6.6.0"
+    babel-plugin-transform-es2015-computed-properties "^6.3.13"
+    babel-plugin-transform-es2015-destructuring "^6.6.0"
+    babel-plugin-transform-es2015-duplicate-keys "^6.6.0"
+    babel-plugin-transform-es2015-for-of "^6.6.0"
+    babel-plugin-transform-es2015-function-name "^6.3.13"
+    babel-plugin-transform-es2015-literals "^6.3.13"
+    babel-plugin-transform-es2015-modules-commonjs "^6.6.0"
+    babel-plugin-transform-es2015-object-super "^6.3.13"
+    babel-plugin-transform-es2015-parameters "^6.6.0"
+    babel-plugin-transform-es2015-shorthand-properties "^6.3.13"
+    babel-plugin-transform-es2015-spread "^6.3.13"
+    babel-plugin-transform-es2015-sticky-regex "^6.3.13"
+    babel-plugin-transform-es2015-template-literals "^6.6.0"
+    babel-plugin-transform-es2015-typeof-symbol "^6.6.0"
+    babel-plugin-transform-es2015-unicode-regex "^6.3.13"
+    babel-plugin-transform-regenerator "^6.6.0"
+
+babel-preset-es3@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/babel-preset-es3/-/babel-preset-es3-1.0.1.tgz#e08dd950a1670dab8b50abceaa9b93d3d9accd1e"
+  dependencies:
+    babel-plugin-transform-es3-member-expression-literals "^6.8.0"
+    babel-plugin-transform-es3-property-literals "^6.8.0"
+
+babel-register@^6.26.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-register/-/babel-register-6.26.0.tgz#6ed021173e2fcb486d7acb45c6009a856f647071"
+  dependencies:
+    babel-core "^6.26.0"
+    babel-runtime "^6.26.0"
+    core-js "^2.5.0"
+    home-or-tmp "^2.0.0"
+    lodash "^4.17.4"
+    mkdirp "^0.5.1"
+    source-map-support "^0.4.15"
+
+babel-runtime@^5.0.0:
+  version "5.8.38"
+  resolved "https://registry.yarnpkg.com/babel-runtime/-/babel-runtime-5.8.38.tgz#1c0b02eb63312f5f087ff20450827b425c9d4c19"
+  dependencies:
+    core-js "^1.0.0"
+
+babel-runtime@^6.18.0, babel-runtime@^6.22.0, babel-runtime@^6.26.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-runtime/-/babel-runtime-6.26.0.tgz#965c7058668e82b55d7bfe04ff2337bc8b5647fe"
+  dependencies:
+    core-js "^2.4.0"
+    regenerator-runtime "^0.11.0"
+
+babel-template@^6.16.0, babel-template@^6.24.1, babel-template@^6.26.0, babel-template@^6.7.0:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-template/-/babel-template-6.26.0.tgz#de03e2d16396b069f46dd9fff8521fb1a0e35e02"
+  dependencies:
+    babel-runtime "^6.26.0"
+    babel-traverse "^6.26.0"
+    babel-types "^6.26.0"
+    babylon "^6.18.0"
+    lodash "^4.17.4"
+
+babel-traverse@^6.18.0, babel-traverse@^6.24.1, babel-traverse@^6.26.0, babel-traverse@^6.6.5:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-traverse/-/babel-traverse-6.26.0.tgz#46a9cbd7edcc62c8e5c064e2d2d8d0f4035766ee"
+  dependencies:
+    babel-code-frame "^6.26.0"
+    babel-messages "^6.23.0"
+    babel-runtime "^6.26.0"
+    babel-types "^6.26.0"
+    babylon "^6.18.0"
+    debug "^2.6.8"
+    globals "^9.18.0"
+    invariant "^2.2.2"
+    lodash "^4.17.4"
+
+babel-types@^6.18.0, babel-types@^6.19.0, babel-types@^6.24.1, babel-types@^6.26.0, babel-types@^6.6.5, babel-types@^6.7.7:
+  version "6.26.0"
+  resolved "https://registry.yarnpkg.com/babel-types/-/babel-types-6.26.0.tgz#a3b073f94ab49eb6fa55cd65227a334380632497"
+  dependencies:
+    babel-runtime "^6.26.0"
+    esutils "^2.0.2"
+    lodash "^4.17.4"
+    to-fast-properties "^1.0.3"
+
+babylon@^6.18.0, babylon@^6.6.5:
+  version "6.18.0"
+  resolved "https://registry.yarnpkg.com/babylon/-/babylon-6.18.0.tgz#af2f3b88fa6f5c1e4c634d1a0f8eac4f55b395e3"
+
+backo2@1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/backo2/-/backo2-1.0.2.tgz#31ab1ac8b129363463e35b3ebb69f4dfcfba7947"
+
+balanced-match@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.0.tgz#89b4d199ab2bee49de164ea02b89ce462d71b767"
+
+base64-arraybuffer@0.1.5:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/base64-arraybuffer/-/base64-arraybuffer-0.1.5.tgz#73926771923b5a19747ad666aa5cd4bf9c6e9ce8"
+
+base64-js@^1.0.2:
+  version "1.2.3"
+  resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.2.3.tgz#fb13668233d9614cf5fb4bce95a9ba4096cdf801"
+
+base64id@1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/base64id/-/base64id-1.0.0.tgz#47688cb99bb6804f0e06d3e763b1c32e57d8e6b6"
+
+batch@0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/batch/-/batch-0.6.1.tgz#dc34314f4e679318093fc760272525f94bf25c16"
+
+batch@^0.5.3:
+  version "0.5.3"
+  resolved "https://registry.yarnpkg.com/batch/-/batch-0.5.3.tgz#3f3414f380321743bfc1042f9a83ff1d5824d464"
+
+bcrypt-pbkdf@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.1.tgz#63bc5dcb61331b92bc05fd528953c33462a06f8d"
+  dependencies:
+    tweetnacl "^0.14.3"
+
+better-assert@~1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/better-assert/-/better-assert-1.0.2.tgz#40866b9e1b9e0b55b481894311e68faffaebc522"
+  dependencies:
+    callsite "1.0.0"
+
+big.js@^3.1.3:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/big.js/-/big.js-3.2.0.tgz#a5fc298b81b9e0dca2e458824784b65c52ba588e"
+
+binary-extensions@^1.0.0:
+  version "1.11.0"
+  resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-1.11.0.tgz#46aa1751fb6a2f93ee5e689bb1087d4b14c6c205"
+
+bind-obj-methods@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/bind-obj-methods/-/bind-obj-methods-1.0.0.tgz#4f5979cac15793adf70e488161e463e209ca509c"
+
+bl@^0.9.0, bl@~0.9.0:
+  version "0.9.5"
+  resolved "https://registry.yarnpkg.com/bl/-/bl-0.9.5.tgz#c06b797af085ea00bc527afc8efcf11de2232054"
+  dependencies:
+    readable-stream "~1.0.26"
+
+blob@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/blob/-/blob-0.0.4.tgz#bcf13052ca54463f30f9fc7e95b9a47630a94921"
+
+block-stream@*:
+  version "0.0.9"
+  resolved "https://registry.yarnpkg.com/block-stream/-/block-stream-0.0.9.tgz#13ebfe778a03205cfe03751481ebb4b3300c126a"
+  dependencies:
+    inherits "~2.0.0"
+
+bluebird@^2.9.27, bluebird@^2.9.30:
+  version "2.11.0"
+  resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-2.11.0.tgz#534b9033c022c9579c56ba3b3e5a5caafbb650e1"
+
+bluebird@^3.5.1:
+  version "3.5.1"
+  resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-3.5.1.tgz#d9551f9de98f1fcda1e683d17ee91a0602ee2eb9"
+
+body-parser@1.18.2, body-parser@^1.12.4:
+  version "1.18.2"
+  resolved "https://registry.yarnpkg.com/body-parser/-/body-parser-1.18.2.tgz#87678a19d84b47d859b83199bd59bce222b10454"
+  dependencies:
+    bytes "3.0.0"
+    content-type "~1.0.4"
+    debug "2.6.9"
+    depd "~1.1.1"
+    http-errors "~1.6.2"
+    iconv-lite "0.4.19"
+    on-finished "~2.3.0"
+    qs "6.5.1"
+    raw-body "2.3.2"
+    type-is "~1.6.15"
+
+body-parser@~1.14.0:
+  version "1.14.2"
+  resolved "https://registry.yarnpkg.com/body-parser/-/body-parser-1.14.2.tgz#1015cb1fe2c443858259581db53332f8d0cf50f9"
+  dependencies:
+    bytes "2.2.0"
+    content-type "~1.0.1"
+    debug "~2.2.0"
+    depd "~1.1.0"
+    http-errors "~1.3.1"
+    iconv-lite "0.4.13"
+    on-finished "~2.3.0"
+    qs "5.2.0"
+    raw-body "~2.1.5"
+    type-is "~1.6.10"
+
+boom@2.x.x:
+  version "2.10.1"
+  resolved "https://registry.yarnpkg.com/boom/-/boom-2.10.1.tgz#39c8918ceff5799f83f9492a848f625add0c766f"
+  dependencies:
+    hoek "2.x.x"
+
+boom@4.x.x:
+  version "4.3.1"
+  resolved "https://registry.yarnpkg.com/boom/-/boom-4.3.1.tgz#4f8a3005cb4a7e3889f749030fd25b96e01d2e31"
+  dependencies:
+    hoek "4.x.x"
+
+boom@5.x.x:
+  version "5.2.0"
+  resolved "https://registry.yarnpkg.com/boom/-/boom-5.2.0.tgz#5dd9da6ee3a5f302077436290cb717d3f4a54e02"
+  dependencies:
+    hoek "4.x.x"
+
+brace-expansion@^1.0.0, brace-expansion@^1.1.7:
+  version "1.1.11"
+  resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd"
+  dependencies:
+    balanced-match "^1.0.0"
+    concat-map "0.0.1"
+
+braces@^0.1.2:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/braces/-/braces-0.1.5.tgz#c085711085291d8b75fdd74eab0f8597280711e6"
+  dependencies:
+    expand-range "^0.1.0"
+
+braces@^1.8.2:
+  version "1.8.5"
+  resolved "https://registry.yarnpkg.com/braces/-/braces-1.8.5.tgz#ba77962e12dff969d6b76711e914b737857bf6a7"
+  dependencies:
+    expand-range "^1.8.1"
+    preserve "^0.2.0"
+    repeat-element "^1.1.2"
+
+browserify-aes@0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/browserify-aes/-/browserify-aes-0.4.0.tgz#067149b668df31c4b58533e02d01e806d8608e2c"
+  dependencies:
+    inherits "^2.0.1"
+
+browserify-zlib@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/browserify-zlib/-/browserify-zlib-0.1.4.tgz#bb35f8a519f600e0fa6b8485241c979d0141fb2d"
+  dependencies:
+    pako "~0.2.0"
+
+buffer-crc32@~0.2.1:
+  version "0.2.13"
+  resolved "https://registry.yarnpkg.com/buffer-crc32/-/buffer-crc32-0.2.13.tgz#0d333e3f00eac50aa1454abd30ef8c2a5d9a7242"
+
+buffer@^4.9.0:
+  version "4.9.1"
+  resolved "https://registry.yarnpkg.com/buffer/-/buffer-4.9.1.tgz#6d1bb601b07a4efced97094132093027c95bc298"
+  dependencies:
+    base64-js "^1.0.2"
+    ieee754 "^1.1.4"
+    isarray "^1.0.0"
+
+builtin-modules@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/builtin-modules/-/builtin-modules-1.1.1.tgz#270f076c5a72c02f5b65a47df94c5fe3a278892f"
+
+builtin-status-codes@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/builtin-status-codes/-/builtin-status-codes-3.0.0.tgz#85982878e21b98e1c66425e03d0174788f569ee8"
+
+bytes@0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/bytes/-/bytes-0.1.0.tgz#c574812228126d6369d1576925a8579db3f8e5a2"
+
+bytes@2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/bytes/-/bytes-2.2.0.tgz#fd35464a403f6f9117c2de3609ecff9cae000588"
+
+bytes@2.4.0:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/bytes/-/bytes-2.4.0.tgz#7d97196f9d5baf7f6935e25985549edd2a6c2339"
+
+bytes@3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/bytes/-/bytes-3.0.0.tgz#d32815404d689699f85a4ea4fa8755dd13a96048"
+
+caching-transform@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/caching-transform/-/caching-transform-1.0.1.tgz#6dbdb2f20f8d8fbce79f3e94e9d1742dcdf5c0a1"
+  dependencies:
+    md5-hex "^1.2.0"
+    mkdirp "^0.5.1"
+    write-file-atomic "^1.1.4"
+
+callsite@1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/callsite/-/callsite-1.0.0.tgz#280398e5d664bd74038b6f0905153e6e8af1bc20"
+
+camelcase-keys@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/camelcase-keys/-/camelcase-keys-2.1.0.tgz#308beeaffdf28119051efa1d932213c91b8f92e7"
+  dependencies:
+    camelcase "^2.0.0"
+    map-obj "^1.0.0"
+
+camelcase@^1.0.2:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-1.2.1.tgz#9bb5304d2e0b56698b2c758b08a3eaa9daa58a39"
+
+camelcase@^2.0.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-2.1.1.tgz#7c1d16d679a1bbe59ca02cacecfb011e201f5a1f"
+
+camelcase@^4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-4.1.0.tgz#d545635be1e33c542649c69173e5de6acfae34dd"
+
+caseless@~0.11.0:
+  version "0.11.0"
+  resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.11.0.tgz#715b96ea9841593cc33067923f5ec60ebda4f7d7"
+
+caseless@~0.12.0:
+  version "0.12.0"
+  resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.12.0.tgz#1b681c21ff84033c826543090689420d187151dc"
+
+caseless@~0.9.0:
+  version "0.9.0"
+  resolved "https://registry.yarnpkg.com/caseless/-/caseless-0.9.0.tgz#b7b65ce6bf1413886539cfd533f0b30effa9cf88"
+
+center-align@^0.1.1:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/center-align/-/center-align-0.1.3.tgz#aa0d32629b6ee972200411cbd4461c907bc2b7ad"
+  dependencies:
+    align-text "^0.1.3"
+    lazy-cache "^1.0.3"
+
+chai@^3.3.0:
+  version "3.5.0"
+  resolved "https://registry.yarnpkg.com/chai/-/chai-3.5.0.tgz#4d02637b067fe958bdbfdd3a40ec56fef7373247"
+  dependencies:
+    assertion-error "^1.0.1"
+    deep-eql "^0.1.3"
+    type-detect "^1.0.0"
+
+chalk@^1.0.0, chalk@^1.1.1, chalk@^1.1.3:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-1.1.3.tgz#a8115c55e4a702fe4d150abd3872822a7e09fc98"
+  dependencies:
+    ansi-styles "^2.2.1"
+    escape-string-regexp "^1.0.2"
+    has-ansi "^2.0.0"
+    strip-ansi "^3.0.0"
+    supports-color "^2.0.0"
+
+chalk@^2.0.1, chalk@^2.1.0:
+  version "2.3.2"
+  resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.3.2.tgz#250dc96b07491bfd601e648d66ddf5f60c7a5c65"
+  dependencies:
+    ansi-styles "^3.2.1"
+    escape-string-regexp "^1.0.5"
+    supports-color "^5.3.0"
+
+chokidar@^1.0.0, chokidar@^1.4.1:
+  version "1.7.0"
+  resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-1.7.0.tgz#798e689778151c8076b4b360e5edd28cda2bb468"
+  dependencies:
+    anymatch "^1.3.0"
+    async-each "^1.0.0"
+    glob-parent "^2.0.0"
+    inherits "^2.0.1"
+    is-binary-path "^1.0.0"
+    is-glob "^2.0.0"
+    path-is-absolute "^1.0.0"
+    readdirp "^2.0.0"
+  optionalDependencies:
+    fsevents "^1.0.0"
+
+circular-json@^0.3.1:
+  version "0.3.3"
+  resolved "https://registry.yarnpkg.com/circular-json/-/circular-json-0.3.3.tgz#815c99ea84f6809529d2f45791bdf82711352d66"
+
+clean-yaml-object@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/clean-yaml-object/-/clean-yaml-object-0.1.0.tgz#63fb110dc2ce1a84dc21f6d9334876d010ae8b68"
+
+cli-cursor@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-1.0.2.tgz#64da3f7d56a54412e59794bd62dc35295e8f2987"
+  dependencies:
+    restore-cursor "^1.0.1"
+
+cli-width@^1.0.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-1.1.1.tgz#a4d293ef67ebb7b88d4a4d42c0ccf00c4d1e366d"
+
+cli@0.4.3:
+  version "0.4.3"
+  resolved "https://registry.yarnpkg.com/cli/-/cli-0.4.3.tgz#e6819c8d5faa957f64f98f66a8506268c1d1f17d"
+  dependencies:
+    glob ">= 3.1.4"
+
+cliui@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/cliui/-/cliui-2.1.0.tgz#4b475760ff80264c762c3a1719032e91c7fea0d1"
+  dependencies:
+    center-align "^0.1.1"
+    right-align "^0.1.1"
+    wordwrap "0.0.2"
+
+cliui@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/cliui/-/cliui-4.0.0.tgz#743d4650e05f36d1ed2575b59638d87322bfbbcc"
+  dependencies:
+    string-width "^2.1.1"
+    strip-ansi "^4.0.0"
+    wrap-ansi "^2.0.0"
+
+clone@^1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/clone/-/clone-1.0.3.tgz#298d7e2231660f40c003c2ed3140decf3f53085f"
+
+co@^4.6.0:
+  version "4.6.0"
+  resolved "https://registry.yarnpkg.com/co/-/co-4.6.0.tgz#6ea6bdf3d853ae54ccb8e47bfa0bf3f9031fb184"
+
+code-point-at@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/code-point-at/-/code-point-at-1.1.0.tgz#0d070b4d043a5bea33a2f1a40e2edb3d9a4ccf77"
+
+coffee-script@~1.3.3:
+  version "1.3.3"
+  resolved "https://registry.yarnpkg.com/coffee-script/-/coffee-script-1.3.3.tgz#150d6b4cb522894369efed6a2101c20bc7f4a4f4"
+
+color-convert@^1.9.0:
+  version "1.9.1"
+  resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.1.tgz#c1261107aeb2f294ebffec9ed9ecad529a6097ed"
+  dependencies:
+    color-name "^1.1.1"
+
+color-name@^1.1.1:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25"
+
+color-support@^1.1.0:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/color-support/-/color-support-1.1.3.tgz#93834379a1cc9a0c61f82f52f0d04322251bd5a2"
+
+colors@0.x.x, colors@~0.6.0, colors@~0.6.2:
+  version "0.6.2"
+  resolved "https://registry.yarnpkg.com/colors/-/colors-0.6.2.tgz#2423fe6678ac0c5dae8852e5d0e5be08c997abcc"
+
+colors@^1.1.0, colors@^1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/colors/-/colors-1.1.2.tgz#168a4701756b6a7f51a12ce0c97bfa28c084ed63"
+
+combined-stream@1.0.6, combined-stream@^1.0.5, combined-stream@~1.0.5:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-1.0.6.tgz#723e7df6e801ac5613113a7e445a9b69cb632818"
+  dependencies:
+    delayed-stream "~1.0.0"
+
+combined-stream@~0.0.4, combined-stream@~0.0.5:
+  version "0.0.7"
+  resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-0.0.7.tgz#0137e657baa5a7541c57ac37ac5fc07d73b4dc1f"
+  dependencies:
+    delayed-stream "0.0.5"
+
+commander@0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/commander/-/commander-0.6.1.tgz#fa68a14f6a945d54dbbe50d8cdb3320e9e3b1a06"
+
+commander@2.3.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/commander/-/commander-2.3.0.tgz#fd430e889832ec353b9acd1de217c11cb3eef873"
+
+commander@^2.8.1, commander@^2.9.0:
+  version "2.14.1"
+  resolved "https://registry.yarnpkg.com/commander/-/commander-2.14.1.tgz#2235123e37af8ca3c65df45b026dbd357b01b9aa"
+
+commondir@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/commondir/-/commondir-1.0.1.tgz#ddd800da0c66127393cca5950ea968a3aaf1253b"
+
+component-bind@1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/component-bind/-/component-bind-1.0.0.tgz#00c608ab7dcd93897c0009651b1d3a8e1e73bbd1"
+
+component-emitter@1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/component-emitter/-/component-emitter-1.1.2.tgz#296594f2753daa63996d2af08d15a95116c9aec3"
+
+component-emitter@1.2.1:
+  version "1.2.1"
+  resolved "https://registry.yarnpkg.com/component-emitter/-/component-emitter-1.2.1.tgz#137918d6d78283f7df7a6b7c5a63e140e69425e6"
+
+component-inherit@0.0.3:
+  version "0.0.3"
+  resolved "https://registry.yarnpkg.com/component-inherit/-/component-inherit-0.0.3.tgz#645fc4adf58b72b649d5cae65135619db26ff143"
+
+compress-commons@~0.2.0:
+  version "0.2.9"
+  resolved "https://registry.yarnpkg.com/compress-commons/-/compress-commons-0.2.9.tgz#422d927430c01abd06cd455b6dfc04cb4cf8003c"
+  dependencies:
+    buffer-crc32 "~0.2.1"
+    crc32-stream "~0.3.1"
+    node-int64 "~0.3.0"
+    readable-stream "~1.0.26"
+
+compressible@~2.0.13:
+  version "2.0.13"
+  resolved "https://registry.yarnpkg.com/compressible/-/compressible-2.0.13.tgz#0d1020ab924b2fdb4d6279875c7d6daba6baa7a9"
+  dependencies:
+    mime-db ">= 1.33.0 < 2"
+
+compression@^1.5.2:
+  version "1.7.2"
+  resolved "https://registry.yarnpkg.com/compression/-/compression-1.7.2.tgz#aaffbcd6aaf854b44ebb280353d5ad1651f59a69"
+  dependencies:
+    accepts "~1.3.4"
+    bytes "3.0.0"
+    compressible "~2.0.13"
+    debug "2.6.9"
+    on-headers "~1.0.1"
+    safe-buffer "5.1.1"
+    vary "~1.1.2"
+
+concat-map@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b"
+
+concat-stream@1.6.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.0.tgz#0aac662fd52be78964d5532f694784e70110acf7"
+  dependencies:
+    inherits "^2.0.3"
+    readable-stream "^2.2.2"
+    typedarray "^0.0.6"
+
+concat-stream@^1.4.1, concat-stream@^1.4.6:
+  version "1.6.1"
+  resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-1.6.1.tgz#261b8f518301f1d834e36342b9fea095d2620a26"
+  dependencies:
+    inherits "^2.0.3"
+    readable-stream "^2.2.2"
+    typedarray "^0.0.6"
+
+connect-history-api-fallback@^1.3.0:
+  version "1.5.0"
+  resolved "https://registry.yarnpkg.com/connect-history-api-fallback/-/connect-history-api-fallback-1.5.0.tgz#b06873934bc5e344fef611a196a6faae0aee015a"
+
+connect@^3.3.5:
+  version "3.6.6"
+  resolved "https://registry.yarnpkg.com/connect/-/connect-3.6.6.tgz#09eff6c55af7236e137135a72574858b6786f524"
+  dependencies:
+    debug "2.6.9"
+    finalhandler "1.1.0"
+    parseurl "~1.3.2"
+    utils-merge "1.0.1"
+
+connect@~2.4.4:
+  version "2.4.6"
+  resolved "https://registry.yarnpkg.com/connect/-/connect-2.4.6.tgz#012c2fe05018504ed2028668a16903199e6e7ace"
+  dependencies:
+    bytes "0.1.0"
+    cookie "0.0.4"
+    crc "0.2.0"
+    debug "*"
+    formidable "1.0.11"
+    fresh "0.1.0"
+    pause "0.0.1"
+    qs "0.5.1"
+    send "0.0.4"
+
+console-browserify@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/console-browserify/-/console-browserify-1.1.0.tgz#f0241c45730a9fc6323b206dbf38edc741d0bb10"
+  dependencies:
+    date-now "^0.1.4"
+
+console-control-strings@^1.0.0, console-control-strings@~1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/console-control-strings/-/console-control-strings-1.1.0.tgz#3d7cf4464db6446ea644bf4b39507f9851008e8e"
+
+constants-browserify@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/constants-browserify/-/constants-browserify-1.0.0.tgz#c20b96d8c617748aaf1c16021760cd27fcb8cb75"
+
+content-disposition@0.5.2:
+  version "0.5.2"
+  resolved "https://registry.yarnpkg.com/content-disposition/-/content-disposition-0.5.2.tgz#0cf68bb9ddf5f2be7961c3a85178cb85dba78cb4"
+
+content-type@~1.0.1, content-type@~1.0.4:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/content-type/-/content-type-1.0.4.tgz#e138cc75e040c727b1966fe5e5f8c9aee256fe3b"
+
+convert-source-map@^1.1.1, convert-source-map@^1.3.0, convert-source-map@^1.5.0:
+  version "1.5.1"
+  resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-1.5.1.tgz#b8278097b9bc229365de5c62cf5fcaed8b5599e5"
+
+cookie-signature@1.0.6:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/cookie-signature/-/cookie-signature-1.0.6.tgz#e303a882b342cc3ee8ca513a79999734dab3ae2c"
+
+cookie@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/cookie/-/cookie-0.0.4.tgz#5456bd47aee2666eac976ea80a6105940483fe98"
+
+cookie@0.3.1:
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/cookie/-/cookie-0.3.1.tgz#e7e0a1f9ef43b4c8ba925c5c5a96e806d16873bb"
+
+core-js@^1.0.0:
+  version "1.2.7"
+  resolved "https://registry.yarnpkg.com/core-js/-/core-js-1.2.7.tgz#652294c14651db28fa93bd2d5ff2983a4f08c636"
+
+core-js@^2.1.0, core-js@^2.4.0, core-js@^2.5.0:
+  version "2.5.3"
+  resolved "https://registry.yarnpkg.com/core-js/-/core-js-2.5.3.tgz#8acc38345824f16d8365b7c9b4259168e8ed603e"
+
+core-util-is@1.0.2, core-util-is@~1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7"
+
+coveralls@^2.13.3:
+  version "2.13.3"
+  resolved "https://registry.yarnpkg.com/coveralls/-/coveralls-2.13.3.tgz#9ad7c2ae527417f361e8b626483f48ee92dd2bc7"
+  dependencies:
+    js-yaml "3.6.1"
+    lcov-parse "0.0.10"
+    log-driver "1.2.5"
+    minimist "1.2.0"
+    request "2.79.0"
+
+crc32-stream@~0.3.1:
+  version "0.3.4"
+  resolved "https://registry.yarnpkg.com/crc32-stream/-/crc32-stream-0.3.4.tgz#73bc25b45fac1db6632231a7bfce8927e9f06552"
+  dependencies:
+    buffer-crc32 "~0.2.1"
+    readable-stream "~1.0.24"
+
+"crc32@>= 0.2.2":
+  version "0.2.2"
+  resolved "https://registry.yarnpkg.com/crc32/-/crc32-0.2.2.tgz#7ad220d6ffdcd119f9fc127a7772cacea390a4ba"
+
+crc@0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/crc/-/crc-0.2.0.tgz#f4486b9bf0a12df83c3fca14e31e030fdabd9454"
+
+cross-spawn@^4:
+  version "4.0.2"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-4.0.2.tgz#7b9247621c23adfdd3856004a823cbe397424d41"
+  dependencies:
+    lru-cache "^4.0.1"
+    which "^1.2.9"
+
+cross-spawn@^5.0.1:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-5.1.0.tgz#e8bd0efee58fcff6f8f94510a0a554bbfa235449"
+  dependencies:
+    lru-cache "^4.0.1"
+    shebang-command "^1.2.0"
+    which "^1.2.9"
+
+cryptiles@2.x.x:
+  version "2.0.5"
+  resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-2.0.5.tgz#3bdfecdc608147c1c67202fa291e7dca59eaa3b8"
+  dependencies:
+    boom "2.x.x"
+
+cryptiles@3.x.x:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-3.1.2.tgz#a89fbb220f5ce25ec56e8c4aa8a4fd7b5b0d29fe"
+  dependencies:
+    boom "5.x.x"
+
+crypto-browserify@3.3.0:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/crypto-browserify/-/crypto-browserify-3.3.0.tgz#b9fc75bb4a0ed61dcf1cd5dae96eb30c9c3e506c"
+  dependencies:
+    browserify-aes "0.4.0"
+    pbkdf2-compat "2.0.1"
+    ripemd160 "0.2.0"
+    sha.js "2.2.6"
+
+ctype@0.5.3:
+  version "0.5.3"
+  resolved "https://registry.yarnpkg.com/ctype/-/ctype-0.5.3.tgz#82c18c2461f74114ef16c135224ad0b9144ca12f"
+
+currently-unhandled@^0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/currently-unhandled/-/currently-unhandled-0.4.1.tgz#988df33feab191ef799a61369dd76c17adf957ea"
+  dependencies:
+    array-find-index "^1.0.1"
+
+custom-event@~1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/custom-event/-/custom-event-1.0.1.tgz#5d02a46850adf1b4a317946a3928fccb5bfd0425"
+
+d@1:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/d/-/d-1.0.0.tgz#754bb5bfe55451da69a58b94d45f4c5b0462d58f"
+  dependencies:
+    es5-ext "^0.10.9"
+
+dashdash@^1.12.0:
+  version "1.14.1"
+  resolved "https://registry.yarnpkg.com/dashdash/-/dashdash-1.14.1.tgz#853cfa0f7cbe2fed5de20326b8dd581035f6e2f0"
+  dependencies:
+    assert-plus "^1.0.0"
+
+date-now@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/date-now/-/date-now-0.1.4.tgz#eaf439fd4d4848ad74e5cc7dbef200672b9e345b"
+
+dateformat@1.0.2-1.2.3:
+  version "1.0.2-1.2.3"
+  resolved "https://registry.yarnpkg.com/dateformat/-/dateformat-1.0.2-1.2.3.tgz#b0220c02de98617433b72851cf47de3df2cdbee9"
+
+debug-log@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/debug-log/-/debug-log-1.0.1.tgz#2307632d4c04382b8df8a32f70b895046d52745f"
+
+debug@*, debug@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-3.1.0.tgz#5bb5a0672628b64149566ba16819e61518c67261"
+  dependencies:
+    ms "2.0.0"
+
+debug@2, debug@2.6.9, debug@^2.1.1, debug@^2.1.3, debug@^2.2.0, debug@^2.6.6, debug@^2.6.8:
+  version "2.6.9"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f"
+  dependencies:
+    ms "2.0.0"
+
+debug@2.2.0, debug@~2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-2.2.0.tgz#f87057e995b1a1f6ae6a4960664137bc56f039da"
+  dependencies:
+    ms "0.7.1"
+
+debug@2.3.3:
+  version "2.3.3"
+  resolved "https://registry.yarnpkg.com/debug/-/debug-2.3.3.tgz#40c453e67e6e13c901ddec317af8986cda9eff8c"
+  dependencies:
+    ms "0.7.2"
+
+decamelize@^1.0.0, decamelize@^1.1.1, decamelize@^1.1.2:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-1.2.0.tgz#f6534d15148269b20352e7bee26f501f9a191290"
+
+deep-eql@^0.1.3:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/deep-eql/-/deep-eql-0.1.3.tgz#ef558acab8de25206cd713906d74e56930eb69f2"
+  dependencies:
+    type-detect "0.1.1"
+
+deep-extend@~0.4.0:
+  version "0.4.2"
+  resolved "https://registry.yarnpkg.com/deep-extend/-/deep-extend-0.4.2.tgz#48b699c27e334bf89f10892be432f6e4c7d34a7f"
+
+deep-is@~0.1.2, deep-is@~0.1.3:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.3.tgz#b369d6fb5dbc13eecf524f91b070feedc357cf34"
+
+default-require-extensions@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/default-require-extensions/-/default-require-extensions-1.0.0.tgz#f37ea15d3e13ffd9b437d33e1a75b5fb97874cb8"
+  dependencies:
+    strip-bom "^2.0.0"
+
+"deflate-js@>= 0.2.2":
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/deflate-js/-/deflate-js-0.2.3.tgz#f85abb58ebc5151a306147473d57c3e4f7e4426b"
+
+del@^2.0.2:
+  version "2.2.2"
+  resolved "https://registry.yarnpkg.com/del/-/del-2.2.2.tgz#c12c981d067846c84bcaf862cff930d907ffd1a8"
+  dependencies:
+    globby "^5.0.0"
+    is-path-cwd "^1.0.0"
+    is-path-in-cwd "^1.0.0"
+    object-assign "^4.0.1"
+    pify "^2.0.0"
+    pinkie-promise "^2.0.0"
+    rimraf "^2.2.8"
+
+delayed-stream@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-0.0.5.tgz#d4b1f43a93e8296dfe02694f4680bc37a313c73f"
+
+delayed-stream@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619"
+
+delegates@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/delegates/-/delegates-1.0.0.tgz#84c6e159b81904fdca59a0ef44cd870d31250f9a"
+
+depd@1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/depd/-/depd-1.1.1.tgz#5783b4e1c459f06fa5ca27f991f3d06e7a310359"
+
+depd@~1.1.0, depd@~1.1.1:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/depd/-/depd-1.1.2.tgz#9bcd52e14c097763e749b274c4346ed2e560b5a9"
+
+destroy@~1.0.4:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/destroy/-/destroy-1.0.4.tgz#978857442c44749e4206613e37946205826abd80"
+
+detect-indent@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/detect-indent/-/detect-indent-4.0.0.tgz#f76d064352cdf43a1cb6ce619c4ee3a9475de208"
+  dependencies:
+    repeating "^2.0.0"
+
+detect-libc@^1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/detect-libc/-/detect-libc-1.0.3.tgz#fa137c4bd698edf55cd5cd02ac559f91a4c4ba9b"
+
+di@^0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/di/-/di-0.0.1.tgz#806649326ceaa7caa3306d75d985ea2748ba913c"
+
+diff@1.4.0, diff@^1.3.2:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/diff/-/diff-1.4.0.tgz#7f28d2eb9ee7b15a97efd89ce63dcfdaa3ccbabf"
+
+doctrine@^0.7.1:
+  version "0.7.2"
+  resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-0.7.2.tgz#7cb860359ba3be90e040b26b729ce4bfa654c523"
+  dependencies:
+    esutils "^1.1.6"
+    isarray "0.0.1"
+
+dom-serialize@^2.2.0:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/dom-serialize/-/dom-serialize-2.2.1.tgz#562ae8999f44be5ea3076f5419dcd59eb43ac95b"
+  dependencies:
+    custom-event "~1.0.0"
+    ent "~2.2.0"
+    extend "^3.0.0"
+    void-elements "^2.0.0"
+
+domain-browser@^1.1.1:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/domain-browser/-/domain-browser-1.2.0.tgz#3d31f50191a6749dd1375a7f522e823d42e54eda"
+
+ecc-jsbn@~0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/ecc-jsbn/-/ecc-jsbn-0.1.1.tgz#0fc73a9ed5f0d53c38193398523ef7e543777505"
+  dependencies:
+    jsbn "~0.1.0"
+
+ee-first@1.1.1:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/ee-first/-/ee-first-1.1.1.tgz#590c61156b0ae2f4f0255732a158b266bc56b21d"
+
+emojis-list@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/emojis-list/-/emojis-list-2.1.0.tgz#4daa4d9db00f9819880c79fa457ae5b09a1fd389"
+
+encodeurl@~1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/encodeurl/-/encodeurl-1.0.2.tgz#ad3ff4c86ec2d029322f5a02c3a9a606c95b3f59"
+
+end-of-stream@^1.0.0:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/end-of-stream/-/end-of-stream-1.4.1.tgz#ed29634d19baba463b6ce6b80a37213eab71ec43"
+  dependencies:
+    once "^1.4.0"
+
+engine.io-client@~1.8.4:
+  version "1.8.5"
+  resolved "https://registry.yarnpkg.com/engine.io-client/-/engine.io-client-1.8.5.tgz#fe7fb60cb0dcf2fa2859489329cb5968dedeb11f"
+  dependencies:
+    component-emitter "1.2.1"
+    component-inherit "0.0.3"
+    debug "2.3.3"
+    engine.io-parser "1.3.2"
+    has-cors "1.1.0"
+    indexof "0.0.1"
+    parsejson "0.0.3"
+    parseqs "0.0.5"
+    parseuri "0.0.5"
+    ws "~1.1.5"
+    xmlhttprequest-ssl "1.5.3"
+    yeast "0.1.2"
+
+engine.io-parser@1.3.2:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/engine.io-parser/-/engine.io-parser-1.3.2.tgz#937b079f0007d0893ec56d46cb220b8cb435220a"
+  dependencies:
+    after "0.8.2"
+    arraybuffer.slice "0.0.6"
+    base64-arraybuffer "0.1.5"
+    blob "0.0.4"
+    has-binary "0.1.7"
+    wtf-8 "1.0.0"
+
+engine.io@~1.8.4:
+  version "1.8.5"
+  resolved "https://registry.yarnpkg.com/engine.io/-/engine.io-1.8.5.tgz#4ebe5e75c6dc123dee4afdce6e5fdced21eb93f6"
+  dependencies:
+    accepts "1.3.3"
+    base64id "1.0.0"
+    cookie "0.3.1"
+    debug "2.3.3"
+    engine.io-parser "1.3.2"
+    ws "~1.1.5"
+
+enhanced-resolve@~0.9.0:
+  version "0.9.1"
+  resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-0.9.1.tgz#4d6e689b3725f86090927ccc86cd9f1635b89e2e"
+  dependencies:
+    graceful-fs "^4.1.2"
+    memory-fs "^0.2.0"
+    tapable "^0.1.8"
+
+ent@~2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/ent/-/ent-2.2.0.tgz#e964219325a21d05f44466a2f686ed6ce5f5dd1d"
+
+errno@^0.1.3:
+  version "0.1.7"
+  resolved "https://registry.yarnpkg.com/errno/-/errno-0.1.7.tgz#4684d71779ad39af177e3f007996f7c67c852618"
+  dependencies:
+    prr "~1.0.1"
+
+error-ex@^1.2.0:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/error-ex/-/error-ex-1.3.1.tgz#f855a86ce61adc4e8621c3cda21e7a7612c3a8dc"
+  dependencies:
+    is-arrayish "^0.2.1"
+
+es5-ext@^0.10.14, es5-ext@^0.10.35, es5-ext@^0.10.9, es5-ext@~0.10.14:
+  version "0.10.39"
+  resolved "https://registry.yarnpkg.com/es5-ext/-/es5-ext-0.10.39.tgz#fca21b67559277ca4ac1a1ed7048b107b6f76d87"
+  dependencies:
+    es6-iterator "~2.0.3"
+    es6-symbol "~3.1.1"
+
+es6-iterator@^2.0.1, es6-iterator@~2.0.1, es6-iterator@~2.0.3:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/es6-iterator/-/es6-iterator-2.0.3.tgz#a7de889141a05a94b0854403b2d0a0fbfa98f3b7"
+  dependencies:
+    d "1"
+    es5-ext "^0.10.35"
+    es6-symbol "^3.1.1"
+
+es6-map@^0.1.3:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/es6-map/-/es6-map-0.1.5.tgz#9136e0503dcc06a301690f0bb14ff4e364e949f0"
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+    es6-iterator "~2.0.1"
+    es6-set "~0.1.5"
+    es6-symbol "~3.1.1"
+    event-emitter "~0.3.5"
+
+es6-promise@^4.0.3:
+  version "4.2.4"
+  resolved "https://registry.yarnpkg.com/es6-promise/-/es6-promise-4.2.4.tgz#dc4221c2b16518760bd8c39a52d8f356fc00ed29"
+
+es6-set@~0.1.5:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/es6-set/-/es6-set-0.1.5.tgz#d2b3ec5d4d800ced818db538d28974db0a73ccb1"
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+    es6-iterator "~2.0.1"
+    es6-symbol "3.1.1"
+    event-emitter "~0.3.5"
+
+es6-symbol@3.1.1, es6-symbol@^3.1.1, es6-symbol@~3.1.1:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/es6-symbol/-/es6-symbol-3.1.1.tgz#bf00ef4fdab6ba1b46ecb7b629b4c7ed5715cc77"
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+
+es6-weak-map@^2.0.1:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/es6-weak-map/-/es6-weak-map-2.0.2.tgz#5e3ab32251ffd1538a1f8e5ffa1357772f92d96f"
+  dependencies:
+    d "1"
+    es5-ext "^0.10.14"
+    es6-iterator "^2.0.1"
+    es6-symbol "^3.1.1"
+
+escape-html@~1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/escape-html/-/escape-html-1.0.3.tgz#0258eae4d3d0c0974de1c169188ef0051d1d1988"
+
+escape-string-regexp@1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.2.tgz#4dbc2fe674e71949caf3fb2695ce7f2dc1d9a8d1"
+
+escape-string-regexp@^1.0.2, escape-string-regexp@^1.0.3, escape-string-regexp@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4"
+
+escodegen@1.7.x:
+  version "1.7.1"
+  resolved "https://registry.yarnpkg.com/escodegen/-/escodegen-1.7.1.tgz#30ecfcf66ca98dc67cd2fd162abeb6eafa8ce6fc"
+  dependencies:
+    esprima "^1.2.2"
+    estraverse "^1.9.1"
+    esutils "^2.0.2"
+    optionator "^0.5.0"
+  optionalDependencies:
+    source-map "~0.2.0"
+
+escope@^3.3.0:
+  version "3.6.0"
+  resolved "https://registry.yarnpkg.com/escope/-/escope-3.6.0.tgz#e01975e812781a163a6dadfdd80398dc64c889c3"
+  dependencies:
+    es6-map "^0.1.3"
+    es6-weak-map "^2.0.1"
+    esrecurse "^4.1.0"
+    estraverse "^4.1.1"
+
+eslint@^1.5.1, eslint@^1.6.0:
+  version "1.10.3"
+  resolved "https://registry.yarnpkg.com/eslint/-/eslint-1.10.3.tgz#fb19a91b13c158082bbca294b17d979bc8353a0a"
