diff options
45 files changed, 9388 insertions, 439 deletions
diff --git a/Makefile b/Makefile deleted file mode 100644 index 31cee684..00000000 --- a/Makefile +++ /dev/null @@ -1,63 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz> -# - -ifeq (Makefile.conf,$(wildcard Makefile.conf)) -include Makefile.conf -else -dummy: - @echo - @echo "Please, run configure script as first..." - @echo -endif - - -all: include/asoundlib.h - $(MAKE) -C src - $(MAKE) -C doc - @echo - @echo "ALSA library were sucessfully compiled." - @echo - -include/asoundlib.h: include/header.h include/version.h include/error.h include/footer.h \ - include/control.h include/mixer.h include/pcm.h include/rawmidi.h - cat include/header.h include/version.h include/error.h \ - include/control.h include/mixer.h \ - include/pcm.h include/rawmidi.h \ - include/footer.h > include/asoundlib.h - -install: all - $(INSTALL) -m 755 -o root -g root -d ${aclocaldir} - $(INSTALL) -m 755 -o root -g root aclocal.m4 ${aclocaldir}/alsa-lib.m4 - $(INSTALL) -m 755 -o root -g root -d ${includedir}/sys - $(INSTALL) -m 644 -o root -g root include/asoundlib.h ${includedir}/sys - $(INSTALL) -m 755 -o root -g root -d ${libdir} - $(INSTALL) -m 644 -o root -g root lib/libasound.a ${libdir} - $(LN_S) -f libasound.so.${SND_LIB_VERSION} ${libdir}/libasound.so - $(LN_S) -f libasound.so.${SND_LIB_VERSION} ${libdir}/libasound.so.${SND_LIB_MAJOR} - $(INSTALL) -m 644 -o root -g root lib/libasound.so.${SND_LIB_VERSION} ${libdir} - /sbin/ldconfig - -clean: - $(MAKE) -C include clean - $(MAKE) -C src clean - $(MAKE) -C test clean - $(MAKE) -C doc clean - $(MAKE) -C utils clean - rm -f core .depend *.o *.orig *~ - rm -f `find . -name "out.txt"` - -mrproper: clean - rm -f config.cache config.log config.status Makefile.conf \ - utils/alsa-lib.spec include/config.h include/version.h - -cvsclean: mrproper - rm -f configure include/asoundlib.h - -pack: mrproper - chown -R root.root ../alsa-lib - mv ../alsa-lib ../alsa-lib-$(SND_LIB_VERSION) - tar cvz -C .. -f ../alsa-lib-$(SND_LIB_VERSION).tar.gz alsa-lib-$(SND_LIB_VERSION) - mv ../alsa-lib-$(SND_LIB_VERSION) ../alsa-lib - diff --git a/Makefile.am b/Makefile.am new file mode 100644 index 00000000..d10e67f0 --- /dev/null +++ b/Makefile.am @@ -0,0 +1,4 @@ +SUBDIRS=doc include src test utils + + +INCLUDES=-I$(top_srcdir)/include diff --git a/Makefile.conf.in b/Makefile.conf.in deleted file mode 100644 index fe2e8033..00000000 --- a/Makefile.conf.in +++ /dev/null @@ -1,26 +0,0 @@ -# -# Configuration Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz> -# - -srcdir=@srcdir@ -VPATH=@srcdir@ -prefix=@prefix@ -exec_prefix=@exec_prefix@ -includedir=@includedir@ -libdir=@libdir@ -aclocaldir=/usr/share/aclocal -c_opts=@CFLAGS@ -INSTALL=@INSTALL@ -SND_LIB_VERSION=@SND_LIB_VERSION@ -SND_LIB_MAJOR=@SND_LIB_MAJOR@ -SND_LIB_MINOR=@SND_LIB_MINOR@ -SND_LIB_SUBMINOR=@SND_LIB_SUBMINOR@ - -CC=@CC@ -CPP=@CPP@ -INCLUDE=-I../include -I../../include -COPTS = $(c_opts) -COPTS += -Wall -Wstrict-prototypes -fomit-frame-pointer -pipe -LINKER=ld -LN_S=@LN_S@ diff --git a/Makefile.in b/Makefile.in new file mode 100644 index 00000000..e83c0314 --- /dev/null +++ b/Makefile.in @@ -0,0 +1,291 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = . + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +SUBDIRS=doc include src test utils + +INCLUDES=-I$(top_srcdir)/include +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ./include/config.h +CONFIG_CLEAN_FILES = +DIST_COMMON = COPYING ChangeLog Makefile.am Makefile.in acinclude.m4 \ +aclocal.m4 config.guess config.sub configure.in install-sh ltconfig \ +ltmain.sh missing mkinstalldirs + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +all: all-recursive all-am + +.SUFFIXES: +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$@ CONFIG_HEADERS= $(SHELL) ./config.status + +$(ACLOCAL_M4): configure.in acinclude.m4 + cd $(srcdir) && $(ACLOCAL) + +config.status: $(srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + $(SHELL) ./config.status --recheck +$(srcdir)/configure: $(srcdir)/configure.in $(ACLOCAL_M4) $(CONFIGURE_DEPENDENCIES) + cd $(srcdir) && $(AUTOCONF) + +# This directory's subdirectories are mostly independent; you can cd +# into them and run `make' without going through this Makefile. +# To change the values of `make' variables: instead of editing Makefiles, +# (1) if the variable is set in `config.status', edit `config.status' +# (which will cause the Makefiles to be regenerated when you run `make'); +# (2) otherwise, pass the desired values on the `make' command line. + +@SET_MAKE@ + +all-recursive install-data-recursive install-exec-recursive \ +installdirs-recursive install-recursive uninstall-recursive \ +check-recursive installcheck-recursive info-recursive dvi-recursive: + @set fnord $(MAKEFLAGS); amf=$$2; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + target=`echo $@ | sed s/-recursive//`; \ + echo "Making $$target in $$subdir"; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \ + || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \ + done && test -z "$$fail" + +mostlyclean-recursive clean-recursive distclean-recursive \ +maintainer-clean-recursive: + @set fnord $(MAKEFLAGS); amf=$$2; \ + rev=''; list='$(SUBDIRS)'; for subdir in $$list; do \ + rev="$$subdir $$rev"; \ + done; \ + for subdir in $$rev; do \ + target=`echo $@ | sed s/-recursive//`; \ + echo "Making $$target in $$subdir"; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \ + || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \ + done && test -z "$$fail" +tags-recursive: + list='$(SUBDIRS)'; for subdir in $$list; do \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \ + done + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + test -f $$subdir/TAGS && tags="$$tags -i $$here/$$subdir/TAGS"; \ + done; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(PACKAGE)-$(VERSION) +top_distdir = $(distdir) + +# This target untars the dist file and tries a VPATH configuration. Then +# it guarantees that the distribution is self-contained by making another +# tarfile. +distcheck: dist + -rm -rf $(distdir) + GZIP=$(GZIP) $(TAR) zxf $(distdir).tar.gz + mkdir $(distdir)/=build + mkdir $(distdir)/=inst + dc_install_base=`cd $(distdir)/=inst && pwd`; \ + cd $(distdir)/=build \ + && ../configure --srcdir=.. --prefix=$$dc_install_base \ + && $(MAKE) $(AM_MAKEFLAGS) \ + && $(MAKE) $(AM_MAKEFLAGS) dvi \ + && $(MAKE) $(AM_MAKEFLAGS) check \ + && $(MAKE) $(AM_MAKEFLAGS) install \ + && $(MAKE) $(AM_MAKEFLAGS) installcheck \ + && $(MAKE) $(AM_MAKEFLAGS) dist + -rm -rf $(distdir) + @echo "========================"; \ + echo "$(distdir).tar.gz is ready for distribution"; \ + echo "========================" +dist: distdir + -chmod -R a+r $(distdir) + GZIP=$(GZIP) $(TAR) chozf $(distdir).tar.gz $(distdir) + -rm -rf $(distdir) +dist-all: distdir + -chmod -R a+r $(distdir) + GZIP=$(GZIP) $(TAR) chozf $(distdir).tar.gz $(distdir) + -rm -rf $(distdir) +distdir: $(DISTFILES) + -rm -rf $(distdir) + mkdir $(distdir) + -chmod 777 $(distdir) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done + for subdir in $(SUBDIRS); do \ + test -d $(distdir)/$$subdir \ + || mkdir $(distdir)/$$subdir \ + || exit 1; \ + chmod 777 $(distdir)/$$subdir; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir=../$(distdir) distdir=../$(distdir)/$$subdir distdir) \ + || exit 1; \ + done +info: info-recursive +dvi: dvi-recursive +check: all-am + $(MAKE) $(AM_MAKEFLAGS) check-recursive +installcheck: installcheck-recursive +all-am: Makefile + +install-exec: install-exec-recursive + @$(NORMAL_INSTALL) + +install-data: install-data-recursive + @$(NORMAL_INSTALL) + +install: install-recursive + @: + +uninstall: uninstall-recursive + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: installdirs-recursive + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean-am: mostlyclean-tags mostlyclean-generic + +clean-am: clean-tags clean-generic mostlyclean-am + +distclean-am: distclean-tags distclean-generic clean-am + +maintainer-clean-am: maintainer-clean-tags maintainer-clean-generic \ + distclean-am + +mostlyclean: mostlyclean-recursive mostlyclean-am + +clean: clean-recursive clean-am + +distclean: distclean-recursive distclean-am + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-recursive maintainer-clean-am + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + -rm -f config.status + +.PHONY: install-data-recursive uninstall-data-recursive \ +install-exec-recursive uninstall-exec-recursive installdirs-recursive \ +uninstalldirs-recursive all-recursive check-recursive \ +installcheck-recursive info-recursive dvi-recursive \ +mostlyclean-recursive distclean-recursive clean-recursive \ +maintainer-clean-recursive tags tags-recursive mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck all-am install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/acconfig.h b/acconfig.h new file mode 100644 index 00000000..e26f1785 --- /dev/null +++ b/acconfig.h @@ -0,0 +1,8 @@ +/* Package name */ +#undef PACKAGE + +/* Package version */ +#undef VERSION + +/* Sound library version string */ +#undef SND_LIB_VERSION diff --git a/acinclude.m4 b/acinclude.m4 new file mode 100644 index 00000000..5b6c1e84 --- /dev/null +++ b/acinclude.m4 @@ -0,0 +1,109 @@ +dnl Configure Paths for Alsa +dnl Christopher Lansdown (lansdoct@cs.alfred.edu) +dnl 29/10/1998 +dnl AM_PATH_ALSA(MINIMUM-VERSION) +dnl Test for libasound, and define ALSA_CFLAGS and ALSA_LIBS as appropriate. +dnl enables arguments --with-alsa-prefix= --with-alsa-enc-prefix= --disable-alsatest +dnl +AC_DEFUN(AM_PATH_ALSA, +[dnl +dnl Get the clfags and libraries for alsa +dnl +AC_ARG_WITH(alsa-prefix,[ --with-alsa-prefix=PFX Prefix where Alsa library is installed(optional)], + [alsa_prefix="$withval"], [alsa_prefix=""]) +AC_ARG_WITH(alsa-inc-prefix, [ --with-alsa-inc-prefix=PFX Prefix where include libraries are (optional)], + [alsa_inc_prefix="$withval"], [alsa_inc_prefix=""]) +AC_ARG_ENABLE(alsatest, [ --disable-alsatest Do not try to compile and run a test Alsa program], [enable_alsatest=no], [enable_alsatest=yes]) + +dnl Add any special include directories +AC_MSG_CHECKING(for ALSA CFLAGS) +if test "$alsa_inc_prefix" != "" ; then + ALSA_CFLAGS="$ALSA_CFLAGS -I$alsa_inc_prefix" + CFLAGS="-I$alsa_inc_prefix" +fi +AC_MSG_RESULT($ALSA_CFLAGS) + +dnl add any special lib dirs +AC_MSG_CHECKING(for ALSA LDFLAGS) +if test "$alsa_prefix" != "" ; then + ALSA_LIBS="$ALSA_LIBS -L$alsa_prefix" + LIBS="-L$alsa_prefix" +fi + +dnl add the alsa library +ALSA_LIBS="$ALSA_LIBS -lasound" +LDFLAGS="$ALSA_LIBS -lasound" +AC_MSG_RESULT($ALSA_LIBS) + +dnl Check for the presence of the library +dnl if test $enable_alsatest = yes; then +dnl AC_MSG_CHECKING(for working libasound) +dnl AC_TRY_RUN([ +dnl #include <sys/asoundlib.h> +dnl void main(void) +dnl { +dnl snd_cards(); +dnl exit(0); +dnl } +dnl ], +dnl [AC_MSG_RESULT("present")], +dnl [AC_MSG_RESULT("not found. ") +dnl AC_MSG_ERROR(Fatal error: Install alsa-lib package or use --with-alsa-prefix option...)], +dnl [AC_MSG_RESULT(unsopported) +dnl AC_MSG_ERROR(Cross-compiling isn't supported...)] +dnl ) +dnl fi + +dnl Check for a working version of libasound that is of the right version. +min_alsa_version=ifelse([$1], ,0.1.1,$1) +AC_MSG_CHECKING(for libasound headers version >= $min_alsa_version) +no_alsa="" + alsa_min_major_version=`echo $min_alsa_version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'` + alsa_min_minor_version=`echo $min_alsa_version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'` + alsa_min_micro_version=`echo $min_alsa_version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'` + +AC_TRY_COMPILE([ +#include <sys/asoundlib.h> +], [ +void main(void) +{ +# if(SOUNDLIB_VERSION_MAJOR > $alsa_min_major_version) + exit(0); +# else +# if(SOUNDLIB_VERSION_MAJOR < $alsa_min_major_version) +# error not present +# endif + +# if(SOUNDLIB_VERSION_MINOR > $alsa_min_minor_version) + exit(0); +# else +# if(SOUNDLIB_VERSION_MINOR < $alsa_min_minor_version) +# error not present +# endif + +# if(SOUNDLIB_VERSION_SUBMINOR < $alsa_min_micro_version) +# error not present +# endif +# endif +# endif +exit(0); +} +], + [AC_MSG_RESULT(found.)], + [AC_MSG_RESULT(not present.) + AC_MSG_ERROR(Sufficiently new version of libasound not found.)] +) + +dnl Now that we know that we have the right version, let's see if we have the library and not just the headers. +AC_CHECK_LIB([asound], [snd_cards],, + [AC_MSG_ERROR(No linkable libasound was found.)] +) + +dnl That should be it. Now just export out symbols: +AC_SUBST(ALSA_CFLAGS) +AC_SUBST(ALSA_LIBS) +]) + @@ -1,3 +1,15 @@ +dnl aclocal.m4 generated automatically by aclocal 1.3b + +dnl Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +dnl This file is free software; the Free Software Foundation +dnl gives unlimited permission to copy and/or distribute it, +dnl with or without modifications, as long as this notice is preserved. + +dnl This program is distributed in the hope that it will be useful, +dnl but WITHOUT ANY WARRANTY, to the extent permitted by law; without +dnl even the implied warranty of MERCHANTABILITY or FITNESS FOR A +dnl PARTICULAR PURPOSE. + dnl Configure Paths for Alsa dnl Christopher Lansdown (lansdoct@cs.alfred.edu) dnl 29/10/1998 @@ -107,3 +119,366 @@ AC_SUBST(ALSA_CFLAGS) AC_SUBST(ALSA_LIBS) ]) + +# Do all the work for Automake. This macro actually does too much -- +# some checks are only needed if your package does certain things. +# But this isn't really a big deal. + +# serial 1 + +dnl Usage: +dnl AM_INIT_AUTOMAKE(package,version, [no-define]) + +AC_DEFUN(AM_INIT_AUTOMAKE, +[AC_REQUIRE([AM_PROG_INSTALL]) +PACKAGE=[$1] +AC_SUBST(PACKAGE) +VERSION=[$2] +AC_SUBST(VERSION) +dnl test to see if srcdir already configured +if test "`cd $srcdir && pwd`" != "`pwd`" && test -f $srcdir/config.status; then + AC_MSG_ERROR([source directory already configured; run "make distclean" there first]) +fi +ifelse([$3],, +AC_DEFINE_UNQUOTED(PACKAGE, "$PACKAGE") +AC_DEFINE_UNQUOTED(VERSION, "$VERSION")) +AC_REQUIRE([AM_SANITY_CHECK]) +AC_REQUIRE([AC_ARG_PROGRAM]) +dnl FIXME This is truly gross. +missing_dir=`cd $ac_aux_dir && pwd` +AM_MISSING_PROG(ACLOCAL, aclocal, $missing_dir) +AM_MISSING_PROG(AUTOCONF, autoconf, $missing_dir) +AM_MISSING_PROG(AUTOMAKE, automake, $missing_dir) +AM_MISSING_PROG(AUTOHEADER, autoheader, $missing_dir) +AM_MISSING_PROG(MAKEINFO, makeinfo, $missing_dir) +AC_REQUIRE([AC_PROG_MAKE_SET])]) + + +# serial 1 + +AC_DEFUN(AM_PROG_INSTALL, +[AC_REQUIRE([AC_PROG_INSTALL]) +test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL_PROGRAM}' +AC_SUBST(INSTALL_SCRIPT)dnl +]) + +# +# Check to make sure that the build environment is sane. +# + +AC_DEFUN(AM_SANITY_CHECK, +[AC_MSG_CHECKING([whether build environment is sane]) +# Just in case +sleep 1 +echo timestamp > conftestfile +# Do `set' in a subshell so we don't clobber the current shell's +# arguments. Must try -L first in case configure is actually a +# symlink; some systems play weird games with the mod time of symlinks +# (eg FreeBSD returns the mod time of the symlink's containing +# directory). +if ( + set X `ls -Lt $srcdir/configure conftestfile 2> /dev/null` + if test "[$]*" = "X"; then + # -L didn't work. + set X `ls -t $srcdir/configure conftestfile` + fi + if test "[$]*" != "X $srcdir/configure conftestfile" \ + && test "[$]*" != "X conftestfile $srcdir/configure"; then + + # If neither matched, then we have a broken ls. This can happen + # if, for instance, CONFIG_SHELL is bash and it inherits a + # broken ls alias from the environment. This has actually + # happened. Such a system could not be considered "sane". + AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken +alias in your environment]) + fi + + test "[$]2" = conftestfile + ) +then + # Ok. + : +else + AC_MSG_ERROR([newly created file is older than distributed files! +Check your system clock]) +fi +rm -f conftest* +AC_MSG_RESULT(yes)]) + +dnl AM_MISSING_PROG(NAME, PROGRAM, DIRECTORY) +dnl The program must properly implement --version. +AC_DEFUN(AM_MISSING_PROG, +[AC_MSG_CHECKING(for working $2) +# Run test in a subshell; some versions of sh will print an error if +# an executable is not found, even if stderr is redirected. +# Redirect stdin to placate older versions of autoconf. Sigh. +if ($2 --version) < /dev/null > /dev/null 2>&1; then + $1=$2 + AC_MSG_RESULT(found) +else + $1="$3/missing $2" + AC_MSG_RESULT(missing) +fi +AC_SUBST($1)]) + + +# serial 25 AM_PROG_LIBTOOL +AC_DEFUN(AM_PROG_LIBTOOL, +[AC_REQUIRE([AM_ENABLE_SHARED])dnl +AC_REQUIRE([AM_ENABLE_STATIC])dnl +AC_REQUIRE([AC_CANONICAL_HOST])dnl +AC_REQUIRE([AC_PROG_RANLIB])dnl +AC_REQUIRE([AC_PROG_CC])dnl +AC_REQUIRE([AM_PROG_LD])dnl +AC_REQUIRE([AM_PROG_NM])dnl +AC_REQUIRE([AC_PROG_LN_S])dnl +dnl +# Always use our own libtool. +LIBTOOL='$(SHELL) $(top_builddir)/libtool' +AC_SUBST(LIBTOOL)dnl + +# Check for any special flags to pass to ltconfig. +libtool_flags= +test "$enable_shared" = no && libtool_flags="$libtool_flags --disable-shared" +test "$enable_static" = no && libtool_flags="$libtool_flags --disable-static" +test "$silent" = yes && libtool_flags="$libtool_flags --silent" +test "$ac_cv_prog_gcc" = yes && libtool_flags="$libtool_flags --with-gcc" +test "$ac_cv_prog_gnu_ld" = yes && libtool_flags="$libtool_flags --with-gnu-ld" + +# Some flags need to be propagated to the compiler or linker for good +# libtool support. +case "$host" in +*-*-irix6*) + # Find out which ABI we are using. + echo '[#]line __oline__ "configure"' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + case "`/usr/bin/file conftest.o`" in + *32-bit*) + LD="${LD-ld} -32" + ;; + *N32*) + LD="${LD-ld} -n32" + ;; + *64-bit*) + LD="${LD-ld} -64" + ;; + esac + fi + rm -rf conftest* + ;; + +*-*-sco3.2v5*) + # On SCO OpenServer 5, we need -belf to get full-featured binaries. + CFLAGS="$CFLAGS -belf" + ;; +esac + +# Actually configure libtool. ac_aux_dir is where install-sh is found. +CC="$CC" CFLAGS="$CFLAGS" CPPFLAGS="$CPPFLAGS" \ +LD="$LD" NM="$NM" RANLIB="$RANLIB" LN_S="$LN_S" \ +${CONFIG_SHELL-/bin/sh} $ac_aux_dir/ltconfig --no-reexec \ +$libtool_flags --no-verify $ac_aux_dir/ltmain.sh $host \ +|| AC_MSG_ERROR([libtool configure failed]) + +# Redirect the config.log output again, so that the ltconfig log is not +# clobbered by the next message. +exec 5>>./config.log +]) + +# AM_ENABLE_SHARED - implement the --enable-shared flag +# Usage: AM_ENABLE_SHARED[(DEFAULT)] +# Where DEFAULT is either `yes' or `no'. If omitted, it defaults to +# `yes'. +AC_DEFUN(AM_ENABLE_SHARED, +[define([AM_ENABLE_SHARED_DEFAULT], ifelse($1, no, no, yes))dnl +AC_ARG_ENABLE(shared, +changequote(<<, >>)dnl +<< --enable-shared[=PKGS] build shared libraries [default=>>AM_ENABLE_SHARED_DEFAULT], +changequote([, ])dnl +[p=${PACKAGE-default} +case "$enableval" in +yes) enable_shared=yes ;; +no) enable_shared=no ;; +*) + enable_shared=no + # Look at the argument we got. We use all the common list separators. + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:," + for pkg in $enableval; do + if test "X$pkg" = "X$p"; then + enable_shared=yes + fi + done + IFS="$ac_save_ifs" + ;; +esac], +enable_shared=AM_ENABLE_SHARED_DEFAULT)dnl +]) + +# AM_DISABLE_SHARED - set the default shared flag to --disable-shared +AC_DEFUN(AM_DISABLE_SHARED, +[AM_ENABLE_SHARED(no)]) + +# AM_DISABLE_STATIC - set the default static flag to --disable-static +AC_DEFUN(AM_DISABLE_STATIC, +[AM_ENABLE_STATIC(no)]) + +# AM_ENABLE_STATIC - implement the --enable-static flag +# Usage: AM_ENABLE_STATIC[(DEFAULT)] +# Where DEFAULT is either `yes' or `no'. If omitted, it defaults to +# `yes'. +AC_DEFUN(AM_ENABLE_STATIC, +[define([AM_ENABLE_STATIC_DEFAULT], ifelse($1, no, no, yes))dnl +AC_ARG_ENABLE(static, +changequote(<<, >>)dnl +<< --enable-static[=PKGS] build static libraries [default=>>AM_ENABLE_STATIC_DEFAULT], +changequote([, ])dnl +[p=${PACKAGE-default} +case "$enableval" in +yes) enable_static=yes ;; +no) enable_static=no ;; +*) + enable_static=no + # Look at the argument we got. We use all the common list separators. + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:," + for pkg in $enableval; do + if test "X$pkg" = "X$p"; then + enable_static=yes + fi + done + IFS="$ac_save_ifs" + ;; +esac], +enable_static=AM_ENABLE_STATIC_DEFAULT)dnl +]) + + +# AM_PROG_LD - find the path to the GNU or non-GNU linker +AC_DEFUN(AM_PROG_LD, +[AC_ARG_WITH(gnu-ld, +[ --with-gnu-ld assume the C compiler uses GNU ld [default=no]], +test "$withval" = no || with_gnu_ld=yes, with_gnu_ld=no) +AC_REQUIRE([AC_PROG_CC]) +ac_prog=ld +if test "$ac_cv_prog_gcc" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + AC_MSG_CHECKING([for ld used by GCC]) + ac_prog=`($CC -print-prog-name=ld) 2>&5` + case "$ac_prog" in + # Accept absolute paths. +changequote(,)dnl + /* | [A-Za-z]:\\*) +changequote([,])dnl + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we aren't using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac +elif test "$with_gnu_ld" = yes; then + AC_MSG_CHECKING([for GNU ld]) +else + AC_MSG_CHECKING([for non-GNU ld]) +fi +AC_CACHE_VAL(ac_cv_path_LD, +[if test -z "$LD"; then + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in $PATH; do + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog"; then + ac_cv_path_LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some GNU ld's only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + if "$ac_cv_path_LD" -v 2>&1 < /dev/null | egrep '(GNU|with BFD)' > /dev/null; then + test "$with_gnu_ld" != no && break + else + test "$with_gnu_ld" != yes && break + fi + fi + done + IFS="$ac_save_ifs" +else + ac_cv_path_LD="$LD" # Let the user override the test with a path. +fi]) +LD="$ac_cv_path_LD" +if test -n "$LD"; then + AC_MSG_RESULT($LD) +else + AC_MSG_RESULT(no) +fi +test -z "$LD" && AC_MSG_ERROR([no acceptable ld found in \$PATH]) +AC_SUBST(LD) +AM_PROG_LD_GNU +]) + +AC_DEFUN(AM_PROG_LD_GNU, +[AC_CACHE_CHECK([if the linker ($LD) is GNU ld], ac_cv_prog_gnu_ld, +[# I'd rather use --version here, but apparently some GNU ld's only accept -v. +if $LD -v 2>&1 </dev/null | egrep '(GNU|with BFD)' 1>&5; then + ac_cv_prog_gnu_ld=yes +else + ac_cv_prog_gnu_ld=no +fi]) +]) + +# AM_PROG_NM - find the path to a BSD-compatible name lister +AC_DEFUN(AM_PROG_NM, +[AC_MSG_CHECKING([for BSD-compatible nm]) +AC_CACHE_VAL(ac_cv_path_NM, +[if test -n "$NM"; then + # Let the user override the test. + ac_cv_path_NM="$NM" +else + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in /usr/ucb /usr/ccs/bin $PATH /bin; do + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/nm; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the `sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + if ($ac_dir/nm -B /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then + ac_cv_path_NM="$ac_dir/nm -B" + elif ($ac_dir/nm -p /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then + ac_cv_path_NM="$ac_dir/nm -p" + else + ac_cv_path_NM="$ac_dir/nm" + fi + break + fi + done + IFS="$ac_save_ifs" + test -z "$ac_cv_path_NM" && ac_cv_path_NM=nm +fi]) +NM="$ac_cv_path_NM" +AC_MSG_RESULT([$NM]) +AC_SUBST(NM) +]) + +# Like AC_CONFIG_HEADER, but automatically create stamp file. + +AC_DEFUN(AM_CONFIG_HEADER, +[AC_PREREQ([2.12]) +AC_CONFIG_HEADER([$1]) +dnl When config.status generates a header, we must update the stamp-h file. +dnl This file resides in the same directory as the config header +dnl that is generated. We must strip everything past the first ":", +dnl and everything past the last "/". +AC_OUTPUT_COMMANDS(changequote(<<,>>)dnl +ifelse(patsubst(<<$1>>, <<[^ ]>>, <<>>), <<>>, +<<test -z "<<$>>CONFIG_HEADERS" || echo timestamp > patsubst(<<$1>>, <<^\([^:]*/\)?.*>>, <<\1>>)stamp-h<<>>dnl>>, +<<am_indx=1 +for am_file in <<$1>>; do + case " <<$>>CONFIG_HEADERS " in + *" <<$>>am_file "*<<)>> + echo timestamp > `echo <<$>>am_file | sed -e 's%:.*%%' -e 's%[^/]*$%%'`stamp-h$am_indx + ;; + esac + am_indx=`expr "<<$>>am_indx" + 1` +done<<>>dnl>>) +changequote([,]))]) + diff --git a/config.guess b/config.guess new file mode 100644 index 00000000..30230b3d --- /dev/null +++ b/config.guess @@ -0,0 +1,890 @@ +#! /bin/sh +# Attempt to guess a canonical system name. +# Copyright (C) 1992, 93, 94, 95, 96, 97, 1998 Free Software Foundation, Inc. +# +# This file is free software; you can redistribute it and/or modify it +# under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Written by Per Bothner <bothner@cygnus.com>. +# The master version of this file is at the FSF in /home/gd/gnu/lib. +# +# This script attempts to guess a canonical system name similar to +# config.sub. If it succeeds, it prints the system name on stdout, and +# exits with 0. Otherwise, it exits with 1. +# +# The plan is that this can be called by configure scripts if you +# don't specify an explicit system type (host/target name). +# +# Only a few systems have been added to this list; please add others +# (but try to keep the structure clean). +# + +# This is needed to find uname on a Pyramid OSx when run in the BSD universe. +# (ghazi@noc.rutgers.edu 8/24/94.) +if (test -f /.attbin/uname) >/dev/null 2>&1 ; then + PATH=$PATH:/.attbin ; export PATH +fi + +UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown +UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown +UNAME_SYSTEM=`(uname -s) 2>/dev/null` || UNAME_SYSTEM=unknown +UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown + +trap 'rm -f dummy.c dummy.o dummy; exit 1' 1 2 15 + +# Note: order is significant - the case branches are not exclusive. + +case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in + alpha:OSF1:*:*) + if test $UNAME_RELEASE = "V4.0"; then + UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'` + fi + # A Vn.n version is a released version. + # A Tn.n version is a released field test version. + # A Xn.n version is an unreleased experimental baselevel. + # 1.2 uses "1.2" for uname -r. + cat <<EOF >dummy.s + .globl main + .ent main +main: + .frame \$30,0,\$26,0 + .prologue 0 + .long 0x47e03d80 # implver $0 + lda \$2,259 + .long 0x47e20c21 # amask $2,$1 + srl \$1,8,\$2 + sll \$2,2,\$2 + sll \$0,3,\$0 + addl \$1,\$0,\$0 + addl \$2,\$0,\$0 + ret \$31,(\$26),1 + .end main +EOF + ${CC-cc} dummy.s -o dummy 2>/dev/null + if test "$?" = 0 ; then + ./dummy + case "$?" in + 7) + UNAME_MACHINE="alpha" + ;; + 15) + UNAME_MACHINE="alphaev5" + ;; + 14) + UNAME_MACHINE="alphaev56" + ;; + 10) + UNAME_MACHINE="alphapca56" + ;; + 16) + UNAME_MACHINE="alphaev6" + ;; + esac + fi + rm -f dummy.s dummy + echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[VTX]//' | tr [[A-Z]] [[a-z]]` + exit 0 ;; + 21064:Windows_NT:50:3) + echo alpha-dec-winnt3.5 + exit 0 ;; + Amiga*:UNIX_System_V:4.0:*) + echo m68k-cbm-sysv4 + exit 0;; + amiga:NetBSD:*:*) + echo m68k-cbm-netbsd${UNAME_RELEASE} + exit 0 ;; + amiga:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + arc64:OpenBSD:*:*) + echo mips64el-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + arc:OpenBSD:*:*) + echo mipsel-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + hkmips:OpenBSD:*:*) + echo mips-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + pmax:OpenBSD:*:*) + echo mipsel-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + sgi:OpenBSD:*:*) + echo mips-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + wgrisc:OpenBSD:*:*) + echo mipsel-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*) + echo arm-acorn-riscix${UNAME_RELEASE} + exit 0;; + arm32:NetBSD:*:*) + echo arm-unknown-netbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'` + exit 0 ;; + SR2?01:HI-UX/MPP:*:*) + echo hppa1.1-hitachi-hiuxmpp + exit 0;; + Pyramid*:OSx*:*:*|MIS*:OSx*:*:*) + # akee@wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE. + if test "`(/bin/universe) 2>/dev/null`" = att ; then + echo pyramid-pyramid-sysv3 + else + echo pyramid-pyramid-bsd + fi + exit 0 ;; + NILE:*:*:dcosx) + echo pyramid-pyramid-svr4 + exit 0 ;; + sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*) + echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + i86pc:SunOS:5.