+  dependencies:
+    chalk "^1.0.0"
+    concat-stream "^1.4.6"
+    debug "^2.1.1"
+    doctrine "^0.7.1"
+    escape-string-regexp "^1.0.2"
+    escope "^3.3.0"
+    espree "^2.2.4"
+    estraverse "^4.1.1"
+    estraverse-fb "^1.3.1"
+    esutils "^2.0.2"
+    file-entry-cache "^1.1.1"
+    glob "^5.0.14"
+    globals "^8.11.0"
+    handlebars "^4.0.0"
+    inquirer "^0.11.0"
+    is-my-json-valid "^2.10.0"
+    is-resolvable "^1.0.0"
+    js-yaml "3.4.5"
+    json-stable-stringify "^1.0.0"
+    lodash.clonedeep "^3.0.1"
+    lodash.merge "^3.3.2"
+    lodash.omit "^3.1.0"
+    minimatch "^3.0.0"
+    mkdirp "^0.5.0"
+    object-assign "^4.0.1"
+    optionator "^0.6.0"
+    path-is-absolute "^1.0.0"
+    path-is-inside "^1.0.1"
+    shelljs "^0.5.3"
+    strip-json-comments "~1.0.1"
+    text-table "~0.2.0"
+    user-home "^2.0.0"
+    xml-escape "~1.0.0"
+
+espree@^2.2.4:
+  version "2.2.5"
+  resolved "https://registry.yarnpkg.com/espree/-/espree-2.2.5.tgz#df691b9310889402aeb29cc066708c56690b854b"
+
+esprima@2.5.x:
+  version "2.5.0"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-2.5.0.tgz#f387a46fd344c1b1a39baf8c20bfb43b6d0058cc"
+
+esprima@^1.2.2:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-1.2.5.tgz#0993502feaf668138325756f30f9a51feeec11e9"
+
+esprima@^2.6.0:
+  version "2.7.3"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-2.7.3.tgz#96e3b70d5779f6ad49cd032673d1c312767ba581"
+
+esprima@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.0.tgz#4499eddcd1110e0b218bacf2fa7f7f59f55ca804"
+
+"esprima@~ 1.0.2":
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/esprima/-/esprima-1.0.4.tgz#9f557e08fc3b4d26ece9dd34f8fbf476b62585ad"
+
+esrecurse@^4.1.0:
+  version "4.2.1"
+  resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.2.1.tgz#007a3b9fdbc2b3bb87e4879ea19c92fdbd3942cf"
+  dependencies:
+    estraverse "^4.1.0"
+
+estraverse-fb@^1.3.1:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/estraverse-fb/-/estraverse-fb-1.3.2.tgz#d323a4cb5e5ac331cea033413a9253e1643e07c4"
+
+estraverse@^1.9.1:
+  version "1.9.3"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-1.9.3.tgz#af67f2dc922582415950926091a4005d29c9bb44"
+
+estraverse@^4.1.0, estraverse@^4.1.1:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.2.0.tgz#0dee3fed31fcd469618ce7342099fc1afa0bdb13"
+
+esutils@^1.1.6:
+  version "1.1.6"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-1.1.6.tgz#c01ccaa9ae4b897c6d0c3e210ae52f3c7a844375"
+
+esutils@^2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.2.tgz#0abf4f1caa5bcb1f7a9d8acc6dea4faaa04bac9b"
+
+etag@~1.8.1:
+  version "1.8.1"
+  resolved "https://registry.yarnpkg.com/etag/-/etag-1.8.1.tgz#41ae2eeb65efa62268aebfea83ac7d79299b0887"
+
+event-emitter@~0.3.5:
+  version "0.3.5"
+  resolved "https://registry.yarnpkg.com/event-emitter/-/event-emitter-0.3.5.tgz#df8c69eef1647923c7157b9ce83840610b02cc39"
+  dependencies:
+    d "1"
+    es5-ext "~0.10.14"
+
+eventemitter2@~0.4.13:
+  version "0.4.14"
+  resolved "https://registry.yarnpkg.com/eventemitter2/-/eventemitter2-0.4.14.tgz#8f61b75cde012b2e9eb284d4545583b5643b61ab"
+
+eventemitter3@1.x.x:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/eventemitter3/-/eventemitter3-1.2.0.tgz#1c86991d816ad1e504750e73874224ecf3bec508"
+
+events-to-array@^1.0.1:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/events-to-array/-/events-to-array-1.1.2.tgz#2d41f563e1fe400ed4962fe1a4d5c6a7539df7f6"
+
+events@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/events/-/events-1.1.1.tgz#9ebdb7635ad099c70dcc4c2a1f5004288e8bd924"
+
+eventsource@0.1.6:
+  version "0.1.6"
+  resolved "https://registry.yarnpkg.com/eventsource/-/eventsource-0.1.6.tgz#0acede849ed7dd1ccc32c811bb11b944d4f29232"
+  dependencies:
+    original ">=0.0.5"
+
+execa@^0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/execa/-/execa-0.7.0.tgz#944becd34cc41ee32a63a9faf27ad5a65fc59777"
+  dependencies:
+    cross-spawn "^5.0.1"
+    get-stream "^3.0.0"
+    is-stream "^1.1.0"
+    npm-run-path "^2.0.0"
+    p-finally "^1.0.0"
+    signal-exit "^3.0.0"
+    strip-eof "^1.0.0"
+
+exit-hook@^1.0.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/exit-hook/-/exit-hook-1.1.1.tgz#f05ca233b48c05d54fff07765df8507e95c02ff8"
+
+exit@~0.1.1:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/exit/-/exit-0.1.2.tgz#0632638f8d877cc82107d30a0fff1a17cba1cd0c"
+
+expand-braces@^0.1.1:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/expand-braces/-/expand-braces-0.1.2.tgz#488b1d1d2451cb3d3a6b192cfc030f44c5855fea"
+  dependencies:
+    array-slice "^0.2.3"
+    array-unique "^0.2.1"
+    braces "^0.1.2"
+
+expand-brackets@^0.1.4:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/expand-brackets/-/expand-brackets-0.1.5.tgz#df07284e342a807cd733ac5af72411e581d1177b"
+  dependencies:
+    is-posix-bracket "^0.1.0"
+
+expand-range@^0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/expand-range/-/expand-range-0.1.1.tgz#4cb8eda0993ca56fa4f41fc42f3cbb4ccadff044"
+  dependencies:
+    is-number "^0.1.1"
+    repeat-string "^0.2.2"
+
+expand-range@^1.8.1:
+  version "1.8.2"
+  resolved "https://registry.yarnpkg.com/expand-range/-/expand-range-1.8.2.tgz#a299effd335fe2721ebae8e257ec79644fc85337"
+  dependencies:
+    fill-range "^2.1.0"
+
+express@^4.13.3:
+  version "4.16.2"
+  resolved "https://registry.yarnpkg.com/express/-/express-4.16.2.tgz#e35c6dfe2d64b7dca0a5cd4f21781be3299e076c"
+  dependencies:
+    accepts "~1.3.4"
+    array-flatten "1.1.1"
+    body-parser "1.18.2"
+    content-disposition "0.5.2"
+    content-type "~1.0.4"
+    cookie "0.3.1"
+    cookie-signature "1.0.6"
+    debug "2.6.9"
+    depd "~1.1.1"
+    encodeurl "~1.0.1"
+    escape-html "~1.0.3"
+    etag "~1.8.1"
+    finalhandler "1.1.0"
+    fresh "0.5.2"
+    merge-descriptors "1.0.1"
+    methods "~1.1.2"
+    on-finished "~2.3.0"
+    parseurl "~1.3.2"
+    path-to-regexp "0.1.7"
+    proxy-addr "~2.0.2"
+    qs "6.5.1"
+    range-parser "~1.2.0"
+    safe-buffer "5.1.1"
+    send "0.16.1"
+    serve-static "1.13.1"
+    setprototypeof "1.1.0"
+    statuses "~1.3.1"
+    type-is "~1.6.15"
+    utils-merge "1.0.1"
+    vary "~1.1.2"
+
+extend@3, extend@^3.0.0, extend@~3.0.0, extend@~3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/extend/-/extend-3.0.1.tgz#a755ea7bc1adfcc5a31ce7e762dbaadc5e636444"
+
+extglob@^0.3.1:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/extglob/-/extglob-0.3.2.tgz#2e18ff3d2f49ab2765cec9023f011daa8d8349a1"
+  dependencies:
+    is-extglob "^1.0.0"
+
+extract-zip@^1.6.5:
+  version "1.6.6"
+  resolved "https://registry.yarnpkg.com/extract-zip/-/extract-zip-1.6.6.tgz#1290ede8d20d0872b429fd3f351ca128ec5ef85c"
+  dependencies:
+    concat-stream "1.6.0"
+    debug "2.6.9"
+    mkdirp "0.5.0"
+    yauzl "2.4.1"
+
+extsprintf@1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.3.0.tgz#96918440e3041a7a414f8c52e3c574eb3c3e1e05"
+
+extsprintf@^1.2.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.4.0.tgz#e2689f8f356fad62cca65a3a91c5df5f9551692f"
+
+eyes@0.1.x:
+  version "0.1.8"
+  resolved "https://registry.yarnpkg.com/eyes/-/eyes-0.1.8.tgz#62cf120234c683785d902348a800ef3e0cc20bc0"
+
+fast-deep-equal@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-1.1.0.tgz#c053477817c86b51daa853c81e059b733d023614"
+
+fast-json-stable-stringify@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.0.0.tgz#d5142c0caee6b1189f87d3a76111064f86c8bbf2"
+
+fast-levenshtein@~1.0.0, fast-levenshtein@~1.0.6:
+  version "1.0.7"
+  resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-1.0.7.tgz#0178dcdee023b92905193af0959e8a7639cfdcb9"
+
+faye-websocket@^0.10.0, faye-websocket@~0.10.0:
+  version "0.10.0"
+  resolved "https://registry.yarnpkg.com/faye-websocket/-/faye-websocket-0.10.0.tgz#4e492f8d04dfb6f89003507f6edbf2d501e7c6f4"
+  dependencies:
+    websocket-driver ">=0.5.1"
+
+faye-websocket@~0.11.0:
+  version "0.11.1"
+  resolved "https://registry.yarnpkg.com/faye-websocket/-/faye-websocket-0.11.1.tgz#f0efe18c4f56e4f40afc7e06c719fd5ee6188f38"
+  dependencies:
+    websocket-driver ">=0.5.1"
+
+fd-slicer@~1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/fd-slicer/-/fd-slicer-1.0.1.tgz#8b5bcbd9ec327c5041bf9ab023fd6750f1177e65"
+  dependencies:
+    pend "~1.2.0"
+
+figures@^1.0.1, figures@^1.3.5:
+  version "1.7.0"
+  resolved "https://registry.yarnpkg.com/figures/-/figures-1.7.0.tgz#cbe1e3affcf1cd44b80cadfed28dc793a9701d2e"
+  dependencies:
+    escape-string-regexp "^1.0.5"
+    object-assign "^4.1.0"
+
+file-entry-cache@^1.1.1:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-1.3.1.tgz#44c61ea607ae4be9c1402f41f44270cbfe334ff8"
+  dependencies:
+    flat-cache "^1.2.1"
+    object-assign "^4.0.1"
+
+file-sync-cmp@^0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/file-sync-cmp/-/file-sync-cmp-0.1.1.tgz#a5e7a8ffbfa493b43b923bbd4ca89a53b63b612b"
+
+filename-regex@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/filename-regex/-/filename-regex-2.0.1.tgz#c1c4b9bee3e09725ddb106b75c1e301fe2f18b26"
+
+fileset@0.2.x:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/fileset/-/fileset-0.2.1.tgz#588ef8973c6623b2a76df465105696b96aac8067"
+  dependencies:
+    glob "5.x"
+    minimatch "2.x"
+
+fill-range@^2.1.0:
+  version "2.2.3"
+  resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-2.2.3.tgz#50b77dfd7e469bc7492470963699fe7a8485a723"
+  dependencies:
+    is-number "^2.1.0"
+    isobject "^2.0.0"
+    randomatic "^1.1.3"
+    repeat-element "^1.1.2"
+    repeat-string "^1.5.2"
+
+finalhandler@1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/finalhandler/-/finalhandler-1.1.0.tgz#ce0b6855b45853e791b2fcc680046d88253dd7f5"
+  dependencies:
+    debug "2.6.9"
+    encodeurl "~1.0.1"
+    escape-html "~1.0.3"
+    on-finished "~2.3.0"
+    parseurl "~1.3.2"
+    statuses "~1.3.1"
+    unpipe "~1.0.0"
+
+find-cache-dir@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/find-cache-dir/-/find-cache-dir-0.1.1.tgz#c8defae57c8a52a8a784f9e31c57c742e993a0b9"
+  dependencies:
+    commondir "^1.0.1"
+    mkdirp "^0.5.1"
+    pkg-dir "^1.0.0"
+
+find-up@^1.0.0:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/find-up/-/find-up-1.1.2.tgz#6b2e9822b1a2ce0a60ab64d610eccad53cb24d0f"
+  dependencies:
+    path-exists "^2.0.0"
+    pinkie-promise "^2.0.0"
+
+find-up@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/find-up/-/find-up-2.1.0.tgz#45d1b7e506c717ddd482775a2b77920a3c0c57a7"
+  dependencies:
+    locate-path "^2.0.0"
+
+findup-sync@~0.1.0, findup-sync@~0.1.2:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/findup-sync/-/findup-sync-0.1.3.tgz#7f3e7a97b82392c653bf06589bd85190e93c3683"
+  dependencies:
+    glob "~3.2.9"
+    lodash "~2.4.1"
+
+flat-cache@^1.2.1:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-1.3.0.tgz#d3030b32b38154f4e3b7e9c709f490f7ef97c481"
+  dependencies:
+    circular-json "^0.3.1"
+    del "^2.0.2"
+    graceful-fs "^4.1.2"
+    write "^0.2.1"
+
+for-in@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/for-in/-/for-in-1.0.2.tgz#81068d295a8142ec0ac726c6e2200c30fb6d5e80"
+
+for-own@^0.1.4:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/for-own/-/for-own-0.1.5.tgz#5265c681a4f294dabbf17c9509b6763aa84510ce"
+  dependencies:
+    for-in "^1.0.1"
+
+foreground-child@^1.3.3, foreground-child@^1.5.3, foreground-child@^1.5.6:
+  version "1.5.6"
+  resolved "https://registry.yarnpkg.com/foreground-child/-/foreground-child-1.5.6.tgz#4fd71ad2dfde96789b980a5c0a295937cb2f5ce9"
+  dependencies:
+    cross-spawn "^4"
+    signal-exit "^3.0.0"
+
+forever-agent@~0.6.0, forever-agent@~0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/forever-agent/-/forever-agent-0.6.1.tgz#fbc71f0c41adeb37f96c577ad1ed42d8fdacca91"
+
+form-data@~0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/form-data/-/form-data-0.2.0.tgz#26f8bc26da6440e299cbdcfb69035c4f77a6e466"
+  dependencies:
+    async "~0.9.0"
+    combined-stream "~0.0.4"
+    mime-types "~2.0.3"
+
+form-data@~2.1.1:
+  version "2.1.4"
+  resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.1.4.tgz#33c183acf193276ecaa98143a69e94bfee1750d1"
+  dependencies:
+    asynckit "^0.4.0"
+    combined-stream "^1.0.5"
+    mime-types "^2.1.12"
+
+form-data@~2.3.1:
+  version "2.3.2"
+  resolved "https://registry.yarnpkg.com/form-data/-/form-data-2.3.2.tgz#4970498be604c20c005d4f5c23aecd21d6b49099"
+  dependencies:
+    asynckit "^0.4.0"
+    combined-stream "1.0.6"
+    mime-types "^2.1.12"
+
+formidable@1.0.11:
+  version "1.0.11"
+  resolved "https://registry.yarnpkg.com/formidable/-/formidable-1.0.11.tgz#68f63325a035e644b6f7bb3d11243b9761de1b30"
+
+forwarded@~0.1.2:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/forwarded/-/forwarded-0.1.2.tgz#98c23dab1175657b8c0573e8ceccd91b0ff18c84"
+
+fresh@0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/fresh/-/fresh-0.1.0.tgz#03e4b0178424e4c2d5d19a54d8814cdc97934850"
+
+fresh@0.5.2:
+  version "0.5.2"
+  resolved "https://registry.yarnpkg.com/fresh/-/fresh-0.5.2.tgz#3d8cadd90d976569fa835ab1f8e4b23a105605a7"
+
+fs-exists-cached@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs-exists-cached/-/fs-exists-cached-1.0.0.tgz#cf25554ca050dc49ae6656b41de42258989dcbce"
+
+fs-extra@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-1.0.0.tgz#cd3ce5f7e7cb6145883fcae3191e9877f8587950"
+  dependencies:
+    graceful-fs "^4.1.2"
+    jsonfile "^2.1.0"
+    klaw "^1.0.0"
+
+fs.realpath@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f"
+
+fsevents@^1.0.0:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-1.1.3.tgz#11f82318f5fe7bb2cd22965a108e9306208216d8"
+  dependencies:
+    nan "^2.3.0"
+    node-pre-gyp "^0.6.39"
+
+fstream-ignore@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/fstream-ignore/-/fstream-ignore-1.0.5.tgz#9c31dae34767018fe1d249b24dada67d092da105"
+  dependencies:
+    fstream "^1.0.0"
+    inherits "2"
+    minimatch "^3.0.0"
+
+fstream@^1.0.0, fstream@^1.0.10, fstream@^1.0.2:
+  version "1.0.11"
+  resolved "https://registry.yarnpkg.com/fstream/-/fstream-1.0.11.tgz#5c1fb1f117477114f0632a0eb4b71b3cb0fd3171"
+  dependencies:
+    graceful-fs "^4.1.2"
+    inherits "~2.0.0"
+    mkdirp ">=0.5 0"
+    rimraf "2"
+
+function-loop@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/function-loop/-/function-loop-1.0.1.tgz#8076bb305e8e6a3cceee2920765f330d190f340c"
+
+gauge@~2.7.3:
+  version "2.7.4"
+  resolved "https://registry.yarnpkg.com/gauge/-/gauge-2.7.4.tgz#2c03405c7538c39d7eb37b317022e325fb018bf7"
+  dependencies:
+    aproba "^1.0.3"
+    console-control-strings "^1.0.0"
+    has-unicode "^2.0.0"
+    object-assign "^4.1.0"
+    signal-exit "^3.0.0"
+    string-width "^1.0.1"
+    strip-ansi "^3.0.1"
+    wide-align "^1.1.0"
+
+gaze@^1.0.0:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/gaze/-/gaze-1.1.2.tgz#847224677adb8870d679257ed3388fdb61e40105"
+  dependencies:
+    globule "^1.0.0"
+
+generate-function@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/generate-function/-/generate-function-2.0.0.tgz#6858fe7c0969b7d4e9093337647ac79f60dfbe74"
+
+generate-object-property@^1.1.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/generate-object-property/-/generate-object-property-1.2.0.tgz#9c0e1c40308ce804f4783618b937fa88f99d50d0"
+  dependencies:
+    is-property "^1.0.0"
+
+get-caller-file@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/get-caller-file/-/get-caller-file-1.0.2.tgz#f702e63127e7e231c160a80c1554acb70d5047e5"
+
+get-stdin@^4.0.1:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-4.0.1.tgz#b968c6b0a04384324902e8bf1a5df32579a450fe"
+
+get-stream@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-3.0.0.tgz#8e943d1358dc37555054ecbe2edb05aa174ede14"
+
+getobject@~0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/getobject/-/getobject-0.1.0.tgz#047a449789fa160d018f5486ed91320b6ec7885c"
+
+getpass@^0.1.1:
+  version "0.1.7"
+  resolved "https://registry.yarnpkg.com/getpass/-/getpass-0.1.7.tgz#5eff8e3e684d569ae4cb2b1282604e8ba62149fa"
+  dependencies:
+    assert-plus "^1.0.0"
+
+glob-base@^0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/glob-base/-/glob-base-0.3.0.tgz#dbb164f6221b1c0b1ccf82aea328b497df0ea3c4"
+  dependencies:
+    glob-parent "^2.0.0"
+    is-glob "^2.0.0"
+
+glob-parent@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-2.0.0.tgz#81383d72db054fcccf5336daa902f182f6edbb28"
+  dependencies:
+    is-glob "^2.0.0"
+
+glob-whatev@~0.1.4:
+  version "0.1.8"
+  resolved "https://registry.yarnpkg.com/glob-whatev/-/glob-whatev-0.1.8.tgz#a33a763262e501e851bc84fd22b5736cff3826fd"
+  dependencies:
+    minimatch "~0.2.5"
+
+glob@3.2.11, glob@~3.2.9:
+  version "3.2.11"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-3.2.11.tgz#4a973f635b9190f715d10987d5c00fd2815ebe3d"
+  dependencies:
+    inherits "2"
+    minimatch "0.3"
+
+glob@5.x, glob@^5.0.14:
+  version "5.0.15"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-5.0.15.tgz#1bc936b9e02f4a603fcc222ecf7633d30b8b93b1"
+  dependencies:
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "2 || 3"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+"glob@>= 3.1.4", glob@^7.0.0, glob@^7.0.3, glob@^7.0.5, glob@^7.0.6, glob@~7.1.1:
+  version "7.1.2"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.2.tgz#c19c9df9a028702d678612384a6552404c636d15"
+  dependencies:
+    fs.realpath "^1.0.0"
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^3.0.4"
+    once "^1.3.0"
+    path-is-absolute "^1.0.0"
+
+glob@~3.1.21:
+  version "3.1.21"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-3.1.21.tgz#d29e0a055dea5138f4d07ed40e8982e83c2066cd"
+  dependencies:
+    graceful-fs "~1.2.0"
+    inherits "1"
+    minimatch "~0.2.11"
+
+glob@~4.3.0:
+  version "4.3.5"
+  resolved "https://registry.yarnpkg.com/glob/-/glob-4.3.5.tgz#80fbb08ca540f238acce5d11d1e9bc41e75173d3"
+  dependencies:
+    inflight "^1.0.4"
+    inherits "2"
+    minimatch "^2.0.1"
+    once "^1.3.0"
+
+globals@^8.11.0:
+  version "8.18.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-8.18.0.tgz#93d4a62bdcac38cfafafc47d6b034768cb0ffcb4"
+
+globals@^9.18.0:
+  version "9.18.0"
+  resolved "https://registry.yarnpkg.com/globals/-/globals-9.18.0.tgz#aa3896b3e69b487f17e31ed2143d69a8e30c2d8a"
+
+globby@^5.0.0:
+  version "5.0.0"
+  resolved "https://registry.yarnpkg.com/globby/-/globby-5.0.0.tgz#ebd84667ca0dbb330b99bcfc68eac2bc54370e0d"
+  dependencies:
+    array-union "^1.0.1"
+    arrify "^1.0.0"
+    glob "^7.0.3"
+    object-assign "^4.0.1"
+    pify "^2.0.0"
+    pinkie-promise "^2.0.0"
+
+globule@^1.0.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/globule/-/globule-1.2.0.tgz#1dc49c6822dd9e8a2fa00ba2a295006e8664bd09"
+  dependencies:
+    glob "~7.1.1"
+    lodash "~4.17.4"
+    minimatch "~3.0.2"
+
+graceful-fs@^4.1.11, graceful-fs@^4.1.2, graceful-fs@^4.1.6, graceful-fs@^4.1.9:
+  version "4.1.11"
+  resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.1.11.tgz#0e8bdfe4d1ddb8854d64e04ea7c00e2a026e5658"
+
+graceful-fs@~1.2.0:
+  version "1.2.3"
+  resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-1.2.3.tgz#15a4806a57547cb2d2dbf27f42e89a8c3451b364"
+
+growl@1.9.2:
+  version "1.9.2"
+  resolved "https://registry.yarnpkg.com/growl/-/growl-1.9.2.tgz#0ea7743715db8d8de2c5ede1775e1b45ac85c02f"
+
+grunt-babel@^6.0.0:
+  version "6.0.0"
+  resolved "https://registry.yarnpkg.com/grunt-babel/-/grunt-babel-6.0.0.tgz#378189b487de1168c4c4a9fc88dd6005b35df960"
+  dependencies:
+    babel-core "^6.0.12"
+
+grunt-clean@^0.4.0:
+  version "0.4.0"
+  resolved "https://registry.yarnpkg.com/grunt-clean/-/grunt-clean-0.4.0.tgz#a7b4e188d7e94ca6c93bb88ec64096534931c40b"
+  dependencies:
+    grunt "~0.3.9"
+
+grunt-cli@^0.1.13:
+  version "0.1.13"
+  resolved "https://registry.yarnpkg.com/grunt-cli/-/grunt-cli-0.1.13.tgz#e9ebc4047631f5012d922770c39378133cad10f4"
+  dependencies:
+    findup-sync "~0.1.0"
+    nopt "~1.0.10"
+    resolve "~0.3.1"
+
+grunt-contrib-clean@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/grunt-contrib-clean/-/grunt-contrib-clean-1.1.0.tgz#564abf2d0378a983a15b9e3f30ee75b738c40638"
+  dependencies:
+    async "^1.5.2"
+    rimraf "^2.5.1"
+
+grunt-contrib-copy@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/grunt-contrib-copy/-/grunt-contrib-copy-1.0.0.tgz#7060c6581e904b8ab0d00f076e0a8f6e3e7c3573"
+  dependencies:
+    chalk "^1.1.1"
+    file-sync-cmp "^0.1.0"
+
+grunt-contrib-uglify@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/grunt-contrib-uglify/-/grunt-contrib-uglify-1.0.2.tgz#ae67a46f9153edd4cb11813a55eb69c70d7db2fb"
+  dependencies:
+    chalk "^1.0.0"
+    lodash "^4.0.1"
+    maxmin "^1.1.0"
+    uglify-js "~2.6.2"
+    uri-path "^1.0.0"
+
+grunt-contrib-watch@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/grunt-contrib-watch/-/grunt-contrib-watch-1.0.0.tgz#84a1a7a1d6abd26ed568413496c73133e990018f"
+  dependencies:
+    async "^1.5.0"
+    gaze "^1.0.0"
+    lodash "^3.10.1"
+    tiny-lr "^0.2.1"
+
+grunt-eslint@^17.3.1:
+  version "17.3.2"
+  resolved "https://registry.yarnpkg.com/grunt-eslint/-/grunt-eslint-17.3.2.tgz#36a8b3be6ccde88c8b58f909745d75db19e5d4b0"
+  dependencies:
+    chalk "^1.0.0"
+    eslint "^1.5.1"
+
+grunt-karma@^0.12.1:
+  version "0.12.2"
+  resolved "https://registry.yarnpkg.com/grunt-karma/-/grunt-karma-0.12.2.tgz#d52676ab94779e4b20052b5f3519eb32653dc566"
+  dependencies:
+    lodash "^3.10.1"
+
+grunt-legacy-log-utils@~0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/grunt-legacy-log-utils/-/grunt-legacy-log-utils-0.1.1.tgz#c0706b9dd9064e116f36f23fe4e6b048672c0f7e"
+  dependencies:
+    colors "~0.6.2"
+    lodash "~2.4.1"
+    underscore.string "~2.3.3"
+
+grunt-legacy-log@~0.1.0:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/grunt-legacy-log/-/grunt-legacy-log-0.1.3.tgz#ec29426e803021af59029f87d2f9cd7335a05531"
+  dependencies:
+    colors "~0.6.2"
+    grunt-legacy-log-utils "~0.1.1"
+    hooker "~0.2.3"
+    lodash "~2.4.1"
+    underscore.string "~2.3.3"
+
+grunt-legacy-util@~0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/grunt-legacy-util/-/grunt-legacy-util-0.2.0.tgz#93324884dbf7e37a9ff7c026dff451d94a9e554b"
+  dependencies:
+    async "~0.1.22"
+    exit "~0.1.1"
+    getobject "~0.1.0"
+    hooker "~0.2.3"
+    lodash "~0.9.2"
+    underscore.string "~2.2.1"
+    which "~1.0.5"
+
+grunt-mocha-istanbul@^3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/grunt-mocha-istanbul/-/grunt-mocha-istanbul-3.0.1.tgz#a33525707b2fa82eb2f7fb3230513f7ca279bf60"
+
+grunt-mocha-test@^0.12.7:
+  version "0.12.7"
+  resolved "https://registry.yarnpkg.com/grunt-mocha-test/-/grunt-mocha-test-0.12.7.tgz#c61cdf32a6762954115fe712b983e3dd8e0c9554"
+  dependencies:
+    hooker "~0.2.3"
+    mkdirp "^0.5.0"
+
+grunt-webpack@^1.0.11:
+  version "1.0.18"
+  resolved "https://registry.yarnpkg.com/grunt-webpack/-/grunt-webpack-1.0.18.tgz#ff26c43ff35bae6cca707a93c4bcdd950a3ecbb7"
+  dependencies:
+    lodash "^4.7.0"
+
+grunt@^0.4.5:
+  version "0.4.5"
+  resolved "https://registry.yarnpkg.com/grunt/-/grunt-0.4.5.tgz#56937cd5194324adff6d207631832a9d6ba4e7f0"
+  dependencies:
+    async "~0.1.22"
+    coffee-script "~1.3.3"
+    colors "~0.6.2"
+    dateformat "1.0.2-1.2.3"
+    eventemitter2 "~0.4.13"
+    exit "~0.1.1"
+    findup-sync "~0.1.2"
+    getobject "~0.1.0"
+    glob "~3.1.21"
+    grunt-legacy-log "~0.1.0"
+    grunt-legacy-util "~0.2.0"
+    hooker "~0.2.3"
+    iconv-lite "~0.2.11"
+    js-yaml "~2.0.5"
+    lodash "~0.9.2"
+    minimatch "~0.2.12"
+    nopt "~1.0.10"
+    rimraf "~2.2.8"
+    underscore.string "~2.2.1"
+    which "~1.0.5"
+
+grunt@~0.3.9:
+  version "0.3.17"
+  resolved "https://registry.yarnpkg.com/grunt/-/grunt-0.3.17.tgz#f2e034d200befd5eeb38ba5c41d4ccd7235fd64d"
+  dependencies:
+    async "~0.1.18"
+    colors "~0.6.0"
+    connect "~2.4.4"
+    dateformat "1.0.2-1.2.3"
+    glob-whatev "~0.1.4"
+    gzip-js "~0.3.1"
+    hooker "~0.2.3"
+    jshint "~0.9.1"
+    nodeunit "~0.7.4"
+    nopt "~1.0.10"
+    prompt "~0.1.12"
+    semver "~1.0.13"
+    temporary "~0.0.4"
+    uglify-js "~1.3.3"
+    underscore "~1.2.4"
+    underscore.string "~2.1.1"
+
+gzip-js@~0.3.1:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/gzip-js/-/gzip-js-0.3.2.tgz#23117efeeb28cf385248deff0dffad894836d96b"
+  dependencies:
+    crc32 ">= 0.2.2"
+    deflate-js ">= 0.2.2"
+
+gzip-size@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/gzip-size/-/gzip-size-1.0.0.tgz#66cf8b101047227b95bace6ea1da0c177ed5c22f"
+  dependencies:
+    browserify-zlib "^0.1.4"
+    concat-stream "^1.4.1"
+
+handlebars@^4.0.0, handlebars@^4.0.1, handlebars@^4.0.3:
+  version "4.0.11"
+  resolved "https://registry.yarnpkg.com/handlebars/-/handlebars-4.0.11.tgz#630a35dfe0294bc281edae6ffc5d329fc7982dcc"
+  dependencies:
+    async "^1.4.0"
+    optimist "^0.6.1"
+    source-map "^0.4.4"
+  optionalDependencies:
+    uglify-js "^2.6"
+
+har-schema@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/har-schema/-/har-schema-1.0.5.tgz#d263135f43307c02c602afc8fe95970c0151369e"
+
+har-schema@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/har-schema/-/har-schema-2.0.0.tgz#a94c2224ebcac04782a0d9035521f24735b7ec92"
+
+har-validator@^1.4.0:
+  version "1.8.0"
+  resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-1.8.0.tgz#d83842b0eb4c435960aeb108a067a3aa94c0eeb2"
+  dependencies:
+    bluebird "^2.9.30"
+    chalk "^1.0.0"
+    commander "^2.8.1"
+    is-my-json-valid "^2.12.0"
+
+har-validator@~2.0.6:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-2.0.6.tgz#cdcbc08188265ad119b6a5a7c8ab70eecfb5d27d"
+  dependencies:
+    chalk "^1.1.1"
+    commander "^2.9.0"
+    is-my-json-valid "^2.12.4"
+    pinkie-promise "^2.0.0"
+
+har-validator@~4.2.1:
+  version "4.2.1"
+  resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-4.2.1.tgz#33481d0f1bbff600dd203d75812a6a5fba002e2a"
+  dependencies:
+    ajv "^4.9.1"
+    har-schema "^1.0.5"
+
+har-validator@~5.0.3:
+  version "5.0.3"
+  resolved "https://registry.yarnpkg.com/har-validator/-/har-validator-5.0.3.tgz#ba402c266194f15956ef15e0fcf242993f6a7dfd"
+  dependencies:
+    ajv "^5.1.0"
+    har-schema "^2.0.0"
+
+has-ansi@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/has-ansi/-/has-ansi-2.0.0.tgz#34f5049ce1ecdf2b0649af3ef24e45ed35416d91"
+  dependencies:
+    ansi-regex "^2.0.0"
+
+has-binary@0.1.7:
+  version "0.1.7"
+  resolved "https://registry.yarnpkg.com/has-binary/-/has-binary-0.1.7.tgz#68e61eb16210c9545a0a5cce06a873912fe1e68c"
+  dependencies:
+    isarray "0.0.1"
+
+has-cors@1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/has-cors/-/has-cors-1.1.0.tgz#5e474793f7ea9843d1bb99c23eef49ff126fff39"
+
+has-flag@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-1.0.0.tgz#9d9e793165ce017a00f00418c43f942a7b1d11fa"
+
+has-flag@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd"
+
+has-unicode@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/has-unicode/-/has-unicode-2.0.1.tgz#e0e6fe6a28cf51138855e086d1691e771de2a8b9"
+
+hasha@^2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/hasha/-/hasha-2.2.0.tgz#78d7cbfc1e6d66303fe79837365984517b2f6ee1"
+  dependencies:
+    is-stream "^1.0.1"
+    pinkie-promise "^2.0.0"
+
+hawk@3.1.3, hawk@~3.1.3:
+  version "3.1.3"
+  resolved "https://registry.yarnpkg.com/hawk/-/hawk-3.1.3.tgz#078444bd7c1640b0fe540d2c9b73d59678e8e1c4"
+  dependencies:
+    boom "2.x.x"
+    cryptiles "2.x.x"
+    hoek "2.x.x"
+    sntp "1.x.x"
+
+hawk@~2.3.0:
+  version "2.3.1"
+  resolved "https://registry.yarnpkg.com/hawk/-/hawk-2.3.1.tgz#1e731ce39447fa1d0f6d707f7bceebec0fd1ec1f"
+  dependencies:
+    boom "2.x.x"
+    cryptiles "2.x.x"
+    hoek "2.x.x"
+    sntp "1.x.x"
+
+hawk@~6.0.2:
+  version "6.0.2"
+  resolved "https://registry.yarnpkg.com/hawk/-/hawk-6.0.2.tgz#af4d914eb065f9b5ce4d9d11c1cb2126eecc3038"
+  dependencies:
+    boom "4.x.x"
+    cryptiles "3.x.x"
+    hoek "4.x.x"
+    sntp "2.x.x"
+
+hoek@2.x.x:
+  version "2.16.3"
+  resolved "https://registry.yarnpkg.com/hoek/-/hoek-2.16.3.tgz#20bb7403d3cea398e91dc4710a8ff1b8274a25ed"
+
+hoek@4.x.x:
+  version "4.2.1"
+  resolved "https://registry.yarnpkg.com/hoek/-/hoek-4.2.1.tgz#9634502aa12c445dd5a7c5734b572bb8738aacbb"
+
+home-or-tmp@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/home-or-tmp/-/home-or-tmp-2.0.0.tgz#e36c3f2d2cae7d746a857e38d18d5f32a7882db8"
+  dependencies:
+    os-homedir "^1.0.0"
+    os-tmpdir "^1.0.1"
+
+hooker@~0.2.3:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/hooker/-/hooker-0.2.3.tgz#b834f723cc4a242aa65963459df6d984c5d3d959"
+
+hosted-git-info@^2.1.4:
+  version "2.5.0"
+  resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.5.0.tgz#6d60e34b3abbc8313062c3b798ef8d901a07af3c"
+
+http-errors@1.6.2, http-errors@~1.6.2:
+  version "1.6.2"
+  resolved "https://registry.yarnpkg.com/http-errors/-/http-errors-1.6.2.tgz#0a002cc85707192a7e7946ceedc11155f60ec736"
+  dependencies:
+    depd "1.1.1"
+    inherits "2.0.3"
+    setprototypeof "1.0.3"
+    statuses ">= 1.3.1 < 2"
+
+http-errors@~1.3.1:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/http-errors/-/http-errors-1.3.1.tgz#197e22cdebd4198585e8694ef6786197b91ed942"
+  dependencies:
+    inherits "~2.0.1"
+    statuses "1"
+
+http-parser-js@>=0.4.0:
+  version "0.4.10"
+  resolved "https://registry.yarnpkg.com/http-parser-js/-/http-parser-js-0.4.10.tgz#92c9c1374c35085f75db359ec56cc257cbb93fa4"
+
+http-proxy-middleware@~0.17.1:
+  version "0.17.4"
+  resolved "https://registry.yarnpkg.com/http-proxy-middleware/-/http-proxy-middleware-0.17.4.tgz#642e8848851d66f09d4f124912846dbaeb41b833"
+  dependencies:
+    http-proxy "^1.16.2"
+    is-glob "^3.1.0"
+    lodash "^4.17.2"
+    micromatch "^2.3.11"
+
+http-proxy@^1.13.0, http-proxy@^1.16.2:
+  version "1.16.2"
+  resolved "https://registry.yarnpkg.com/http-proxy/-/http-proxy-1.16.2.tgz#06dff292952bf64dbe8471fa9df73066d4f37742"
+  dependencies:
+    eventemitter3 "1.x.x"
+    requires-port "1.x.x"
+
+http-signature@~0.10.0:
+  version "0.10.1"
+  resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-0.10.1.tgz#4fbdac132559aa8323121e540779c0a012b27e66"
+  dependencies:
+    asn1 "0.1.11"
+    assert-plus "^0.1.5"
+    ctype "0.5.3"
+
+http-signature@~1.1.0:
+  version "1.1.1"
+  resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-1.1.1.tgz#df72e267066cd0ac67fb76adf8e134a8fbcf91bf"
+  dependencies:
+    assert-plus "^0.2.0"
+    jsprim "^1.2.2"
+    sshpk "^1.7.0"
+
+http-signature@~1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/http-signature/-/http-signature-1.2.0.tgz#9aecd925114772f3d95b65a60abb8f7c18fbace1"
+  dependencies:
+    assert-plus "^1.0.0"
+    jsprim "^1.2.2"
+    sshpk "^1.7.0"
+
+https-browserify@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/https-browserify/-/https-browserify-0.0.1.tgz#3f91365cabe60b77ed0ebba24b454e3e09d95a82"
+
+https-proxy-agent@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/https-proxy-agent/-/https-proxy-agent-1.0.0.tgz#35f7da6c48ce4ddbfa264891ac593ee5ff8671e6"
+  dependencies:
+    agent-base "2"
+    debug "2"
+    extend "3"
+
+iconv-lite@0.4.13:
+  version "0.4.13"
+  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.13.tgz#1f88aba4ab0b1508e8312acc39345f36e992e2f2"
+
+iconv-lite@0.4.19:
+  version "0.4.19"
+  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.19.tgz#f7468f60135f5e5dad3399c0a81be9a1603a082b"
+
+iconv-lite@~0.2.11:
+  version "0.2.11"
+  resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.2.11.tgz#1ce60a3a57864a292d1321ff4609ca4bb965adc8"
+
+ieee754@^1.1.4:
+  version "1.1.8"
+  resolved "https://registry.yarnpkg.com/ieee754/-/ieee754-1.1.8.tgz#be33d40ac10ef1926701f6f08a2d86fbfd1ad3e4"
+
+imurmurhash@^0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+
+indent-string@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/indent-string/-/indent-string-2.1.0.tgz#8e2d48348742121b4a8218b7a137e9a52049dc80"
+  dependencies:
+    repeating "^2.0.0"
+
+indexof@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/indexof/-/indexof-0.0.1.tgz#82dc336d232b9062179d05ab3293a66059fd435d"
+
+inflight@^1.0.4:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9"
+  dependencies:
+    once "^1.3.0"
+    wrappy "1"
+
+inherits@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-1.0.2.tgz#ca4309dadee6b54cc0b8d247e8d7c7a0975bdc9b"
+
+inherits@2, inherits@2.0.3, inherits@^2.0.1, inherits@^2.0.3, inherits@~2.0.0, inherits@~2.0.1, inherits@~2.0.3:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de"
+
+inherits@2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.1.tgz#b17d08d326b4423e568eff719f91b0b1cbdf69f1"
+
+ini@~1.3.0:
+  version "1.3.5"
+  resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.5.tgz#eee25f56db1c9ec6085e0c22778083f596abf927"
+
+inquirer@^0.11.0:
+  version "0.11.4"
+  resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-0.11.4.tgz#81e3374e8361beaff2d97016206d359d0b32fa4d"
+  dependencies:
+    ansi-escapes "^1.1.0"
+    ansi-regex "^2.0.0"
+    chalk "^1.0.0"
+    cli-cursor "^1.0.1"
+    cli-width "^1.0.1"
+    figures "^1.3.5"
+    lodash "^3.3.1"
+    readline2 "^1.0.1"
+    run-async "^0.1.0"
+    rx-lite "^3.1.2"
+    string-width "^1.0.1"
+    strip-ansi "^3.0.0"
+    through "^2.3.6"
+
+interpret@^0.6.4:
+  version "0.6.6"
+  resolved "https://registry.yarnpkg.com/interpret/-/interpret-0.6.6.tgz#fecd7a18e7ce5ca6abfb953e1f86213a49f1625b"
+
+invariant@^2.2.2:
+  version "2.2.3"
+  resolved "https://registry.yarnpkg.com/invariant/-/invariant-2.2.3.tgz#1a827dfde7dcbd7c323f0ca826be8fa7c5e9d688"
+  dependencies:
+    loose-envify "^1.0.0"
+
+invert-kv@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/invert-kv/-/invert-kv-1.0.0.tgz#104a8e4aaca6d3d8cd157a8ef8bfab2d7a3ffdb6"
+
+ipaddr.js@1.6.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/ipaddr.js/-/ipaddr.js-1.6.0.tgz#e3fa357b773da619f26e95f049d055c72796f86b"
+
+is-arrayish@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.2.1.tgz#77c99840527aa8ecb1a8ba697b80645a7a926a9d"
+
+is-binary-path@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-1.0.1.tgz#75f16642b480f187a711c814161fd3a4a7655898"
+  dependencies:
+    binary-extensions "^1.0.0"
+
+is-buffer@^1.1.5:
+  version "1.1.6"
+  resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.6.tgz#efaa2ea9daa0d7ab2ea13a97b2b8ad51fefbe8be"
+
+is-builtin-module@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-builtin-module/-/is-builtin-module-1.0.0.tgz#540572d34f7ac3119f8f76c30cbc1b1e037affbe"
+  dependencies:
+    builtin-modules "^1.0.0"
+
+is-dotfile@^1.0.0:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/is-dotfile/-/is-dotfile-1.0.3.tgz#a6a2f32ffd2dfb04f5ca25ecd0f6b83cf798a1e1"
+
+is-equal-shallow@^0.1.3:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/is-equal-shallow/-/is-equal-shallow-0.1.3.tgz#2238098fc221de0bcfa5d9eac4c45d638aa1c534"
+  dependencies:
+    is-primitive "^2.0.0"
+
+is-extendable@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-0.1.1.tgz#62b110e289a471418e3ec36a617d472e301dfc89"
+
+is-extglob@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-1.0.0.tgz#ac468177c4943405a092fc8f29760c6ffc6206c0"
+
+is-extglob@^2.1.0:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2"
+
+is-finite@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/is-finite/-/is-finite-1.0.2.tgz#cc6677695602be550ef11e8b4aa6305342b6d0aa"
+  dependencies:
+    number-is-nan "^1.0.0"
+
+is-fullwidth-code-point@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-1.0.0.tgz#ef9e31386f031a7f0d643af82fde50c457ef00cb"
+  dependencies:
+    number-is-nan "^1.0.0"
+
+is-fullwidth-code-point@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f"
+
+is-glob@^2.0.0, is-glob@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-2.0.1.tgz#d096f926a3ded5600f3fdfd91198cb0888c2d863"
+  dependencies:
+    is-extglob "^1.0.0"
+
+is-glob@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-3.1.0.tgz#7ba5ae24217804ac70707b96922567486cc3e84a"
+  dependencies:
+    is-extglob "^2.1.0"
+
+is-my-ip-valid@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-my-ip-valid/-/is-my-ip-valid-1.0.0.tgz#7b351b8e8edd4d3995d4d066680e664d94696824"
+
+is-my-json-valid@^2.10.0, is-my-json-valid@^2.12.0, is-my-json-valid@^2.12.4:
+  version "2.17.2"
+  resolved "https://registry.yarnpkg.com/is-my-json-valid/-/is-my-json-valid-2.17.2.tgz#6b2103a288e94ef3de5cf15d29dd85fc4b78d65c"
+  dependencies:
+    generate-function "^2.0.0"
+    generate-object-property "^1.1.0"
+    is-my-ip-valid "^1.0.0"
+    jsonpointer "^4.0.0"
+    xtend "^4.0.0"
+
+is-number@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/is-number/-/is-number-0.1.1.tgz#69a7af116963d47206ec9bd9b48a14216f1e3806"
+
+is-number@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/is-number/-/is-number-2.1.0.tgz#01fcbbb393463a548f2f466cce16dece49db908f"
+  dependencies:
+    kind-of "^3.0.2"
+
+is-number@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/is-number/-/is-number-3.0.0.tgz#24fd6201a4782cf50561c810276afc7d12d71195"
+  dependencies:
+    kind-of "^3.0.2"
+
+is-path-cwd@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-path-cwd/-/is-path-cwd-1.0.0.tgz#d225ec23132e89edd38fda767472e62e65f1106d"
+
+is-path-in-cwd@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-path-in-cwd/-/is-path-in-cwd-1.0.0.tgz#6477582b8214d602346094567003be8a9eac04dc"
+  dependencies:
+    is-path-inside "^1.0.0"
+
+is-path-inside@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-1.0.1.tgz#8ef5b7de50437a3fdca6b4e865ef7aa55cb48036"
+  dependencies:
+    path-is-inside "^1.0.1"
+
+is-posix-bracket@^0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/is-posix-bracket/-/is-posix-bracket-0.1.1.tgz#3334dc79774368e92f016e6fbc0a88f5cd6e6bc4"
+
+is-primitive@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/is-primitive/-/is-primitive-2.0.0.tgz#207bab91638499c07b2adf240a41a87210034575"
+
+is-property@^1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/is-property/-/is-property-1.0.2.tgz#57fe1c4e48474edd65b09911f26b1cd4095dda84"
+
+is-resolvable@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/is-resolvable/-/is-resolvable-1.1.0.tgz#fb18f87ce1feb925169c9a407c19318a3206ed88"
+
+is-stream@^1.0.1, is-stream@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44"
+
+is-typedarray@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/is-typedarray/-/is-typedarray-1.0.0.tgz#e479c80858df0c1b11ddda6940f96011fcda4a9a"
+
+is-utf8@^0.2.0:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/is-utf8/-/is-utf8-0.2.1.tgz#4b0da1442104d1b336340e80797e865cf39f7d72"
+
+isarray@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/isarray/-/isarray-0.0.1.tgz#8a18acfca9a8f4177e09abfc6038939b05d1eedf"
+
+isarray@1.0.0, isarray@^1.0.0, isarray@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11"
+
+isbinaryfile@^3.0.0:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/isbinaryfile/-/isbinaryfile-3.0.2.tgz#4a3e974ec0cba9004d3fc6cde7209ea69368a621"
+
+isexe@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10"
+
+isobject@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/isobject/-/isobject-2.1.0.tgz#f065561096a3f1da2ef46272f815c840d87e0c89"
+  dependencies:
+    isarray "1.0.0"
+
+isstream@~0.1.1, isstream@~0.1.2:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/isstream/-/isstream-0.1.2.tgz#47e63f7af55afa6f92e1500e690eb8b8529c099a"
+
+istanbul-lib-coverage@^1.1.1, istanbul-lib-coverage@^1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-coverage/-/istanbul-lib-coverage-1.1.2.tgz#4113c8ff6b7a40a1ef7350b01016331f63afde14"
+
+istanbul-lib-hook@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-hook/-/istanbul-lib-hook-1.1.0.tgz#8538d970372cb3716d53e55523dd54b557a8d89b"
+  dependencies:
+    append-transform "^0.4.0"
+
+istanbul-lib-instrument@^1.9.1:
+  version "1.9.2"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-instrument/-/istanbul-lib-instrument-1.9.2.tgz#84905bf47f7e0b401d6b840da7bad67086b4aab6"
+  dependencies:
+    babel-generator "^6.18.0"
+    babel-template "^6.16.0"
+    babel-traverse "^6.18.0"
+    babel-types "^6.18.0"
+    babylon "^6.18.0"
+    istanbul-lib-coverage "^1.1.2"
+    semver "^5.3.0"
+
+istanbul-lib-report@^1.1.2:
+  version "1.1.3"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-report/-/istanbul-lib-report-1.1.3.tgz#2df12188c0fa77990c0d2176d2d0ba3394188259"
+  dependencies:
+    istanbul-lib-coverage "^1.1.2"
+    mkdirp "^0.5.1"
+    path-parse "^1.0.5"
+    supports-color "^3.1.2"
+
+istanbul-lib-source-maps@^1.2.2:
+  version "1.2.3"
+  resolved "https://registry.yarnpkg.com/istanbul-lib-source-maps/-/istanbul-lib-source-maps-1.2.3.tgz#20fb54b14e14b3fb6edb6aca3571fd2143db44e6"
+  dependencies:
+    debug "^3.1.0"
+    istanbul-lib-coverage "^1.1.2"
+    mkdirp "^0.5.1"
+    rimraf "^2.6.1"
+    source-map "^0.5.3"
+
+istanbul-reports@^1.1.3:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/istanbul-reports/-/istanbul-reports-1.1.4.tgz#5ccba5e22b7b5a5d91d5e0a830f89be334bf97bd"
+  dependencies:
+    handlebars "^4.0.3"
+
+"istanbul@github:kpdecker/istanbul":
+  version "0.4.0"
+  resolved "https://codeload.github.com/kpdecker/istanbul/tar.gz/dd1228d2f0a6e8506cbb5dba398a8297b1dbaf22"
+  dependencies:
+    abbrev "1.0.x"
+    async "1.x"
+    convert-source-map "^1.1.1"
+    escodegen "1.7.x"
+    esprima "2.5.x"
+    fileset "0.2.x"
+    handlebars "^4.0.1"
+    js-yaml "3.x"
+    mkdirp "0.5.x"
+    nopt "3.x"
+    once "1.x"
+    resolve "1.1.x"
+    source-map "^0.4.4"
+    source-map-support "^0.3.2"
+    supports-color "^3.1.0"
+    which "^1.1.1"
+    wordwrap "^1.0.0"
+
+jade@0.26.3:
+  version "0.26.3"
+  resolved "https://registry.yarnpkg.com/jade/-/jade-0.26.3.tgz#8f10d7977d8d79f2f6ff862a81b0513ccb25686c"
+  dependencies:
+    commander "0.6.1"
+    mkdirp "0.3.0"
+
+js-tokens@^3.0.0, js-tokens@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-3.0.2.tgz#9866df395102130e38f7f996bceb65443209c25b"
+
+js-yaml@3.4.5:
+  version "3.4.5"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.4.5.tgz#c3403797df12b91866574f2de23646fe8cafb44d"
+  dependencies:
+    argparse "^1.0.2"
+    esprima "^2.6.0"
+
+js-yaml@3.6.1:
+  version "3.6.1"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.6.1.tgz#6e5fe67d8b205ce4d22fad05b7781e8dadcc4b30"
+  dependencies:
+    argparse "^1.0.7"
+    esprima "^2.6.0"
+
+js-yaml@3.x, js-yaml@^3.10.0, js-yaml@^3.2.7, js-yaml@^3.3.1:
+  version "3.10.0"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.10.0.tgz#2e78441646bd4682e963f22b6e92823c309c62dc"
+  dependencies:
+    argparse "^1.0.7"
+    esprima "^4.0.0"
+
+js-yaml@~2.0.5:
+  version "2.0.5"
+  resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-2.0.5.tgz#a25ae6509999e97df278c6719da11bd0687743a8"
+  dependencies:
+    argparse "~ 0.1.11"
+    esprima "~ 1.0.2"
+
+jsbn@~0.1.0:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/jsbn/-/jsbn-0.1.1.tgz#a5e654c2e5a2deb5f201d96cefbca80c0ef2f513"
+
+jsesc@^1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-1.3.0.tgz#46c3fec8c1892b12b0833db9bc7622176dbab34b"
+
+jsesc@~0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-0.5.0.tgz#e7dee66e35d6fc16f710fe91d5cf69f70f08911d"
+
+jshint@~0.9.1:
+  version "0.9.1"
+  resolved "https://registry.yarnpkg.com/jshint/-/jshint-0.9.1.tgz#ff32ec7f09f84001f7498eeafd63c9e4fbb2dc0e"
+  dependencies:
+    cli "0.4.3"
+    minimatch "0.0.x"
+
+json-schema-traverse@^0.3.0:
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.3.1.tgz#349a6d44c53a51de89b40805c5d5e59b417d3340"
+
+json-schema@0.2.3:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13"
+
+json-stable-stringify@^1.0.0, json-stable-stringify@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/json-stable-stringify/-/json-stable-stringify-1.0.1.tgz#9a759d39c5f2ff503fd5300646ed445f88c4f9af"
+  dependencies:
+    jsonify "~0.0.0"
+
+json-stringify-safe@~5.0.0, json-stringify-safe@~5.0.1:
+  version "5.0.1"
+  resolved "https://registry.yarnpkg.com/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz#1296a2d58fd45f19a0f6ce01d65701e2c735b6eb"
+
+json3@3.3.2, json3@^3.3.2:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/json3/-/json3-3.3.2.tgz#3c0434743df93e2f5c42aee7b19bcb483575f4e1"
+
+json5@^0.5.0, json5@^0.5.1:
+  version "0.5.1"
+  resolved "https://registry.yarnpkg.com/json5/-/json5-0.5.1.tgz#1eade7acc012034ad84e2396767ead9fa5495821"
+
+jsonfile@^2.1.0:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-2.4.0.tgz#3736a2b428b87bbda0cc83b53fa3d633a35c2ae8"
+  optionalDependencies:
+    graceful-fs "^4.1.6"
+
+jsonify@~0.0.0:
+  version "0.0.0"
+  resolved "https://registry.yarnpkg.com/jsonify/-/jsonify-0.0.0.tgz#2c74b6ee41d93ca51b7b5aaee8f503631d252a73"
+
+jsonpointer@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/jsonpointer/-/jsonpointer-4.0.1.tgz#4fd92cb34e0e9db3c89c8622ecf51f9b978c6cb9"
+
+jsprim@^1.2.2:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/jsprim/-/jsprim-1.4.1.tgz#313e66bc1e5cc06e438bc1b7499c2e5c56acb6a2"
+  dependencies:
+    assert-plus "1.0.0"
+    extsprintf "1.3.0"
+    json-schema "0.2.3"
+    verror "1.10.0"
+
+karma-mocha-reporter@^2.0.0:
+  version "2.2.5"
+  resolved "https://registry.yarnpkg.com/karma-mocha-reporter/-/karma-mocha-reporter-2.2.5.tgz#15120095e8ed819186e47a0b012f3cd741895560"
+  dependencies:
+    chalk "^2.1.0"
+    log-symbols "^2.1.0"
+    strip-ansi "^4.0.0"
+
+karma-mocha@^0.2.0:
+  version "0.2.2"
+  resolved "https://registry.yarnpkg.com/karma-mocha/-/karma-mocha-0.2.2.tgz#388ed917da15dcb196d1b915c1934ef803193f8e"
+
+karma-phantomjs-launcher@^1.0.0:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/karma-phantomjs-launcher/-/karma-phantomjs-launcher-1.0.4.tgz#d23ca34801bda9863ad318e3bb4bd4062b13acd2"
+  dependencies:
+    lodash "^4.0.1"
+    phantomjs-prebuilt "^2.1.7"
+
+karma-sauce-launcher@^0.3.0:
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/karma-sauce-launcher/-/karma-sauce-launcher-0.3.1.tgz#fa41f6afd1ad6cb7610885da83cbc9921a4d334c"
+  dependencies:
+    q "^1.4.1"
+    sauce-connect-launcher "^0.13.0"
+    saucelabs "^1.0.1"
+    wd "^0.3.4"
+
+karma-sourcemap-loader@^0.3.6:
+  version "0.3.7"
+  resolved "https://registry.yarnpkg.com/karma-sourcemap-loader/-/karma-sourcemap-loader-0.3.7.tgz#91322c77f8f13d46fed062b042e1009d4c4505d8"
+  dependencies:
+    graceful-fs "^4.1.2"
+
+karma-webpack@^1.7.0:
+  version "1.8.1"
+  resolved "https://registry.yarnpkg.com/karma-webpack/-/karma-webpack-1.8.1.tgz#39d5fd2edeea3cc3ef5b405989b37d5b0e6a3b4e"
+  dependencies:
+    async "~0.9.0"
+    loader-utils "^0.2.5"
+    lodash "^3.8.0"
+    source-map "^0.1.41"
+    webpack-dev-middleware "^1.0.11"
+
+karma@^0.13.11:
+  version "0.13.22"
+  resolved "https://registry.yarnpkg.com/karma/-/karma-0.13.22.tgz#07750b1bd063d7e7e7b91bcd2e6354d8f2aa8744"
+  dependencies:
+    batch "^0.5.3"
+    bluebird "^2.9.27"
+    body-parser "^1.12.4"
+    chokidar "^1.4.1"
+    colors "^1.1.0"
+    connect "^3.3.5"
+    core-js "^2.1.0"
+    di "^0.0.1"
+    dom-serialize "^2.2.0"
+    expand-braces "^0.1.1"
+    glob "^7.0.0"
+    graceful-fs "^4.1.2"
+    http-proxy "^1.13.0"
+    isbinaryfile "^3.0.0"
+    lodash "^3.8.0"
+    log4js "^0.6.31"
+    mime "^1.3.4"
+    minimatch "^3.0.0"
+    optimist "^0.6.1"
+    rimraf "^2.3.3"
+    socket.io "^1.4.5"
+    source-map "^0.5.3"
+    useragent "^2.1.6"
+
+kew@^0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/kew/-/kew-0.7.0.tgz#79d93d2d33363d6fdd2970b335d9141ad591d79b"
+
+kind-of@^3.0.2:
+  version "3.2.2"
+  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-3.2.2.tgz#31ea21a734bab9bbb0f32466d893aea51e4a3c64"
+  dependencies:
+    is-buffer "^1.1.5"
+
+kind-of@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-4.0.0.tgz#20813df3d712928b207378691a45066fae72dd57"
+  dependencies:
+    is-buffer "^1.1.5"
+
+klaw@^1.0.0:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/klaw/-/klaw-1.3.1.tgz#4088433b46b3b1ba259d78785d8e96f73ba02439"
+  optionalDependencies:
+    graceful-fs "^4.1.9"
+
+lazy-cache@^1.0.3:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/lazy-cache/-/lazy-cache-1.0.4.tgz#a1d78fc3a50474cb80845d3b3b6e1da49a446e8e"
+
+lazystream@~0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/lazystream/-/lazystream-0.1.0.tgz#1b25d63c772a4c20f0a5ed0a9d77f484b6e16920"
+  dependencies:
+    readable-stream "~1.0.2"
+
+lcid@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/lcid/-/lcid-1.0.0.tgz#308accafa0bc483a3867b4b6f2b9506251d1b835"
+  dependencies:
+    invert-kv "^1.0.0"
+
+lcov-parse@0.0.10:
+  version "0.0.10"
+  resolved "https://registry.yarnpkg.com/lcov-parse/-/lcov-parse-0.0.10.tgz#1b0b8ff9ac9c7889250582b70b71315d9da6d9a3"
+
+levn@~0.2.5:
+  version "0.2.5"
+  resolved "https://registry.yarnpkg.com/levn/-/levn-0.2.5.tgz#ba8d339d0ca4a610e3a3f145b9caf48807155054"
+  dependencies:
+    prelude-ls "~1.1.0"
+    type-check "~0.3.1"
+
+livereload-js@^2.2.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/livereload-js/-/livereload-js-2.3.0.tgz#c3ab22e8aaf5bf3505d80d098cbad67726548c9a"
+
+load-json-file@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-1.1.0.tgz#956905708d58b4bab4c2261b04f59f31c99374c0"
+  dependencies:
+    graceful-fs "^4.1.2"
+    parse-json "^2.2.0"
+    pify "^2.0.0"
+    pinkie-promise "^2.0.0"
+    strip-bom "^2.0.0"
+
+loader-utils@^0.2.11, loader-utils@^0.2.16, loader-utils@^0.2.5:
+  version "0.2.17"
+  resolved "https://registry.yarnpkg.com/loader-utils/-/loader-utils-0.2.17.tgz#f86e6374d43205a6e6c60e9196f17c0299bfb348"
+  dependencies:
+    big.js "^3.1.3"
+    emojis-list "^2.0.0"
+    json5 "^0.5.0"
+    object-assign "^4.0.1"
+
+locate-path@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-2.0.0.tgz#2b568b265eec944c6d9c0de9c3dbbbca0354cd8e"
+  dependencies:
+    p-locate "^2.0.0"
+    path-exists "^3.0.0"
+
+lodash._arraycopy@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash._arraycopy/-/lodash._arraycopy-3.0.0.tgz#76e7b7c1f1fb92547374878a562ed06a3e50f6e1"
+
+lodash._arrayeach@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash._arrayeach/-/lodash._arrayeach-3.0.0.tgz#bab156b2a90d3f1bbd5c653403349e5e5933ef9e"
+
+lodash._arraymap@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash._arraymap/-/lodash._arraymap-3.0.0.tgz#1a8fd0f4c0df4b61dea076d717cdc97f0a3c3e66"
+
+lodash._baseassign@^3.0.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/lodash._baseassign/-/lodash._baseassign-3.2.0.tgz#8c38a099500f215ad09e59f1722fd0c52bfe0a4e"
+  dependencies:
+    lodash._basecopy "^3.0.0"
+    lodash.keys "^3.0.0"
+
+lodash._baseclone@^3.0.0:
+  version "3.3.0"
+  resolved "https://registry.yarnpkg.com/lodash._baseclone/-/lodash._baseclone-3.3.0.tgz#303519bf6393fe7e42f34d8b630ef7794e3542b7"
+  dependencies:
+    lodash._arraycopy "^3.0.0"
+    lodash._arrayeach "^3.0.0"
+    lodash._baseassign "^3.0.0"
+    lodash._basefor "^3.0.0"
+    lodash.isarray "^3.0.0"
+    lodash.keys "^3.0.0"
+
+lodash._basecopy@^3.0.0:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/lodash._basecopy/-/lodash._basecopy-3.0.1.tgz#8da0e6a876cf344c0ad8a54882111dd3c5c7ca36"
+
+lodash._basedifference@^3.0.0:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/lodash._basedifference/-/lodash._basedifference-3.0.3.tgz#f2c204296c2a78e02b389081b6edcac933cf629c"
+  dependencies:
+    lodash._baseindexof "^3.0.0"
+    lodash._cacheindexof "^3.0.0"
+    lodash._createcache "^3.0.0"
+
+lodash._baseflatten@^3.0.0:
+  version "3.1.4"
+  resolved "https://registry.yarnpkg.com/lodash._baseflatten/-/lodash._baseflatten-3.1.4.tgz#0770ff80131af6e34f3b511796a7ba5214e65ff7"
+  dependencies:
+    lodash.isarguments "^3.0.0"
+    lodash.isarray "^3.0.0"
+
+lodash._basefor@^3.0.0:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/lodash._basefor/-/lodash._basefor-3.0.3.tgz#7550b4e9218ef09fad24343b612021c79b4c20c2"
+
+lodash._baseindexof@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/lodash._baseindexof/-/lodash._baseindexof-3.1.0.tgz#fe52b53a1c6761e42618d654e4a25789ed61822c"
+
+lodash._bindcallback@^3.0.0:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/lodash._bindcallback/-/lodash._bindcallback-3.0.1.tgz#e531c27644cf8b57a99e17ed95b35c748789392e"
+
+lodash._cacheindexof@^3.0.0:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/lodash._cacheindexof/-/lodash._cacheindexof-3.0.2.tgz#3dc69ac82498d2ee5e3ce56091bafd2adc7bde92"
+
+lodash._createassigner@^3.0.0:
+  version "3.1.1"
+  resolved "https://registry.yarnpkg.com/lodash._createassigner/-/lodash._createassigner-3.1.1.tgz#838a5bae2fdaca63ac22dee8e19fa4e6d6970b11"
+  dependencies:
+    lodash._bindcallback "^3.0.0"
+    lodash._isiterateecall "^3.0.0"
+    lodash.restparam "^3.0.0"
+
+lodash._createcache@^3.0.0:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/lodash._createcache/-/lodash._createcache-3.1.2.tgz#56d6a064017625e79ebca6b8018e17440bdcf093"
+  dependencies:
+    lodash._getnative "^3.0.0"
+
+lodash._getnative@^3.0.0:
+  version "3.9.1"
+  resolved "https://registry.yarnpkg.com/lodash._getnative/-/lodash._getnative-3.9.1.tgz#570bc7dede46d61cdcde687d65d3eecbaa3aaff5"
+
+lodash._isiterateecall@^3.0.0:
+  version "3.0.9"
+  resolved "https://registry.yarnpkg.com/lodash._isiterateecall/-/lodash._isiterateecall-3.0.9.tgz#5203ad7ba425fae842460e696db9cf3e6aac057c"
+
+lodash._pickbyarray@^3.0.0:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/lodash._pickbyarray/-/lodash._pickbyarray-3.0.2.tgz#1f898d9607eb560b0e167384b77c7c6d108aa4c5"
+
+lodash._pickbycallback@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash._pickbycallback/-/lodash._pickbycallback-3.0.0.tgz#ff61b9a017a7b3af7d30e6c53de28afa19b8750a"
+  dependencies:
+    lodash._basefor "^3.0.0"
+    lodash.keysin "^3.0.0"
+
+lodash.clonedeep@^3.0.1:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/lodash.clonedeep/-/lodash.clonedeep-3.0.2.tgz#a0a1e40d82a5ea89ff5b147b8444ed63d92827db"
+  dependencies:
+    lodash._baseclone "^3.0.0"
+    lodash._bindcallback "^3.0.0"
+
+lodash.isarguments@^3.0.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/lodash.isarguments/-/lodash.isarguments-3.1.0.tgz#2f573d85c6a24289ff00663b491c1d338ff3458a"
+
+lodash.isarray@^3.0.0:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/lodash.isarray/-/lodash.isarray-3.0.4.tgz#79e4eb88c36a8122af86f844aa9bcd851b5fbb55"
+
+lodash.isplainobject@^3.0.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/lodash.isplainobject/-/lodash.isplainobject-3.2.0.tgz#9a8238ae16b200432960cd7346512d0123fbf4c5"
+  dependencies:
+    lodash._basefor "^3.0.0"
+    lodash.isarguments "^3.0.0"
+    lodash.keysin "^3.0.0"
+
+lodash.istypedarray@^3.0.0:
+  version "3.0.6"
+  resolved "https://registry.yarnpkg.com/lodash.istypedarray/-/lodash.istypedarray-3.0.6.tgz#c9a477498607501d8e8494d283b87c39281cef62"
+
+lodash.keys@^3.0.0:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/lodash.keys/-/lodash.keys-3.1.2.tgz#4dbc0472b156be50a0b286855d1bd0b0c656098a"
+  dependencies:
+    lodash._getnative "^3.0.0"
+    lodash.isarguments "^3.0.0"
+    lodash.isarray "^3.0.0"
+
+lodash.keysin@^3.0.0:
+  version "3.0.8"
+  resolved "https://registry.yarnpkg.com/lodash.keysin/-/lodash.keysin-3.0.8.tgz#22c4493ebbedb1427962a54b445b2c8a767fb47f"
+  dependencies:
+    lodash.isarguments "^3.0.0"
+    lodash.isarray "^3.0.0"
+
+lodash.merge@^3.3.2:
+  version "3.3.2"
+  resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-3.3.2.tgz#0d90d93ed637b1878437bb3e21601260d7afe994"
+  dependencies:
+    lodash._arraycopy "^3.0.0"
+    lodash._arrayeach "^3.0.0"
+    lodash._createassigner "^3.0.0"
+    lodash._getnative "^3.0.0"
+    lodash.isarguments "^3.0.0"
+    lodash.isarray "^3.0.0"
+    lodash.isplainobject "^3.0.0"
+    lodash.istypedarray "^3.0.0"
+    lodash.keys "^3.0.0"
+    lodash.keysin "^3.0.0"
+    lodash.toplainobject "^3.0.0"
+
+lodash.omit@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/lodash.omit/-/lodash.omit-3.1.0.tgz#897fe382e6413d9ac97c61f78ed1e057a00af9f3"
+  dependencies:
+    lodash._arraymap "^3.0.0"
+    lodash._basedifference "^3.0.0"
+    lodash._baseflatten "^3.0.0"
+    lodash._bindcallback "^3.0.0"
+    lodash._pickbyarray "^3.0.0"
+    lodash._pickbycallback "^3.0.0"
+    lodash.keysin "^3.0.0"
+    lodash.restparam "^3.0.0"
+
+lodash.restparam@^3.0.0:
+  version "3.6.1"
+  resolved "https://registry.yarnpkg.com/lodash.restparam/-/lodash.restparam-3.6.1.tgz#936a4e309ef330a7645ed4145986c85ae5b20805"
+
+lodash.toplainobject@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/lodash.toplainobject/-/lodash.toplainobject-3.0.0.tgz#28790ad942d293d78aa663a07ecf7f52ca04198d"
+  dependencies:
+    lodash._basecopy "^3.0.0"
+    lodash.keysin "^3.0.0"
+
+lodash@3.10.1, lodash@^3.10.1, lodash@^3.3.1, lodash@^3.8.0:
+  version "3.10.1"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-3.10.1.tgz#5bf45e8e49ba4189e17d482789dfd15bd140b7b6"
+
+lodash@^4.0.1, lodash@^4.17.2, lodash@^4.17.4, lodash@^4.7.0, lodash@~4.17.4:
+  version "4.17.5"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.5.tgz#99a92d65c0272debe8c96b6057bc8fbfa3bed511"
+
+lodash@~0.9.2:
+  version "0.9.2"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-0.9.2.tgz#8f3499c5245d346d682e5b0d3b40767e09f1a92c"
+
+lodash@~2.4.1:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-2.4.2.tgz#fadd834b9683073da179b3eae6d9c0d15053f73e"
+
+lodash@~3.2.0:
+  version "3.2.0"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-3.2.0.tgz#4bf50a3243f9aeb0bac41a55d3d5990675a462fb"
+
+lodash@~3.9.3:
+  version "3.9.3"
+  resolved "https://registry.yarnpkg.com/lodash/-/lodash-3.9.3.tgz#0159e86832feffc6d61d852b12a953b99496bd32"
+
+log-driver@1.2.5:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/log-driver/-/log-driver-1.2.5.tgz#7ae4ec257302fd790d557cb10c97100d857b0056"
+
+log-symbols@^2.1.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-2.2.0.tgz#5740e1c5d6f0dfda4ad9323b5332107ef6b4c40a"
+  dependencies:
+    chalk "^2.0.1"
+
+log4js@^0.6.31:
+  version "0.6.38"
+  resolved "https://registry.yarnpkg.com/log4js/-/log4js-0.6.38.tgz#2c494116695d6fb25480943d3fc872e662a522fd"
+  dependencies:
+    readable-stream "~1.0.2"
+    semver "~4.3.3"
+
+"loggly@0.3.x >=0.3.7":
+  version "0.3.11"
+  resolved "https://registry.yarnpkg.com/loggly/-/loggly-0.3.11.tgz#62c1ec3436772f0954598f26b957d2ad2986b611"
+  dependencies:
+    request "2.9.x"
+    timespan "2.x.x"
+
+longest@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/longest/-/longest-1.0.1.tgz#30a0b2da38f73770e8294a0d22e6625ed77d0097"
+
+loose-envify@^1.0.0:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/loose-envify/-/loose-envify-1.3.1.tgz#d1a8ad33fa9ce0e713d65fdd0ac8b748d478c848"
+  dependencies:
+    js-tokens "^3.0.0"
+
+loud-rejection@^1.0.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/loud-rejection/-/loud-rejection-1.6.0.tgz#5b46f80147edee578870f086d04821cf998e551f"
+  dependencies:
+    currently-unhandled "^0.4.1"
+    signal-exit "^3.0.0"
+
+lru-cache@2:
+  version "2.7.3"
+  resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-2.7.3.tgz#6d4524e8b955f95d4f5b58851ce21dd72fb4e952"
+
+lru-cache@4.1.x, lru-cache@^4.0.1:
+  version "4.1.1"
+  resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-4.1.1.tgz#622e32e82488b49279114a4f9ecf45e7cd6bba55"
+  dependencies:
+    pseudomap "^1.0.2"
+    yallist "^2.1.2"
+
+lru-cache@~1.0.2:
+  version "1.0.6"
+  resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-1.0.6.tgz#aa50f97047422ac72543bda177a9c9d018d98452"
+
+map-obj@^1.0.0, map-obj@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/map-obj/-/map-obj-1.0.1.tgz#d933ceb9205d82bdcf4886f6742bdc2b4dea146d"
+
+maxmin@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/maxmin/-/maxmin-1.1.0.tgz#71365e84a99dd8f8b3f7d5fde2f00d1e7f73be61"
+  dependencies:
+    chalk "^1.0.0"
+    figures "^1.0.1"
+    gzip-size "^1.0.0"
+    pretty-bytes "^1.0.0"
+
+md5-hex@^1.2.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/md5-hex/-/md5-hex-1.3.0.tgz#d2c4afe983c4370662179b8cad145219135046c4"
+  dependencies:
+    md5-o-matic "^0.1.1"
+
+md5-o-matic@^0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/md5-o-matic/-/md5-o-matic-0.1.1.tgz#822bccd65e117c514fab176b25945d54100a03c3"
+
+media-typer@0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/media-typer/-/media-typer-0.3.0.tgz#8710d7af0aa626f8fffa1ce00168545263255748"
+
+mem@^1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/mem/-/mem-1.1.0.tgz#5edd52b485ca1d900fe64895505399a0dfa45f76"
+  dependencies:
+    mimic-fn "^1.0.0"
+
+memory-fs@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/memory-fs/-/memory-fs-0.2.0.tgz#f2bb25368bc121e391c2520de92969caee0a0290"
+
+memory-fs@~0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/memory-fs/-/memory-fs-0.3.0.tgz#7bcc6b629e3a43e871d7e29aca6ae8a7f15cbb20"
+  dependencies:
+    errno "^0.1.3"
+    readable-stream "^2.0.1"
+
+memory-fs@~0.4.1:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/memory-fs/-/memory-fs-0.4.1.tgz#3a9a20b8462523e447cfbc7e8bb80ed667bfc552"
+  dependencies:
+    errno "^0.1.3"
+    readable-stream "^2.0.1"
+
+meow@^3.1.0:
+  version "3.7.0"
+  resolved "https://registry.yarnpkg.com/meow/-/meow-3.7.0.tgz#72cb668b425228290abbfa856892587308a801fb"
+  dependencies:
+    camelcase-keys "^2.0.0"
+    decamelize "^1.1.2"
+    loud-rejection "^1.0.0"
+    map-obj "^1.0.1"
+    minimist "^1.1.3"
+    normalize-package-data "^2.3.4"
+    object-assign "^4.0.1"
+    read-pkg-up "^1.0.1"
+    redent "^1.0.0"
+    trim-newlines "^1.0.0"
+
+merge-descriptors@1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/merge-descriptors/-/merge-descriptors-1.0.1.tgz#b00aaa556dd8b44568150ec9d1b953f3f90cbb61"
+
+merge-source-map@^1.0.2:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/merge-source-map/-/merge-source-map-1.1.0.tgz#2fdde7e6020939f70906a68f2d7ae685e4c8c646"
+  dependencies:
+    source-map "^0.6.1"
+
+methods@~1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/methods/-/methods-1.1.2.tgz#5529a4d67654134edcc5266656835b0f851afcee"
+
+micromatch@^2.1.5, micromatch@^2.3.11:
+  version "2.3.11"
+  resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-2.3.11.tgz#86677c97d1720b363431d04d0d15293bd38c1565"
+  dependencies:
+    arr-diff "^2.0.0"
+    array-unique "^0.2.1"
+    braces "^1.8.2"
+    expand-brackets "^0.1.4"
+    extglob "^0.3.1"
+    filename-regex "^2.0.0"
+    is-extglob "^1.0.0"
+    is-glob "^2.0.1"
+    kind-of "^3.0.2"
+    normalize-path "^2.0.1"
+    object.omit "^2.0.0"
+    parse-glob "^3.0.4"
+    regex-cache "^0.4.2"
+
+"mime-db@>= 1.33.0 < 2", mime-db@~1.33.0:
+  version "1.33.0"
+  resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.33.0.tgz#a3492050a5cb9b63450541e39d9788d2272783db"
+
+mime-db@~1.12.0:
+  version "1.12.0"
+  resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.12.0.tgz#3d0c63180f458eb10d325aaa37d7c58ae312e9d7"
+
+mime-types@^2.1.12, mime-types@~2.1.11, mime-types@~2.1.17, mime-types@~2.1.18, mime-types@~2.1.7:
+  version "2.1.18"
+  resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.18.tgz#6f323f60a83d11146f831ff11fd66e2fe5503bb8"
+  dependencies:
+    mime-db "~1.33.0"
+
+mime-types@~2.0.1, mime-types@~2.0.3:
+  version "2.0.14"
+  resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.0.14.tgz#310e159db23e077f8bb22b748dabfa4957140aa6"
+  dependencies:
+    mime-db "~1.12.0"
+
+mime@1.2.6:
+  version "1.2.6"
+  resolved "https://registry.yarnpkg.com/mime/-/mime-1.2.6.tgz#b1f86c768c025fa87b48075f1709f28aeaf20365"
+
+mime@1.4.1:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/mime/-/mime-1.4.1.tgz#121f9ebc49e3766f311a76e1fa1c8003c4b03aa6"
+
+mime@^1.3.4, mime@^1.5.0:
+  version "1.6.0"
+  resolved "https://registry.yarnpkg.com/mime/-/mime-1.6.0.tgz#32cd9e5c64553bd58d19a568af452acff04981b1"
+
+mimic-fn@^1.0.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.2.0.tgz#820c86a39334640e99516928bd03fca88057d022"
+
+minimatch@0.0.x:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-0.0.5.tgz#96bb490bbd3ba6836bbfac111adf75301b1584de"
+  dependencies:
+    lru-cache "~1.0.2"
+
+minimatch@0.3:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-0.3.0.tgz#275d8edaac4f1bb3326472089e7949c8394699dd"
+  dependencies:
+    lru-cache "2"
+    sigmund "~1.0.0"
+
+"minimatch@2 || 3", minimatch@^3.0.0, minimatch@^3.0.2, minimatch@^3.0.4, minimatch@~3.0.2:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083"
+  dependencies:
+    brace-expansion "^1.1.7"
+
+minimatch@2.x, minimatch@^2.0.1:
+  version "2.0.10"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-2.0.10.tgz#8d087c39c6b38c001b97fca7ce6d0e1e80afbac7"
+  dependencies:
+    brace-expansion "^1.0.0"
+
+minimatch@~0.2.11, minimatch@~0.2.12, minimatch@~0.2.5:
+  version "0.2.14"
+  resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-0.2.14.tgz#c74e780574f63c6f9a090e90efbe6ef53a6a756a"
+  dependencies:
+    lru-cache "2"
+    sigmund "~1.0.0"
+
+minimist@0.0.8:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d"
+
+minimist@1.2.0, minimist@^1.1.3, minimist@^1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.0.tgz#a35008b20f41383eec1fb914f4cd5df79a264284"
+
+minimist@~0.0.1:
+  version "0.0.10"
+  resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.10.tgz#de3f98543dbf96082be48ad1a0c7cda836301dcf"
+
+minipass@^2.2.0, minipass@^2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/minipass/-/minipass-2.2.1.tgz#5ada97538b1027b4cf7213432428578cb564011f"
+  dependencies:
+    yallist "^3.0.0"
+
+mkdirp@0.3.0:
+  version "0.3.0"
+  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.3.0.tgz#1bbf5ab1ba827af23575143490426455f481fe1e"
+
+mkdirp@0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.0.tgz#1d73076a6df986cd9344e15e71fcc05a4c9abf12"
+  dependencies:
+    minimist "0.0.8"
+
+mkdirp@0.5.1, mkdirp@0.5.x, "mkdirp@>=0.5 0", mkdirp@^0.5.0, mkdirp@^0.5.1, mkdirp@~0.5.0:
+  version "0.5.1"
+  resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.1.tgz#30057438eac6cf7f8c4767f38648d6697d75c903"
+  dependencies:
+    minimist "0.0.8"
+
+mocha@^2.3.3:
+  version "2.5.3"
+  resolved "https://registry.yarnpkg.com/mocha/-/mocha-2.5.3.tgz#161be5bdeb496771eb9b35745050b622b5aefc58"
+  dependencies:
+    commander "2.3.0"
+    debug "2.2.0"
+    diff "1.4.0"
+    escape-string-regexp "1.0.2"
+    glob "3.2.11"
+    growl "1.9.2"
+    jade "0.26.3"
+    mkdirp "0.5.1"
+    supports-color "1.2.0"
+    to-iso-string "0.0.2"
+
+modify-babel-preset@2.0.2:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/modify-babel-preset/-/modify-babel-preset-2.0.2.tgz#bfa509669fe49f4222c0ce171ba44ed0e81551e7"
+  dependencies:
+    require-relative "^0.8.7"
+
+ms@0.7.1:
+  version "0.7.1"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-0.7.1.tgz#9cd13c03adbff25b65effde7ce864ee952017098"
+
+ms@0.7.2:
+  version "0.7.2"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-0.7.2.tgz#ae25cf2512b3885a1d95d7f037868d8431124765"
+
+ms@2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8"
+
+mute-stream@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.5.tgz#8fbfabb0a98a253d3184331f9e8deb7372fac6c0"
+
+nan@^2.3.0:
+  version "2.9.2"
+  resolved "https://registry.yarnpkg.com/nan/-/nan-2.9.2.tgz#f564d75f5f8f36a6d9456cca7a6c4fe488ab7866"
+
+negotiator@0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/negotiator/-/negotiator-0.6.1.tgz#2b327184e8992101177b28563fb5e7102acd0ca9"
+
+node-int64@~0.3.0:
+  version "0.3.3"
+  resolved "https://registry.yarnpkg.com/node-int64/-/node-int64-0.3.3.tgz#2d6e6b2ece5de8588b43d88d1bc41b26cd1fa84d"
+
+node-libs-browser@^0.7.0:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/node-libs-browser/-/node-libs-browser-0.7.0.tgz#3e272c0819e308935e26674408d7af0e1491b83b"
+  dependencies:
+    assert "^1.1.1"
+    browserify-zlib "^0.1.4"
+    buffer "^4.9.0"
+    console-browserify "^1.1.0"
+    constants-browserify "^1.0.0"
+    crypto-browserify "3.3.0"
+    domain-browser "^1.1.1"
+    events "^1.0.0"
+    https-browserify "0.0.1"
+    os-browserify "^0.2.0"
+    path-browserify "0.0.0"
+    process "^0.11.0"
+    punycode "^1.2.4"
+    querystring-es3 "^0.2.0"
+    readable-stream "^2.0.5"
+    stream-browserify "^2.0.1"
+    stream-http "^2.3.1"
+    string_decoder "^0.10.25"
+    timers-browserify "^2.0.2"
+    tty-browserify "0.0.0"
+    url "^0.11.0"
+    util "^0.10.3"
+    vm-browserify "0.0.4"
+
+node-pre-gyp@^0.6.39:
+  version "0.6.39"
+  resolved "https://registry.yarnpkg.com/node-pre-gyp/-/node-pre-gyp-0.6.39.tgz#c00e96860b23c0e1420ac7befc5044e1d78d8649"
+  dependencies:
+    detect-libc "^1.0.2"
+    hawk "3.1.3"
+    mkdirp "^0.5.1"
+    nopt "^4.0.1"
+    npmlog "^4.0.2"
+    rc "^1.1.7"
+    request "2.81.0"
+    rimraf "^2.6.1"
+    semver "^5.3.0"
+    tar "^2.2.1"
+    tar-pack "^3.4.0"
+
+node-uuid@~1.4.0:
+  version "1.4.8"
+  resolved "https://registry.yarnpkg.com/node-uuid/-/node-uuid-1.4.8.tgz#b040eb0923968afabf8d32fb1f17f1167fdab907"
+
+nodeunit@~0.7.4:
+  version "0.7.4"
+  resolved "https://registry.yarnpkg.com/nodeunit/-/nodeunit-0.7.4.tgz#c908def7f299fbe65ff7ac888782955c46aae9f8"
+  dependencies:
+    tap ">=0.2.3"
+
+nopt@3.x:
+  version "3.0.6"
+  resolved "https://registry.yarnpkg.com/nopt/-/nopt-3.0.6.tgz#c6465dbf08abcd4db359317f79ac68a646b28ff9"
+  dependencies:
+    abbrev "1"
+
+nopt@^4.0.1:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/nopt/-/nopt-4.0.1.tgz#d0d4685afd5415193c8c7505602d0d17cd64474d"
+  dependencies:
+    abbrev "1"
+    osenv "^0.1.4"
+
+nopt@~1.0.10:
+  version "1.0.10"
+  resolved "https://registry.yarnpkg.com/nopt/-/nopt-1.0.10.tgz#6ddd21bd2a31417b92727dd585f8a6f37608ebee"
+  dependencies:
+    abbrev "1"
+
+normalize-package-data@^2.3.2, normalize-package-data@^2.3.4:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/normalize-package-data/-/normalize-package-data-2.4.0.tgz#12f95a307d58352075a04907b84ac8be98ac012f"
+  dependencies:
+    hosted-git-info "^2.1.4"
+    is-builtin-module "^1.0.0"
+    semver "2 || 3 || 4 || 5"
+    validate-npm-package-license "^3.0.1"
+
+normalize-path@^2.0.0, normalize-path@^2.0.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-2.1.1.tgz#1ab28b556e198363a8c1a6f7e6fa20137fe6aed9"
+  dependencies:
+    remove-trailing-separator "^1.0.1"
+
+npm-run-path@^2.0.0:
+  version "2.0.2"
+  resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-2.0.2.tgz#35a9232dfa35d7067b4cb2ddf2357b1871536c5f"
+  dependencies:
+    path-key "^2.0.0"
+
+npmlog@^4.0.2:
+  version "4.1.2"
+  resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.1.2.tgz#08a7f2a8bf734604779a9efa4ad5cc717abb954b"
+  dependencies:
+    are-we-there-yet "~1.1.2"
+    console-control-strings "~1.1.0"
+    gauge "~2.7.3"
+    set-blocking "~2.0.0"
+
+number-is-nan@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/number-is-nan/-/number-is-nan-1.0.1.tgz#097b602b53422a522c1afb8790318336941a011d"
+
+nyc@^11.3.0:
+  version "11.4.1"
+  resolved "https://registry.yarnpkg.com/nyc/-/nyc-11.4.1.tgz#13fdf7e7ef22d027c61d174758f6978a68f4f5e5"
+  dependencies:
+    archy "^1.0.0"
+    arrify "^1.0.1"
+    caching-transform "^1.0.0"
+    convert-source-map "^1.3.0"
+    debug-log "^1.0.1"
+    default-require-extensions "^1.0.0"
+    find-cache-dir "^0.1.1"
+    find-up "^2.1.0"
+    foreground-child "^1.5.3"
+    glob "^7.0.6"
+    istanbul-lib-coverage "^1.1.1"
+    istanbul-lib-hook "^1.1.0"
+    istanbul-lib-instrument "^1.9.1"
+    istanbul-lib-report "^1.1.2"
+    istanbul-lib-source-maps "^1.2.2"
+    istanbul-reports "^1.1.3"
+    md5-hex "^1.2.0"
+    merge-source-map "^1.0.2"
+    micromatch "^2.3.11"
+    mkdirp "^0.5.0"
+    resolve-from "^2.0.0"
+    rimraf "^2.5.4"
+    signal-exit "^3.0.1"
+    spawn-wrap "^1.4.2"
+    test-exclude "^4.1.1"
+    yargs "^10.0.3"
+    yargs-parser "^8.0.0"
+
+oauth-sign@~0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/oauth-sign/-/oauth-sign-0.6.0.tgz#7dbeae44f6ca454e1f168451d630746735813ce3"
+
+oauth-sign@~0.8.1, oauth-sign@~0.8.2:
+  version "0.8.2"
+  resolved "https://registry.yarnpkg.com/oauth-sign/-/oauth-sign-0.8.2.tgz#46a6ab7f0aead8deae9ec0565780b7d4efeb9d43"
+
+object-assign@4.1.0:
+  version "4.1.0"
+  resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.0.tgz#7a3b3d0e98063d43f4c03f2e8ae6cd51a86883a0"
+
+object-assign@^4.0.1, object-assign@^4.1.0:
+  version "4.1.1"
+  resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863"
+
+object-component@0.0.3:
+  version "0.0.3"
+  resolved "https://registry.yarnpkg.com/object-component/-/object-component-0.0.3.tgz#f0c69aa50efc95b866c186f400a33769cb2f1291"
+
+object.omit@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/object.omit/-/object.omit-2.0.1.tgz#1a9c744829f39dbb858c76ca3579ae2a54ebd1fa"
+  dependencies:
+    for-own "^0.1.4"
+    is-extendable "^0.1.1"
+
+on-finished@~2.3.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/on-finished/-/on-finished-2.3.0.tgz#20f1336481b083cd75337992a16971aa2d906947"
+  dependencies:
+    ee-first "1.1.1"
+
+on-headers@~1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/on-headers/-/on-headers-1.0.1.tgz#928f5d0f470d49342651ea6794b0857c100693f7"
+
+once@1.x, once@^1.3.0, once@^1.3.3, once@^1.4.0:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1"
+  dependencies:
+    wrappy "1"
+
+onetime@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/onetime/-/onetime-1.1.0.tgz#a1f7838f8314c516f05ecefcbc4ccfe04b4ed789"
+
+open@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/open/-/open-0.0.5.tgz#42c3e18ec95466b6bf0dc42f3a2945c3f0cad8fc"
+
+opener@^1.4.1:
+  version "1.4.3"
+  resolved "https://registry.yarnpkg.com/opener/-/opener-1.4.3.tgz#5c6da2c5d7e5831e8ffa3964950f8d6674ac90b8"
+
+optimist@^0.6.1, optimist@~0.6.0, optimist@~0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/optimist/-/optimist-0.6.1.tgz#da3ea74686fa21a19a111c326e90eb15a0196686"
+  dependencies:
+    minimist "~0.0.1"
+    wordwrap "~0.0.2"
+
+optionator@^0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.5.0.tgz#b75a8995a2d417df25b6e4e3862f50aa88651368"
+  dependencies:
+    deep-is "~0.1.2"
+    fast-levenshtein "~1.0.0"
+    levn "~0.2.5"
+    prelude-ls "~1.1.1"
+    type-check "~0.3.1"
+    wordwrap "~0.0.2"
+
+optionator@^0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.6.0.tgz#b63ecbbf0e315fad4bc9827b45dc7ba45284fcb6"
+  dependencies:
+    deep-is "~0.1.3"
+    fast-levenshtein "~1.0.6"
+    levn "~0.2.5"
+    prelude-ls "~1.1.1"
+    type-check "~0.3.1"
+    wordwrap "~0.0.2"
+
+options@>=0.0.5:
+  version "0.0.6"
+  resolved "https://registry.yarnpkg.com/options/-/options-0.0.6.tgz#ec22d312806bb53e731773e7cdaefcf1c643128f"
+
+original@>=0.0.5:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/original/-/original-1.0.0.tgz#9147f93fa1696d04be61e01bd50baeaca656bd3b"
+  dependencies:
+    url-parse "1.0.x"
+
+os-browserify@^0.2.0:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/os-browserify/-/os-browserify-0.2.1.tgz#63fc4ccee5d2d7763d26bbf8601078e6c2e0044f"
+
+os-homedir@^1.0.0, os-homedir@^1.0.1, os-homedir@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/os-homedir/-/os-homedir-1.0.2.tgz#ffbc4988336e0e833de0c168c7ef152121aa7fb3"
+
+os-locale@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/os-locale/-/os-locale-2.1.0.tgz#42bc2900a6b5b8bd17376c8e882b65afccf24bf2"
+  dependencies:
+    execa "^0.7.0"
+    lcid "^1.0.0"
+    mem "^1.1.0"
+
+os-tmpdir@^1.0.0, os-tmpdir@^1.0.1, os-tmpdir@~1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
+
+osenv@^0.1.4:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/osenv/-/osenv-0.1.5.tgz#85cdfafaeb28e8677f416e287592b5f3f49ea410"
+  dependencies:
+    os-homedir "^1.0.0"
+    os-tmpdir "^1.0.0"
+
+own-or-env@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/own-or-env/-/own-or-env-1.0.1.tgz#54ce601d3bf78236c5c65633aa1c8ec03f8007e4"
+  dependencies:
+    own-or "^1.0.0"
+
+own-or@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/own-or/-/own-or-1.0.0.tgz#4e877fbeda9a2ec8000fbc0bcae39645ee8bf8dc"
+
+p-finally@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/p-finally/-/p-finally-1.0.0.tgz#3fbcfb15b899a44123b34b6dcc18b724336a2cae"
+
+p-limit@^1.1.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-1.2.0.tgz#0e92b6bedcb59f022c13d0f1949dc82d15909f1c"
+  dependencies:
+    p-try "^1.0.0"
+
+p-locate@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-2.0.0.tgz#20a0103b222a70c8fd39cc2e580680f3dde5ec43"
+  dependencies:
+    p-limit "^1.1.0"
+
+p-try@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/p-try/-/p-try-1.0.0.tgz#cbc79cdbaf8fd4228e13f621f2b1a237c1b207b3"
+
+"package@>= 1.0.0 < 1.2.0":
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/package/-/package-1.0.1.tgz#d25a1f99e2506dcb27d6704b83dca8a312e4edcc"
+
+pako@~0.2.0:
+  version "0.2.9"
+  resolved "https://registry.yarnpkg.com/pako/-/pako-0.2.9.tgz#f3f7522f4ef782348da8161bad9ecfd51bf83a75"
+
+parse-glob@^3.0.4:
+  version "3.0.4"
+  resolved "https://registry.yarnpkg.com/parse-glob/-/parse-glob-3.0.4.tgz#b2c376cfb11f35513badd173ef0bb6e3a388391c"
+  dependencies:
+    glob-base "^0.3.0"
+    is-dotfile "^1.0.0"
+    is-extglob "^1.0.0"
+    is-glob "^2.0.0"
+
+parse-json@^2.2.0:
+  version "2.2.0"
+  resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-2.2.0.tgz#f480f40434ef80741f8469099f8dea18f55a4dc9"
+  dependencies:
+    error-ex "^1.2.0"
+
+parsejson@0.0.3:
+  version "0.0.3"
+  resolved "https://registry.yarnpkg.com/parsejson/-/parsejson-0.0.3.tgz#ab7e3759f209ece99437973f7d0f1f64ae0e64ab"
+  dependencies:
+    better-assert "~1.0.0"
+
+parseqs@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/parseqs/-/parseqs-0.0.5.tgz#d5208a3738e46766e291ba2ea173684921a8b89d"
+  dependencies:
+    better-assert "~1.0.0"
+
+parseuri@0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/parseuri/-/parseuri-0.0.5.tgz#80204a50d4dbb779bfdc6ebe2778d90e4bce320a"
+  dependencies:
+    better-assert "~1.0.0"
+
+parseurl@~1.3.0, parseurl@~1.3.2:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/parseurl/-/parseurl-1.3.2.tgz#fc289d4ed8993119460c156253262cdc8de65bf3"
+
+path-browserify@0.0.0:
+  version "0.0.0"
+  resolved "https://registry.yarnpkg.com/path-browserify/-/path-browserify-0.0.0.tgz#a0b870729aae214005b7d5032ec2cbbb0fb4451a"
+
+path-exists@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-2.1.0.tgz#0feb6c64f0fc518d9a754dd5efb62c7022761f4b"
+  dependencies:
+    pinkie-promise "^2.0.0"
+
+path-exists@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-3.0.0.tgz#ce0ebeaa5f78cb18925ea7d810d7b59b010fd515"
+
+path-is-absolute@^1.0.0, path-is-absolute@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f"
+
+path-is-inside@^1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53"
+
+path-key@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40"
+
+path-parse@^1.0.5:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/path-parse/-/path-parse-1.0.5.tgz#3c1adf871ea9cd6c9431b6ea2bd74a0ff055c4c1"
+
+path-to-regexp@0.1.7:
+  version "0.1.7"
+  resolved "https://registry.yarnpkg.com/path-to-regexp/-/path-to-regexp-0.1.7.tgz#df604178005f522f15eb4490e7247a1bfaa67f8c"
+
+path-type@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/path-type/-/path-type-1.1.0.tgz#59c44f7ee491da704da415da5a4070ba4f8fe441"
+  dependencies:
+    graceful-fs "^4.1.2"
+    pify "^2.0.0"
+    pinkie-promise "^2.0.0"
+
+pause@0.0.1:
+  version "0.0.1"
+  resolved "https://registry.yarnpkg.com/pause/-/pause-0.0.1.tgz#1d408b3fdb76923b9543d96fb4c9dfd535d9cb5d"
+
+pbkdf2-compat@2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/pbkdf2-compat/-/pbkdf2-compat-2.0.1.tgz#b6e0c8fa99494d94e0511575802a59a5c142f288"
+
+pend@~1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/pend/-/pend-1.2.0.tgz#7a57eb550a6783f9115331fcf4663d5c8e007a50"
+
+performance-now@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/performance-now/-/performance-now-0.2.0.tgz#33ef30c5c77d4ea21c5a53869d91b56d8f2555e5"
+
+performance-now@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/performance-now/-/performance-now-2.1.0.tgz#6309f4e0e5fa913ec1c69307ae364b4b377c9e7b"
+
+phantomjs-prebuilt@^2.1.5, phantomjs-prebuilt@^2.1.7:
+  version "2.1.16"
+  resolved "https://registry.yarnpkg.com/phantomjs-prebuilt/-/phantomjs-prebuilt-2.1.16.tgz#efd212a4a3966d3647684ea8ba788549be2aefef"
+  dependencies:
+    es6-promise "^4.0.3"
+    extract-zip "^1.6.5"
+    fs-extra "^1.0.0"
+    hasha "^2.2.0"
+    kew "^0.7.0"
+    progress "^1.1.8"
+    request "^2.81.0"
+    request-progress "^2.0.1"
+    which "^1.2.10"
+
+pify@^2.0.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c"
+
+pinkie-promise@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-2.0.1.tgz#2135d6dfa7a358c069ac9b178776288228450ffa"
+  dependencies:
+    pinkie "^2.0.0"
+
+pinkie@^2.0.0:
+  version "2.0.4"
+  resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-2.0.4.tgz#72556b80cfa0d48a974e80e77248e80ed4f7f870"
+
+pkg-dir@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/pkg-dir/-/pkg-dir-1.0.0.tgz#7a4b508a8d5bb2d629d447056ff4e9c9314cf3d4"
+  dependencies:
+    find-up "^1.0.0"
+
+pkginfo@0.2.x:
+  version "0.2.3"
+  resolved "https://registry.yarnpkg.com/pkginfo/-/pkginfo-0.2.3.tgz#7239c42a5ef6c30b8f328439d9b9ff71042490f8"
+
+pkginfo@0.x.x:
+  version "0.4.1"
+  resolved "https://registry.yarnpkg.com/pkginfo/-/pkginfo-0.4.1.tgz#b5418ef0439de5425fc4995042dced14fb2a84ff"
+
+prelude-ls@~1.1.0, prelude-ls@~1.1.1, prelude-ls@~1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.1.2.tgz#21932a549f5e52ffd9a827f570e04be62a97da54"
+
+preserve@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/preserve/-/preserve-0.2.0.tgz#815ed1f6ebc65926f865b310c0713bcb3315ce4b"
+
+pretty-bytes@^1.0.0:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/pretty-bytes/-/pretty-bytes-1.0.4.tgz#0a22e8210609ad35542f8c8d5d2159aff0751c84"
+  dependencies:
+    get-stdin "^4.0.1"
+    meow "^3.1.0"
+
+private@^0.1.6, private@^0.1.7, private@~0.1.5:
+  version "0.1.8"
+  resolved "https://registry.yarnpkg.com/private/-/private-0.1.8.tgz#2381edb3689f7a53d653190060fcf822d2f368ff"
+
+process-nextick-args@~2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.0.tgz#a37d732f4271b4ab1ad070d35508e8290788ffaa"
+
+process@^0.11.0:
+  version "0.11.10"
+  resolved "https://registry.yarnpkg.com/process/-/process-0.11.10.tgz#7332300e840161bda3e69a1d1d91a7d4bc16f182"
+
+progress@^1.1.8:
+  version "1.1.8"
+  resolved "https://registry.yarnpkg.com/progress/-/progress-1.1.8.tgz#e260c78f6161cdd9b0e56cc3e0a85de17c7a57be"
+
+prompt@~0.1.12:
+  version "0.1.12"
+  resolved "https://registry.yarnpkg.com/prompt/-/prompt-0.1.12.tgz#d3114e4fb985ac66eaa35586dcb7b3fb3b27bfc6"
+  dependencies:
+    async "0.1.x"
+    colors "0.x.x"
+    pkginfo "0.x.x"
+    winston "0.5.x"
+
+proxy-addr@~2.0.2:
+  version "2.0.3"
+  resolved "https://registry.yarnpkg.com/proxy-addr/-/proxy-addr-2.0.3.tgz#355f262505a621646b3130a728eb647e22055341"
+  dependencies:
+    forwarded "~0.1.2"
+    ipaddr.js "1.6.0"
+
+prr@~1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/prr/-/prr-1.0.1.tgz#d3fc114ba06995a45ec6893f484ceb1d78f5f476"
+
+pseudomap@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/pseudomap/-/pseudomap-1.0.2.tgz#f052a28da70e618917ef0a8ac34c1ae5a68286b3"
+
+punycode@1.3.2:
+  version "1.3.2"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.3.2.tgz#9653a036fb7c1ee42342f2325cceefea3926c48d"
+
+punycode@^1.2.4, punycode@^1.3.2, punycode@^1.4.1:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.4.1.tgz#c0d5a63b2718800ad8e1eb0fa5269c84dd41845e"
+
+q@^1.4.1:
+  version "1.5.1"
+  resolved "https://registry.yarnpkg.com/q/-/q-1.5.1.tgz#7e32f75b41381291d04611f1bf14109ac00651d7"
+
+q@~1.4.1:
+  version "1.4.1"
+  resolved "https://registry.yarnpkg.com/q/-/q-1.4.1.tgz#55705bcd93c5f3673530c2c2cbc0c2b3addc286e"
+
+qs@0.5.1:
+  version "0.5.1"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-0.5.1.tgz#9f6bf5d9ac6c76384e95d36d15b48980e5e4add0"
+
+qs@5.2.0:
+  version "5.2.0"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-5.2.0.tgz#a9f31142af468cb72b25b30136ba2456834916be"
+
+qs@6.5.1, qs@~6.5.1:
+  version "6.5.1"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-6.5.1.tgz#349cdf6eef89ec45c12d7d5eb3fc0c870343a6d8"
+
+qs@~2.4.0:
+  version "2.4.2"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-2.4.2.tgz#f7ce788e5777df0b5010da7f7c4e73ba32470f5a"
+
+qs@~5.1.0:
+  version "5.1.0"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-5.1.0.tgz#4d932e5c7ea411cca76a312d39a606200fd50cd9"
+
+qs@~6.3.0:
+  version "6.3.2"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-6.3.2.tgz#e75bd5f6e268122a2a0e0bda630b2550c166502c"
+
+qs@~6.4.0:
+  version "6.4.0"
+  resolved "https://registry.yarnpkg.com/qs/-/qs-6.4.0.tgz#13e26d28ad6b0ffaa91312cd3bf708ed351e7233"
+
+querystring-es3@^0.2.0:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/querystring-es3/-/querystring-es3-0.2.1.tgz#9ec61f79049875707d69414596fd907a4d711e73"
+
+querystring@0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/querystring/-/querystring-0.2.0.tgz#b209849203bb25df820da756e747005878521620"
+
+querystringify@0.0.x:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/querystringify/-/querystringify-0.0.4.tgz#0cf7f84f9463ff0ae51c4c4b142d95be37724d9c"
+
+querystringify@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/querystringify/-/querystringify-1.0.0.tgz#6286242112c5b712fa654e526652bf6a13ff05cb"
+
+randomatic@^1.1.3:
+  version "1.1.7"
+  resolved "https://registry.yarnpkg.com/randomatic/-/randomatic-1.1.7.tgz#c7abe9cc8b87c0baa876b19fde83fd464797e38c"
+  dependencies:
+    is-number "^3.0.0"
+    kind-of "^4.0.0"
+
+range-parser@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/range-parser/-/range-parser-0.0.4.tgz#c0427ffef51c10acba0782a46c9602e744ff620b"
+
+range-parser@^1.0.3, range-parser@~1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/range-parser/-/range-parser-1.2.0.tgz#f49be6b487894ddc40dcc94a322f611092e00d5e"
+
+raw-body@2.3.2:
+  version "2.3.2"
+  resolved "https://registry.yarnpkg.com/raw-body/-/raw-body-2.3.2.tgz#bcd60c77d3eb93cde0050295c3f379389bc88f89"
+  dependencies:
+    bytes "3.0.0"
+    http-errors "1.6.2"
+    iconv-lite "0.4.19"
+    unpipe "1.0.0"
+
+raw-body@~2.1.5:
+  version "2.1.7"
+  resolved "https://registry.yarnpkg.com/raw-body/-/raw-body-2.1.7.tgz#adfeace2e4fb3098058014d08c072dcc59758774"
+  dependencies:
+    bytes "2.4.0"
+    iconv-lite "0.4.13"
+    unpipe "1.0.0"
+
+rc@^1.1.7:
+  version "1.2.5"
+  resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.5.tgz#275cd687f6e3b36cc756baa26dfee80a790301fd"
+  dependencies:
+    deep-extend "~0.4.0"
+    ini "~1.3.0"
+    minimist "^1.2.0"
+    strip-json-comments "~2.0.1"
+
+read-pkg-up@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-1.0.1.tgz#9d63c13276c065918d57f002a57f40a1b643fb02"
+  dependencies:
+    find-up "^1.0.0"
+    read-pkg "^1.0.0"
+
+read-pkg@^1.0.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-1.1.0.tgz#f5ffaa5ecd29cb31c0474bca7d756b6bb29e3f28"
+  dependencies:
+    load-json-file "^1.0.0"
+    normalize-package-data "^2.3.2"
+    path-type "^1.0.0"
+
+readable-stream@^2, readable-stream@^2.0.1, readable-stream@^2.0.2, readable-stream@^2.0.5, readable-stream@^2.0.6, readable-stream@^2.1.4, readable-stream@^2.1.5, readable-stream@^2.2.2, readable-stream@^2.3.3:
+  version "2.3.5"
+  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.5.tgz#b4f85003a938cbb6ecbce2a124fb1012bd1a838d"
+  dependencies:
+    core-util-is "~1.0.0"
+    inherits "~2.0.3"
+    isarray "~1.0.0"
+    process-nextick-args "~2.0.0"
+    safe-buffer "~5.1.1"
+    string_decoder "~1.0.3"
+    util-deprecate "~1.0.1"
+
+readable-stream@~1.0.2, readable-stream@~1.0.24, readable-stream@~1.0.26, readable-stream@~1.0.33:
+  version "1.0.34"
+  resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-1.0.34.tgz#125820e34bc842d2f2aaafafe4c2916ee32c157c"
+  dependencies:
+    core-util-is "~1.0.0"
+    inherits "~2.0.1"
+    isarray "0.0.1"
+    string_decoder "~0.10.x"
+
+readdirp@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-2.1.0.tgz#4ed0ad060df3073300c48440373f72d1cc642d78"
+  dependencies:
+    graceful-fs "^4.1.2"
+    minimatch "^3.0.2"
+    readable-stream "^2.0.2"
+    set-immediate-shim "^1.0.1"
+
+readline2@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/readline2/-/readline2-1.0.1.tgz#41059608ffc154757b715d9989d199ffbf372e35"
+  dependencies:
+    code-point-at "^1.0.0"
+    is-fullwidth-code-point "^1.0.0"
+    mute-stream "0.0.5"
+
+redent@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/redent/-/redent-1.0.0.tgz#cf916ab1fd5f1f16dfb20822dd6ec7f730c2afde"
+  dependencies:
+    indent-string "^2.1.0"
+    strip-indent "^1.0.1"
+
+regenerate@^1.2.1:
+  version "1.3.3"
+  resolved "https://registry.yarnpkg.com/regenerate/-/regenerate-1.3.3.tgz#0c336d3980553d755c39b586ae3b20aa49c82b7f"
+
+regenerator-runtime@^0.11.0:
+  version "0.11.1"
+  resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.11.1.tgz#be05ad7f9bf7d22e056f9726cee5017fbf19e2e9"
+
+regenerator-transform@^0.10.0:
+  version "0.10.1"
+  resolved "https://registry.yarnpkg.com/regenerator-transform/-/regenerator-transform-0.10.1.tgz#1e4996837231da8b7f3cf4114d71b5691a0680dd"
+  dependencies:
+    babel-runtime "^6.18.0"
+    babel-types "^6.19.0"
+    private "^0.1.6"
+
+regex-cache@^0.4.2:
+  version "0.4.4"
+  resolved "https://registry.yarnpkg.com/regex-cache/-/regex-cache-0.4.4.tgz#75bdc58a2a1496cec48a12835bc54c8d562336dd"
+  dependencies:
+    is-equal-shallow "^0.1.3"
+
+regexpu-core@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/regexpu-core/-/regexpu-core-2.0.0.tgz#49d038837b8dcf8bfa5b9a42139938e6ea2ae240"
+  dependencies:
+    regenerate "^1.2.1"
+    regjsgen "^0.2.0"
+    regjsparser "^0.1.4"
+
+regjsgen@^0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/regjsgen/-/regjsgen-0.2.0.tgz#6c016adeac554f75823fe37ac05b92d5a4edb1f7"
+
+regjsparser@^0.1.4:
+  version "0.1.5"
+  resolved "https://registry.yarnpkg.com/regjsparser/-/regjsparser-0.1.5.tgz#7ee8f84dc6fa792d3fd0ae228d24bd949ead205c"
+  dependencies:
+    jsesc "~0.5.0"
+
+remove-trailing-separator@^1.0.1:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/remove-trailing-separator/-/remove-trailing-separator-1.1.0.tgz#c24bce2a283adad5bc3f58e0d48249b92379d8ef"
+
+repeat-element@^1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/repeat-element/-/repeat-element-1.1.2.tgz#ef089a178d1483baae4d93eb98b4f9e4e11d990a"
+
+repeat-string@^0.2.2:
+  version "0.2.2"
+  resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-0.2.2.tgz#c7a8d3236068362059a7e4651fc6884e8b1fb4ae"
+
+repeat-string@^1.5.2:
+  version "1.6.1"
+  resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-1.6.1.tgz#8dcae470e1c88abc2d600fff4a776286da75e637"
+
+repeating@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/repeating/-/repeating-2.0.1.tgz#5214c53a926d3552707527fbab415dbc08d06dda"
+  dependencies:
+    is-finite "^1.0.0"
+
+request-progress@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/request-progress/-/request-progress-2.0.1.tgz#5d36bb57961c673aa5b788dbc8141fdf23b44e08"
+  dependencies:
+    throttleit "^1.0.0"
+
+request@2.79.0:
+  version "2.79.0"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.79.0.tgz#4dfe5bf6be8b8cdc37fcf93e04b65577722710de"
+  dependencies:
+    aws-sign2 "~0.6.0"
+    aws4 "^1.2.1"
+    caseless "~0.11.0"
+    combined-stream "~1.0.5"
+    extend "~3.0.0"
+    forever-agent "~0.6.1"
+    form-data "~2.1.1"
+    har-validator "~2.0.6"
+    hawk "~3.1.3"
+    http-signature "~1.1.0"
+    is-typedarray "~1.0.0"
+    isstream "~0.1.2"
+    json-stringify-safe "~5.0.1"
+    mime-types "~2.1.7"
+    oauth-sign "~0.8.1"
+    qs "~6.3.0"
+    stringstream "~0.0.4"
+    tough-cookie "~2.3.0"
+    tunnel-agent "~0.4.1"
+    uuid "^3.0.0"
+
+request@2.81.0:
+  version "2.81.0"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.81.0.tgz#c6928946a0e06c5f8d6f8a9333469ffda46298a0"
+  dependencies:
+    aws-sign2 "~0.6.0"
+    aws4 "^1.2.1"
+    caseless "~0.12.0"
+    combined-stream "~1.0.5"
+    extend "~3.0.0"
+    forever-agent "~0.6.1"
+    form-data "~2.1.1"
+    har-validator "~4.2.1"
+    hawk "~3.1.3"
+    http-signature "~1.1.0"
+    is-typedarray "~1.0.0"
+    isstream "~0.1.2"
+    json-stringify-safe "~5.0.1"
+    mime-types "~2.1.7"
+    oauth-sign "~0.8.1"
+    performance-now "^0.2.0"
+    qs "~6.4.0"
+    safe-buffer "^5.0.1"
+    stringstream "~0.0.4"
+    tough-cookie "~2.3.0"
+    tunnel-agent "^0.6.0"
+    uuid "^3.0.0"
+
+request@2.9.x:
+  version "2.9.203"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.9.203.tgz#6c1711a5407fb94a114219563e44145bcbf4723a"
+
+request@^2.81.0:
+  version "2.83.0"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.83.0.tgz#ca0b65da02ed62935887808e6f510381034e3356"
+  dependencies:
+    aws-sign2 "~0.7.0"
+    aws4 "^1.6.0"
+    caseless "~0.12.0"
+    combined-stream "~1.0.5"
+    extend "~3.0.1"
+    forever-agent "~0.6.1"
+    form-data "~2.3.1"
+    har-validator "~5.0.3"
+    hawk "~6.0.2"
+    http-signature "~1.2.0"
+    is-typedarray "~1.0.0"
+    isstream "~0.1.2"
+    json-stringify-safe "~5.0.1"
+    mime-types "~2.1.17"
+    oauth-sign "~0.8.2"
+    performance-now "^2.1.0"
+    qs "~6.5.1"
+    safe-buffer "^5.1.1"
+    stringstream "~0.0.5"
+    tough-cookie "~2.3.3"
+    tunnel-agent "^0.6.0"
+    uuid "^3.1.0"
+
+request@~2.55.0:
+  version "2.55.0"
+  resolved "https://registry.yarnpkg.com/request/-/request-2.55.0.tgz#d75c1cdf679d76bb100f9bffe1fe551b5c24e93d"
+  dependencies:
+    aws-sign2 "~0.5.0"
+    bl "~0.9.0"
+    caseless "~0.9.0"
+    combined-stream "~0.0.5"
+    forever-agent "~0.6.0"
+    form-data "~0.2.0"
+    har-validator "^1.4.0"
+    hawk "~2.3.0"
+    http-signature "~0.10.0"
+    isstream "~0.1.1"
+    json-stringify-safe "~5.0.0"
+    mime-types "~2.0.1"
+    node-uuid "~1.4.0"
+    oauth-sign "~0.6.0"
+    qs "~2.4.0"
+    stringstream "~0.0.4"
+    tough-cookie ">=0.12.0"
+    tunnel-agent "~0.4.0"
+
+require-directory@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/require-directory/-/require-directory-2.1.1.tgz#8c64ad5fd30dab1c976e2344ffe7f792a6a6df42"
+
+require-main-filename@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/require-main-filename/-/require-main-filename-1.0.1.tgz#97f717b69d48784f5f526a6c5aa8ffdda055a4d1"
+
+require-relative@^0.8.7:
+  version "0.8.7"
+  resolved "https://registry.yarnpkg.com/require-relative/-/require-relative-0.8.7.tgz#7999539fc9e047a37928fa196f8e1563dabd36de"
+
+requires-port@1.0.x, requires-port@1.x.x, requires-port@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/requires-port/-/requires-port-1.0.0.tgz#925d2601d39ac485e091cf0da5c6e694dc3dcaff"
+
+resolve-from@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-2.0.0.tgz#9480ab20e94ffa1d9e80a804c7ea147611966b57"
+
+resolve@1.1.x:
+  version "1.1.7"
+  resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.1.7.tgz#203114d82ad2c5ed9e8e0411b3932875e889e97b"
+
+resolve@~0.3.1:
+  version "0.3.1"
+  resolved "https://registry.yarnpkg.com/resolve/-/resolve-0.3.1.tgz#34c63447c664c70598d1c9b126fc43b2a24310a4"
+
+restore-cursor@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-1.0.1.tgz#34661f46886327fed2991479152252df92daa541"
+  dependencies:
+    exit-hook "^1.0.0"
+    onetime "^1.0.0"
+
+right-align@^0.1.1:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/right-align/-/right-align-0.1.3.tgz#61339b722fe6a3515689210d24e14c96148613ef"
+  dependencies:
+    align-text "^0.1.1"
+
+rimraf@2, rimraf@^2.2.8, rimraf@^2.3.3, rimraf@^2.5.1, rimraf@^2.5.4, rimraf@^2.6.1, rimraf@^2.6.2:
+  version "2.6.2"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.6.2.tgz#2ed8150d24a16ea8651e6d6ef0f47c4158ce7a36"
+  dependencies:
+    glob "^7.0.5"
+
+rimraf@2.4.3:
+  version "2.4.3"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.4.3.tgz#e5b51c9437a4c582adb955e9f28cf8d945e272af"
+  dependencies:
+    glob "^5.0.14"
+
+rimraf@~2.2.8:
+  version "2.2.8"
+  resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-2.2.8.tgz#e439be2aaee327321952730f99a8929e4fc50582"
+
+ripemd160@0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/ripemd160/-/ripemd160-0.2.0.tgz#2bf198bde167cacfa51c0a928e84b68bbe171fce"
+
+run-async@^0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/run-async/-/run-async-0.1.0.tgz#c8ad4a5e110661e402a7d21b530e009f25f8e389"
+  dependencies:
+    once "^1.3.0"
+
+rx-lite@^3.1.2:
+  version "3.1.2"
+  resolved "https://registry.yarnpkg.com/rx-lite/-/rx-lite-3.1.2.tgz#19ce502ca572665f3b647b10939f97fd1615f102"
+
+safe-buffer@5.1.1, safe-buffer@^5.0.1, safe-buffer@^5.1.1, safe-buffer@~5.1.0, safe-buffer@~5.1.1:
+  version "5.1.1"
+  resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.1.tgz#893312af69b2123def71f57889001671eeb2c853"
+
+sauce-connect-launcher@^0.13.0:
+  version "0.13.0"
+  resolved "https://registry.yarnpkg.com/sauce-connect-launcher/-/sauce-connect-launcher-0.13.0.tgz#25d7df9da16a5ed1caa13df424cb57cb0b6d5a22"
+  dependencies:
+    adm-zip "~0.4.3"
+    async "1.4.0"
+    lodash "3.10.1"
+    rimraf "2.4.3"
+
+saucelabs@^1.0.1:
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/saucelabs/-/saucelabs-1.4.0.tgz#b934a9af9da2874b3f40aae1fcde50a4466f5f38"
+  dependencies:
+    https-proxy-agent "^1.0.0"
+
+"semver@2 || 3 || 4 || 5", semver@^5.0.3, semver@^5.3.0:
+  version "5.5.0"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-5.5.0.tgz#dc4bbc7a6ca9d916dee5d43516f0092b58f7b8ab"
+
+semver@~1.0.13:
+  version "1.0.14"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-1.0.14.tgz#cac5e2d55a6fbf958cb220ae844045071c78f676"
+
+semver@~4.3.3:
+  version "4.3.6"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-4.3.6.tgz#300bc6e0e86374f7ba61068b5b1ecd57fc6532da"
+
+semver@~5.0.1:
+  version "5.0.3"
+  resolved "https://registry.yarnpkg.com/semver/-/semver-5.0.3.tgz#77466de589cd5d3c95f138aa78bc569a3cb5d27a"
+
+send@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/send/-/send-0.0.4.tgz#2d4cf79b189fcd09610e1302510ac9b0e4dde800"
+  dependencies:
+    debug "*"
+    fresh "0.1.0"
+    mime "1.2.6"
+    range-parser "0.0.4"
+
+send@0.16.1:
+  version "0.16.1"
+  resolved "https://registry.yarnpkg.com/send/-/send-0.16.1.tgz#a70e1ca21d1382c11d0d9f6231deb281080d7ab3"
+  dependencies:
+    debug "2.6.9"
+    depd "~1.1.1"
+    destroy "~1.0.4"
+    encodeurl "~1.0.1"
+    escape-html "~1.0.3"
+    etag "~1.8.1"
+    fresh "0.5.2"
+    http-errors "~1.6.2"
+    mime "1.4.1"
+    ms "2.0.0"
+    on-finished "~2.3.0"
+    range-parser "~1.2.0"
+    statuses "~1.3.1"
+
+serve-index@^1.7.2:
+  version "1.9.1"
+  resolved "https://registry.yarnpkg.com/serve-index/-/serve-index-1.9.1.tgz#d3768d69b1e7d82e5ce050fff5b453bea12a9239"
+  dependencies:
+    accepts "~1.3.4"
+    batch "0.6.1"
+    debug "2.6.9"
+    escape-html "~1.0.3"
+    http-errors "~1.6.2"
+    mime-types "~2.1.17"
+    parseurl "~1.3.2"
+
+serve-static@1.13.1:
+  version "1.13.1"
+  resolved "https://registry.yarnpkg.com/serve-static/-/serve-static-1.13.1.tgz#4c57d53404a761d8f2e7c1e8a18a47dbf278a719"
+  dependencies:
+    encodeurl "~1.0.1"
+    escape-html "~1.0.3"
+    parseurl "~1.3.2"
+    send "0.16.1"
+
+set-blocking@^2.0.0, set-blocking@~2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7"
+
+set-immediate-shim@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/set-immediate-shim/-/set-immediate-shim-1.0.1.tgz#4b2b1b27eb808a9f8dcc481a58e5e56f599f3f61"
+
+setimmediate@^1.0.4:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/setimmediate/-/setimmediate-1.0.5.tgz#290cbb232e306942d7d7ea9b83732ab7856f8285"
+
+setprototypeof@1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/setprototypeof/-/setprototypeof-1.0.3.tgz#66567e37043eeb4f04d91bd658c0cbefb55b8e04"
+
+setprototypeof@1.1.0:
+  version "1.1.0"
+  resolved "https://registry.yarnpkg.com/setprototypeof/-/setprototypeof-1.1.0.tgz#d0bd85536887b6fe7c0d818cb962d9d91c54e656"
+
+sha.js@2.2.6:
+  version "2.2.6"
+  resolved "https://registry.yarnpkg.com/sha.js/-/sha.js-2.2.6.tgz#17ddeddc5f722fb66501658895461977867315ba"
+
+shebang-command@^1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-1.2.0.tgz#44aac65b695b03398968c39f363fee5deafdf1ea"
+  dependencies:
+    shebang-regex "^1.0.0"
+
+shebang-regex@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-1.0.0.tgz#da42f49740c0b42db2ca9728571cb190c98efea3"
+
+shelljs@^0.5.3:
+  version "0.5.3"
+  resolved "https://registry.yarnpkg.com/shelljs/-/shelljs-0.5.3.tgz#c54982b996c76ef0c1e6b59fbdc5825f5b713113"
+
+sigmund@~1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/sigmund/-/sigmund-1.0.1.tgz#3ff21f198cad2175f9f3b781853fd94d0d19b590"
+
+signal-exit@^3.0.0, signal-exit@^3.0.1, signal-exit@^3.0.2:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.2.tgz#b5fdc08f1287ea1178628e415e25132b73646c6d"
+
+slash@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/slash/-/slash-1.0.0.tgz#c41f2f6c39fc16d1cd17ad4b5d896114ae470d55"
+
+slide@^1.1.5:
+  version "1.1.6"
+  resolved "https://registry.yarnpkg.com/slide/-/slide-1.1.6.tgz#56eb027d65b4d2dce6cb2e2d32c4d4afc9e1d707"
+
+sntp@1.x.x:
+  version "1.0.9"
+  resolved "https://registry.yarnpkg.com/sntp/-/sntp-1.0.9.tgz#6541184cc90aeea6c6e7b35e2659082443c66198"
+  dependencies:
+    hoek "2.x.x"
+
+sntp@2.x.x:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/sntp/-/sntp-2.1.0.tgz#2c6cec14fedc2222739caf9b5c3d85d1cc5a2cc8"
+  dependencies:
+    hoek "4.x.x"
+
+socket.io-adapter@0.5.0:
+  version "0.5.0"
+  resolved "https://registry.yarnpkg.com/socket.io-adapter/-/socket.io-adapter-0.5.0.tgz#cb6d4bb8bec81e1078b99677f9ced0046066bb8b"
+  dependencies:
+    debug "2.3.3"
+    socket.io-parser "2.3.1"
+
+socket.io-client@1.7.4:
+  version "1.7.4"
+  resolved "https://registry.yarnpkg.com/socket.io-client/-/socket.io-client-1.7.4.tgz#ec9f820356ed99ef6d357f0756d648717bdd4281"
+  dependencies:
+    backo2 "1.0.2"
+    component-bind "1.0.0"
+    component-emitter "1.2.1"
+    debug "2.3.3"
+    engine.io-client "~1.8.4"
+    has-binary "0.1.7"
+    indexof "0.0.1"
+    object-component "0.0.3"
+    parseuri "0.0.5"
+    socket.io-parser "2.3.1"
+    to-array "0.1.4"
+
+socket.io-parser@2.3.1:
+  version "2.3.1"
+  resolved "https://registry.yarnpkg.com/socket.io-parser/-/socket.io-parser-2.3.1.tgz#dd532025103ce429697326befd64005fcfe5b4a0"
+  dependencies:
+    component-emitter "1.1.2"
+    debug "2.2.0"
+    isarray "0.0.1"
+    json3 "3.3.2"
+