*:*) + echo i386-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + sun4*:SunOS:6*:*) + # According to config.sub, this is the proper way to canonicalize + # SunOS6. Hard to guess exactly what SunOS6 will be like, but + # it's likely to be more like Solaris than SunOS4. + echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + sun4*:SunOS:*:*) + case "`/usr/bin/arch -k`" in + Series*|S4*) + UNAME_RELEASE=`uname -v` + ;; + esac + # Japanese Language versions have a version number like `4.1.3-JL'. + echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'` + exit 0 ;; + sun3*:SunOS:*:*) + echo m68k-sun-sunos${UNAME_RELEASE} + exit 0 ;; + sun*:*:4.2BSD:*) + UNAME_RELEASE=`(head -1 /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null` + test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3 + case "`/bin/arch`" in + sun3) + echo m68k-sun-sunos${UNAME_RELEASE} + ;; + sun4) + echo sparc-sun-sunos${UNAME_RELEASE} + ;; + esac + exit 0 ;; + aushp:SunOS:*:*) + echo sparc-auspex-sunos${UNAME_RELEASE} + exit 0 ;; + atari*:NetBSD:*:*) + echo m68k-atari-netbsd${UNAME_RELEASE} + exit 0 ;; + atari*:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + sun3*:NetBSD:*:*) + echo m68k-sun-netbsd${UNAME_RELEASE} + exit 0 ;; + sun3*:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mac68k:NetBSD:*:*) + echo m68k-apple-netbsd${UNAME_RELEASE} + exit 0 ;; + mac68k:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mvme68k:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mvme88k:OpenBSD:*:*) + echo m88k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + powerpc:machten:*:*) + echo powerpc-apple-machten${UNAME_RELEASE} + exit 0 ;; + RISC*:Mach:*:*) + echo mips-dec-mach_bsd4.3 + exit 0 ;; + RISC*:ULTRIX:*:*) + echo mips-dec-ultrix${UNAME_RELEASE} + exit 0 ;; + VAX*:ULTRIX*:*:*) + echo vax-dec-ultrix${UNAME_RELEASE} + exit 0 ;; + 2020:CLIX:*:*) + echo clipper-intergraph-clix${UNAME_RELEASE} + exit 0 ;; + mips:*:*:UMIPS | mips:*:*:RISCos) + sed 's/^ //' << EOF >dummy.c + int main (argc, argv) int argc; char **argv; { + #if defined (host_mips) && defined (MIPSEB) + #if defined (SYSTYPE_SYSV) + printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0); + #endif + #if defined (SYSTYPE_SVR4) + printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0); + #endif + #if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD) + printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0); + #endif + #endif + exit (-1); + } +EOF + ${CC-cc} dummy.c -o dummy \ + && ./dummy `echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` \ + && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + echo mips-mips-riscos${UNAME_RELEASE} + exit 0 ;; + Night_Hawk:Power_UNIX:*:*) + echo powerpc-harris-powerunix + exit 0 ;; + m88k:CX/UX:7*:*) + echo m88k-harris-cxux7 + exit 0 ;; + m88k:*:4*:R4*) + echo m88k-motorola-sysv4 + exit 0 ;; + m88k:*:3*:R3*) + echo m88k-motorola-sysv3 + exit 0 ;; + AViiON:dgux:*:*) + # DG/UX returns AViiON for all architectures + UNAME_PROCESSOR=`/usr/bin/uname -p` + if [ $UNAME_PROCESSOR = mc88100 -o $UNAME_PROCESSOR = mc88110 ] ; then + if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx \ + -o ${TARGET_BINARY_INTERFACE}x = x ] ; then + echo m88k-dg-dgux${UNAME_RELEASE} + else + echo m88k-dg-dguxbcs${UNAME_RELEASE} + fi + else echo i586-dg-dgux${UNAME_RELEASE} + fi + exit 0 ;; + M88*:DolphinOS:*:*) # DolphinOS (SVR3) + echo m88k-dolphin-sysv3 + exit 0 ;; + M88*:*:R3*:*) + # Delta 88k system running SVR3 + echo m88k-motorola-sysv3 + exit 0 ;; + XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3) + echo m88k-tektronix-sysv3 + exit 0 ;; + Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD) + echo m68k-tektronix-bsd + exit 0 ;; + *:IRIX*:*:*) + echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'` + exit 0 ;; + ????????:AIX?:[12].1:2) # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX. + echo romp-ibm-aix # uname -m gives an 8 hex-code CPU id + exit 0 ;; # Note that: echo "'`uname -s`'" gives 'AIX ' + i?86:AIX:*:*) + echo i386-ibm-aix + exit 0 ;; + *:AIX:2:3) + if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then + sed 's/^ //' << EOF >dummy.c + #include <sys/systemcfg.h> + + main() + { + if (!__power_pc()) + exit(1); + puts("powerpc-ibm-aix3.2.5"); + exit(0); + } +EOF + ${CC-cc} dummy.c -o dummy && ./dummy && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + echo rs6000-ibm-aix3.2.5 + elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then + echo rs6000-ibm-aix3.2.4 + else + echo rs6000-ibm-aix3.2 + fi + exit 0 ;; + *:AIX:*:4) + if /usr/sbin/lsattr -EHl proc0 | grep POWER >/dev/null 2>&1; then + IBM_ARCH=rs6000 + else + IBM_ARCH=powerpc + fi + if [ -x /usr/bin/oslevel ] ; then + IBM_REV=`/usr/bin/oslevel` + else + IBM_REV=4.${UNAME_RELEASE} + fi + echo ${IBM_ARCH}-ibm-aix${IBM_REV} + exit 0 ;; + *:AIX:*:*) + echo rs6000-ibm-aix + exit 0 ;; + ibmrt:4.4BSD:*|romp-ibm:BSD:*) + echo romp-ibm-bsd4.4 + exit 0 ;; + ibmrt:*BSD:*|romp-ibm:BSD:*) # covers RT/PC NetBSD and + echo romp-ibm-bsd${UNAME_RELEASE} # 4.3 with uname added to + exit 0 ;; # report: romp-ibm BSD 4.3 + *:BOSX:*:*) + echo rs6000-bull-bosx + exit 0 ;; + DPX/2?00:B.O.S.:*:*) + echo m68k-bull-sysv3 + exit 0 ;; + 9000/[34]??:4.3bsd:1.*:*) + echo m68k-hp-bsd + exit 0 ;; + hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*) + echo m68k-hp-bsd4.4 + exit 0 ;; + 9000/[3478]??:HP-UX:*:*) + case "${UNAME_MACHINE}" in + 9000/31? ) HP_ARCH=m68000 ;; + 9000/[34]?? ) HP_ARCH=m68k ;; + 9000/7?? | 9000/8?[1679] ) HP_ARCH=hppa1.1 ;; + 9000/8?? ) HP_ARCH=hppa1.0 ;; + esac + HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'` + echo ${HP_ARCH}-hp-hpux${HPUX_REV} + exit 0 ;; + 3050*:HI-UX:*:*) + sed 's/^ //' << EOF >dummy.c + #include <unistd.h> + int + main () + { + long cpu = sysconf (_SC_CPU_VERSION); + /* The order matters, because CPU_IS_HP_MC68K erroneously returns + true for CPU_PA_RISC1_0. CPU_IS_PA_RISC returns correct + results, however. */ + if (CPU_IS_PA_RISC (cpu)) + { + switch (cpu) + { + case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break; + case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break; + case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break; + default: puts ("hppa-hitachi-hiuxwe2"); break; + } + } + else if (CPU_IS_HP_MC68K (cpu)) + puts ("m68k-hitachi-hiuxwe2"); + else puts ("unknown-hitachi-hiuxwe2"); + exit (0); + } +EOF + ${CC-cc} dummy.c -o dummy && ./dummy && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + echo unknown-hitachi-hiuxwe2 + exit 0 ;; + 9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* ) + echo hppa1.1-hp-bsd + exit 0 ;; + 9000/8??:4.3bsd:*:*) + echo hppa1.0-hp-bsd + exit 0 ;; + hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* ) + echo hppa1.1-hp-osf + exit 0 ;; + hp8??:OSF1:*:*) + echo hppa1.0-hp-osf + exit 0 ;; + i?86:OSF1:*:*) + if [ -x /usr/sbin/sysversion ] ; then + echo ${UNAME_MACHINE}-unknown-osf1mk + else + echo ${UNAME_MACHINE}-unknown-osf1 + fi + exit 0 ;; + parisc*:Lites*:*:*) + echo hppa1.1-hp-lites + exit 0 ;; + C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*) + echo c1-convex-bsd + exit 0 ;; + C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*) + if getsysinfo -f scalar_acc + then echo c32-convex-bsd + else echo c2-convex-bsd + fi + exit 0 ;; + C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*) + echo c34-convex-bsd + exit 0 ;; + C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*) + echo c38-convex-bsd + exit 0 ;; + C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*) + echo c4-convex-bsd + exit 0 ;; + CRAY*X-MP:*:*:*) + echo xmp-cray-unicos + exit 0 ;; + CRAY*Y-MP:*:*:*) + echo ymp-cray-unicos${UNAME_RELEASE} + exit 0 ;; + CRAY*[A-Z]90:*:*:*) + echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \ + | sed -e 's/CRAY.*\([A-Z]90\)/\1/' \ + -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/ + exit 0 ;; + CRAY*TS:*:*:*) + echo t90-cray-unicos${UNAME_RELEASE} + exit 0 ;; + CRAY-2:*:*:*) + echo cray2-cray-unicos + exit 0 ;; + F300:UNIX_System_V:*:*) + FUJITSU_SYS=`uname -p | tr [A-Z] [a-z] | sed -e 's/\///'` + FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'` + echo "f300-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}" + exit 0 ;; + F301:UNIX_System_V:*:*) + echo f301-fujitsu-uxpv`echo $UNAME_RELEASE | sed 's/ .*//'` + exit 0 ;; + hp3[0-9][05]:NetBSD:*:*) + echo m68k-hp-netbsd${UNAME_RELEASE} + exit 0 ;; + hp300:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + i?86:BSD/386:*:* | *:BSD/OS:*:*) + echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE} + exit 0 ;; + *:FreeBSD:*:*) + echo ${UNAME_MACHINE}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` + exit 0 ;; + *:NetBSD:*:*) + echo ${UNAME_MACHINE}-unknown-netbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'` + exit 0 ;; + *:OpenBSD:*:*) + echo ${UNAME_MACHINE}-unknown-openbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'` + exit 0 ;; + i*:CYGWIN*:*) + echo ${UNAME_MACHINE}-pc-cygwin32 + exit 0 ;; + i*:MINGW*:*) + echo ${UNAME_MACHINE}-pc-mingw32 + exit 0 ;; + p*:CYGWIN*:*) + echo powerpcle-unknown-cygwin32 + exit 0 ;; + prep*:SunOS:5.*:*) + echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + *:GNU:*:*) + echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-gnu`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'` + exit 0 ;; + *:Linux:*:*) + # uname on the ARM produces all sorts of strangeness, and we need to + # filter it out. + case "$UNAME_MACHINE" in + arm* | sa110*) UNAME_MACHINE="arm" ;; + esac + + # The BFD linker knows what the default object file format is, so + # first see if it will tell us. + ld_help_string=`ld --help 2>&1` + ld_supported_emulations=`echo $ld_help_string \ + | sed -ne '/supported emulations:/!d + s/[ ][ ]*/ /g + s/.*supported emulations: *// + s/ .*// + p'` + case "$ld_supported_emulations" in + i?86linux) echo "${UNAME_MACHINE}-pc-linux-gnuaout" ; exit 0 ;; + i?86coff) echo "${UNAME_MACHINE}-pc-linux-gnucoff" ; exit 0 ;; + sparclinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;; + armlinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;; + m68klinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;; + elf32ppc) echo "powerpc-unknown-linux-gnu" ; exit 0 ;; + esac + + if test "${UNAME_MACHINE}" = "alpha" ; then + sed 's/^ //' <<EOF >dummy.s + .globl main + .ent main + main: + .frame \$30,0,\$26,0 + .prologue 0 + .long 0x47e03d80 # implver $0 + lda \$2,259 + .long 0x47e20c21 # amask $2,$1 + srl \$1,8,\$2 + sll \$2,2,\$2 + sll \$0,3,\$0 + addl \$1,\$0,\$0 + addl \$2,\$0,\$0 + ret \$31,(\$26),1 + .end main +EOF + LIBC="" + ${CC-cc} dummy.s -o dummy 2>/dev/null + if test "$?" = 0 ; then + ./dummy + case "$?" in + 7) + UNAME_MACHINE="alpha" + ;; + 15) + UNAME_MACHINE="alphaev5" + ;; + 14) + UNAME_MACHINE="alphaev56" + ;; + 10) + UNAME_MACHINE="alphapca56" + ;; + 16) + UNAME_MACHINE="alphaev6" + ;; + esac + + objdump --private-headers dummy | \ + grep ld.so.1 > /dev/null + if test "$?" = 0 ; then + LIBC="libc1" + fi + fi + rm -f dummy.s dummy + echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC} ; exit 0 + elif test "${UNAME_MACHINE}" = "mips" ; then + cat >dummy.c <<EOF +main(argc, argv) + int argc; + char *argv[]; +{ +#ifdef __MIPSEB__ + printf ("%s-unknown-linux-gnu\n", argv[1]); +#endif +#ifdef __MIPSEL__ + printf ("%sel-unknown-linux-gnu\n", argv[1]); +#endif + return 0; +} +EOF + ${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy "${UNAME_MACHINE}" && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + else + # Either a pre-BFD a.out linker (linux-gnuoldld) + # or one that does not give us useful --help. + # GCC wants to distinguish between linux-gnuoldld and linux-gnuaout. + # If ld does not provide *any* "supported emulations:" + # that means it is gnuoldld. + echo "$ld_help_string" | grep >/dev/null 2>&1 "supported emulations:" + test $? != 0 && echo "${UNAME_MACHINE}-pc-linux-gnuoldld" && exit 0 + + case "${UNAME_MACHINE}" in + i?86) + VENDOR=pc; + ;; + *) + VENDOR=unknown; + ;; + esac + # Determine whether the default compiler is a.out or elf + cat >dummy.c <<EOF +#include <features.h> +main(argc, argv) + int argc; + char *argv[]; +{ +#ifdef __ELF__ +# ifdef __GLIBC__ +# if __GLIBC__ >= 2 + printf ("%s-${VENDOR}-linux-gnu\n", argv[1]); +# else + printf ("%s-${VENDOR}-linux-gnulibc1\n", argv[1]); +# endif +# else + printf ("%s-${VENDOR}-linux-gnulibc1\n", argv[1]); +# endif +#else + printf ("%s-${VENDOR}-linux-gnuaout\n", argv[1]); +#endif + return 0; +} +EOF + ${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy "${UNAME_MACHINE}" && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + fi ;; +# ptx 4.0 does uname -s correctly, with DYNIX/ptx in there. earlier versions +# are messed up and put the nodename in both sysname and nodename. + i?86:DYNIX/ptx:4*:*) + echo i386-sequent-sysv4 + exit 0 ;; + i?86:UNIX_SV:4.2MP:2.*) + # Unixware is an offshoot of SVR4, but it has its own version + # number series starting with 2... + # I am not positive that other SVR4 systems won't match this, + # I just have to hope. -- rms. + # Use sysv4.2uw... so that sysv4* matches it. + echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION} + exit 0 ;; + i?86:*:4.*:* | i?86:SYSTEM_V:4.*:*) + if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then + echo ${UNAME_MACHINE}-univel-sysv${UNAME_RELEASE} + else + echo ${UNAME_MACHINE}-pc-sysv${UNAME_RELEASE} + fi + exit 0 ;; + i?86:*:3.2:*) + if test -f /usr/options/cb.name; then + UNAME_REL=`sed -n 's/.*Version //p' </usr/options/cb.name` + echo ${UNAME_MACHINE}-pc-isc$UNAME_REL + elif /bin/uname -X 2>/dev/null >/dev/null ; then + UNAME_REL=`(/bin/uname -X|egrep Release|sed -e 's/.*= //')` + (/bin/uname -X|egrep i80486 >/dev/null) && UNAME_MACHINE=i486 + (/bin/uname -X|egrep '^Machine.*Pentium' >/dev/null) \ + && UNAME_MACHINE=i586 + echo ${UNAME_MACHINE}-pc-sco$UNAME_REL + else + echo ${UNAME_MACHINE}-pc-sysv32 + fi + exit 0 ;; + pc:*:*:*) + # uname -m prints for DJGPP always 'pc', but it prints nothing about + # the processor, so we play safe by assuming i386. + echo i386-pc-msdosdjgpp + exit 0 ;; + Intel:Mach:3*:*) + echo i386-pc-mach3 + exit 0 ;; + paragon:*:*:*) + echo i860-intel-osf1 + exit 0 ;; + i860:*:4.*:*) # i860-SVR4 + if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then + echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4 + else # Add other i860-SVR4 vendors below as they are discovered. + echo i860-unknown-sysv${UNAME_RELEASE} # Unknown i860-SVR4 + fi + exit 0 ;; + mini*:CTIX:SYS*5:*) + # "miniframe" + echo m68010-convergent-sysv + exit 0 ;; + M68*:*:R3V[567]*:*) + test -r /sysV68 && echo 'm68k-motorola-sysv' && exit 0 ;; + 3[34]??:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 4850:*:4.0:3.0) + OS_REL='' + test -r /etc/.relid \ + && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid` + /bin/uname -p 2>/dev/null | grep 86 >/dev/null \ + && echo i486-ncr-sysv4.3${OS_REL} && exit 0 + /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \ + && echo i586-ncr-sysv4.3${OS_REL} && exit 0 ;; + 3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*) + /bin/uname -p 2>/dev/null | grep 86 >/dev/null \ + && echo i486-ncr-sysv4 && exit 0 ;; + m68*:LynxOS:2.*:*) + echo m68k-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + mc68030:UNIX_System_V:4.*:*) + echo m68k-atari-sysv4 + exit 0 ;; + i?86:LynxOS:2.*:*) + echo i386-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + TSUNAMI:LynxOS:2.*:*) + echo sparc-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + rs6000:LynxOS:2.*:* | PowerPC:LynxOS:2.*:*) + echo rs6000-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + SM[BE]S:UNIX_SV:*:*) + echo mips-dde-sysv${UNAME_RELEASE} + exit 0 ;; + RM*:SINIX-*:*:*) + echo mips-sni-sysv4 + exit 0 ;; + *:SINIX-*:*:*) + if uname -p 2>/dev/null >/dev/null ; then + UNAME_MACHINE=`(uname -p) 2>/dev/null` + echo ${UNAME_MACHINE}-sni-sysv4 + else + echo ns32k-sni-sysv + fi + exit 0 ;; + PENTIUM:CPunix:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort + # says <Richard.M.Bartel@ccMail.Census.GOV> + echo i586-unisys-sysv4 + exit 0 ;; + *:UNIX_System_V:4*:FTX*) + # From Gerald Hewes <hewes@openmarket.com>. + # How about differentiating between stratus architectures? -djm + echo hppa1.1-stratus-sysv4 + exit 0 ;; + *:*:*:FTX*) + # From seanf@swdc.stratus.com. + echo i860-stratus-sysv4 + exit 0 ;; + mc68*:A/UX:*:*) + echo m68k-apple-aux${UNAME_RELEASE} + exit 0 ;; + news*:NEWS-OS:*:6*) + echo mips-sony-newsos6 + exit 0 ;; + R3000:*System_V*:*:* | R4000:UNIX_SYSV:*:*) + if [ -d /usr/nec ]; then + echo mips-nec-sysv${UNAME_RELEASE} + else + echo mips-unknown-sysv${UNAME_RELEASE} + fi + exit 0 ;; +esac + +#echo '(No uname command or uname output not recognized.)' 1>&2 +#echo "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" 1>&2 + +cat >dummy.c <<EOF +#ifdef _SEQUENT_ +# include <sys/types.h> +# include <sys/utsname.h> +#endif +main () +{ +#if defined (sony) +#if defined (MIPSEB) + /* BFD wants "bsd" instead of "newsos". Perhaps BFD should be changed, + I don't know.... */ + printf ("mips-sony-bsd\n"); exit (0); +#else +#include <sys/param.h> + printf ("m68k-sony-newsos%s\n", +#ifdef NEWSOS4 + "4" +#else + "" +#endif + ); exit (0); +#endif +#endif + +#if defined (__arm) && defined (__acorn) && defined (__unix) + printf ("arm-acorn-riscix"); exit (0); +#endif + +#if defined (hp300) && !defined (hpux) + printf ("m68k-hp-bsd\n"); exit (0); +#endif + +#if defined (NeXT) +#if !defined (__ARCHITECTURE__) +#define __ARCHITECTURE__ "m68k" +#endif + int version; + version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`; + printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version); + exit (0); +#endif + +#if defined (MULTIMAX) || defined (n16) +#if defined (UMAXV) + printf ("ns32k-encore-sysv\n"); exit (0); +#else +#if defined (CMU) + printf ("ns32k-encore-mach\n"); exit (0); +#else + printf ("ns32k-encore-bsd\n"); exit (0); +#endif +#endif +#endif + +#if defined (__386BSD__) + printf ("i386-pc-bsd\n"); exit (0); +#endif + +#if defined (sequent) +#if defined (i386) + printf ("i386-sequent-dynix\n"); exit (0); +#endif +#if defined (ns32000) + printf ("ns32k-sequent-dynix\n"); exit (0); +#endif +#endif + +#if defined (_SEQUENT_) + struct utsname un; + + uname(&un); + + if (strncmp(un.version, "V2", 2) == 0) { + printf ("i386-sequent-ptx2\n"); exit (0); + } + if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */ + printf ("i386-sequent-ptx1\n"); exit (0); + } + printf ("i386-sequent-ptx\n"); exit (0); + +#endif + +#if defined (vax) +#if !defined (ultrix) + printf ("vax-dec-bsd\n"); exit (0); +#else + printf ("vax-dec-ultrix\n"); exit (0); +#endif +#endif + +#if defined (alliant) && defined (i860) + printf ("i860-alliant-bsd\n"); exit (0); +#endif + + exit (1); +} +EOF + +${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy && rm dummy.c dummy && exit 0 +rm -f dummy.c dummy + +# Apollos put the system type in the environment. + +test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit 0; } + +# Convex versions that predate uname can use getsysinfo(1) + +if [ -x /usr/convex/getsysinfo ] +then + case `getsysinfo -f cpu_type` in + c1*) + echo c1-convex-bsd + exit 0 ;; + c2*) + if getsysinfo -f scalar_acc + then echo c32-convex-bsd + else echo c2-convex-bsd + fi + exit 0 ;; + c34*) + echo c34-convex-bsd + exit 0 ;; + c38*) + echo c38-convex-bsd + exit 0 ;; + c4*) + echo c4-convex-bsd + exit 0 ;; + esac +fi + +#echo '(Unable to guess system type)' 1>&2 + +exit 1 diff --git a/config.sub b/config.sub new file mode 100644 index 00000000..e24b8504 --- /dev/null +++ b/config.sub @@ -0,0 +1,952 @@ +#! /bin/sh +# Configuration validation subroutine script, version 1.1. +# Copyright (C) 1991, 92-97, 1998 Free Software Foundation, Inc. +# This file is (in principle) common to ALL GNU software. +# The presence of a machine in this file suggests that SOME GNU software +# can handle that machine. It does not imply ALL GNU software can. +# +# This file is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, +# Boston, MA 02111-1307, USA. + +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Configuration subroutine to validate and canonicalize a configuration type. +# Supply the specified configuration type as an argument. +# If it is invalid, we print an error message on stderr and exit with code 1. +# Otherwise, we print the canonical config type on stdout and succeed. + +# This file is supposed to be the same for all GNU packages +# and recognize all the CPU types, system types and aliases +# that are meaningful with *any* GNU software. +# Each package is responsible for reporting which valid configurations +# it does not support. The user should be able to distinguish +# a failure to support a valid configuration from a meaningless +# configuration. + +# The goal of this file is to map all the various variations of a given +# machine specification into a single specification in the form: +# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM +# or in some cases, the newer four-part form: +# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM +# It is wrong to echo any other type of specification. + +if [ x$1 = x ] +then + echo Configuration name missing. 1>&2 + echo "Usage: $0 CPU-MFR-OPSYS" 1>&2 + echo "or $0 ALIAS" 1>&2 + echo where ALIAS is a recognized configuration type. 1>&2 + exit 1 +fi + +# First pass through any local machine types. +case $1 in + *local*) + echo $1 + exit 0 + ;; + *) + ;; +esac + +# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any). +# Here we must recognize all the valid KERNEL-OS combinations. +maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'` +case $maybe_os in + linux-gnu*) + os=-$maybe_os + basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'` + ;; + *) + basic_machine=`echo $1 | sed 's/-[^-]*$//'` + if [ $basic_machine != $1 ] + then os=`echo $1 | sed 's/.*-/-/'` + else os=; fi + ;; +esac + +### Let's recognize common machines as not being operating systems so +### that things like config.sub decstation-3100 work. We also +### recognize some manufacturers as not being operating systems, so we +### can provide default operating systems below. +case $os in + -sun*os*) + # Prevent following clause from handling this invalid input. + ;; + -dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \ + -att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \ + -unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \ + -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\ + -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \ + -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \ + -apple) + os= + basic_machine=$1 + ;; + -hiux*) + os=-hiuxwe2 + ;; + -sco5) + os=sco3.2v5 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco4) + os=-sco3.2v4 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco3.2.