+socket.io@^1.4.5:
+  version "1.7.4"
+  resolved "https://registry.yarnpkg.com/socket.io/-/socket.io-1.7.4.tgz#2f7ecedc3391bf2d5c73e291fe233e6e34d4dd00"
+  dependencies:
+    debug "2.3.3"
+    engine.io "~1.8.4"
+    has-binary "0.1.7"
+    object-assign "4.1.0"
+    socket.io-adapter "0.5.0"
+    socket.io-client "1.7.4"
+    socket.io-parser "2.3.1"
+
+sockjs-client@^1.0.3:
+  version "1.1.4"
+  resolved "https://registry.yarnpkg.com/sockjs-client/-/sockjs-client-1.1.4.tgz#5babe386b775e4cf14e7520911452654016c8b12"
+  dependencies:
+    debug "^2.6.6"
+    eventsource "0.1.6"
+    faye-websocket "~0.11.0"
+    inherits "^2.0.1"
+    json3 "^3.3.2"
+    url-parse "^1.1.8"
+
+sockjs@^0.3.15:
+  version "0.3.19"
+  resolved "https://registry.yarnpkg.com/sockjs/-/sockjs-0.3.19.tgz#d976bbe800af7bd20ae08598d582393508993c0d"
+  dependencies:
+    faye-websocket "^0.10.0"
+    uuid "^3.0.1"
+
+source-list-map@~0.1.7:
+  version "0.1.8"
+  resolved "https://registry.yarnpkg.com/source-list-map/-/source-list-map-0.1.8.tgz#c550b2ab5427f6b3f21f5afead88c4f5587b2106"
+
+source-map-support@^0.3.2:
+  version "0.3.3"
+  resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.3.3.tgz#34900977d5ba3f07c7757ee72e73bb1a9b53754f"
+  dependencies:
+    source-map "0.1.32"
+
+source-map-support@^0.4.15, source-map-support@^0.4.18:
+  version "0.4.18"
+  resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.4.18.tgz#0286a6de8be42641338594e97ccea75f0a2c585f"
+  dependencies:
+    source-map "^0.5.6"
+
+source-map@0.1.32:
+  version "0.1.32"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.1.32.tgz#c8b6c167797ba4740a8ea33252162ff08591b266"
+  dependencies:
+    amdefine ">=0.0.4"
+
+source-map@^0.1.41:
+  version "0.1.43"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.1.43.tgz#c24bc146ca517c1471f5dacbe2571b2b7f9e3346"
+  dependencies:
+    amdefine ">=0.0.4"
+
+source-map@^0.4.4, source-map@~0.4.1:
+  version "0.4.4"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.4.4.tgz#eba4f5da9c0dc999de68032d8b4f76173652036b"
+  dependencies:
+    amdefine ">=0.0.4"
+
+source-map@^0.5.3, source-map@^0.5.6, source-map@^0.5.7, source-map@~0.5.1:
+  version "0.5.7"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc"
+
+source-map@^0.6.1:
+  version "0.6.1"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.6.1.tgz#74722af32e9614e9c287a8d0bbde48b5e2f1a263"
+
+source-map@~0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.2.0.tgz#dab73fbcfc2ba819b4de03bd6f6eaa48164b3f9d"
+  dependencies:
+    amdefine ">=0.0.4"
+
+spawn-wrap@^1.4.2:
+  version "1.4.2"
+  resolved "https://registry.yarnpkg.com/spawn-wrap/-/spawn-wrap-1.4.2.tgz#cff58e73a8224617b6561abdc32586ea0c82248c"
+  dependencies:
+    foreground-child "^1.5.6"
+    mkdirp "^0.5.0"
+    os-homedir "^1.0.1"
+    rimraf "^2.6.2"
+    signal-exit "^3.0.2"
+    which "^1.3.0"
+
+spdx-correct@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/spdx-correct/-/spdx-correct-3.0.0.tgz#05a5b4d7153a195bc92c3c425b69f3b2a9524c82"
+  dependencies:
+    spdx-expression-parse "^3.0.0"
+    spdx-license-ids "^3.0.0"
+
+spdx-exceptions@^2.1.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/spdx-exceptions/-/spdx-exceptions-2.1.0.tgz#2c7ae61056c714a5b9b9b2b2af7d311ef5c78fe9"
+
+spdx-expression-parse@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/spdx-expression-parse/-/spdx-expression-parse-3.0.0.tgz#99e119b7a5da00e05491c9fa338b7904823b41d0"
+  dependencies:
+    spdx-exceptions "^2.1.0"
+    spdx-license-ids "^3.0.0"
+
+spdx-license-ids@^3.0.0:
+  version "3.0.0"
+  resolved "https://registry.yarnpkg.com/spdx-license-ids/-/spdx-license-ids-3.0.0.tgz#7a7cd28470cc6d3a1cfe6d66886f6bc430d3ac87"
+
+sprintf-js@~1.0.2:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c"
+
+sshpk@^1.7.0:
+  version "1.13.1"
+  resolved "https://registry.yarnpkg.com/sshpk/-/sshpk-1.13.1.tgz#512df6da6287144316dc4c18fe1cf1d940739be3"
+  dependencies:
+    asn1 "~0.2.3"
+    assert-plus "^1.0.0"
+    dashdash "^1.12.0"
+    getpass "^0.1.1"
+  optionalDependencies:
+    bcrypt-pbkdf "^1.0.0"
+    ecc-jsbn "~0.1.1"
+    jsbn "~0.1.0"
+    tweetnacl "~0.14.0"
+
+stack-trace@0.0.x:
+  version "0.0.10"
+  resolved "https://registry.yarnpkg.com/stack-trace/-/stack-trace-0.0.10.tgz#547c70b347e8d32b4e108ea1a2a159e5fdde19c0"
+
+stack-utils@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/stack-utils/-/stack-utils-1.0.1.tgz#d4f33ab54e8e38778b0ca5cfd3b3afb12db68620"
+
+statuses@1, "statuses@>= 1.3.1 < 2":
+  version "1.4.0"
+  resolved "https://registry.yarnpkg.com/statuses/-/statuses-1.4.0.tgz#bb73d446da2796106efcc1b601a253d6c46bd087"
+
+statuses@~1.3.1:
+  version "1.3.1"
+  resolved "https://registry.yarnpkg.com/statuses/-/statuses-1.3.1.tgz#faf51b9eb74aaef3b3acf4ad5f61abf24cb7b93e"
+
+stream-browserify@^2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/stream-browserify/-/stream-browserify-2.0.1.tgz#66266ee5f9bdb9940a4e4514cafb43bb71e5c9db"
+  dependencies:
+    inherits "~2.0.1"
+    readable-stream "^2.0.2"
+
+stream-cache@~0.0.1:
+  version "0.0.2"
+  resolved "https://registry.yarnpkg.com/stream-cache/-/stream-cache-0.0.2.tgz#1ac5ad6832428ca55667dbdee395dad4e6db118f"
+
+stream-http@^2.3.1:
+  version "2.8.0"
+  resolved "https://registry.yarnpkg.com/stream-http/-/stream-http-2.8.0.tgz#fd86546dac9b1c91aff8fc5d287b98fafb41bc10"
+  dependencies:
+    builtin-status-codes "^3.0.0"
+    inherits "^2.0.1"
+    readable-stream "^2.3.3"
+    to-arraybuffer "^1.0.0"
+    xtend "^4.0.0"
+
+string-width@^1.0.1, string-width@^1.0.2:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-1.0.2.tgz#118bdf5b8cdc51a2a7e70d211e07e2b0b9b107d3"
+  dependencies:
+    code-point-at "^1.0.0"
+    is-fullwidth-code-point "^1.0.0"
+    strip-ansi "^3.0.0"
+
+string-width@^2.0.0, string-width@^2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e"
+  dependencies:
+    is-fullwidth-code-point "^2.0.0"
+    strip-ansi "^4.0.0"
+
+string_decoder@^0.10.25, string_decoder@~0.10.x:
+  version "0.10.31"
+  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-0.10.31.tgz#62e203bc41766c6c28c9fc84301dab1c5310fa94"
+
+string_decoder@~1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.0.3.tgz#0fc67d7c141825de94282dd536bec6b9bce860ab"
+  dependencies:
+    safe-buffer "~5.1.0"
+
+stringstream@~0.0.4, stringstream@~0.0.5:
+  version "0.0.5"
+  resolved "https://registry.yarnpkg.com/stringstream/-/stringstream-0.0.5.tgz#4e484cd4de5a0bbbee18e46307710a8a81621878"
+
+strip-ansi@^3.0.0, strip-ansi@^3.0.1:
+  version "3.0.1"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-3.0.1.tgz#6a385fb8853d952d5ff05d0e8aaf94278dc63dcf"
+  dependencies:
+    ansi-regex "^2.0.0"
+
+strip-ansi@^4.0.0:
+  version "4.0.0"
+  resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-4.0.0.tgz#a8479022eb1ac368a871389b635262c505ee368f"
+  dependencies:
+    ansi-regex "^3.0.0"
+
+strip-bom@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-2.0.0.tgz#6219a85616520491f35788bdbf1447a99c7e6b0e"
+  dependencies:
+    is-utf8 "^0.2.0"
+
+strip-eof@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/strip-eof/-/strip-eof-1.0.0.tgz#bb43ff5598a6eb05d89b59fcd129c983313606bf"
+
+strip-indent@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-1.0.1.tgz#0c7962a6adefa7bbd4ac366460a638552ae1a0a2"
+  dependencies:
+    get-stdin "^4.0.1"
+
+strip-json-comments@~1.0.1:
+  version "1.0.4"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-1.0.4.tgz#1e15fbcac97d3ee99bf2d73b4c656b082bbafb91"
+
+strip-json-comments@~2.0.1:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a"
+
+supports-color@1.2.0:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-1.2.0.tgz#ff1ed1e61169d06b3cf2d588e188b18d8847e17e"
+
+supports-color@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-2.0.0.tgz#535d045ce6b6363fa40117084629995e9df324c7"
+
+supports-color@^3.1.0, supports-color@^3.1.1, supports-color@^3.1.2:
+  version "3.2.3"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-3.2.3.tgz#65ac0504b3954171d8a64946b2ae3cbb8a5f54f6"
+  dependencies:
+    has-flag "^1.0.0"
+
+supports-color@^5.3.0:
+  version "5.3.0"
+  resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.3.0.tgz#5b24ac15db80fa927cf5227a4a33fd3c4c7676c0"
+  dependencies:
+    has-flag "^3.0.0"
+
+tap-mocha-reporter@^3.0.6:
+  version "3.0.6"
+  resolved "https://registry.yarnpkg.com/tap-mocha-reporter/-/tap-mocha-reporter-3.0.6.tgz#12abe97ff409a5a6ecc3d70b6dba34d82184a770"
+  dependencies:
+    color-support "^1.1.0"
+    debug "^2.1.3"
+    diff "^1.3.2"
+    escape-string-regexp "^1.0.3"
+    glob "^7.0.5"
+    js-yaml "^3.3.1"
+    tap-parser "^5.1.0"
+    unicode-length "^1.0.0"
+  optionalDependencies:
+    readable-stream "^2.1.5"
+
+tap-parser@^5.1.0:
+  version "5.4.0"
+  resolved "https://registry.yarnpkg.com/tap-parser/-/tap-parser-5.4.0.tgz#6907e89725d7b7fa6ae41ee2c464c3db43188aec"
+  dependencies:
+    events-to-array "^1.0.1"
+    js-yaml "^3.2.7"
+  optionalDependencies:
+    readable-stream "^2"
+
+tap-parser@^7.0.0:
+  version "7.0.0"
+  resolved "https://registry.yarnpkg.com/tap-parser/-/tap-parser-7.0.0.tgz#54db35302fda2c2ccc21954ad3be22b2cba42721"
+  dependencies:
+    events-to-array "^1.0.1"
+    js-yaml "^3.2.7"
+    minipass "^2.2.0"
+
+tap@>=0.2.3:
+  version "11.1.1"
+  resolved "https://registry.yarnpkg.com/tap/-/tap-11.1.1.tgz#6dbd23c487127f621a95c793f7a247fa7e2c053a"
+  dependencies:
+    bind-obj-methods "^1.0.0"
+    bluebird "^3.5.1"
+    clean-yaml-object "^0.1.0"
+    color-support "^1.1.0"
+    coveralls "^2.13.3"
+    foreground-child "^1.3.3"
+    fs-exists-cached "^1.0.0"
+    function-loop "^1.0.1"
+    glob "^7.0.0"
+    isexe "^2.0.0"
+    js-yaml "^3.10.0"
+    minipass "^2.2.1"
+    mkdirp "^0.5.1"
+    nyc "^11.3.0"
+    opener "^1.4.1"
+    os-homedir "^1.0.2"
+    own-or "^1.0.0"
+    own-or-env "^1.0.0"
+    rimraf "^2.6.2"
+    signal-exit "^3.0.0"
+    source-map-support "^0.4.18"
+    stack-utils "^1.0.0"
+    tap-mocha-reporter "^3.0.6"
+    tap-parser "^7.0.0"
+    tmatch "^3.1.0"
+    trivial-deferred "^1.0.1"
+    tsame "^1.1.2"
+    write-file-atomic "^2.3.0"
+    yapool "^1.0.0"
+
+tapable@^0.1.8, tapable@~0.1.8:
+  version "0.1.10"
+  resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.1.10.tgz#29c35707c2b70e50d07482b5d202e8ed446dafd4"
+
+tar-pack@^3.4.0:
+  version "3.4.1"
+  resolved "https://registry.yarnpkg.com/tar-pack/-/tar-pack-3.4.1.tgz#e1dbc03a9b9d3ba07e896ad027317eb679a10a1f"
+  dependencies:
+    debug "^2.2.0"
+    fstream "^1.0.10"
+    fstream-ignore "^1.0.5"
+    once "^1.3.3"
+    readable-stream "^2.1.4"
+    rimraf "^2.5.1"
+    tar "^2.2.1"
+    uid-number "^0.0.6"
+
+tar-stream@~1.1.0:
+  version "1.1.5"
+  resolved "https://registry.yarnpkg.com/tar-stream/-/tar-stream-1.1.5.tgz#be9218c130c20029e107b0f967fb23de0579d13c"
+  dependencies:
+    bl "^0.9.0"
+    end-of-stream "^1.0.0"
+    readable-stream "~1.0.33"
+    xtend "^4.0.0"
+
+tar@^2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/tar/-/tar-2.2.1.tgz#8e4d2a256c0e2185c6b18ad694aec968b83cb1d1"
+  dependencies:
+    block-stream "*"
+    fstream "^1.0.2"
+    inherits "2"
+
+temporary@~0.0.4:
+  version "0.0.8"
+  resolved "https://registry.yarnpkg.com/temporary/-/temporary-0.0.8.tgz#a18a981d28ba8ca36027fb3c30538c3ecb740ac0"
+  dependencies:
+    package ">= 1.0.0 < 1.2.0"
+
+test-exclude@^4.1.1:
+  version "4.2.0"
+  resolved "https://registry.yarnpkg.com/test-exclude/-/test-exclude-4.2.0.tgz#07e3613609a362c74516a717515e13322ab45b3c"
+  dependencies:
+    arrify "^1.0.1"
+    micromatch "^2.3.11"
+    object-assign "^4.1.0"
+    read-pkg-up "^1.0.1"
+    require-main-filename "^1.0.1"
+
+text-table@~0.2.0:
+  version "0.2.0"
+  resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4"
+
+throttleit@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/throttleit/-/throttleit-1.0.0.tgz#9e785836daf46743145a5984b6268d828528ac6c"
+
+through@^2.3.6:
+  version "2.3.8"
+  resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
+
+time-stamp@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/time-stamp/-/time-stamp-2.0.0.tgz#95c6a44530e15ba8d6f4a3ecb8c3a3fac46da357"
+
+timers-browserify@^2.0.2:
+  version "2.0.6"
+  resolved "https://registry.yarnpkg.com/timers-browserify/-/timers-browserify-2.0.6.tgz#241e76927d9ca05f4d959819022f5b3664b64bae"
+  dependencies:
+    setimmediate "^1.0.4"
+
+timespan@2.x.x:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/timespan/-/timespan-2.3.0.tgz#4902ce040bd13d845c8f59b27e9d59bad6f39929"
+
+tiny-lr@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/tiny-lr/-/tiny-lr-0.2.1.tgz#b3fdba802e5d56a33c2f6f10794b32e477ac729d"
+  dependencies:
+    body-parser "~1.14.0"
+    debug "~2.2.0"
+    faye-websocket "~0.10.0"
+    livereload-js "^2.2.0"
+    parseurl "~1.3.0"
+    qs "~5.1.0"
+
+tmatch@^3.1.0:
+  version "3.1.0"
+  resolved "https://registry.yarnpkg.com/tmatch/-/tmatch-3.1.0.tgz#701264fd7582d0144a80c85af3358cca269c71e3"
+
+tmp@0.0.x:
+  version "0.0.33"
+  resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9"
+  dependencies:
+    os-tmpdir "~1.0.2"
+
+to-array@0.1.4:
+  version "0.1.4"
+  resolved "https://registry.yarnpkg.com/to-array/-/to-array-0.1.4.tgz#17e6c11f73dd4f3d74cda7a4ff3238e9ad9bf890"
+
+to-arraybuffer@^1.0.0:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/to-arraybuffer/-/to-arraybuffer-1.0.1.tgz#7d229b1fcc637e466ca081180836a7aabff83f43"
+
+to-fast-properties@^1.0.3:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/to-fast-properties/-/to-fast-properties-1.0.3.tgz#b83571fa4d8c25b82e231b06e3a3055de4ca1a47"
+
+to-iso-string@0.0.2:
+  version "0.0.2"
+  resolved "https://registry.yarnpkg.com/to-iso-string/-/to-iso-string-0.0.2.tgz#4dc19e664dfccbe25bd8db508b00c6da158255d1"
+
+tough-cookie@>=0.12.0, tough-cookie@~2.3.0, tough-cookie@~2.3.3:
+  version "2.3.4"
+  resolved "https://registry.yarnpkg.com/tough-cookie/-/tough-cookie-2.3.4.tgz#ec60cee38ac675063ffc97a5c18970578ee83655"
+  dependencies:
+    punycode "^1.4.1"
+
+trim-newlines@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/trim-newlines/-/trim-newlines-1.0.0.tgz#5887966bb582a4503a41eb524f7d35011815a613"
+
+trim-right@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/trim-right/-/trim-right-1.0.1.tgz#cb2e1203067e0c8de1f614094b9fe45704ea6003"
+
+trivial-deferred@^1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/trivial-deferred/-/trivial-deferred-1.0.1.tgz#376d4d29d951d6368a6f7a0ae85c2f4d5e0658f3"
+
+tsame@^1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/tsame/-/tsame-1.1.2.tgz#5ce0002acf685942789c63018797a2aa5e6b03c5"
+
+tty-browserify@0.0.0:
+  version "0.0.0"
+  resolved "https://registry.yarnpkg.com/tty-browserify/-/tty-browserify-0.0.0.tgz#a157ba402da24e9bf957f9aa69d524eed42901a6"
+
+tunnel-agent@^0.6.0:
+  version "0.6.0"
+  resolved "https://registry.yarnpkg.com/tunnel-agent/-/tunnel-agent-0.6.0.tgz#27a5dea06b36b04a0a9966774b290868f0fc40fd"
+  dependencies:
+    safe-buffer "^5.0.1"
+
+tunnel-agent@~0.4.0, tunnel-agent@~0.4.1:
+  version "0.4.3"
+  resolved "https://registry.yarnpkg.com/tunnel-agent/-/tunnel-agent-0.4.3.tgz#6373db76909fe570e08d73583365ed828a74eeeb"
+
+tweetnacl@^0.14.3, tweetnacl@~0.14.0:
+  version "0.14.5"
+  resolved "https://registry.yarnpkg.com/tweetnacl/-/tweetnacl-0.14.5.tgz#5ae68177f192d4456269d108afa93ff8743f4f64"
+
+type-check@~0.3.1:
+  version "0.3.2"
+  resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.3.2.tgz#5884cab512cf1d355e3fb784f30804b2b520db72"
+  dependencies:
+    prelude-ls "~1.1.2"
+
+type-detect@0.1.1:
+  version "0.1.1"
+  resolved "https://registry.yarnpkg.com/type-detect/-/type-detect-0.1.1.tgz#0ba5ec2a885640e470ea4e8505971900dac58822"
+
+type-detect@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/type-detect/-/type-detect-1.0.0.tgz#762217cc06db258ec48908a1298e8b95121e8ea2"
+
+type-is@~1.6.10, type-is@~1.6.15:
+  version "1.6.16"
+  resolved "https://registry.yarnpkg.com/type-is/-/type-is-1.6.16.tgz#f89ce341541c672b25ee7ae3c73dee3b2be50194"
+  dependencies:
+    media-typer "0.3.0"
+    mime-types "~2.1.18"
+
+typedarray@^0.0.6:
+  version "0.0.6"
+  resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777"
+
+uglify-js@^2.6:
+  version "2.8.29"
+  resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.8.29.tgz#29c5733148057bb4e1f75df35b7a9cb72e6a59dd"
+  dependencies:
+    source-map "~0.5.1"
+    yargs "~3.10.0"
+  optionalDependencies:
+    uglify-to-browserify "~1.0.0"
+
+uglify-js@~1.3.3:
+  version "1.3.5"
+  resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-1.3.5.tgz#4b5bfff9186effbaa888e4c9e94bd9fc4c94929d"
+
+uglify-js@~2.6.2:
+  version "2.6.4"
+  resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.6.4.tgz#65ea2fb3059c9394692f15fed87c2b36c16b9adf"
+  dependencies:
+    async "~0.2.6"
+    source-map "~0.5.1"
+    uglify-to-browserify "~1.0.0"
+    yargs "~3.10.0"
+
+uglify-js@~2.7.3:
+  version "2.7.5"
+  resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.7.5.tgz#4612c0c7baaee2ba7c487de4904ae122079f2ca8"
+  dependencies:
+    async "~0.2.6"
+    source-map "~0.5.1"
+    uglify-to-browserify "~1.0.0"
+    yargs "~3.10.0"
+
+uglify-to-browserify@~1.0.0:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz#6e0924d6bda6b5afe349e39a6d632850a0f882b7"
+
+uid-number@^0.0.6:
+  version "0.0.6"
+  resolved "https://registry.yarnpkg.com/uid-number/-/uid-number-0.0.6.tgz#0ea10e8035e8eb5b8e4449f06da1c730663baa81"
+
+ultron@1.0.x:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/ultron/-/ultron-1.0.2.tgz#ace116ab557cd197386a4e88f4685378c8b2e4fa"
+
+underscore.string@~2.1.1:
+  version "2.1.1"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-2.1.1.tgz#458397799114b9b67f6030bb527b0afae689c061"
+
+underscore.string@~2.2.1:
+  version "2.2.1"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-2.2.1.tgz#d7c0fa2af5d5a1a67f4253daee98132e733f0f19"
+
+underscore.string@~2.3.3:
+  version "2.3.3"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-2.3.3.tgz#71c08bf6b428b1133f37e78fa3a21c82f7329b0d"
+
+underscore.string@~2.4.0:
+  version "2.4.0"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-2.4.0.tgz#8cdd8fbac4e2d2ea1e7e2e8097c42f442280f85b"
+
+underscore.string@~3.0.3:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/underscore.string/-/underscore.string-3.0.3.tgz#4617b8c1a250cf6e5064fbbb363d0fa96cf14552"
+
+underscore@~1.2.4:
+  version "1.2.4"
+  resolved "https://registry.yarnpkg.com/underscore/-/underscore-1.2.4.tgz#e8da6241aa06f64df2473bb2590b8c17c84c3c7e"
+
+underscore@~1.7.0:
+  version "1.7.0"
+  resolved "https://registry.yarnpkg.com/underscore/-/underscore-1.7.0.tgz#6bbaf0877500d36be34ecaa584e0db9fef035209"
+
+unicode-length@^1.0.0:
+  version "1.0.3"
+  resolved "https://registry.yarnpkg.com/unicode-length/-/unicode-length-1.0.3.tgz#5ada7a7fed51841a418a328cf149478ac8358abb"
+  dependencies:
+    punycode "^1.3.2"
+    strip-ansi "^3.0.1"
+
+unpipe@1.0.0, unpipe@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/unpipe/-/unpipe-1.0.0.tgz#b2bf4ee8514aae6165b4817829d21b2ef49904ec"
+
+uri-path@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/uri-path/-/uri-path-1.0.0.tgz#9747f018358933c31de0fccfd82d138e67262e32"
+
+url-parse@1.0.x:
+  version "1.0.5"
+  resolved "https://registry.yarnpkg.com/url-parse/-/url-parse-1.0.5.tgz#0854860422afdcfefeb6c965c662d4800169927b"
+  dependencies:
+    querystringify "0.0.x"
+    requires-port "1.0.x"
+
+url-parse@^1.1.8:
+  version "1.2.0"
+  resolved "https://registry.yarnpkg.com/url-parse/-/url-parse-1.2.0.tgz#3a19e8aaa6d023ddd27dcc44cb4fc8f7fec23986"
+  dependencies:
+    querystringify "~1.0.0"
+    requires-port "~1.0.0"
+
+url@^0.11.0:
+  version "0.11.0"
+  resolved "https://registry.yarnpkg.com/url/-/url-0.11.0.tgz#3838e97cfc60521eb73c525a8e55bfdd9e2e28f1"
+  dependencies:
+    punycode "1.3.2"
+    querystring "0.2.0"
+
+user-home@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/user-home/-/user-home-2.0.0.tgz#9c70bfd8169bc1dcbf48604e0f04b8b49cde9e9f"
+  dependencies:
+    os-homedir "^1.0.0"
+
+useragent@^2.1.6:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/useragent/-/useragent-2.3.0.tgz#217f943ad540cb2128658ab23fc960f6a88c9972"
+  dependencies:
+    lru-cache "4.1.x"
+    tmp "0.0.x"
+
+util-deprecate@~1.0.1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf"
+
+util@0.10.3, util@^0.10.3:
+  version "0.10.3"
+  resolved "https://registry.yarnpkg.com/util/-/util-0.10.3.tgz#7afb1afe50805246489e3db7fe0ed379336ac0f9"
+  dependencies:
+    inherits "2.0.1"
+
+utils-merge@1.0.1:
+  version "1.0.1"
+  resolved "https://registry.yarnpkg.com/utils-merge/-/utils-merge-1.0.1.tgz#9f95710f50a267947b2ccc124741c1028427e713"
+
+uuid@^3.0.0, uuid@^3.0.1, uuid@^3.1.0:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.2.1.tgz#12c528bb9d58d0b9265d9a2f6f0fe8be17ff1f14"
+
+validate-npm-package-license@^3.0.1:
+  version "3.0.3"
+  resolved "https://registry.yarnpkg.com/validate-npm-package-license/-/validate-npm-package-license-3.0.3.tgz#81643bcbef1bdfecd4623793dc4648948ba98338"
+  dependencies:
+    spdx-correct "^3.0.0"
+    spdx-expression-parse "^3.0.0"
+
+vargs@~0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/vargs/-/vargs-0.1.0.tgz#6b6184da6520cc3204ce1b407cac26d92609ebff"
+
+vary@~1.1.2:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/vary/-/vary-1.1.2.tgz#2299f02c6ded30d4a5961b0b9f74524a18f634fc"
+
+verror@1.10.0:
+  version "1.10.0"
+  resolved "https://registry.yarnpkg.com/verror/-/verror-1.10.0.tgz#3a105ca17053af55d6e270c1f8288682e18da400"
+  dependencies:
+    assert-plus "^1.0.0"
+    core-util-is "1.0.2"
+    extsprintf "^1.2.0"
+
+vm-browserify@0.0.4:
+  version "0.0.4"
+  resolved "https://registry.yarnpkg.com/vm-browserify/-/vm-browserify-0.0.4.tgz#5d7ea45bbef9e4a6ff65f95438e0a87c357d5a73"
+  dependencies:
+    indexof "0.0.1"
+
+void-elements@^2.0.0:
+  version "2.0.1"
+  resolved "https://registry.yarnpkg.com/void-elements/-/void-elements-2.0.1.tgz#c066afb582bb1cb4128d60ea92392e94d5e9dbec"
+
+watchpack@^0.2.1:
+  version "0.2.9"
+  resolved "https://registry.yarnpkg.com/watchpack/-/watchpack-0.2.9.tgz#62eaa4ab5e5ba35fdfc018275626e3c0f5e3fb0b"
+  dependencies:
+    async "^0.9.0"
+    chokidar "^1.0.0"
+    graceful-fs "^4.1.2"
+
+wd@^0.3.4:
+  version "0.3.12"
+  resolved "https://registry.yarnpkg.com/wd/-/wd-0.3.12.tgz#3fb4f1d759f8c85dde5393d17334ffe03e9bb329"
+  dependencies:
+    archiver "~0.14.0"
+    async "~1.0.0"
+    lodash "~3.9.3"
+    q "~1.4.1"
+    request "~2.55.0"
+    underscore.string "~3.0.3"
+    vargs "~0.1.0"
+
+webpack-core@~0.6.9:
+  version "0.6.9"
+  resolved "https://registry.yarnpkg.com/webpack-core/-/webpack-core-0.6.9.tgz#fc571588c8558da77be9efb6debdc5a3b172bdc2"
+  dependencies:
+    source-list-map "~0.1.7"
+    source-map "~0.4.1"
+
+webpack-dev-middleware@^1.0.11, webpack-dev-middleware@^1.10.2:
+  version "1.12.2"
+  resolved "https://registry.yarnpkg.com/webpack-dev-middleware/-/webpack-dev-middleware-1.12.2.tgz#f8fc1120ce3b4fc5680ceecb43d777966b21105e"
+  dependencies:
+    memory-fs "~0.4.1"
+    mime "^1.5.0"
+    path-is-absolute "^1.0.0"
+    range-parser "^1.0.3"
+    time-stamp "^2.0.0"
+
+webpack-dev-server@^1.12.0:
+  version "1.16.5"
+  resolved "https://registry.yarnpkg.com/webpack-dev-server/-/webpack-dev-server-1.16.5.tgz#0cbd5f2d2ac8d4e593aacd5c9702e7bbd5e59892"
+  dependencies:
+    compression "^1.5.2"
+    connect-history-api-fallback "^1.3.0"
+    express "^4.13.3"
+    http-proxy-middleware "~0.17.1"
+    open "0.0.5"
+    optimist "~0.6.1"
+    serve-index "^1.7.2"
+    sockjs "^0.3.15"
+    sockjs-client "^1.0.3"
+    stream-cache "~0.0.1"
+    strip-ansi "^3.0.0"
+    supports-color "^3.1.1"
+    webpack-dev-middleware "^1.10.2"
+
+webpack@^1.12.2:
+  version "1.15.0"
+  resolved "https://registry.yarnpkg.com/webpack/-/webpack-1.15.0.tgz#4ff31f53db03339e55164a9d468ee0324968fe98"
+  dependencies:
+    acorn "^3.0.0"
+    async "^1.3.0"
+    clone "^1.0.2"
+    enhanced-resolve "~0.9.0"
+    interpret "^0.6.4"
+    loader-utils "^0.2.11"
+    memory-fs "~0.3.0"
+    mkdirp "~0.5.0"
+    node-libs-browser "^0.7.0"
+    optimist "~0.6.0"
+    supports-color "^3.1.0"
+    tapable "~0.1.8"
+    uglify-js "~2.7.3"
+    watchpack "^0.2.1"
+    webpack-core "~0.6.9"
+
+websocket-driver@>=0.5.1:
+  version "0.7.0"
+  resolved "https://registry.yarnpkg.com/websocket-driver/-/websocket-driver-0.7.0.tgz#0caf9d2d755d93aee049d4bdd0d3fe2cca2a24eb"
+  dependencies:
+    http-parser-js ">=0.4.0"
+    websocket-extensions ">=0.1.1"
+
+websocket-extensions@>=0.1.1:
+  version "0.1.3"
+  resolved "https://registry.yarnpkg.com/websocket-extensions/-/websocket-extensions-0.1.3.tgz#5d2ff22977003ec687a4b87073dfbbac146ccf29"
+
+which-module@^2.0.0:
+  version "2.0.0"
+  resolved "https://registry.yarnpkg.com/which-module/-/which-module-2.0.0.tgz#d9ef07dce77b9902b8a3a8fa4b31c3e3f7e6e87a"
+
+which@^1.1.1, which@^1.2.10, which@^1.2.9, which@^1.3.0:
+  version "1.3.0"
+  resolved "https://registry.yarnpkg.com/which/-/which-1.3.0.tgz#ff04bdfc010ee547d780bec38e1ac1c2777d253a"
+  dependencies:
+    isexe "^2.0.0"
+
+which@~1.0.5:
+  version "1.0.9"
+  resolved "https://registry.yarnpkg.com/which/-/which-1.0.9.tgz#460c1da0f810103d0321a9b633af9e575e64486f"
+
+wide-align@^1.1.0:
+  version "1.1.2"
+  resolved "https://registry.yarnpkg.com/wide-align/-/wide-align-1.1.2.tgz#571e0f1b0604636ebc0dfc21b0339bbe31341710"
+  dependencies:
+    string-width "^1.0.2"
+
+window-size@0.1.0:
+  version "0.1.0"
+  resolved "https://registry.yarnpkg.com/window-size/-/window-size-0.1.0.tgz#5438cd2ea93b202efa3a19fe8887aee7c94f9c9d"
+
+winston@0.5.x:
+  version "0.5.11"
+  resolved "https://registry.yarnpkg.com/winston/-/winston-0.5.11.tgz#9d84ead981a497a92ddf76616137abef661c414f"
+  dependencies:
+    async "0.1.x"
+    colors "0.x.x"
+    eyes "0.1.x"
+    loggly "0.3.x >=0.3.7"
+    pkginfo "0.2.x"
+    stack-trace "0.0.x"
+
+wordwrap@0.0.2:
+  version "0.0.2"
+  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-0.0.2.tgz#b79669bb42ecb409f83d583cad52ca17eaa1643f"
+
+wordwrap@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb"
+
+wordwrap@~0.0.2:
+  version "0.0.3"
+  resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-0.0.3.tgz#a3d5da6cd5c0bc0008d37234bbaf1bed63059107"
+
+wrap-ansi@^2.0.0:
+  version "2.1.0"
+  resolved "https://registry.yarnpkg.com/wrap-ansi/-/wrap-ansi-2.1.0.tgz#d8fc3d284dd05794fe84973caecdd1cf824fdd85"
+  dependencies:
+    string-width "^1.0.1"
+    strip-ansi "^3.0.1"
+
+wrappy@1:
+  version "1.0.2"
+  resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f"
+
+write-file-atomic@^1.1.4:
+  version "1.3.4"
+  resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-1.3.4.tgz#f807a4f0b1d9e913ae7a48112e6cc3af1991b45f"
+  dependencies:
+    graceful-fs "^4.1.11"
+    imurmurhash "^0.1.4"
+    slide "^1.1.5"
+
+write-file-atomic@^2.3.0:
+  version "2.3.0"
+  resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-2.3.0.tgz#1ff61575c2e2a4e8e510d6fa4e243cce183999ab"
+  dependencies:
+    graceful-fs "^4.1.11"
+    imurmurhash "^0.1.4"
+    signal-exit "^3.0.2"
+
+write@^0.2.1:
+  version "0.2.1"
+  resolved "https://registry.yarnpkg.com/write/-/write-0.2.1.tgz#5fc03828e264cea3fe91455476f7a3c566cb0757"
+  dependencies:
+    mkdirp "^0.5.1"
+
+ws@~1.1.5:
+  version "1.1.5"
+  resolved "https://registry.yarnpkg.com/ws/-/ws-1.1.5.tgz#cbd9e6e75e09fc5d2c90015f21f0c40875e0dd51"
+  dependencies:
+    options ">=0.0.5"
+    ultron "1.0.x"
+
+wtf-8@1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/wtf-8/-/wtf-8-1.0.0.tgz#392d8ba2d0f1c34d1ee2d630f15d0efb68e1048a"
+
+xml-escape@~1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/xml-escape/-/xml-escape-1.0.0.tgz#00963d697b2adf0c185c4e04e73174ba9b288eb2"
+
+xmlhttprequest-ssl@1.5.3:
+  version "1.5.3"
+  resolved "https://registry.yarnpkg.com/xmlhttprequest-ssl/-/xmlhttprequest-ssl-1.5.3.tgz#185a888c04eca46c3e4070d99f7b49de3528992d"
+
+xtend@^4.0.0:
+  version "4.0.1"
+  resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.1.tgz#a5c6d532be656e23db820efb943a1f04998d63af"
+
+y18n@^3.2.1:
+  version "3.2.1"
+  resolved "https://registry.yarnpkg.com/y18n/-/y18n-3.2.1.tgz#6d15fba884c08679c0d77e88e7759e811e07fa41"
+
+yallist@^2.1.2:
+  version "2.1.2"
+  resolved "https://registry.yarnpkg.com/yallist/-/yallist-2.1.2.tgz#1c11f9218f076089a47dd512f93c6699a6a81d52"
+
+yallist@^3.0.0:
+  version "3.0.2"
+  resolved "https://registry.yarnpkg.com/yallist/-/yallist-3.0.2.tgz#8452b4bb7e83c7c188d8041c1a837c773d6d8bb9"
+
+yapool@^1.0.0:
+  version "1.0.0"
+  resolved "https://registry.yarnpkg.com/yapool/-/yapool-1.0.0.tgz#f693f29a315b50d9a9da2646a7a6645c96985b6a"
+
+yargs-parser@^8.0.0, yargs-parser@^8.1.0:
+  version "8.1.0"
+  resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-8.1.0.tgz#f1376a33b6629a5d063782944da732631e966950"
+  dependencies:
+    camelcase "^4.1.0"
+
+yargs@^10.0.3:
+  version "10.1.2"
+  resolved "https://registry.yarnpkg.com/yargs/-/yargs-10.1.2.tgz#454d074c2b16a51a43e2fb7807e4f9de69ccb5c5"
+  dependencies:
+    cliui "^4.0.0"
+    decamelize "^1.1.1"
+    find-up "^2.1.0"
+    get-caller-file "^1.0.1"
+    os-locale "^2.0.0"
+    require-directory "^2.1.1"
+    require-main-filename "^1.0.1"
+    set-blocking "^2.0.0"
+    string-width "^2.0.0"
+    which-module "^2.0.0"
+    y18n "^3.2.1"
+    yargs-parser "^8.1.0"
+
+yargs@~3.10.0:
+  version "3.10.0"
+  resolved "https://registry.yarnpkg.com/yargs/-/yargs-3.10.0.tgz#f7ee7bd857dd7c1d2d38c0e74efbd681d1431fd1"
+  dependencies:
+    camelcase "^1.0.2"
+    cliui "^2.1.0"
+    decamelize "^1.0.0"
+    window-size "0.1.0"
+
+yauzl@2.4.1:
+  version "2.4.1"
+  resolved "https://registry.yarnpkg.com/yauzl/-/yauzl-2.4.1.tgz#9528f442dab1b2284e58b4379bb194e22e0c4005"
+  dependencies:
+    fd-slicer "~1.0.1"
+
+yeast@0.1.2:
+  version "0.1.2"
+  resolved "https://registry.yarnpkg.com/yeast/-/yeast-0.1.2.tgz#008e06d8094320c372dbc2f8ed76a0ca6c8ac419"
+
+zip-stream@~0.5.0:
+  version "0.5.2"
+  resolved "https://registry.yarnpkg.com/zip-stream/-/zip-stream-0.5.2.tgz#32dcbc506d0dab4d21372625bd7ebaac3c2fff56"
+  dependencies:
+    compress-commons "~0.2.0"
+    lodash "~3.2.0"
+    readable-stream "~1.0.26"
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/index.js
new file mode 100644
index 00000000000..8e83819cea5
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/index.js
@@ -0,0 +1,46 @@
+'use strict';
+const path = require('path');
+const locatePath = require('locate-path');
+
+module.exports = (filename, opts = {}) => {
+	const startDir = path.resolve(opts.cwd || '');
+	const {root} = path.parse(startDir);
+
+	const filenames = [].concat(filename);
+
+	return new Promise(resolve => {
+		(function find(dir) {
+			locatePath(filenames, {cwd: dir}).then(file => {
+				if (file) {
+					resolve(path.join(dir, file));
+				} else if (dir === root) {
+					resolve(null);
+				} else {
+					find(path.dirname(dir));
+				}
+			});
+		})(startDir);
+	});
+};
+
+module.exports.sync = (filename, opts = {}) => {
+	let dir = path.resolve(opts.cwd || '');
+	const {root} = path.parse(dir);
+
+	const filenames = [].concat(filename);
+
+	// eslint-disable-next-line no-constant-condition
+	while (true) {
+		const file = locatePath.sync(filenames, {cwd: dir});
+
+		if (file) {
+			return path.join(dir, file);
+		}
+
+		if (dir === root) {
+			return null;
+		}
+
+		dir = path.dirname(dir);
+	}
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/license b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/license
new file mode 100644
index 00000000000..e7af2f77107
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/license
@@ -0,0 +1,9 @@
+MIT License
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/package.json b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/package.json
new file mode 100644
index 00000000000..a8ac9b90ecf
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/package.json
@@ -0,0 +1,50 @@
+{
+  "author": {
+    "email": "sindresorhus@gmail.com", 
+    "name": "Sindre Sorhus", 
+    "url": "sindresorhus.com"
+  }, 
+  "dependencies": {
+    "locate-path": "^3.0.0"
+  }, 
+  "description": "Find a file or directory by walking up parent directories", 
+  "devDependencies": {
+    "ava": "*", 
+    "tempy": "^0.2.1", 
+    "xo": "*"
+  }, 
+  "engines": {
+    "node": ">=6"
+  }, 
+  "files": [
+    "index.js"
+  ], 
+  "keywords": [
+    "find", 
+    "up", 
+    "find-up", 
+    "findup", 
+    "look-up", 
+    "look", 
+    "file", 
+    "search", 
+    "match", 
+    "package", 
+    "resolve", 
+    "parent", 
+    "parents", 
+    "folder", 
+    "directory", 
+    "dir", 
+    "walk", 
+    "walking", 
+    "path"
+  ], 
+  "license": "MIT", 
+  "name": "find-up", 
+  "repository": "sindresorhus/find-up", 
+  "scripts": {
+    "test": "xo && ava"
+  }, 
+  "version": "3.0.0"
+}
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/readme.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/readme.md
new file mode 100644
index 00000000000..810ad7ceb52
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/find-up/readme.md
@@ -0,0 +1,87 @@
+# find-up [![Build Status: Linux and macOS](https://travis-ci.org/sindresorhus/find-up.svg?branch=master)](https://travis-ci.org/sindresorhus/find-up) [![Build Status: Windows](https://ci.appveyor.com/api/projects/status/l0cyjmvh5lq72vq2/branch/master?svg=true)](https://ci.appveyor.com/project/sindresorhus/find-up/branch/master)
+
+> Find a file or directory by walking up parent directories
+
+
+## Install
+
+```
+$ npm install find-up
+```
+
+
+## Usage
+
+```
+/
+└── Users
+		└── sindresorhus
+				├── unicorn.png
+				└── foo
+						└── bar
+								├── baz
+								└── example.js
+```
+
+`example.js`
+
+```js
+const findUp = require('find-up');
+
+(async () => {
+	console.log(await findUp('unicorn.png'));
+	//=> '/Users/sindresorhus/unicorn.png'
+
+	console.log(await findUp(['rainbow.png', 'unicorn.png']));
+	//=> '/Users/sindresorhus/unicorn.png'
+})();
+```
+
+
+## API
+
+### findUp(filename, [options])
+
+Returns a `Promise` for either the filepath or `null` if it couldn't be found.
+
+### findUp([filenameA, filenameB], [options])
+
+Returns a `Promise` for either the first filepath found (by respecting the order) or `null` if none could be found.
+
+### findUp.sync(filename, [options])
+
+Returns a filepath or `null`.
+
+### findUp.sync([filenameA, filenameB], [options])
+
+Returns the first filepath found (by respecting the order) or `null`.
+
+#### filename
+
+Type: `string`
+
+Filename of the file to find.
+
+#### options
+
+Type: `Object`
+
+##### cwd
+
+Type: `string`<br>
+Default: `process.cwd()`
+
+Directory to start from.
+
+
+## Related
+
+- [find-up-cli](https://github.com/sindresorhus/find-up-cli) - CLI for this module
+- [pkg-up](https://github.com/sindresorhus/pkg-up) - Find the closest package.json file
+- [pkg-dir](https://github.com/sindresorhus/pkg-dir) - Find the root directory of an npm package
+- [resolve-from](https://github.com/sindresorhus/resolve-from) - Resolve the path of a module like `require.resolve()` but from a given path
+
+
+## License
+
+MIT © [Sindre Sorhus](https://sindresorhus.com)
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/LICENSE b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/LICENSE
new file mode 100644
index 00000000000..19129e315fe
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/LICENSE
@@ -0,0 +1,15 @@
+The ISC License
+
+Copyright (c) Isaac Z. Schlueter and Contributors
+
+Permission to use, copy, modify, and/or distribute this software for any
+purpose with or without fee is hereby granted, provided that the above
+copyright notice and this permission notice appear in all copies.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR
+IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/README.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/README.md
new file mode 100644
index 00000000000..baa1d1ba865
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/README.md
@@ -0,0 +1,368 @@
+# Glob
+
+Match files using the patterns the shell uses, like stars and stuff.
+
+[![Build Status](https://travis-ci.org/isaacs/node-glob.svg?branch=master)](https://travis-ci.org/isaacs/node-glob/) [![Build Status](https://ci.appveyor.com/api/projects/status/kd7f3yftf7unxlsx?svg=true)](https://ci.appveyor.com/project/isaacs/node-glob) [![Coverage Status](https://coveralls.io/repos/isaacs/node-glob/badge.svg?branch=master&service=github)](https://coveralls.io/github/isaacs/node-glob?branch=master)
+
+This is a glob implementation in JavaScript.  It uses the `minimatch`
+library to do its matching.
+
+![](oh-my-glob.gif)
+
+## Usage
+
+Install with npm
+
+```
+npm i glob
+```
+
+```javascript
+var glob = require("glob")
+
+// options is optional
+glob("**/*.js", options, function (er, files) {
+  // files is an array of filenames.
+  // If the `nonull` option is set, and nothing
+  // was found, then files is ["**/*.js"]
+  // er is an error object or null.
+})
+```
+
+## Glob Primer
+
+"Globs" are the patterns you type when you do stuff like `ls *.js` on
+the command line, or put `build/*` in a `.gitignore` file.
+
+Before parsing the path part patterns, braced sections are expanded
+into a set.  Braced sections start with `{` and end with `}`, with any
+number of comma-delimited sections within.  Braced sections may contain
+slash characters, so `a{/b/c,bcd}` would expand into `a/b/c` and `abcd`.
+
+The following characters have special magic meaning when used in a
+path portion:
+
+* `*` Matches 0 or more characters in a single path portion
+* `?` Matches 1 character
+* `[...]` Matches a range of characters, similar to a RegExp range.
+  If the first character of the range is `!` or `^` then it matches
+  any character not in the range.
+* `!(pattern|pattern|pattern)` Matches anything that does not match
+  any of the patterns provided.
+* `?(pattern|pattern|pattern)` Matches zero or one occurrence of the
+  patterns provided.
+* `+(pattern|pattern|pattern)` Matches one or more occurrences of the
+  patterns provided.
+* `*(a|b|c)` Matches zero or more occurrences of the patterns provided
+* `@(pattern|pat*|pat?erN)` Matches exactly one of the patterns
+  provided
+* `**` If a "globstar" is alone in a path portion, then it matches
+  zero or more directories and subdirectories searching for matches.
+  It does not crawl symlinked directories.
+
+### Dots
+
+If a file or directory path portion has a `.` as the first character,
+then it will not match any glob pattern unless that pattern's
+corresponding path part also has a `.` as its first character.
+
+For example, the pattern `a/.*/c` would match the file at `a/.b/c`.
+However the pattern `a/*/c` would not, because `*` does not start with
+a dot character.
+
+You can make glob treat dots as normal characters by setting
+`dot:true` in the options.
+
+### Basename Matching
+
+If you set `matchBase:true` in the options, and the pattern has no
+slashes in it, then it will seek for any file anywhere in the tree
+with a matching basename.  For example, `*.js` would match
+`test/simple/basic.js`.
+
+### Empty Sets
+
+If no matching files are found, then an empty array is returned.  This
+differs from the shell, where the pattern itself is returned.  For
+example:
+
+    $ echo a*s*d*f
+    a*s*d*f
+
+To get the bash-style behavior, set the `nonull:true` in the options.
+
+### See Also:
+
+* `man sh`
+* `man bash` (Search for "Pattern Matching")
+* `man 3 fnmatch`
+* `man 5 gitignore`
+* [minimatch documentation](https://github.com/isaacs/minimatch)
+
+## glob.hasMagic(pattern, [options])
+
+Returns `true` if there are any special characters in the pattern, and
+`false` otherwise.
+
+Note that the options affect the results.  If `noext:true` is set in
+the options object, then `+(a|b)` will not be considered a magic
+pattern.  If the pattern has a brace expansion, like `a/{b/c,x/y}`
+then that is considered magical, unless `nobrace:true` is set in the
+options.
+
+## glob(pattern, [options], cb)
+
+* `pattern` `{String}` Pattern to be matched
+* `options` `{Object}`
+* `cb` `{Function}`
+  * `err` `{Error | null}`
+  * `matches` `{Array<String>}` filenames found matching the pattern
+
+Perform an asynchronous glob search.
+
+## glob.sync(pattern, [options])
+
+* `pattern` `{String}` Pattern to be matched
+* `options` `{Object}`
+* return: `{Array<String>}` filenames found matching the pattern
+
+Perform a synchronous glob search.
+
+## Class: glob.Glob
+
+Create a Glob object by instantiating the `glob.Glob` class.
+
+```javascript
+var Glob = require("glob").Glob
+var mg = new Glob(pattern, options, cb)
+```
+
+It's an EventEmitter, and starts walking the filesystem to find matches
+immediately.
+
+### new glob.Glob(pattern, [options], [cb])
+
+* `pattern` `{String}` pattern to search for
+* `options` `{Object}`
+* `cb` `{Function}` Called when an error occurs, or matches are found
+  * `err` `{Error | null}`
+  * `matches` `{Array<String>}` filenames found matching the pattern
+
+Note that if the `sync` flag is set in the options, then matches will
+be immediately available on the `g.found` member.
+
+### Properties
+
+* `minimatch` The minimatch object that the glob uses.
+* `options` The options object passed in.
+* `aborted` Boolean which is set to true when calling `abort()`.  There
+  is no way at this time to continue a glob search after aborting, but
+  you can re-use the statCache to avoid having to duplicate syscalls.
+* `cache` Convenience object.  Each field has the following possible
+  values:
+  * `false` - Path does not exist
+  * `true` - Path exists
+  * `'FILE'` - Path exists, and is not a directory
+  * `'DIR'` - Path exists, and is a directory
+  * `[file, entries, ...]` - Path exists, is a directory, and the
+    array value is the results of `fs.readdir`
+* `statCache` Cache of `fs.stat` results, to prevent statting the same
+  path multiple times.
+* `symlinks` A record of which paths are symbolic links, which is
+  relevant in resolving `**` patterns.
+* `realpathCache` An optional object which is passed to `fs.realpath`
+  to minimize unnecessary syscalls.  It is stored on the instantiated
+  Glob object, and may be re-used.
+
+### Events
+
+* `end` When the matching is finished, this is emitted with all the
+  matches found.  If the `nonull` option is set, and no match was found,
+  then the `matches` list contains the original pattern.  The matches
+  are sorted, unless the `nosort` flag is set.
+* `match` Every time a match is found, this is emitted with the specific
+  thing that matched. It is not deduplicated or resolved to a realpath.
+* `error` Emitted when an unexpected error is encountered, or whenever
+  any fs error occurs if `options.strict` is set.
+* `abort` When `abort()` is called, this event is raised.
+
+### Methods
+
+* `pause` Temporarily stop the search
+* `resume` Resume the search
+* `abort` Stop the search forever
+
+### Options
+
+All the options that can be passed to Minimatch can also be passed to
+Glob to change pattern matching behavior.  Also, some have been added,
+or have glob-specific ramifications.
+
+All options are false by default, unless otherwise noted.
+
+All options are added to the Glob object, as well.
+
+If you are running many `glob` operations, you can pass a Glob object
+as the `options` argument to a subsequent operation to shortcut some
+`stat` and `readdir` calls.  At the very least, you may pass in shared
+`symlinks`, `statCache`, `realpathCache`, and `cache` options, so that
+parallel glob operations will be sped up by sharing information about
+the filesystem.
+
+* `cwd` The current working directory in which to search.  Defaults
+  to `process.cwd()`.
+* `root` The place where patterns starting with `/` will be mounted
+  onto.  Defaults to `path.resolve(options.cwd, "/")` (`/` on Unix
+  systems, and `C:\` or some such on Windows.)
+* `dot` Include `.dot` files in normal matches and `globstar` matches.
+  Note that an explicit dot in a portion of the pattern will always
+  match dot files.
+* `nomount` By default, a pattern starting with a forward-slash will be
+  "mounted" onto the root setting, so that a valid filesystem path is
+  returned.  Set this flag to disable that behavior.
+* `mark` Add a `/` character to directory matches.  Note that this
+  requires additional stat calls.
+* `nosort` Don't sort the results.
+* `stat` Set to true to stat *all* results.  This reduces performance
+  somewhat, and is completely unnecessary, unless `readdir` is presumed
+  to be an untrustworthy indicator of file existence.
+* `silent` When an unusual error is encountered when attempting to
+  read a directory, a warning will be printed to stderr.  Set the
+  `silent` option to true to suppress these warnings.
+* `strict` When an unusual error is encountered when attempting to
+  read a directory, the process will just continue on in search of
+  other matches.  Set the `strict` option to raise an error in these
+  cases.
+* `cache` See `cache` property above.  Pass in a previously generated
+  cache object to save some fs calls.
+* `statCache` A cache of results of filesystem information, to prevent
+  unnecessary stat calls.  While it should not normally be necessary
+  to set this, you may pass the statCache from one glob() call to the
+  options object of another, if you know that the filesystem will not
+  change between calls.  (See "Race Conditions" below.)
+* `symlinks` A cache of known symbolic links.  You may pass in a
+  previously generated `symlinks` object to save `lstat` calls when
+  resolving `**` matches.
+* `sync` DEPRECATED: use `glob.sync(pattern, opts)` instead.
+* `nounique` In some cases, brace-expanded patterns can result in the
+  same file showing up multiple times in the result set.  By default,
+  this implementation prevents duplicates in the result set.  Set this
+  flag to disable that behavior.
+* `nonull` Set to never return an empty set, instead returning a set
+  containing the pattern itself.  This is the default in glob(3).
+* `debug` Set to enable debug logging in minimatch and glob.
+* `nobrace` Do not expand `{a,b}` and `{1..3}` brace sets.
+* `noglobstar` Do not match `**` against multiple filenames.  (Ie,
+  treat it as a normal `*` instead.)
+* `noext` Do not match `+(a|b)` "extglob" patterns.
+* `nocase` Perform a case-insensitive match.  Note: on
+  case-insensitive filesystems, non-magic patterns will match by
+  default, since `stat` and `readdir` will not raise errors.
+* `matchBase` Perform a basename-only match if the pattern does not
+  contain any slash characters.  That is, `*.js` would be treated as
+  equivalent to `**/*.js`, matching all js files in all directories.
+* `nodir` Do not match directories, only files.  (Note: to match
+  *only* directories, simply put a `/` at the end of the pattern.)
+* `ignore` Add a pattern or an array of glob patterns to exclude matches.
+  Note: `ignore` patterns are *always* in `dot:true` mode, regardless
+  of any other settings.
+* `follow` Follow symlinked directories when expanding `**` patterns.
+  Note that this can result in a lot of duplicate references in the
+  presence of cyclic links.
+* `realpath` Set to true to call `fs.realpath` on all of the results.
+  In the case of a symlink that cannot be resolved, the full absolute
+  path to the matched entry is returned (though it will usually be a
+  broken symlink)
+* `absolute` Set to true to always receive absolute paths for matched
+  files.  Unlike `realpath`, this also affects the values returned in
+  the `match` event.
+
+## Comparisons to other fnmatch/glob implementations
+
+While strict compliance with the existing standards is a worthwhile
+goal, some discrepancies exist between node-glob and other
+implementations, and are intentional.
+
+The double-star character `**` is supported by default, unless the
+`noglobstar` flag is set.  This is supported in the manner of bsdglob
+and bash 4.3, where `**` only has special significance if it is the only
+thing in a path part.  That is, `a/**/b` will match `a/x/y/b`, but
+`a/**b` will not.
+
+Note that symlinked directories are not crawled as part of a `**`,
+though their contents may match against subsequent portions of the
+pattern.  This prevents infinite loops and duplicates and the like.
+
+If an escaped pattern has no matches, and the `nonull` flag is set,
+then glob returns the pattern as-provided, rather than
+interpreting the character escapes.  For example,
+`glob.match([], "\\*a\\?")` will return `"\\*a\\?"` rather than
+`"*a?"`.  This is akin to setting the `nullglob` option in bash, except
+that it does not resolve escaped pattern characters.
+
+If brace expansion is not disabled, then it is performed before any
+other interpretation of the glob pattern.  Thus, a pattern like
+`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded
+**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are
+checked for validity.  Since those two are valid, matching proceeds.
+
+### Comments and Negation
+
+Previously, this module let you mark a pattern as a "comment" if it
+started with a `#` character, or a "negated" pattern if it started
+with a `!` character.
+
+These options were deprecated in version 5, and removed in version 6.
+
+To specify things that should not match, use the `ignore` option.
+
+## Windows
+
+**Please only use forward-slashes in glob expressions.**
+
+Though windows uses either `/` or `\` as its path separator, only `/`
+characters are used by this glob implementation.  You must use
+forward-slashes **only** in glob expressions.  Back-slashes will always
+be interpreted as escape characters, not path separators.
+
+Results from absolute patterns such as `/foo/*` are mounted onto the
+root setting using `path.join`.  On windows, this will by default result
+in `/foo/*` matching `C:\foo\bar.txt`.
+
+## Race Conditions
+
+Glob searching, by its very nature, is susceptible to race conditions,
+since it relies on directory walking and such.
+
+As a result, it is possible that a file that exists when glob looks for
+it may have been deleted or modified by the time it returns the result.
+
+As part of its internal implementation, this program caches all stat
+and readdir calls that it makes, in order to cut down on system
+overhead.  However, this also makes it even more susceptible to races,
+especially if the cache or statCache objects are reused between glob
+calls.
+
+Users are thus advised not to use a glob result as a guarantee of
+filesystem state in the face of rapid changes.  For the vast majority
+of operations, this is never a problem.
+
+## Contributing
+
+Any change to behavior (including bugfixes) must come with a test.
+
+Patches that fail tests or reduce performance will be rejected.
+
+```
+# to run tests
+npm test
+
+# to re-generate test fixtures
+npm run test-regen
+
+# to benchmark against bash/zsh
+npm run bench
+
+# to profile javascript
+npm run prof
+```
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/changelog.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/changelog.md
new file mode 100644
index 00000000000..41636771e3a
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/changelog.md
@@ -0,0 +1,67 @@
+## 7.0
+
+- Raise error if `options.cwd` is specified, and not a directory
+
+## 6.0
+
+- Remove comment and negation pattern support
+- Ignore patterns are always in `dot:true` mode
+
+## 5.0
+
+- Deprecate comment and negation patterns
+- Fix regression in `mark` and `nodir` options from making all cache
+  keys absolute path.
+- Abort if `fs.readdir` returns an error that's unexpected
+- Don't emit `match` events for ignored items
+- Treat ENOTSUP like ENOTDIR in readdir
+
+## 4.5
+
+- Add `options.follow` to always follow directory symlinks in globstar
+- Add `options.realpath` to call `fs.realpath` on all results
+- Always cache based on absolute path
+
+## 4.4
+
+- Add `options.ignore`
+- Fix handling of broken symlinks
+
+## 4.3
+
+- Bump minimatch to 2.x
+- Pass all tests on Windows
+
+## 4.2
+
+- Add `glob.hasMagic` function
+- Add `options.nodir` flag
+
+## 4.1
+
+- Refactor sync and async implementations for performance
+- Throw if callback provided to sync glob function
+- Treat symbolic links in globstar results the same as Bash 4.3
+
+## 4.0
+
+- Use `^` for dependency versions (bumped major because this breaks
+  older npm versions)
+- Ensure callbacks are only ever called once
+- switch to ISC license
+
+## 3.x
+
+- Rewrite in JavaScript
+- Add support for setting root, cwd, and windows support
+- Cache many fs calls
+- Add globstar support
+- emit match events
+
+## 2.x
+
+- Use `glob.h` and `fnmatch.h` from NetBSD
+
+## 1.x
+
+- `glob.h` static binding.
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/common.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/common.js
new file mode 100644
index 00000000000..66651bb3aac
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/common.js
@@ -0,0 +1,240 @@
+exports.alphasort = alphasort
+exports.alphasorti = alphasorti
+exports.setopts = setopts
+exports.ownProp = ownProp
+exports.makeAbs = makeAbs
+exports.finish = finish
+exports.mark = mark
+exports.isIgnored = isIgnored
+exports.childrenIgnored = childrenIgnored
+
+function ownProp (obj, field) {
+  return Object.prototype.hasOwnProperty.call(obj, field)
+}
+
+var path = require("path")
+var minimatch = require("minimatch")
+var isAbsolute = require("path-is-absolute")
+var Minimatch = minimatch.Minimatch
+
+function alphasorti (a, b) {
+  return a.toLowerCase().localeCompare(b.toLowerCase())
+}
+
+function alphasort (a, b) {
+  return a.localeCompare(b)
+}
+
+function setupIgnores (self, options) {
+  self.ignore = options.ignore || []
+
+  if (!Array.isArray(self.ignore))
+    self.ignore = [self.ignore]
+
+  if (self.ignore.length) {
+    self.ignore = self.ignore.map(ignoreMap)
+  }
+}
+
+// ignore patterns are always in dot:true mode.
+function ignoreMap (pattern) {
+  var gmatcher = null
+  if (pattern.slice(-3) === '/**') {
+    var gpattern = pattern.replace(/(\/\*\*)+$/, '')
+    gmatcher = new Minimatch(gpattern, { dot: true })
+  }
+
+  return {
+    matcher: new Minimatch(pattern, { dot: true }),
+    gmatcher: gmatcher
+  }
+}
+
+function setopts (self, pattern, options) {
+  if (!options)
+    options = {}
+
+  // base-matching: just use globstar for that.
+  if (options.matchBase && -1 === pattern.indexOf("/")) {
+    if (options.noglobstar) {
+      throw new Error("base matching requires globstar")
+    }
+    pattern = "**/" + pattern
+  }
+
+  self.silent = !!options.silent
+  self.pattern = pattern
+  self.strict = options.strict !== false
+  self.realpath = !!options.realpath
+  self.realpathCache = options.realpathCache || Object.create(null)
+  self.follow = !!options.follow
+  self.dot = !!options.dot
+  self.mark = !!options.mark
+  self.nodir = !!options.nodir
+  if (self.nodir)
+    self.mark = true
+  self.sync = !!options.sync
+  self.nounique = !!options.nounique
+  self.nonull = !!options.nonull
+  self.nosort = !!options.nosort
+  self.nocase = !!options.nocase
+  self.stat = !!options.stat
+  self.noprocess = !!options.noprocess
+  self.absolute = !!options.absolute
+
+  self.maxLength = options.maxLength || Infinity
+  self.cache = options.cache || Object.create(null)
+  self.statCache = options.statCache || Object.create(null)
+  self.symlinks = options.symlinks || Object.create(null)
+
+  setupIgnores(self, options)
+
+  self.changedCwd = false
+  var cwd = process.cwd()
+  if (!ownProp(options, "cwd"))
+    self.cwd = cwd
+  else {
+    self.cwd = path.resolve(options.cwd)
+    self.changedCwd = self.cwd !== cwd
+  }
+
+  self.root = options.root || path.resolve(self.cwd, "/")
+  self.root = path.resolve(self.root)
+  if (process.platform === "win32")
+    self.root = self.root.replace(/\\/g, "/")
+
+  // TODO: is an absolute `cwd` supposed to be resolved against `root`?
+  // e.g. { cwd: '/test', root: __dirname } === path.join(__dirname, '/test')
+  self.cwdAbs = isAbsolute(self.cwd) ? self.cwd : makeAbs(self, self.cwd)
+  if (process.platform === "win32")
+    self.cwdAbs = self.cwdAbs.replace(/\\/g, "/")
+  self.nomount = !!options.nomount
+
+  // disable comments and negation in Minimatch.
+  // Note that they are not supported in Glob itself anyway.
+  options.nonegate = true
+  options.nocomment = true
+
+  self.minimatch = new Minimatch(pattern, options)
+  self.options = self.minimatch.options
+}
+
+function finish (self) {
+  var nou = self.nounique
+  var all = nou ? [] : Object.create(null)
+
+  for (var i = 0, l = self.matches.length; i < l; i ++) {
+    var matches = self.matches[i]
+    if (!matches || Object.keys(matches).length === 0) {
+      if (self.nonull) {
+        // do like the shell, and spit out the literal glob
+        var literal = self.minimatch.globSet[i]
+        if (nou)
+          all.push(literal)
+        else
+          all[literal] = true
+      }
+    } else {
+      // had matches
+      var m = Object.keys(matches)
+      if (nou)
+        all.push.apply(all, m)
+      else
+        m.forEach(function (m) {
+          all[m] = true
+        })
+    }
+  }
+
+  if (!nou)
+    all = Object.keys(all)
+
+  if (!self.nosort)
+    all = all.sort(self.nocase ? alphasorti : alphasort)
+
+  // at *some* point we statted all of these
+  if (self.mark) {
+    for (var i = 0; i < all.length; i++) {
+      all[i] = self._mark(all[i])
+    }
+    if (self.nodir) {
+      all = all.filter(function (e) {
+        var notDir = !(/\/$/.test(e))
+        var c = self.cache[e] || self.cache[makeAbs(self, e)]
+        if (notDir && c)
+          notDir = c !== 'DIR' && !Array.isArray(c)
+        return notDir
+      })
+    }
+  }
+
+  if (self.ignore.length)
+    all = all.filter(function(m) {
+      return !isIgnored(self, m)
+    })
+
+  self.found = all
+}
+
+function mark (self, p) {
+  var abs = makeAbs(self, p)
+  var c = self.cache[abs]
+  var m = p
+  if (c) {
+    var isDir = c === 'DIR' || Array.isArray(c)
+    var slash = p.slice(-1) === '/'
+
+    if (isDir && !slash)
+      m += '/'
+    else if (!isDir && slash)
+      m = m.slice(0, -1)
+
+    if (m !== p) {
+      var mabs = makeAbs(self, m)
+      self.statCache[mabs] = self.statCache[abs]
+      self.cache[mabs] = self.cache[abs]
+    }
+  }
+
+  return m
+}
+
+// lotta situps...
+function makeAbs (self, f) {
+  var abs = f
+  if (f.charAt(0) === '/') {
+    abs = path.join(self.root, f)
+  } else if (isAbsolute(f) || f === '') {
+    abs = f
+  } else if (self.changedCwd) {
+    abs = path.resolve(self.cwd, f)
+  } else {
+    abs = path.resolve(f)
+  }
+
+  if (process.platform === 'win32')
+    abs = abs.replace(/\\/g, '/')
+
+  return abs
+}
+
+
+// Return true, if pattern ends with globstar '**', for the accompanying parent directory.
+// Ex:- If node_modules/** is the pattern, add 'node_modules' to ignore list along with it's contents
+function isIgnored (self, path) {
+  if (!self.ignore.length)
+    return false
+
+  return self.ignore.some(function(item) {
+    return item.matcher.match(path) || !!(item.gmatcher && item.gmatcher.match(path))
+  })
+}
+
+function childrenIgnored (self, path) {
+  if (!self.ignore.length)
+    return false
+
+  return self.ignore.some(function(item) {
+    return !!(item.gmatcher && item.gmatcher.match(path))
+  })
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/glob.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/glob.js
new file mode 100644
index 00000000000..58dec0f6c2b
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/glob.js
@@ -0,0 +1,790 @@
+// Approach:
+//
+// 1. Get the minimatch set
+// 2. For each pattern in the set, PROCESS(pattern, false)
+// 3. Store matches per-set, then uniq them
+//
+// PROCESS(pattern, inGlobStar)
+// Get the first [n] items from pattern that are all strings
+// Join these together.  This is PREFIX.
+//   If there is no more remaining, then stat(PREFIX) and
+//   add to matches if it succeeds.  END.
+//
+// If inGlobStar and PREFIX is symlink and points to dir
+//   set ENTRIES = []
+// else readdir(PREFIX) as ENTRIES
+//   If fail, END
+//
+// with ENTRIES
+//   If pattern[n] is GLOBSTAR
+//     // handle the case where the globstar match is empty
+//     // by pruning it out, and testing the resulting pattern
+//     PROCESS(pattern[0..n] + pattern[n+1 .. $], false)
+//     // handle other cases.
+//     for ENTRY in ENTRIES (not dotfiles)
+//       // attach globstar + tail onto the entry
+//       // Mark that this entry is a globstar match
+//       PROCESS(pattern[0..n] + ENTRY + pattern[n .. $], true)
+//
+//   else // not globstar
+//     for ENTRY in ENTRIES (not dotfiles, unless pattern[n] is dot)
+//       Test ENTRY against pattern[n]
+//       If fails, continue
+//       If passes, PROCESS(pattern[0..n] + item + pattern[n+1 .. $])
+//
+// Caveat:
+//   Cache all stats and readdirs results to minimize syscall.  Since all
+//   we ever care about is existence and directory-ness, we can just keep
+//   `true` for files, and [children,...] for directories, or `false` for
+//   things that don't exist.
+
+module.exports = glob
+
+var fs = require('fs')
+var rp = require('fs.realpath')
+var minimatch = require('minimatch')
+var Minimatch = minimatch.Minimatch
+var inherits = require('inherits')
+var EE = require('events').EventEmitter
+var path = require('path')
+var assert = require('assert')
+var isAbsolute = require('path-is-absolute')
+var globSync = require('./sync.js')
+var common = require('./common.js')
+var alphasort = common.alphasort
+var alphasorti = common.alphasorti
+var setopts = common.setopts
+var ownProp = common.ownProp
+var inflight = require('inflight')
+var util = require('util')
+var childrenIgnored = common.childrenIgnored
+var isIgnored = common.isIgnored
+
+var once = require('once')
+
+function glob (pattern, options, cb) {
+  if (typeof options === 'function') cb = options, options = {}
+  if (!options) options = {}
+
+  if (options.sync) {
+    if (cb)
+      throw new TypeError('callback provided to sync glob')
+    return globSync(pattern, options)
+  }
+
+  return new Glob(pattern, options, cb)
+}
+
+glob.sync = globSync
+var GlobSync = glob.GlobSync = globSync.GlobSync
+
+// old api surface
+glob.glob = glob
+
+function extend (origin, add) {
+  if (add === null || typeof add !== 'object') {
+    return origin
+  }
+
+  var keys = Object.keys(add)
+  var i = keys.length
+  while (i--) {
+    origin[keys[i]] = add[keys[i]]
+  }
+  return origin
+}
+
+glob.hasMagic = function (pattern, options_) {
+  var options = extend({}, options_)
+  options.noprocess = true
+
+  var g = new Glob(pattern, options)
+  var set = g.minimatch.set
+
+  if (!pattern)
+    return false
+
+  if (set.length > 1)
+    return true
+
+  for (var j = 0; j < set[0].length; j++) {
+    if (typeof set[0][j] !== 'string')
+      return true
+  }
+
+  return false
+}
+
+glob.Glob = Glob
+inherits(Glob, EE)
+function Glob (pattern, options, cb) {
+  if (typeof options === 'function') {
+    cb = options
+    options = null
+  }
+
+  if (options && options.sync) {
+    if (cb)
+      throw new TypeError('callback provided to sync glob')
+    return new GlobSync(pattern, options)
+  }
+
+  if (!(this instanceof Glob))
+    return new Glob(pattern, options, cb)
+
+  setopts(this, pattern, options)
+  this._didRealPath = false
+
+  // process each pattern in the minimatch set
+  var n = this.minimatch.set.length
+
+  // The matches are stored as {<filename>: true,...} so that
+  // duplicates are automagically pruned.
+  // Later, we do an Object.keys() on these.
+  // Keep them as a list so we can fill in when nonull is set.
+  this.matches = new Array(n)
+
+  if (typeof cb === 'function') {
+    cb = once(cb)
+    this.on('error', cb)
+    this.on('end', function (matches) {
+      cb(null, matches)
+    })
+  }
+
+  var self = this
+  this._processing = 0
+
+  this._emitQueue = []
+  this._processQueue = []
+  this.paused = false
+
+  if (this.noprocess)
+    return this
+
+  if (n === 0)
+    return done()
+
+  var sync = true
+  for (var i = 0; i < n; i ++) {
+    this._process(this.minimatch.set[i], i, false, done)
+  }
+  sync = false
+
+  function done () {
+    --self._processing
+    if (self._processing <= 0) {
+      if (sync) {
+        process.nextTick(function () {
+          self._finish()
+        })
+      } else {
+        self._finish()
+      }
+    }
+  }
+}
+
+Glob.prototype._finish = function () {
+  assert(this instanceof Glob)
+  if (this.aborted)
+    return
+
+  if (this.realpath && !this._didRealpath)
+    return this._realpath()
+
+  common.finish(this)
+  this.emit('end', this.found)
+}
+
+Glob.prototype._realpath = function () {
+  if (this._didRealpath)
+    return
+
+  this._didRealpath = true
+
+  var n = this.matches.length
+  if (n === 0)
+    return this._finish()
+
+  var self = this
+  for (var i = 0; i < this.matches.length; i++)
+    this._realpathSet(i, next)
+
+  function next () {
+    if (--n === 0)
+      self._finish()
+  }
+}
+
+Glob.prototype._realpathSet = function (index, cb) {
+  var matchset = this.matches[index]
+  if (!matchset)
+    return cb()
+
+  var found = Object.keys(matchset)
+  var self = this
+  var n = found.length
+
+  if (n === 0)
+    return cb()
+
+  var set = this.matches[index] = Object.create(null)
+  found.forEach(function (p, i) {
+    // If there's a problem with the stat, then it means that
+    // one or more of the links in the realpath couldn't be
+    // resolved.  just return the abs value in that case.
+    p = self._makeAbs(p)
+    rp.realpath(p, self.realpathCache, function (er, real) {
+      if (!er)
+        set[real] = true
+      else if (er.syscall === 'stat')
+        set[p] = true
+      else
+        self.emit('error', er) // srsly wtf right here
+
+      if (--n === 0) {
+        self.matches[index] = set
+        cb()
+      }
+    })
+  })
+}
+
+Glob.prototype._mark = function (p) {
+  return common.mark(this, p)
+}
+
+Glob.prototype._makeAbs = function (f) {
+  return common.makeAbs(this, f)
+}
+
+Glob.prototype.abort = function () {
+  this.aborted = true
+  this.emit('abort')
+}
+
+Glob.prototype.pause = function () {
+  if (!this.paused) {
+    this.paused = true
+    this.emit('pause')
+  }
+}
+
+Glob.prototype.resume = function () {
+  if (this.paused) {
+    this.emit('resume')
+    this.paused = false
+    if (this._emitQueue.length) {
+      var eq = this._emitQueue.slice(0)
+      this._emitQueue.length = 0
+      for (var i = 0; i < eq.length; i ++) {
+        var e = eq[i]
+        this._emitMatch(e[0], e[1])
+      }
+    }
+    if (this._processQueue.length) {
+      var pq = this._processQueue.slice(0)
+      this._processQueue.length = 0
+      for (var i = 0; i < pq.length; i ++) {
+        var p = pq[i]
+        this._processing--
+        this._process(p[0], p[1], p[2], p[3])
+      }
+    }
+  }
+}
+
+Glob.prototype._process = function (pattern, index, inGlobStar, cb) {
+  assert(this instanceof Glob)
+  assert(typeof cb === 'function')
+
+  if (this.aborted)
+    return
+
+  this._processing++
+  if (this.paused) {
+    this._processQueue.push([pattern, index, inGlobStar, cb])
+    return
+  }
+
+  //console.error('PROCESS %d', this._processing, pattern)
+
+  // Get the first [n] parts of pattern that are all strings.