[4-9]*) + os=`echo $os | sed -e 's/sco3.2./sco3.2v/'` + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco3.2v[4-9]*) + # Don't forget version if it is 3.2v4 or newer. + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco*) + os=-sco3.2v2 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -isc) + os=-isc2.2 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -clix*) + basic_machine=clipper-intergraph + ;; + -isc*) + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -lynx*) + os=-lynxos + ;; + -ptx*) + basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'` + ;; + -windowsnt*) + os=`echo $os | sed -e 's/windowsnt/winnt/'` + ;; + -psos*) + os=-psos + ;; +esac + +# Decode aliases for certain CPU-COMPANY combinations. +case $basic_machine in + # Recognize the basic CPU types without company name. + # Some are omitted here because they have special meanings below. + tahoe | i860 | m32r | m68k | m68000 | m88k | ns32k | arc | arm \ + | arme[lb] | pyramid | mn10200 | mn10300 \ + | tron | a29k | 580 | i960 | h8300 | hppa | hppa1.0 | hppa1.1 \ + | alpha | alphaev5 | alphaev56 | we32k | ns16k | clipper \ + | i370 | sh | powerpc | powerpcle | 1750a | dsp16xx | pdp11 \ + | mips64 | mipsel | mips64el | mips64orion | mips64orionel \ + | mipstx39 | mipstx39el \ + | sparc | sparclet | sparclite | sparc64 | v850) + basic_machine=$basic_machine-unknown + ;; + # We use `pc' rather than `unknown' + # because (1) that's what they normally are, and + # (2) the word "unknown" tends to confuse beginning users. + i[34567]86) + basic_machine=$basic_machine-pc + ;; + # Object if more than one company name word. + *-*-*) + echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2 + exit 1 + ;; + # Recognize the basic CPU types with company name. + vax-* | tahoe-* | i[34567]86-* | i860-* | m32r-* | m68k-* | m68000-* \ + | m88k-* | sparc-* | ns32k-* | fx80-* | arc-* | arm-* | c[123]* \ + | mips-* | pyramid-* | tron-* | a29k-* | romp-* | rs6000-* \ + | power-* | none-* | 580-* | cray2-* | h8300-* | i960-* \ + | xmp-* | ymp-* | hppa-* | hppa1.0-* | hppa1.1-* \ + | alpha-* | alphaev5-* | alphaev56-* | we32k-* | cydra-* \ + | ns16k-* | pn-* | np1-* | xps100-* | clipper-* | orion-* \ + | sparclite-* | pdp11-* | sh-* | powerpc-* | powerpcle-* \ + | sparc64-* | mips64-* | mipsel-* \ + | mips64el-* | mips64orion-* | mips64orionel-* \ + | mipstx39-* | mipstx39el-* \ + | f301-*) + ;; + # Recognize the various machine names and aliases which stand + # for a CPU type and a company and sometimes even an OS. + 3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc) + basic_machine=m68000-att + ;; + 3b*) + basic_machine=we32k-att + ;; + alliant | fx80) + basic_machine=fx80-alliant + ;; + altos | altos3068) + basic_machine=m68k-altos + ;; + am29k) + basic_machine=a29k-none + os=-bsd + ;; + amdahl) + basic_machine=580-amdahl + os=-sysv + ;; + amiga | amiga-*) + basic_machine=m68k-cbm + ;; + amigaos | amigados) + basic_machine=m68k-cbm + os=-amigaos + ;; + amigaunix | amix) + basic_machine=m68k-cbm + os=-sysv4 + ;; + apollo68) + basic_machine=m68k-apollo + os=-sysv + ;; + aux) + basic_machine=m68k-apple + os=-aux + ;; + balance) + basic_machine=ns32k-sequent + os=-dynix + ;; + convex-c1) + basic_machine=c1-convex + os=-bsd + ;; + convex-c2) + basic_machine=c2-convex + os=-bsd + ;; + convex-c32) + basic_machine=c32-convex + os=-bsd + ;; + convex-c34) + basic_machine=c34-convex + os=-bsd + ;; + convex-c38) + basic_machine=c38-convex + os=-bsd + ;; + cray | ymp) + basic_machine=ymp-cray + os=-unicos + ;; + cray2) + basic_machine=cray2-cray + os=-unicos + ;; + [ctj]90-cray) + basic_machine=c90-cray + os=-unicos + ;; + crds | unos) + basic_machine=m68k-crds + ;; + da30 | da30-*) + basic_machine=m68k-da30 + ;; + decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn) + basic_machine=mips-dec + ;; + delta | 3300 | motorola-3300 | motorola-delta \ + | 3300-motorola | delta-motorola) + basic_machine=m68k-motorola + ;; + delta88) + basic_machine=m88k-motorola + os=-sysv3 + ;; + dpx20 | dpx20-*) + basic_machine=rs6000-bull + os=-bosx + ;; + dpx2* | dpx2*-bull) + basic_machine=m68k-bull + os=-sysv3 + ;; + ebmon29k) + basic_machine=a29k-amd + os=-ebmon + ;; + elxsi) + basic_machine=elxsi-elxsi + os=-bsd + ;; + encore | umax | mmax) + basic_machine=ns32k-encore + ;; + fx2800) + basic_machine=i860-alliant + ;; + genix) + basic_machine=ns32k-ns + ;; + gmicro) + basic_machine=tron-gmicro + os=-sysv + ;; + h3050r* | hiux*) + basic_machine=hppa1.1-hitachi + os=-hiuxwe2 + ;; + h8300hms) + basic_machine=h8300-hitachi + os=-hms + ;; + harris) + basic_machine=m88k-harris + os=-sysv3 + ;; + hp300-*) + basic_machine=m68k-hp + ;; + hp300bsd) + basic_machine=m68k-hp + os=-bsd + ;; + hp300hpux) + basic_machine=m68k-hp + os=-hpux + ;; + hp9k2[0-9][0-9] | hp9k31[0-9]) + basic_machine=m68000-hp + ;; + hp9k3[2-9][0-9]) + basic_machine=m68k-hp + ;; + hp9k7[0-9][0-9] | hp7[0-9][0-9] | hp9k8[0-9]7 | hp8[0-9]7) + basic_machine=hppa1.1-hp + ;; + hp9k8[0-9][0-9] | hp8[0-9][0-9]) + basic_machine=hppa1.0-hp + ;; + hppa-next) + os=-nextstep3 + ;; + i370-ibm* | ibm*) + basic_machine=i370-ibm + os=-mvs + ;; +# I'm not sure what "Sysv32" means. Should this be sysv3.2? + i[34567]86v32) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-sysv32 + ;; + i[34567]86v4*) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-sysv4 + ;; + i[34567]86v) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-sysv + ;; + i[34567]86sol2) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-solaris2 + ;; + iris | iris4d) + basic_machine=mips-sgi + case $os in + -irix*) + ;; + *) + os=-irix4 + ;; + esac + ;; + isi68 | isi) + basic_machine=m68k-isi + os=-sysv + ;; + m88k-omron*) + basic_machine=m88k-omron + ;; + magnum | m3230) + basic_machine=mips-mips + os=-sysv + ;; + merlin) + basic_machine=ns32k-utek + os=-sysv + ;; + miniframe) + basic_machine=m68000-convergent + ;; + mipsel*-linux*) + basic_machine=mipsel-unknown + os=-linux-gnu + ;; + mips*-linux*) + basic_machine=mips-unknown + os=-linux-gnu + ;; + mips3*-*) + basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'` + ;; + mips3*) + basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown + ;; + ncr3000) + basic_machine=i486-ncr + os=-sysv4 + ;; + news | news700 | news800 | news900) + basic_machine=m68k-sony + os=-newsos + ;; + news1000) + basic_machine=m68030-sony + os=-newsos + ;; + news-3600 | risc-news) + basic_machine=mips-sony + os=-newsos + ;; + next | m*-next ) + basic_machine=m68k-next + case $os in + -nextstep* ) + ;; + -ns2*) + os=-nextstep2 + ;; + *) + os=-nextstep3 + ;; + esac + ;; + nh3000) + basic_machine=m68k-harris + os=-cxux + ;; + nh[45]000) + basic_machine=m88k-harris + os=-cxux + ;; + nindy960) + basic_machine=i960-intel + os=-nindy + ;; + np1) + basic_machine=np1-gould + ;; + pa-hitachi) + basic_machine=hppa1.1-hitachi + os=-hiuxwe2 + ;; + paragon) + basic_machine=i860-intel + os=-osf + ;; + pbd) + basic_machine=sparc-tti + ;; + pbb) + basic_machine=m68k-tti + ;; + pc532 | pc532-*) + basic_machine=ns32k-pc532 + ;; + pentium | p5 | k5 | nexen) + basic_machine=i586-pc + ;; + pentiumpro | p6 | k6 | 6x86) + basic_machine=i686-pc + ;; + pentiumii | pentium2) + basic_machine=i786-pc + ;; + pentium-* | p5-* | k5-* | nexen-*) + basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pentiumpro-* | p6-* | k6-* | 6x86-*) + basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pentiumii-* | pentium2-*) + basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pn) + basic_machine=pn-gould + ;; + power) basic_machine=rs6000-ibm + ;; + ppc) basic_machine=powerpc-unknown + ;; + ppc-*) basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + ppcle | powerpclittle | ppc-le | powerpc-little) + basic_machine=powerpcle-unknown + ;; + ppcle-* | powerpclittle-*) + basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + ps2) + basic_machine=i386-ibm + ;; + rm[46]00) + basic_machine=mips-siemens + ;; + rtpc | rtpc-*) + basic_machine=romp-ibm + ;; + sequent) + basic_machine=i386-sequent + ;; + sh) + basic_machine=sh-hitachi + os=-hms + ;; + sps7) + basic_machine=m68k-bull + os=-sysv2 + ;; + spur) + basic_machine=spur-unknown + ;; + sun2) + basic_machine=m68000-sun + ;; + sun2os3) + basic_machine=m68000-sun + os=-sunos3 + ;; + sun2os4) + basic_machine=m68000-sun + os=-sunos4 + ;; + sun3os3) + basic_machine=m68k-sun + os=-sunos3 + ;; + sun3os4) + basic_machine=m68k-sun + os=-sunos4 + ;; + sun4os3) + basic_machine=sparc-sun + os=-sunos3 + ;; + sun4os4) + basic_machine=sparc-sun + os=-sunos4 + ;; + sun4sol2) + basic_machine=sparc-sun + os=-solaris2 + ;; + sun3 | sun3-*) + basic_machine=m68k-sun + ;; + sun4) + basic_machine=sparc-sun + ;; + sun386 | sun386i | roadrunner) + basic_machine=i386-sun + ;; + symmetry) + basic_machine=i386-sequent + os=-dynix + ;; + tx39) + basic_machine=mipstx39-unknown + ;; + tx39el) + basic_machine=mipstx39el-unknown + ;; + tower | tower-32) + basic_machine=m68k-ncr + ;; + udi29k) + basic_machine=a29k-amd + os=-udi + ;; + ultra3) + basic_machine=a29k-nyu + os=-sym1 + ;; + vaxv) + basic_machine=vax-dec + os=-sysv + ;; + vms) + basic_machine=vax-dec + os=-vms + ;; + vpp*|vx|vx-*) + basic_machine=f301-fujitsu + ;; + vxworks960) + basic_machine=i960-wrs + os=-vxworks + ;; + vxworks68) + basic_machine=m68k-wrs + os=-vxworks + ;; + vxworks29k) + basic_machine=a29k-wrs + os=-vxworks + ;; + xmp) + basic_machine=xmp-cray + os=-unicos + ;; + xps | xps100) + basic_machine=xps100-honeywell + ;; + none) + basic_machine=none-none + os=-none + ;; + +# Here we handle the default manufacturer of certain CPU types. It is in +# some cases the only manufacturer, in others, it is the most popular. + mips) + if [ x$os = x-linux-gnu ]; then + basic_machine=mips-unknown + else + basic_machine=mips-mips + fi + ;; + romp) + basic_machine=romp-ibm + ;; + rs6000) + basic_machine=rs6000-ibm + ;; + vax) + basic_machine=vax-dec + ;; + pdp11) + basic_machine=pdp11-dec + ;; + we32k) + basic_machine=we32k-att + ;; + sparc) + basic_machine=sparc-sun + ;; + cydra) + basic_machine=cydra-cydrome + ;; + orion) + basic_machine=orion-highlevel + ;; + orion105) + basic_machine=clipper-highlevel + ;; + *) + echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2 + exit 1 + ;; +esac + +# Here we canonicalize certain aliases for manufacturers. +case $basic_machine in + *-digital*) + basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'` + ;; + *-commodore*) + basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'` + ;; + *) + ;; +esac + +# Decode manufacturer-specific aliases for certain operating systems. + +if [ x"$os" != x"" ] +then +case $os in + # First match some system type aliases + # that might get confused with valid system types. + # -solaris* is a basic system type, with this one exception. + -solaris1 | -solaris1.*) + os=`echo $os | sed -e 's|solaris1|sunos4|'` + ;; + -solaris) + os=-solaris2 + ;; + -svr4*) + os=-sysv4 + ;; + -unixware*) + os=-sysv4.2uw + ;; + -gnu/linux*) + os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'` + ;; + # First accept the basic system types. + # The portable systems comes first. + # Each alternative MUST END IN A *, to match a version number. + # -sysv* is not here because it comes later, after sysvr4. + -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \ + | -*vms* | -sco* | -esix* | -isc* | -aix* | -sunos | -sunos[34]*\ + | -hpux* | -unos* | -osf* | -luna* | -dgux* | -solaris* | -sym* \ + | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \ + | -aos* \ + | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \ + | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \ + | -hiux* | -386bsd* | -netbsd* | -openbsd* | -freebsd* | -riscix* \ + | -lynxos* | -bosx* | -nextstep* | -cxux* | -aout* | -elf* \ + | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \ + | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \ + | -cygwin32* | -pe* | -psos* | -moss* | -proelf* | -rtems* \ + | -mingw32* | -linux-gnu* | -uxpv*) + # Remember, each alternative MUST END IN *, to match a version number. + ;; + -linux*) + os=`echo $os | sed -e 's|linux|linux-gnu|'` + ;; + -sunos5*) + os=`echo $os | sed -e 's|sunos5|solaris2|'` + ;; + -sunos6*) + os=`echo $os | sed -e 's|sunos6|solaris3|'` + ;; + -osfrose*) + os=-osfrose + ;; + -osf*) + os=-osf + ;; + -utek*) + os=-bsd + ;; + -dynix*) + os=-bsd + ;; + -acis*) + os=-aos + ;; + -ctix* | -uts*) + os=-sysv + ;; + -ns2 ) + os=-nextstep2 + ;; + # Preserve the version number of sinix5. + -sinix5.*) + os=`echo $os | sed -e 's|sinix|sysv|'` + ;; + -sinix*) + os=-sysv4 + ;; + -triton*) + os=-sysv3 + ;; + -oss*) + os=-sysv3 + ;; + -svr4) + os=-sysv4 + ;; + -svr3) + os=-sysv3 + ;; + -sysvr4) + os=-sysv4 + ;; + # This must come after -sysvr4. + -sysv*) + ;; + -xenix) + os=-xenix + ;; + -none) + ;; + *) + # Get rid of the `-' at the beginning of $os. + os=`echo $os | sed 's/[^-]*-//'` + echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2 + exit 1 + ;; +esac +else + +# Here we handle the default operating systems that come with various machines. +# The value should be what the vendor currently ships out the door with their +# machine or put another way, the most popular os provided with the machine. + +# Note that if you're going to try to match "-MANUFACTURER" here (say, +# "-sun"), then you have to tell the case statement up towards the top +# that MANUFACTURER isn't an operating system. Otherwise, code above +# will signal an error saying that MANUFACTURER isn't an operating +# system, and we'll never get to this point. + +case $basic_machine in + *-acorn) + os=-riscix1.2 + ;; + arm*-semi) + os=-aout + ;; + pdp11-*) + os=-none + ;; + *-dec | vax-*) + os=-ultrix4.2 + ;; + m68*-apollo) + os=-domain + ;; + i386-sun) + os=-sunos4.0.2 + ;; + m68000-sun) + os=-sunos3 + # This also exists in the configure program, but was not the + # default. + # os=-sunos4 + ;; + *-tti) # must be before sparc entry or we get the wrong os. + os=-sysv3 + ;; + sparc-* | *-sun) + os=-sunos4.1.1 + ;; + *-ibm) + os=-aix + ;; + *-hp) + os=-hpux + ;; + *-hitachi) + os=-hiux + ;; + i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent) + os=-sysv + ;; + *-cbm) + os=-amigaos + ;; + *-dg) + os=-dgux + ;; + *-dolphin) + os=-sysv3 + ;; + m68k-ccur) + os=-rtu + ;; + m88k-omron*) + os=-luna + ;; + *-next ) + os=-nextstep + ;; + *-sequent) + os=-ptx + ;; + *-crds) + os=-unos + ;; + *-ns) + os=-genix + ;; + i370-*) + os=-mvs + ;; + *-next) + os=-nextstep3 + ;; + *-gould) + os=-sysv + ;; + *-highlevel) + os=-bsd + ;; + *-encore) + os=-bsd + ;; + *-sgi) + os=-irix + ;; + *-siemens) + os=-sysv4 + ;; + *-masscomp) + os=-rtu + ;; + f301-fujitsu) + os=-uxpv + ;; + *) + os=-none + ;; +esac +fi + +# Here we handle the case where we know the os, and the CPU type, but not the +# manufacturer. We pick the logical manufacturer. +vendor=unknown +case $basic_machine in + *-unknown) + case $os in + -riscix*) + vendor=acorn + ;; + -sunos*) + vendor=sun + ;; + -aix*) + vendor=ibm + ;; + -hpux*) + vendor=hp + ;; + -hiux*) + vendor=hitachi + ;; + -unos*) + vendor=crds + ;; + -dgux*) + vendor=dg + ;; + -luna*) + vendor=omron + ;; + -genix*) + vendor=ns + ;; + -mvs*) + vendor=ibm + ;; + -ptx*) + vendor=sequent + ;; + -vxsim* | -vxworks*) + vendor=wrs + ;; + -aux*) + vendor=apple + ;; + esac + basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"` + ;; +esac + +echo $basic_machine$os diff --git a/configure.in b/configure.in index 3ea6e2fa..271c1a14 100644 --- a/configure.in +++ b/configure.in @@ -1,17 +1,18 @@ dnl Process this file with autoconf to produce a configure script. +AC_INIT(src/control/control.c) +AM_INIT_AUTOMAKE(alsa-lib, 0.1.2) -AC_INIT(Makefile.conf.in) AC_PREFIX_DEFAULT(/usr) dnl Checks for programs. AC_PROG_CC -AC_PROG_RANLIB AC_PROG_INSTALL AC_PROG_LN_S +AM_PROG_LIBTOOL dnl Checks for header files. AC_HEADER_STDC -AC_CONFIG_HEADER(include/config.h) +AM_CONFIG_HEADER(include/config.h) AC_CHECK_HEADERS(linux/asound.h) dnl Checks for typedefs, structures, and compiler characteristics. @@ -23,41 +24,9 @@ AC_HEADER_TIME dnl Checks for library functions. AC_PROG_GCC_TRADITIONAL -dnl Check for ALSA driver package. -myprefix=$prefix -if test "$myprefix" = "NONE"; then - myprefix=$ac_default_prefix -fi -CFLAGS="-I$myprefix/include" -#echo "CFLAGS=$CFLAGS" -AC_MSG_CHECKING(for alsa-driver package) -AC_TRY_RUN([ -#include <linux/asound.h> -void main(void) -{ -#if !defined( SND_PROTOCOL_VERSION ) || !defined( SND_PROTOCOL_UNCOMPATIBLE ) - exit(1); -#else - exit(0); -#endif -} -], - AC_MSG_RESULT("present"), - AC_MSG_RESULT("not found"); echo "Fatal error: Install alsa-driver v0.2.0pre6+ package at first..."; exit 1;, - AC_MSG_RESULT("not supported"); echo "Fatal error: Cross-compiling isn't supported..."; exit 1;, -) +AM_PATH_ALSA -dnl Check for version... -AC_MSG_CHECKING(for library version) -SND_LIB_VERSION=`cat $srcdir/version` -AC_DEFINE_UNQUOTED(SND_LIB_VERSION, "$SND_LIB_VERSION") -AC_SUBST(SND_LIB_VERSION) -SND_LIB_MAJOR=`echo $SND_LIB_VERSION | cut -d . -f 1` -AC_SUBST(SND_LIB_MAJOR) -SND_LIB_MINOR=`echo $SND_LIB_VERSION | cut -d . -f 2` -AC_SUBST(SND_LIB_MINOR) -SND_LIB_SUBMINOR=`echo $SND_LIB_VERSION | cut -d . -f 3` -AC_SUBST(SND_LIB_SUBMINOR) -AC_MSG_RESULT($SND_LIB_VERSION) - -AC_OUTPUT(Makefile.conf include/version.h utils/alsa-lib.spec) +AC_OUTPUT(Makefile doc/Makefile include/Makefile src/Makefile \ + src/control/Makefile src/mixer/Makefile src/pcm/Makefile \ + src/rawmidi/Makefile test/Makefile utils/Makefile include/version.h \ + utils/alsa-lib.spec) diff --git a/doc/Makefile b/doc/Makefile deleted file mode 100644 index 708995bf..00000000 --- a/doc/Makefile +++ /dev/null @@ -1,20 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz> -# - -include ../Makefile.conf - -TARGETS=soundapi.txt \ - soundapi.html - -all: $(TARGETS) - -soundapi.txt: soundapi.sgml - sgml2txt soundapi.sgml - -soundapi.html: soundapi.sgml - sgml2html soundapi.sgml - -clean: - rm -f core .depend *.orig *~ diff --git a/doc/Makefile.am b/doc/Makefile.am new file mode 100644 index 00000000..aa8e4466 --- /dev/null +++ b/doc/Makefile.am @@ -0,0 +1,3 @@ + + +INCLUDES=-I$(top_srcdir)/include diff --git a/doc/Makefile.in b/doc/Makefile.in new file mode 100644 index 00000000..a9ef7226 --- /dev/null +++ b/doc/Makefile.in @@ -0,0 +1,159 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../include/config.h +CONFIG_CLEAN_FILES = +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +all: Makefile + +.SUFFIXES: +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps doc/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + +tags: TAGS +TAGS: + + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = doc + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-generic + +clean: clean-generic mostlyclean + +distclean: distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-generic distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: tags distdir info dvi installcheck install-exec install-data \ +install uninstall all installdirs mostlyclean-generic distclean-generic \ +clean-generic maintainer-clean-generic clean mostlyclean distclean \ +maintainer-clean + + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/include/Makefile.am b/include/Makefile.am new file mode 100644 index 00000000..501365f6 --- /dev/null +++ b/include/Makefile.am @@ -0,0 +1,15 @@ +sysincludedir = ${includedir}/sys +sysinclude_HEADERS = asoundlib.h + +# This is the order they will be concatenated into asoundlib.h! +# +header_files=header.h version.h error.h control.h mixer.h pcm.h rawmidi.h \ + footer.h + +noinst_HEADERS=$(header_files) + +$(srcdir)/asoundlib.h: $(header_files) + cat $^ > $@ + + +INCLUDES=-I$(top_srcdir)/include diff --git a/include/Makefile.in b/include/Makefile.in new file mode 100644 index 00000000..f4000a4e --- /dev/null +++ b/include/Makefile.in @@ -0,0 +1,240 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +sysincludedir = ${includedir}/sys +sysinclude_HEADERS = asoundlib.h + +# This is the order they will be concatenated into asoundlib.h! +# +header_files=header.h version.h error.h control.h mixer.h pcm.h rawmidi.h \ + footer.h + +noinst_HEADERS=$(header_files) + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = config.h +CONFIG_CLEAN_FILES = version.h +HEADERS = $(noinst_HEADERS) $(sysinclude_HEADERS) + +DIST_COMMON = Makefile.am Makefile.in config.h.in stamp-h.in \ +version.h.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +all: Makefile $(HEADERS) config.h + +.SUFFIXES: +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps include/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +config.h: stamp-h + @: +stamp-h: $(srcdir)/config.h.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES= CONFIG_HEADERS=include/config.h \ + $(SHELL) ./config.status + @echo timestamp > stamp-h +$(srcdir)/config.h.in: $(srcdir)/stamp-h.in +$(srcdir)/stamp-h.in: $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOHEADER) + @echo timestamp > $(srcdir)/stamp-h.in + +mostlyclean-hdr: + +clean-hdr: + +distclean-hdr: + -rm -f config.h + +maintainer-clean-hdr: +version.h: $(top_builddir)/config.status version.h.in + cd $(top_builddir) && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + +install-sysincludeHEADERS: $(sysinclude_HEADERS) + @$(NORMAL_INSTALL) + $(mkinstalldirs) $(DESTDIR)$(sysincludedir) + @list='$(sysinclude_HEADERS)'; for p in $$list; do \ + if test -f "$$p"; then d= ; else d="$(srcdir)/"; fi; \ + echo " $(INSTALL_DATA) $$d$$p $(DESTDIR)$(sysincludedir)/$$p"; \ + $(INSTALL_DATA) $$d$$p $(DESTDIR)$(sysincludedir)/$$p; \ + done + +uninstall-sysincludeHEADERS: + @$(NORMAL_UNINSTALL) + list='$(sysinclude_HEADERS)'; for p in $$list; do \ + rm -f $(DESTDIR)$(sysincludedir)/$$p; \ + done + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)config.h.in$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags config.h.in $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = include + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: install-sysincludeHEADERS + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: uninstall-sysincludeHEADERS + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + $(mkinstalldirs) $(DESTDIR)$(sysincludedir) + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-hdr mostlyclean-tags mostlyclean-generic + +clean: clean-hdr clean-tags clean-generic mostlyclean + +distclean: distclean-hdr distclean-tags distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-hdr maintainer-clean-tags \ + maintainer-clean-generic distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-hdr distclean-hdr clean-hdr maintainer-clean-hdr \ +uninstall-sysincludeHEADERS install-sysincludeHEADERS tags \ +mostlyclean-tags distclean-tags clean-tags maintainer-clean-tags \ +distdir info dvi installcheck install-exec install-data install \ +uninstall all installdirs mostlyclean-generic distclean-generic \ +clean-generic maintainer-clean-generic clean mostlyclean distclean \ +maintainer-clean + + +$(srcdir)/asoundlib.h: $(header_files) + cat $^ > $@ + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/include/config.h.in b/include/config.h.in index b6042e02..3dda2224 100644 --- a/include/config.h.in +++ b/include/config.h.in @@ -1,6 +1,29 @@ -/* - * Configuration header file for compilation of the ALSA driver - */ +/* include/config.h.in. Generated automatically from configure.in by autoheader. */ -#undef SND_LIB_VERSION +/* Define to empty if the keyword does not work. */ +#undef const + +/* Define as __inline if that's what the C compiler calls it. */ +#undef inline + +/* Define if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Define if you can safely include both <sys/time.h> and <time.h>. */ +#undef TIME_WITH_SYS_TIME + +/* Define if your processor stores words with the most significant + byte first (like Motorola and SPARC, unlike Intel and VAX). */ #undef WORDS_BIGENDIAN + +/* Package name */ +#undef PACKAGE + +/* Package version */ +#undef VERSION + +/* Sound library version string */ +#undef SND_LIB_VERSION + +/* Define if you have the <linux/asound.h> header file. */ +#undef HAVE_LINUX_ASOUND_H diff --git a/include/version.h.in b/include/version.h.in index 0a4ac282..19b3a91c 100644 --- a/include/version.h.in +++ b/include/version.h.in @@ -5,5 +5,5 @@ #define SOUNDLIB_VERSION_MAJOR @SND_LIB_MAJOR@ #define SOUNDLIB_VERSION_MINOR @SND_LIB_MINOR@ #define SOUNDLIB_VERSION_SUBMINOR @SND_LIB_SUBMINOR@ -#define SOUNDLIB_VERSION ( ( LIBULTRA_VERSION_MAJOR << 16 ) | ( LIBULTRA_VERSION_MINOR << 8 ) | LIB_ULTRA_VERSION_SUBMINOR ) +#define SOUNDLIB_VERSION ( ( SOUNDLIB_VERSION_MAJOR << 16 ) | ( SOUNDLIB_VERSION_MINOR << 8 ) | SOUNDLIB_VERSION_SUBMINOR ) diff --git a/ltconfig b/ltconfig new file mode 100644 index 00000000..40d40da0 --- /dev/null +++ b/ltconfig @@ -0,0 +1,1563 @@ +#! /bin/sh + +# ltconfig - Create a system-specific libtool. +# Copyright (C) 1996-1998 Free Software Foundation, Inc. +# Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996 +# +# This file is free software; you can redistribute it and/or modify it +# under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# A lot of this script is taken from autoconf-2.10. + +# Check that we are running under the correct shell. +SHELL=${CONFIG_SHELL-/bin/sh} +echo=echo +if test "X$1" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift +elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then + # Yippee, $echo works! + : +else + # Restart under the correct shell. + exec "$SHELL" "$0" --no-reexec ${1+"$@"} +fi + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +if test "${CDPATH+set}" = set; then CDPATH=; export CDPATH; fi + +if test "X`($echo '\t') 2>/dev/null`" != 'X\t'; then + # The Solaris, AIX, and Digital Unix default echo programs unquote + # backslashes. This makes it impossible to quote backslashes using + # echo "$something" | sed 's/\\/\\\\/g' + # + # So, first we look for a working echo in the user's PATH. + IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:" + for dir in $PATH /usr/ucb; do + if test -f $dir/echo && test "X`($dir/echo '\t') 2>/dev/null`" = 'X\t'; then + echo="$dir/echo" + break + fi + done + IFS="$save_ifs" + + if test "X$echo" = Xecho; then + # We didn't find a better echo, so look for alternatives. + if test "X`(print -r '\t') 2>/dev/null`" = 'X\t'; then + # This shell has a builtin print -r that does the trick. + echo='print -r' + elif test -f /bin/ksh && test "X$CONFIG_SHELL" != X/bin/ksh; then + # If we have ksh, try running ltconfig again with it. + CONFIG_SHELL=/bin/ksh + export CONFIG_SHELL + exec "$CONFIG_SHELL" "$0" --no-reexec ${1+"$@"} + else + # Try using printf. + echo='printf %s\n' + if test "X`($echo '\t') 2>/dev/null`" != 'X\t'; then + # Oops. We lost completely, so just stick with echo. + echo=echo + fi + fi + fi +fi + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed='sed -e s/^X//' +sed_quote_subst='s/\([\\"\\`$\\\\]\)/\\\1/g' + +# Same as above, but do not quote variable references. +double_quote_subst='s/\([\\"\\`\\\\]\)/\\\1/g' + +# The name of this program. +progname=`$echo "X$0" | $Xsed -e 's%^.