+  var n = 0
+  while (typeof pattern[n] === 'string') {
+    n ++
+  }
+  // now n is the index of the first one that is *not* a string.
+
+  // see if there's anything else
+  var prefix
+  switch (n) {
+    // if not, then this is rather simple
+    case pattern.length:
+      this._processSimple(pattern.join('/'), index, cb)
+      return
+
+    case 0:
+      // pattern *starts* with some non-trivial item.
+      // going to readdir(cwd), but not include the prefix in matches.
+      prefix = null
+      break
+
+    default:
+      // pattern has some string bits in the front.
+      // whatever it starts with, whether that's 'absolute' like /foo/bar,
+      // or 'relative' like '../baz'
+      prefix = pattern.slice(0, n).join('/')
+      break
+  }
+
+  var remain = pattern.slice(n)
+
+  // get the list of entries.
+  var read
+  if (prefix === null)
+    read = '.'
+  else if (isAbsolute(prefix) || isAbsolute(pattern.join('/'))) {
+    if (!prefix || !isAbsolute(prefix))
+      prefix = '/' + prefix
+    read = prefix
+  } else
+    read = prefix
+
+  var abs = this._makeAbs(read)
+
+  //if ignored, skip _processing
+  if (childrenIgnored(this, read))
+    return cb()
+
+  var isGlobStar = remain[0] === minimatch.GLOBSTAR
+  if (isGlobStar)
+    this._processGlobStar(prefix, read, abs, remain, index, inGlobStar, cb)
+  else
+    this._processReaddir(prefix, read, abs, remain, index, inGlobStar, cb)
+}
+
+Glob.prototype._processReaddir = function (prefix, read, abs, remain, index, inGlobStar, cb) {
+  var self = this
+  this._readdir(abs, inGlobStar, function (er, entries) {
+    return self._processReaddir2(prefix, read, abs, remain, index, inGlobStar, entries, cb)
+  })
+}
+
+Glob.prototype._processReaddir2 = function (prefix, read, abs, remain, index, inGlobStar, entries, cb) {
+
+  // if the abs isn't a dir, then nothing can match!
+  if (!entries)
+    return cb()
+
+  // It will only match dot entries if it starts with a dot, or if
+  // dot is set.  Stuff like @(.foo|.bar) isn't allowed.
+  var pn = remain[0]
+  var negate = !!this.minimatch.negate
+  var rawGlob = pn._glob
+  var dotOk = this.dot || rawGlob.charAt(0) === '.'
+
+  var matchedEntries = []
+  for (var i = 0; i < entries.length; i++) {
+    var e = entries[i]
+    if (e.charAt(0) !== '.' || dotOk) {
+      var m
+      if (negate && !prefix) {
+        m = !e.match(pn)
+      } else {
+        m = e.match(pn)
+      }
+      if (m)
+        matchedEntries.push(e)
+    }
+  }
+
+  //console.error('prd2', prefix, entries, remain[0]._glob, matchedEntries)
+
+  var len = matchedEntries.length
+  // If there are no matched entries, then nothing matches.
+  if (len === 0)
+    return cb()
+
+  // if this is the last remaining pattern bit, then no need for
+  // an additional stat *unless* the user has specified mark or
+  // stat explicitly.  We know they exist, since readdir returned
+  // them.
+
+  if (remain.length === 1 && !this.mark && !this.stat) {
+    if (!this.matches[index])
+      this.matches[index] = Object.create(null)
+
+    for (var i = 0; i < len; i ++) {
+      var e = matchedEntries[i]
+      if (prefix) {
+        if (prefix !== '/')
+          e = prefix + '/' + e
+        else
+          e = prefix + e
+      }
+
+      if (e.charAt(0) === '/' && !this.nomount) {
+        e = path.join(this.root, e)
+      }
+      this._emitMatch(index, e)
+    }
+    // This was the last one, and no stats were needed
+    return cb()
+  }
+
+  // now test all matched entries as stand-ins for that part
+  // of the pattern.
+  remain.shift()
+  for (var i = 0; i < len; i ++) {
+    var e = matchedEntries[i]
+    var newPattern
+    if (prefix) {
+      if (prefix !== '/')
+        e = prefix + '/' + e
+      else
+        e = prefix + e
+    }
+    this._process([e].concat(remain), index, inGlobStar, cb)
+  }
+  cb()
+}
+
+Glob.prototype._emitMatch = function (index, e) {
+  if (this.aborted)
+    return
+
+  if (isIgnored(this, e))
+    return
+
+  if (this.paused) {
+    this._emitQueue.push([index, e])
+    return
+  }
+
+  var abs = isAbsolute(e) ? e : this._makeAbs(e)
+
+  if (this.mark)
+    e = this._mark(e)
+
+  if (this.absolute)
+    e = abs
+
+  if (this.matches[index][e])
+    return
+
+  if (this.nodir) {
+    var c = this.cache[abs]
+    if (c === 'DIR' || Array.isArray(c))
+      return
+  }
+
+  this.matches[index][e] = true
+
+  var st = this.statCache[abs]
+  if (st)
+    this.emit('stat', e, st)
+
+  this.emit('match', e)
+}
+
+Glob.prototype._readdirInGlobStar = function (abs, cb) {
+  if (this.aborted)
+    return
+
+  // follow all symlinked directories forever
+  // just proceed as if this is a non-globstar situation
+  if (this.follow)
+    return this._readdir(abs, false, cb)
+
+  var lstatkey = 'lstat\0' + abs
+  var self = this
+  var lstatcb = inflight(lstatkey, lstatcb_)
+
+  if (lstatcb)
+    fs.lstat(abs, lstatcb)
+
+  function lstatcb_ (er, lstat) {
+    if (er && er.code === 'ENOENT')
+      return cb()
+
+    var isSym = lstat && lstat.isSymbolicLink()
+    self.symlinks[abs] = isSym
+
+    // If it's not a symlink or a dir, then it's definitely a regular file.
+    // don't bother doing a readdir in that case.
+    if (!isSym && lstat && !lstat.isDirectory()) {
+      self.cache[abs] = 'FILE'
+      cb()
+    } else
+      self._readdir(abs, false, cb)
+  }
+}
+
+Glob.prototype._readdir = function (abs, inGlobStar, cb) {
+  if (this.aborted)
+    return
+
+  cb = inflight('readdir\0'+abs+'\0'+inGlobStar, cb)
+  if (!cb)
+    return
+
+  //console.error('RD %j %j', +inGlobStar, abs)
+  if (inGlobStar && !ownProp(this.symlinks, abs))
+    return this._readdirInGlobStar(abs, cb)
+
+  if (ownProp(this.cache, abs)) {
+    var c = this.cache[abs]
+    if (!c || c === 'FILE')
+      return cb()
+
+    if (Array.isArray(c))
+      return cb(null, c)
+  }
+
+  var self = this
+  fs.readdir(abs, readdirCb(this, abs, cb))
+}
+
+function readdirCb (self, abs, cb) {
+  return function (er, entries) {
+    if (er)
+      self._readdirError(abs, er, cb)
+    else
+      self._readdirEntries(abs, entries, cb)
+  }
+}
+
+Glob.prototype._readdirEntries = function (abs, entries, cb) {
+  if (this.aborted)
+    return
+
+  // if we haven't asked to stat everything, then just
+  // assume that everything in there exists, so we can avoid
+  // having to stat it a second time.
+  if (!this.mark && !this.stat) {
+    for (var i = 0; i < entries.length; i ++) {
+      var e = entries[i]
+      if (abs === '/')
+        e = abs + e
+      else
+        e = abs + '/' + e
+      this.cache[e] = true
+    }
+  }
+
+  this.cache[abs] = entries
+  return cb(null, entries)
+}
+
+Glob.prototype._readdirError = function (f, er, cb) {
+  if (this.aborted)
+    return
+
+  // handle errors, and cache the information
+  switch (er.code) {
+    case 'ENOTSUP': // https://github.com/isaacs/node-glob/issues/205
+    case 'ENOTDIR': // totally normal. means it *does* exist.
+      var abs = this._makeAbs(f)
+      this.cache[abs] = 'FILE'
+      if (abs === this.cwdAbs) {
+        var error = new Error(er.code + ' invalid cwd ' + this.cwd)
+        error.path = this.cwd
+        error.code = er.code
+        this.emit('error', error)
+        this.abort()
+      }
+      break
+
+    case 'ENOENT': // not terribly unusual
+    case 'ELOOP':
+    case 'ENAMETOOLONG':
+    case 'UNKNOWN':
+      this.cache[this._makeAbs(f)] = false
+      break
+
+    default: // some unusual error.  Treat as failure.
+      this.cache[this._makeAbs(f)] = false
+      if (this.strict) {
+        this.emit('error', er)
+        // If the error is handled, then we abort
+        // if not, we threw out of here
+        this.abort()
+      }
+      if (!this.silent)
+        console.error('glob error', er)
+      break
+  }
+
+  return cb()
+}
+
+Glob.prototype._processGlobStar = function (prefix, read, abs, remain, index, inGlobStar, cb) {
+  var self = this
+  this._readdir(abs, inGlobStar, function (er, entries) {
+    self._processGlobStar2(prefix, read, abs, remain, index, inGlobStar, entries, cb)
+  })
+}
+
+
+Glob.prototype._processGlobStar2 = function (prefix, read, abs, remain, index, inGlobStar, entries, cb) {
+  //console.error('pgs2', prefix, remain[0], entries)
+
+  // no entries means not a dir, so it can never have matches
+  // foo.txt/** doesn't match foo.txt
+  if (!entries)
+    return cb()
+
+  // test without the globstar, and with every child both below
+  // and replacing the globstar.
+  var remainWithoutGlobStar = remain.slice(1)
+  var gspref = prefix ? [ prefix ] : []
+  var noGlobStar = gspref.concat(remainWithoutGlobStar)
+
+  // the noGlobStar pattern exits the inGlobStar state
+  this._process(noGlobStar, index, false, cb)
+
+  var isSym = this.symlinks[abs]
+  var len = entries.length
+
+  // If it's a symlink, and we're in a globstar, then stop
+  if (isSym && inGlobStar)
+    return cb()
+
+  for (var i = 0; i < len; i++) {
+    var e = entries[i]
+    if (e.charAt(0) === '.' && !this.dot)
+      continue
+
+    // these two cases enter the inGlobStar state
+    var instead = gspref.concat(entries[i], remainWithoutGlobStar)
+    this._process(instead, index, true, cb)
+
+    var below = gspref.concat(entries[i], remain)
+    this._process(below, index, true, cb)
+  }
+
+  cb()
+}
+
+Glob.prototype._processSimple = function (prefix, index, cb) {
+  // XXX review this.  Shouldn't it be doing the mounting etc
+  // before doing stat?  kinda weird?
+  var self = this
+  this._stat(prefix, function (er, exists) {
+    self._processSimple2(prefix, index, er, exists, cb)
+  })
+}
+Glob.prototype._processSimple2 = function (prefix, index, er, exists, cb) {
+
+  //console.error('ps2', prefix, exists)
+
+  if (!this.matches[index])
+    this.matches[index] = Object.create(null)
+
+  // If it doesn't exist, then just mark the lack of results
+  if (!exists)
+    return cb()
+
+  if (prefix && isAbsolute(prefix) && !this.nomount) {
+    var trail = /[\/\\]$/.test(prefix)
+    if (prefix.charAt(0) === '/') {
+      prefix = path.join(this.root, prefix)
+    } else {
+      prefix = path.resolve(this.root, prefix)
+      if (trail)
+        prefix += '/'
+    }
+  }
+
+  if (process.platform === 'win32')
+    prefix = prefix.replace(/\\/g, '/')
+
+  // Mark this as a match
+  this._emitMatch(index, prefix)
+  cb()
+}
+
+// Returns either 'DIR', 'FILE', or false
+Glob.prototype._stat = function (f, cb) {
+  var abs = this._makeAbs(f)
+  var needDir = f.slice(-1) === '/'
+
+  if (f.length > this.maxLength)
+    return cb()
+
+  if (!this.stat && ownProp(this.cache, abs)) {
+    var c = this.cache[abs]
+
+    if (Array.isArray(c))
+      c = 'DIR'
+
+    // It exists, but maybe not how we need it
+    if (!needDir || c === 'DIR')
+      return cb(null, c)
+
+    if (needDir && c === 'FILE')
+      return cb()
+
+    // otherwise we have to stat, because maybe c=true
+    // if we know it exists, but not what it is.
+  }
+
+  var exists
+  var stat = this.statCache[abs]
+  if (stat !== undefined) {
+    if (stat === false)
+      return cb(null, stat)
+    else {
+      var type = stat.isDirectory() ? 'DIR' : 'FILE'
+      if (needDir && type === 'FILE')
+        return cb()
+      else
+        return cb(null, type, stat)
+    }
+  }
+
+  var self = this
+  var statcb = inflight('stat\0' + abs, lstatcb_)
+  if (statcb)
+    fs.lstat(abs, statcb)
+
+  function lstatcb_ (er, lstat) {
+    if (lstat && lstat.isSymbolicLink()) {
+      // If it's a symlink, then treat it as the target, unless
+      // the target does not exist, then treat it as a file.
+      return fs.stat(abs, function (er, stat) {
+        if (er)
+          self._stat2(f, abs, null, lstat, cb)
+        else
+          self._stat2(f, abs, er, stat, cb)
+      })
+    } else {
+      self._stat2(f, abs, er, lstat, cb)
+    }
+  }
+}
+
+Glob.prototype._stat2 = function (f, abs, er, stat, cb) {
+  if (er && (er.code === 'ENOENT' || er.code === 'ENOTDIR')) {
+    this.statCache[abs] = false
+    return cb()
+  }
+
+  var needDir = f.slice(-1) === '/'
+  this.statCache[abs] = stat
+
+  if (abs.slice(-1) === '/' && stat && !stat.isDirectory())
+    return cb(null, false, stat)
+
+  var c = true
+  if (stat)
+    c = stat.isDirectory() ? 'DIR' : 'FILE'
+  this.cache[abs] = this.cache[abs] || c
+
+  if (needDir && c === 'FILE')
+    return cb()
+
+  return cb(null, c, stat)
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/package.json b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/package.json
new file mode 100644
index 00000000000..d0492885c0f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/package.json
@@ -0,0 +1,43 @@
+{
+  "author": "Isaac Z. Schlueter <i@izs.me> (http://blog.izs.me/)", 
+  "dependencies": {
+    "fs.realpath": "^1.0.0", 
+    "inflight": "^1.0.4", 
+    "inherits": "2", 
+    "minimatch": "^3.0.4", 
+    "once": "^1.3.0", 
+    "path-is-absolute": "^1.0.0"
+  }, 
+  "description": "a little globber", 
+  "devDependencies": {
+    "mkdirp": "0", 
+    "rimraf": "^2.2.8", 
+    "tap": "^12.0.1", 
+    "tick": "0.0.6"
+  }, 
+  "engines": {
+    "node": "*"
+  }, 
+  "files": [
+    "glob.js", 
+    "sync.js", 
+    "common.js"
+  ], 
+  "license": "ISC", 
+  "main": "glob.js", 
+  "name": "glob", 
+  "repository": {
+    "type": "git", 
+    "url": "git://github.com/isaacs/node-glob.git"
+  }, 
+  "scripts": {
+    "bench": "bash benchmark.sh", 
+    "benchclean": "node benchclean.js", 
+    "prepublish": "npm run benchclean", 
+    "prof": "bash prof.sh && cat profile.txt", 
+    "profclean": "rm -f v8.log profile.txt", 
+    "test": "tap test/*.js --cov", 
+    "test-regen": "npm run profclean && TEST_REGEN=1 node test/00-setup.js"
+  }, 
+  "version": "7.1.3"
+}
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/sync.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/sync.js
new file mode 100644
index 00000000000..c952134baa7
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/glob/sync.js
@@ -0,0 +1,486 @@
+module.exports = globSync
+globSync.GlobSync = GlobSync
+
+var fs = require('fs')
+var rp = require('fs.realpath')
+var minimatch = require('minimatch')
+var Minimatch = minimatch.Minimatch
+var Glob = require('./glob.js').Glob
+var util = require('util')
+var path = require('path')
+var assert = require('assert')
+var isAbsolute = require('path-is-absolute')
+var common = require('./common.js')
+var alphasort = common.alphasort
+var alphasorti = common.alphasorti
+var setopts = common.setopts
+var ownProp = common.ownProp
+var childrenIgnored = common.childrenIgnored
+var isIgnored = common.isIgnored
+
+function globSync (pattern, options) {
+  if (typeof options === 'function' || arguments.length === 3)
+    throw new TypeError('callback provided to sync glob\n'+
+                        'See: https://github.com/isaacs/node-glob/issues/167')
+
+  return new GlobSync(pattern, options).found
+}
+
+function GlobSync (pattern, options) {
+  if (!pattern)
+    throw new Error('must provide pattern')
+
+  if (typeof options === 'function' || arguments.length === 3)
+    throw new TypeError('callback provided to sync glob\n'+
+                        'See: https://github.com/isaacs/node-glob/issues/167')
+
+  if (!(this instanceof GlobSync))
+    return new GlobSync(pattern, options)
+
+  setopts(this, pattern, options)
+
+  if (this.noprocess)
+    return this
+
+  var n = this.minimatch.set.length
+  this.matches = new Array(n)
+  for (var i = 0; i < n; i ++) {
+    this._process(this.minimatch.set[i], i, false)
+  }
+  this._finish()
+}
+
+GlobSync.prototype._finish = function () {
+  assert(this instanceof GlobSync)
+  if (this.realpath) {
+    var self = this
+    this.matches.forEach(function (matchset, index) {
+      var set = self.matches[index] = Object.create(null)
+      for (var p in matchset) {
+        try {
+          p = self._makeAbs(p)
+          var real = rp.realpathSync(p, self.realpathCache)
+          set[real] = true
+        } catch (er) {
+          if (er.syscall === 'stat')
+            set[self._makeAbs(p)] = true
+          else
+            throw er
+        }
+      }
+    })
+  }
+  common.finish(this)
+}
+
+
+GlobSync.prototype._process = function (pattern, index, inGlobStar) {
+  assert(this instanceof GlobSync)
+
+  // Get the first [n] parts of pattern that are all strings.
+  var n = 0
+  while (typeof pattern[n] === 'string') {
+    n ++
+  }
+  // now n is the index of the first one that is *not* a string.
+
+  // See if there's anything else
+  var prefix
+  switch (n) {
+    // if not, then this is rather simple
+    case pattern.length:
+      this._processSimple(pattern.join('/'), index)
+      return
+
+    case 0:
+      // pattern *starts* with some non-trivial item.
+      // going to readdir(cwd), but not include the prefix in matches.
+      prefix = null
+      break
+
+    default:
+      // pattern has some string bits in the front.
+      // whatever it starts with, whether that's 'absolute' like /foo/bar,
+      // or 'relative' like '../baz'
+      prefix = pattern.slice(0, n).join('/')
+      break
+  }
+
+  var remain = pattern.slice(n)
+
+  // get the list of entries.
+  var read
+  if (prefix === null)
+    read = '.'
+  else if (isAbsolute(prefix) || isAbsolute(pattern.join('/'))) {
+    if (!prefix || !isAbsolute(prefix))
+      prefix = '/' + prefix
+    read = prefix
+  } else
+    read = prefix
+
+  var abs = this._makeAbs(read)
+
+  //if ignored, skip processing
+  if (childrenIgnored(this, read))
+    return
+
+  var isGlobStar = remain[0] === minimatch.GLOBSTAR
+  if (isGlobStar)
+    this._processGlobStar(prefix, read, abs, remain, index, inGlobStar)
+  else
+    this._processReaddir(prefix, read, abs, remain, index, inGlobStar)
+}
+
+
+GlobSync.prototype._processReaddir = function (prefix, read, abs, remain, index, inGlobStar) {
+  var entries = this._readdir(abs, inGlobStar)
+
+  // if the abs isn't a dir, then nothing can match!
+  if (!entries)
+    return
+
+  // It will only match dot entries if it starts with a dot, or if
+  // dot is set.  Stuff like @(.foo|.bar) isn't allowed.
+  var pn = remain[0]
+  var negate = !!this.minimatch.negate
+  var rawGlob = pn._glob
+  var dotOk = this.dot || rawGlob.charAt(0) === '.'
+
+  var matchedEntries = []
+  for (var i = 0; i < entries.length; i++) {
+    var e = entries[i]
+    if (e.charAt(0) !== '.' || dotOk) {
+      var m
+      if (negate && !prefix) {
+        m = !e.match(pn)
+      } else {
+        m = e.match(pn)
+      }
+      if (m)
+        matchedEntries.push(e)
+    }
+  }
+
+  var len = matchedEntries.length
+  // If there are no matched entries, then nothing matches.
+  if (len === 0)
+    return
+
+  // if this is the last remaining pattern bit, then no need for
+  // an additional stat *unless* the user has specified mark or
+  // stat explicitly.  We know they exist, since readdir returned
+  // them.
+
+  if (remain.length === 1 && !this.mark && !this.stat) {
+    if (!this.matches[index])
+      this.matches[index] = Object.create(null)
+
+    for (var i = 0; i < len; i ++) {
+      var e = matchedEntries[i]
+      if (prefix) {
+        if (prefix.slice(-1) !== '/')
+          e = prefix + '/' + e
+        else
+          e = prefix + e
+      }
+
+      if (e.charAt(0) === '/' && !this.nomount) {
+        e = path.join(this.root, e)
+      }
+      this._emitMatch(index, e)
+    }
+    // This was the last one, and no stats were needed
+    return
+  }
+
+  // now test all matched entries as stand-ins for that part
+  // of the pattern.
+  remain.shift()
+  for (var i = 0; i < len; i ++) {
+    var e = matchedEntries[i]
+    var newPattern
+    if (prefix)
+      newPattern = [prefix, e]
+    else
+      newPattern = [e]
+    this._process(newPattern.concat(remain), index, inGlobStar)
+  }
+}
+
+
+GlobSync.prototype._emitMatch = function (index, e) {
+  if (isIgnored(this, e))
+    return
+
+  var abs = this._makeAbs(e)
+
+  if (this.mark)
+    e = this._mark(e)
+
+  if (this.absolute) {
+    e = abs
+  }
+
+  if (this.matches[index][e])
+    return
+
+  if (this.nodir) {
+    var c = this.cache[abs]
+    if (c === 'DIR' || Array.isArray(c))
+      return
+  }
+
+  this.matches[index][e] = true
+
+  if (this.stat)
+    this._stat(e)
+}
+
+
+GlobSync.prototype._readdirInGlobStar = function (abs) {
+  // follow all symlinked directories forever
+  // just proceed as if this is a non-globstar situation
+  if (this.follow)
+    return this._readdir(abs, false)
+
+  var entries
+  var lstat
+  var stat
+  try {
+    lstat = fs.lstatSync(abs)
+  } catch (er) {
+    if (er.code === 'ENOENT') {
+      // lstat failed, doesn't exist
+      return null
+    }
+  }
+
+  var isSym = lstat && lstat.isSymbolicLink()
+  this.symlinks[abs] = isSym
+
+  // If it's not a symlink or a dir, then it's definitely a regular file.
+  // don't bother doing a readdir in that case.
+  if (!isSym && lstat && !lstat.isDirectory())
+    this.cache[abs] = 'FILE'
+  else
+    entries = this._readdir(abs, false)
+
+  return entries
+}
+
+GlobSync.prototype._readdir = function (abs, inGlobStar) {
+  var entries
+
+  if (inGlobStar && !ownProp(this.symlinks, abs))
+    return this._readdirInGlobStar(abs)
+
+  if (ownProp(this.cache, abs)) {
+    var c = this.cache[abs]
+    if (!c || c === 'FILE')
+      return null
+
+    if (Array.isArray(c))
+      return c
+  }
+
+  try {
+    return this._readdirEntries(abs, fs.readdirSync(abs))
+  } catch (er) {
+    this._readdirError(abs, er)
+    return null
+  }
+}
+
+GlobSync.prototype._readdirEntries = function (abs, entries) {
+  // if we haven't asked to stat everything, then just
+  // assume that everything in there exists, so we can avoid
+  // having to stat it a second time.
+  if (!this.mark && !this.stat) {
+    for (var i = 0; i < entries.length; i ++) {
+      var e = entries[i]
+      if (abs === '/')
+        e = abs + e
+      else
+        e = abs + '/' + e
+      this.cache[e] = true
+    }
+  }
+
+  this.cache[abs] = entries
+
+  // mark and cache dir-ness
+  return entries
+}
+
+GlobSync.prototype._readdirError = function (f, er) {
+  // handle errors, and cache the information
+  switch (er.code) {
+    case 'ENOTSUP': // https://github.com/isaacs/node-glob/issues/205
+    case 'ENOTDIR': // totally normal. means it *does* exist.
+      var abs = this._makeAbs(f)
+      this.cache[abs] = 'FILE'
+      if (abs === this.cwdAbs) {
+        var error = new Error(er.code + ' invalid cwd ' + this.cwd)
+        error.path = this.cwd
+        error.code = er.code
+        throw error
+      }
+      break
+
+    case 'ENOENT': // not terribly unusual
+    case 'ELOOP':
+    case 'ENAMETOOLONG':
+    case 'UNKNOWN':
+      this.cache[this._makeAbs(f)] = false
+      break
+
+    default: // some unusual error.  Treat as failure.
+      this.cache[this._makeAbs(f)] = false
+      if (this.strict)
+        throw er
+      if (!this.silent)
+        console.error('glob error', er)
+      break
+  }
+}
+
+GlobSync.prototype._processGlobStar = function (prefix, read, abs, remain, index, inGlobStar) {
+
+  var entries = this._readdir(abs, inGlobStar)
+
+  // no entries means not a dir, so it can never have matches
+  // foo.txt/** doesn't match foo.txt
+  if (!entries)
+    return
+
+  // test without the globstar, and with every child both below
+  // and replacing the globstar.
+  var remainWithoutGlobStar = remain.slice(1)
+  var gspref = prefix ? [ prefix ] : []
+  var noGlobStar = gspref.concat(remainWithoutGlobStar)
+
+  // the noGlobStar pattern exits the inGlobStar state
+  this._process(noGlobStar, index, false)
+
+  var len = entries.length
+  var isSym = this.symlinks[abs]
+
+  // If it's a symlink, and we're in a globstar, then stop
+  if (isSym && inGlobStar)
+    return
+
+  for (var i = 0; i < len; i++) {
+    var e = entries[i]
+    if (e.charAt(0) === '.' && !this.dot)
+      continue
+
+    // these two cases enter the inGlobStar state
+    var instead = gspref.concat(entries[i], remainWithoutGlobStar)
+    this._process(instead, index, true)
+
+    var below = gspref.concat(entries[i], remain)
+    this._process(below, index, true)
+  }
+}
+
+GlobSync.prototype._processSimple = function (prefix, index) {
+  // XXX review this.  Shouldn't it be doing the mounting etc
+  // before doing stat?  kinda weird?
+  var exists = this._stat(prefix)
+
+  if (!this.matches[index])
+    this.matches[index] = Object.create(null)
+
+  // If it doesn't exist, then just mark the lack of results
+  if (!exists)
+    return
+
+  if (prefix && isAbsolute(prefix) && !this.nomount) {
+    var trail = /[\/\\]$/.test(prefix)
+    if (prefix.charAt(0) === '/') {
+      prefix = path.join(this.root, prefix)
+    } else {
+      prefix = path.resolve(this.root, prefix)
+      if (trail)
+        prefix += '/'
+    }
+  }
+
+  if (process.platform === 'win32')
+    prefix = prefix.replace(/\\/g, '/')
+
+  // Mark this as a match
+  this._emitMatch(index, prefix)
+}
+
+// Returns either 'DIR', 'FILE', or false
+GlobSync.prototype._stat = function (f) {
+  var abs = this._makeAbs(f)
+  var needDir = f.slice(-1) === '/'
+
+  if (f.length > this.maxLength)
+    return false
+
+  if (!this.stat && ownProp(this.cache, abs)) {
+    var c = this.cache[abs]
+
+    if (Array.isArray(c))
+      c = 'DIR'
+
+    // It exists, but maybe not how we need it
+    if (!needDir || c === 'DIR')
+      return c
+
+    if (needDir && c === 'FILE')
+      return false
+
+    // otherwise we have to stat, because maybe c=true
+    // if we know it exists, but not what it is.
+  }
+
+  var exists
+  var stat = this.statCache[abs]
+  if (!stat) {
+    var lstat
+    try {
+      lstat = fs.lstatSync(abs)
+    } catch (er) {
+      if (er && (er.code === 'ENOENT' || er.code === 'ENOTDIR')) {
+        this.statCache[abs] = false
+        return false
+      }
+    }
+
+    if (lstat && lstat.isSymbolicLink()) {
+      try {
+        stat = fs.statSync(abs)
+      } catch (er) {
+        stat = lstat
+      }
+    } else {
+      stat = lstat
+    }
+  }
+
+  this.statCache[abs] = stat
+
+  var c = true
+  if (stat)
+    c = stat.isDirectory() ? 'DIR' : 'FILE'
+
+  this.cache[abs] = this.cache[abs] || c
+
+  if (needDir && c === 'FILE')
+    return false
+
+  return c
+}
+
+GlobSync.prototype._mark = function (p) {
+  return common.mark(this, p)
+}
+
+GlobSync.prototype._makeAbs = function (f) {
+  return common.makeAbs(this, f)
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/index.js
new file mode 100644
index 00000000000..72297501f9b
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/index.js
@@ -0,0 +1,162 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var w = d * 7;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ *  - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} [options]
+ * @throws {Error} throw an error if val is not a non-empty string or a number
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options) {
+  options = options || {};
+  var type = typeof val;
+  if (type === 'string' && val.length > 0) {
+    return parse(val);
+  } else if (type === 'number' && isNaN(val) === false) {
+    return options.long ? fmtLong(val) : fmtShort(val);
+  }
+  throw new Error(
+    'val is not a non-empty string or a valid number. val=' +
+      JSON.stringify(val)
+  );
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+  str = String(str);
+  if (str.length > 100) {
+    return;
+  }
+  var match = /^((?:\d+)?\-?\d?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(
+    str
+  );
+  if (!match) {
+    return;
+  }
+  var n = parseFloat(match[1]);
+  var type = (match[2] || 'ms').toLowerCase();
+  switch (type) {
+    case 'years':
+    case 'year':
+    case 'yrs':
+    case 'yr':
+    case 'y':
+      return n * y;
+    case 'weeks':
+    case 'week':
+    case 'w':
+      return n * w;
+    case 'days':
+    case 'day':
+    case 'd':
+      return n * d;
+    case 'hours':
+    case 'hour':
+    case 'hrs':
+    case 'hr':
+    case 'h':
+      return n * h;
+    case 'minutes':
+    case 'minute':
+    case 'mins':
+    case 'min':
+    case 'm':
+      return n * m;
+    case 'seconds':
+    case 'second':
+    case 'secs':
+    case 'sec':
+    case 's':
+      return n * s;
+    case 'milliseconds':
+    case 'millisecond':
+    case 'msecs':
+    case 'msec':
+    case 'ms':
+      return n;
+    default:
+      return undefined;
+  }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtShort(ms) {
+  var msAbs = Math.abs(ms);
+  if (msAbs >= d) {
+    return Math.round(ms / d) + 'd';
+  }
+  if (msAbs >= h) {
+    return Math.round(ms / h) + 'h';
+  }
+  if (msAbs >= m) {
+    return Math.round(ms / m) + 'm';
+  }
+  if (msAbs >= s) {
+    return Math.round(ms / s) + 's';
+  }
+  return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function fmtLong(ms) {
+  var msAbs = Math.abs(ms);
+  if (msAbs >= d) {
+    return plural(ms, msAbs, d, 'day');
+  }
+  if (msAbs >= h) {
+    return plural(ms, msAbs, h, 'hour');
+  }
+  if (msAbs >= m) {
+    return plural(ms, msAbs, m, 'minute');
+  }
+  if (msAbs >= s) {
+    return plural(ms, msAbs, s, 'second');
+  }
+  return ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, msAbs, n, name) {
+  var isPlural = msAbs >= n * 1.5;
+  return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
+}
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/license.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/license.md
new file mode 100644
index 00000000000..69b61253a38
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/license.md
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2016 Zeit, Inc.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/package.json b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/package.json
new file mode 100644
index 00000000000..c29339fd99f
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/package.json
@@ -0,0 +1,37 @@
+{
+  "description": "Tiny millisecond conversion utility", 
+  "devDependencies": {
+    "eslint": "4.12.1", 
+    "expect.js": "0.3.1", 
+    "husky": "0.14.3", 
+    "lint-staged": "5.0.0", 
+    "mocha": "4.0.1"
+  }, 
+  "eslintConfig": {
+    "env": {
+      "es6": true, 
+      "node": true
+    }, 
+    "extends": "eslint:recommended"
+  }, 
+  "files": [
+    "index.js"
+  ], 
+  "license": "MIT", 
+  "lint-staged": {
+    "*.js": [
+      "npm run lint", 
+      "prettier --single-quote --write", 
+      "git add"
+    ]
+  }, 
+  "main": "./index", 
+  "name": "ms", 
+  "repository": "zeit/ms", 
+  "scripts": {
+    "lint": "eslint lib/* bin/*", 
+    "precommit": "lint-staged", 
+    "test": "mocha tests.js"
+  }, 
+  "version": "2.1.1"
+}
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/readme.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/readme.md
new file mode 100644
index 00000000000..bb767293ac7
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/ms/readme.md
@@ -0,0 +1,60 @@
+# ms
+
+[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms)
+[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/)
+
+Use this package to easily convert various time formats to milliseconds.
+
+## Examples
+
+```js
+ms('2 days')  // 172800000
+ms('1d')      // 86400000
+ms('10h')     // 36000000
+ms('2.5 hrs') // 9000000
+ms('2h')      // 7200000
+ms('1m')      // 60000
+ms('5s')      // 5000
+ms('1y')      // 31557600000
+ms('100')     // 100
+ms('-3 days') // -259200000
+ms('-1h')     // -3600000
+ms('-200')    // -200
+```
+
+### Convert from Milliseconds
+
+```js
+ms(60000)             // "1m"
+ms(2 * 60000)         // "2m"
+ms(-3 * 60000)        // "-3m"
+ms(ms('10 hours'))    // "10h"
+```
+
+### Time Format Written-Out
+
+```js
+ms(60000, { long: true })             // "1 minute"
+ms(2 * 60000, { long: true })         // "2 minutes"
+ms(-3 * 60000, { long: true })        // "-3 minutes"
+ms(ms('10 hours'), { long: true })    // "10 hours"
+```
+
+## Features
+
+- Works both in [Node.js](https://nodejs.org) and in the browser
+- If a number is supplied to `ms`, a string with a unit is returned
+- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`)
+- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned
+
+## Related Packages
+
+- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time.
+
+## Caught a Bug?
+
+1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device
+2. Link the package to the global module directory: `npm link`
+3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms!
+
+As always, you can run the tests using: `npm test`
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/browser.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/browser.js
new file mode 100644
index 00000000000..62afa3a7425
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/browser.js
@@ -0,0 +1,5 @@
+'use strict';
+module.exports = {
+	stdout: false,
+	stderr: false
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/index.js b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/index.js
new file mode 100644
index 00000000000..6aacf5b4988
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/index.js
@@ -0,0 +1,137 @@
+'use strict';
+const os = require('os');
+const hasFlag = require('has-flag');
+
+const {env} = process;
+
+let forceColor;
+if (hasFlag('no-color') ||
+	hasFlag('no-colors') ||
+	hasFlag('color=false')) {
+	forceColor = 0;
+} else if (hasFlag('color') ||
+	hasFlag('colors') ||
+	hasFlag('color=true') ||
+	hasFlag('color=always')) {
+	forceColor = 1;
+}
+if ('FORCE_COLOR' in env) {
+	if (env.FORCE_COLOR === true || env.FORCE_COLOR === 'true') {
+		forceColor = 1;
+	} else if (env.FORCE_COLOR === false || env.FORCE_COLOR === 'false') {
+		forceColor = 0;
+	} else {
+		forceColor = env.FORCE_COLOR.length === 0 ? 1 : Math.min(parseInt(env.FORCE_COLOR, 10), 3);
+	}
+}
+
+function translateLevel(level) {
+	if (level === 0) {
+		return false;
+	}
+
+	return {
+		level,
+		hasBasic: true,
+		has256: level >= 2,
+		has16m: level >= 3
+	};
+}
+
+function supportsColor(stream) {
+	if (forceColor === 0) {
+		return 0;
+	}
+
+	if (hasFlag('color=16m') ||
+		hasFlag('color=full') ||
+		hasFlag('color=truecolor')) {
+		return 3;
+	}
+
+	if (hasFlag('color=256')) {
+		return 2;
+	}
+
+	if (stream && !stream.isTTY && forceColor === undefined) {
+		return 0;
+	}
+
+	const min = forceColor || 0;
+
+	if (env.TERM === 'dumb') {
+		return min;
+	}
+
+	if (process.platform === 'win32') {
+		// Node.js 7.5.0 is the first version of Node.js to include a patch to
+		// libuv that enables 256 color output on Windows. Anything earlier and it
+		// won't work. However, here we target Node.js 8 at minimum as it is an LTS
+		// release, and Node.js 7 is not. Windows 10 build 10586 is the first Windows
+		// release that supports 256 colors. Windows 10 build 14931 is the first release
+		// that supports 16m/TrueColor.
+		const osRelease = os.release().split('.');
+		if (
+			Number(process.versions.node.split('.')[0]) >= 8 &&
+			Number(osRelease[0]) >= 10 &&
+			Number(osRelease[2]) >= 10586
+		) {
+			return Number(osRelease[2]) >= 14931 ? 3 : 2;
+		}
+
+		return 1;
+	}
+
+	if ('CI' in env) {
+		if (['TRAVIS', 'CIRCLECI', 'APPVEYOR', 'GITLAB_CI'].some(sign => sign in env) || env.CI_NAME === 'codeship') {
+			return 1;
+		}
+
+		return min;
+	}
+
+	if ('TEAMCITY_VERSION' in env) {
+		return /^(9\.(0*[1-9]\d*)\.|\d{2,}\.)/.test(env.TEAMCITY_VERSION) ? 1 : 0;
+	}
+
+	if (env.COLORTERM === 'truecolor') {
+		return 3;
+	}
+
+	if ('TERM_PROGRAM' in env) {
+		const version = parseInt((env.TERM_PROGRAM_VERSION || '').split('.')[0], 10);
+
+		switch (env.TERM_PROGRAM) {
+			case 'iTerm.app':
+				return version >= 3 ? 3 : 2;
+			case 'Apple_Terminal':
+				return 2;
+			// No default
+		}
+	}
+
+	if (/-256(color)?$/i.test(env.TERM)) {
+		return 2;
+	}
+
+	if (/^screen|^xterm|^vt100|^vt220|^rxvt|color|ansi|cygwin|linux/i.test(env.TERM)) {
+		return 1;
+	}
+
+	if ('COLORTERM' in env) {
+		return 1;
+	}
+
+	return min;
+}
+
+function getSupportLevel(stream) {
+	const level = supportsColor(stream);
+	return translateLevel(level);
+}
+
+module.exports = {
+	supportsColor: getSupportLevel,
+	stdout: getSupportLevel(process.stdout),
+	stderr: getSupportLevel(process.stderr)
+};
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/license b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/license
new file mode 100644
index 00000000000..e7af2f77107
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/license
@@ -0,0 +1,9 @@
+MIT License
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/package.json b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/package.json
new file mode 100644
index 00000000000..4d7a938e5c4
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/package.json
@@ -0,0 +1,53 @@
+{
+  "author": {
+    "email": "sindresorhus@gmail.com", 
+    "name": "Sindre Sorhus", 
+    "url": "sindresorhus.com"
+  }, 
+  "browser": "browser.js", 
+  "dependencies": {
+    "has-flag": "^3.0.0"
+  }, 
+  "description": "Detect whether a terminal supports color", 
+  "devDependencies": {
+    "ava": "^0.25.0", 
+    "import-fresh": "^2.0.0", 
+    "xo": "^0.23.0"
+  }, 
+  "engines": {
+    "node": ">=6"
+  }, 
+  "files": [
+    "index.js", 
+    "browser.js"
+  ], 
+  "keywords": [
+    "color", 
+    "colour", 
+    "colors", 
+    "terminal", 
+    "console", 
+    "cli", 
+    "ansi", 
+    "styles", 
+    "tty", 
+    "rgb", 
+    "256", 
+    "shell", 
+    "xterm", 
+    "command-line", 
+    "support", 
+    "supports", 
+    "capability", 
+    "detect", 
+    "truecolor", 
+    "16m"
+  ], 
+  "license": "MIT", 
+  "name": "supports-color", 
+  "repository": "chalk/supports-color", 
+  "scripts": {
+    "test": "xo && ava"
+  }, 
+  "version": "6.0.0"
+}
+\ No newline at end of file
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/readme.md b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/readme.md
new file mode 100644
index 00000000000..ff29b2c1296
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/node_modules/supports-color/readme.md
@@ -0,0 +1,80 @@
+# supports-color [![Build Status](https://travis-ci.org/chalk/supports-color.svg?branch=master)](https://travis-ci.org/chalk/supports-color)
+
+> Detect whether a terminal supports color
+
+---
+
+<div align="center">
+	<b>
+		<a href="https://tidelift.com/subscription/pkg/npm-supports-color?utm_source=npm-supports-color&utm_medium=referral&utm_campaign=readme">Get professional support for this package with a Tidelift subscription</a>
+	</b>
+	<br>
+	<sub>
+		Tidelift helps make open source sustainable for maintainers while giving companies<br>assurances about security, maintenance, and licensing for their dependencies.
+	</sub>
+</div>
+
+---
+
+
+## Install
+
+```
+$ npm install supports-color
+```
+
+
+## Usage
+
+```js
+const supportsColor = require('supports-color');
+
+if (supportsColor.stdout) {
+	console.log('Terminal stdout supports color');
+}
+
+if (supportsColor.stdout.has256) {
+	console.log('Terminal stdout supports 256 colors');
+}
+
+if (supportsColor.stderr.has16m) {
+	console.log('Terminal stderr supports 16 million colors (truecolor)');
+}
+```
+
+
+## API
+
+Returns an `Object` with a `stdout` and `stderr` property for testing either streams. Each property is an `Object`, or `false` if color is not supported.
+
+The `stdout`/`stderr` objects specifies a level of support for color through a `.level` property and a corresponding flag:
+
+- `.level = 1` and `.hasBasic = true`: Basic color support (16 colors)
+- `.level = 2` and `.has256 = true`: 256 color support
+- `.level = 3` and `.has16m = true`: Truecolor support (16 million colors)
+
+
+## Info
+
+It obeys the `--color` and `--no-color` CLI flags.
+
+For situations where using `--color` is not possible, use the environment variable `FORCE_COLOR=1` (level 1), `FORCE_COLOR=2` (level 2), or `FORCE_COLOR=3` (level 3) to forcefully enable color, or `FORCE_COLOR=0` to forcefully disable. The use of `FORCE_COLOR` overrides all other color support checks.
+
+Explicit 256/Truecolor mode can be enabled using the `--color=256` and `--color=16m` flags, respectively.
+
+
+## Related
+
+- [supports-color-cli](https://github.com/chalk/supports-color-cli) - CLI for this module
+- [chalk](https://github.com/chalk/chalk) - Terminal string styling done right
+
+
+## Maintainers
+
+- [Sindre Sorhus](https://github.com/sindresorhus)
+- [Josh Junon](https://github.com/qix-)
+
+
+## License
+
+MIT
diff --git a/chromium/third_party/devtools-frontend/src/node_modules/mocha/package.json b/chromium/third_party/devtools-frontend/src/node_modules/mocha/package.json
new file mode 100644
index 00000000000..405b74044aa
--- /dev/null
+++ b/chromium/third_party/devtools-frontend/src/node_modules/mocha/package.json
@@ -0,0 +1,639 @@
+{
+  "@mocha/contributors": {
+    "exclude": [
+      "greenkeeperio-bot <support@greenkeeper.io>", 
+      "greenkeeper[bot] <greenkeeper[bot]@users.noreply.github.com>", 
+      "TJ Holowaychuk <tj@vision-media.ca>"
+    ]
+  }, 
+  "author": "TJ Holowaychuk <tj@vision-media.ca>", 
+  "bin": {
+    "_mocha": "./bin/_mocha", 
+    "mocha": "./bin/mocha"
+  }, 
+  "browser": {
+    "./index.js": "./browser-entry.js", 
+    "./lib/growl.js": "./lib/browser/growl.js", 
+    "fs": false, 
+    "glob": false, 
+    "path": false, 
+    "supports-color": false, 
+    "tty": "./lib/browser/tty.js"
+  }, 
+  "browserify": {
+    "transform": [
+      "./scripts/package-json-cullify"
+    ]
+  }, 
+  "bugs": {
+    "url": "https://github.com/mochajs/mocha/issues/"
+  }, 
+  "contributors": [
+    "38elements <mh19820223@gmail.com>", 
+    "Aaron Brady <aaron@mori.com>", 
+    "Aaron Hamid <aaron.hamid@gmail.com>", 
+    "Aaron Heckmann <aaron.heckmann+github@gmail.com>", 
+    "Aaron Krause <aaronjkrause@gmail.com>", 
+    "Aaron Petcoff <hello@aaronpetcoff.me>", 
+    "abrkn <a@abrkn.com>", 
+    "Adam Crabtree <adam.crabtree@redrobotlabs.com>", 
+    "Adam Ginzberg <aginzberg@gmail.com>", 
+    "Adam Gruber <talknmime@gmail.com>", 
+    "Adrian Ludwig <me@adrianludwig.pl>", 
+    "Ahmad Bamieh <ahmadbamieh@gmail.com>", 
+    "airportyh <airportyh@gmail.com>", 
+    "Ajay Kodali <ajay.kodali@citrix.com>", 
+    "Al Scott <al.scott@atomicobject.com>", 
+    "Alex Bainter <metalex9@users.noreply.github.com>", 
+    "Alexander Early <alexander.early@gmail.com>", 
+    "Alexander Shepelin <Brightcor@gmail.com>", 
+    "Alhadis <gardnerjohng@gmail.com>", 
+    "amsul <reach@amsul.ca>", 
+    "Anders Olsen Sandvik <Andersos@users.noreply.github.com>", 
+    "Andreas Brekken <andreas@opuno.com>", 
+    "Andreas Lind <andreaslindpetersen@gmail.com>", 
+    "Andreas Lind Petersen <andreas@one.com>", 
+    "Andrew Bradley <abradley@brightcove.com>", 
+    "Andrew Bradley <cspotcode@gmail.com>", 
+    "Andrew Krawchyk <903716+akrawchyk@users.noreply.github.com>", 
+    "Andrew Nesbitt <andrewnez@gmail.com>", 
+    "Andrey Popp <8mayday@gmail.com>", 
+    "Andrii Shumada <eagleeyes91@gmail.com>", 
+    "andy matthews <andy@commadelimited.com>", 
+    "Angelica Valenta <angelicavalenta@gmail.com>", 
+    "Anis Safine <anis.safine.ext@francetv.fr>", 
+    "Anish Karandikar <anishkny@gmail.com>", 
+    "Anna Henningsen <github@addaleax.net>", 
+    "Anthony <keppi@o2.pl>", 
+    "Anton <anton.redfox@gmail.com>", 
+    "anton <anton.valickij@gmail.com>", 
+    "APerson <danielhglus@gmail.com>", 
+    "Arian Stolwijk <arian@aryweb.nl>", 
+    "Ariel Mashraki <ariel@mashraki.co.il>", 
+    "Arnaud Brousseau <arnaud.brousseau@gmail.com>", 
+    "Artem Govorov <artem.govorov@gmail.com>", 
+    "Atsuya Takagi <asoftonight@gmail.com>", 
+    "Attila Domokos <adomokos@gmail.com>", 
+    "Austin Birch <mraustinbirch@gmail.com>", 
+    "Avi Vahl <avi.vahl@wix.com>", 
+    "badunk <baduncaduncan@gmail.com>", 
+    "Bamieh <ahmadbamieh@gmail.com>", 
+    "Ben Bradley <ben@bradleyit.com>", 
+    "Ben Glassman <benglass@users.noreply.github.com>", 
+    "Ben Harris <benhdev@gmail.com>", 
+    "Ben Hutchison <ben@aldaviva.com>", 
+    "Ben Lindsey <ben.lindsey@vungle.com>", 
+    "Ben Noordhuis <info@bnoordhuis.nl>", 
+    "Ben Vinegar <ben@benv.ca>", 
+    "Benjamin Eidelman <beneidel@gmail.com>", 
+    "Benjie Gillam <benjie@jemjie.com>", 
+    "Benoit Larroque <zeta.ben@gmail.com>", 
+    "Beno\u00eet Zugmeyer <bzugmeyer@gmail.com>", 
+    "Benson Trent <bensontrent@gmail.com>", 
+    "Berker Peksag <berker.peksag@gmail.com>", 
+    "berni <berni@extensa.pl>", 
+    "Bj\u00f8rge N\u00e6ss <bjoerge@origo.no>", 
+    "Bjorn Stromberg <bjorn@bjornstar.com>", 
+    "Brendan Nee <brendan.nee@gmail.com>", 
+    "Brian Beck <exogen@gmail.com>", 
+    "Brian Lagerman <49239617+brian-lagerman@users.noreply.github.com>", 
+    "Brian Lalor <blalor@bravo5.org>", 
+    "Brian M. Carlson <brian.m.carlson@gmail.com>", 
+    "Brian Moore <guardbionic-github@yahoo.com>", 
+    "Brian Tomlin <tendonstrength@gmail.com>", 
+    "Brittany Moore <moore.brittanyann@gmail.com>", 
+    "Bryan Donovan <bdondo@gmail.com>", 
+    "Buck Doyle <b@chromatin.ca>", 
+    "C. Scott Ananian <cscott@cscott.net>", 
+    "Callum Macrae <callum@macr.ae>", 
+    "Can Oztokmak <can@zeplin.io>", 
+    "Capacitor Set <CapacitorSet@users.noreply.github.com>", 
+    "Carl-Erik Kopseng <carlerik@gmail.com>", 
+    "Casey Foster <casey@caseywebdev.com>", 
+    "Charles Lowell <cowboyd@frontside.io>", 
+    "Charles Merriam <charles.merriam@gmail.com>", 
+    "Charles Samborski <demurgos@demurgos.net>", 
+    "Charlie Rudolph <charles.w.rudolph@gmail.com>", 
+    "Chen Yangjian <252317+cyjake@users.noreply.github.com>", 
+    "Chris <chrisleck@users.noreply.github.com>", 
+    "Chris Buckley <chris@cmbuckley.co.uk>", 
+    "Chris Lamb <chris@chris-lamb.co.uk>", 
+    "Christian <me@rndm.de>", 
+    "Christoffer Hallas <christoffer.hallas@gmail.com>", 
+    "Christoph Neuroth <christoph.neuroth@gmail.com>", 
+    "Christopher Hiller <boneskull@boneskull.com>", 
+    "ChrisWren <cthewren@gmail.com>", 
+    "claudyus <claudyus@HEX.(none)>", 
+    "Connor Dunn <connorhd@gmail.com>", 
+    "Corey Butler <corey@coreybutler.com>", 
+    "Corey Farrell <git@cfware.com>", 
+    "Cory Thomas <cory.thomas@bazaarvoice.com>", 
+    "Craig Taub <craigtaub@gmail.com>", 
+    "Cube <maty21@gmail.com>", 
+    "Daniel Ruf <827205+DanielRuf@users.noreply.github.com>", 
+    "Daniel Ruf <daniel@daniel-ruf.de>", 
+    "Daniel St. Jules <danielst.jules@gmail.com>", 
+    "Daniel Stockman <daniel.stockman@gmail.com>", 
+    "Darryl Pogue <dvpdiner2@gmail.com>", 
+    "Dave McKenna <davemckenna01@gmail.com>", 
+    "David da Silva Cont\u00edn <dasilvacontin@gmail.com>", 
+    "David Henderson <david.henderson@triggeredmessaging.com>", 
+    "David M. Lee <leedm777@yahoo.com>", 
+    "David Neubauer <davidneub@gmail.com>", 
+    "DavidLi119 <han.david.li@gmail.com>", 
+    "DavNej <davnej.dev@gmail.com>", 
+    "Denis Bardadym <bardadymchik@gmail.com>", 
+    "Devin Weaver <suki@tritarget.org>", 
+    "dfberry <dinaberry@outlook.com>", 
+    "Di Wu <dwu@palantir.com>", 
+    "Dina Berry <dfberry@users.noreply.github.com>", 
+    "Diogo Monteiro <diogo.gmt@gmail.com>", 
+    "Dmitriy Simushev <simushevds@gmail.com>", 
+    "Dmitry Shirokov <deadrunk@gmail.com>", 
+    "Dmitry Sorin <info@staypositive.ru>", 
+    "Domenic Denicola <domenic@domenicdenicola.com>", 
+    "Dominic Barnes <dominic@dbarnes.info>", 
+    "Dominique Quatravaux <dominique@quatravaux.org>", 
+    "Douglas Christopher Wilson <doug@somethingdoug.com>", 
+    "Duncan Beevers <duncan@dweebd.com>", 
+    "eiji.ienaga <eiji.ienaga@gmail.com>", 
+    "elergy <elergy@yandex-team.ru>", 
+    "Eli Skeggs <skeggse@users.noreply.github.com>", 
+    "ELLIOTTCABLE <me@ell.io>", 
+    "Emanuele <my.burning@gmail.com>", 
+    "Enric Pallerols <enric@pallerols.cat>", 
+    "Erik Eng <mail@ptz0n.se>", 
+    "Eugene Tiutiunnyk <eugene.tiutiunnyk@lookout.com>", 
+    "Fabio M. Costa <fabiomcosta@gmail.com>", 
+    "F\u00e1bio Santos <fabiosantosart@gmail.com>", 
+    "Fagner Brack <github3@fagnermartins.com>", 
+    "fargies <fargies@users.noreply.github.com>", 
+    "FARKAS M\u00e1t\u00e9 <mate.farkas@virtual-call-center.eu>", 
+    "fcrisci <fabio.crisci@amadeus.com>", 
+    "Fede Ramirez <i@2fd.me>", 
+    "Fedor Indutny <fedor.indutny@gmail.com>", 
+    "fengmk2 <fengmk2@gmail.com>", 
+    "Fin Chen <finfin@gmail.com>", 
+    "Florian Margaine <florian@margaine.com>", 
+    "FND <FND@users.noreply.github.com>", 
+    "fool2fish <fool2fish@gmail.com>", 
+    "Forbes Lindesay <forbes@lindesay.co.uk>", 
+    "Frank Leon Rose <frankleonrose@gmail.com>", 
+    "Frederico Silva <frederico.silva@gmail.com>", 
+    "Fredrik Enestad <fredrik@devloop.se>", 
+    "Fredrik Lindin <fredriklindin@gmail.com>", 
+    "Fumiaki MATSUSHIMA <mtsmfm@gmail.com>", 
+    "Gabe Gorelick <gabegorelick@gmail.com>", 
+    "Gabriel Silk <gabesilk@gmail.com>", 
+    "Gareth Aye <gaye@mozilla.com>", 
+    "Gareth Murphy <gareth.cpm@gmail.com>", 
+    "Gast\u00f3n I. Silva <givanse@gmail.com>", 
+    "Gavin Mogan <GavinM@airg.com>", 
+    "gaye <gaye@mozilla.com>", 
+    "gigadude <gigadude@users.noreply.github.com>", 
+    "Giovanni Bassi <giggio@giggio.net>", 
+    "gizemkeser <44727928+gizemkeser@users.noreply.github.com>", 
+    "Glen Huang <curvedmark@gmail.com>", 
+    "Glen Mailer <glenjamin@gmail.com>", 
+    "grasGendarme <me@grasgendar.me>", 
+    "Greg Perkins <gregperkins@alum.mit.edu>", 
+    "Guangcong Luo <guangcongluo@gmail.com>", 
+    "Guillermo Rauch <rauchg@gmail.com>", 
+    "Guy Arye <arye.guy@gmail.com>", 
+    "Gyandeep Singh <gyandeeps@gmail.com>", 
+    "Harish <hyeluri@gmail.com>", 
+    "Harry Brundage <harry.brundage@gmail.com>", 
+    "Harry Sarson <harry.sarson@hotmail.co.uk>", 
+    "Harry Wolff <hswolff@users.noreply.github.com>", 
+    "Herman Junge <herman@geekli.st>", 
+    "hokaccha <k.hokamura@gmail.com>", 
+    "Honza Javorek <mail@honzajavorek.cz>", 
+    "Hugo Giraudel <hugo.giraudel@gmail.com>", 
+    "Ian Storm Taylor <ian@ianstormtaylor.com>", 
+    "Ian W. Remmel <design@ianwremmel.com>", 
+    "Ian Young <ian.greenleaf@gmail.com>", 
+    "Ian Zamojc <ian@thesecretlocation.net>", 
+    "Igwe Kalu <igwe.kalu@live.com>", 
+    "ImgBot <31427850+ImgBotApp@users.noreply.github.com>", 
+    "inxorable <inxorable@codewren.ch>", 
+    "Ivan <ivan@kinvey.com>", 
+    "Jaakko Salonen <jaakko.salonen@iki.fi>", 
+    "Jacob Wejendorp <jacob@wejendorp.dk>", 
+    "Jake Craige <james.craige@gmail.com>", 
+    "Jake Marsh <jakemmarsh@gmail.com>", 
+    "Jakob Krigovsky <jakob@krigovsky.com>", 
+    "Jakub Nes\u030cetr\u030cil <jakub@apiary.io>", 
+    "James Bowes <jbowes@repl.ca>", 
+    "James Carr <james.r.carr@gmail.com>", 
+    "James D. Rogers <jd2rogers2@gmail.com>", 
+    "James G. Kim <jgkim@jayg.org>", 
+    "James Lal <james@lightsofapollo.com>", 
+    "James Nylen <jnylen@gmail.com>", 
+    "Jan Kopriva <jan.kopriva@gooddata.com>", 
+    "Jan Krems <jan.krems@groupon.com>", 
+    "Jan Lehnardt <jan@apache.org>", 
+    "Jason Barry <jay@jcbarry.com>", 
+    "Jason Lai <jason@getpebble.com>", 
+    "Jason Leyba <jmleyba@gmail.com>", 
+    "Javier Aranda <javierav@javierav.com>", 
+    "Jayasankar <jayasankar.m@gmail.com>", 
+    "Jean Ponchon <gelule@gmail.com>", 
+    "Jeff Kunkle <jeff.kunkle@nearinfinity.com>", 
+    "Jeff Schilling <jeff.schilling@q2ebanking.com>", 
+    "JeongHoon Byun (aka Outsider) <outsideris@gmail.com>", 
+    "J\u00e9r\u00e9mie Astori <jeremie@astori.fr>", 
+    "Jeremy Martin <jmar777@gmail.com>", 
+    "Jerry Muzsik <jerrymuzsik@icloud.com>", 
+    "Jesse Dailey <jesse.dailey@gmail.com>", 
+    "jimenglish81 <jimenglish81@gmail.com>", 
+    "Jimmy Cuadra <jimmy@jimmycuadra.com>", 
+    "Jo Liss <joliss42@gmail.com>", 
+    "Joao Moreno <mail@joaomoreno.com>", 
+    "Joel Kemp <mrjoelkemp@gmail.com>", 
+    "Joey Cozza <joey@grow.com>", 
+    "John Doty <jrhdoty@gmail.com>", 
+    "John Firebaugh <john.firebaugh@gmail.com>", 
+    "John Reeves <github@jonnyreeves.co.uk>", 
+    "Johnathon Sanders <outdooricon@gmail.com>", 
+    "Jon Surrell <jon.surrell@automattic.com>", 
+    "Jonas Dohse <jonas@mbr-targeting.com>", 
+    "Jonas Westerlund <jonas.westerlund@me.com>", 
+    "Jonathan Creamer <matrixhasyou2k4@gmail.com>", 
+    "Jonathan Delgado <jdelgado@rewip.com>", 
+    "Jonathan Kim <jkimbo@gmail.com>", 
+    "Jonathan Ong <jonathanrichardong@gmail.com>", 
+    "Jonathan Park <jpark@daptiv.com>", 
+    "Jonathan Rajavuori <jrajav@gmail.com>", 
+    "Jordan Sexton <jordan@jordansexton.com>", 
+    "Joseph Lin <josephlin55555@gmail.com>", 
+    "Josh Eversmann <josh.eversmann@gmail.com>", 
+    "Josh Lory <josh.lory@code.org>", 
+    "Josh Soref <jsoref@users.noreply.github.com>", 
+    "Joshua Appelman <jappelman@xebia.com>", 
+    "Joshua Krall <joshuakrall@pobox.com>", 
+    "JP Bochi <jpbochi@gmail.com>", 
+    "jsdevel <js.developer.undefined@gmail.com>", 
+    "Juerg B <44573692+juergba@users.noreply.github.com>", 
+    "juergba <filodron@gmail.com>", 
+    "Julien Wajsberg <felash@gmail.com>", 
+    "Jupp M\u00fcller <jupp0r@gmail.com>", 
+    "Jussi Virtanen <jussi.k.virtanen@gmail.com>", 
+    "Justin DuJardin <justin.dujardin@sococo.com>", 
+    "Juzer Ali <er.juzerali@gmail.com>", 
+    "Katie Gengler <katiegengler@gmail.com>", 
+    "kavun <kevin.a.reed@gmail.com>", 
+    "Kazuhito Hokamura <k.hokamura@gmail.com>", 
+    "Keith Cirkel <github@keithcirkel.co.uk>", 
+    "Kelong Wang <buaawkl@gmail.com>", 
+    "Kent C. Dodds <kent+github@doddsfamily.us>", 
+    "Kevin Burke <kev@inburke.com>", 
+    "Kevin Conway <kevinjacobconway@gmail.com>", 
+    "Kevin Kirsche <Kev.Kirsche+GitHub@gmail.com>", 
+    "Kevin Partington <platinum.azure@kernelpanicstudios.com>", 
+    "Kevin Wang <kevin@fossa.io>", 
+    "Kirill Korolyov <kirill.korolyov@gmail.com>", 
+    "klaemo <klaemo@fastmail.fm>", 
+    "Koen Punt <koen@koenpunt.nl>", 
+    "Konstantin Ka\u0308fer <github@kkaefer.com>", 
+    "Kris Rasmussen <kristopher.rasmussen@gmail.com>", 
+    "Kunal Nagpal <kunagpal@users.noreply.github.com>", 
+    "Kyle Mitchell <kyle@kemitchell.com>", 
+    "lakmeer <lakmeerkravid@gmail.com>", 
+    "Lane Kelly <lanekelly16@gmail.com>", 
+    "L\u00e1szl\u00f3 B\u00e1csi <lackac@lackac.hu>", 
+    "Laurence Rowe <lrowe@netflix.com>", 
+    "Liam Newman <bitwiseman@gmail.com>", 
+    "Linus Unneb\u00e4ck <linus@folkdatorn.se>", 
+    "lodr <salva@unoyunodiez.com>", 
+    "Long Ho <longlho@users.noreply.github.com>", 
+    "Maciej Ma\u0142ecki <maciej.malecki@notimplemented.org>", 
+    "Mal Graty <mal.graty@googlemail.com>", 
+    "Marais Rossouw <me@maraisr.com>", 
+    "Marc Kuo <kuomarc2@gmail.com>", 
+    "Marc Udoff <mlucool@gmail.com>", 
+    "Marcello Bastea-Forte <marcello@cellosoft.com>", 
+    "Mark Banner <standard8@mozilla.com>", 
+    "Mark Owsiak <mark.owsiak@gmail.com>", 
+    "Markus Tacker <m@coderbyheart.com>", 
+    "Martijn Cuppens <martijn.cuppens@intracto.com>", 
+    "Martin Marko <marcus@gratex.com>", 
+    "Mathieu Desv\u00e9 <mathieudesve@MacBook-Pro-de-Mathieu.local>", 
+    "Matija Marohni\u0107 <matija.marohnic@gmail.com>", 
+    "Matt Bierner <mattbierner@gmail.com>", 
+    "Matt Giles <matt.giles@cerner.com>", 
+    "Matt Robenolt <matt@ydekproductions.com>", 
+    "Matt Smith <matthewgarysmith@gmail.com>", 
+    "Matthew Shanley <matthewshanley@littlesecretsrecords.com>", 
+    "Mattias Tidlund <mattias.tidlund@learningwell.se>", 
+    "Max Goodman <c@chromakode.com>", 
+    "Maximilian Antoni <mail@maxantoni.de>", 
+    "Merrick Christensen <merrick.christensen@gmail.com>", 
+    "Michael Demmer <demmer@jut.io>", 
+    "Michael Jackson <mjijackson@gmail.com>", 
+    "Michael Olson <mwolson@member.fsf.org>", 
+    "Michael Riley <michael.riley@autodesk.com>", 
+    "Michael Schoonmaker <michael.r.schoonmaker@gmail.com>", 
+    "Michal Charemza <michalcharemza@gmail.com>", 
+    "Michiel de Jong <michiel@unhosted.org>", 
+    "Mick Brooks <mick.brooks@sinking.in>", 
+    "Mike Pennisi <mike@mikepennisi.com>", 
+    "Mislav Marohni\u0107 <mislav.marohnic@gmail.com>", 
+    "monowerker <monowerker@gmail.com>", 
+    "Moshe Kolodny <mkolodny@integralads.com>", 
+    "mrShturman <mrshturman@gmail.com>", 
+    "Nathan Alderson <nathan.alderson@adtran.com>", 
+    "Nathan Black <nathan@nathanblack.org>", 
+    "Nathan Bowser <nathan.bowser@spiderstrategies.com>", 
+    "Nathan Houle <nathan@nathanhoule.com>", 
+    "Nathan Rajlich <nathan@tootallnate.net>", 
+    "nexdrew <andrew.goode@nextraq.com>", 
+    "Nick Fitzgerald <fitzgen@gmail.com>", 
+    "Nicolas Girault <nic.girault@gmail.com>", 
+    "Nicolo Taddei <taddei.uk@gmail.com>", 
+    "Nik Nyby <nnyby@columbia.edu>", 
+    "Nikolaos Georgiou <Nikolaos.Georgiou@gmail.com>", 
+    "nishigori <Takuya_Nishigori@voyagegroup.com>", 
+    "Noshir Patel <nosh@blackpiano.com>", 
+    "not-an-aardvark <not-an-aardvark@users.noreply.github.com>", 
+    "OlegTsyba <oleg.tsyba.ua@gmail.com>", 
+    "olsonpm <olsonpm@users.noreply.github.com>", 
+    "omardelarosa <thedelarosa@gmail.com>", 
+    "Oscar Godson <oscargodson@outlook.com>", 
+    "Outsider <outsideris@gmail.com>", 
+    "oveddan <stangogh@gmail.com>", 
+    "P. Roebuck <plroebuck@users.noreply.github.com>", 
+    "Panu Horsmalahti <panu.horsmalahti@iki.fi>", 
+    "Parker Moore <parkrmoore@gmail.com>", 
+    "Pascal <pascal@pascal.com>", 
+    "Pat Finnigan <patrick.k.finnigan@gmail.com>", 
+    "Paul Armstrong <paul@paularmstrongdesigns.com>", 
+    "Paul Miller <paul@paulmillr.com>", 
+    "Paul Roebuck <plroebuck@users.noreply.github.com>", 
+    "Pavel Zubkou <pavel.zubkou@gmail.com>", 
+    "Pete Hawkins <pete@petes-imac.frontinternal.net>", 
+    "Peter M\u00fcller <munter@fumle.dk>", 
+    "Peter Rust <peter@cornerstonenw.com>", 
+    "Phil Sung <psung@dnanexus.com>", 
+    "Philip M. White <philip@mailworks.org>", 
+    "Piotr Kuczynski <piotr.kuczynski@gmail.com>", 
+    "PoppinL <poppinlp@gmail.com>", 
+    "Popr\u00e1di \u00c1rp\u00e1d <popradi.arpad11@gmail.com>", 
+    "Prayag Verma <prayag.verma@gmail.com>", 
+    "qiuzuhui <qiuzuhui@users.noreply.github.com>", 
+    "Quang Van <quangvvv@gmail.com>", 
+    "Quanlong He <kyan.ql.he@gmail.com>", 
+    "R56 <rviskus@gmail.com>", 
+    "Raynos <raynos2@gmail.com>", 
+    "Refael Ackermann <refael@empeeric.com>", 
+    "Rich Trott <rtrott@gmail.com>", 
+    "Richard Dingwall <rdingwall@gmail.com>", 
+    "Richard Knop <RichardKnop@users.noreply.github.com>", 
+    "Rico Sta. Cruz <rstacruz@users.noreply.github.com>", 
+    "rmacklin <richard.github@nrm.com>", 
+    "Rob Loach <robloach@gmail.com>", 
+    "Rob Raux <rraux@peachworks.com>", 
+    "Rob Wu <rob@robwu.nl>", 
+    "Robert Rossmann <rr.rossmann@me.com>", 
+    "Romain Prieto <romain.prieto@gmail.com>", 
+    "Roman Neuhauser <rneuhauser@suse.cz>", 
+    "Roman Shtylman <shtylman@gmail.com>", 
+    "Ross Warren <rosswarren4@gmail.com>", 
+    "rotemdan <rotemdan@gmail.com>", 
+    "Russ Bradberry <devdazed@me.com>", 
+    "Russell Munson <rmunson@github.com>", 
+    "Rustem Mustafin <mustafin.rustem@gmail.com>", 
+    "Ryan Hubbard <ryanmhubbard@gmail.com>", 
+    "Ryan Shaw <ryan.shaw@min.vc>", 
+    "Ryan Tablada <ryan.tablada@gmail.com>", 
+    "Ryunosuke SATO <tricknotes.rs@gmail.com>", 
+    "ryym <ryym.64@gmail.com>", 
+    "Salehen Shovon Rahman <salehen.rahman@gmail.com>", 
+    "Sam Mussell <smussell@gmail.com>", 
+    "samuel goldszmidt <samuel.goldszmidt@gmail.com>", 
+    "sarehag <joakim.sarehag@gmail.com>", 
+    "Sasha Koss <koss@nocorp.me>", 
+    "Scott Kao <Scottkao85@users.noreply.github.com>", 
+    "Scott Santucci <ScottFreeCode@users.noreply.github.com>", 
+    "ScottFreeCode <ScottFreeCode@users.noreply.github.com>", 
+    "Sean Lang <slang800@gmail.com>", 
+    "Sebastian Van Sande <sebastian@vansande.org>", 
+    "sebv <seb.vincent@gmail.com>", 
+    "Seiya Konno <nulltask@gmail.com>", 
+    "Sergey Simonchik <sergey.simonchik@jetbrains.com>", 
+    "Sergio Santoro <santoro.srg@gmail.com>", 
+    "Shaine Hatch <shaine@squidtree.com>", 
+    "Shawn Krisman <telaviv@github>", 
+    "Shinnosuke Watanabe <snnskwtnb@gmail.com>", 
+    "silentcloud <rjmuqiang@gmail.com>", 
+    "Silvio Massari <silvio.massari@auth0.com>", 
+    "Simon Gaeremynck <gaeremyncks@gmail.com>", 
+    "Simon Goumaz <simon@attentif.ch>", 
+    "simov <simeonvelichkov@gmail.com>", 
+    "Sindre Sorhus <sindresorhus@gmail.com>", 
+    "Slobodan Mi\u0161kovi\u0107 <slobodan@miskovic.ca>", 
+    "slyg <syl.faucherand@gmail.com>", 
+    "Soel <shachar.soel@sap.com>", 
+    "solodynamo <bittuf3@gmail.com>", 
+    "Sorin Iclanzan <sorin@iclanzan.com>", 
+    "Standa Opichal <opichals@gmail.com>", 
+    "startswithaj <jake.mc@icloud.com>", 
+    "Stephen Hess <trescube@users.noreply.github.com>", 
+    "Stephen Mathieson <smath23@gmail.com>", 
+    "Steve Mason <stevem@brandwatch.com>", 
+    "Stewart Taylor <stewart.taylor1@gmail.com>", 
+    "Stone <baoshi.li@adleida.com>", 
+    "Sulabh Bista <sul4bh@gmail.com>", 
+    "Sune Simonsen <sune@we-knowhow.dk>", 
+    "Svetlana <39729453+Lana-Light@users.noreply.github.com>", 
+    "Sylvain <sstephant+github@gmail.com>", 
+    "Sylvester Keil <sylvester@keil.or.at>", 
+    "Szauka <33459309+Szauka@users.noreply.github.com>", 
+    "Tapiwa Kelvin <tapiwa@munzwa.tk>", 
+    "Ted Yavuzkurt <hello@TedY.io>", 
+    "Teddy Zeenny <teddyzeenny@gmail.com>", 
+    "tgautier@yahoo.com <tgautier@gmail.com>", 
+    "Thedark1337 <thedark1337@thedark1337.com>", 
+    "Thomas Broadley <buriedunderbooks@hotmail.com>", 
+    "Thomas Grainger <tagrain@gmail.com>", 
+    "Thomas Scholtes <thomas-scholtes@gmx.de>", 
+    "Thomas Vantuycom <thomasvantuycom@protonmail.com>", 
+    "Tim Ehat <timehat@gmail.com>", 
+    "Tim Harshman <goteamtim+git@gmail.com>", 
+    "Timo Tijhof <krinklemail@gmail.com>", 
+    "Timothy Gu <timothygu99@gmail.com>", 
+    "Tingan Ho <tingan87@gmail.com>", 
+    "tmont <tommy.mont@gmail.com>", 
+    "Tobias Bieniek <tobias.bieniek@gmail.com>", 
+    "Tobias Mollstam <tobias@mollstam.com>", 
+    "Todd Agulnick <tagulnick@onjack.com>", 
+    "Tom Coquereau <tom@thau.me>", 
+    "Tom Hughes <tom@compton.nu>", 
+    "Tomer Eskenazi <tomer.eskenazi@ironsrc.com>", 
+    "toyjhlee <toyjhlee@gmail.com>", 
+    "traleig1 <darkphoenix739@gmail.com>", 
+    "Travis Jeffery <tj@travisjeffery.com>", 
+    "tripu <t@tripu.info>", 
+    "Tyson Tate <tyson@tysontate.com>", 
+    "Vadim Nikitin <vnikiti@ncsu.edu>", 
+    "Valentin Agachi <github-com@agachi.name>", 
+    "Valeri Karpov <val@karpov.io>", 
+    "Victor <victor@turo.com>", 
+    "Victor Costan <costan@gmail.com>", 
+    "Ville Saukkonen <villesau@users.noreply.github.com>", 
+    "Vivek Ganesan <caliberoviv@gmail.com>", 
+    "vlad <iamvlad@gmail.com>", 
+    "Vlad Magdalin <vlad@webflow.com>", 
+    "Volker Buzek <volker.buzek@sap.com>", 
+    "Wanseob Lim <email@wanseob.com>", 
+    "Wil Moore III <wil.moore@wilmoore.com>", 
+    "Will Langstroth <will@langstroth.com>", 
+    "wsw <wsw0108@gmail.com>", 
+    "Xavier Antoviaque <xavier@antoviaque.org>", 
+    "Xavier Damman <xdamman@gmail.com>", 
+    "XhmikosR <xhmikosr@gmail.com>", 
+    "XhmikosR <xhmikosr@users.sourceforge.net>", 
+    "Yanis Wang <yanis.wang@gmail.com>", 
+    "yehiyam <yehiyam@users.noreply.github.com>", 
+    "Yoshiya Hinosawa <hinosawa@waku-2.com>", 
+    "Yuest Wang <yuestwang@gmail.com>", 
+    "yuitest <yuitest@cjhat.net>", 
+    "zhiyelee <zhiyelee@gmail.com>", 
+    "Zsolt Tak\u00e1cs <zsolt@takacs.cc>", 
+    "\u73b0\u5145 <qixiang.cqx@alibaba-inc.com>"
+  ], 
+  "dependencies": {
+    "ansi-colors": "3.2.3", 
+    "browser-stdout": "1.3.1", 
+    "debug": "3.2.6", 
+    "diff": "3.5.0", 
+    "escape-string-regexp": "1.0.5", 
+    "find-up": "3.0.0", 
+    "glob": "7.1.3", 
+    "growl": "1.10.5", 
+    "he": "1.2.0", 
+    "js-yaml": "3.13.1", 
+    "log-symbols": "2.2.0", 
+    "minimatch": "3.0.4", 
+    "mkdirp": "0.5.1", 
+    "ms": "2.1.1", 
+    "node-environment-flags": "1.0.5", 
+    "object.assign": "4.1.0", 
+    "strip-json-comments": "2.0.1", 
+    "supports-color": "6.0.0", 
+    "which": "1.3.1", 
+    "wide-align": "1.1.3", 
+    "yargs": "13.2.2", 
+    "yargs-parser": "13.0.0", 
+    "yargs-unparser": "1.5.0"
+  }, 
+  "description": "simple, flexible, fun test framework", 
+  "devDependencies": {
+    "@11ty/eleventy": "^0.8.3", 
+    "@mocha/contributors": "^1.0.4", 
+    "@mocha/docdash": "^2.1.1", 
+    "assetgraph-builder": "^6.10.1", 
+    "autoprefixer": "^9.6.0", 
+    "browserify": "^16.2.3", 
+    "browserify-package-json": "^1.0.1", 
+    "chai": "^4.2.0", 
+    "coffee-script": "^1.12.7", 
+    "coveralls": "^3.0.3", 
+    "cross-env": "^5.2.0", 
+    "cross-spawn": "^6.0.5", 
+    "eslint": "^5.16.0", 
+    "eslint-config-prettier": "^3.6.0", 
+    "eslint-config-semistandard": "^13.0.0", 
+    "eslint-config-standard": "^12.0.0", 
+    "eslint-plugin-import": "^2.17.3", 
+    "eslint-plugin-node": "^8.0.1", 
+    "eslint-plugin-prettier": "^3.1.0", 
+    "eslint-plugin-promise": "^4.1.1", 
+    "eslint-plugin-standard": "^4.0.0", 
+    "fs-extra": "^8.0.1", 
+    "husky": "^1.3.1", 
+    "jsdoc": "^3.6.2", 
+    "karma": "^4.1.0", 
+    "karma-browserify": "^6.0.0", 
+    "karma-chrome-launcher": "^2.2.0", 
+    "karma-mocha": "^1.3.0", 
+    "karma-mocha-reporter": "^2.2.5", 
+    "karma-sauce-launcher": "^2.0.2", 
+    "lint-staged": "^8.1.7", 
+    "markdown-it": "^8.4.2", 
+    "markdown-it-anchor": "^5.2.4", 
+    "markdown-it-attrs": "^2.4.1", 
+    "markdown-it-prism": "^2.0.2", 
+    "markdown-magic": "^0.1.25", 
+    "markdown-magic-package-json": "^2.0.0", 
+    "markdown-toc": "^1.2.0", 
+    "markdownlint-cli": "^0.14.1", 
+    "nps": "^5.9.5", 
+    "nyc": "^14.1.1", 
+    "prettier": "^1.17.1", 
+    "remark": "^10.0.1", 
+    "remark-github": "^7.0.6", 
+    "remark-inline-links": "^3.1.2", 
+    "rewiremock": "^3.13.7", 
+    "rimraf": "^2.6.3", 
+    "sinon": "^7.3.2", 
+    "strip-ansi": "^5.2.0", 
+    "svgo": "^1.2.2", 
+    "through2": "^3.0.1", 
+    "to-vfile": "^5.0.3", 
+    "unexpected": "^10.40.2", 
+    "unexpected-eventemitter": "^1.1.3", 
+    "unexpected-sinon": "^10.11.2", 
+    "uslug": "^1.0.4", 
+    "watchify": "^3.11.1"
+  }, 
+  "directories": {
+    "lib": "./lib", 
+    "test": "./test"
+  }, 
+  "engines": {
+    "node": ">= 6.0.0"
+  }, 
+  "files": [
+    "bin/{*mocha,options.js}", 
+    "assets/growl/*.png", 
+    "lib/**/*.{js,html,json}", 
+    "index.js", 
+    "mocha.css", 
+    "mocha.js", 
+    "browser-entry.js"
+  ], 
+  "gitter": "https://gitter.im/mochajs/mocha", 
+  "homepage": "https://mochajs.org/", 
+  "husky": {
+    "hooks": {
+      "pre-commit": "lint-staged"
+    }
+  }, 
+  "keywords": [
+    "mocha", 
+    "test", 
+    "bdd", 
+    "tdd", 
+    "tap"
+  ], 
+  "license": "MIT", 
+  "logo": "https://cldup.com/S9uQ-cOLYz.svg", 
+  "name": "mocha", 
+  "notifyLogo": "https://ibin.co/4QuRuGjXvl36.png", 
+  "prettier": {
+    "bracketSpacing": false, 
+    "endOfLine": "auto", 
+    "singleQuote": true
+  }, 
+  "repository": {
+    "type": "git", 
+    "url": "https://github.com/mochajs/mocha.git"
+  }, 
+  "scripts": {
+    "prepublishOnly": "nps test clean build", 
+    "start": "nps", 
+    "test": "nps test", 
+    "version": "nps version"
+  }, 
+  "version": "6.2.0"
+}
+\ No newline at end of file
author	Allan Sandfeld Jensen <allan.jensen@qt.io>	2020-03-11 11:32:04 +0100
committer	Allan Sandfeld Jensen <allan.jensen@qt.io>	2020-03-18 13:40:17 +0000
commit	31ccca0778db85c159634478b4ec7997f6704860 (patch)
tree	3d33fc3afd9d5ec95541e1bbe074a9cf8da12a0e /chromium/third_party/devtools-frontend/src/node_modules/mocha
parent	248b70b82a40964d5594eb04feca0fa36716185d (diff)
download	qtwebengine-chromium-31ccca0778db85c159634478b4ec7997f6704860.tar.gz