*/%%'` + +# Constants: +PROGRAM=ltconfig +PACKAGE=libtool +VERSION=1.2b +ac_compile='${CC-cc} -c $CFLAGS $CPPFLAGS conftest.c 1>&5' +ac_link='${CC-cc} -o conftest $CFLAGS $CPPFLAGS $LDFLAGS conftest.c $LIBS 1>&5' +rm="rm -f" + +help="Try \`$progname --help' for more information." + +# Global variables: +default_ofile=libtool +can_build_shared=yes +enable_shared=yes +# All known linkers require a `.a' archive for static linking. +enable_static=yes +ltmain= +silent= +srcdir= +ac_config_guess= +ac_config_sub= +host= +nonopt= +ofile="$default_ofile" +verify_host=yes +with_gcc=no +with_gnu_ld=no + +old_AR="$AR" +old_CC="$CC" +old_CFLAGS="$CFLAGS" +old_CPPFLAGS="$CPPFLAGS" +old_LD="$LD" +old_LN_S="$LN_S" +old_NM="$NM" +old_RANLIB="$RANLIB" + +# Parse the command line options. +args= +prev= +for option +do + case "$option" in + -*=*) optarg=`echo "$option" | sed 's/[-_a-zA-Z0-9]*=//'` ;; + *) optarg= ;; + esac + + # If the previous option needs an argument, assign it. + if test -n "$prev"; then + eval "$prev=\$option" + prev= + continue + fi + + case "$option" in + --help) cat <<EOM +Usage: $progname [OPTION]... LTMAIN [HOST] + +Generate a system-specific libtool script. + + --debug enable verbose shell tracing + --disable-shared do not build shared libraries + --disable-static do not build static libraries + --help display this help and exit + --no-verify do not verify that HOST is a valid host type +-o, --output=FILE specify the output file [default=$default_ofile] + --quiet same as \`--silent' + --silent do not print informational messages + --srcdir=DIR find \`config.guess' in DIR + --version output version information and exit + --with-gcc assume that the GNU C compiler will be used + --with-gnu-ld assume that the C compiler uses the GNU linker + +LTMAIN is the \`ltmain.sh' shell script fragment that provides basic libtool +functionality. + +HOST is the canonical host system name [default=guessed]. +EOM + exit 0 + ;; + + --debug) + echo "$progname: enabling shell trace mode" + set -x + ;; + + --disable-shared) enable_shared=no ;; + + --disable-static) enable_static=no ;; + + --quiet | --silent) silent=yes ;; + + --srcdir) prev=srcdir ;; + --srcdir=*) srcdir="$optarg" ;; + + --no-verify) verify_host=no ;; + + --output | -o) prev=ofile ;; + --output=*) ofile="$optarg" ;; + + --version) echo "$PROGRAM (GNU $PACKAGE) $VERSION"; exit 0 ;; + + --with-gcc) with_gcc=yes ;; + --with-gnu-ld) with_gnu_ld=yes ;; + + -*) + echo "$progname: unrecognized option \`$option'" 1>&2 + echo "$help" 1>&2 + exit 1 + ;; + + *) + if test -z "$ltmain"; then + ltmain="$option" + elif test -z "$host"; then +# This generates an unnecessary warning for sparc-sun-solaris4.1.3_U1 +# if test -n "`echo $option| sed 's/[-a-z0-9.]//g'`"; then +# echo "$progname: warning \`$option' is not a valid host type" 1>&2 +# fi + host="$option" + else + echo "$progname: too many arguments" 1>&2 + echo "$help" 1>&2 + exit 1 + fi ;; + esac +done + +if test -z "$ltmain"; then + echo "$progname: you must specify a LTMAIN file" 1>&2 + echo "$help" 1>&2 + exit 1 +fi + +if test ! -f "$ltmain"; then + echo "$progname: \`$ltmain' does not exist" 1>&2 + echo "$help" 1>&2 + exit 1 +fi + +# Quote any args containing shell metacharacters. +ltconfig_args= +for arg +do + case "$arg" in + *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?]*) + ltconfig_args="$ltconfig_args '$arg'" ;; + *) ltconfig_args="$ltconfig_args $arg" ;; + esac +done + +# A relevant subset of AC_INIT. + +# File descriptor usage: +# 0 standard input +# 1 file creation +# 2 errors and warnings +# 3 some systems may open it to /dev/tty +# 4 used on the Kubota Titan +# 5 compiler messages saved in config.log +# 6 checking for... messages and results +if test "$silent" = yes; then + exec 6>/dev/null +else + exec 6>&1 +fi +exec 5>>./config.log + +# NLS nuisances. +# Only set LANG and LC_ALL to C if already set. +# These must not be set unconditionally because not all systems understand +# e.g. LANG=C (notably SCO). +if test "${LC_ALL+set}" = set; then LC_ALL=C; export LC_ALL; fi +if test "${LANG+set}" = set; then LANG=C; export LANG; fi + +if (echo "testing\c"; echo 1,2,3) | grep c >/dev/null; then + # Stardent Vistra SVR4 grep lacks -e, says ghazi@caip.rutgers.edu. + if (echo -n testing; echo 1,2,3) | sed s/-n/xn/ | grep xn >/dev/null; then + ac_n= ac_c=' +' ac_t=' ' + else + ac_n=-n ac_c= ac_t= + fi +else + ac_n= ac_c='\c' ac_t= +fi + +if test -z "$srcdir"; then + # Assume the source directory is the same one as the path to ltmain.sh. + srcdir=`$echo "$ltmain" | $Xsed -e 's%/[^/]*$%%'` + test "$srcdir" = "$ltmain" && srcdir=. +fi + +trap "$rm conftest*; exit 1" 1 2 15 +if test "$verify_host" = yes; then + # Check for config.guess and config.sub. + ac_aux_dir= + for ac_dir in $srcdir $srcdir/.. $srcdir/../..; do + if test -f $ac_dir/config.guess; then + ac_aux_dir=$ac_dir + break + fi + done + if test -z "$ac_aux_dir"; then + echo "$progname: cannot find config.guess in $srcdir $srcdir/.. $srcdir/../.." 1>&2 + echo "$help" 1>&2 + exit 1 + fi + ac_config_guess=$ac_aux_dir/config.guess + ac_config_sub=$ac_aux_dir/config.sub + + # Make sure we can run config.sub. + if $SHELL $ac_config_sub sun4 >/dev/null 2>&1; then : + else + echo "$progname: cannot run $ac_config_sub" 1>&2 + echo "$help" 1>&2 + exit 1 + fi + + echo $ac_n "checking host system type""... $ac_c" 1>&6 + + host_alias=$host + case "$host_alias" in + "") + if host_alias=`$SHELL $ac_config_guess`; then : + else + echo "$progname: cannot guess host type; you must specify one" 1>&2 + echo "$help" 1>&2 + exit 1 + fi ;; + esac + host=`$SHELL $ac_config_sub $host_alias` + echo "$ac_t$host" 1>&6 + + # Make sure the host verified. + test -z "$host" && exit 1 + +elif test -z "$host"; then + echo "$progname: you must specify a host type if you use \`--no-verify'" 1>&2 + echo "$help" 1>&2 + exit 1 +else + host_alias=$host +fi + +# Transform linux* to *-*-linux-gnu*, to support old configure scripts. +case "$host_os" in +linux-gnu*) ;; +linux*) host=`echo $host | sed 's/^\(.*-.*-linux\)\(.*\)$/\1-gnu\2/'` +esac + +host_cpu=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'` +host_vendor=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'` +host_os=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'` + +case "$host_os" in +aix3*) + # AIX sometimes has problems with the GCC collect2 program. For some + # reason, if we set the COLLECT_NAMES environment variable, the problems + # vanish in a puff of smoke. + if test "${COLLECT_NAMES+set}" != set; then + COLLECT_NAMES= + export COLLECT_NAMES + fi + ;; +esac + +# Determine commands to create old-style static archives. +old_archive_cmds='$AR cru $oldlib$oldobjs' +old_postinstall_cmds='chmod 644 $oldlib' +old_postuninstall_cmds= + +# Set a sane default for `AR'. +test -z "$AR" && AR=ar + +# If RANLIB is not set, then run the test. +if test "${RANLIB+set}" != "set"; then + result=no + + echo $ac_n "checking for ranlib... $ac_c" 1>&6 + IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:" + for dir in $PATH; do + test -z "$dir" && dir=. + if test -f $dir/ranlib; then + RANLIB="ranlib" + result="ranlib" + break + fi + done + IFS="$save_ifs" + + echo "$ac_t$result" 1>&6 +fi + +if test -n "$RANLIB"; then + old_archive_cmds="$old_archive_cmds;\$RANLIB \$oldlib" + old_postinstall_cmds="\$RANLIB \$oldlib;$old_postinstall_cmds" +fi + +# Check to see if we are using GCC. +if test "$with_gcc" != yes || test -z "$CC"; then + # If CC is not set, then try to find GCC or a usable CC. + if test -z "$CC"; then + echo $ac_n "checking for gcc... $ac_c" 1>&6 + IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:" + for dir in $PATH; do + IFS="$save_ifs" + test -z "$dir" && dir=. + if test -f $dir/gcc; then + CC="gcc" + break + fi + done + IFS="$save_ifs" + + if test -n "$CC"; then + echo "$ac_t$CC" 1>&6 + else + echo "$ac_t"no 1>&6 + fi + fi + + # Not "gcc", so try "cc", rejecting "/usr/ucb/cc". + if test -z "$CC"; then + echo $ac_n "checking for cc... $ac_c" 1>&6 + IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:" + cc_rejected=no + for dir in $PATH; do + test -z "$dir" && dir=. + if test -f $dir/cc; then + if test "$dir/cc" = "/usr/ucb/cc"; then + cc_rejected=yes + continue + fi + CC="cc" + break + fi + done + IFS="$save_ifs" + if test $cc_rejected = yes; then + # We found a bogon in the path, so make sure we never use it. + set dummy $CC + shift + if test $# -gt 0; then + # We chose a different compiler from the bogus one. + # However, it has the same name, so the bogon will be chosen + # first if we set CC to just the name; use the full file name. + shift + set dummy "$dir/cc" "$@" + shift + CC="$@" + fi + fi + + if test -n "$CC"; then + echo "$ac_t$CC" 1>&6 + else + echo "$ac_t"no 1>&6 + fi + + if test -z "$CC"; then + echo "$progname: error: no acceptable cc found in \$PATH" 1>&2 + exit 1 + fi + fi + + # Now see if the compiler is really GCC. + with_gcc=no + echo $ac_n "checking whether we are using GNU C... $ac_c" 1>&6 + echo "$progname:462: checking whether we are using GNU C" >&5 + + $rm conftest.c + cat > conftest.c <<EOF +#ifdef __GNUC__ + yes; +#endif +EOF + if { ac_try='${CC-cc} -E conftest.c'; { (eval echo $progname:470: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; }; } | egrep yes >/dev/null 2>&1; then + with_gcc=yes + fi + $rm conftest.c + echo "$ac_t$with_gcc" 1>&6 +fi + +# Allow CC to be a program name with arguments. +set dummy $CC +compiler="$2" + +echo $ac_n "checking for $compiler option to produce PIC... $ac_c" 1>&6 +pic_flag= +special_shlib_compile_flags= +wl= +link_static_flag= +no_builtin_flag= + +if test "$with_gcc" = yes; then + wl='-Wl,' + link_static_flag='-static' + no_builtin_flag=' -fno-builtin' + + case "$host_os" in + aix3* | aix4* | irix5* | irix6* | osf3* | osf4*) + # PIC is the default for these OSes. + ;; + os2*) + # We can build DLLs from non-PIC. + ;; + amigaos*) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + pic_flag='-m68020 -resident32 -malways-restore-a4' + ;; + *) + pic_flag='-fPIC' + ;; + esac +else + # PORTME Check for PIC flags for the system compiler. + case "$host_os" in + aix3* | aix4*) + # All AIX code is PIC. + link_static_flag='-bnso -bI:/lib/syscalls.exp' + ;; + + hpux9* | hpux10* | hpux11*) + # Is there a better link_static_flag that works with the bundled CC? + wl='-Wl,' + link_static_flag="${wl}-a ${wl}archive" + pic_flag='+Z' + ;; + + irix5* | irix6*) + wl='-Wl,' + link_static_flag='-non_shared' + # PIC (with -KPIC) is the default. + ;; + + os2*) + # We can build DLLs from non-PIC. + ;; + + osf3* | osf4*) + # All OSF/1 code is PIC. + wl='-Wl,' + link_static_flag='-non_shared' + ;; + + sco3.2v5*) + pic_flag='-Kpic' + link_static_flag='-dn' + special_shlib_compile_flags='-belf' + ;; + + solaris2*) + pic_flag='-KPIC' + link_static_flag='-Bstatic' + wl='-Wl,' + ;; + + sunos4*) + pic_flag='-PIC' + link_static_flag='-Bstatic' + wl='-Qoption ld ' + ;; + + sysv4.2uw2*) + pic_flag='-KPIC' + link_static_flag='-Bstatic' + wl='-Wl,' + ;; + + uts4*) + pic_flag='-pic' + link_static_flag='-Bstatic' + ;; + + *) + can_build_shared=no + ;; + esac +fi + +if test -n "$pic_flag"; then + echo "$ac_t$pic_flag" 1>&6 + + # Check to make sure the pic_flag actually works. + echo $ac_n "checking if $compiler PIC flag $pic_flag works... $ac_c" 1>&6 + $rm conftest* + echo "int some_variable = 0;" > conftest.c + save_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS $pic_flag -DPIC" + echo "$progname:585: checking if $compiler PIC flag $pic_flag works" >&5 + if { (eval echo $progname:586: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>conftest.err; } && test -s conftest.o; then + # Append any warnings to the config.log. + cat conftest.err 1>&5 + + # On HP-UX, both CC and GCC only warn that PIC is supported... then they + # create non-PIC objects. So, if there were any warnings, we assume that + # PIC is not supported. + if test -s conftest.err; then + echo "$ac_t"no 1>&6 + can_build_shared=no + pic_flag= + else + echo "$ac_t"yes 1>&6 + pic_flag=" $pic_flag" + fi + else + # Append any errors to the config.log. + cat conftest.err 1>&5 + can_build_shared=no + pic_flag= + echo "$ac_t"no 1>&6 + fi + CFLAGS="$save_CFLAGS" + $rm conftest* +else + echo "$ac_t"none 1>&6 +fi + +# Check for any special shared library compilation flags. +if test -n "$special_shlib_compile_flags"; then + echo "$progname: warning: \`$CC' requires \`$special_shlib_compile_flags' to build shared libraries" 1>&2 + if echo "$old_CC $old_CFLAGS " | egrep -e "[ ]$special_shlib_compile_flags[ ]" >/dev/null; then : + else + echo "$progname: add \`$special_shlib_compile_flags' to the CC or CFLAGS env variable and reconfigure" 1>&2 + can_build_shared=no + fi +fi + +echo $ac_n "checking if $compiler static flag $link_static_flag works... $ac_c" 1>&6 +$rm conftest* +echo 'main(){return(0);}' > conftest.c +save_LDFLAGS="$LDFLAGS" +LDFLAGS="$LDFLAGS $link_static_flag" +echo "$progname:629: checking if $compiler static flag $link_static_flag works" >&5 +if { (eval echo $progname:630: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest; then + echo "$ac_t$link_static_flag" 1>&6 +else + echo "$ac_t"none 1>&6 + link_static_flag= +fi +LDFLAGS="$save_LDFLAGS" +$rm conftest* + +if test -z "$LN_S"; then + # Check to see if we can use ln -s, or we need hard links. + echo $ac_n "checking whether ln -s works... $ac_c" 1>&6 + $rm conftestdata + if ln -s X conftestdata 2>/dev/null; then + $rm conftestdata + LN_S="ln -s" + else + LN_S=ln + fi + if test "$LN_S" = "ln -s"; then + echo "$ac_t"yes 1>&6 + else + echo "$ac_t"no 1>&6 + fi +fi + +# Make sure LD is an absolute path. +if test -z "$LD"; then + ac_prog=ld + if test "$with_gcc" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + echo $ac_n "checking for ld used by GCC... $ac_c" 1>&6 + echo "$progname:662: checking for ld used by GCC" >&5 + ac_prog=`($CC -print-prog-name=ld) 2>&5` + case "$ac_prog" in + # Accept absolute paths. + /* | [A-Za-z]:[/\\]*) + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we are not using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac + elif test "$with_gnu_ld" = yes; then + echo $ac_n "checking for GNU ld... $ac_c" 1>&6 + echo "$progname:680: checking for GNU ld" >&5 + else + echo $ac_n "checking for non-GNU ld""... $ac_c" 1>&6 + echo "$progname:683: checking for non-GNU ld" >&5 + fi + + if test -z "$LD"; then + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in $PATH; do + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog"; then + LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some GNU ld's only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + if "$LD" -v 2>&1 < /dev/null | egrep '(GNU|with BFD)' > /dev/null; then + test "$with_gnu_ld" != no && break + else + test "$with_gnu_ld" != yes && break + fi + fi + done + IFS="$ac_save_ifs" + fi + + if test -n "$LD"; then + echo "$ac_t$LD" 1>&6 + else + echo "$ac_t"no 1>&6 + fi + + if test -z "$LD"; then + echo "$progname: error: no acceptable ld found in \$PATH" 1>&2 + exit 1 + fi +fi + +# Check to see if it really is or is not GNU ld. +echo $ac_n "checking if the linker ($LD) is GNU ld... $ac_c" 1>&6 +# I'd rather use --version here, but apparently some GNU ld's only accept -v. +if $LD -v 2>&1 </dev/null | egrep '(GNU|with BFD)' 1>&5; then + with_gnu_ld=yes +else + with_gnu_ld=no +fi +echo "$ac_t$with_gnu_ld" 1>&6 + +# See if the linker supports building shared libraries. +echo $ac_n "checking whether the linker ($LD) supports shared libraries... $ac_c" 1>&6 + +allow_undefined_flag= +no_undefined_flag= +archive_cmds= +old_archive_from_new_cmds= +export_dynamic_flag_spec= +whole_archive_flag_spec= +hardcode_libdir_flag_spec= +hardcode_libdir_separator= +hardcode_direct=no +hardcode_minus_L=no +hardcode_shlibpath_var=unsupported +runpath_var= + +ld_shlibs=yes +if test "$with_gnu_ld" = yes; then + + # See if GNU ld supports shared libraries. + case "$host_os" in + amigaos*) + archive_cmds='$rm $objdir/a2ixlibrary.data;$echo "#define NAME $libname" > $objdir/a2ixlibrary.data;$echo "#define LIBRARY_ID 1" >> $objdir/a2ixlibrary.data;$echo "#define VERSION $major" >> $objdir/a2ixlibrary.data;$echo "#define REVISION $revision" >> $objdir/a2ixlibrary.data;$AR cru $lib$libobjs;$RANLIB $lib;(cd $objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + ;; + + linux-gnu*) + if $LD --help 2>&1 | egrep ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared ${wl}-soname $wl$soname -o $lib$libobjs $deplibs' + else + ld_shlibs=no + fi + ;; + + sunos4*) + archive_cmds='$LD -assert pure-text -Bstatic -o $lib$libobjs' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + *) + if $LD --help 2>&1 | egrep ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared ${wl}-soname $wl$soname -o $lib$libobjs' + else + ld_shlibs=no + fi + ;; + esac + + if test "$ld_shlibs" = yes; then + runpath_var=LD_RUN_PATH + hardcode_libdir_flag_spec='${wl}--rpath ${wl}$libdir' + export_dynamic_flag_spec='${wl}--export-dynamic' + whole_archive_flag_spec='${wl}--whole-archive$convenience ${wl}--no-whole-archive' + fi +else + # PORTME fill in a description of your system's linker (not GNU ld) + case "$host_os" in + aix3*) + allow_undefined_flag=unsupported + archive_cmds='$NM$libobjs | $global_symbol_pipe | sed '\''s/.* //'\'' > $lib.exp;$LD -o $objdir/$soname$libobjs -bE:$lib.exp -T512 -H512 -bM:SRE;$AR cru $lib $objdir/$soname' + # Note: this linker hardcodes the directories in LIBPATH if there + # are no directories specified by -L. + hardcode_minus_L=yes + if test "$with_gcc" = yes && test -z "$link_static_flag"; then + # Neither direct hardcoding nor static linking is supported with a + # broken collect2. + hardcode_direct=unsupported + fi + ;; + + aix4*) + allow_undefined_flag=unsupported + archive_cmds='$NM$libobjs | $global_symbol_pipe | sed '\''s/.* //'\'' > $lib.exp;$CC -o $objdir/$soname$libobjs ${wl}-bE:$lib.exp ${wl}-bM:SRE ${wl}-bnoentry;$AR cru $lib $objdir/$soname' + hardcode_direct=yes + hardcode_minus_L=yes + ;; + + amigaos*) + archive_cmds='$rm $objdir/a2ixlibrary.data;$echo "#define NAME $libname" > $objdir/a2ixlibrary.data;$echo "#define LIBRARY_ID 1" >> $objdir/a2ixlibrary.data;$echo "#define VERSION $major" >> $objdir/a2ixlibrary.data;$echo "#define REVISION $revision" >> $objdir/a2ixlibrary.data;$AR cru $lib$libobjs;$RANLIB $lib;(cd $objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + ;; + + # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor + # support. Future versions do this automatically, but an explicit c++rt0.o + # does not break anything, and helps significantly (at the cost of a little + # extra space). + freebsd2.2*) + archive_cmds='$LD -Bshareable -o $lib$libobjs /usr/lib/c++rt0.o' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + # Unfortunately, older versions of FreeBSD 2 do not have this feature. + freebsd2*) + archive_cmds='$LD -Bshareable -o $lib$libobjs' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + # FreeBSD 3, at last, uses gcc -shared to do shared libraries. + freebsd3*) + archive_cmds='$CC -shared -o $lib$libobjs' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_minus_L=no + hardcode_shlibpath_var=no + ;; + + hpux9*) + archive_cmds='$rm $objdir/$soname;$LD -b +s +b $install_libdir -o $objdir/$soname$libobjs;mv $objdir/$soname $lib' + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + export_dynamic_flag_spec='${wl}-E' + ;; + + hpux10* | hpux11*) + archive_cmds='$LD -b +h $soname +s +b $install_libdir -o $lib$libobjs' + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + export_dynamic_flag_spec='${wl}-E' + ;; + + irix5* | irix6*) + if test "$with_gcc" = yes; then + archive_cmds='$CC -shared -o $lib ${wl}-soname ${wl}$soname ${wl}-set_version ${wl}$verstring$libobjs' + else + archive_cmds='$LD -shared -o $lib -soname $soname -set_version $verstring$libobjs' + fi + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + ;; + + netbsd*) + # Tested with NetBSD 1.2 ld + archive_cmds='$LD -Bshareable -o $lib$libobjs' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + openbsd*) + archive_cmds='$LD -Bshareable -o $lib$libobjs' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + os2*) + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + allow_undefined_flag=unsupported + archive_cmds='$echo "LIBRARY $libname INITINSTANCE" > $objdir/$libname.def;$echo "DESCRIPTION \"$libname\"" >> $objdir/$libname.def;$echo DATA >> $objdir/$libname.def;$echo " SINGLE NONSHARED" >> $objdir/$libname.def;$echo EXPORTS >> $objdir/$libname.def;emxexp$libobjs >> $objdir/$libname.def;$CC -Zdll -Zcrtdll -o $lib$libobjs $objdir/$libname.def' + old_archive_from_new_cmds='emximp -o $objdir/$libname.a $objdir/$libname.def' + ;; + + osf3* | osf4*) + allow_undefined_flag=' -expect_unresolved \*' + archive_cmds='$LD -shared${allow_undefined_flag} -o $lib -soname $soname -set_version $verstring$libobjs$deplibs' + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator=: + ;; + + sco3.2v5*) + archive_cmds='$LD -G -o $lib$libobjs' + hardcode_direct=yes + ;; + + solaris2*) + no_undefined_flag=' -z text' + archive_cmds='$LD -G${allow_undefined_flag} -h $soname -o $lib$libobjs' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_shlibpath_var=no + + # Solaris 2 before 2.5 hardcodes -L paths. + case "$host_os" in + solaris2.[0-4]*) + hardcode_minus_L=yes + ;; + esac + ;; + + sunos4*) + archive_cmds='$LD -assert pure-text -Bstatic -o $lib$libobjs' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + uts4*) + archive_cmds='$LD -G -h $soname -o $lib$libobjs' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_direct=no + hardcode_minus_L=no + hardcode_shlibpath_var=no + ;; + + *) + ld_shlibs=no + can_build_shared=no + ;; + esac +fi +echo "$ac_t$ld_shlibs" 1>&6 + +if test -z "$NM"; then + echo $ac_n "checking for BSD-compatible nm... $ac_c" 1>&6 + case "$NM" in + /* | [A-Za-z]:[/\\]*) ;; # Let the user override the test with a path. + *) + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in /usr/ucb /usr/ccs/bin $PATH /bin; do + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/nm; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the `sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + if ($ac_dir/nm -B /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then + NM="$ac_dir/nm -B" + elif ($ac_dir/nm -p /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then + NM="$ac_dir/nm -p" + else + NM="$ac_dir/nm" + fi + break + fi + done + IFS="$ac_save_ifs" + test -z "$NM" && NM=nm + ;; + esac + echo "$ac_t$NM" 1>&6 +fi + +# Check for command to grab the raw symbol name followed by C symbol from nm. +echo $ac_n "checking command to parse $NM output... $ac_c" 1>&6 + +# These are sane defaults that work on at least a few old systems. +# [They come from Ultrix. What could be older than Ultrix?!! ;)] + +# Character class describing NM global symbol codes. +symcode='[BCDEGRSTU]' + +# Regexp to match symbols that can be accessed directly from C. +sympat='\([_A-Za-z][_A-Za-z0-9]*\)' + +# Transform the above into a raw symbol and a C symbol. +symxfrm='\1 \1' + +# Define system-specific variables. +case "$host_os" in +aix*) + symcode='[BCDTU]' + ;; +irix*) + # Cannot use undefined symbols on IRIX because inlined functions mess us up. + symcode='[BCDEGRST]' + ;; +solaris2*) + symcode='[BDTU]' + ;; +esac + +# If we're using GNU nm, then use its standard symbol codes. +if $NM -V 2>&1 | egrep '(GNU|with BFD)' > /dev/null; then + symcode='[ABCDGISTUW]' +fi + +# Write the raw and C identifiers. +global_symbol_pipe="sed -n -e 's/^.* $symcode $sympat$/$symxfrm/p'" + +# Check to see that the pipe works correctly. +pipe_works=no +$rm conftest* +cat > conftest.c <<EOF +#ifdef __cplusplus +extern "C" { +#endif +char nm_test_var; +void nm_test_func(){} +#ifdef __cplusplus +} +#endif +main(){nm_test_var='a';nm_test_func();return(0);} +EOF + +echo "$progname:1021: checking if global_symbol_pipe works" >&5 +if { (eval echo $progname:1022: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; } && test -s conftest.o; then + # Now try to grab the symbols. + nlist=conftest.nm + if { echo "$progname:1025: eval \"$NM conftest.o | $global_symbol_pipe > $nlist\"" >&5; eval "$NM conftest.o | $global_symbol_pipe > $nlist 2>&5"; } && test -s "$nlist"; then + + # Try sorting and uniquifying the output. + if sort "$nlist" | uniq > "$nlist"T; then + mv -f "$nlist"T "$nlist" + wcout=`wc "$nlist" 2>/dev/null` + count=`$echo "X$wcout" | $Xsed -e 's/^[ ]*\([0-9][0-9]*\).*$/\1/'` + (test "$count" -ge 0) 2>/dev/null || count=-1 + else + rm -f "$nlist"T + count=-1 + fi + + # Make sure that we snagged all the symbols we need. + if egrep ' nm_test_var$' "$nlist" >/dev/null; then + if egrep ' nm_test_func$' "$nlist" >/dev/null; then + cat <<EOF > conftest.c +#ifdef __cplusplus +extern "C" { +#endif + +EOF + # Now generate the symbol file. + sed 's/^.* \(.*\)$/extern char \1;/' < "$nlist" >> conftest.c + + cat <<EOF >> conftest.c +#if defined (__STDC__) && __STDC__ +# define __ptr_t void * +#else +# define __ptr_t char * +#endif + +/* The number of symbols in dld_preloaded_symbols, -1 if unsorted. */ +int dld_preloaded_symbol_count = $count; + +/* The mapping between symbol names and symbols. */ +struct { + char *name; + __ptr_t address; +} +dld_preloaded_symbols[] = +{ +EOF + sed 's/^\(.*\) \(.*\)$/ {"\1", (__ptr_t) \&\2},/' < "$nlist" >> conftest.c + cat <<\EOF >> conftest.c + {0, (__ptr_t) 0} +}; + +#ifdef __cplusplus +} +#endif +EOF + # Now try linking the two files. + mv conftest.o conftestm.o + save_LIBS="$LIBS" + save_CFLAGS="$CFLAGS" + LIBS='conftestm.o' + CFLAGS="$CFLAGS$no_builtin_flag" + if { (eval echo $progname:1083: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest; then + pipe_works=yes + else + echo "$progname: failed program was:" >&5 + cat conftest.c >&5 + fi + LIBS="$save_LIBS" + else + echo "cannot find nm_test_func in $nlist" >&5 + fi + else + echo "cannot find nm_test_var in $nlist" >&5 + fi + else + echo "cannot run $global_symbol_pipe" >&5 + fi +else + echo "$progname: failed program was:" >&5 + cat conftest.c >&5 +fi +$rm conftest* + +# Do not use the global_symbol_pipe unless it works. +echo "$ac_t$pipe_works" 1>&6 +test "$pipe_works" = yes || global_symbol_pipe= + +# Check hardcoding attributes. +echo $ac_n "checking how to hardcode library paths into programs... $ac_c" 1>&6 +hardcode_action= +if test -n "$hardcode_libdir_flag_spec" || \ + test -n "$runpath_var"; then + + # We can hardcode non-existant directories. + if test "$hardcode_direct" != no && \ + test "$hardcode_minus_L" != no && \ + test "$hardcode_shlibpath_var" != no; then + + # Linking always hardcodes the temporary library directory. + hardcode_action=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + hardcode_action=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + hardcode_action=unsupported +fi +echo "$ac_t$hardcode_action" 1>&6 + + +reload_flag= +reload_cmds='$LD$reload_flag -o $output$reload_objs' +echo $ac_n "checking for $LD option to reload object files... $ac_c" 1>&6 +# PORTME Some linkers may need a different reload flag. +reload_flag='-r' +echo "$ac_t$reload_flag" 1>&6 +test -n "$reload_flag" && reload_flag=" $reload_flag" + +# PORTME Fill in your ld.so characteristics +library_names_spec= +libname_spec='lib$name' +soname_spec= +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +version_type=none +dynamic_linker="$host_os ld.so" + +echo $ac_n "checking dynamic linker characteristics... $ac_c" 1>&6 +case "$host_os" in +aix3* | aix4*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX has no versioning support, so we append a major version to the name. + soname_spec='${libname}${release}.so$major' + ;; + +amigaos*) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "(cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a)"; (cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a) || exit 1; done' + ;; + +freebsd2* | freebsd3*) + version_type=sunos + library_names_spec='${libname}${release}.so$versuffix $libname.so' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + ;; + +gnu*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}.so' + shlibpath_var=LD_LIBRARY_PATH + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + dynamic_linker="$host_os dld.sl" + version_type=sunos + shlibpath_var=SHLIB_PATH + library_names_spec='${libname}${release}.sl$versuffix ${libname}${release}.sl$major $libname.sl' + soname_spec='${libname}${release}.sl$major' + # HP-UX runs *really* slowly unless shared libraries are mode 555. + postinstall_cmds='chmod 555 $lib' + ;; + +irix5* | irix6*) + version_type=osf + soname_spec='${libname}${release}.so' + library_names_spec='${libname}${release}.so$versuffix $libname.so' + shlibpath_var=LD_LIBRARY_PATH + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux-gnuoldld* | linux-gnuaout* | linux-gnucoff*) + dynamic_linker=no + ;; + +# This must be Linux ELF. +linux-gnu*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + soname_spec='${libname}${release}.so$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + + if test -f /lib/ld.so.1; then + dynamic_linker='GNU ld.so' + else + # Only the GNU ld.so supports shared libraries on MkLinux. + case "$host_cpu" in + powerpc*) dynamic_linker=no ;; + *) dynamic_linker='Linux ld.so' ;; + esac + fi + ;; + +netbsd* | openbsd*) + version_type=sunos + library_names_spec='${libname}${release}.so$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + ;; + +os2*) + libname_spec='$name' + library_names_spec='$libname.dll $libname.a' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=LIBPATH + ;; + +osf3* | osf4*) + version_type=osf + soname_spec='${libname}${release}.so' + library_names_spec='${libname}${release}.so$versuffix $libname.so' + shlibpath_var=LD_LIBRARY_PATH + ;; + +sco3.2v5*) + version_type=osf + soname_spec='${libname}${release}.so$major' + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + shlibpath_var=LD_LIBRARY_PATH + ;; + +solaris2*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + soname_spec='${libname}${release}.so$major' + shlibpath_var=LD_LIBRARY_PATH + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='${libname}${release}.so$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + ;; + +sysv4.2uw2*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + soname_spec='${libname}${release}.so$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +uts4*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + soname_spec='${libname}${release}.so$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +echo "$ac_t$dynamic_linker" +test "$dynamic_linker" = no && can_build_shared=no + +# Report the final consequences. +echo "checking if libtool supports shared libraries... $can_build_shared" 1>&6 + +echo $ac_n "checking whether to build shared libraries... $ac_c" 1>&6 +test "$can_build_shared" = "no" && enable_shared=no + +# On AIX, shared libraries and static libraries use the same namespace, and +# are all built from PIC. +case "$host_os" in +aix*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds;\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; +esac + +echo "$ac_t$enable_shared" 1>&6 + +# Make sure either enable_shared or enable_static is yes. +test "$enable_shared" = yes || enable_static=yes + +echo "checking whether to build static libraries... $enable_static" 1>&6 + +echo $ac_n "checking for objdir... $ac_c" 1>&6 +rm -f .libs 2>/dev/null +mkdir .libs 2>/dev/null +if test -d .libs; then + objdir=.libs +else + # MS-DOS does not allow filenames that begin with a dot. + objdir=_libs +fi +rmdir .libs 2>/dev/null +echo "$ac_t$objdir" 1>&6 + +# Copy echo and quote the copy, instead of the original, because it is +# used later. +ltecho="$echo" + +# Now quote all the things that may contain metacharacters. +for var in ltecho old_CC old_CFLAGS old_CPPFLAGS old_LD old_NM old_RANLIB \ + old_LN_S AR CC LD LN_S NM reload_flag reload_cmds wl pic_flag \ + link_static_flag no_builtin_flag export_dynamic_flag_spec \ + whole_archive_flag_spec libname_spec library_names_spec soname_spec RANLIB \ + old_archive_cmds old_archive_from_new_cmds old_postinstall_cmds \ + old_postuninstall_cmds archive_cmds postinstall_cmds postuninstall_cmds \ + allow_undefined_flag no_undefined_flag \ + finish_cmds finish_eval global_symbol_pipe \ + hardcode_libdir_flag_spec hardcode_libdir_separator; do + + case "$var" in + reload_cmds | old_archive_cmds | old_archive_from_new_cmds | \ + old_postinstall_cmds | old_postuninstall_cmds | archive_cmds | \ + postinstall_cmds | postuninstall_cmds | finish_cmds) + # Double-quote double-evaled strings. + eval "$var=\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\"\`" + ;; + *) + eval "$var=\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`" + ;; + esac +done + +trap "$rm \"$ofile\"; exit 1" 1 2 15 +echo "creating $ofile" +$rm "$ofile" +cat <<EOF > "$ofile" +#! $SHELL + +# `$echo "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services. +# Generated automatically by $PROGRAM - GNU $PACKAGE $VERSION +# NOTE: Changes made to this file will be lost: look at ltconfig or ltmain.sh. +# +# Copyright (C) 1996-1998 Free Software Foundation, Inc. +# Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Sed that helps us avoid accidentally triggering echo(1) options like -n. +Xsed="sed -e s/^X//" + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +if test "\${CDPATH+set}" = set; then CDPATH=; export CDPATH; fi + +### BEGIN LIBTOOL CONFIG +# Libtool was configured as follows, on host `(hostname || uname -n) 2>/dev/null | sed 1q`: +# +# CC="$old_CC" CFLAGS="$old_CFLAGS" CPPFLAGS="$old_CPPFLAGS" \\ +# LD="$old_LD" NM="$old_NM" RANLIB="$old_RANLIB" LN_S="$old_LN_S" \\ +# $0$ltconfig_args +# +# Compiler and other test output produced by $progname, useful for +# debugging $progname, is in ./config.log if it exists. + +# The version of $progname that generated this script. +LTCONFIG_VERSION="$VERSION" + +# Shell to use when invoking shell scripts. +SHELL="$SHELL" + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# The host system. +host_alias="$host_alias" +host="$host" + +# An echo program that does not interpret backslashes. +echo="$ltecho" + +# The archiver. +AR="$AR" + +# The default C compiler. +CC="$CC" + +# The linker used to build libraries. +LD="$LD" + +# Whether we need hard or soft links. +LN_S="$LN_S" + +# A BSD-compatible nm program. +NM="$NM" + +# The name of the directory that contains temporary libtool files. +objdir="$objdir" + +# How to create reloadable object files. +reload_flag="$reload_flag" +reload_cmds="$reload_cmds" + +# How to pass a linker flag through the compiler. +wl="$wl" + +# Additional compiler flags for building library objects. +pic_flag="$pic_flag" + +# Compiler flag to prevent dynamic linking. +link_static_flag="$link_static_flag" + +# Compiler flag to turn off builtin functions. +no_builtin_flag="$no_builtin_flag" + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec="$export_dynamic_flag_spec" + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec="$whole_archive_flag_spec" + +# Library versioning type. +version_type=$version_type + +# Format of library name prefix. +libname_spec="$libname_spec" + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME. +library_names_spec="$library_names_spec" + +# The coded name of the library, if different from the real name. +soname_spec="$soname_spec" + +# Commands used to build and install an old-style archive. +RANLIB="$RANLIB" +old_archive_cmds="$old_archive_cmds" +old_postinstall_cmds="$old_postinstall_cmds" +old_postuninstall_cmds="$old_postuninstall_cmds" + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds="$old_archive_from_new_cmds" + +# Commands used to build and install a shared archive. +archive_cmds="$archive_cmds" +postinstall_cmds="$postinstall_cmds" +postuninstall_cmds="$postuninstall_cmds" + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag="$allow_undefined_flag" + +# Flag that forces no undefined symbols. +no_undefined_flag="$no_undefined_flag" + +# Commands used to finish a libtool library installation in a directory. +finish_cmds="$finish_cmds" + +# Same as above, but a single script fragment to be evaled but not shown. +finish_eval="$finish_eval" + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe="$global_symbol_pipe" + +# This is the shared library runtime path variable. +runpath_var=$runpath_var + +# This is the shared library path variable. +shlibpath_var=$shlibpath_var + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist. +hardcode_libdir_flag_spec="$hardcode_libdir_flag_spec" + +# Whether we need a single -rpath flag with a separated argument. +hardcode_libdir_separator="$hardcode_libdir_separator" + +# Set to yes if using DIR/libNAME.so during linking hardcodes DIR into the +# resulting binary. +hardcode_direct=$hardcode_direct + +# Set to yes if using the -LDIR flag during linking hardcodes DIR into the +# resulting binary. +hardcode_minus_L=$hardcode_minus_L + +# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into +# the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var +EOF + +case "$host_os" in +aix3*) + cat <<\EOF >> "$ofile" + +# AIX sometimes has problems with the GCC collect2 program. For some +# reason, if we set the COLLECT_NAMES environment variable, the problems +# vanish in a puff of smoke. +if test "${COLLECT_NAMES+set}" != set; then + COLLECT_NAMES= + export COLLECT_NAMES +fi +EOF + ;; +esac + +echo '### END LIBTOOL CONFIG' >> "$ofile" +echo >> "$ofile" + +# Append the ltmain.sh script. +cat "$ltmain" >> "$ofile" || (rm -f "$ofile"; exit 1) + +chmod +x "$ofile" +exit 0 + +# Local Variables: +# mode:shell-script +# sh-indentation:2 +# End: diff --git a/ltmain.sh b/ltmain.sh new file mode 100644 index 00000000..cb817471 --- /dev/null +++ b/ltmain.sh @@ -0,0 +1,2608 @@ +# ltmain.sh - Provide generalized library-building support services. +# NOTE: Changing this file will not affect anything until you rerun ltconfig. +# +# Copyright (C) 1996-1998 Free Software Foundation, Inc. +# Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Check that we have a working $echo. +if test "X$1" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift +elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then + # Yippee, $echo works! + : +else + # Restart under the correct shell, and then maybe $echo will work. + exec $SHELL "$0" --no-reexec ${1+"$@"} +fi + +# The name of this program. +progname=`$echo "$0" | sed 's%^.*/%%'` +modename="$progname" + +# Constants. +PROGRAM=ltmain.sh +PACKAGE=libtool +VERSION=1.2b + +default_mode= +help="Try \`$progname --help' for more information." +magic="%%%MAGIC variable%%%" +mkdir="mkdir" +mv="mv -f" +rm="rm -f" + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed='sed -e s/^X//' +sed_quote_subst='s/\([\\`\\"$\\\\]\)/\\\1/g' + +# NLS nuisances. +# Only set LANG and LC_ALL to C if already set. +# These must not be set unconditionally because not all systems understand +# e.g. LANG=C (notably SCO). +# We save the old values to restore during execute mode. +if test "${LC_ALL+set}" = set; then + save_LC_ALL="$LC_ALL"; LC_ALL=C; export LC_ALL +fi +if test "${LANG+set}" = set; then + save_LANG="$LANG"; LANG=C; export LANG +fi + +if test "$LTCONFIG_VERSION" != "$VERSION"; then + echo "$modename: ltconfig version \`$LTCONFIG_VERSION' does not match $PROGRAM version \`$VERSION'" 1>&2 + echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2 + exit 1 +fi + +if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then + echo "$modename: not configured to build any kind of library" 1>&2 + echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2 + exit 1 +fi + +# Global variables. +mode=$default_mode +nonopt= +prev= +prevopt= +run= +show="$echo" +show_help= +execute_dlfiles= + +# Parse our command line options once, thoroughly. +while test $# -gt 0 +do + arg="$1" + shift + + case "$arg" in + -*=*) optarg=`$echo "X$arg" | $Xsed -e 's/[-_a-zA-Z0-9]*=//'` ;; + *) optarg= ;; + esac + + # If the previous option needs an argument, assign it. + if test -n "$prev"; then + case "$prev" in + execute_dlfiles) + eval "$prev=\"\$$prev \$arg\"" + ;; + *) + eval "$prev=\$arg" + ;; + esac + + prev= + prevopt= + continue + fi + + # Have we seen a non-optional argument yet? + case "$arg" in + --help) + show_help=yes + ;; + + --version) + echo "$PROGRAM (GNU $PACKAGE) $VERSION" + exit 0 + ;; + + --config) + sed -e '1,/^### BEGIN LIBTOOL CONFIG/d' -e '/^### END LIBTOOL CONFIG/,$d' $0 + exit 0 + ;; + + --debug) + echo "$progname: enabling shell trace mode" + set -x + ;; + + --dry-run | -n) + run=: + ;; + + --features) + echo "host: $host" + if test "$build_libtool_libs" = yes; then + echo "enable shared libraries" + else + echo "disable shared libraries" + fi + if test "$build_old_libs" = yes; then + echo "enable static libraries" + else + echo "disable static libraries" + fi + exit 0 + ;; + + --finish) mode="finish" ;; + + --mode) prevopt="--mode" prev=mode ;; + --mode=*) mode="$optarg" ;; + + --quiet | --silent) + show=: + ;; + + -dlopen) + prevopt="-dlopen" + prev=execute_dlfiles + ;; + + -*) + $echo "$modename: unrecognized option \`$arg'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + + *) + nonopt="$arg" + break + ;; + esac +done + +if test -n "$prevopt"; then + $echo "$modename: option \`$prevopt' requires an argument" 1>&2 + $echo "$help" 1>&2 + exit 1 +fi + +if test -z "$show_help"; then + + # Infer the operation mode. + if test -z "$mode"; then + case "$nonopt" in + *cc | *++ | gcc* | *-gcc*) + mode=link + for arg + do + case "$arg" in + -c) + mode=compile + break + ;; + esac + done + ;; + *db | *dbx | *strace | *truss) + mode=execute + ;; + *install*|cp|mv) + mode=install + ;; + *rm) + mode=uninstall + ;; + *) + # If we have no mode, but dlfiles were specified, then do execute mode. + test -n "$execute_dlfiles" && mode=execute + + # Just use the default operation mode. + if test -z "$mode"; then + if test -n "$nonopt"; then + $echo "$modename: warning: cannot infer operation mode from \`$nonopt'" 1>&2 + else + $echo "$modename: warning: cannot infer operation mode without MODE-ARGS" 1>&2 + fi + fi + ;; + esac + fi + + # Only execute mode is allowed to have -dlopen flags. + if test -n "$execute_dlfiles" && test "$mode" != execute; then + $echo "$modename: unrecognized option \`-dlopen'" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + # Change the help message to a mode-specific one. + generic_help="$help" + help="Try \`$modename --help --mode=$mode' for more information." + + # These modes are in order of execution frequency so that they run quickly. + case "$mode" in + # libtool compile mode + compile) + modename="$modename: compile" + # Get the compilation command and the source file. + base_compile= + lastarg= + srcfile="$nonopt" + suppress_output= + + for arg + do + # Accept any command-line options. + case "$arg" in + -o) + $echo "$modename: you cannot specify the output filename with \`-o'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + + -static) + build_old_libs=yes + continue + ;; + esac + + # Accept the current argument as the source file. + lastarg="$srcfile" + srcfile="$arg" + + # Aesthetically quote the previous argument. + + # Backslashify any backslashes, double quotes, and dollar signs. + # These are the only characters that are still specially + # interpreted inside of double-quoted scrings. + lastarg=`$echo "X$lastarg" | $Xsed -e "$sed_quote_subst"` + + # Double-quote args containing other shell metacharacters. + # Many Bourne shells cannot handle close brackets correctly in scan + # sets, so we specify it separately. + case "$lastarg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + lastarg="\"$lastarg\"" + ;; + esac + + # Add the previous argument to base_compile. + if test -z "$base_compile"; then + base_compile="$lastarg" + else + base_compile="$base_compile $lastarg" + fi + done + + # Get the name of the library object. + libobj=`$echo "X$srcfile" | $Xsed -e 's%^.*/%%'` + + # Recognize several different file suffixes. + xform='[cCFSfms]' + case "$libobj" in + *.ada) xform=ada ;; + *.adb) xform=adb ;; + *.ads) xform=ads ;; + *.asm) xform=asm ;; + *.c++) xform=c++ ;; + *.cc) xform=cc ;; + *.cpp) xform=cpp ;; + *.cxx) xform=cxx ;; + *.f90) xform=f90 ;; + *.for) xform=for ;; + esac + + libobj=`$echo "X$libobj" | $Xsed -e "s/\.$xform$/.lo/"` + + case "$libobj" in + *.lo) obj=`$echo "X$libobj" | $Xsed -e 's/\.lo$/.o/'` ;; + *) + $echo "$modename: cannot determine name of library object from \`$srcfile'" 1>&2 + exit 1 + ;; + esac + + if test -z "$base_compile"; then + $echo "$modename: you must specify a compilation command" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + # Delete any leftover library objects. + if test "$build_old_libs" = yes; then + $run $rm $obj $libobj + trap "$run $rm $obj $libobj; exit 1" 1 2 15 + else + $run $rm $libobj + trap "$run $rm $libobj; exit 1" 1 2 15 + fi + + # Only build a PIC object if we are building libtool libraries. + if test "$build_libtool_libs" = yes; then + # Without this assignment, base_compile gets emptied. + fbsd_hideous_sh_bug=$base_compile + + # All platforms use -DPIC, to notify preprocessed assembler code. + $show "$base_compile$pic_flag -DPIC $srcfile" + if $run eval "$base_compile\$pic_flag -DPIC \$srcfile"; then : + else + test -n "$obj" && $run $rm $obj + exit 1 + fi + + # If we have no pic_flag, then copy the object into place and finish. + if test -z "$pic_flag"; then + $show "$LN_S $obj $libobj" + $run $LN_S $obj $libobj + exit $? + fi + + # Just move the object, then go on to compile the next one + $show "$mv $obj $libobj" + $run $mv $obj $libobj || exit $? + + # Allow error messages only from the first compilation. + suppress_output=' >/dev/null 2>&1' + fi + + # Only build a position-dependent object if we build old libraries. + if test "$build_old_libs" = yes; then + # Suppress compiler output if we already did a PIC compilation. + $show "$base_compile $srcfile$suppress_output" + if $run eval "$base_compile \$srcfile$suppress_output"; then : + else + $run $rm $obj $libobj + exit 1 + fi + fi + + # Create an invalid libtool object if no PIC, so that we do not + # accidentally link it into a program. + if test "$build_libtool_libs" != yes; then + $show "echo timestamp > $libobj" + $run eval "echo timestamp > \$libobj" || exit $? + fi + + exit 0 + ;; + + # libtool link mode + link) + modename="$modename: link" + CC="$nonopt" + allow_undefined=yes + compile_command="$CC" + finalize_command="$CC" + + compile_shlibpath= + finalize_shlibpath= + convenience= + old_convenience= + deplibs= + dlfiles= + dlprefiles= + export_dynamic=no + generated= + hardcode_libdirs= + libobjs= + link_against_libtool_libs= + ltlibs= + objs= + prev= + prevarg= + release= + rpath= + perm_rpath= + temp_rpath= + vinfo= + + # We need to know -static, to get the right output filenames. + for arg + do + case "$arg" in + -all-static | -static) + if test "X$arg" = "X-all-static" && test "$build_libtool_libs" = yes && test -z "$link_static_flag"; then + $echo "$modename: warning: complete static linking is impossible in this configuration" 1>&2 + fi + build_libtool_libs=no + build_old_libs=yes + break + ;; + esac + done + + # See if our shared archives depend on static archives. + test -n "$old_archive_from_new_cmds" && build_old_libs=yes + + # Go through the arguments, transforming them on the way. + while test $# -gt 0; do + arg="$1" + shift + + # If the previous option needs an argument, assign it. + if test -n "$prev"; then + case "$prev" in + output) + compile_command="$compile_command @OUTPUT@" + finalize_command="$finalize_command @OUTPUT@" + ;; + esac + + case "$prev" in + dlfiles|dlprefiles) + case "$arg" in + *.la | *.lo) ;; # We handle these cases below. + *) + dlprefiles="$dlprefiles $arg" + test "$prev" = dlfiles && dlfiles="$dlfiles $arg" + prev= + ;; + esac + ;; + release) + release="-$arg" + prev= + continue + ;; + rpath) + rpath="$rpath $arg" + prev= + continue + ;; + *) + eval "$prev=\"\$arg\"" + prev= + continue + ;; + esac + fi + + prevarg="$arg" + + case "$arg" in + -all-static) + if test -n "$link_static_flag"; then + compile_command="$compile_command $link_static_flag" + finalize_command="$finalize_command $link_static_flag" + fi + continue + ;; + + -allow-undefined) + # FIXME: remove this flag sometime in the future. + $echo "$modename: \`-allow-undefined' is deprecated because it is the default" 1>&2 + continue + ;; + + -dlopen) + prev=dlfiles + continue + ;; + + -dlpreopen) + prev=dlprefiles + continue + ;; + + -export-dynamic) + if test "$export_dynamic" != yes; then + export_dynamic=yes + if test -n "$export_dynamic_flag_spec"; then + eval arg=\"$export_dynamic_flag_spec\" + else + arg= + fi + + # Add the symbol object into the linking commands. + compile_command="$compile_command @SYMFILE@" + finalize_command="$finalize_command @SYMFILE@" + fi + ;; + + -L*) + dir=`$echo "X$arg" | $Xsed -e 's%^-L\(.*\)$%\1%'` + case "$dir" in + /* | [A-Za-z]:[/\\]*) + # Add the corresponding hardcode_libdir_flag, if it is not identical. + ;; + *) + $echo "$modename: \`-L$dir' cannot specify a relative directory" 1>&2 + exit 1 + ;; + esac + deplibs="$deplibs $arg" + ;; + + -l*) deplibs="$deplibs $arg" ;; + + -no-undefined) + allow_undefined=no + continue + ;; + + -o) prev=output ;; + + -release) + prev=release + continue + ;; + + -rpath) + prev=rpath + continue + ;; + + -static) + # If we have no pic_flag, then this is the same as -all-static. + if test -z "$pic_flag" && test -n "$link_static_flag"; then + compile_command="$compile_command $link_static_flag" + finalize_command="$finalize_command $link_static_flag" + fi + continue + ;; + + -version-info) + prev=vinfo + continue + ;; + + # Some other compiler flag. + -* | +*) + # Unknown arguments in both finalize_command and compile_command need + # to be aesthetically quoted because they are evaled later. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + ;; + + *.o | *.a) + # A standard object. + objs="$objs $arg" + ;; + + *.lo) + # A library object. + if test "$prev" = dlfiles; then + dlfiles="$dlfiles $arg" + if test "$build_libtool_libs" = yes; then + prev= + continue + else + # If libtool objects are unsupported, then we need to preload. + prev=dlprefiles + fi + fi + + if test "$prev" = dlprefiles; then + # Preload the old-style object. + dlprefiles="$dlprefiles "`$echo "X$arg" | $Xsed -e 's/\.lo$/.o/'` + prev= + fi + libobjs="$libobjs $arg" + ;; + + *.la) + # A libtool-controlled library. + + dlname= + libdir= + library_names= + old_library= + + # Check to see that this really is a libtool archive. + if (sed -e '2q' $arg | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then : + else + $echo "$modename: \`$arg' is not a valid libtool archive" 1>&2 + exit 1 + fi + + # If there is no directory component, then add one. + case "$arg" in + */* | *\\*) . $arg ;; + *) . ./$arg ;; + esac + + # Get the name of the library we link against. + linklib= + for l in $old_library $library_names; do + linklib="$l" + done + + if test -z "$linklib"; then + $echo "$modename: cannot find name of link library for \`$arg'" 1>&2 + exit 1 + fi + + # Find the relevant object directory and library name. + name=`$echo "X$arg" | $Xsed -e 's%^.*/%%' -e 's/\.la$//' -e 's/^lib//'` + dir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'` + if test "X$dir" = "X$arg"; then + dir="$objdir" + else + dir="$dir/$objdir" + fi + + if test -z "$libdir"; then + # It is a libtool convenience library, so add in its objects. + convenience="$convenience $dir/$old_library"l + old_convenience="$old_convenience $dir/$old_library" + compile_command="$compile_command $dir/$old_library" + finalize_command="$finalize_command $dir/$old_library" + continue + fi + + # This library was specified with -dlopen. + if test "$prev" = dlfiles; then + dlfiles="$dlfiles $arg" + if test -z "$dlname"; then + # If there is no dlname, we need to preload. + prev=dlprefiles + else + # We should not create a dependency on this library, but we + # may need any libraries it requires. + compile_command="$compile_command$dependency_libs" + finalize_command="$finalize_command$dependency_libs" + prev= + continue + fi + fi + + # The library was specified with -dlpreopen. + if test "$prev" = dlprefiles; then + # Prefer using a static library (so that no silly _DYNAMIC symbols + # are required to link). + if test -n "$old_library"; then + dlprefiles="$dlprefiles $dir/$old_library" + else + dlprefiles="$dlprefiles $dir/$linklib" + fi + prev= + fi + + if test "$build_libtool_libs" = yes && test -n "$library_names"; then + link_against_libtool_libs="$link_against_libtool_libs $arg" + if test -n "$shlibpath_var"; then + # Make sure the rpath contains only unique directories. + case "$temp_rpath " in + *" $dir "*) ;; + *) temp_rpath="$temp_rpath $dir" ;; + esac + fi + + # This is the magic to use -rpath. + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + if test -z "$hardcode_libdirs"; then + # Put the magic libdir with the hardcode flag. + hardcode_libdirs="$libdir" + libdir="@HARDCODE_LIBDIRS@" + else + # Just accumulate the unique libdirs. + case "$hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator" in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir" + ;; + esac + libdir= + fi + fi + + if test -n "$libdir"; then + eval flag=\"$hardcode_libdir_flag_spec\" + + compile_command="$compile_command $flag" + finalize_command="$finalize_command $flag" + fi + elif test -n "$runpath_var"; then + # Do the same for the permanent run path. + case "$perm_rpath " in + *" $libdir "*) ;; + *) perm_rpath="$perm_rpath $libdir" ;; + esac + fi + + + lib_linked=yes + case "$hardcode_action" in + immediate | unsupported) + if test "$hardcode_direct" = no; then + compile_command="$compile_command $dir/$linklib" + elif test "$hardcode_minus_L" = no; then + compile_command="$compile_command -L$dir -l$name" + elif test "$hardcode_shlibpath_var" = no; then + compile_shlibpath="$compile_shlibpath$dir:" + compile_command="$compile_command -l$name" + else + lib_linked=no + fi + ;; + + relink) + # We need an absolute path. + case "$dir" in + /* | [A-Za-z]:[/\\]*) ;; + *) + absdir=`cd "$dir" && pwd` + if test -z "$absdir"; then + $echo "$modename: cannot determine absolute directory name of \`$dir'" 1>&2 + exit 1 + fi + dir="$absdir" + ;; + esac + + if test "$hardcode_direct" = yes; then + compile_command="$compile_command $dir/$linklib" + elif test "$hardcode_minus_L" = yes; then + compile_command="$compile_command -L$dir -l$name" + elif test "$hardcode_shlibpath_var" = yes; then + compile_shlibpath="$compile_shlibpath$dir:" + compile_command="$compile_command -l$name" + else + lib_linked=no + fi + ;; + + *) + lib_linked=no + ;; + esac + + if test "$lib_linked" != yes; then + $echo "$modename: configuration error: unsupported hardcode properties" + exit 1 + fi + + # Finalize command for both is simple: just hardcode it. + if test "$hardcode_direct" = yes; then + finalize_command="$finalize_command $libdir/$linklib" + elif test "$hardcode_minus_L" = yes; then + finalize_command="$finalize_command -L$libdir -l$name" + elif test "$hardcode_shlibpath_var" = yes; then + finalize_shlibpath="$finalize_shlibpath$libdir:" + finalize_command="$finalize_command -l$name" + else + # We cannot seem to hardcode it, guess we'll fake it. + finalize_command="$finalize_command -L$libdir -l$name" + fi + else + # Transform directly to old archives if we don't build new libraries. + if test -n "$pic_flag" && test -z "$old_library"; then + $echo "$modename: cannot find static library for \`$arg'" 1>&2 + exit 1 + fi + + # Here we assume that one of hardcode_direct or hardcode_minus_L + # is not unsupported. This is valid on all known static and + # shared platforms. + if test "$hardcode_direct" != unsupported; then + test -n "$old_library" && linklib="$old_library" + compile_command="$compile_command $dir/$linklib" + finalize_command="$finalize_command $dir/$linklib" + else + compile_command="$compile_command -L$dir -l$name" + finalize_command="$finalize_command -L$dir -l$name" + fi + fi + + # Add in any libraries that this one depends upon. + compile_command="$compile_command$dependency_libs" + finalize_command="$finalize_command$dependency_libs" + continue + ;; + + # Some other compiler argument. + *) + # Unknown arguments in both finalize_command and compile_command need + # to be aesthetically quoted because they are evaled later. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + ;; + esac + + # Now actually substitute the argument into the commands. + if test -n "$arg"; then + compile_command="$compile_command $arg" + finalize_command="$finalize_command $arg" + fi + done + + if test -n "$prev"; then + $echo "$modename: the \`$prevarg' option requires an argument" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + oldlibs= + case "$output" in + "") + $echo "$modename: you must specify an output file" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + + */* | *\\*) + $echo "$modename: output file \`$output' must have no directory components" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + + *.a) + if test -n "$link_against_libtool_libs"; then + $echo "$modename: error: cannot link libtool libraries into archives" 1>&2 + exit 1 + fi + + if test -n "$deplibs"; then + $echo "$modename: warning: \`-l' and \`-L' are ignored for archives" 1>&2 + fi + + if test -n "$dlfiles$dlprefiles"; then + $echo "$modename: warning: \`-dlopen' is ignored for archives" 1>&2 + fi + + if test -n "$rpath"; then + $echo "$modename: warning: \`-rpath' is ignored for archives" 1>&2 + fi + + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for archives" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for archives" 1>&2 + fi + + # Now set the variables for building old libraries. + build_libtool_libs=no + oldlibs="$output" + ;; + + *.la) + # Make sure we only generate libraries of the form `libNAME.la'. + case "$output" in + lib*) ;; + *) + $echo "$modename: libtool library \`$output' must begin with \`lib'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + esac + + name=`$echo "X$output" | $Xsed -e 's/\.la$//' -e 's/^lib//'` + eval libname=\"$libname_spec\" + + # All the library-specific variables (install_libdir is set above). + library_names= + old_library= + dlname= + + if test -n "$objs"; then + $echo "$modename: cannot build libtool library \`$output' from non-libtool objects:$objs" 2>&1 + exit 1 + fi + + # How the heck are we supposed to write a wrapper for a shared library? + if test -n "$link_against_libtool_libs"; then + $echo "$modename: error: cannot link shared libraries into libtool libraries" 1>&2 + exit 1 + fi + + if test -n "$dlfiles$dlprefiles"; then + $echo "$modename: warning: \`-dlopen' is ignored for libtool libraries" 1>&2 + fi + + set dummy $rpath + if test $# -gt 2; then + $echo "$modename: warning: ignoring multiple \`-rpath's for a libtool library" 1>&2 + fi + install_libdir="$2" + + # Now set the variables for building old libraries. + oldlibs="$objdir/$libname.a" + if test -z "$rpath"; then + # Building a libtool convenience library. + oldlibs="$objdir/$libname.al $oldlibs" + build_libtool_libs=convenience + + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for convenience libraries" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for convenience libraries" 1>&2 + fi + else + + # Parse the version information argument. + IFS="${IFS= }"; save_ifs="$IFS"; IFS=':' + set dummy $vinfo 0 0 0 + IFS="$save_ifs" + + if test -n "$8"; then + $echo "$modename: too many parameters to \`-version-info'" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + current="$2" + revision="$3" + age="$4" + + # Check that each of the things are valid numbers. + case "$current" in + 0 | [1-9] | [1-9][0-9]*) ;; + *) + $echo "$modename: CURRENT \`$current' is not a nonnegative integer" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit 1 + ;; + esac + + case "$revision" in + 0 | [1-9] | [1-9][0-9]*) ;; + *) + $echo "$modename: REVISION \`$revision' is not a nonnegative integer" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit 1 + ;; + esac + + case "$age" in + 0 | [1-9] | [1-9][0-9]*) ;; + *) + $echo "$modename: AGE \`$age' is not a nonnegative integer" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit 1 + ;; + esac + + if test $age -gt $current; then + $echo "$modename: AGE \`$age' is greater than the current interface number \`$current'" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit 1 + fi + + # Calculate the version variables. + major= + versuffix= + verstring= + case "$version_type" in + none) ;; + + linux) + major=.`expr $current - $age` + versuffix="$major.$age.$revision" + ;; + + osf) + major=`expr $current - $age` + versuffix=".$current.$age.$revision" + verstring="$current.$age.$revision" + + # Add in all the interfaces that we are compatible with. + loop=$age + while test $loop != 0; do + iface=`expr $current - $loop` + loop=`expr $loop - 1` + verstring="$verstring:${iface}.0" + done + + # Make executables depend on our current version. + verstring="$verstring:${current}.0" + ;; + + sunos) + major=".$current" + versuffix=".$current.$revision" + ;; + + *) + $echo "$modename: unknown library version type \`$version_type'" 1>&2 + echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2 + exit 1 + ;; + esac + + # Clear the version info if we defaulted, and they specified a release. + if test -z "$vinfo" && test -n "$release"; then + major= + versuffix= + verstring="0.0" + fi + + # Check to see if the archive will have undefined symbols. + if test "$allow_undefined" = yes; then + if test "$allow_undefined_flag" = unsupported; then + $echo "$modename: warning: undefined symbols not allowed in $host shared libraries" 1>&2 + build_libtool_libs=no + build_old_libs=yes + fi + else + # Don't allow undefined symbols. + allow_undefined_flag="$no_undefined_flag" + fi + + # Add libc to deplibs on all systems. + dependency_libs="$deplibs" + deplibs="$deplibs -lc" + fi + + # Create the output directory, or remove our outputs if we need to. + if test -d $objdir; then + $show "${rm}r $objdir/$output $objdir/$libname.* $objdir/${libname}${release}.*" + $run ${rm}r $objdir/$output $objdir/$libname.* $objdir/${libname}${release}.* + else + $show "$mkdir $objdir" + $run $mkdir $objdir + status=$? + if test $status -ne 0 && test ! -d $objdir; then + exit $status + fi + fi + + if test "$build_libtool_libs" = yes; then + # Get the real and link names of the library. + eval library_names=\"$library_names_spec\" + set dummy $library_names + realname="$2" + shift; shift + + if test -n "$soname_spec"; then + eval soname=\"$soname_spec\" + else + soname="$realname" + fi + + lib="$objdir/$realname" + for link + do + linknames="$linknames $link" + done + + # Use standard objects if they are PIC. + test -z "$pic_flag" && libobjs=`$echo "X$libobjs " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//g'` + + # Transform .lo files to .o files. + test "$build_old_libs" = yes && oldobjs="$objs"`$echo "X$libobjs " | $Xsed -e 's/[^ ]*\.a //g' -e 's/\.lo /.o /g' -e 's/ $//g'` + + if test -n "$whole_archive_flag_spec"; then + if test -n "$convenience"; then + eval libobjs=\"\$libobjs $whole_archive_flag_spec\" + fi + else + for xlib in $convenience; do + # Extract the objects. + xdir="$xlib"x + generated="$generated $xdir" + xlib=`echo "$xlib" | $Xsed -e 's%^.*/%%'` + + $show "${rm}r $xdir" + $run ${rm}r "$xdir" + $show "mkdir $xdir" + $run mkdir "$xdir" + status=$? + if test $status -ne 0 && test ! -d "$xdir"; then + exit $status + fi + $show "(cd $xdir && $AR x ../$xlib)" + $run eval "(cd \$xdir && $AR x ../\$xlib)" || exit $? + + libobjs="$libobjs `echo $xdir/*`" + done + fi + + # Do each of the archive commands. + eval cmds=\"$archive_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + + # Create links to the real library. + for linkname in $linknames; do + if test "$realname" != "$linkname"; then + $show "(cd $objdir && $LN_S $realname $linkname)" + $run eval '(cd $objdir && $LN_S $realname $linkname)' || exit $? + fi + done + + # If -export-dynamic was specified, set the dlname. + if test "$export_dynamic" = yes; then + # On all known operating systems, these are identical. + dlname="$soname" + fi + fi + ;; + + *.lo | *.o) + if test -n "$link_against_libtool_libs"; then + $echo "$modename: error: cannot link libtool libraries into objects" 1>&2 + exit 1 + fi + + if test -n "$deplibs"; then + $echo "$modename: warning: \`-l' and \`-L' are ignored for objects" 1>&2 + fi + + if test -n "$dlfiles$dlprefiles"; then + $echo "$modename: warning: \`-dlopen' is ignored for objects" 1>&2 + fi + + if test -n "$rpath"; then + $echo "$modename: warning: \`-rpath' is ignored for objects" 1>&2 + fi + + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for objects" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for objects" 1>&2 + fi + + case "$output" in + *.lo) + if test -n "$objs"; then + $echo "$modename: cannot build library object \`$output' from non-libtool objects" 1>&2 + exit 1 + fi + libobj="$output" + obj=`$echo "X$output" | $Xsed -e 's/\.lo$/.o/'` + ;; + *) + libobj= + obj="$output" + ;; + esac + + # Delete the old objects. + $run $rm $obj $libobj + + # Create the old-style object. + reload_objs="$objs"`$echo "X$libobjs " | $Xsed -e 's/[^ ]*\.a //g' -e 's/\.lo /.o /g' -e 's/ $//g'` + + output="$obj" + eval cmds=\"$reload_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + + # Exit if we aren't doing a library object file. + test -z "$libobj" && exit 0 + + if test "$build_libtool_libs" != yes; then + # Create an invalid libtool object if no PIC, so that we don't + # accidentally link it into a program. + $show "echo timestamp > $libobj" + $run eval "echo timestamp > $libobj" || exit $? + exit 0 + fi + + if test -n "$pic_flag"; then + # Only do commands if we really have different PIC objects. + reload_objs="$libobjs" + output="$libobj" + eval cmds=\"$reload_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + else + # Just create a symlink. + $show "$LN_S $obj $libobj" + $run $LN_S $obj $libobj || exit $? + fi + + exit 0 + ;; + + *) + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for programs" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for programs" 1>&2 + fi + + if test -n "$rpath"; then + # If the user specified any rpath flags, then add them. + for libdir in $rpath; do + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + if test -z "$hardcode_libdirs"; then + # Put the magic libdir with the hardcode flag. + hardcode_libdirs="$libdir" + libdir="@HARDCODE_LIBDIRS@" + else + # Just accumulate the unique libdirs. + case "$hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator" in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir" + ;; + esac + libdir= + fi + fi + + if test -n "$libdir"; then + eval flag=\"$hardcode_libdir_flag_spec\" + + compile_command="$compile_command $flag" + finalize_command="$finalize_command $flag" + fi + elif test -n "$runpath_var"; then + case "$perm_rpath " in + *" $libdir "*) ;; + *) perm_rpath="$perm_rpath $libdir" ;; + esac + fi + done + fi + + # Substitute the hardcoded libdirs into the compile commands. + if test -n "$hardcode_libdir_separator"; then + compile_command=`$echo "X$compile_command" | $Xsed -e "s%@HARDCODE_LIBDIRS@%$hardcode_libdirs%g"` + finalize_command=`$echo "X$finalize_command" | $Xsed -e "s%@HARDCODE_LIBDIRS@%$hardcode_libdirs%g"` + fi + + if test -n "$libobjs" && test "$build_old_libs" = yes; then + # Transform all the library objects into standard objects. + compile_command=`$echo "X$compile_command " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'` + finalize_command=`$echo "X$finalize_command " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'` + fi + + if test "$export_dynamic" = yes && test -n "$NM" && test -n "$global_symbol_pipe"; then + dlsyms="${output}S.c" + else + dlsyms= + fi + + if test -n "$dlsyms"; then + # Add our own program objects to the preloaded list. + dlprefiles=`$echo "X$objs$dlprefiles " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'` + + # Discover the nlist of each of the dlfiles. + nlist="$objdir/${output}.nm" + + if test -d $objdir; then + $show "$rm $nlist ${nlist}T" + $run $rm "$nlist" "${nlist}T" + else + $show "$mkdir $objdir" + $run $mkdir $objdir + status=$? + if test $status -ne 0 && test ! -d $objdir; then + exit $status + fi + fi + + for arg in $dlprefiles; do + $show "extracting global C symbols from \`$arg'" + $run eval "$NM $arg | $global_symbol_pipe >> '$nlist'" + done + + # Parse the name list into a source file. + $show "creating $objdir/$dlsyms" + if test -z "$run"; then + # Make sure we at least have an empty file. + test -f "$nlist" || : > "$nlist" + + # Try sorting and uniquifying the output. + if sort "$nlist" | uniq > "$nlist"T; then + mv -f "$nlist"T "$nlist" + wcout=`wc "$nlist" 2>/dev/null` + count=`echo "X$wcout" | $Xsed -e 's/^[ ]*\([0-9][0-9]*\).*$/\1/'` + (test "$count" -ge 0) 2>/dev/null || count=-1 + else + $rm "$nlist"T + count=-1 + fi + + case "$dlsyms" in + "") ;; + *.c) + $echo > "$objdir/$dlsyms" "\ +/* $dlsyms - symbol resolution table for \`$output' dlsym emulation. */ +/* Generated by $PROGRAM - GNU $PACKAGE $VERSION */ + +#ifdef __cplusplus +extern \"C\" { +#endif + +/* Prevent the only kind of declaration conflicts we can make. */ +#define dld_preloaded_symbol_count some_other_symbol +#define dld_preloaded_symbols some_other_symbol + +/* External symbol declarations for the compiler. */\ +" + + if test -f "$nlist"; then + sed -e 's/^.* \(.*\)$/extern char \1;/' < "$nlist" >> "$objdir/$dlsyms" + else + echo '/* NONE */' >> "$objdir/$dlsyms" + fi + + $echo >> "$objdir/$dlsyms" "\ + +#undef dld_preloaded_symbol_count +#undef dld_preloaded_symbols + +#if defined (__STDC__) && __STDC__ +# define __ptr_t void * +#else +# define __ptr_t char * +#endif + +/* The number of symbols in dld_preloaded_symbols, -1 if unsorted. */ +int dld_preloaded_symbol_count = $count; + +/* The mapping between symbol names and symbols. */ +struct { + char *name; + __ptr_t address; +} +dld_preloaded_symbols[] = +{\ +" + + if test -f "$nlist"; then + sed 's/^\(.*\) \(.*\)$/ {"\1", (__ptr_t) \&\2},/' < "$nlist" >> "$objdir/$dlsyms" + fi + + $echo >> "$objdir/$dlsyms" "\ + {0, (__ptr_t) 0} +}; + +#ifdef __cplusplus +} +#endif\ +" + ;; + + *) + $echo "$modename: unknown suffix for \`$dlsyms'" 1>&2 + exit 1 + ;; + esac + fi + + # Now compile the dynamic symbol file. + $show "(cd $objdir && $CC -c$no_builtin_flag \"$dlsyms\")" + $run eval '(cd $objdir && $CC -c$no_builtin_flag "$dlsyms")' || exit $? + + # Transform the symbol file into the correct name. + compile_command=`$echo "X$compile_command" | $Xsed -e "s%@SYMFILE@%$objdir/${output}S.o%"` + finalize_command=`$echo "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$objdir/${output}S.o%"` + elif test "$export_dynamic" != yes; then + test -n "$dlfiles$dlprefiles" && $echo "$modename: warning: \`-dlopen' and \`-dlpreopen' are ignored without \`-export-dynamic'" 1>&2 + else + # We keep going just in case the user didn't refer to + # dld_preloaded_symbols. The linker will fail if global_symbol_pipe + # really was required. + $echo "$modename: not configured to extract global symbols from dlpreopened files" 1>&2 + + # Nullify the symbol file. + compile_command=`$echo "X$compile_command" | $Xsed -e "s% @SYMFILE@%%"` + finalize_command=`$echo "X$finalize_command" | $Xsed -e "s% @SYMFILE@%%"` + fi + + if test -z "$link_against_libtool_libs" || test "$build_libtool_libs" != yes; then + # Replace the output file specification. + compile_command=`$echo "X$compile_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'` + finalize_command=`$echo "X$finalize_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'` + + # We have no uninstalled library dependencies, so finalize right now. + $show "$compile_command" + $run eval "$compile_command" + exit $? + fi + + # Replace the output file specification. + compile_command=`$echo "X$compile_command" | $Xsed -e 's%@OUTPUT@%'"$objdir/$output"'%g'` + finalize_command=`$echo "X$finalize_command" | $Xsed -e 's%@OUTPUT@%'"$objdir/$output"'T%g'` + + # Create the binary in the object directory, then wrap it. + if test ! -d $objdir; then + $show "$mkdir $objdir" + $run $mkdir $objdir + status=$? + if test $status -ne 0 && test ! -d $objdir; then + exit $status + fi + fi + + if test -n "$shlibpath_var"; then + # We should set the shlibpath_var + rpath= + for dir in $temp_rpath; do + case "$dir" in + /* | [A-Za-z]:[/\\]*) + # Absolute path. + rpath="$rpath$dir:" + ;; + *) + # Relative path: add a thisdir entry. + rpath="$rpath\$thisdir/$dir:" + ;; + esac + done + temp_rpath="$rpath" + fi + + # Delete the old output file. + $run $rm $output + + if test -n "$compile_shlibpath"; then + compile_command="$shlibpath_var=\"$compile_shlibpath\$$shlibpath_var\" $compile_command" + fi + if test -n "$finalize_shlibpath"; then + finalize_command="$shlibpath_var=\"$finalize_shlibpath\$$shlibpath_var\" $finalize_command" + fi + + if test -n "$runpath_var" && test -n "$perm_rpath"; then + # We should set the runpath_var. + rpath= + for dir in $perm_rpath; do + rpath="$rpath$dir:" + done + compile_command="$runpath_var=\"$rpath\$$runpath_var\" $compile_command" + finalize_command="$runpath_var=\"$rpath\$$runpath_var\" $finalize_command" + fi + + if test "$hardcode_action" = relink; then + # AGH! Flame the AIX and HP-UX people for me, will ya? + $echo "$modename: warning: using a buggy system linker" 1>&2 + $echo "$modename: relinking will be required before \`$output' can be installed" 1>&2 + fi + + $show "$compile_command" + $run eval "$compile_command" || exit $? + + # Now create the wrapper script. + $show "creating $output" + + # Quote the finalize command for shipping. + finalize_command=`$echo "X$finalize_command" | $Xsed -e "$sed_quote_subst"` + + # Quote $echo for shipping. + qecho=`$echo "X$echo" | $Xsed -e "$sed_quote_subst"` + + # Only actually do things if our run command is non-null. + if test -z "$run"; then + $rm $output + trap "$rm $output; exit 1" 1 2 15 + + $echo > $output "\ +#! $SHELL + +# $output - temporary wrapper script for $objdir/$output +# Generated by $PROGRAM - GNU $PACKAGE $VERSION +# +# The $output program cannot be directly executed until all the libtool +# libraries that it depends on are installed. +# +# This wrapper script should never be moved out of \``pwd`'. +# If it is, it will not operate correctly. + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed='sed -e s/^X//' +sed_quote_subst='$sed_quote_subst' + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +if test \"\${CDPATH+set}\" = set; then CDPATH=; export CDPATH; fi + +# This environment variable determines our operation mode. +if test \"\$libtool_install_magic\" = \"$magic\"; then + # install mode needs the following variables: + link_against_libtool_libs='$link_against_libtool_libs' + finalize_command=\"$finalize_command\" +else + # When we are sourced in execute mode, \$file and \$echo are already set. + if test \"\$libtool_execute_magic\" != \"$magic\"; then + echo=\"$qecho\" + file=\"\$0\" + # Make sure echo works. + if test \"X\$1\" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift + elif test \"X\`(\$echo '\t') 2>/dev/null\`\" = 'X\t'; then + # Yippee, \$echo works! + : + else + # Restart under the correct shell, and then maybe \$echo will work. + exec $SHELL \"\$0\" --no-reexec \${1+\"\$@\"} + fi + fi\ +" + $echo >> $output "\ + + # Find the directory that this script lives in. + thisdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*$%%'\` + test \"x\$thisdir\" = \"x\$file\" && thisdir=. + + # Follow symbolic links until we get to the real thisdir. + file=\`ls -ld \"\$file\" | sed -n 's/.*-> //p'\` + while test -n \"\$file\"; do + destdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*\$%%'\` + + # If there was a directory component, then change thisdir. + if test \"x\$destdir\" != \"x\$file\"; then + case \"\$destdir\" in + /* | [A-Za-z]:[/\\]*) thisdir=\"\$destdir\" ;; + *) thisdir=\"\$thisdir/\$destdir\" ;; + esac + fi + + file=\`\$echo \"X\$file\" | \$Xsed -e 's%^.*/%%'\` + file=\`ls -ld \"\$thisdir/\$file\" | sed -n 's/.*-> //p'\` + done + + # Try to get the absolute directory name. + absdir=\`cd \"\$thisdir\" && pwd\` + test -n \"\$absdir\" && thisdir=\"\$absdir\" + + progdir=\"\$thisdir/$objdir\" + program='$output' + + if test -f \"\$progdir/\$program\"; then" + + # Export our shlibpath_var if we have one. + if test -n "$shlibpath_var" && test -n "$temp_rpath"; then + $echo >> $output "\ + # Add our own library path to $shlibpath_var + $shlibpath_var=\"$temp_rpath\$$shlibpath_var\" + + # Some systems cannot cope with colon-terminated $shlibpath_var + $shlibpath_var=\`\$echo \"X\$$shlibpath_var\" | \$Xsed -e 's/:*\$//'\` + + export $shlibpath_var +" + fi + + $echo >> $output "\ + if test \"\$libtool_execute_magic\" != \"$magic\"; then + # Run the actual program with our arguments. + + # Export the path to the program. + PATH=\"\$progdir:\$PATH\" + export PATH + + exec \$program \${1+\"\$@\"} + + \$echo \"\$0: cannot exec \$program \${1+\"\$@\"}\" + exit 1 + fi + else + # The program doesn't exist. + \$echo \"\$0: error: \$progdir/\$program does not exist\" 1>&2 + \$echo \"This script is just a wrapper for \$program.\" 1>&2 + echo \"See the $PACKAGE documentation for more information.\" 1>&2 + exit 1 + fi +fi\ +" + chmod +x $output + fi + exit 0 + ;; + esac + + # See if we need to build an old-fashioned archive. + for oldlib in $oldlibs; do + + if test "$build_libtool_libs" = convenience; then + oldobjs="$libobjs" + addlibs="$convenience" + build_libtool_libs=no + else + addlibs="$old_convenience" + fi + + # Add in members from convenience archives. + for xlib in $addlibs; do + # Extract the objects. + xdir="$xlib"x + generated="$generated $xdir" + xlib=`echo "$xlib" | $Xsed -e 's%^.*/%%'` + + $show "${rm}r $xdir" + $run ${rm}r "$xdir" + $show "mkdir $xdir" + $run mkdir "$xdir" + status=$? + if test $status -ne 0 && test ! -d "$xdir"; then + exit $status + fi + $show "(cd $xdir && $AR x ../$xlib)" + $run eval "(cd \$xdir && $AR x ../\$xlib)" || exit $? + + oldobjs="$oldobjs `echo $xdir/*`" + done + + # Do each command in the archive commands. + if test -n "$old_archive_from_new_cmds" && test "$build_libtool_libs" = yes; then + eval cmds=\"$old_archive_from_new_cmds\" + else + eval cmds=\"$old_archive_cmds\" + fi + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + done + + if test -n "$generated"; then + $show "${rm}r$generated" + $run ${rm}r$generated + fi + + # Now create the libtool archive. + case "$output" in + *.la) + old_library= + test "$build_old_libs" = yes && old_library="$libname.a" + $show "creating $output" + + # Only create the output if not a dry run. + if test -z "$run"; then + $echo > $output "\ +# $output - a libtool library file +# Generated by $PROGRAM - GNU $PACKAGE $VERSION + +# The name that we can dlopen(3). +dlname='$dlname' + +# Names of this library. +library_names='$library_names' + +# The name of the static archive. +old_library='$old_library' + +# Libraries that this one depends upon. +dependency_libs='$dependency_libs' + +# Version information for $libname. +current=$current +age=$age +revision=$revision + +# Directory that this library needs to be installed in: +libdir='$install_libdir'\ +" + fi + + # Do a symbolic link so that the libtool archive can be found in + # LD_LIBRARY_PATH before the program is installed. + $show "(cd $objdir && $LN_S ../$output $output)" + $run eval "(cd $objdir && $LN_S ../$output $output)" || exit $? + ;; + esac + exit 0 + ;; + + # libtool install mode + install) + modename="$modename: install" + + # There may be an optional sh(1) argument at the beginning of + # install_prog (especially on Windows NT). + if test "$nonopt" = "$SHELL"; then + # Aesthetically quote it. + arg=`$echo "X$nonopt" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + install_prog="$arg " + arg="$1" + shift + else + install_prog= + arg="$nonopt" + fi + + # The real first argument should be the name of the installation program. + # Aesthetically quote it. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + install_prog="$install_prog$arg" + + # We need to accept at least all the BSD install flags. + dest= + files= + opts= + prev= + install_type= + isdir=no + stripme= + for arg + do + if test -n "$dest"; then + files="$files $dest" + dest="$arg" + continue + fi + + case "$arg" in + -d) isdir=yes ;; + -f) prev="-f" ;; + -g) prev="-g" ;; + -m) prev="-m" ;; + -o) prev="-o" ;; + -s) + stripme=" -s" + continue + ;; + -*) ;; + + *) + # If the previous option needed an argument, then skip it. + if test -n "$prev"; then + prev= + else + dest="$arg" + continue + fi + ;; + esac + + # Aesthetically quote the argument. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + install_prog="$install_prog $arg" + done + + if test -z "$install_prog"; then + $echo "$modename: you must specify an install program" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + if test -n "$prev"; then + $echo "$modename: the \`$prev' option requires an argument" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + if test -z "$files"; then + if test -z "$dest"; then + $echo "$modename: no file or destination specified" 1>&2 + else + $echo "$modename: you must specify a destination" 1>&2 + fi + $echo "$help" 1>&2 + exit 1 + fi + + # Strip any trailing slash from the destination. + dest=`$echo "X$dest" | $Xsed -e 's%/$%%'` + + # Check to see that the destination is a directory. + test -d "$dest" && isdir=yes + if test "$isdir" = yes; then + destdir="$dest" + destname= + else + destdir=`$echo "X$dest" | $Xsed -e 's%/[^/]*$%%'` + test "X$destdir" = "X$dest" && destdir=. + destname=`$echo "X$dest" | $Xsed -e 's%^.*/%%'` + + # Not a directory, so check to see that there is only one file specified. + set dummy $files + if test $# -gt 2; then + $echo "$modename: \`$dest' is not a directory" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + fi + case "$destdir" in + /* | [A-Za-z]:[/\\]*) ;; + *) + for file in $files; do + case "$file" in + *.lo) ;; + *) + $echo "$modename: \`$destdir' must be an absolute directory name" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + esac + done + ;; + esac + + # This variable tells wrapper scripts just to set variables rather + # than running their programs. + libtool_install_magic="$magic" + + staticlibs= + future_libdirs= + current_libdirs= + for file in $files; do + + # Do each installation. + case "$file" in + *.a) + # Do the static libraries later. + staticlibs="$staticlibs $file" + ;; + + *.la) + # Check to see that this really is a libtool archive. + if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then : + else + $echo "$modename: \`$file' is not a valid libtool archive" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + library_names= + old_library= + # If there is no directory component, then add one. + case "$file" in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Add the libdir to current_libdirs if it is the destination. + if test "X$destdir" = "X$libdir"; then + case "$current_libdirs " in + *" $libdir "*) ;; + *) current_libdirs="$current_libdirs $libdir" ;; + esac + else + # Note the libdir as a future libdir. + case "$future_libdirs " in + *" $libdir "*) ;; + *) future_libdirs="$future_libdirs $libdir" ;; + esac + fi + + dir="`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`/" + test "X$dir" = "X$file/" && dir= + dir="$dir$objdir" + + # See the names of the shared library. + set dummy $library_names + if test -n "$2"; then + realname="$2" + shift + shift + + # Install the shared library and build the symlinks. + $show "$install_prog $dir/$realname $destdir/$realname" + $run eval "$install_prog $dir/$realname $destdir/$realname" || exit $? + test "X$dlname" = "X$realname" && dlname= + + if test $# -gt 0; then + # Delete the old symlinks. + rmcmd="$rm" + for linkname + do + rmcmd="$rmcmd $destdir/$linkname" + done + $show "$rmcmd" + $run $rmcmd + + # ... and create new ones. + for linkname + do + test "X$dlname" = "X$linkname" && dlname= + $show "(cd $destdir && $LN_S $realname $linkname)" + $run eval "(cd $destdir && $LN_S $realname $linkname)" + done + fi + + if test -n "$dlname"; then + # Install the dynamically-loadable library. + $show "$install_prog $dir/$dlname $destdir/$dlname" + $run eval "$install_prog $dir/$dlname $destdir/$dlname" || exit $? + fi + + # Do each command in the postinstall commands. + lib="$destdir/$realname" + eval cmds=\"$postinstall_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + fi + + # Install the pseudo-library for information purposes. + name=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + $show "$install_prog $file $destdir/$name" + $run eval "$install_prog $file $destdir/$name" || exit $? + + # Maybe install the static library, too. + test -n "$old_library" && staticlibs="$staticlibs $dir/$old_library" + ;; + + *.lo) + # Install (i.e. copy) a libtool object. + + # Figure out destination file name, if it wasn't already specified. + if test -n "$destname"; then + destfile="$destdir/$destname" + else + destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + destfile="$destdir/$destfile" + fi + + # Deduce the name of the destination old-style object file. + case "$destfile" in + *.lo) + staticdest=`$echo "X$destfile" | $Xsed -e 's/\.lo$/.o/'` + ;; + *.o) + staticdest="$destfile" + destfile= + ;; + *) + $echo "$modename: cannot copy a libtool object to \`$destfile'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + esac + + # Install the libtool object if requested. + if test -n "$destfile"; then + $show "$install_prog $file $destfile" + $run eval "$install_prog $file $destfile" || exit $? + fi + + # Install the old object if enabled. + if test "$build_old_libs" = yes; then + # Deduce the name of the old-style object file. + staticobj=`$echo "X$file" | $Xsed -e 's/\.lo$/.o/'` + + $show "$install_prog $staticobj $staticdest" + $run eval "$install_prog \$staticobj \$staticdest" || exit $? + fi + exit 0 + ;; + + *) + # Figure out destination file name, if it wasn't already specified. + if test -n "$destname"; then + destfile="$destdir/$destname" + else + destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + destfile="$destdir/$destfile" + fi + + # Do a test to see if this is really a libtool program. + if (sed -e '4q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + link_against_libtool_libs= + finalize_command= + + # If there is no directory component, then add one. + case "$file" in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Check the variables that should have been set. + if test -z "$link_against_libtool_libs" || test -z "$finalize_command"; then + $echo "$modename: invalid libtool wrapper script \`$file'" 1>&2 + exit 1 + fi + + finalize=yes + for lib in $link_against_libtool_libs; do + # Check to see that each library is installed. + libdir= + if test -f "$lib"; then + # If there is no directory component, then add one. + case "$lib" in + */* | *\\*) . $lib ;; + *) . ./$lib ;; + esac + fi + libfile="$libdir/`$echo "X$lib" | $Xsed -e 's%^.*/%%g'`" + if test -n "$libdir" && test ! -f "$libfile"; then + $echo "$modename: warning: \`$lib' has not been installed in \`$libdir'" 1>&2 + finalize=no + fi + done + + if test "$hardcode_action" = relink; then + if test "$finalize" = yes; then + $echo "$modename: warning: relinking \`$file' on behalf of your buggy system linker" 1>&2 + $show "$finalize_command" + if $run eval "$finalize_command"; then : + else + $echo "$modename: error: relink \`$file' with the above command before installing it" 1>&2 + continue + fi + file="$objdir/$file"T + else + $echo "$modename: warning: cannot relink \`$file' on behalf of your buggy system linker" 1>&2 + fi + else + # Install the binary that we compiled earlier. + file=`$echo "X$file" | $Xsed -e "s%\([^/]*\)$%$objdir/\1%"` + fi + fi + + $show "$install_prog$stripme $file $destfile" + $run eval "$install_prog\$stripme \$file \$destfile" || exit $? + ;; + esac + done + + for file in $staticlibs; do + name=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + + # Set up the ranlib parameters. + oldlib="$destdir/$name" + + $show "$install_prog $file $oldlib" + $run eval "$install_prog \$file \$oldlib" || exit $? + + # Do each command in the postinstall commands. + eval cmds=\"$old_postinstall_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + done + + if test -n "$future_libdirs"; then + $echo "$modename: warning: remember to run \`$progname --finish$future_libdirs'" 1>&2 + fi + + if test -n "$current_libdirs"; then + # Maybe just do a dry run. + test -n "$run" && current_libdirs=" -n$current_libdirs" + exec $SHELL $0 --finish$current_libdirs + exit 1 + fi + + exit 0 + ;; + + # libtool finish mode + finish) + modename="$modename: finish" + libdirs="$nonopt" + admincmds= + + if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then + for dir + do + libdirs="$libdirs $dir" + done + + for libdir in $libdirs; do + if test -n "$finish_cmds"; then + # Do each command in the finish commands. + eval cmds=\"$finish_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || admincmds="$admincmds + $cmd" + done + IFS="$save_ifs" + fi + if test -n "$finish_eval"; then + # Do the single finish_eval. + eval cmds=\"$finish_eval\" + $run eval "$cmds" || admincmds="$admincmds + $cmds" + fi + done + fi + + echo "----------------------------------------------------------------------" + echo "Libraries have been installed in:" + for libdir in $libdirs; do + echo " $libdir" + done + echo + echo "To link against installed libraries in a given directory, LIBDIR," + echo "you must use the \`-LLIBDIR' flag during linking." + echo + echo " You will also need to do at least one of the following:" + if test -n "$shlibpath_var"; then + echo " - add LIBDIR to the \`$shlibpath_var' environment variable" + echo " during execution" + fi + if test -n "$runpath_var"; then + echo " - add LIBDIR to the \`$runpath_var' environment variable" + echo " during linking" + fi + if test -n "$hardcode_libdir_flag_spec"; then + libdir=LIBDIR + eval flag=\"$hardcode_libdir_flag_spec\" + + echo " - use the \`$flag' linker flag" + fi + if test -n "$admincmds"; then + echo " - have your system administrator run these commands:$admincmds" + fi + if test -f /etc/ld.so.conf; then + echo " - have your system administrator add LIBDIR to \`/etc/ld.so.conf'" + fi + echo + echo "See any operating system documentation about shared libraries for" + echo "more information, such as the ld(1) and ld.so(8) manual pages." + echo "----------------------------------------------------------------------" + exit 0 + ;; + + # libtool execute mode + execute) + modename="$modename: execute" + + # The first argument is the command name. + cmd="$nonopt" + if test -z "$cmd"; then + $echo "$modename: you must specify a COMMAND" 1>&2 + $echo "$help" + exit 1 + fi + + # Handle -dlopen flags immediately. + for file in $execute_dlfiles; do + if test ! -f "$file"; then + $echo "$modename: \`$file' is not a file" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + dir= + case "$file" in + *.la) + # Check to see that this really is a libtool archive. + if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then : + else + $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + # Read the libtool library. + dlname= + library_names= + + # If there is no directory component, then add one. + case "$file" in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Skip this library if it cannot be dlopened. + if test -z "$dlname"; then + # Warn if it was a shared library. + test -n "$library_names" && $echo "$modename: warning: \`$file' was not linked with \`-export-dynamic'" + continue + fi + + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'` + test "X$dir" = "X$file" && dir=. + + if test -f "$dir/$objdir/$dlname"; then + dir="$dir/$objdir" + else + $echo "$modename: cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'" 1>&2 + exit 1 + fi + ;; + + *.lo) + # Just add the directory containing the .lo file. + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'` + test "X$dir" = "X$file" && dir=. + ;; + + *) + $echo "$modename: warning \`-dlopen' is ignored for non-libtool libraries and objects" 1>&2 + continue + ;; + esac + + # Get the absolute pathname. + absdir=`cd "$dir" && pwd` + test -n "$absdir" && dir="$absdir" + + # Now add the directory to shlibpath_var. + if eval "test -z \"\$$shlibpath_var\""; then + eval "$shlibpath_var=\"\$dir\"" + else + eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\"" + fi + done + + # This variable tells wrapper scripts just to set shlibpath_var + # rather than running their programs. + libtool_execute_magic="$magic" + + # Check if any of the arguments is a wrapper script. + args= + for file + do + case "$file" in + -*) ;; + *) + # Do a test to see if this is really a libtool program. + if (sed -e '4q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + # If there is no directory component, then add one. + case "$file" in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Transform arg to wrapped name. + file="$progdir/$program" + fi + ;; + esac + # Quote arguments (to preserve shell metacharacters). + file=`$echo "X$file" | $Xsed -e "$sed_quote_subst"` + args="$args \"$file\"" + done + + if test -z "$run"; then + # Export the shlibpath_var. + eval "export $shlibpath_var" + + # Restore saved enviroment variables + if test "${save_LC_ALL+set}" = set; then + LC_ALL="$save_LC_ALL"; export LC_ALL + fi + if test "${save_LANG+set}" = set; then + LANG="$save_LANG"; export LANG + fi + + # Now actually exec the command. + eval "exec \$cmd$args" + + $echo "$modename: cannot exec \$cmd$args" + exit 1 + else + # Display what would be done. + eval "\$echo \"\$shlibpath_var=\$$shlibpath_var\"" + $echo "export $shlibpath_var" + $echo "$cmd$args" + exit 0 + fi + ;; + + # libtool uninstall mode + uninstall) + modename="$modename: uninstall" + rm="$nonopt" + files= + + for arg + do + case "$arg" in + -*) rm="$rm $arg" ;; + *) files="$files $arg" ;; + esac + done + + if test -z "$rm"; then + $echo "$modename: you must specify an RM program" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + for file in $files; do + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'` + test "X$dir" = "X$file" && dir=. + name=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + + rmfiles="$file" + + case "$name" in + *.la) + # Possibly a libtool archive, so verify it. + if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + . $dir/$name + + # Delete the libtool libraries and symlinks. + for n in $library_names; do + rmfiles="$rmfiles $dir/$n" + test "X$n" = "X$dlname" && dlname= + done + test -n "$dlname" && rmfiles="$rmfiles $dir/$dlname" + test -n "$old_library" && rmfiles="$rmfiles $dir/$old_library" + + $show "$rm $rmfiles" + $run $rm $rmfiles + + if test -n "$library_names"; then + # Do each command in the postuninstall commands. + eval cmds=\"$postuninstall_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" + done + IFS="$save_ifs" + fi + + if test -n "$old_library"; then + # Do each command in the old_postuninstall commands. + eval cmds=\"$old_postuninstall_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" + done + IFS="$save_ifs" + fi + + # FIXME: should reinstall the best remaining shared library. + fi + ;; + + *.lo) + if test "$build_old_libs" = yes; then + oldobj=`$echo "X$name" | $Xsed -e 's/\.lo$/.o/'` + rmfiles="$rmfiles $dir/$oldobj" + fi + $show "$rm $rmfiles" + $run $rm $rmfiles + ;; + + *) + $show "$rm $rmfiles" + $run $rm $rmfiles + ;; + esac + done + exit 0 + ;; + + "") + $echo "$modename: you must specify a MODE" 1>&2 + $echo "$generic_help" 1>&2 + exit 1 + ;; + esac + + $echo "$modename: invalid operation mode \`$mode'" 1>&2 + $echo "$generic_help" 1>&2 + exit 1 +fi # test -z "$show_help" + +# We need to display help for each of the modes. +case "$mode" in +"") $echo \ +"Usage: $modename [OPTION]... [MODE-ARG]... + +Provide generalized library-building support services. + + --config show all configuration variables + --debug enable verbose shell tracing +-n, --dry-run display commands without modifying any files + --features display basic configuration information and exit + --finish same as \`--mode=finish' + --help display this help message and exit + --mode=MODE use operation mode MODE [default=inferred from MODE-ARGS] + --quiet same as \`--silent' + --silent don't print informational messages + --version print version information + +MODE must be one of the following: + + compile compile a source file into a libtool object + execute automatically set library path, then run a program + finish complete the installation of libtool libraries + install install libraries or executables + link create a library or an executable + uninstall remove libraries from an installed directory + +MODE-ARGS vary depending on the MODE. Try \`$modename --help --mode=MODE' for +a more detailed description of MODE." + exit 0 + ;; + +compile) + $echo \ +"Usage: $modename [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE + +Compile a source file into a libtool library object. + +This mode accepts the following additional options: + + -static always build a \`.o' file suitable for static linking + +COMPILE-COMMAND is a command to be used in creating a \`standard' object file +from the given SOURCEFILE. + +The output file name is determined by removing the directory component from +SOURCEFILE, then substituting the C source code suffix \`.c' with the +library object suffix, \`.lo'." + ;; + +execute) + $echo \ +"Usage: $modename [OPTION]... --mode=execute COMMAND [ARGS]... + +Automatically set library path, then run a program. + +This mode accepts the following additional options: + + -dlopen FILE add the directory containing FILE to the library path + +This mode sets the library path environment variable according to \`-dlopen' +flags. + +If any of the ARGS are libtool executable wrappers, then they are translated +into their corresponding uninstalled binary, and any of their required library +directories are added to the library path. + +Then, COMMAND is executed, with ARGS as arguments." + ;; + +finish) + $echo \ +"Usage: $modename [OPTION]... --mode=finish [LIBDIR]... + +Complete the installation of libtool libraries. + +Each LIBDIR is a directory that contains libtool libraries. + +The commands that this mode executes may require superuser privileges. Use +the \`--dry-run' option if you just want to see what would be executed." + ;; + +install) + $echo \ +"Usage: $modename [OPTION]... --mode=install INSTALL-COMMAND... + +Install executables or libraries. + +INSTALL-COMMAND is the installation command. The first component should be +either the \`install' or \`cp' program. + +The rest of the components are interpreted as arguments to that command (only +BSD-compatible install options are recognized)." + ;; + +link) + $echo \ +"Usage: $modename [OPTION]... --mode=link LINK-COMMAND... + +Link object files or libraries together to form another library, or to +create an executable program. + +LINK-COMMAND is a command using the C compiler that you would use to create +a program from several object files. + +The following components of LINK-COMMAND are treated specially: + + -all-static do not do any dynamic linking at all + -dlopen FILE \`-dlpreopen' FILE if it cannot be dlopened at runtime + -dlpreopen FILE link in FILE and add its symbols to dld_preloaded_symbols + -export-dynamic allow symbols from OUTPUT-FILE to be resolved with dlsym(3) + -LLIBDIR search LIBDIR for required installed libraries + -lNAME OUTPUT-FILE requires the installed library libNAME + -no-undefined declare that a library does not refer to external symbols + -o OUTPUT-FILE create OUTPUT-FILE from the specified objects + -release RELEASE specify package release information + -rpath LIBDIR the created library will eventually be installed in LIBDIR + -static do not do any dynamic linking of libtool libraries + -version-info CURRENT[:REVISION[:AGE]] + specify library version info [each variable defaults to 0] + +All other options (arguments beginning with \`-') are ignored. + +Every other argument is treated as a filename. Files ending in \`.la' are +treated as uninstalled libtool libraries, other files are standard or library +object files. + +If the OUTPUT-FILE ends in \`.la', then a libtool library is created, only +library objects (\`.lo' files) may be specified, and \`-rpath' is required. + +If OUTPUT-FILE ends in \`.a', then a standard library is created using \`ar' +and \`ranlib'. + +If OUTPUT-FILE ends in \`.lo' or \`.o', then a reloadable object file is +created, otherwise an executable program is created." + ;; + +uninstall) + $echo +"Usage: $modename [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE... + +Remove libraries from an installation directory. + +RM is the name of the program to use to delete files associated with each FILE +(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed +to RM. + +If FILE is a libtool library, all the files associated with it are deleted. +Otherwise, only FILE itself is deleted using RM." + ;; + +*) + $echo "$modename: invalid operation mode \`$mode'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; +esac + +echo +$echo "Try \`$modename --help' for more information about other modes." + +exit 0 + +# Local Variables: +# mode:shell-script +# sh-indentation:2 +# End: diff --git a/missing b/missing new file mode 100644 index 00000000..cbe2b0ef --- /dev/null +++ b/missing @@ -0,0 +1,188 @@ +#! /bin/sh +# Common stub for a few missing GNU programs while installing. +# Copyright (C) 1996, 1997 Free Software Foundation, Inc. +# Franc,ois Pinard <pinard@iro.umontreal.ca>, 1996. + +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2, or (at your option) +# any later version. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. + +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA +# 02111-1307, USA. + +if test $# -eq 0; then + echo 1>&2 "Try \`$0 --help' for more information" + exit 1 +fi + +case "$1" in + + -h|--h|--he|--hel|--help) + echo "\ +$0 [OPTION]... PROGRAM [ARGUMENT]... + +Handle \`PROGRAM [ARGUMENT]...' for when PROGRAM is missing, or return an +error status if there is no known handling for PROGRAM. + +Options: + -h, --help display this help and exit + -v, --version output version information and exit + +Supported PROGRAM values: + aclocal touch file \`aclocal.m4' + autoconf touch file \`configure' + autoheader touch file \`config.h.in' + automake touch all \`Makefile.in' files + bison create \`y.tab.[ch]', if possible, from existing .[ch] + flex create \`lex.yy.c', if possible, from existing .c + lex create \`lex.yy.c', if possible, from existing .c + makeinfo touch the output file + yacc create \`y.tab.[ch]', if possible, from existing .[ch]" + ;; + + -v|--v|--ve|--ver|--vers|--versi|--versio|--version) + echo "missing - GNU libit 0.0" + ;; + + -*) + echo 1>&2 "$0: Unknown \`$1' option" + echo 1>&2 "Try \`$0 --help' for more information" + exit 1 + ;; + + aclocal) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified \`acinclude.m4' or \`configure.in'. You might want + to install the \`Automake' and \`Perl' packages. Grab them from + any GNU archive site." + touch aclocal.m4 + ;; + + autoconf) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified \`configure.in'. You might want to install the + \`Autoconf' and \`GNU m4' packages. Grab them from any GNU + archive site." + touch configure + ;; + + autoheader) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified \`acconfig.h' or \`configure.in'. You might want + to install the \`Autoconf' and \`GNU m4' packages. Grab them + from any GNU archive site." + files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER([^):]*:\([^)]*\)).*/\1/p' configure.in` + if test -z "$files"; then + files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER(\([^):]*\)).*/\1/p' configure.in` + test -z "$files" || files="$files.in" + else + files=`echo "$files" | sed -e 's/:/ /g'` + fi + test -z "$files" && files="config.h.in" + touch $files + ;; + + automake) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified \`Makefile.am', \`acinclude.m4' or \`configure.in'. + You might want to install the \`Automake' and \`Perl' packages. + Grab them from any GNU archive site." + find . -type f -name Makefile.am -print \ + | sed 's/^\(.*\).am$/touch \1.in/' \ + | sh + ;; + + bison|yacc) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified a \`.y' file. You may need the \`Bison' package + in order for those modifications to take effect. You can get + \`Bison' from any GNU archive site." + rm -f y.tab.c y.tab.h + if [ $# -ne 1 ]; then + eval LASTARG="\${$#}" + case "$LASTARG" in + *.y) + SRCFILE=`echo "$LASTARG" | sed 's/y$/c/'` + if [ -f "$SRCFILE" ]; then + cp "$SRCFILE" y.tab.c + fi + SRCFILE=`echo "$LASTARG" | sed 's/y$/h/'` + if [ -f "$SRCFILE" ]; then + cp "$SRCFILE" y.tab.h + fi + ;; + esac + fi + if [ ! -f y.tab.h ]; then + echo >y.tab.h + fi + if [ ! -f y.tab.c ]; then + echo 'main() { return 0; }' >y.tab.c + fi + ;; + + lex|flex) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified a \`.l' file. You may need the \`Flex' package + in order for those modifications to take effect. You can get + \`Flex' from any GNU archive site." + rm -f lex.yy.c + if [ $# -ne 1 ]; then + eval LASTARG="\${$#}" + case "$LASTARG" in + *.l) + SRCFILE=`echo "$LASTARG" | sed 's/l$/c/'` + if [ -f "$SRCFILE" ]; then + cp "$SRCFILE" lex.yy.c + fi + ;; + esac + fi + if [ ! -f lex.yy.c ]; then + echo 'main() { return 0; }' >lex.yy.c + fi + ;; + + makeinfo) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified a \`.texi' or \`.texinfo' file, or any other file + indirectly affecting the aspect of the manual. The spurious + call might also be the consequence of using a buggy \`make' (AIX, + DU, IRIX). You might want to install the \`Texinfo' package or + the \`GNU make' package. Grab either from any GNU archive site." + file=`echo "$*" | sed -n 's/.*-o \([^ ]*\).*/\1/p'` + if test -z "$file"; then + file=`echo "$*" | sed 's/.* \([^ ]*\) *$/\1/'` + file=`sed -n '/^@setfilename/ { s/.* \([^ ]*\) *$/\1/; p; q; }' $file` + fi + touch $file + ;; + + *) + echo 1>&2 "\ +WARNING: \`$1' is needed, and you do not seem to have it handy on your + system. You might have modified some files without having the + proper tools for further handling them. Check the \`README' file, + it often tells you about the needed prerequirements for installing + this package. You may also peek at any GNU archive site, in case + some other package would contain this missing \`$1' program." + exit 1 + ;; +esac + +exit 0 diff --git a/mkinstalldirs b/mkinstalldirs new file mode 100644 index 00000000..a719d6a6 --- /dev/null +++ b/mkinstalldirs @@ -0,0 +1,40 @@ +#! /bin/sh +# mkinstalldirs --- make directory hierarchy +# Author: Noah Friedman <friedman@prep.ai.mit.edu> +# Created: 1993-05-16 +# Public domain + +# $Id: mkinstalldirs,v 1.1 1998/11/18 20:42:13 chris Exp $ + +errstatus=0 + +for file +do + set fnord `echo ":$file" | sed -ne 's/^:\//#/;s/^://;s/\// /g;s/^#/\//;p'` + shift + + pathcomp= + for d + do + pathcomp="$pathcomp$d" + case "$pathcomp" in + -* ) pathcomp=./$pathcomp ;; + esac + + if test ! -d "$pathcomp"; then + echo "mkdir $pathcomp" 1>&2 + + mkdir "$pathcomp" || lasterr=$? + + if test ! -d "$pathcomp"; then + errstatus=$lasterr + fi + fi + + pathcomp="$pathcomp/" + done +done + +exit $errstatus + +# mkinstalldirs ends here diff --git a/src/Makefile b/src/Makefile deleted file mode 100644 index 42740fe1..00000000 --- a/src/Makefile +++ /dev/null @@ -1,82 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz> -# - -include ../Makefile.conf - -TARGET=../lib/libasound.a -STARGET=../lib/libasound.so -STARGETX=../lib/libasound.so.$(SND_LIB_VERSION) -STARGETO=../lib/libasound.so.$(SND_LIB_MAJOR) -TARGETS=$(TARGET) $(STARGET) - -STATIC_LIBS= control/libcontrol.a \ - mixer/libmixer.a \ - pcm/libpcm.a \ - rawmidi/librawmidi.a -DYNAMIC_LIBS= control/libcontrol.Sa \ - mixer/libmixer.Sa \ - pcm/libpcm.Sa \ - rawmidi/librawmidi.Sa - -OBJECTS=error.o -SOBJECTS=error.So - -.SUFFIXES: -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) $(STATIC_LIBS) - rm -f ../lib/libasound.a - $(LINKER) -r -o $(TARGET) $(STATIC_LIBS) $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) $(DYNAMIC_LIBS) - rm -f ../lib/libasound*.so* - $(CC) -shared -Wl,-soname,libasound.so.$(SND_LIB_MAJOR) $(DYNAMIC_LIBS) $(SOBJECTS) -o $(STARGETX) - ln -s libasound.so.$(SND_LIB_VERSION) $(STARGET) - ln -s libasound.so.$(SND_LIB_VERSION) $(STARGETO) - -control/libcontrol.a: - $(MAKE) -C control -control/libcontrol.sa: - $(MAKE) -C control - -mixer/libmixer.a: - $(MAKE) -C mixer -mixer/libmixer.sa: - $(MAKE) -C mixer - -pcm/libpcm.a: - $(MAKE) -C pcm -pcm/libpcm.sa: - $(MAKE) -C pcm - -rawmidi/librawmidi.a: - $(MAKE) -C rawmidi -rawmidi/librawmidi.sa: - $(MAKE) -C rawmidi - -clean: - $(MAKE) -C control clean - $(MAKE) -C pcm clean - $(MAKE) -C mixer clean - $(MAKE) -C rawmidi clean - rm -f core .depend *.o *.So *.orig *~ - rm -f ../lib/libasound.* - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/Makefile.am b/src/Makefile.am new file mode 100644 index 00000000..9e1c1ca0 --- /dev/null +++ b/src/Makefile.am @@ -0,0 +1,22 @@ +SUBDIRS=control mixer pcm rawmidi + +lib_LTLIBRARIES = libasound.la +libasound_la_SOURCES = error.c +libasound_la_LIBADD = control/libcontrol.la mixer/libmixer.la pcm/libpcm.la \ + rawmidi/librawmidi.la + +control/libcontrol.la: + $(MAKE) -C control libcontrol.la + +mixer/libmixer.la: + $(MAKE) -C mixer libmixer.la + +pcm/libpcm.la: + $(MAKE) -C pcm libpcm.la + +rawmidi/librawmidi.la: + $(MAKE) -C rawmidi librawmidi.la + + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/Makefile.in b/src/Makefile.in new file mode 100644 index 00000000..064b432d --- /dev/null +++ b/src/Makefile.in @@ -0,0 +1,369 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +SUBDIRS=control mixer pcm rawmidi + +lib_LTLIBRARIES = libasound.la +libasound_la_SOURCES = error.c +libasound_la_LIBADD = control/libcontrol.la mixer/libmixer.la pcm/libpcm.la \ + rawmidi/librawmidi.la + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../include/config.h +CONFIG_CLEAN_FILES = +LTLIBRARIES = $(lib_LTLIBRARIES) + + +DEFS = @DEFS@ -I. -I$(srcdir) -I../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +libasound_la_LDFLAGS = +libasound_la_DEPENDENCIES = control/libcontrol.la mixer/libmixer.la \ +pcm/libpcm.la rawmidi/librawmidi.la +libasound_la_OBJECTS = error.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(libasound_la_SOURCES) +OBJECTS = $(libasound_la_OBJECTS) + +all: all-recursive all-am + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +mostlyclean-libLTLIBRARIES: + +clean-libLTLIBRARIES: + -test -z "$(lib_LTLIBRARIES)" || rm -f $(lib_LTLIBRARIES) + +distclean-libLTLIBRARIES: + +maintainer-clean-libLTLIBRARIES: + +install-libLTLIBRARIES: $(lib_LTLIBRARIES) + @$(NORMAL_INSTALL) + $(mkinstalldirs) $(DESTDIR)$(libdir) + @list='$(lib_LTLIBRARIES)'; for p in $$list; do \ + if test -f $$p; then \ + echo "$(LIBTOOL) --mode=install $(INSTALL_DATA) $$p $(DESTDIR)$(libdir)/$$p"; \ + $(LIBTOOL) --mode=install $(INSTALL_DATA) $$p $(DESTDIR)$(libdir)/$$p; \ + else :; fi; \ + done + +uninstall-libLTLIBRARIES: + @$(NORMAL_UNINSTALL) + list='$(lib_LTLIBRARIES)'; for p in $$list; do \ + $(LIBTOOL) --mode=uninstall rm -f $(DESTDIR)$(libdir)/$$p; \ + done + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +libasound.la: $(libasound_la_OBJECTS) $(libasound_la_DEPENDENCIES) + $(LINK) -rpath $(libdir) $(libasound_la_LDFLAGS) $(libasound_la_OBJECTS) $(libasound_la_LIBADD) $(LIBS) + +# This directory's subdirectories are mostly independent; you can cd +# into them and run `make' without going through this Makefile. +# To change the values of `make' variables: instead of editing Makefiles, +# (1) if the variable is set in `config.status', edit `config.status' +# (which will cause the Makefiles to be regenerated when you run `make'); +# (2) otherwise, pass the desired values on the `make' command line. + +@SET_MAKE@ + +all-recursive install-data-recursive install-exec-recursive \ +installdirs-recursive install-recursive uninstall-recursive \ +check-recursive installcheck-recursive info-recursive dvi-recursive: + @set fnord $(MAKEFLAGS); amf=$$2; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + target=`echo $@ | sed s/-recursive//`; \ + echo "Making $$target in $$subdir"; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \ + || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \ + done && test -z "$$fail" + +mostlyclean-recursive clean-recursive distclean-recursive \ +maintainer-clean-recursive: + @set fnord $(MAKEFLAGS); amf=$$2; \ + rev=''; list='$(SUBDIRS)'; for subdir in $$list; do \ + rev="$$subdir $$rev"; \ + done; \ + for subdir in $$rev; do \ + target=`echo $@ | sed s/-recursive//`; \ + echo "Making $$target in $$subdir"; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \ + || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \ + done && test -z "$$fail" +tags-recursive: + list='$(SUBDIRS)'; for subdir in $$list; do \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \ + done + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + test -f $$subdir/TAGS && tags="$$tags -i $$here/$$subdir/TAGS"; \ + done; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done + for subdir in $(SUBDIRS); do \ + test -d $(distdir)/$$subdir \ + || mkdir $(distdir)/$$subdir \ + || exit 1; \ + chmod 777 $(distdir)/$$subdir; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir=../$(top_distdir) distdir=../$(distdir)/$$subdir distdir) \ + || exit 1; \ + done +info: info-recursive +dvi: dvi-recursive +check: all-am + $(MAKE) $(AM_MAKEFLAGS) check-recursive +installcheck: installcheck-recursive +all-am: Makefile $(LTLIBRARIES) + +install-exec-am: install-libLTLIBRARIES + +uninstall-am: uninstall-libLTLIBRARIES + +install-exec: install-exec-recursive install-exec-am + @$(NORMAL_INSTALL) + +install-data: install-data-recursive + @$(NORMAL_INSTALL) + +install: install-recursive install-exec-am + @: + +uninstall: uninstall-recursive uninstall-am + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: installdirs-recursive + $(mkinstalldirs) $(DESTDIR)$(libdir) + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean-am: mostlyclean-libLTLIBRARIES mostlyclean-compile \ + mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean-am: clean-libLTLIBRARIES clean-compile clean-libtool clean-tags \ + clean-generic mostlyclean-am + +distclean-am: distclean-libLTLIBRARIES distclean-compile \ + distclean-libtool distclean-tags distclean-generic \ + clean-am + +maintainer-clean-am: maintainer-clean-libLTLIBRARIES \ + maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean-am + +mostlyclean: mostlyclean-recursive mostlyclean-am + +clean: clean-recursive clean-am + +distclean: distclean-recursive distclean-am + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-recursive maintainer-clean-am + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-libLTLIBRARIES distclean-libLTLIBRARIES \ +clean-libLTLIBRARIES maintainer-clean-libLTLIBRARIES \ +uninstall-libLTLIBRARIES install-libLTLIBRARIES mostlyclean-compile \ +distclean-compile clean-compile maintainer-clean-compile \ +mostlyclean-libtool distclean-libtool clean-libtool \ +maintainer-clean-libtool install-data-recursive \ +uninstall-data-recursive install-exec-recursive \ +uninstall-exec-recursive installdirs-recursive uninstalldirs-recursive \ +all-recursive check-recursive installcheck-recursive info-recursive \ +dvi-recursive mostlyclean-recursive distclean-recursive clean-recursive \ +maintainer-clean-recursive tags tags-recursive mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck all-am install-exec-am uninstall-am install-exec \ +install-data install uninstall all installdirs mostlyclean-generic \ +distclean-generic clean-generic maintainer-clean-generic clean \ +mostlyclean distclean maintainer-clean + + +control/libcontrol.la: + $(MAKE) -C control libcontrol.la + +mixer/libmixer.la: + $(MAKE) -C mixer libmixer.la + +pcm/libpcm.la: + $(MAKE) -C pcm libpcm.la + +rawmidi/librawmidi.la: + $(MAKE) -C rawmidi librawmidi.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/src/control/Makefile b/src/control/Makefile deleted file mode 100644 index 38a47f15..00000000 --- a/src/control/Makefile +++ /dev/null @@ -1,42 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz> -# - -include ../../Makefile.conf - -TARGET=libcontrol.a -STARGET=libcontrol.Sa -OBJECTS=cards.o control.o -SOBJECTS=cards.So control.So -TARGETS=$(TARGET) $(STARGET) - -.SUFFIXES: -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) - $(LINKER) -r -o $@ $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) - $(LINKER) -r -o $@ $(SOBJECTS) - -clean: - rm -f core .depend *.o *.So *.a *.Sa *.orig *~ - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/control/Makefile.am b/src/control/Makefile.am new file mode 100644 index 00000000..5390f278 --- /dev/null +++ b/src/control/Makefile.am @@ -0,0 +1,8 @@ +EXTRA_LTLIBRARIES = libcontrol.la + +libcontrol_la_SOURCES = cards.c control.c + +all: libcontrol.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/control/Makefile.in b/src/control/Makefile.in new file mode 100644 index 00000000..f49957e0 --- /dev/null +++ b/src/control/Makefile.in @@ -0,0 +1,251 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = ../.. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +EXTRA_LTLIBRARIES = libcontrol.la + +libcontrol_la_SOURCES = cards.c control.c + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +libcontrol_la_LDFLAGS = +libcontrol_la_LIBADD = +libcontrol_la_OBJECTS = cards.lo control.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(libcontrol_la_SOURCES) +OBJECTS = $(libcontrol_la_OBJECTS) + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/control/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +libcontrol.la: $(libcontrol_la_OBJECTS) $(libcontrol_la_DEPENDENCIES) + $(LINK) $(libcontrol_la_LDFLAGS) $(libcontrol_la_OBJECTS) $(libcontrol_la_LIBADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src/control + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean + +distclean: distclean-compile distclean-libtool distclean-tags \ + distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-compile distclean-compile clean-compile \ +maintainer-clean-compile mostlyclean-libtool distclean-libtool \ +clean-libtool maintainer-clean-libtool tags mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + + +all: libcontrol.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/src/mixer/Makefile b/src/mixer/Makefile deleted file mode 100644 index 6d60adbf..00000000 --- a/src/mixer/Makefile +++ /dev/null @@ -1,41 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz> -# - -include ../../Makefile.conf - -TARGET=libmixer.a -STARGET=libmixer.Sa -OBJECTS=mixer.o -SOBJECTS=mixer.So -TARGETS=$(TARGET) $(STARGET) - -.SUFFIXES: -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) - $(LINKER) -r -o $@ $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) - $(LINKER) -r -o $@ $(SOBJECTS) - -clean: - rm -f core .depend *.o *.So *.a *.Sa *.orig *~ - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/mixer/Makefile.am b/src/mixer/Makefile.am new file mode 100644 index 00000000..1350aba6 --- /dev/null +++ b/src/mixer/Makefile.am @@ -0,0 +1,8 @@ +EXTRA_LTLIBRARIES=libmixer.la + +libmixer_la_SOURCES = mixer.c + +all: libmixer.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/mixer/Makefile.in b/src/mixer/Makefile.in new file mode 100644 index 00000000..1e922680 --- /dev/null +++ b/src/mixer/Makefile.in @@ -0,0 +1,251 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = ../.. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +EXTRA_LTLIBRARIES=libmixer.la + +libmixer_la_SOURCES = mixer.c + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +libmixer_la_LDFLAGS = +libmixer_la_LIBADD = +libmixer_la_OBJECTS = mixer.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(libmixer_la_SOURCES) +OBJECTS = $(libmixer_la_OBJECTS) + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/mixer/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +libmixer.la: $(libmixer_la_OBJECTS) $(libmixer_la_DEPENDENCIES) + $(LINK) $(libmixer_la_LDFLAGS) $(libmixer_la_OBJECTS) $(libmixer_la_LIBADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src/mixer + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean + +distclean: distclean-compile distclean-libtool distclean-tags \ + distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-compile distclean-compile clean-compile \ +maintainer-clean-compile mostlyclean-libtool distclean-libtool \ +clean-libtool maintainer-clean-libtool tags mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + + +all: libmixer.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/src/pcm/Makefile b/src/pcm/Makefile deleted file mode 100644 index 8bc28fbc..00000000 --- a/src/pcm/Makefile +++ /dev/null @@ -1,40 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz> -# - -include ../../Makefile.conf - -TARGET=libpcm.a -STARGET=libpcm.Sa -OBJECTS=pcm.o pcm_loopback.o -SOBJECTS=pcm.So pcm_loopback.So -TARGETS=$(TARGET) $(STARGET) - -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) - $(LINKER) -r -o $@ $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) - $(LINKER) -r -o $@ $(SOBJECTS) - -clean: - rm -f core .depend *.o *.So *.a *.Sa *.orig *~ - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/pcm/Makefile.am b/src/pcm/Makefile.am new file mode 100644 index 00000000..2f08022f --- /dev/null +++ b/src/pcm/Makefile.am @@ -0,0 +1,7 @@ +EXTRA_LTLIBRARIES=libpcm.la + +libpcm_la_SOURCES = pcm.c +all: libpcm.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/pcm/Makefile.in b/src/pcm/Makefile.in new file mode 100644 index 00000000..901ac576 --- /dev/null +++ b/src/pcm/Makefile.in @@ -0,0 +1,250 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = ../.. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +EXTRA_LTLIBRARIES=libpcm.la + +libpcm_la_SOURCES = pcm.c + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +libpcm_la_LDFLAGS = +libpcm_la_LIBADD = +libpcm_la_OBJECTS = pcm.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(libpcm_la_SOURCES) +OBJECTS = $(libpcm_la_OBJECTS) + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/pcm/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +libpcm.la: $(libpcm_la_OBJECTS) $(libpcm_la_DEPENDENCIES) + $(LINK) $(libpcm_la_LDFLAGS) $(libpcm_la_OBJECTS) $(libpcm_la_LIBADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src/pcm + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean + +distclean: distclean-compile distclean-libtool distclean-tags \ + distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-compile distclean-compile clean-compile \ +maintainer-clean-compile mostlyclean-libtool distclean-libtool \ +clean-libtool maintainer-clean-libtool tags mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + +all: libpcm.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/src/rawmidi/Makefile b/src/rawmidi/Makefile deleted file mode 100644 index c675bf4a..00000000 --- a/src/rawmidi/Makefile +++ /dev/null @@ -1,40 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz> -# - -include ../../Makefile.conf - -TARGET=librawmidi.a -STARGET=librawmidi.Sa -OBJECTS=rawmidi.o -SOBJECTS=rawmidi.So -TARGETS=$(TARGET) $(STARGET) - -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) - $(LINKER) -r -o $@ $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) - $(LINKER) -r -o $@ $(SOBJECTS) - -clean: - rm -f core .depend *.o *.So *.a *.Sa *.orig *~ - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/rawmidi/Makefile.am b/src/rawmidi/Makefile.am new file mode 100644 index 00000000..1abeadd1 --- /dev/null +++ b/src/rawmidi/Makefile.am @@ -0,0 +1,7 @@ +EXTRA_LTLIBRARIES=librawmidi.la + +librawmidi_la_SOURCES = rawmidi.c +all: librawmidi.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/rawmidi/Makefile.in b/src/rawmidi/Makefile.in new file mode 100644 index 00000000..b9c1b6e2 --- /dev/null +++ b/src/rawmidi/Makefile.in @@ -0,0 +1,250 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = ../.. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +EXTRA_LTLIBRARIES=librawmidi.la + +librawmidi_la_SOURCES = rawmidi.c + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +librawmidi_la_LDFLAGS = +librawmidi_la_LIBADD = +librawmidi_la_OBJECTS = rawmidi.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(librawmidi_la_SOURCES) +OBJECTS = $(librawmidi_la_OBJECTS) + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/rawmidi/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +librawmidi.la: $(librawmidi_la_OBJECTS) $(librawmidi_la_DEPENDENCIES) + $(LINK) $(librawmidi_la_LDFLAGS) $(librawmidi_la_OBJECTS) $(librawmidi_la_LIBADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src/rawmidi + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean + +distclean: distclean-compile distclean-libtool distclean-tags \ + distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-compile distclean-compile clean-compile \ +maintainer-clean-compile mostlyclean-libtool distclean-libtool \ +clean-libtool maintainer-clean-libtool tags mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + +all: librawmidi.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/test/Makefile b/test/Makefile deleted file mode 100644 index 5ea08936..00000000 --- a/test/Makefile +++ /dev/null @@ -1,24 +0,0 @@ -CC = gcc -CFLAGS = -static -O2 -g -Wall -pipe -TARGETS = control mixer switches pause pcm -LIB = -L../lib -lasound - -all: $(TARGETS) - -control: control.c - $(CC) $(CFLAGS) $(LIB) -o control control.c - -mixer: mixer.c - $(CC) $(CFLAGS) $(LIB) -o mixer mixer.c - -switches: switches.c - $(CC) $(CFLAGS) $(LIB) -o switches switches.c - -pause: pause.c - $(CC) $(CFLAGS) $(LIB) -o pause pause.c - -pcm: pcm.c - $(CC) $(CFLAGS) $(LIB) -o pcm pcm.c - -clean: - rm -f *.o $(TARGETS) *~ diff --git a/test/Makefile.am b/test/Makefile.am new file mode 100644 index 00000000..d3e5d6e7 --- /dev/null +++ b/test/Makefile.am @@ -0,0 +1,10 @@ +check_PROGRAMS=control mixer switches pause pcm + +control_LDADD=../src/libasound.la +mixer_LDADD=../src/libasound.la +switches_LDADD=../src/libasound.la +pause_LDADD=../src/libasound.la +pcm_LDADD=../src/libasound.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/test/Makefile.in b/test/Makefile.in new file mode 100644 index 00000000..46acd885 --- /dev/null +++ b/test/Makefile.in @@ -0,0 +1,301 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +check_PROGRAMS=control mixer switches pause pcm + +control_LDADD=../src/libasound.la +mixer_LDADD=../src/libasound.la +switches_LDADD=../src/libasound.la +pause_LDADD=../src/libasound.la +pcm_LDADD=../src/libasound.la + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +control_SOURCES = control.c +control_OBJECTS = control.o +control_DEPENDENCIES = ../src/libasound.la +control_LDFLAGS = +mixer_SOURCES = mixer.c +mixer_OBJECTS = mixer.o +mixer_DEPENDENCIES = ../src/libasound.la +mixer_LDFLAGS = +switches_SOURCES = switches.c +switches_OBJECTS = switches.o +switches_DEPENDENCIES = ../src/libasound.la +switches_LDFLAGS = +pause_SOURCES = pause.c +pause_OBJECTS = pause.o +pause_DEPENDENCIES = ../src/libasound.la +pause_LDFLAGS = +pcm_SOURCES = pcm.c +pcm_OBJECTS = pcm.o +pcm_DEPENDENCIES = ../src/libasound.la +pcm_LDFLAGS = +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = control.c mixer.c switches.c pause.c pcm.c +OBJECTS = control.o mixer.o switches.o pause.o pcm.o + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps test/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +mostlyclean-checkPROGRAMS: + +clean-checkPROGRAMS: + -test -z "$(check_PROGRAMS)" || rm -f $(check_PROGRAMS) + +distclean-checkPROGRAMS: + +maintainer-clean-checkPROGRAMS: + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +control: $(control_OBJECTS) $(control_DEPENDENCIES) + @rm -f control + $(LINK) $(control_LDFLAGS) $(control_OBJECTS) $(control_LDADD) $(LIBS) + +mixer: $(mixer_OBJECTS) $(mixer_DEPENDENCIES) + @rm -f mixer + $(LINK) $(mixer_LDFLAGS) $(mixer_OBJECTS) $(mixer_LDADD) $(LIBS) + +switches: $(switches_OBJECTS) $(switches_DEPENDENCIES) + @rm -f switches + $(LINK) $(switches_LDFLAGS) $(switches_OBJECTS) $(switches_LDADD) $(LIBS) + +pause: $(pause_OBJECTS) $(pause_DEPENDENCIES) + @rm -f pause + $(LINK) $(pause_LDFLAGS) $(pause_OBJECTS) $(pause_LDADD) $(LIBS) + +pcm: $(pcm_OBJECTS) $(pcm_DEPENDENCIES) + @rm -f pcm + $(LINK) $(pcm_LDFLAGS) $(pcm_OBJECTS) $(pcm_LDADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = test + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all $(check_PROGRAMS) +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-checkPROGRAMS mostlyclean-compile \ + mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-checkPROGRAMS clean-compile clean-libtool clean-tags \ + clean-generic mostlyclean + +distclean: distclean-checkPROGRAMS distclean-compile distclean-libtool \ + distclean-tags distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-checkPROGRAMS \ + maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-checkPROGRAMS distclean-checkPROGRAMS \ +clean-checkPROGRAMS maintainer-clean-checkPROGRAMS mostlyclean-compile \ +distclean-compile clean-compile maintainer-clean-compile \ +mostlyclean-libtool distclean-libtool clean-libtool \ +maintainer-clean-libtool tags mostlyclean-tags distclean-tags \ +clean-tags maintainer-clean-tags distdir info dvi installcheck \ +install-exec install-data install uninstall all installdirs \ +mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/utils/Makefile b/utils/Makefile deleted file mode 100644 index d9e97658..00000000 --- a/utils/Makefile +++ /dev/null @@ -1,10 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz> -# - -include ../Makefile.conf - -clean: - rm -f core .depend *.o *.orig *~ - diff --git a/utils/Makefile.am b/utils/Makefile.am new file mode 100644 index 00000000..de052686 --- /dev/null +++ b/utils/Makefile.am @@ -0,0 +1,4 @@ +rpm: buildrpm alsa-lib.spec + VERSION=$(VERSION) $(srcdir)/buildrpm + +INCLUDES=-I$(top_srcdir)/include diff --git a/utils/Makefile.in b/utils/Makefile.in new file mode 100644 index 00000000..f6a6b798 --- /dev/null +++ b/utils/Makefile.in @@ -0,0 +1,164 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../include/config.h +CONFIG_CLEAN_FILES = alsa-lib.spec +DIST_COMMON = Makefile.am Makefile.in alsa-lib.spec.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +all: Makefile + +.SUFFIXES: +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps utils/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + +alsa-lib.spec: $(top_builddir)/config.status alsa-lib.spec.in + cd $(top_builddir) && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status +tags: TAGS +TAGS: + + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = utils + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-generic + +clean: clean-generic mostlyclean + +distclean: distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-generic distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: tags distdir info dvi installcheck install-exec install-data \ +install uninstall all installdirs mostlyclean-generic distclean-generic \ +clean-generic maintainer-clean-generic clean mostlyclean distclean \ +maintainer-clean + + +rpm: buildrpm alsa-lib.spec + VERSION=$(VERSION) $(srcdir)/buildrpm + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/utils/alsa-lib.spec.in b/utils/alsa-lib.spec.in index 8989a987..8ff7f66e 100644 --- a/utils/alsa-lib.spec.in +++ b/utils/alsa-lib.spec.in @@ -74,6 +74,5 @@ rm -rf $RPM_BUILD_ROOT %doc doc/*.sgml %doc doc/*.txt -%{prefix}/usr/include/sys/asoundlib.h +%{prefix}/usr/include/sys/soundlib.h %{prefix}/usr/lib/lib* -/usr/share/aclocal/alsa-lib.m4 diff --git a/utils/buildrpm b/utils/buildrpm index 36230e22..aaf88659 100644 --- a/utils/buildrpm +++ b/utils/buildrpm @@ -1,15 +1,15 @@ #!/bin/bash source=. -version=`cat $source/../version` -package=$source/../../alsa-lib-$version.tar.gz +version=$VERSION +package=$source/../alsa-lib-$version.tar.gz if [ ! -r $package ]; then echo "Error: wrong package: $package" exit 1 fi -make -C .. pack +make -C .. dist cp -fv $package /usr/src/redhat/SOURCES diff --git a/version b/version deleted file mode 100644 index 0ea3a944..00000000 --- a/version +++ /dev/null @@ -1 +0,0 @@ -0.2.0 |